openpkg/build.pl

Tue, 02 Jul 2013 21:40:10 +0200

author
Michael Schloh von Bennewitz <michael@schloh.com>
date
Tue, 02 Jul 2013 21:40:10 +0200
changeset 786
d42403a4ec05
permissions
-rw-r--r--

Try to correct broken build configuration and installation structure.

michael@428 1 ##
michael@428 2 ## build.pl -- OpenPKG Package Building and Installing
michael@428 3 ## Copyright (c) 2000-2012 OpenPKG GmbH <http://openpkg.com/>
michael@428 4 ##
michael@428 5 ## This software is property of the OpenPKG GmbH, DE MUC HRB 160208.
michael@428 6 ## All rights reserved. Licenses which grant limited permission to use,
michael@428 7 ## copy, modify and distribute this software are available from the
michael@428 8 ## OpenPKG GmbH.
michael@428 9 ##
michael@428 10 ## THIS SOFTWARE IS PROVIDED "AS IS" AND ANY EXPRESSED OR IMPLIED
michael@428 11 ## WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
michael@428 12 ## MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED.
michael@428 13 ## IN NO EVENT SHALL THE AUTHORS AND COPYRIGHT HOLDERS AND THEIR
michael@428 14 ## CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,
michael@428 15 ## SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT
michael@428 16 ## LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF
michael@428 17 ## USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND
michael@428 18 ## ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY,
michael@428 19 ## OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT
michael@428 20 ## OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF
michael@428 21 ## SUCH DAMAGE.
michael@428 22 ##
michael@428 23
michael@428 24 #############################################################################
michael@428 25 ##
michael@428 26 ## MAIN PROCEDURE
michael@428 27 ##
michael@428 28 #############################################################################
michael@428 29
michael@428 30 require 5;
michael@428 31 #use strict;
michael@428 32 my (
michael@428 33 $opt_h,
michael@428 34 $opt_R, $opt_r, $opt_f, $opt_u, $opt_U, $opt_a, $opt_A,
michael@428 35 $opt_z, $opt_Z, $opt_P, $opt_N, $opt_E, $opt_H, $opt_i,
michael@428 36 $opt_D, $opt_p, $opt_q, $opt_s, $opt_S, $opt_X, $opt_M,
michael@428 37 $opt_L, $opt_W, $opt_K, $opt_e, $opt_b, $opt_B, $opt_g,
michael@428 38 $opt_k
michael@428 39 );
michael@428 40
michael@428 41 # global context variables
michael@428 42 my $prg = "openpkg build";
michael@428 43 my %env = ('' => {});
michael@428 44
michael@428 45 ##
michael@428 46 ## OPTION PARSING
michael@428 47 ##
michael@428 48
michael@428 49 # parse command line options
michael@428 50 my $getopts = 'hR:r:f:uUaAzZP:N:E:H:iD:p:qsSXMLWKebBgk';
michael@428 51 getopts($getopts);
michael@428 52
michael@428 53 # parse configuration script options
michael@428 54 if (open(FH, "<$ENV{'HOME'}/.openpkg/build")) {
michael@428 55 my ($env) = $env{''};
michael@428 56 my ($go) = $getopts;
michael@428 57 $go =~ s/[^a-zA-Z]//g;
michael@428 58 while (my $line = <FH>) {
michael@428 59 if ($line =~ m/^\s*\[([^\]]*)\]/) {
michael@428 60 $env{$1} = {} unless ($env{$1});
michael@428 61 $env = $env{$1};
michael@428 62 } elsif (my ($opt, $val) = ($line =~ m/^\-([$go])\s*(.*?)\s*$/)) {
michael@428 63 $val = 1 unless (defined($val));
michael@428 64 if (exists($env->{$opt})) {
michael@428 65 $env->{$opt} .= " " . $val;
michael@428 66 } else {
michael@428 67 $env->{$opt} = $val;
michael@428 68 }
michael@428 69 }
michael@428 70 }
michael@428 71 close(FH);
michael@428 72 }
michael@428 73
michael@428 74 # usage sanity check and usage help
michael@428 75 sub usage {
michael@428 76 my ($rc) = @_;
michael@428 77 my $usage =
michael@428 78 "openpkg:build:USAGE: $prg [options] [pattern ...]\n" .
michael@428 79 " -a operate on all installed packages\n" .
michael@428 80 " -A operate on all repository packages\n" .
michael@428 81 " -R <rpm> path to \"openpkg rpm\" command\n" .
michael@428 82 " -r <repository> URL to package repository directory\n" .
michael@428 83 " -f <index.rdf> URL to package repository index file\n" .
michael@428 84 " -u ignore local binary RPMs\n" .
michael@428 85 " -U upgrade all selected packages including dependencies\n" .
michael@428 86 " -z rebuild from zero all selected installed packages\n" .
michael@428 87 " -Z rebuild from zero all selected available packages\n" .
michael@428 88 " -i ignore errors in the generated script\n" .
michael@428 89 " -q ignore all reverse dependencies\n" .
michael@428 90 " -s generate status map instead of shell script\n" .
michael@428 91 " -S generate status map instead of shell script (including new)\n" .
michael@428 92 " -X use external XML/RDF parser instead of internal one\n" .
michael@428 93 " -M generate short dependency map instead of shell script\n" .
michael@428 94 " -L generate list of packages in repository depending on target\n" .
michael@428 95 " -W include dependencies as if all build options are enabled\n" .
michael@428 96 " -K keep temporarily installed packages\n" .
michael@428 97 " -k keep temporarily downloaded packages\n" .
michael@428 98 " -e rebuild exact version of a package from repository\n" .
michael@428 99 " -b build-time check existing binaries for dependencies only\n" .
michael@428 100 " -B build-time check existing binaries for dependencies and target\n" .
michael@428 101 " -g rebuild packages even when most recent version is installed\n" .
michael@428 102 " -P <priv-cmd> command prefix for privileged commands\n" .
michael@428 103 " -N <non-priv-cmd> command prefix for non-privileged commands\n" .
michael@428 104 " -p <platform> match platform against repository index for binary packages\n" .
michael@428 105 " -E <name> exclude package\n" .
michael@428 106 " -H <name> hint about packages to resolve ambiquity\n" .
michael@428 107 " -D <name>[=<val>] set build option for packages\n";
michael@428 108 if ($rc == 0) {
michael@428 109 print STDOUT $usage;
michael@428 110 }
michael@428 111 else {
michael@428 112 print STDERR $usage;
michael@428 113 }
michael@428 114 exit($rc);
michael@428 115 }
michael@428 116 if ($opt_h) {
michael@428 117 usage(0);
michael@428 118 }
michael@428 119 if (not ( ($#ARGV >= 0 && !($opt_a || $opt_A))
michael@428 120 || ($#ARGV == -1 && ($opt_a || $opt_A)))) {
michael@428 121 usage(1);
michael@428 122 };
michael@428 123
michael@428 124 # determine RPM run-time information
michael@428 125 my $config = rpm_runtime_info();
michael@428 126
michael@428 127 # override command line options with configuration script options
michael@428 128 # now that the effectively used OpenPKG RPM command is known
michael@428 129 foreach my $env (sort { $a cmp $b } grep {
michael@428 130 $config->{"rpm"} =~ m/^\Q$_\E/ # compatibility
michael@428 131 or $config->{"prefix"} =~ m/^\Q$_\E/ # regular
michael@428 132 } keys %env) {
michael@428 133 while (my ($opt, $val) = each(%{$env{$env}})) {
michael@428 134 eval "\$opt_$opt = '$val' unless defined \$opt_$opt;";
michael@428 135 }
michael@428 136 }
michael@428 137
michael@428 138 ##
michael@428 139 ## OPTION POST-PROCESSING
michael@428 140 ##
michael@428 141
michael@428 142 my ($url, $repository, $installed, $env, $list, $bonly, $clist);
michael@428 143 my ($pattern, %with, %exclude, %hint);
michael@428 144
michael@428 145 # determine package goal pattern
michael@428 146 if ($opt_a) {
michael@428 147 $pattern = undef;
michael@428 148 } else {
michael@428 149 $pattern = join(' ', @ARGV);
michael@428 150 }
michael@428 151 if ($opt_A) {
michael@428 152 $pattern = '*';
michael@428 153 }
michael@428 154
michael@428 155 # parse build options
michael@428 156 %with = map {
michael@428 157 m/([^\s=]+)(?:\=(\S+))?/
michael@428 158 ? ($1 => (defined($2) ? $2 : 'yes'))
michael@428 159 : ()
michael@428 160 } split(/\s+/, $opt_D);
michael@428 161
michael@428 162 # split accumulated option values
michael@428 163 %exclude = map { $_ => 1 } split(/\s+/, $opt_E);
michael@428 164 %hint = map { $_ => 1 } split(/\s+/, $opt_H);
michael@428 165
michael@428 166 if (defined($opt_p)) {
michael@428 167 $config->{platform} = $opt_p;
michael@428 168 }
michael@428 169
michael@428 170 # determine RPM package repository information
michael@428 171 if (defined $opt_r) {
michael@428 172 $url = $opt_r;
michael@428 173 $url .= '/' unless $url =~ m/\/$/;
michael@428 174 } else {
michael@428 175 $url = rpm_release_url();
michael@428 176 }
michael@428 177 # if we read the index from a file we can no longer deduce
michael@428 178 # repository paths from index paths. For now lets assume
michael@428 179 # that everything is below SRC/ to be compatible with
michael@428 180 # existing file indexes.
michael@428 181 if (defined($opt_f) and not defined($opt_r)) {
michael@428 182 $url .= 'SRC/';
michael@428 183 }
michael@428 184
michael@428 185 # determine information about INSTALLED packages (virtual and regular),
michael@428 186 # including their options, provides and requirements
michael@428 187 my $installed = get_installed();
michael@428 188
michael@428 189 # SPECIAL CASE post-processing for
michael@428 190 # -Z (ignore installed packages)
michael@428 191 # -a (operate for all installed packages)
michael@428 192 if ($opt_a and $opt_Z) {
michael@428 193 # This allows one to correctly upgrade an existing OpenPKG
michael@428 194 # instance to a newer major version by querying all installed
michael@428 195 # packages and their options (-a) but then ignore them (-Z) during
michael@428 196 # the later processing and instead perform more or less a fresh
michael@428 197 # rebuild from scratch. This ensures that during the process the
michael@428 198 # installed packages are effectively picked up as dependencies
michael@428 199 # only after they in turn were already updated.
michael@428 200 foreach my $package (keys(%{$installed})) {
michael@428 201 next if ($package =~ m/::/);
michael@428 202 if (exists($installed->{$package}->{""})) {
michael@428 203 # virtual package
michael@428 204 $hint{$installed->{$package}->{""}->[0]->{"name"}} = 1
michael@428 205 if (exists($installed->{$package}->{""}->[0]->{"name"}));
michael@428 206 }
michael@428 207 else {
michael@428 208 # regular package
michael@428 209 $pattern .= " $package";
michael@428 210 foreach my $version (keys(%{$installed->{$package}})) {
michael@428 211 foreach my $rec (@{$installed->{$package}->{$version}}) {
michael@428 212 if (defined($rec->{"OPTIONS"})) {
michael@428 213 my $options = $rec->{"OPTIONS"};
michael@428 214 foreach my $option (keys(%{$options})) {
michael@428 215 $with{$package."::".$option} = $options->{$option};
michael@428 216 }
michael@428 217 }
michael@428 218 }
michael@428 219 }
michael@428 220 }
michael@428 221 }
michael@428 222 }
michael@428 223 if ($opt_Z) {
michael@428 224 $installed = {};
michael@428 225 }
michael@428 226
michael@428 227 # determine information about AVAILABLE packages
michael@428 228 # by fetching and parsing a package repository XML/RDF index
michael@428 229 $repository = get_index(
michael@428 230 $url . '00INDEX.rdf',
michael@428 231 $opt_f,
michael@428 232 $opt_X,
michael@428 233 $config->{platform},
michael@428 234 $installed
michael@428 235 );
michael@428 236
michael@428 237 # assemble together all determined environment information
michael@428 238 $env = {
michael@428 239 config => $config,
michael@428 240 installed => $installed,
michael@428 241 repository => $repository,
michael@428 242 built => {},
michael@428 243 revdep => undef,
michael@428 244 with => \%with,
michael@428 245 exclude => \%exclude,
michael@428 246 hint => \%hint,
michael@428 247 upgrade => ($opt_a || $opt_U),
michael@428 248 zero => ($opt_z || $opt_Z),
michael@428 249 exact => $opt_e,
michael@428 250 quick => ($opt_q || $opt_z || $opt_Z),
michael@428 251 status => ($opt_s || $opt_S),
michael@428 252 fatal => [],
michael@428 253 goals => $opt_g,
michael@428 254 sourceonly => ($opt_u || $opt_U || $opt_z || $opt_Z)
michael@428 255 };
michael@428 256
michael@428 257 ##
michael@428 258 ## PERFORM REQUESTED OPERATION
michael@428 259 ##
michael@428 260
michael@428 261 if ($opt_L) {
michael@428 262 # case 1: calculate dependencies only and
michael@428 263 # print packages depending on target
michael@428 264 ($list) = build_deps($pattern, $env);
michael@428 265 print_deps($list);
michael@428 266 } else {
michael@428 267 # case 2: calculate build commands and
michael@428 268 # print results in different formats
michael@428 269 ($list, $bonly, $clist) = build_list($pattern, $env);
michael@428 270 die "openpkg:build:FATAL: cannot find package\n" if (not defined($list));
michael@428 271 if ($opt_M) {
michael@428 272 print_map($installed, $repository, $list, $bonly, $clist);
michael@428 273 } elsif ($opt_S) {
michael@428 274 print_status($installed, $repository, $list, $bonly, $clist);
michael@428 275 } elsif ($opt_s) {
michael@428 276 print_status($installed, {}, $list, $bonly, $clist);
michael@428 277 } else {
michael@428 278 if (@{$env->{fatal}}) {
michael@428 279 die "openpkg:build:FATAL: errors occured while building:\n", @{$env->{fatal}}, "\n";
michael@428 280 }
michael@428 281 print_list1($list, $config, $opt_a || $opt_u || $opt_U, $env->{with}, $opt_i, $opt_b, $opt_B);
michael@428 282 print_list2($bonly, $config) if (not $opt_K);
michael@428 283 }
michael@428 284 }
michael@428 285
michael@428 286 # die gracefully
michael@428 287 exit(0);
michael@428 288
michael@428 289 #############################################################################
michael@428 290 ##
michael@428 291 ## FUNCTIONS: PARSING & RUN-TIME INFORMATION
michael@428 292 ##
michael@428 293 #############################################################################
michael@428 294
michael@428 295 # home-brewn getopt(3) style option parser
michael@428 296 sub getopts ($) {
michael@428 297 my ($opts) = @_;
michael@428 298 my (%optf) = map { m/(\w)/; $1 => $_ } $opts =~ m/(\w:|\w)/g;
michael@428 299 my (%opts, @argv, $optarg);
michael@428 300
michael@428 301 foreach (@ARGV) {
michael@428 302 if (@argv) {
michael@428 303 push @argv, $_;
michael@428 304 } elsif (defined $optarg) {
michael@428 305 if (exists $opts{$optarg}) {
michael@428 306 $opts{$optarg} .= " $_";
michael@428 307 } else {
michael@428 308 $opts{$optarg} = $_;
michael@428 309 }
michael@428 310 $optarg = undef;
michael@428 311 } elsif (!/^[-]/) {
michael@428 312 push @argv, $_;
michael@428 313 } else {
michael@428 314 while (/^\-(\w)(.*)/) {
michael@428 315 if (exists $optf{$1}) {
michael@428 316 if (length($optf{$1}) > 1) {
michael@428 317 if ($2 ne '') {
michael@428 318 if (exists $opts{$1}) {
michael@428 319 $opts{$1} .= " $2";
michael@428 320 } else {
michael@428 321 $opts{$1} = $2;
michael@428 322 }
michael@428 323 } else {
michael@428 324 $optarg = $1;
michael@428 325 }
michael@428 326 last;
michael@428 327 } else {
michael@428 328 $opts{$1} = 1;
michael@428 329 }
michael@428 330 } else {
michael@428 331 warn "openpkg:build:WARNING: unknown option $_\n";
michael@428 332 }
michael@428 333 $_ = "-$2";
michael@428 334 }
michael@428 335 }
michael@428 336 }
michael@428 337 if (defined $optarg) {
michael@428 338 warn "openpkg:build:WARNING: option $optarg requires an argument\n";
michael@428 339 }
michael@428 340 foreach (keys %opts) {
michael@428 341 eval '$opt_'.$_.' = "'.quotemeta($opts{$_}).'";';
michael@428 342 }
michael@428 343 @ARGV = @argv;
michael@428 344 }
michael@428 345
michael@428 346 # determine RPM run-time information
michael@428 347 sub rpm_runtime_info () {
michael@428 348 # determine OpenPKG instance prefix via
michael@428 349 # 1. the environment of the "openpkg build" framework
michael@428 350 # 2. the installation path of the script
michael@428 351 # 3. the installation path of the Perl interpreter
michael@428 352 # 4. the path of the "openpkg" command in $PATH
michael@428 353 my $l_prefix = $ENV{'OPENPKG_PREFIX'};
michael@428 354 if (not $l_prefix) {
michael@428 355 ($l_prefix) = ($0 =~ m/^(.+)\/lib(exec)?\/openpkg(-tools)?\/build(\.pl)?$/);
michael@428 356 }
michael@428 357 if (not $l_prefix) {
michael@428 358 ($l_prefix) = ($^X =~ m/^(.+)\/bin\/perl.*$/);
michael@428 359 }
michael@428 360 if (not $l_prefix) {
michael@428 361 $l_prefix = (`(which openpkg) 2>/dev/null` =~ m/^(.+)\/bin\/openpkg$/);
michael@428 362 }
michael@428 363 if (not -x "$l_prefix/bin/openpkg") {
michael@428 364 die "openpkg:build:FATAL: cannot determine OpenPKG instance prefix";
michael@428 365 }
michael@428 366 print "# operating with OpenPKG instance $l_prefix\n";
michael@428 367
michael@428 368 # determine OpenPKG RPM command
michael@428 369 my $rpm = $opt_R || $env{''}->{'R'} ||
michael@428 370 ((-f "$l_prefix/bin/openpkg" && -f "$l_prefix/libexec/openpkg/rpm") ?
michael@428 371 "$l_prefix/bin/openpkg rpm" : "$l_prefix/bin/rpm");
michael@428 372 $rpm = (`(which $rpm) 2>/dev/null` =~ m{^(/.*)})[0] if ($rpm !~ m|^/|);
michael@428 373 die "openpkg:build:FATAL: cannot locate OpenPKG RPM in path" unless ($rpm =~ m{^/});
michael@428 374 print "# operating with OpenPKG RPM $rpm\n";
michael@428 375
michael@428 376 # determine additional tools
michael@428 377 my $mkp = "$l_prefix/bin/openpkg makeproxy";
michael@428 378 my $rel = "$l_prefix/bin/openpkg release";
michael@428 379 my $bzip2 = $rpm;
michael@428 380 $bzip2 =~ s/\/bin\/openpkg rpm$/\/lib\/openpkg\/bzip2/;
michael@428 381 my $curl = $rpm;
michael@428 382 $curl =~ s/\/bin\/openpkg rpm$/\/lib\/openpkg\/curl/;
michael@428 383 $curl = "$l_prefix/bin/openpkg curl" if (system("$l_prefix/bin/openpkg curl file://$l_prefix/etc/openpkg/platform >/dev/null 2>&1") == 0);
michael@428 384
michael@428 385 # expand RPM macros holding information
michael@428 386 my $c = run("$rpm --eval '%{_rpmdir} %{_rpmfilename} %{_target_os} %{_target_cpu} %{_srcrpmdir}'");
michael@428 387
michael@428 388 # parse and post-process information
michael@428 389 chomp($c);
michael@428 390 my (@q) = split(/\s+/, $c);
michael@428 391 $q[1] =~ s/%{OS}/$q[2]/;
michael@428 392 $q[1] =~ s/%{ARCH}/$q[3]/;
michael@428 393
michael@428 394 # expand RPM rc information about tools
michael@428 395 $c = run("$rpm --showrc");
michael@428 396 my @g = ($c =~ m/\%\{l_tool_locate\s+([^\s\}]+)/g);
michael@428 397
michael@428 398 # return accumulated information
michael@428 399 return {
michael@428 400 rpm => $rpm,
michael@428 401 mkp => $mkp,
michael@428 402 rel => $rel,
michael@428 403 bzip2 => $bzip2,
michael@428 404 curl => $curl,
michael@428 405 rpmdir => $q[0],
michael@428 406 srcrpmdir=> $q[4],
michael@428 407 template => $q[1],
michael@428 408 platform => '',
michael@428 409 prefix => $l_prefix,
michael@428 410 optreg => '(?:'. join('|', map { "\Quse_$_\E" } @g) .')'
michael@428 411 };
michael@428 412 }
michael@428 413
michael@428 414 # determine RPM release URL
michael@428 415 sub rpm_release_url ($$) {
michael@428 416 my ($rel, $url);
michael@428 417
michael@428 418 # determine the release URL the newer way
michael@428 419 $url = run("(".$config->{"rel"}." --fmt='%u') 2>/dev/null || true") || "";
michael@428 420 $url =~ s/^\s+//s;
michael@428 421 $url =~ s/\s+$//s;
michael@428 422
michael@428 423 # use a local jumpstart RDF
michael@428 424 if (-f $config->{"prefix"}."/etc/openpkg/build.rdf") {
michael@428 425 $url = "file://".$config->{"prefix"}."/etc/openpkg/build.rdf"
michael@428 426 }
michael@428 427
michael@428 428 return $url;
michael@428 429 }
michael@428 430
michael@428 431 #############################################################################
michael@428 432 ##
michael@428 433 ## FUNCTIONS: VERSION STRING HANDLING
michael@428 434 ##
michael@428 435 #############################################################################
michael@428 436
michael@428 437 # compare two package versions
michael@428 438 # - "openpkg rpm":
michael@428 439 # splits according to !isalnum(3) ([a-zA-Z0-9])
michael@428 440 # and between isdigit(3) ([0-9]) and isalpha(3) ([a-zA-Z])
michael@428 441 # - "openpkg build" (this):
michael@428 442 # splits on "." characters
michael@428 443 sub vcmp_version ($$) {
michael@428 444 my ($a, $b) = @_;
michael@428 445 my (@a, @b, $c);
michael@428 446 my ($ax, $bx);
michael@428 447
michael@428 448 # split according to dots
michael@428 449 @a = split(/\./, $a);
michael@428 450 @b = split(/\./, $b);
michael@428 451
michael@428 452 # compare as long as components exist
michael@428 453 while (@a && @b) {
michael@428 454 if ($a[0] =~ m/^\d+$/ && $b[0] =~ m/^\d+$/) {
michael@428 455 # numerical comparison
michael@428 456 $c = $a[0] <=> $b[0];
michael@428 457 } elsif ((($a, $ax) = $a[0] =~ m/^(\d+)(.*)$/) &&
michael@428 458 (($b, $bx) = $b[0] =~ m/^(\d+)(.*)$/)) {
michael@428 459 # numerical comparison for prefix,
michael@428 460 # string comparison for remainder
michael@428 461 $c = $a <=> $b;
michael@428 462 $c = $ax cmp $bx unless ($c);
michael@428 463 } else {
michael@428 464 # string comparison
michael@428 465 $c = $a[0] cmp $b[0];
michael@428 466 }
michael@428 467
michael@428 468 # stop comparison if components already mismatched
michael@428 469 return $c if ($c != 0);
michael@428 470
michael@428 471 # else reduce by one component level
michael@428 472 shift(@a);
michael@428 473 shift(@b);
michael@428 474 }
michael@428 475
michael@428 476 # finally compare number of remaining components
michael@428 477 # (in case one is more specific)
michael@428 478 $c = (scalar(@a) <=> scalar(@b));
michael@428 479 return $c;
michael@428 480 }
michael@428 481
michael@428 482 # compare two package releases
michael@428 483 # - "openpkg rpm":
michael@428 484 # uses "vcmp_version" semantics 1:1 again
michael@428 485 # - "openpkg build" (this):
michael@428 486 # uses "vcmp_version" semantics 1:1 again (>= 20060719)
michael@428 487 # trivial string comparison (<= 20060719)
michael@428 488 sub vcmp_release ($$) {
michael@428 489 my ($a, $b) = @_;
michael@428 490
michael@428 491 return vcmp_version($a, $b);
michael@428 492 }
michael@428 493
michael@428 494 # compare two package "version" or "version-release" strings
michael@428 495 # - "openpkg rpm":
michael@428 496 # compares "epoch", "version", "release" (in this order)
michael@428 497 # - "openpkg build" (this):
michael@428 498 # compares "release", "version", (in this order)
michael@428 499 sub vcmp ($$) {
michael@428 500 my ($a, $b) = @_;
michael@428 501 my ($c);
michael@428 502
michael@428 503 # short-circuit comparison for simple case
michael@428 504 return 0 if ($a eq $b);
michael@428 505
michael@428 506 # split into "version" and "release"
michael@428 507 my ($av, $ar) = ($a =~ m/^(.*?)(?:\-([\d\.]+))?$/);
michael@428 508 my ($bv, $br) = ($b =~ m/^(.*?)(?:\-([\d\.]+))?$/);
michael@428 509
michael@428 510 # compare "release"
michael@428 511 if (defined($ar) and defined($br)) {
michael@428 512 $c = vcmp_release($ar, $br);
michael@428 513 return $c if ($c); # short-circuit
michael@428 514 }
michael@428 515
michael@428 516 # compare "version"
michael@428 517 if (defined($av) && defined($bv)) {
michael@428 518 $c = vcmp_version($av, $bv);
michael@428 519 return $c if ($c); # short-circuit
michael@428 520 }
michael@428 521
michael@428 522 # equality
michael@428 523 return 0;
michael@428 524 }
michael@428 525
michael@428 526 # create "version" or "version-release" string
michael@428 527 # from a provide object (see parse_provides)
michael@428 528 sub vs ($) {
michael@428 529 my ($t) = @_;
michael@428 530 return (
michael@428 531 defined($t->{release})
michael@428 532 ? "$t->{version}-$t->{release}"
michael@428 533 : $t->{version}
michael@428 534 );
michael@428 535 }
michael@428 536
michael@428 537 # create "name-version" or "name-version-release" string
michael@428 538 # from a provide object (see parse_provides)
michael@428 539 sub vsn ($) {
michael@428 540 my ($t) = @_;
michael@428 541 return "$t->{name}-".vs($t);
michael@428 542 }
michael@428 543
michael@428 544 #############################################################################
michael@428 545 ##
michael@428 546 ## FUNCTIONS: INSTALLATION INFORMATION
michael@428 547 ##
michael@428 548 #############################################################################
michael@428 549
michael@428 550 # parse OpenPKG RPM 'provide' string
michael@428 551 # "<virtual-name>" (virtual package)
michael@428 552 # "<name> = <version>-<release>" (regular package)
michael@428 553 # "<name>::<option> = <value>" (regular package build option)
michael@428 554 sub parse_provides ($) {
michael@428 555 my ($s) = @_;
michael@428 556 my ($nam, $val, $pre, $with, $pxy, $ver, $rel);
michael@428 557
michael@428 558 ($nam, $val) = ($s =~ m/^([^\s\(]+(?:\([^\)]*\))?)\s*(?:=\s*(\S*?))?$/);
michael@428 559 if (($pre, $with) = ($nam =~ m/^(\S+?)::(\S*)$/)) {
michael@428 560 # build option
michael@428 561 $val =~ s/(?:\%([0-9a-fA-F][0-9a-fA-F]))/chr(hex($1))/eg; # hex decode
michael@428 562 ($ver, $rel, $pxy) = ($val, undef, undef);
michael@428 563 } else {
michael@428 564 # virtual or real package
michael@428 565 ($ver, $rel, $pxy) = ($val =~ m/^([^\s\-]+)-([^\s\+]+)(\+PROXY)?$/);
michael@428 566 }
michael@428 567
michael@428 568 # return accumulated information
michael@428 569 return {
michael@428 570 name => $nam, # the full name of the resource
michael@428 571 version => $ver, # the version (or value)
michael@428 572 release => $rel, # and release number (or undef)
michael@428 573 proxy => $pxy, # whether the resource is a PROXY resource (or undef)
michael@428 574 prefix => $pre, # the packagename (if resource is an option)
michael@428 575 with => $with # the buildoption (if resource is an option)
michael@428 576 };
michael@428 577 }
michael@428 578
michael@428 579 # parse option from RPM 'provides' list
michael@428 580 sub parse_provideslist ($) {
michael@428 581 my ($l) = @_;
michael@428 582 my ($p);
michael@428 583 my ($nam, $val, %opts);
michael@428 584
michael@428 585 foreach (@$l) {
michael@428 586 $p = parse_provides($_);
michael@428 587 next if (not (defined $p->{with} && defined $p->{prefix}));
michael@428 588 $opts{$p->{with}} = $p->{version};
michael@428 589 }
michael@428 590 return \%opts;
michael@428 591 }
michael@428 592
michael@428 593 # translate dependency object into provides object
michael@428 594 sub depends2provides ($) {
michael@428 595 my ($dep) = @_;
michael@428 596 my ($ver, $rel, $pxy, $pre, $with);
michael@428 597
michael@428 598 ($ver, $rel, $pxy) = ($dep->{val} =~ m/^([^\s\-]+)-([^\s\+]+)(\+PROXY)?$/);
michael@428 599 ($pre, $with) = ($dep->{name} =~ m/^(\S+?)::(\S*)$/);
michael@428 600
michael@428 601 return {
michael@428 602 name => $dep->{name},
michael@428 603 version => (defined $ver ? $ver : $dep->{val}),
michael@428 604 release => $rel,
michael@428 605 proxy => $pxy,
michael@428 606 prefix => $pre,
michael@428 607 with => $with
michael@428 608 }
michael@428 609 }
michael@428 610
michael@428 611 # parse OpenPKG RPM 'require' string
michael@428 612 # "<virtual-name>" (virtual package)
michael@428 613 # "<name> =|<|<=|>|>= <version>[-<release>]" (regular package)
michael@428 614 # "<name>::<option> =|<|<=|>|>= <value>" (regular package build option)
michael@428 615 sub parse_depends ($) {
michael@428 616 my ($dep) = @_;
michael@428 617 my ($name, $op, $val);
michael@428 618
michael@428 619 if (ref($dep)) {
michael@428 620 # dependency from new index stored as a node
michael@428 621 # - content of the node is the name
michael@428 622 # - certain attributes denote the comparison operator
michael@428 623 # - the value of such an attribute is the comparison operand
michael@428 624 # - the operator (and operand) are optional and there can only be one
michael@428 625 $name = $dep->{content};
michael@428 626 $op = undef;
michael@428 627 $op = 'equ' if (exists($dep->{equ}));
michael@428 628 $op = 'geq' if (exists($dep->{geq}));
michael@428 629 $op = 'leq' if (exists($dep->{leq}));
michael@428 630 $op = 'gt' if (exists($dep->{gt}));
michael@428 631 $op = 'lt' if (exists($dep->{lt}));
michael@428 632 if (defined($op)) {
michael@428 633 $val = $dep->{$op};
michael@428 634 }
michael@428 635 } elsif ($dep =~ m/\S/) {
michael@428 636 # dependency from old index stored as text string
michael@428 637 # "name operator operand" or "name"
michael@428 638 ($name, $op, $val) = ($dep =~ m/(\S+)\s*(?:(\S+)\s*(\S+))?\s*$/);
michael@428 639 if (defined($op)) {
michael@428 640 $op = {
michael@428 641 '==' => 'equ', '=' => 'equ',
michael@428 642 '>=' => 'geq', '=>' => 'geq',
michael@428 643 '<=' => 'leq', '=<' => 'leq',
michael@428 644 '>' => 'gt', '<' => 'lt'
michael@428 645 }->{$op};
michael@428 646 if (not defined($op)) {
michael@428 647 print "# don't know how to handle dependency: $dep (invalid operator)\n";
michael@428 648 return;
michael@428 649 }
michael@428 650 }
michael@428 651 }
michael@428 652 return {
michael@428 653 name => $name,
michael@428 654 op => $op,
michael@428 655 val => $val
michael@428 656 };
michael@428 657 }
michael@428 658
michael@428 659 # retrieve the local installed package base.
michael@428 660 # for packages that provide option resources (packagename::buildoption)
michael@428 661 # the options are parsed into the OPTIONS hash.
michael@428 662 # other packages will query options on demand.
michael@428 663 sub get_installed () {
michael@428 664 my (%map);
michael@428 665 my (@l, $p);
michael@428 666 my ($nam, $val, %options);
michael@428 667 my ($vs, $rec, @list);
michael@428 668 my ($name, $version, $release);
michael@428 669 my ($req);
michael@428 670
michael@428 671 # generated total result:
michael@428 672 # $map = {
michael@428 673 # # regular package
michael@428 674 # "<package-name>" <foo> => {
michael@428 675 # "<version>-<release>" <1.2.3-20060622> => [
michael@428 676 # <<1>{
michael@428 677 # "name" => $name,
michael@428 678 # "version" => $version,
michael@428 679 # "release" => $release,
michael@428 680 # "PROXY" => $proxy,
michael@428 681 # "depends" => [
michael@428 682 # <<3>>{
michael@428 683 # "cond" => '',
michael@428 684 # "value" => {
michael@428 685 # name => $name,
michael@428 686 # op => $op,
michael@428 687 # val => $val
michael@428 688 # },
michael@428 689 # },
michael@428 690 # ...
michael@428 691 # ],
michael@428 692 # "keeps" => [
michael@428 693 # \<<3>
michael@428 694 # ...
michael@428 695 # ],
michael@428 696 # "OPTIONS" => {
michael@428 697 # "<option>" => "<value>",
michael@428 698 # "<option>" => "<value>",
michael@428 699 # ...
michael@428 700 # },
michael@428 701 # },
michael@428 702 # ...
michael@428 703 # ],
michael@428 704 # },
michael@428 705 # # build option
michael@428 706 # "<package-name>::<option>" <foo::with_baz> => {
michael@428 707 # "<value>" <yes> => [
michael@428 708 # \<<1>>
michael@428 709 # ...
michael@428 710 # ],
michael@428 711 # },
michael@428 712 # # virtual package
michael@428 713 # "<package-name>" <BAR> => {
michael@428 714 # "" => [
michael@428 715 # \<<1>>,
michael@428 716 # ...
michael@428 717 # ],
michael@428 718 # },
michael@428 719 # ...
michael@428 720 # };
michael@428 721
michael@428 722 # query and parse all provides of all packages
michael@428 723 # HINT: We assume(!) that OpenPKG RPM outputs "provides" in order:
michael@428 724 # 1. virtual package & build option
michael@428 725 # 2. regular package
michael@428 726 # FIXME: The better long-term solution for all this fiddling would be something like:
michael@428 727 # "openpkg rpm -qa -qf '%{NAME} %{VERSION} %{RELEASE}[ .%{PROVIDENAME} .%{PROVIDEFLAGS:depflags} .%{PROVIDEVERSION}]\\n'"
michael@428 728 @l = run($config->{"rpm"}. " --provides -qa");
michael@428 729 @list = ();
michael@428 730 foreach (@l) {
michael@428 731 # parse into provide object
michael@428 732 $p = parse_provides($_) or next;
michael@428 733
michael@428 734 # short-circuit processing for RPM special case
michael@428 735 next if ($p->{name} =~ m/^gpg\(/);
michael@428 736
michael@428 737 # is this an option?
michael@428 738 if (defined($p->{with})) {
michael@428 739 $options{$p->{prefix}}->{$p->{with}} = $p->{version};
michael@428 740 push(@list, $p);
michael@428 741 next;
michael@428 742 }
michael@428 743
michael@428 744 # is this a virtual target?
michael@428 745 $vs = vs($p);
michael@428 746 if ($vs eq '') {
michael@428 747 push(@list, $p);
michael@428 748 next;
michael@428 749 }
michael@428 750
michael@428 751 # assemble package details
michael@428 752 $name = $p->{name};
michael@428 753 $version = defined($p->{version}) ? $p->{version} : '*';
michael@428 754 $release = defined($p->{release}) ? $p->{release} : '*';
michael@428 755 push(@list, {
michael@428 756 name => $name,
michael@428 757 version => $version,
michael@428 758 release => $release
michael@428 759 });
michael@428 760
michael@428 761 # create target record
michael@428 762 $rec = {
michael@428 763 name => $name,
michael@428 764 version => $version,
michael@428 765 release => $release,
michael@428 766 PROXY => $p->{proxy},
michael@428 767 depends => [],
michael@428 768 keeps => []
michael@428 769 };
michael@428 770 foreach (@list) {
michael@428 771 push(@{$map{$_->{name}}->{vs($_)}}, $rec);
michael@428 772 }
michael@428 773
michael@428 774 # remove assembled details
michael@428 775 @list = ();
michael@428 776 }
michael@428 777 if (@list) {
michael@428 778 print "# ATTENTION: ", scalar(@list), " froods (unassignable RPM 'provides') left\n";
michael@428 779 }
michael@428 780
michael@428 781 # options are provided for a package,
michael@428 782 # apply them to all instances of the package
michael@428 783 # FIXME: duplicate copying because record exists multiple times (but harmless)
michael@428 784 # FIXME: merges all "provides" of all package instances together -- which might be wrong
michael@428 785 foreach $nam (keys(%options)) {
michael@428 786 foreach $val (keys(%{$map{$nam}})) {
michael@428 787 foreach (@{$map{$nam}->{$val}}) {
michael@428 788 $_->{OPTIONS} = $options{$nam};
michael@428 789 }
michael@428 790 }
michael@428 791 }
michael@428 792
michael@428 793 # query all 'requires' of all installed packages
michael@428 794 # to determine the package dependencies
michael@428 795 @l = run($config->{"rpm"} . " --qf '%{NAME}:::%{VERSION}:::%{RELEASE}[ :::%{REQUIRENAME}:::%{REQUIREFLAGS:depflags}:::%{REQUIREVERSION}:::]\\n' -qa");
michael@428 796 @list = ();
michael@428 797 foreach (@l) {
michael@428 798 ($name, $version, $release, $req) = m/^([^:]+):::([^:]+):::([^:]+)(.*?)$/;
michael@428 799 next if ($name eq 'gpg-pubkey');
michael@428 800 $release =~ s/\+PROXY$//;
michael@428 801 # for each requirement triple...
michael@428 802 while ($req =~ m/\s+:::(.+?):::\s*(.*?)\s*:::(.*?):::/g) {
michael@428 803 $p = parse_depends("$1 $2 $3");
michael@428 804 next if ($p->{name} =~ m/^(rpmlib|gpg)\(/);
michael@428 805 $vs = vs({ version => $version, release => $release });
michael@428 806 $p = { cond => '', value => $p };
michael@428 807 foreach $rec (@{$map{$name}->{$vs}}) {
michael@428 808 push(@{$rec->{depends}}, $p);
michael@428 809 push(@{$rec->{keeps}}, $p);
michael@428 810 }
michael@428 811 }
michael@428 812 }
michael@428 813 if (@list) {
michael@428 814 print "# ATTENTION: ",scalar(@list)," fnords (unassignable RPM 'requires') left\n";
michael@428 815 }
michael@428 816
michael@428 817 # return final result
michael@428 818 return \%map;
michael@428 819 }
michael@428 820
michael@428 821 #############################################################################
michael@428 822 ##
michael@428 823 ## FUNCTIONS: REPOSITORY INDEX INFORMATION
michael@428 824 ##
michael@428 825 #############################################################################
michael@428 826
michael@428 827 # fetch XML/RDF index from file or URL
michael@428 828 # (recursively fetches sub-indexes, too)
michael@428 829 sub get_index ($$$$$) {
michael@428 830 my ($url, $fn, $xml, $pfmatch, $installed) = @_;
michael@428 831 my (%map, $include);
michael@428 832 my ($fetch, $bzip2, $path);
michael@428 833 my ($parser);
michael@428 834
michael@428 835 # determine command/path to fetch/open index
michael@428 836 $bzip2 = $config->{"bzip2"};
michael@428 837 $fetch = defined($fn) ? $fn : $url;
michael@428 838 $fetch !~ m/\.bz2$/ || -x $bzip2
michael@428 839 or die "openpkg:build:FATAL: $bzip2 not found\n";
michael@428 840 if ($fetch =~ m/^\w+:/) {
michael@428 841 # looks like URL scheme
michael@428 842 print "# fetching XML/RDF index from URL $fetch\n";
michael@428 843 $path = $config->{"curl"} . " -s -o - \"$fetch\" |";
michael@428 844 $path .= "$bzip2 -dc |" if ($fetch =~ m/\.bz2$/);
michael@428 845 } else {
michael@428 846 print "# reading XML/RDF index from file $fetch\n";
michael@428 847 if ($fetch =~ m/\.bz2$/) {
michael@428 848 $path = "$bzip2 -dc $fetch |";
michael@428 849 } else {
michael@428 850 $path = "<$fetch";
michael@428 851 }
michael@428 852 }
michael@428 853
michael@428 854 # open index
michael@428 855 open(RFH, $path) or
michael@428 856 die "openpkg:build:FATAL: cannot open '$fetch' ($!)\n";
michael@428 857
michael@428 858 # if XML parser can be used, try to lazy-load it
michael@428 859 if ($xml) {
michael@428 860 eval { require XML::Simple; };
michael@428 861 $xml = 0 if ($@);
michael@428 862 }
michael@428 863
michael@428 864 # determine and run XML parser
michael@428 865 # (returns contained index includes)
michael@428 866 $parser = ($xml ? \&xml_parser : \&simple_text_parser);
michael@428 867 $include = $parser->(\*RFH, $url, \%map, $pfmatch, $installed);
michael@428 868
michael@428 869 # close index
michael@428 870 close(RFH)
michael@428 871 or die "openpkg:build:FATAL: an I/O error occured\n";
michael@428 872
michael@428 873 # cannot do real recursions on file handles, so we simply append
michael@428 874 # (instead of inserting at the correct position) all sub-RDFs, as
michael@428 875 # the result is flattend into a big hash anyway
michael@428 876 foreach (@$include) {
michael@428 877 my ($submap);
michael@428 878 my ($suburl, $subfn) = relurl($url, $fn, $_);
michael@428 879 $submap = get_index($suburl, $subfn, $xml, $pfmatch, $installed); # RECURSION
michael@428 880 while (my ($name, $vmap) = each(%$submap)) {
michael@428 881 while (my ($vs, $recs) = each(%$vmap)) {
michael@428 882 push(@{$map{$name}->{$vs}}, @$recs);
michael@428 883 }
michael@428 884 }
michael@428 885 }
michael@428 886
michael@428 887 # return final result
michael@428 888 # $map = {
michael@428 889 # <package-name> => {
michael@428 890 # "<version>-<release>" => {
michael@428 891 # href => ...,
michael@428 892 # name => ...,
michael@428 893 # version => ...,
michael@428 894 # release => ...,
michael@428 895 # platform => ...,
michael@428 896 # prefix => ...,
michael@428 897 # depends => [ ... ],
michael@428 898 # keeps => [ ... ],
michael@428 899 # conflicts => [ ... ],
michael@428 900 # source => ...,
michael@428 901 # nosource => ...,
michael@428 902 # desc => $desc,
michael@428 903 # OPTIONS => $options,
michael@428 904 # DEFOPTS => { %$options },
michael@428 905 # };
michael@428 906 # };
michael@428 907 # };
michael@428 908 return \%map;
michael@428 909 }
michael@428 910
michael@428 911 # compute absolute paths
michael@428 912 # - (url, fn) point to a base document
michael@428 913 # the location is the file path fn if fn is
michael@428 914 # defined, otherwise it is url.
michael@428 915 # - augment the pointer with suburl
michael@428 916 # - suburl can be an absolute url
michael@428 917 # then the new pointer is (suburl, undef)
michael@428 918 # - suburl can be a absolute file path
michael@428 919 # then the new pointer is (suburl, suburl)
michael@428 920 # - suburl can be a relative path
michael@428 921 # then it augments url or fn accordingly
michael@428 922 sub relurl ($$$) {
michael@428 923 my ($url, $fn, $suburl) = @_;
michael@428 924 my ($subfn);
michael@428 925
michael@428 926 if ($suburl =~ m/^\w+:\/\//) {
michael@428 927 # NOP
michael@428 928 } elsif ($suburl =~ m/^\//) {
michael@428 929 $subfn = $suburl;
michael@428 930 } else {
michael@428 931 if (defined($fn)) {
michael@428 932 $subfn = $fn;
michael@428 933 $subfn =~ s/(\/)?\/*[^\/]*$/$1$suburl/;
michael@428 934 $suburl = $subfn;
michael@428 935 } else {
michael@428 936 $subfn = $url;
michael@428 937 $subfn =~ s/(\/)?\/*[^\/]*$/$1$suburl/;
michael@428 938 $suburl = $subfn;
michael@428 939 $subfn = undef;
michael@428 940 }
michael@428 941 }
michael@428 942 1 while ($suburl =~ s/\/\.\//\//s);
michael@428 943 1 while ($suburl =~ s/\/[^\/]+\/\.\.\//\//s);
michael@428 944 return ($suburl, $subfn);
michael@428 945 }
michael@428 946
michael@428 947 # XML/RDF parser (simple way)
michael@428 948 sub simple_text_parser ($$$$$) {
michael@428 949 my ($fh, $url, $map, $pfmatch, $installed) = @_;
michael@428 950 my (@include);
michael@428 951 my ($section);
michael@428 952 my ($name, $version);
michael@428 953 my ($href, $release, $desc, $bags);
michael@428 954 my (%options, @provides);
michael@428 955 my ($platform, $prefix);
michael@428 956 my ($rec);
michael@428 957 my ($tag, $cond, $attrname, $attrval, $body);
michael@428 958 my ($usecond);
michael@428 959 my ($options);
michael@428 960
michael@428 961 print "# using internal XML/RDF parser\n";
michael@428 962
michael@428 963 # read XML/RDF line-wise as we know that our
michael@428 964 # OpenPKG XML/RDF indices follow a strict formatting
michael@428 965 while (<$fh>) {
michael@428 966 # unescape some XML entities
michael@428 967 s/&gt;/>/g;
michael@428 968 s/&lt;/</g;
michael@428 969
michael@428 970 if (!(defined($href)) && m/<rdf:Description.*?href="([^"]*)"/) {
michael@428 971 # start of new package description
michael@428 972 $href = $1;
michael@428 973 $section = undef;
michael@428 974 $name = undef;
michael@428 975 $release = undef;
michael@428 976 $desc = '';
michael@428 977 $platform = undef;
michael@428 978 $prefix = undef;
michael@428 979 $bags = {};
michael@428 980 @provides = ();
michael@428 981 }
michael@428 982
michael@428 983 if (!(defined($href)) && m/<Repository.*?href="([^"]*)"(?:\s*platform="([^"]*)")?/) {
michael@428 984 # external XML/RDF index reference for particular binary platform
michael@428 985 if (goodpf($2, $pfmatch)) {
michael@428 986 push(@include, $1);
michael@428 987 }
michael@428 988 next;
michael@428 989 }
michael@428 990
michael@428 991 # skip content unless referenced piece was found
michael@428 992 next if (not defined($href));
michael@428 993
michael@428 994 # parse XML/RDF element into components
michael@428 995 ($tag, $cond, $attrname, $attrval, $body) = m{
michael@428 996 < # start delimiter
michael@428 997 (\/?[\w:]+) # begin element name
michael@428 998 \s* # optional space before attributes
michael@428 999 (?:cond="([^"]+)")? # known attribute
michael@428 1000 (?:(\w+)="([^"]+)")? # unknown attribute
michael@428 1001 > # end delimiter
michael@428 1002 (.*?) # optional element body
michael@428 1003 (?:<\/\1>)? # optional end tag
michael@428 1004 $ # end of string
michael@428 1005 }mx;
michael@428 1006
michael@428 1007 # recognize the various XML/RDF elements
michael@428 1008 if ($tag eq 'Description') {
michael@428 1009 $usecond = $cond;
michael@428 1010 $section = 'description';
michael@428 1011 } elsif ($tag eq '/Description') {
michael@428 1012 $usecond = $cond;
michael@428 1013 $section = undef;
michael@428 1014 } elsif ($section eq 'description') {
michael@428 1015 $desc .= $_;
michael@428 1016 } elsif ($tag eq 'PreReq') {
michael@428 1017 $usecond = $cond;
michael@428 1018 $section = 'prereq';
michael@428 1019 } elsif ($tag eq '/PreReq') {
michael@428 1020 $usecond = undef;
michael@428 1021 $section = undef;
michael@428 1022 } elsif ($tag eq 'BuildPreReq') {
michael@428 1023 $usecond = $cond;
michael@428 1024 $section = 'bprereq';
michael@428 1025 } elsif ($tag eq '/BuildPreReq') {
michael@428 1026 $usecond = undef;
michael@428 1027 $section = undef;
michael@428 1028 } elsif ($tag eq 'Provides') {
michael@428 1029 $usecond = $cond;
michael@428 1030 $section = 'provides';
michael@428 1031 } elsif ($tag eq '/Provides') {
michael@428 1032 $usecond = undef;
michael@428 1033 $section = undef;
michael@428 1034 } elsif ($tag eq 'Conflicts') {
michael@428 1035 $usecond = $cond;
michael@428 1036 $section = 'conflicts';
michael@428 1037 } elsif ($tag eq '/Conflicts') {
michael@428 1038 $usecond = undef;
michael@428 1039 $section = undef;
michael@428 1040 } elsif ($tag eq 'NoSource') {
michael@428 1041 $usecond = $cond;
michael@428 1042 $section = 'nosource';
michael@428 1043 } elsif ($tag eq '/NoSource') {
michael@428 1044 $usecond = undef;
michael@428 1045 $section = undef;
michael@428 1046 } elsif ($tag eq 'Source') {
michael@428 1047 $usecond = $cond;
michael@428 1048 $section = 'source';
michael@428 1049 } elsif ($tag eq '/Source') {
michael@428 1050 $usecond = undef;
michael@428 1051 $section = undef;
michael@428 1052 } elsif ($tag eq 'Name') {
michael@428 1053 $name = $body;
michael@428 1054 } elsif ($tag eq 'Version') {
michael@428 1055 $version = $body;
michael@428 1056 } elsif ($tag eq 'Release') {
michael@428 1057 $release = $body;
michael@428 1058 } elsif ($tag eq 'Platform') {
michael@428 1059 $platform = $body;
michael@428 1060 } elsif ($tag eq 'Prefixes') {
michael@428 1061 $prefix = $body;
michael@428 1062 } elsif ($tag eq 'rdf:li' || $tag eq 'resource') {
michael@428 1063 if (defined($attrname)) {
michael@428 1064 $body = {
michael@428 1065 $attrname => $attrval,
michael@428 1066 content => $body
michael@428 1067 };
michael@428 1068 }
michael@428 1069 if ($section eq 'provides') {
michael@428 1070 push(@provides, $body) if (!defined($usecond));
michael@428 1071 } elsif ($section ne '') {
michael@428 1072 push(@{$bags->{"$usecond"}->{$section}}, $body);
michael@428 1073 }
michael@428 1074 } elsif ($tag eq '/rdf:Description') {
michael@428 1075 if ( defined($href)
michael@428 1076 && defined($name)
michael@428 1077 && defined($version)
michael@428 1078 && defined($release)) {
michael@428 1079 # process the accumulated package information
michael@428 1080 @provides = map {
michael@428 1081 depends2provides(parse_depends($_))
michael@428 1082 } @provides;
michael@428 1083 %options = map {
michael@428 1084 ($_->{with} => $_->{version})
michael@428 1085 } grep {
michael@428 1086 defined($_->{with})
michael@428 1087 } @provides;
michael@428 1088 push(@provides, {
michael@428 1089 name => $name,
michael@428 1090 version => $version,
michael@428 1091 release => $release
michael@428 1092 });
michael@428 1093 $options =
michael@428 1094 %options
michael@428 1095 ? { %options }
michael@428 1096 : parse_options($desc);
michael@428 1097 if ($options) {
michael@428 1098 my (@t) = get_targets($installed->{$name}, sub { 1; });
michael@428 1099 }
michael@428 1100 # store accumulated package information
michael@428 1101 eval {
michael@428 1102 $rec = {
michael@428 1103 href => (relurl($url, undef, $href))[0],
michael@428 1104 name => $name,
michael@428 1105 version => $version,
michael@428 1106 release => $release,
michael@428 1107 depends => depend_list(swith($bags, 'bprereq')),
michael@428 1108 keeps => depend_list(swith($bags, 'prereq')),
michael@428 1109 conflicts => swith($bags, 'conflicts'),
michael@428 1110 source => swith($bags, 'source'),
michael@428 1111 nosource => swith($bags, 'nosource'),
michael@428 1112 desc => $desc,
michael@428 1113 platform => $platform,
michael@428 1114 prefix => $prefix,
michael@428 1115 OPTIONS => $options,
michael@428 1116 DEFOPTS => { %$options }
michael@428 1117 };
michael@428 1118 };
michael@428 1119 if ($@) {
michael@428 1120 die "openpkg:build:FATAL: when reading entry '$name':\n" . $@;
michael@428 1121 }
michael@428 1122 foreach (@provides) {
michael@428 1123 push(@{$map->{$_->{name}}->{vs($_)}}, $rec);
michael@428 1124 }
michael@428 1125 }
michael@428 1126 # prepare to recognize next package
michael@428 1127 $href = undef;
michael@428 1128 }
michael@428 1129 }
michael@428 1130
michael@428 1131 # return contained XML/RDF indices
michael@428 1132 return \@include;
michael@428 1133 }
michael@428 1134
michael@428 1135 # XML/RDF parser (usual way)
michael@428 1136 sub xml_parser ($$$$$) {
michael@428 1137 my ($fh, $url, $map, $pfmatch, $installed) = @_;
michael@428 1138 my (@include);
michael@428 1139 my ($xml, $rep, $sub);
michael@428 1140 my (@provides, %options, $rec);
michael@428 1141 my ($href, $name, $version, $release, $desc);
michael@428 1142 my ($options);
michael@428 1143
michael@428 1144 print "# using external XML/RDF parser\n";
michael@428 1145
michael@428 1146 # parse XML/RDF with XML::Simple parser
michael@428 1147 $xml = XML::Simple::XMLin($fh, forcearray => 1);
michael@428 1148 $rep = $xml->{'Repository'}->[0]->{'rdf:Description'};
michael@428 1149 $sub = $xml->{'Repository'}->[0]->{'Repository'};
michael@428 1150
michael@428 1151 # iterate over all package descriptions
michael@428 1152 foreach (@$rep) {
michael@428 1153 # fetch package information
michael@428 1154 $href = $_->{'href'};
michael@428 1155 $name = xel($_->{'Name'});
michael@428 1156 $version = xel($_->{'Version'});
michael@428 1157 $release = xel($_->{'Release'});
michael@428 1158 next if (not (
michael@428 1159 defined($href)
michael@428 1160 && defined($name)
michael@428 1161 && defined($version)
michael@428 1162 && defined($release)
michael@428 1163 ));
michael@428 1164
michael@428 1165 # determine package "provides"
michael@428 1166 @provides = ();
michael@428 1167 if ($_->{'Provides'}) {
michael@428 1168 @provides = map {
michael@428 1169 $_ = $_->{'rdf:bag'}->[0];
michael@428 1170 $_ = $_->{'rdf:li'} ? $_->{'rdf:li'} : $_->{'resource'};
michael@428 1171 @$_;
michael@428 1172 } grep {
michael@428 1173 !exists $_->{'cond'}
michael@428 1174 } @{$_->{'Provides'}};
michael@428 1175 }
michael@428 1176 @provides = map {
michael@428 1177 depends2provides(parse_depends($_))
michael@428 1178 } @provides;
michael@428 1179 %options = map {
michael@428 1180 ($_->{with} => $_->{version})
michael@428 1181 } grep {
michael@428 1182 defined $_->{with}
michael@428 1183 } @provides;
michael@428 1184 push(@provides, {
michael@428 1185 name => $name,
michael@428 1186 version => $version,
michael@428 1187 release => $release
michael@428 1188 });
michael@428 1189
michael@428 1190 # determine targets
michael@428 1191 $desc = xel($_->{'Description'});
michael@428 1192 $options =
michael@428 1193 %options
michael@428 1194 ? { %options }
michael@428 1195 : parse_options($desc);
michael@428 1196 if ($options) {
michael@428 1197 my (@t) = get_targets($installed->{$name}, sub { 1; });
michael@428 1198 }
michael@428 1199
michael@428 1200 # store accumulated package information
michael@428 1201 eval {
michael@428 1202 $rec = {
michael@428 1203 href => (relurl($url, undef, $href))[0],
michael@428 1204 name => $name,
michael@428 1205 version => $version,
michael@428 1206 release => $release,
michael@428 1207 platform => xel($_->{'Platform'}),
michael@428 1208 prefix => xel($_->{'Prefixes'}),
michael@428 1209 depends => depend_list(xwith($_->{'BuildPreReq'})),
michael@428 1210 keeps => depend_list(xwith($_->{'PreReq'})),
michael@428 1211 conflicts => xwith($_->{'Conflicts'}),
michael@428 1212 source => xwith($_->{'Source'}),
michael@428 1213 nosource => xwith($_->{'NoSource'}),
michael@428 1214 desc => $desc,
michael@428 1215 OPTIONS => $options,
michael@428 1216 DEFOPTS => { %$options }
michael@428 1217 };
michael@428 1218 };
michael@428 1219 if ($@) {
michael@428 1220 die "openpkg:build:FATAL: when reading entry '$name'\n".$@;
michael@428 1221 }
michael@428 1222 foreach (@provides) {
michael@428 1223 push(@{$map->{$_->{name}}->{vs($_)}}, $rec);
michael@428 1224 }
michael@428 1225 }
michael@428 1226
michael@428 1227 # determine contained XML/RDF indices
michael@428 1228 if ($sub) {
michael@428 1229 @include = map {
michael@428 1230 goodpf($_->{platform}, $pfmatch)
michael@428 1231 ? ( $_->{href} )
michael@428 1232 : ( )
michael@428 1233 } @$sub;
michael@428 1234 }
michael@428 1235
michael@428 1236 # return contained XML/RDF indices
michael@428 1237 return \@include;
michael@428 1238 }
michael@428 1239
michael@428 1240 # convert XML parser output to dependency records
michael@428 1241 sub depend_list ($) {
michael@428 1242 my ($dl) = @_;
michael@428 1243 foreach (@$dl) {
michael@428 1244 $_->{value} = parse_depends($_->{value});
michael@428 1245 }
michael@428 1246 return $dl;
michael@428 1247 }
michael@428 1248
michael@428 1249 # convert simple XML parser Bag into flat list
michael@428 1250 sub swith ($$) {
michael@428 1251 my ($bags,$name) = @_;
michael@428 1252 my ($cond);
michael@428 1253 my (@out);
michael@428 1254
michael@428 1255 foreach $cond (keys %$bags) {
michael@428 1256 foreach (@{$bags->{$cond}->{$name}}) {
michael@428 1257 push @out, {
michael@428 1258 cond => $cond,
michael@428 1259 value => $_
michael@428 1260 };
michael@428 1261 }
michael@428 1262 }
michael@428 1263 return \@out;
michael@428 1264 }
michael@428 1265
michael@428 1266 # convert (conditional) XML/RDF Bag into flat list
michael@428 1267 sub xwith ($) {
michael@428 1268 my ($bags) = @_;
michael@428 1269 my ($bag, $li, $el);
michael@428 1270 my (@out);
michael@428 1271
michael@428 1272 foreach $bag (@$bags) {
michael@428 1273 foreach $li (@{$bag->{'rdf:bag'}}) {
michael@428 1274 $el = $li->{'resource'} || $li->{'rdf:li'};
michael@428 1275 foreach (@$el) {
michael@428 1276 push @out, {
michael@428 1277 cond => $bag->{'cond'},
michael@428 1278 value => $_
michael@428 1279 };
michael@428 1280 }
michael@428 1281 }
michael@428 1282 }
michael@428 1283 return \@out;
michael@428 1284 }
michael@428 1285
michael@428 1286 # return node value from XML parser
michael@428 1287 sub xel($) {
michael@428 1288 my ($a) = @_;
michael@428 1289 my ($l) = $a->[0];
michael@428 1290 return '' if ref($l);
michael@428 1291 return $l;
michael@428 1292 }
michael@428 1293
michael@428 1294 # is the platform a good one?
michael@428 1295 sub goodpf ($$) {
michael@428 1296 my ($l, $p) = @_;
michael@428 1297 return 1 if $l eq '';
michael@428 1298 return ($l =~ m/(?:^|\s)\Q$p\E(?:\s|$)/);
michael@428 1299 }
michael@428 1300
michael@428 1301
michael@428 1302 #############################################################################
michael@428 1303 ##
michael@428 1304 ## FUNCTIONS: HELPER FUNCTIONS FOR XML PARSING & DEPENDENCY PROCESSING
michael@428 1305 ##
michael@428 1306 #############################################################################
michael@428 1307
michael@428 1308 # parse option from RPM output
michael@428 1309 # < "%option with_foo bar"
michael@428 1310 # > $with{"with_foo"} = "bar"
michael@428 1311 sub parse_options ($) {
michael@428 1312 my ($l) = @_;
michael@428 1313 $l = join("\n", @$l) if (ref($l));
michael@428 1314 return {} if ($l !~ m/(--define|\%option\s+)/s);
michael@428 1315 my $with = {};
michael@428 1316 $l =~ s/--define\s*'(\S+)\s+(\S+?)'/$with->{$1} = $2, ''/sge; # before openpkg-20021230
michael@428 1317 $l =~ s/\%option\s+(\S+)\s+(\S+)/$with->{$1} = $2, ''/sge; # after openpkg-20021230
michael@428 1318 return $with;
michael@428 1319 }
michael@428 1320
michael@428 1321 # fetch targets of a name that satisfy a condition and sort by target
michael@428 1322 # version. Input is a hash of versions(?) on which the condition has
michael@428 1323 # to be true and which points to an array of records with package
michael@428 1324 # version information. Output is the list of version sorted package
michael@428 1325 # version information records.
michael@428 1326 sub get_targets ($$) {
michael@428 1327 my ($relmap, $cond) = @_;
michael@428 1328 return (
michael@428 1329 sort {
michael@428 1330 vcmp(vs($a), vs($b));
michael@428 1331 } map {
michael@428 1332 @{$relmap->{$_}}
michael@428 1333 } grep {
michael@428 1334 $cond->($_);
michael@428 1335 } keys %$relmap
michael@428 1336 );
michael@428 1337 }
michael@428 1338
michael@428 1339 #############################################################################
michael@428 1340 ##
michael@428 1341 ## FUNCTIONS: DEPENDENCY PROCESSING
michael@428 1342 ##
michael@428 1343 #############################################################################
michael@428 1344
michael@428 1345 # search environment for packages that match a pattern
michael@428 1346 sub search_pattern ($$) {
michael@428 1347 my ($pattern, $env) = @_;
michael@428 1348 my (@todo);
michael@428 1349
michael@428 1350 if (defined($pattern)) {
michael@428 1351 # explicitly given package pattern
michael@428 1352 @todo = map {
michael@428 1353 my ($p) = $_;
michael@428 1354 my ($s, $iswildcard);
michael@428 1355 $s = $1 if ($p =~ s/(,[^\s,]+)$//);
michael@428 1356 if ($p =~ s/\*+$//) {
michael@428 1357 $p = '^'.quotemeta($p).'';
michael@428 1358 $iswildcard = 1;
michael@428 1359 } else {
michael@428 1360 $p = '^'.quotemeta($p).'$';
michael@428 1361 }
michael@428 1362 map { "$_$s" }
michael@428 1363 grep { m/$p/ && !($iswildcard && exists($env->{exclude}->{$_})) }
michael@428 1364 keys %{$env->{repository}}
michael@428 1365 } split(/\s+/, $pattern);
michael@428 1366 } else {
michael@428 1367 # undefined pattern means "-a" option that selects
michael@428 1368 # all packages from repository that are installed
michael@428 1369 # and not explicitly excluded on command line
michael@428 1370 @todo = grep {
michael@428 1371 my ($n) = $_;
michael@428 1372 (ref($env->{installed}->{$n}))
michael@428 1373 && !exists($env->{exclude}->{$n})
michael@428 1374 && grep { $_ ne '-' } keys %{$env->{installed}->{$n}}
michael@428 1375 } keys(%{$env->{repository}});
michael@428 1376 }
michael@428 1377 return \@todo;
michael@428 1378 }
michael@428 1379
michael@428 1380 # pull in OPTIONS for a package or an RPM file
michael@428 1381 my $get_with_cache = {};
michael@428 1382 sub get_with ($;$) {
michael@428 1383 my ($t, $fn) = @_;
michael@428 1384 my (@l, %with);
michael@428 1385 my ($optmap, $opt);
michael@428 1386
michael@428 1387 if ($t->{OPTIONS}) {
michael@428 1388 $opt = $t->{OPTIONS};
michael@428 1389 } else {
michael@428 1390 if (defined($fn)) {
michael@428 1391 @l = run($config->{"rpm"} . " -q --provides -p $fn");
michael@428 1392 } else {
michael@428 1393 if (not exists($get_with_cache->{-provides})) {
michael@428 1394 # pre-cache the "provides" query for all(!) packages at once for speedup
michael@428 1395 my @c = run($config->{"rpm"} . " -qa --qf " .
michael@428 1396 '\'%{NAME}[ :::%{PROVIDENAME}:::%{PROVIDEFLAGS:depflags}:::%{PROVIDEVERSION}:::]\n\'');
michael@428 1397 $get_with_cache->{-provides} = {};
michael@428 1398 foreach my $c (@c) {
michael@428 1399 if ($c =~ m/^(\S+)(.*)$/s) {
michael@428 1400 my ($name, $provides) = ($1, $2);
michael@428 1401 while ($provides =~ m/\s+:::(.+?):::\s*(.*?)\s*:::(.*?):::/g) {
michael@428 1402 $get_with_cache->{-provides}->{$name} = [] if (not exists($get_with_cache->{-provides}->{$name}));
michael@428 1403 push(@{$get_with_cache->{-provides}->{$name}}, "$1 $2 $3");
michael@428 1404 }
michael@428 1405 }
michael@428 1406 }
michael@428 1407 }
michael@428 1408 @l = $get_with_cache->{-provides}->{$t->{name}};
michael@428 1409 if (not @l) {
michael@428 1410 # (should not happen in practice, but anyway)
michael@428 1411 @l = run($config->{"rpm"} . " -q --provides $t->{name}");
michael@428 1412 $get_with_cache->{-provides}->{$t->{name}} = [ @l ];
michael@428 1413 }
michael@428 1414 }
michael@428 1415 $opt = parse_provideslist(\@l);
michael@428 1416 if (scalar(keys(%$opt)) == 0) {
michael@428 1417 if (defined($fn)) {
michael@428 1418 @l = run($config->{"rpm"} . " -qi -p $fn");
michael@428 1419 } else {
michael@428 1420 if (not exists($get_with_cache->{-infos})) {
michael@428 1421 # pre-cache the "infos" query for all(!) packages at once for speedup
michael@428 1422 my @c = run($config->{"rpm"} . " -qi -a");
michael@428 1423 my $p = "";
michael@428 1424 $get_with_cache->{-infos} = {};
michael@428 1425 foreach my $c (@c) {
michael@428 1426 $p = $1 if ($c =~ m/^Name:\s+(\S+)/s);
michael@428 1427 $get_with_cache->{-infos}->{$p} = [] if (not exists($get_with_cache->{-infos}->{$p}));
michael@428 1428 push(@{$get_with_cache->{-infos}->{$p}}, $c);
michael@428 1429 }
michael@428 1430 }
michael@428 1431 @l = $get_with_cache->{-infos}->{$t->{name}};
michael@428 1432 if (not @l) {
michael@428 1433 # (should not happen in practice, but anyway)
michael@428 1434 @l = run($config->{"rpm"} . " -qi $t->{name}");
michael@428 1435 $get_with_cache->{-infos}->{$t->{name}} = [ @l ];
michael@428 1436 }
michael@428 1437 }
michael@428 1438 $opt = parse_options(\@l);
michael@428 1439 }
michael@428 1440 $t->{OPTIONS} = $opt;
michael@428 1441 }
michael@428 1442 return $opt;
michael@428 1443 }
michael@428 1444
michael@428 1445 # copy options from new to old
michael@428 1446 # where option already exists in old or option key
michael@428 1447 # matches regular expression
michael@428 1448 sub override_options ($$$) {
michael@428 1449 my ($old, $new, $reg) = @_;
michael@428 1450 my ($k);
michael@428 1451
michael@428 1452 foreach $k (keys(%$new)) {
michael@428 1453 if ((exists($old->{$k}) && $old->{$k} ne $new->{$k}) || $k =~ m/^$reg$/) {
michael@428 1454 $old->{$k} = $new->{$k};
michael@428 1455 }
michael@428 1456 }
michael@428 1457 }
michael@428 1458
michael@428 1459 # filter package options
michael@428 1460 sub filter_name_with ($$$) {
michael@428 1461 my ($name, $with, $global) = @_;
michael@428 1462 my (@keys);
michael@428 1463
michael@428 1464 if ($global) {
michael@428 1465 push(@keys, grep { !/::/ } keys %$with);
michael@428 1466 }
michael@428 1467 push(@keys, grep { m/::/ } keys %$with);
michael@428 1468 return {
michael@428 1469 map {
michael@428 1470 my ($k) = $_;
michael@428 1471 $k !~ m/::/ || $k =~ s/^\Q$name\E:://
michael@428 1472 ? ( $k => $with->{$_} )
michael@428 1473 : ( )
michael@428 1474 } @keys
michael@428 1475 };
michael@428 1476 }
michael@428 1477
michael@428 1478 # filter out package relevant options
michael@428 1479 sub name_with ($$) {
michael@428 1480 filter_name_with($_[0], $_[1], 1);
michael@428 1481 }
michael@428 1482
michael@428 1483 # filter out package specific options
michael@428 1484 sub name_only_with ($$) {
michael@428 1485 filter_name_with($_[0], $_[1], 0);
michael@428 1486 }
michael@428 1487
michael@428 1488 # evaluate a condition attribute from an option set
michael@428 1489 sub conditional ($$) {
michael@428 1490 my ($cond, $with) = @_;
michael@428 1491 my (@s, $res);
michael@428 1492
michael@428 1493 return 1 if ($cond eq '' || !defined($with));
michael@428 1494 foreach (split(/\s+/,$cond)) {
michael@428 1495 if ($_ eq '+') {
michael@428 1496 die "openpkg:build:FATAL: stack underflow in: $cond\n" if scalar(@s) < 2;
michael@428 1497 my ($a) = pop(@s);
michael@428 1498 my ($b) = pop(@s);
michael@428 1499 push(@s, $a && $b);
michael@428 1500 } elsif ($_ eq '|') {
michael@428 1501 die "openpkg:build:FATAL: stack underflow in: $cond\n" if scalar(@s) < 2;
michael@428 1502 my ($a) = pop(@s);
michael@428 1503 my ($b) = pop(@s);
michael@428 1504 push(@s, $a || $b);
michael@428 1505 } elsif ($_ eq '!') {
michael@428 1506 die "openpkg:build:FATAL: stack underflow in: $cond\n" if scalar(@s) < 1;
michael@428 1507 my ($a) = pop(@s);
michael@428 1508 push(@s, !$a);
michael@428 1509 } else {
michael@428 1510 push(@s, ($with->{$_} eq 'yes') ? 1 : 0);
michael@428 1511 }
michael@428 1512 }
michael@428 1513 die "openpkg:build:FATAL: stack underflow in: $cond\n" if scalar(@s) < 1;
michael@428 1514 $res = pop(@s);
michael@428 1515
michael@428 1516 die "openpkg:build:FATAL: stack not empty in: $cond\n" if scalar(@s) > 0;
michael@428 1517 return $res;
michael@428 1518 }
michael@428 1519
michael@428 1520 # retrieve conditional target attributes in map
michael@428 1521 sub target_attribute ($$$;$) {
michael@428 1522 my ($target, $env, $attr, $with) = @_;
michael@428 1523 my ($optreg) = $env->{config}->{optreg};
michael@428 1524 my ($name, @out);
michael@428 1525
michael@428 1526 return if (not $target);
michael@428 1527 $name = $target->{name};
michael@428 1528
michael@428 1529 my ($mywith) = ($with ? $with : get_with($target));
michael@428 1530 override_options($mywith, name_with($name, $env->{with}), $optreg);
michael@428 1531
michael@428 1532 foreach (@{$target->{$attr}}) {
michael@428 1533 next if (not conditional($_->{'cond'}, $mywith));
michael@428 1534 push(@out, $_->{'value'});
michael@428 1535 }
michael@428 1536 return \@out;
michael@428 1537 }
michael@428 1538
michael@428 1539 # see whether target is in map
michael@428 1540 sub target_exists ($$) {
michael@428 1541 my ($target, $map) = @_;
michael@428 1542 my ($vmap) = $map->{$target->{name}};
michael@428 1543 return if (not $vmap);
michael@428 1544 return (
michael@428 1545 !defined $target->{version}
michael@428 1546 || defined $vmap->{vs($target)}
michael@428 1547 );
michael@428 1548 }
michael@428 1549
michael@428 1550 # see whether target has conflicts
michael@428 1551 sub target_conflicts ($$) {
michael@428 1552 my ($target, $env) = @_;
michael@428 1553 return target_attribute($target, $env, 'conflicts');
michael@428 1554 }
michael@428 1555
michael@428 1556 # retrieve build dependencies for target
michael@428 1557 sub target_depends ($$) {
michael@428 1558 my ($target, $env) = @_;
michael@428 1559 return target_attribute($target, $env, 'depends');
michael@428 1560 }
michael@428 1561
michael@428 1562 # retrieve runtime dependencies for target
michael@428 1563 sub target_keeps ($$) {
michael@428 1564 my ($target, $env) = @_;
michael@428 1565 return target_attribute($target, $env, 'keeps');
michael@428 1566 }
michael@428 1567
michael@428 1568 # retrieve source list for target
michael@428 1569 sub target_source ($$) {
michael@428 1570 my ($target, $env) = @_;
michael@428 1571 return target_attribute($target, $env, 'source');
michael@428 1572 }
michael@428 1573
michael@428 1574 # retrieve nosource list for target
michael@428 1575 sub target_nosource ($$) {
michael@428 1576 my ($target, $env) = @_;
michael@428 1577 return target_attribute($target, $env, 'nosource');
michael@428 1578 }
michael@428 1579
michael@428 1580 # check whether target conflicts against map
michael@428 1581 sub target_has_conflicts ($$$) {
michael@428 1582 my ($target, $map, $env) = @_;
michael@428 1583 my ($conflicts, $t);
michael@428 1584
michael@428 1585 $conflicts = target_conflicts($target, $env);
michael@428 1586 foreach (@$conflicts) {
michael@428 1587 my ($t) = find_target($_, $map, 0);
michael@428 1588 return $t if $t;
michael@428 1589 }
michael@428 1590 return;
michael@428 1591 }
michael@428 1592
michael@428 1593 # record target status
michael@428 1594 sub target_setstatus ($$$) {
michael@428 1595 my ($target, $status, $pri) = @_;
michael@428 1596
michael@428 1597 if ($pri > $target->{STATUSPRI}) {
michael@428 1598 $target->{STATUSPRI} = $pri;
michael@428 1599 $target->{STATUS} = $status;
michael@428 1600 }
michael@428 1601 }
michael@428 1602
michael@428 1603 # strip doubles from depend/keep lists
michael@428 1604 # and return a map name => depend/keep
michael@428 1605 sub unique_map {
michael@428 1606 my (%out);
michael@428 1607 foreach (@_) {
michael@428 1608 foreach (@$_) {
michael@428 1609 $out{$_->{name}} = $_;
michael@428 1610 }
michael@428 1611 }
michael@428 1612 return %out;
michael@428 1613 }
michael@428 1614
michael@428 1615 # check whether installed package matches build options. If default
michael@428 1616 # = 1 then options which are not required must be identical to the
michael@428 1617 # DEFOPTS.
michael@428 1618 sub target_suitable ($$$) {
michael@428 1619 my ($target, $with, $default) = @_;
michael@428 1620 my ($iwith, $dwith);
michael@428 1621 my ($k, $v);
michael@428 1622
michael@428 1623 if ($target->{GOAL}) {
michael@428 1624 $with = name_with($target->{name}, $with);
michael@428 1625 } else {
michael@428 1626 $with = name_only_with($target->{name}, $with);
michael@428 1627 }
michael@428 1628 $iwith = $target->{OPTIONS};
michael@428 1629 $dwith = $target->{DEFOPTS};
michael@428 1630 while (($k,$v) = each(%$iwith)) {
michael@428 1631 if (exists($with->{$k})) {
michael@428 1632 return 0 if ($iwith->{$k} ne $with->{$k});
michael@428 1633 } elsif ($default) {
michael@428 1634 return 0 if ($iwith->{$k} ne $dwith->{$k});
michael@428 1635 }
michael@428 1636 }
michael@428 1637 return 1;
michael@428 1638 }
michael@428 1639
michael@428 1640 # determine whether target should be rebuild
michael@428 1641 sub target_better ($$$) {
michael@428 1642 my ($env, $target, $map) = @_;
michael@428 1643 my ($vs) = vs($target);
michael@428 1644 my ($vmap) = $map->{$target->{name}};
michael@428 1645
michael@428 1646 # rebuild if target isn't installed
michael@428 1647 return 'new' unless $vmap;
michael@428 1648
michael@428 1649 # if "-e" then
michael@428 1650 # always update if installed version is different from repository
michael@428 1651 if ($env->{exact} && !grep { vcmp($vs, $_) == 0; } keys(%$vmap)) {
michael@428 1652 return 'exact';
michael@428 1653 }
michael@428 1654
michael@428 1655 # if target is goal
michael@428 1656 # always update if installed version is older than repository
michael@428 1657 if ($target->{GOAL} && !grep { vcmp($vs, $_) <= 0; } keys(%$vmap)) {
michael@428 1658 return 'goal';
michael@428 1659 }
michael@428 1660
michael@428 1661 # if -U then
michael@428 1662 # always update if installed version is older than repository
michael@428 1663 if ($env->{upgrade} && !grep { vcmp($vs, $_) <= 0; } keys(%$vmap)) {
michael@428 1664 return 'upgrade';
michael@428 1665 }
michael@428 1666
michael@428 1667 # if -z/-Z then
michael@428 1668 # always update if installed version is equal or older than repository
michael@428 1669 if ($env->{zero} && grep { vcmp($vs, $_) >= 0; } keys(%$vmap)) {
michael@428 1670 return 'zero';
michael@428 1671 }
michael@428 1672
michael@428 1673 # keep installed target
michael@428 1674 return;
michael@428 1675 }
michael@428 1676
michael@428 1677 # check if target record describes a source package
michael@428 1678 sub is_source ($) {
michael@428 1679 my ($t) = @_;
michael@428 1680 return !(defined $t->{'prefix'});
michael@428 1681 }
michael@428 1682
michael@428 1683 # there can be multiple sources for a target release
michael@428 1684 sub chose_source ($$$$$) {
michael@428 1685 my ($env, $name, $select, $vmap, $cond) = @_;
michael@428 1686 my (@targ, @recs, @nrecs, $rec, %nam);
michael@428 1687
michael@428 1688 # resolve name into a list of versions
michael@428 1689 # for virtual targets this resolves to a list
michael@428 1690 # of real targets that provide the virtual target
michael@428 1691 @targ = get_targets($vmap, sub { 1; });
michael@428 1692 return unless @targ;
michael@428 1693
michael@428 1694 # find usable binary targets add all source targets
michael@428 1695 @recs = (
michael@428 1696 ( grep {
michael@428 1697 !$env->{sourceonly}
michael@428 1698 && !is_source($_)
michael@428 1699 && $_->{'platform'} eq $env->{config}->{platform}
michael@428 1700 && $_->{'prefix'} eq $env->{config}->{prefix}
michael@428 1701 } get_targets($vmap, $cond) ),
michael@428 1702 ( grep {
michael@428 1703 is_source($_)
michael@428 1704 } @targ )
michael@428 1705 );
michael@428 1706 return if (not @recs);
michael@428 1707
michael@428 1708 # limit list to exact matches if provided by "-e"
michael@428 1709 if (defined($select)) {
michael@428 1710 @recs = grep {
michael@428 1711 vsn($_) =~ m/^\Q$select\E/
michael@428 1712 } @recs;
michael@428 1713 }
michael@428 1714
michael@428 1715 # try to resolve ambiguity against installed targets
michael@428 1716 # and targets previously selected
michael@428 1717 if (scalar(@recs) > 1) {
michael@428 1718 @nrecs = grep {
michael@428 1719 $env->{built}->{$_->{name}}
michael@428 1720 || $env->{installed}->{$_->{name}}
michael@428 1721 } @recs;
michael@428 1722 @recs = @nrecs if (@nrecs);
michael@428 1723 }
michael@428 1724
michael@428 1725 # try to resolve ambiguity against hints
michael@428 1726 if ($env->{hint}) {
michael@428 1727 @nrecs = grep {
michael@428 1728 exists($env->{hint}->{$_->{name}})
michael@428 1729 } @recs;
michael@428 1730 @recs = @nrecs if (@nrecs);
michael@428 1731 }
michael@428 1732
michael@428 1733 # try to resolve ambiguity against targets that match
michael@428 1734 # the exact name
michael@428 1735 if (scalar(@recs) > 1) {
michael@428 1736 @nrecs = grep {
michael@428 1737 $name eq $_->{name}
michael@428 1738 } @recs;
michael@428 1739 @recs = @nrecs if (@nrecs);
michael@428 1740 }
michael@428 1741
michael@428 1742 # try to resolve ambiguity by preferring binaries
michael@428 1743 if (scalar(@recs) > 1 && !$env->{sourceonly}) {
michael@428 1744 @nrecs = grep {
michael@428 1745 defined($_->{'platform'})
michael@428 1746 } @recs;
michael@428 1747 @recs = @nrecs if (@nrecs);
michael@428 1748 }
michael@428 1749
michael@428 1750 # if we still have non-unique targets, complain
michael@428 1751 if (scalar(@recs) > 1) {
michael@428 1752 %nam = map { $_->{name} => 1 } @recs;
michael@428 1753 if (scalar(keys(%nam)) > 1) {
michael@428 1754 print "# ambigous sources for $name\n";
michael@428 1755 my ($i) = 0;
michael@428 1756 foreach (@recs) {
michael@428 1757 print "# $i: ".vsn($_)." = $_->{href}\n";
michael@428 1758 $i++;
michael@428 1759 }
michael@428 1760 return;
michael@428 1761 }
michael@428 1762 }
michael@428 1763
michael@428 1764 # prefer full-source packages
michael@428 1765 if (scalar(@recs) > 1) {
michael@428 1766 @nrecs = grep {
michael@428 1767 ! $_->{nosource}
michael@428 1768 || ! @{$_->{nosource}}
michael@428 1769 } @recs;
michael@428 1770 unless (@nrecs) {
michael@428 1771 @nrecs = grep {
michael@428 1772 $_->{href} !~ m/\.nosrc.rpm$/
michael@428 1773 } @recs;
michael@428 1774 }
michael@428 1775 @recs = @nrecs if (@nrecs);
michael@428 1776 }
michael@428 1777
michael@428 1778 # nothing left -> exit
michael@428 1779 return if (scalar(@recs) == 0);
michael@428 1780
michael@428 1781 # chose last (= max version) in list of targets
michael@428 1782 $rec = $recs[-1];
michael@428 1783 print "# source for $name is ".vsn($rec)."\n";
michael@428 1784 return $rec;
michael@428 1785 }
michael@428 1786
michael@428 1787 # locate target for a dependency
michael@428 1788 sub dep2target ($$$) {
michael@428 1789 my ($dep, $env, $source) = @_;
michael@428 1790 my ($name, $op, @targ);
michael@428 1791 my ($i, $r, $b, $cond, $version);
michael@428 1792 my ($t, $tdef, $why);
michael@428 1793
michael@428 1794 ($name, $op, $version) = ($dep->{name}, $dep->{op}, $dep->{val});
michael@428 1795
michael@428 1796 $i = $env->{installed}->{$name};
michael@428 1797 $r = $env->{repository}->{$name};
michael@428 1798 $b = $env->{built}->{$name};
michael@428 1799
michael@428 1800 return if (not ($i || $r || $b));
michael@428 1801
michael@428 1802 if (!defined($op)) {
michael@428 1803 $cond = sub { 1; };
michael@428 1804 } elsif ($op eq 'geq') {
michael@428 1805 $cond = sub { vcmp($_[0],$version) >= 0; };
michael@428 1806 } elsif ($op eq 'leq') {
michael@428 1807 $cond = sub { vcmp($_[0],$version) <= 0; };
michael@428 1808 } elsif ($op eq 'gt') {
michael@428 1809 $cond = sub { vcmp($_[0],$version) > 0; };
michael@428 1810 } elsif ($op eq 'lt') {
michael@428 1811 $cond = sub { vcmp($_[0],$version) < 0; };
michael@428 1812 } elsif ($op eq 'equ') {
michael@428 1813 $cond = sub { vcmp($_[0],$version) == 0; };
michael@428 1814 } else {
michael@428 1815 die "openpkg:build:FATAL: internal error in dep2target\n";
michael@428 1816 }
michael@428 1817
michael@428 1818 $tdef = undef;
michael@428 1819
michael@428 1820 # search installed target that matches requirement
michael@428 1821 # use it if we are not upgrading (no -U and no -z/-Z)
michael@428 1822 if ($i && (@targ = get_targets($i, $cond))) {
michael@428 1823 foreach $t (@targ) {
michael@428 1824 get_with($t);
michael@428 1825 if (target_suitable($t, $env->{with}, 0)) {
michael@428 1826 $tdef = $t;
michael@428 1827 if (not ($env->{upgrade} || $env->{zero} || $source)) {
michael@428 1828 return ($t, 1);
michael@428 1829 }
michael@428 1830 }
michael@428 1831 }
michael@428 1832 }
michael@428 1833
michael@428 1834 # search target in current build list that matches requirement
michael@428 1835 # use it if it exists
michael@428 1836 if ($b && (@targ = get_targets($b, $cond))) {
michael@428 1837 $t = $targ[0];
michael@428 1838 return ($t, 1);
michael@428 1839 }
michael@428 1840
michael@428 1841 # search target in repository and install it, if it is newer than
michael@428 1842 # corresponding installed versions avoid repository packages that
michael@428 1843 # would install 'new' (i.e. are not an upgrade of an existing
michael@428 1844 # package)
michael@428 1845 $t = chose_source($env, $name, undef, $r, $cond);
michael@428 1846 if ($t) {
michael@428 1847 if (!$tdef || (
michael@428 1848 ($why = target_better($env, $t, $env->{installed})) &&
michael@428 1849 $why ne 'new'
michael@428 1850 ) || $source) {
michael@428 1851 return ($t, 0);
michael@428 1852 }
michael@428 1853 }
michael@428 1854
michael@428 1855 # if nothing is suitable in repository then fall back to
michael@428 1856 # anything we already have installed but that we skipped
michael@428 1857 # above to look for upgrades.
michael@428 1858 if ($tdef) {
michael@428 1859 return ($tdef, 1);
michael@428 1860 }
michael@428 1861
michael@428 1862 return;
michael@428 1863 }
michael@428 1864
michael@428 1865 # compute reverse dependency map
michael@428 1866 sub get_revdep ($) {
michael@428 1867 my ($env) = @_;
michael@428 1868 my ($i) = $env->{'installed'};
michael@428 1869 my ($r) = $env->{'repository'};
michael@428 1870 my ($pkg, %dep, %dlist, %rev);
michael@428 1871 my (@targ, $t, $t1, $t2, $with, $name, $vmap);
michael@428 1872 my ($d, $k, %d, $old, %name, %pkg);
michael@428 1873
michael@428 1874 print "# computing reverse dependencies\n";
michael@428 1875
michael@428 1876 # iterate over all installed packages
michael@428 1877 foreach $pkg (keys(%$i)) {
michael@428 1878 $vmap = $r->{$pkg};
michael@428 1879 if (not $vmap) {
michael@428 1880 print "# ATTENTION: $pkg has no upgrade path (installed package not found in repository)\n";
michael@428 1881 next;
michael@428 1882 }
michael@428 1883
michael@428 1884 # get forward dependencies from installed packages
michael@428 1885 # dep{a}{b} is true if b depends directly on a
michael@428 1886 # dlist{a} is list of packages that depend on a
michael@428 1887 @targ = get_targets($i->{$pkg}, sub { 1; });
michael@428 1888 foreach $t (@targ) {
michael@428 1889 $with = get_with($t);
michael@428 1890 $d = target_attribute($t, $env, 'depends', $with);
michael@428 1891 $k = target_attribute($t, $env, 'keeps', $with);
michael@428 1892 next if (not (@$d || @$k));
michael@428 1893 %d = unique_map($d,$k);
michael@428 1894
michael@428 1895 # resolve package
michael@428 1896 if (not exists($pkg{$pkg})) {
michael@428 1897 ($t2, $old) = dep2target({ name => $pkg }, $env, 1);
michael@428 1898 $t2 = undef if ($old);
michael@428 1899 $pkg{$pkg} = $t2;
michael@428 1900 }
michael@428 1901 $t2 = $pkg{$pkg};
michael@428 1902 next if (not $t2);
michael@428 1903 foreach (keys(%d)) {
michael@428 1904 next if ($_ eq 'OpenPKG');
michael@428 1905 # resolve target
michael@428 1906 unless (exists($name{$_})) {
michael@428 1907 ($t1, $old) = dep2target($d{$_}, $env, 0);
michael@428 1908 $name{$_} = ($t1 ? $t1->{name} : $_);
michael@428 1909 }
michael@428 1910 $name = $name{$_};
michael@428 1911 if (not $dep{$name}{$t->{name}}) {
michael@428 1912 $dep{$name}{$t->{name}} = 1;
michael@428 1913 push(@{$dlist{$name}}, $t2);
michael@428 1914 }
michael@428 1915 }
michael@428 1916 }
michael@428 1917 }
michael@428 1918
michael@428 1919 # sort reverse dependencies
michael@428 1920 foreach $pkg (keys(%dep)) {
michael@428 1921 $rev{$pkg} = [
michael@428 1922 sort {
michael@428 1923 $dep{$b->{name}}{$a->{name}}
michael@428 1924 || -$dep{$a->{name}}{$b->{name}}
michael@428 1925 || $a->{name} cmp $b->{name}
michael@428 1926 } @{$dlist{$pkg}}
michael@428 1927 ];
michael@428 1928 }
michael@428 1929
michael@428 1930 # return hash of package reverse dependencies
michael@428 1931 return \%rev;
michael@428 1932 }
michael@428 1933
michael@428 1934 # build package dependencies
michael@428 1935 # (all input and output is passed in 'env' hash)
michael@428 1936 sub build_deps ($$) {
michael@428 1937 my ($pattern, $env) = @_;
michael@428 1938 my ($todo, @list, $list, @out);
michael@428 1939
michael@428 1940 # determine all packages which match the pattern
michael@428 1941 $todo = search_pattern($pattern, $env);
michael@428 1942
michael@428 1943 # unfold target names into all(!) real targets names
michael@428 1944 @list =
michael@428 1945 map {
michael@428 1946 map {
michael@428 1947 map {
michael@428 1948 $_->{name}
michael@428 1949 } @$_
michael@428 1950 } values(%{$env->{repository}->{$_}})
michael@428 1951 } @$todo;
michael@428 1952
michael@428 1953 # also add target name
michael@428 1954 push @list, @$todo;
michael@428 1955
michael@428 1956 # strip duplicate names
michael@428 1957 @list = keys %{ { map { $_ => 1 } @list } };
michael@428 1958
michael@428 1959 # cache reverse dependencies
michael@428 1960 if (not $env->{revdep}) {
michael@428 1961 $env->{revdep} = get_revdep($env);
michael@428 1962 }
michael@428 1963
michael@428 1964 # map targets into list of dependency names
michael@428 1965 @list = map {
michael@428 1966 $env->{revdep}->{$_}
michael@428 1967 ? (@{$env->{revdep}->{$_}})
michael@428 1968 : ()
michael@428 1969 } @list;
michael@428 1970
michael@428 1971 # iterate over dependencies
michael@428 1972 foreach (@list) {
michael@428 1973 # avoiding cycles
michael@428 1974 next if ($env->{builddeps}->{$_->{name}});
michael@428 1975 $env->{builddeps}->{$_->{name}} = 1;
michael@428 1976
michael@428 1977 # generate result
michael@428 1978 push(@out, $_);
michael@428 1979
michael@428 1980 # generate result recursively
michael@428 1981 $list = build_deps($_->{name}, $env); # RECURSION
michael@428 1982 push(@out, @$list);
michael@428 1983 }
michael@428 1984
michael@428 1985 # return final results
michael@428 1986 return \@out;
michael@428 1987 }
michael@428 1988
michael@428 1989 # report options that are not used for
michael@428 1990 sub warn_about_options ($$$) {
michael@428 1991 my ($target, $with, $c) = @_;
michael@428 1992 my ($iwith) = $target->{OPTIONS};
michael@428 1993 my ($k, $v);
michael@428 1994
michael@428 1995 return if (not defined($iwith));
michael@428 1996 $with = name_with($target->{name}, $with);
michael@428 1997 while (($k,$v) = each %$with) {
michael@428 1998 if (not ($k =~ m/^$c->{optreg}$/ || exists $iwith->{$k})) {
michael@428 1999 print "# ATTENTION: $target->{name} ignores option '$k'\n";
michael@428 2000 }
michael@428 2001 }
michael@428 2002 }
michael@428 2003
michael@428 2004 # find target in map
michael@428 2005 sub find_target ($$$) {
michael@428 2006 my ($name, $map, $pos) = @_;
michael@428 2007 my ($vmap) = $map->{$name};
michael@428 2008 my (@vs);
michael@428 2009
michael@428 2010 return if (not $vmap);
michael@428 2011 @vs = sort { vcmp($b,$a) } keys(%$vmap);
michael@428 2012 return $vmap->{$vs[$pos]}->[-1];
michael@428 2013 }
michael@428 2014
michael@428 2015 # add dependency as build option
michael@428 2016 sub depend_option ($$$) {
michael@428 2017 my ($target, $dep, $env) = @_;
michael@428 2018 my ($with, $opt, $relmap, @t, $t);
michael@428 2019 my ($pro) = depends2provides($dep);
michael@428 2020 my ($conflict) = 0;
michael@428 2021
michael@428 2022 return 1 if (not defined($pro->{with}));
michael@428 2023
michael@428 2024 my ($val) = defined($pro->{version}) ? $pro->{version} : 'yes';
michael@428 2025
michael@428 2026 $with = $env->{with};
michael@428 2027 $opt = $pro->{prefix}.'::'.$pro->{with};
michael@428 2028 if (defined($with->{$opt}) && $with->{$opt} ne $val) {
michael@428 2029 print "# ", vsn($target), " has conflicting requirement $opt = $with->{$opt} != $val\n";
michael@428 2030 $conflict = 1;
michael@428 2031 }
michael@428 2032
michael@428 2033 $relmap = $env->{built}->{$pro->{prefix}};
michael@428 2034 @t = get_targets($relmap, sub { 1; });
michael@428 2035 foreach $t (@t) {
michael@428 2036 $with = $t->{OPTIONS};
michael@428 2037 $opt = $pro->{with};
michael@428 2038 if (defined($with->{$opt}) && $with->{$opt} ne $val) {
michael@428 2039 print "# ", vsn($t), " has conflicting requirement $opt = $with->{$opt} != $val\n";
michael@428 2040 $conflict = 1;
michael@428 2041 }
michael@428 2042 }
michael@428 2043
michael@428 2044 return 0 if ($conflict);
michael@428 2045
michael@428 2046 print "# ", vsn($target), " adds option $opt = $val\n";
michael@428 2047 $with->{$opt} = $val;
michael@428 2048 return 1;
michael@428 2049 }
michael@428 2050
michael@428 2051 # remember fatal error
michael@428 2052 sub pusherr ($$$) {
michael@428 2053 my ($env, $target, $mess) = @_;
michael@428 2054 print "# $mess\n";
michael@428 2055 push(@{$env->{fatal}}, vsn($target).": $mess\n");
michael@428 2056 }
michael@428 2057
michael@428 2058 # generate dependencies
michael@428 2059 sub make_dep ($$$$$$$) {
michael@428 2060 my ($who, $target, $depth, $env, $list, $blist, $clist) = @_;
michael@428 2061 my ($d, $k, %d, %k, $t, $old);
michael@428 2062 my (@deps, $conflict, $why);
michael@428 2063
michael@428 2064 # check whether target is already in list of to be build packages
michael@428 2065 if (target_exists($target, $env->{built})) {
michael@428 2066 print "# $target->{name} is already in list\n";
michael@428 2067 return;
michael@428 2068 }
michael@428 2069
michael@428 2070 # check whether target is in conflict with already installed package
michael@428 2071 if ($t = target_has_conflicts($target, $env->{installed}, $env)) {
michael@428 2072 target_setstatus($target, 'CONFLICT', 4);
michael@428 2073 push(@$clist, $target);
michael@428 2074 pusherr($env, $target, "$target->{name} conflicts with ".vsn($t));
michael@428 2075 return;
michael@428 2076 }
michael@428 2077
michael@428 2078 # check whether target is in conflict with to be build package
michael@428 2079 if ($t = target_has_conflicts($target, $env->{built}, $env)) {
michael@428 2080 target_setstatus($target, 'CONFLICT', 4);
michael@428 2081 push(@$clist, $target);
michael@428 2082 pusherr($env, $target, "$target->{name} conflicts with ".vsn($t));
michael@428 2083 return;
michael@428 2084 }
michael@428 2085
michael@428 2086 # see if a target is already installed and requires a rebuild
michael@428 2087 if ($t = find_target($target->{name}, $env->{installed}, -1)) {
michael@428 2088 if (exists($env->{exclude}->{$target->{name}})) {
michael@428 2089 print "# excluding $target->{name} (no upgrade allowed)\n";
michael@428 2090 return;
michael@428 2091 }
michael@428 2092
michael@428 2093 # pull in options (for status report)
michael@428 2094 if ($target->{REBUILD}) {
michael@428 2095 target_setstatus($target, 'DEPEND', 1);
michael@428 2096 print "# rebuilding $target->{name} (dependency)\n";
michael@428 2097 } elsif ($env->{zero}) {
michael@428 2098 target_setstatus($target, 'ZERO', 1);
michael@428 2099 print "# rebuilding $target->{name} (zero)\n";
michael@428 2100 } elsif (vs($target) ne vs($t)) {
michael@428 2101 target_setstatus($target, 'UPDATE', 3);
michael@428 2102 print "# rebuilding $target->{name} (update)\n";
michael@428 2103 } elsif (!target_suitable($t, $env->{with}, 0)) {
michael@428 2104 target_setstatus($target, 'MISMATCH', 2);
michael@428 2105 print "# rebuilding $target->{name} (parameter mismatch)\n";
michael@428 2106 } elsif ($env->{goals} && $target->{GOAL}) {
michael@428 2107 target_setstatus($target, 'GOAL', 3);
michael@428 2108 print "# rebuilding $target->{name} (goal)\n";
michael@428 2109 } else {
michael@428 2110 print "# $target->{name} is already installed\n";
michael@428 2111 return;
michael@428 2112 }
michael@428 2113
michael@428 2114 # use options from installed base
michael@428 2115 override_options(get_with($target), get_with($t), $env->{config}->{optreg});
michael@428 2116
michael@428 2117 # remember this is a rebuild for a proxy package
michael@428 2118 $target->{PROXY} = $t->{PROXY};
michael@428 2119 $target->{REBUILD} = 1;
michael@428 2120 } else {
michael@428 2121 print "# creating $target->{name}\n";
michael@428 2122 target_setstatus($target, 'ADD', 3);
michael@428 2123 }
michael@428 2124
michael@428 2125 if (exists($env->{exclude}->{$target->{name}})) {
michael@428 2126 die "openpkg:build:FATAL: target ".vsn($target)." is forbidden\n";
michael@428 2127 }
michael@428 2128
michael@428 2129 # mark this as a target before reverse dependencies trigger it again
michael@428 2130 push(@{$env->{built}->{$target->{name}}->{vs($target)}}, $target);
michael@428 2131 $target->{LIMBO} = 1;
michael@428 2132
michael@428 2133 # recurse over dependencies
michael@428 2134 $d = target_depends($target, $env);
michael@428 2135 $k = target_keeps($target, $env);
michael@428 2136 if (@$d || @$k) {
michael@428 2137 %d = unique_map($d, $k);
michael@428 2138 %k = unique_map($k);
michael@428 2139 @deps = ();
michael@428 2140 $conflict = 0;
michael@428 2141 foreach (keys %d) {
michael@428 2142 # old index misses a OpenPKG provider in the index... skip it
michael@428 2143 next if ($_ eq 'OpenPKG');
michael@428 2144 ($t, $old) = dep2target($d{$_}, $env, 0);
michael@428 2145 if ($t) {
michael@428 2146 if ($old) {
michael@428 2147 print "# $target->{name} uses ".vsn($t)." for $_\n";
michael@428 2148 if ($t->{LIMBO}) {
michael@428 2149 print "# ATTENTION: ".vsn($t)." is in LIMBO\n";
michael@428 2150 }
michael@428 2151 next;
michael@428 2152 }
michael@428 2153 if (not depend_option($t, $d{$_}, $env)) {
michael@428 2154 push(@$clist, $target);
michael@428 2155 pusherr($env, $target, "$target->{name} has conflicting requirement");
michael@428 2156 target_setstatus($target, 'UNDEF', 4);
michael@428 2157 $conflict = 1;
michael@428 2158 next;
michael@428 2159 }
michael@428 2160 if ($k{$_}) {
michael@428 2161 push(@$blist, $t);
michael@428 2162 print "# $target->{name} installs ".vsn($t)." for $_\n";
michael@428 2163 } else {
michael@428 2164 print "# $target->{name} requires ".vsn($t)." for $_\n";
michael@428 2165 }
michael@428 2166 push(@deps, $t);
michael@428 2167 } else {
michael@428 2168 push(@$clist, $target);
michael@428 2169 pusherr($env, $target, "$target->{name} searches a frood called '$_'");
michael@428 2170 target_setstatus($target, 'UNDEF', 4);
michael@428 2171 $conflict = 1;
michael@428 2172 }
michael@428 2173 }
michael@428 2174 if (not $conflict) {
michael@428 2175 foreach $t (@deps) {
michael@428 2176 make_dep($target, $t, $depth+1, $env, $list, $blist, $clist); # RECURSION
michael@428 2177 }
michael@428 2178 }
michael@428 2179 }
michael@428 2180
michael@428 2181 print "# adding ".vsn($target)." to list\n";
michael@428 2182 $target->{WHO} = $who;
michael@428 2183 $target->{WHY} = $target->{STATUS};
michael@428 2184 push(@$list, $target);
michael@428 2185
michael@428 2186 # remember new options
michael@428 2187 override_options(get_with($target), name_with($target->{name}, $env->{with}), '');
michael@428 2188
michael@428 2189 # moan about non-source packages
michael@428 2190 foreach (@{target_nosource($target, $env)}) {
michael@428 2191 my ($p) = target_source($target, $env)->[$_];
michael@428 2192 $p =~ s/.*\///;
michael@428 2193 print "# ATTENTION: unpackaged source $_: $p\n";
michael@428 2194 }
michael@428 2195
michael@428 2196 # cleanup limbo
michael@428 2197 $target->{LIMBO} = 0;
michael@428 2198
michael@428 2199 # a dependency could not be resolved, don't bother with reverse
michael@428 2200 # dependencies for this target
michael@428 2201 return if ($conflict);
michael@428 2202
michael@428 2203 if (!$env->{quick} && $target->{name} ne 'openpkg' ) {
michael@428 2204 if (not $env->{revdep}) {
michael@428 2205 $env->{revdep} = get_revdep($env);
michael@428 2206 }
michael@428 2207 foreach $t (@{$env->{revdep}->{$target->{name}}}) {
michael@428 2208 # this is a rebuild, triggering further revdeps
michael@428 2209 $t->{REBUILD} = 1;
michael@428 2210
michael@428 2211 # this is a rebuild, keep this installed
michael@428 2212 push(@$blist, $t);
michael@428 2213
michael@428 2214 print "# rebuilding reverse dependency ".vsn($t)."\n";
michael@428 2215 make_dep($target, $t, $depth+1, $env, $list, $blist, $clist); # RECURSION
michael@428 2216 }
michael@428 2217 }
michael@428 2218 }
michael@428 2219
michael@428 2220 # generate build lists for targets matched by pattern
michael@428 2221 # (all input and output is passed in 'env' hash)
michael@428 2222 sub build_list ($$) {
michael@428 2223 my ($pattern, $env) = @_;
michael@428 2224 my (@goals, @targets, @keeps, @conflicts, @bonly, $t);
michael@428 2225 my ($name, $select, $r, $i);
michael@428 2226 my ($todo, %keep);
michael@428 2227
michael@428 2228 # determine all packages which match the pattern
michael@428 2229 $todo = search_pattern($pattern, $env);
michael@428 2230
michael@428 2231 # chose sources for goals from repository
michael@428 2232 foreach $name (@$todo) {
michael@428 2233 $select = undef;
michael@428 2234 $select = $1 if ($name =~ s/,([^\s,]+)$//);
michael@428 2235 $t = undef;
michael@428 2236
michael@428 2237 # keeping installed packages for goals is ugly
michael@428 2238 # - we currently do not support installed source RPMs
michael@428 2239 # - source RPMs might already have expired from repository
michael@428 2240 # consequence:
michael@428 2241 # - goals are always upgraded to repository versions
michael@428 2242 #if (not $env->{upgrade}) {
michael@428 2243 # $i = $env->{installed}->{$name};
michael@428 2244 # $t = chose_source($env, $name, $select, $i, sub { 1; });
michael@428 2245 #}
michael@428 2246 if (not $t) {
michael@428 2247 $r = $env->{repository}->{$name};
michael@428 2248 $t = chose_source($env, $name, $select, $r, sub { 1; });
michael@428 2249 }
michael@428 2250
michael@428 2251 if ($t) {
michael@428 2252 warn_about_options($t, $env->{with}, $env->{config});
michael@428 2253 $t->{GOAL} = 1;
michael@428 2254 push @goals, $t;
michael@428 2255 } else {
michael@428 2256 # error
michael@428 2257 if ($env->{status}) {
michael@428 2258 print "# dropping goal '$name'\n";
michael@428 2259 } else {
michael@428 2260 die "openpkg:build:FATAL: cannot find source for '$name'\n";
michael@428 2261 }
michael@428 2262 }
michael@428 2263 }
michael@428 2264 return if (not @goals);
michael@428 2265
michael@428 2266 # recurse over dependencies
michael@428 2267 @targets = ();
michael@428 2268 @keeps = @goals;
michael@428 2269 foreach $t (@goals) {
michael@428 2270 print "# recursing over dependencies for ".vsn($t)."\n";
michael@428 2271 make_dep(undef, $t, 0, $env, \@targets, \@keeps, \@conflicts);
michael@428 2272 }
michael@428 2273
michael@428 2274 # determine "binary only" packages which should be not kept
michael@428 2275 # as they were not installed and are used temporarily only.
michael@428 2276 %keep = map { $_ => 1 } @keeps;
michael@428 2277 @bonly = reverse grep {
michael@428 2278 !$keep{$_} && !$env->{installed}->{$_->{name}}
michael@428 2279 } @targets;
michael@428 2280
michael@428 2281 # return results
michael@428 2282 return (\@targets, \@bonly, \@conflicts);
michael@428 2283 }
michael@428 2284
michael@428 2285
michael@428 2286 #############################################################################
michael@428 2287 ##
michael@428 2288 ## FUNCTIONS: RESULT PRINTING
michael@428 2289 ##
michael@428 2290 #############################################################################
michael@428 2291
michael@428 2292 # determine execution command
michael@428 2293 sub cmd ($$) {
michael@428 2294 my ($w,$s) = @_;
michael@428 2295 if (!defined($w)) {
michael@428 2296 return $s;
michael@428 2297 } elsif ($w =~ m/^-(.*)/) {
michael@428 2298 return "$1 \"$s\"";
michael@428 2299 } else {
michael@428 2300 return "$w $s";
michael@428 2301 }
michael@428 2302 }
michael@428 2303 sub priv ($) { cmd($opt_P, $_[0]); }
michael@428 2304 sub npriv ($) { cmd($opt_N, $_[0]); }
michael@428 2305
michael@428 2306 # execute a command
michael@428 2307 my $run_cache = {};
michael@428 2308 sub run ($) {
michael@428 2309 my $cmd = cmd($opt_N, $_[0]);
michael@428 2310 my $out = $run_cache->{$cmd};
michael@428 2311 if (not defined($out)) {
michael@428 2312 my @out = `$cmd`;
michael@428 2313 $out = [ @out ];
michael@428 2314 $run_cache->{$cmd} = $out;
michael@428 2315 }
michael@428 2316 return (wantarray ? @{$out} : join(//, @{$out}));
michael@428 2317 }
michael@428 2318
michael@428 2319 # print dependency list
michael@428 2320 sub print_deps ($) {
michael@428 2321 my ($list) = @_;
michael@428 2322
michael@428 2323 print join("\n", sort map { vsn($_) } @$list), "\n";
michael@428 2324 }
michael@428 2325
michael@428 2326 # print dependency map
michael@428 2327 sub print_map ($$$$$) {
michael@428 2328 my ($installed, $repository, $list, $bonly, $clist) = @_;
michael@428 2329 my (%dep);
michael@428 2330
michael@428 2331 foreach (@$bonly) {
michael@428 2332 $_->{status} = 'TEMP';
michael@428 2333 }
michael@428 2334 foreach (reverse(@$list)) {
michael@428 2335 printf("%-35s %-8s %s\n",
michael@428 2336 $_->{WHO} ? vsn($_->{WHO}) : "GOAL",
michael@428 2337 $_->{WHY} ? $_->{WHY} : '???',
michael@428 2338 vsn($_)
michael@428 2339 );
michael@428 2340 }
michael@428 2341 }
michael@428 2342
michael@428 2343 # instead of printing a command list, print a status map
michael@428 2344 # that shows all packages and how the build process would
michael@428 2345 # change their status
michael@428 2346 sub print_status ($$$$$) {
michael@428 2347 my ($installed, $repository, $list, $bonly, $clist) = @_;
michael@428 2348 my (%bonly) = map { $_ => 1 } @$bonly;
michael@428 2349 my (%map, $n, @names, $t);
michael@428 2350 my ($old, $tag, $new);
michael@428 2351
michael@428 2352 # augment map with additional information
michael@428 2353 # about conflicting and binary only (temporary) packages
michael@428 2354 foreach (@$list, @$clist) {
michael@428 2355 next if (not $_->{release} =~ m/\S/);
michael@428 2356 $map{$_->{name}} = {
michael@428 2357 rel => "$_->{version}-$_->{release}",
michael@428 2358 status => $_->{STATUS}
michael@428 2359 };
michael@428 2360 }
michael@428 2361 foreach (@$bonly) {
michael@428 2362 next if (not $_->{release} =~ m/\S/);
michael@428 2363 $map{$_->{name}} = {
michael@428 2364 rel => "$_->{version}-$_->{release}",
michael@428 2365 status => 'TEMP'
michael@428 2366 };
michael@428 2367 }
michael@428 2368
michael@428 2369 # augment map with additional information
michael@428 2370 # about up-to-date and new packages
michael@428 2371 @names = keys(%map);
michael@428 2372 foreach $n (keys(%$installed)) {
michael@428 2373 next if ($n =~ m/::/);
michael@428 2374 next if (exists($map{$n}));
michael@428 2375 next if (not (grep { $_ ne '' } keys(%{$installed->{$n}})));
michael@428 2376 $map{$n}->{'status'} = 'OK';
michael@428 2377 push(@names, $n);
michael@428 2378 }
michael@428 2379 foreach $n (keys(%$repository)) {
michael@428 2380 next if ($n =~ m/::/);
michael@428 2381 next if (exists($map{$n}));
michael@428 2382 next if (not (grep { $_ ne '' } keys(%{$repository->{$n}})));
michael@428 2383 $t = find_target($n, $repository, 0);
michael@428 2384 $map{$n}->{'status'} = 'NEW';
michael@428 2385 $map{$n}->{'rel'} = vs($t);
michael@428 2386 push(@names, $n);
michael@428 2387 }
michael@428 2388
michael@428 2389 # generate status output
michael@428 2390 foreach $n (sort(@names)) {
michael@428 2391 $old = join(',',
michael@428 2392 map { "$n-$_" }
michael@428 2393 sort
michael@428 2394 grep { $_ ne '-' }
michael@428 2395 keys(%{$installed->{$n}})
michael@428 2396 );
michael@428 2397 $old = $n if ($old eq '');
michael@428 2398 $tag = $map{$n}->{status};
michael@428 2399 $new = defined($map{$n}->{rel}) ? " $n-$map{$n}->{rel}" : '';
michael@428 2400 printf("%-35s %-8s%s\n", $old, $tag, $new);
michael@428 2401 }
michael@428 2402 }
michael@428 2403
michael@428 2404 # compute path to source RPM from rpm config and target data
michael@428 2405 sub target2srcrpm ($$) {
michael@428 2406 my ($target, $c) = @_;
michael@428 2407 return $c->{srcrpmdir}.'/'.$target->{name}.'-'.$target->{version}.'-'.$target->{release}.'.src.rpm';
michael@428 2408 }
michael@428 2409
michael@428 2410 # compute path to binary RPM from rpm config and target data
michael@428 2411 sub target2rpm ($$) {
michael@428 2412 my ($target, $c) = @_;
michael@428 2413 my ($tmpl) = $c->{template};
michael@428 2414 my ($popt) = $target->{PROXY} ? '+PROXY' : '';
michael@428 2415
michael@428 2416 $tmpl =~ s/%{NAME}/$target->{name}/;
michael@428 2417 $tmpl =~ s/%{VERSION}/$target->{version}/;
michael@428 2418 $tmpl =~ s/%{RELEASE}/$target->{release}$popt/;
michael@428 2419
michael@428 2420 return $c->{rpmdir}.'/'.$tmpl;
michael@428 2421 }
michael@428 2422
michael@428 2423 # merge parameters from installed package
michael@428 2424 # with new parameter set and global parameters
michael@428 2425 # from configuration
michael@428 2426 # then map the result to --define command line arguments
michael@428 2427 # suitable for rpm
michael@428 2428 sub make_defines ($$$$) {
michael@428 2429 my ($old, $new, $def, $c) = @_;
michael@428 2430 my ($with);
michael@428 2431
michael@428 2432 $old = {} unless $old;
michael@428 2433 $def = {} unless $def;
michael@428 2434
michael@428 2435 # override old parameters with new parameters
michael@428 2436 # drop new parameters that do not exist in old set
michael@428 2437 $old = { %$old };
michael@428 2438 override_options($old, $new, $c->{optreg});
michael@428 2439
michael@428 2440 # convert parameters to --define command line options
michael@428 2441 # skip parameter templates from index
michael@428 2442 # skip parameters that are identical to defaults
michael@428 2443 $with = join(' ',
michael@428 2444 map { "--define '$_ $old->{$_}'" }
michael@428 2445 sort grep {
michael@428 2446 $old->{$_} =~ m/\S/ &&
michael@428 2447 $old->{$_} !~ m/^%/ &&
michael@428 2448 $old->{$_} ne $def->{$_}
michael@428 2449 } keys %$old
michael@428 2450 );
michael@428 2451
michael@428 2452 $with = ' '.$with if ($with ne '');
michael@428 2453
michael@428 2454 return $with;
michael@428 2455 }
michael@428 2456
michael@428 2457 # compute new target based on old target augmented with options from
michael@428 2458 # a binary RPM file
michael@428 2459 sub binary_target ($$) {
michael@428 2460 my ($t, $fn) = @_;
michael@428 2461 my (%target) = %$t;
michael@428 2462
michael@428 2463 # pull in options from binary RPM file
michael@428 2464 delete $target{'OPTIONS'};
michael@428 2465 get_with(\%target, $fn);
michael@428 2466 return \%target;
michael@428 2467 }
michael@428 2468
michael@428 2469 # return path to master package for a proxy package
michael@428 2470 sub find_proxy ($$) {
michael@428 2471 my ($t, $bpkg) = @_;
michael@428 2472 my (@l) = run($config->{"rpm"} . " -ql $t->{name}");
michael@428 2473 my ($link) = (grep { $_ =~ m/\/\.prefix-$t->{name}$/ } @l)[0];
michael@428 2474 return if (not defined($link));
michael@428 2475 chomp $link;
michael@428 2476 my ($prefix) = readlink($link);
michael@428 2477 return if (not defined($prefix));
michael@428 2478 $bpkg =~ s/.*\///;
michael@428 2479 $bpkg =~ s/\+PROXY(\.[^-]+-[^-]+)-[^-]+\.rpm$/$1-*.rpm/;
michael@428 2480 return (glob("$prefix/RPM/PKG/$bpkg"))[0];
michael@428 2481 }
michael@428 2482
michael@428 2483 # indent text to form a block
michael@428 2484 sub indent ($) {
michael@428 2485 my ($txt) = @_;
michael@428 2486 $txt =~ s/^/ /gm;
michael@428 2487 return $txt;
michael@428 2488 }
michael@428 2489
michael@428 2490 # print commands from package build list
michael@428 2491 # c -> configuration to derive paths from
michael@428 2492 # uncond -> always do the --rebuild
michael@428 2493 # with -> parameter set passed to build tool
michael@428 2494 # ignore -> generate script that does not stop on error
michael@428 2495 # usebin -> build-time check to skip rebuild when binary exists
michael@428 2496 # allbin -> usebin also for goals
michael@428 2497 sub print_list1 ($$$$$$$) {
michael@428 2498 my ($list, $c, $uncond, $with, $ignore, $usebin, $allbin) = @_;
michael@428 2499 my ($pkg, $spkg, $bpkg, $uvhpkg, $ppkg);
michael@428 2500 my ($opt);
michael@428 2501 my ($cmd1, $cmd2, $mark);
michael@428 2502 my ($cmd3, $srcpkg);
michael@428 2503
michael@428 2504 $mark = '::::';
michael@428 2505
michael@428 2506 my $err;
michael@428 2507 if ($ignore) { $err = "|| true" } else { $err = "|| exit \$?" };
michael@428 2508 foreach (@$list) {
michael@428 2509 $pkg = $_->{name};
michael@428 2510 $spkg = $_->{href};
michael@428 2511 unless ($spkg =~ m/\S/) {
michael@428 2512 die "openpkg:build:FATAL: internal error, ",vsn($_)," without source URL\n";
michael@428 2513 }
michael@428 2514 $bpkg = target2rpm($_, $c); $uvhpkg = $bpkg;
michael@428 2515 $srcpkg = target2srcrpm($_, $c);
michael@428 2516 $cmd3 = '';
michael@428 2517
michael@428 2518 # rebuild binary package IF
michael@428 2519 # 'unconditional' option
michael@428 2520 # OR target is tagged as rebuilding
michael@428 2521 # OR there is no binary package
michael@428 2522 # OR dependency check found that installed package is not suitable
michael@428 2523 # OR existing binary package doesn't satisfy wanted options
michael@428 2524 $cmd1 = undef;
michael@428 2525 if ( $uncond
michael@428 2526 || !-f $bpkg
michael@428 2527 || !target_suitable(binary_target($_, $bpkg), $with, 1)) {
michael@428 2528
michael@428 2529 $opt = make_defines($_->{OPTIONS}, $with,
michael@428 2530 $_->{DEFOPTS}, $c);
michael@428 2531
michael@428 2532 # proxy packages are rebuilt from their maste
michael@428 2533 # hierachy
michael@428 2534 # someone preferred a binary from the repository
michael@428 2535 # just copy it to the local store
michael@428 2536 if ($_->{PROXY}) {
michael@428 2537 $ppkg = find_proxy($_,$bpkg) or
michael@428 2538 die "openpkg:build:FATAL: proxy package ",vsn($_)," does not exist\n";
michael@428 2539
michael@428 2540 # rpm doesn't support additional parameters to the
michael@428 2541 # mkproxy script
michael@428 2542 # $cmd1 = npriv($config->{"mkp"} . " $ppkg -- -o $bpkg");
michael@428 2543 $cmd1 = "( cd $c->{rpmdir} && ".
michael@428 2544 npriv($config->{"mkp"} . " $ppkg").
michael@428 2545 " )";
michael@428 2546 } elsif (defined $_->{prefix}) {
michael@428 2547 $cmd1 = '';
michael@428 2548 if ($spkg =~ m|^\.?/|) {
michael@428 2549 $uvhpkg = $spkg;
michael@428 2550 }
michael@428 2551 else {
michael@428 2552 $cmd1 .= npriv($config->{"curl"} . " -# -o $bpkg $spkg $err\n");
michael@428 2553 $cmd3 = npriv("rm -f $bpkg >/dev/null 2>&1 $err\n") unless ($opt_k);
michael@428 2554 }
michael@428 2555 } else {
michael@428 2556 $cmd1 = '';
michael@428 2557 if ($spkg =~ m|^\.?/|) {
michael@428 2558 $cmd1 .= npriv($config->{"rpm"} . "$opt --rebuild $spkg $err\n");
michael@428 2559 }
michael@428 2560 else {
michael@428 2561 $cmd1 .= "if test ! -f $srcpkg; then\n";
michael@428 2562 $cmd1 .= indent(npriv($config->{"curl"} . " -# -o $srcpkg $spkg $err\n"));
michael@428 2563 $cmd1 .= "fi\n";
michael@428 2564 $cmd1 .= npriv($config->{"rpm"} . "$opt --rebuild $srcpkg $err\n");
michael@428 2565 $cmd1 .= npriv("rm -f $srcpkg >/dev/null 2>&1 $err\n") unless ($opt_k);
michael@428 2566 }
michael@428 2567 }
michael@428 2568 }
michael@428 2569
michael@428 2570 # wrap build command with build-time check for existing
michael@428 2571 # binary target
michael@428 2572 if (defined($cmd1) && ($allbin || ($usebin && !$_->{GOAL}))) {
michael@428 2573 $cmd1 = "if test ! -f $uvhpkg; then\n".indent($cmd1)."fi\n";
michael@428 2574 }
michael@428 2575
michael@428 2576 # if package exist force rpm to copy over new files
michael@428 2577 # better than erasing everything and losing configuration
michael@428 2578 # files
michael@428 2579 $opt = ($_->{REBUILD} || ($allbin || ($usebin && !$_->{GOAL}))) ? ' --force' : '';
michael@428 2580 $cmd2 = '';
michael@428 2581 $cmd2 .= priv($config->{"rpm"} . "$opt -Uvh $uvhpkg $err\n");
michael@428 2582 if ($allbin || ($usebin && !$_->{GOAL})) {
michael@428 2583 $cmd2 = "if test \".`".$config->{"rpm"}." -q --qf '\%{SIGMD5}' $pkg`\" != \".`".$config->{"rpm"}." -qp --qf '\%{SIGMD5}' $uvhpkg`\"; then\n".indent($cmd2)."fi\n";
michael@428 2584 }
michael@428 2585 $cmd2 = $cmd1.$cmd2 if ($cmd1);
michael@428 2586 $cmd2 = $cmd2.$cmd3 if ($cmd3);
michael@428 2587 print "echo $mark $spkg $mark\n".$cmd2."echo $mark $spkg = \$? $mark\n";
michael@428 2588 }
michael@428 2589 }
michael@428 2590
michael@428 2591 # print commands for the temporary package list
michael@428 2592 # temporary packages are only used for building other packages
michael@428 2593 # and are removed when everything is done
michael@428 2594 sub print_list2 ($$) {
michael@428 2595 my ($list, $c) = @_;
michael@428 2596 my ($pkg);
michael@428 2597
michael@428 2598 foreach (@$list) {
michael@428 2599 $pkg = "$_->{name}-$_->{version}-$_->{release}";
michael@428 2600 print priv($config->{"rpm"} . " -e $pkg\n");
michael@428 2601 }
michael@428 2602 }
michael@428 2603

mercurial