OpenPKG Specs / changeset

     1.1 --- /dev/null	Thu Jan 01 00:00:00 1970 +0000
     1.2 +++ b/openpkg/Makefile	Tue Jul 31 12:23:42 2012 +0200
     1.3 @@ -0,0 +1,177 @@
     1.4 +##
     1.5 +##  Makefile -- OpenPKG Framework Developer Procedures
     1.6 +##  Copyright (c) 2000-2012 OpenPKG GmbH <http://openpkg.com/>
     1.7 +##
     1.8 +##  This software is property of the OpenPKG GmbH, DE MUC HRB 160208.
     1.9 +##  All rights reserved. Licenses which grant limited permission to use,
    1.10 +##  copy, modify and distribute this software are available from the
    1.11 +##  OpenPKG GmbH.
    1.12 +##
    1.13 +##  THIS SOFTWARE IS PROVIDED "AS IS" AND ANY EXPRESSED OR IMPLIED
    1.14 +##  WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
    1.15 +##  MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED.
    1.16 +##  IN NO EVENT SHALL THE AUTHORS AND COPYRIGHT HOLDERS AND THEIR
    1.17 +##  CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,
    1.18 +##  SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT
    1.19 +##  LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF
    1.20 +##  USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND
    1.21 +##  ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY,
    1.22 +##  OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT
    1.23 +##  OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF
    1.24 +##  SUCH DAMAGE.
    1.25 +##
    1.26 +
    1.27 +PATH      = /usr/opkg/bin:/usr/opkg/sbin:/bin:/sbin:/usr/bin:/usr/sbin
    1.28 +PREFIX    = /openpkg
    1.29 +USER      = openpkg
    1.30 +GROUP     = openpkg
    1.31 +TAG       = openpkg
    1.32 +
    1.33 +SH        = /bin/sh
    1.34 +RPM       = $(PREFIX)/bin/openpkg rpm
    1.35 +SUDO      = sudo
    1.36 +SCP       = scp
    1.37 +RSYNC     = rsync
    1.38 +RSYNC_REM = /v/openpkg/sw/bin/rsync
    1.39 +MTN       = mtn
    1.40 +
    1.41 +UPLOAD1   = openpkg@experimental.openpkg.org:/v/openpkg/download/data/framework/release/source/
    1.42 +UPLOAD2   = openpkg@experimental.openpkg.org:/v/openpkg/download/data/components/cache/openpkg/
    1.43 +
    1.44 +all:
    1.45 +	@echo "Individual Steps:"
    1.46 +	@echo "  $(MAKE) fetch-sh         fetch third-party distribution files (standalone)"
    1.47 +	@echo "  $(MAKE) fetch-rpm        fetch third-party distribution files (requires $(PREFIX))"
    1.48 +	@echo "  $(MAKE) build-src-sh     build   SOURCE SHELL package (standalone)"
    1.49 +	@echo "  $(MAKE) build-bin-sh     build   BINARY SHELL package (standalone)"
    1.50 +	@echo "  $(MAKE) build-src-rpm    build   SOURCE RPM   package (requires $(PREFIX))"
    1.51 +	@echo "  $(MAKE) build-bin-rpm    build   BINARY RPM   package (requires $(PREFIX))"
    1.52 +	@echo "  $(MAKE) install-bin-sh   install BINARY SHELL package (requires $(PREFIX))"
    1.53 +	@echo "  $(MAKE) install-bin-rpm  install BINARY RPM   package (requires $(PREFIX))"
    1.54 +	@echo "  $(MAKE) uninstall        uninstall entire instance under $(PREFIX)"
    1.55 +	@echo "  $(MAKE) upload-dst       upload latest DISTRIBUTION files"
    1.56 +	@echo "  $(MAKE) upload-pkg       upload latest SOURCE SHELL+RPM packages"
    1.57 +	@echo "  $(MAKE) upload-src       upload latest SOURCE repository revisions"
    1.58 +	@echo "  $(MAKE) clean            remove temporary files"
    1.59 +	@echo ""
    1.60 +	@echo "All-In-One Steps:"
    1.61 +	@echo "  $(MAKE) bootstrap        BOOTSTRAP instance under $(PREFIX) from scratch"
    1.62 +	@echo "  $(MAKE) update           UPDATE    instance under $(PREFIX)"
    1.63 +	@echo "  $(MAKE) upload           upload all results"
    1.64 +
    1.65 +##
    1.66 +##  Individual Steps
    1.67 +##
    1.68 +
    1.69 +fetch-sh:
    1.70 +	@echo "++ fetching third-party distribution files (manually)"; \
    1.71 +	eval `egrep '^%define *V_.*' openpkg.spec | \
    1.72 +	    sed -e 's%^.*\(V_[a-z][a-zA-Z0-9_]*\) *\([^ ][^ ]*\).*$$%\1="\2";%'`; \
    1.73 +	for url in \
    1.74 +	    `egrep '^Source[0-9][0-9]*: *(http|ftp)://' openpkg.spec | \
    1.75 +	    sed -e 's;^Source[0-9][0-9]*: *;;' -e 's;%{\(V_[a-z][a-zA-Z0-9_]*\)};$${\1};g'`; do \
    1.76 +	    eval "url=\"$$url\""; \
    1.77 +	    file=`echo "$$url" | sed -e 's;^.*/\([^/]*\)$$;../dst/\1;'`; \
    1.78 +	    if [ ! -f $$file ]; then \
    1.79 +			echo "-- downloading $$url"; \
    1.80 +			if [ ".`(which curl) 2>/dev/null | egrep '^/'`" != . ]; then \
    1.81 +				curl -s -L -o "$$file" "$$url" || true; \
    1.82 +			elif [ ".`(which wget) 2>/dev/null | egrep '^/'`" != . ]; then \
    1.83 +				wget -q -O "$$file" "$$url" || true; \
    1.84 +			elif [ ".`(which fetch) 2>/dev/null | egrep '^/'`" != . ]; then \
    1.85 +				fetch -o "$$file" "$$url" || true; \
    1.86 +			elif [ ".`(which lwp-download) 2>/dev/null | egrep '^/'`" != . ]; then \
    1.87 +				lwp-download "$$url" "$$file" || true; \
    1.88 +			else \
    1.89 +				echo "ERROR: sorry, no download tool found in \$$PATH (\"curl\", \"wget\", \"fetch\", \"lwp-download\")" 1>&2; \
    1.90 +				exit 1; \
    1.91 +			fi; \
    1.92 +			if [ ! -f "$$file" ]; then \
    1.93 +				echo "ERROR: failed to download \"$$url\"" 1>&2; \
    1.94 +				exit 1; \
    1.95 +			fi; \
    1.96 +	    fi; \
    1.97 +	done
    1.98 +
    1.99 +fetch-rpm:
   1.100 +	@echo "++ fetching third-party distribution files (via RPM)"; \
   1.101 +	PATH="$(PATH)" $(RPM) -bf *.spec
   1.102 +
   1.103 +build-src-sh:
   1.104 +	@echo "++ building SOURCE SHELL package"; \
   1.105 +	PATH="$(PATH)" $(SH) openpkg.boot -s
   1.106 +
   1.107 +build-bin-sh:
   1.108 +	@echo "++ building BINARY SHELL package"; \
   1.109 +	cd ../pkg && TMPDIR="`cd ../tmp && pwd`" && export TMPDIR && \
   1.110 +	PATH="$(PATH)" $(SH) openpkg-*-`date '+%Y%m%d'`.src.sh \
   1.111 +	    --prefix=$(PREFIX) \
   1.112 +	    --user=$(USER) \
   1.113 +	    --group=$(GROUP) \
   1.114 +	    --tag=$(TAG)
   1.115 +
   1.116 +build-src-rpm:
   1.117 +	@echo "++ building SOURCE RPM package"; \
   1.118 +	PATH="$(PATH)" $(RPM) -bs openpkg.spec
   1.119 +
   1.120 +build-bin-rpm:
   1.121 +	@echo "++ building BINARY RPM package"; \
   1.122 +	PATH="$(PATH)" $(RPM) -bb openpkg.spec
   1.123 +
   1.124 +install-bin-sh:
   1.125 +	@echo "++ installing BINARY SHELL package"; \
   1.126 +	d=`cd ../pkg && pwd` && cd / && PATH="$(PATH)" $(SUDO) $(SH) $$d/openpkg-*-`date '+%Y%m%d'`.*-*-*.sh
   1.127 +
   1.128 +install-bin-rpm:
   1.129 +	@echo "++ installing BINARY RPM package"; \
   1.130 +	d=`cd ../pkg && pwd` && cd / && PATH="$(PATH)" $(SUDO) $(RPM) -Uvh --replacepkgs $$d/openpkg-*-`date '+%Y%m%d'`.*-*-*.rpm
   1.131 +
   1.132 +uninstall:
   1.133 +	-@echo "++ uninstalling ENTIRE instance"; \
   1.134 +	cd /; $(RPM) -qa | grep -v '^openpkg-[0-9]' | xargs $(SUDO) $(RPM) -e; \
   1.135 +	$(SUDO) $(RPM) -e openpkg
   1.136 +
   1.137 +upload-dst:
   1.138 +	@echo "++ uploading vendor DISTRIBUTION files:"; \
   1.139 +	$(RSYNC) -raH --delete -v --progress --rsync-path=$(RSYNC_REM) ../dst/ $(UPLOAD2)
   1.140 +
   1.141 +upload-pkg:
   1.142 +	@echo "++ uploading SOURCE SHELL/RPM package(s):"; \
   1.143 +	$(RSYNC) -raH --delete -v --progress --rsync-path=$(RSYNC_REM) ../pkg/*.src.* $(UPLOAD1)
   1.144 +
   1.145 +upload-src:
   1.146 +	@echo "++ uploading SOURCE repository revision(s):"; \
   1.147 +	$(MTN) sync
   1.148 +
   1.149 +clean:
   1.150 +	-rm -rf ../tmp/*
   1.151 +
   1.152 +pod2man:
   1.153 +	pod2man --section=1 --center="OpenPKG" --release="OPENPKG(8)"    --date="OpenPKG" --quotes=none openpkg.pod    >openpkg.1
   1.154 +	pod2man --section=8 --center="OpenPKG" --release="RC(8)"         --date="OpenPKG" --quotes=none rc.pod         >rc.8
   1.155 +	pod2man --section=8 --center="OpenPKG" --release="RPMTOOL(8)"    --date="OpenPKG" --quotes=none rpmtool.pod    >rpmtool.8
   1.156 +	pod2man --section=8 --center="OpenPKG" --release="LSYNC(8)"      --date="OpenPKG" --quotes=none lsync.pod      >lsync.8
   1.157 +	pod2man --section=8 --center="OpenPKG" --release="RPM-CONFIG(8)" --date="OpenPKG" --quotes=none rpm-config.pod >rpm-config.8
   1.158 +	pod2man --section=8 --center="OpenPKG" --release="UUID(8)"       --date="OpenPKG" --quotes=none uuid.pod       >uuid.8
   1.159 +	pod2man --section=8 --center="OpenPKG" --release="RELEASE(8)"    --date="OpenPKG" --quotes=none release.pod    >release.8
   1.160 +	pod2man --section=8 --center="OpenPKG" --release="BUILD(8)"      --date="OpenPKG" --quotes=none build.pod      >build.8
   1.161 +	pod2man --section=8 --center="OpenPKG" --release="INDEX(8)"      --date="OpenPKG" --quotes=none index.pod      >index.8
   1.162 +	pod2man --section=8 --center="OpenPKG" --release="SEARCH(8)"     --date="OpenPKG" --quotes=none search.pod     >search.8
   1.163 +	pod2man --section=8 --center="OpenPKG" --release="MIRROR(8)"     --date="OpenPKG" --quotes=none mirror.pod     >mirror.8
   1.164 +	pod2man --section=8 --center="OpenPKG" --release="MAKEPROXY(8)"  --date="OpenPKG" --quotes=none makeproxy.pod  >makeproxy.8
   1.165 +	pod2man --section=8 --center="OpenPKG" --release="REGISTER(8)"   --date="OpenPKG" --quotes=none register.pod   >register.8
   1.166 +	pod2man --section=8 --center="OpenPKG" --release="LICENSE(8)"    --date="OpenPKG" --quotes=none license.pod    >license.8
   1.167 +	pod2man --section=8 --center="OpenPKG" --release="DEV(8)"        --date="OpenPKG" --quotes=none dev.pod        >dev.8
   1.168 +	pod2man --section=8 --center="OpenPKG" --release="SEA(8)"        --date="OpenPKG" --quotes=none sea.pod        >sea.8
   1.169 +	pod2man --section=8 --center="OpenPKG" --release="STACK(8)"      --date="OpenPKG" --quotes=none stack.pod      >stack.8
   1.170 +
   1.171 +##
   1.172 +##  All-In-One Steps
   1.173 +##
   1.174 +
   1.175 +bootstrap: build-src-sh build-bin-sh install-bin-sh
   1.176 +
   1.177 +update: build-bin-rpm install-bin-rpm
   1.178 +
   1.179 +upload: build-src-sh build-src-rpm upload-pkg upload-src
   1.180 +

     2.1 --- a/openpkg/README	Tue Jul 31 12:12:54 2012 +0200
     2.2 +++ b/openpkg/README	Tue Jul 31 12:23:42 2012 +0200
     2.3 @@ -1,52 +1,60 @@
     2.4  
     2.5 -  OpenPKG Boostrap Package Source Tree
     2.6 -  ====================================
     2.7 +  OpenPKG Framework Bootstrap Package, Source Tree
     2.8 +  ================================================
     2.9  
    2.10 -  This is the source code tree for the OpenPKG bootstrap package. What
    2.11 -  you find here is rather complex and tricky stuff, so don't be confused
    2.12 -  if you don't understand everything immediately.
    2.13 +  This is the source tree for the OpenPKG Framework "bootstrap" package.
    2.14 +  What you find here is rather complex and tricky stuff, so don't be
    2.15 +  confused if you don't understand everything immediately.
    2.16  
    2.17    The Files
    2.18    ---------
    2.19  
    2.20    README .................. this file ;-)
    2.21 -  HISTORY ................. change history tracking of this package
    2.22  
    2.23    openpkg.spec ............ the regular build procedure
    2.24    openpkg.boot ............ the bootstrapping procedure
    2.25  
    2.26 -  gzip-*.tar .............. untouched distribution tarball of the GNU gzip tool
    2.27 -  make-*.tar.gz ........... untouched distribution tarball of the GNU make tool
    2.28    patch-*.tar.gz .......... untouched distribution tarball of the GNU patch tool
    2.29    bash-*.tar.gz ........... untouched distribution tarball of the GNU bash tool
    2.30 +  make-*.tar.gz ........... untouched distribution tarball of the GNU make tool
    2.31    tar-*.tar.gz ............ untouched distribution tarball of the GNU tar tool
    2.32 +  config-*.tar.gz ......... untouched distribution tarball of the GNU config scripts
    2.33 +  gzip-*.tar .............. pre-unpacked distribution tarball of the GNU gzip tool
    2.34 +  gzip-*-openpkg-r*.tar ... pre-patched distribution files of the GNU gzip tool
    2.35 +  perl-*-mini.tar.gz ...... stripped down distribution tarball of the Perl tool
    2.36 +  rpm-*.tar.gz ............ untouched distribution tarball of the RPM tool
    2.37 +  openssl-*.tar.gz ........ untouched distribution tarball of the OpenSSL toolkit
    2.38    uuid-*.tar.gz ........... untouched distribution tarball of the OSSP uuid tool
    2.39    curl-*.tar.gz ........... untouched distribution tarball of the cURL tool
    2.40 +  beecrypt-*.tar.gz ....... untouched distribution tarball of the BeeCrypt library
    2.41    bzip2-*.tar.gz .......... untouched distribution tarball of the BZIP2 library
    2.42    zlib-*.tar.gz ........... untouched distribution tarball of the ZLIB library
    2.43 -  beecrypt-*.tar.gz ....... untouched distribution tarball of the BeeCrypt library
    2.44 -  rpm-*.tar.gz ............ untouched distribution tarball of the RPM tool
    2.45 -  config-*.tar.gz ......... untouched distribution tarball of the GNU config scripts
    2.46 -  openpkg-registry-*.tar.gz untouched distribution tarball of the OpenPKG Registry
    2.47 -  openpkg-tools-*.tar.gz .. untouched distribution tarball of the OpenPKG Tool Chain
    2.48 -  openssl-*.tar.gz ........ untouched distribution tarball of the OpenSSL toolkit
    2.49 -  perl-*-mini.tar.gz ...... stripped down distribution tarball of the Perl tool
    2.50 +  popt-*.tar.gz ........... untouched distribution tarball of the POPT library
    2.51 +  sqlite-*.tar.gz ......... untouched distribution tarball of the SQLite library
    2.52 +  pcre-*.tar.gz ........... untouched distribution tarball of the SQLite library
    2.53 +  diffutils-*.tar.gz ...... untouched distribution tarball of the GNU diffutils toolkit
    2.54 +  svs-*.tar.gz ............ untouched distribution tarball of the OSSP svs tool
    2.55 +  xz-*.tar.gz ............. untouched distribution tarball of the XZ tool
    2.56  
    2.57 -  make.patch .............. patch for GNU make
    2.58 -  bash.patch .............. patch for GNU bash
    2.59 -  tar.patch ............... patch for GNU tar
    2.60 -  beecrypt.patch .......... patch for BeeCrypt
    2.61 -  openssl.patch ........... patch for OpenSSL
    2.62 -  perl.patch .............. patch for Perl
    2.63 -  gzip.c .................. replacement file for GNU gzip
    2.64 -  rpm.patch.bugfix ........ patch for RPM (bugfixing parts)
    2.65 -  rpm.patch.feature ....... patch for RPM (new features parts)
    2.66 -  rpm.patch.porting ....... patch for RPM (portability enhancement parts)
    2.67 -  rpm.patch.regen ......... patch for RPM (re-generated files parts)
    2.68 +  bash.patch .............. patch for GNU bash tool
    2.69 +  bash.patch.vendor ....... patch for GNU bash tool (upstream vendor only)
    2.70 +  bash.patch.vendor.sh .... patch for GNU bash tool (generation utility, NOT BUNDLED)
    2.71 +  beecrypt.patch .......... patch for BeeCrypt library
    2.72 +  make.patch .............. patch for GNU make tool
    2.73 +  openssl.patch ........... patch for OpenSSL toolkit
    2.74 +  perl.patch .............. patch for Perl tool
    2.75 +  tar.patch ............... patch for GNU tar tool
    2.76 +  rpm.patch ............... patch for RPM tool
    2.77 +  popt.patch .............. patch for POPT library
    2.78 +  sqlite.patch ............ patch for SQLite library
    2.79 +  curl.patch .............. patch for cURL library
    2.80 +  diffutils.patch ......... patch for GNU diffutils tool
    2.81 +  libarchive.patch ........ patch for BSD libarchive tool
    2.82 +  pcre.patch .............. patch for PCRE library
    2.83 +  xz.patch ................ patch for XZ tool
    2.84  
    2.85    rpmpopt ................. replacements/extensions for RPM's POPT configuration
    2.86    rpmmacros ............... replacements/extensions for RPM's macros
    2.87 -  rpmrc ................... replacements for RPM's run-command configuration
    2.88  
    2.89    root.README ............. the source for installed <prefix>/README
    2.90    local.README ............ the source for installed <prefix>/local/README
    2.91 @@ -55,6 +63,7 @@
    2.92    dot.lsyncrc ............. the source for installed <prefix>/local/.lsyncrc
    2.93  
    2.94    openpkg.c ............... the OpenPKG frontend (set-uid wrapper)
    2.95 +  openpkg.mk .............. the OpenPKG frontend (build procedure)
    2.96    openpkg.sh .............. the OpenPKG frontend (main script)
    2.97    openpkg.pod ............. the OpenPKG frontend manual page (source)
    2.98    openpkg.1 ............... the OpenPKG frontend manual page (pre-generated output)
    2.99 @@ -89,31 +98,74 @@
   2.100    lsync.8 ................. the lsync tool (manual page)
   2.101    lsync.pod ............... the lsync tool (manual page source)
   2.102  
   2.103 -  aux.usrgrp.sh ........... user/group name/id determination script
   2.104 -  aux.prereq.sh ........... prerequisite checking script
   2.105 -  aux.wrapsrc.sh .......... wrapper script for generating openpkg-V-R.src.sh
   2.106 -  aux.wrapbin.sh .......... wrapper script for generating openpkg-V-R.P-L.sh
   2.107 +  etc.usrgrp.sh ........... user/group name/id determination script
   2.108 +  etc.prereq.sh ........... prerequisite checking script
   2.109 +  etc.wrapsrc.sh .......... wrapper script for generating openpkg-V-R.src.sh
   2.110 +  etc.wrapbin.sh .......... wrapper script for generating openpkg-V-R.P-L.sh
   2.111  
   2.112 -  pod2man.sh .............. helper script for pre-generating manual page outputs
   2.113    man.sh .................. helper script for "openpkg man" command
   2.114 -  install.sh .............. helper script for "openpkg install" command
   2.115 +
   2.116 +  rpm.sh .................. wrapper for RPM
   2.117 +  curl.sh ................. wrapper for cURL
   2.118 +
   2.119 +  dev.pl .................. the OpenPKG package development utility script
   2.120 +  dev.pod ................. the OpenPKG package development utility manual page (source)
   2.121 +  dev.8 ................... the OpenPKG package development utility manual page (pre-generated output)
   2.122 +
   2.123 +  index.pl ................ the OpenPKG package indexing utility script
   2.124 +  index.pod ............... the OpenPKG package indexing utility manual page (source)
   2.125 +  index.8 ................. the OpenPKG package indexing utility manual page (pre-generated output)
   2.126 +
   2.127 +  search.pl ............... the OpenPKG package searching utility script
   2.128 +  search.pod .............. the OpenPKG package searching utility manual page (source)
   2.129 +  search.8 ................ the OpenPKG package searching utility manual page (pre-generated output)
   2.130 +
   2.131 +  sea.sh .................. the OpenPKG shell execution archive utility script
   2.132 +  sea.pod ................. the OpenPKG shell execution archive utility manual page (source)
   2.133 +  sea.8 ................... the OpenPKG shell execution archive utility manual page (pre-generated output)
   2.134 +
   2.135 +  mirror.pl ............... the OpenPKG package mirroing utility script
   2.136 +  mirror.pod .............. the OpenPKG package mirroing utility manual page (source)
   2.137 +  mirror.8 ................ the OpenPKG package mirroing utility manual page (pre-generated output)
   2.138 +
   2.139 +  build.pl ................ the OpenPKG package building utility script
   2.140 +  build.pod ............... the OpenPKG package building utility manual page (source)
   2.141 +  build.8 ................. the OpenPKG package building utility manual page (pre-generated output)
   2.142 +
   2.143 +  makeproxy.pl ............ the OpenPKG proxy package building utility script
   2.144 +  makeproxy.pod ........... the OpenPKG proxy package building utility manual page (source)
   2.145 +  makeproxy.8 ............. the OpenPKG proxy package building utility manual page (pre-generated output)
   2.146  
   2.147    openpkg.org.pgp ......... the OpenPGP public key "OpenPKG <openpkg@openpkg.org>"
   2.148    openpkg.com.pgp ......... the OpenPGP public key "OpenPKG GmbH <openpkg@openpkg.com>"
   2.149    openpkg.net.pgp ......... the OpenPGP public key "OpenPKG Foundation e.V. <openpkg@openpkg.net>"
   2.150  
   2.151 +  license.sh .............. the OpenPKG license management utility script
   2.152 +  license.pod ............. the OpenPKG license management utility manual page (source)
   2.153 +  license.8 ............... the OpenPKG license management utility manual page (pre-generated output)
   2.154 +  license-BOOT.txt ........ the OpenPKG Framework Bootstrapping License
   2.155 +  license-COMMUNITY.txt ... the OpenPKG Framework Community License
   2.156 +  license-EVAL.txt ........ the OpenPKG Framework Evaluation License
   2.157 +  license-EXAMPLE.txt ..... the OpenPKG Framework Example License
   2.158 +  license-PROMO.txt ....... the OpenPKG Framework Promotion License
   2.159 +  license-RECOVERY.txt .... the OpenPKG Framework Recovery License
   2.160 +  license.lua ............. the OpenPKG Framework license processor script
   2.161 +
   2.162 +  Makefile ................ development build procedures
   2.163 +
   2.164    The Bootstrapping Procedure
   2.165    ---------------------------
   2.166  
   2.167    The complexity of this OpenPKG RPM package results from the fact that
   2.168    we force us to treat this bootstrapping package equal to every other
   2.169    regular OpenPKG RPM package. First, this implies that the packaging
   2.170 -  tool RPM is packaged with itself as an OpenPKG RPM package (means: its
   2.171 -  build procedure is a real RPM .spec file and it can be installed and
   2.172 -  upgraded through a binary or source RPM). Second, RPM is installed
   2.173 -  into the same filesystem hierarchy as all other packages. Third, RPM
   2.174 -  manages its own files. The reason for this approach should be obvious:
   2.175 -  100% consistency for the whole OpenPKG software packaging facility!
   2.176 +  tool RPM is packaged with itself as an OpenPKG RPM package -- which
   2.177 +  means that its build procedure is a real RPM .spec file and it can be
   2.178 +  installed and upgraded through a binary or source RPM. Second, RPM is
   2.179 +  installed into the same filesystem hierarchy as all other packages.
   2.180 +  Third, RPM manages its own files. The reason for this approach should
   2.181 +  be obvious: 100% consistency for the whole OpenPKG software packaging
   2.182 +  facility!
   2.183  
   2.184    The drawback is that this package requires a very tricky bootstrapping
   2.185    procedure which had cost a lot of time to figure out and establish. If
   2.186 @@ -137,17 +189,17 @@
   2.187    scripts of "openpkg.spec", there is a fresh version of the target
   2.188    filesystem hierarchy staying under a temporary "build root". The
   2.189    "openpkg.boot" script then creates a very special temporary "openpkg
   2.190 -  rpm" command which allows the installed "openpkg rpm" command inside
   2.191 -  the "build root" to work (although it is built for the final target
   2.192 -  filesystem path). Then the $RPM_BOOT variable is set and the package
   2.193 -  is _again_ build via "openpkg.spec" -- but this time with the real
   2.194 -  OpenPKG RPM. To avoid unneccessary re-compilation, the "openpkg.spec"
   2.195 -  skips "%prep", "%build" and "%install" sections if $RPM_BOOT is
   2.196 -  defined. So, on this second build phase, only the "%files" section is
   2.197 -  executed, i.e., a binary OpenPKG RPM package "openpkg-V-R.P-T.rpm"
   2.198 -  is rolled from the files in the "build root". Additionally, a source
   2.199 -  OpenPKG RPM package "openpkg-V-R.src.rpm" is rolled for consistency
   2.200 -  reasons.
   2.201 +  rpm" command which allows the installed "openpkg rpm" command
   2.202 +  inside the "build root" to work (although it is built for the
   2.203 +  final target filesystem path). Then the $OPENPKG_BOOT variable
   2.204 +  is set and the package is _again_ build via "openpkg.spec" --
   2.205 +  but this time with the real OpenPKG RPM. To avoid unneccessary
   2.206 +  re-compilation, the "openpkg.spec" skips "%prep", "%build" and
   2.207 +  "%install" sections if $OPENPKG_BOOT is defined. So, on this second
   2.208 +  build phase, only the "%files" section is effectively executed, i.e.,
   2.209 +  a binary OpenPKG RPM package "openpkg-V-R.P-T.rpm" is rolled from the
   2.210 +  files in the "build root". Additionally, a source OpenPKG RPM package
   2.211 +  "openpkg-V-R.src.rpm" is rolled for consistency reasons, too.
   2.212  
   2.213    Finally, we override the installation in the "build root"
   2.214    again by installing the now rolled binary OpenPKG RPM package
   2.215 @@ -169,14 +221,14 @@
   2.216    is packed into a "tarball", compressed, again wrapped into another
   2.217    tarball together with the uncompression tools ("bzip2" and "tar"),
   2.218    and finally wrapped into a self-extracting shell script by appending
   2.219 -  "aux.wrapbin.sh" (padded to 64KB for easier unpacking of the attached
   2.220 +  "etc.wrapbin.sh" (padded to 64KB for easier unpacking of the attached
   2.221    tarball) to its front.
   2.222  
   2.223    The result is the binary bootstrap script "openpkg-V-R.P-T.sh" which
   2.224 -  can be used to install the target hierarchy from scratch without any
   2.225 -  pre-installed OpenPKG RPM. Nevetheless, the installed target hierarchy
   2.226 -  looks _exactly_ as it would have been installed with OpenPKG RPM.
   2.227 -  If one later wants to upgrade this hierarchy one can just use the
   2.228 +  can be used to install the target hierarchy from scratch without
   2.229 +  any pre-installed OpenPKG RPM. Nevertheless, the installed target
   2.230 +  hierarchy looks _exactly_ as it would have been installed with OpenPKG
   2.231 +  RPM. If one later wants to upgrade this hierarchy one can just use the
   2.232    generated (or a newer) "openpkg-V-R.P-T.rpm".
   2.233  
   2.234    To allow one to easily repeat this from-source bootstrapping procedure

     3.1 --- a/openpkg/bash.patch	Tue Jul 31 12:12:54 2012 +0200
     3.2 +++ b/openpkg/bash.patch	Tue Jul 31 12:23:42 2012 +0200
     3.3 @@ -2,9 +2,9 @@
     3.4  line options "-v" and "-x". It is derived from Debian GNU/Linux.
     3.5  
     3.6  Index: doc/bash.1
     3.7 ---- doc/bash.1.orig	2004-07-12 17:27:08 +0200
     3.8 -+++ doc/bash.1	2004-07-27 19:47:10 +0200
     3.9 -@@ -116,6 +116,12 @@
    3.10 +--- doc/bash.1.orig	2011-01-16 21:31:39.000000000 +0100
    3.11 ++++ doc/bash.1	2011-02-21 18:56:01.000000000 +0100
    3.12 +@@ -117,6 +117,12 @@
    3.13   This option allows the positional parameters to be set
    3.14   when invoking an interactive shell.
    3.15   .TP
    3.16 @@ -23,9 +23,9 @@
    3.17  Port to HP-UX 11i and similar less smart platforms.
    3.18  
    3.19  Index: configure
    3.20 ---- configure.orig	2004-07-21 22:18:56 +0200
    3.21 -+++ configure	2004-07-27 19:47:10 +0200
    3.22 -@@ -1517,6 +1517,7 @@
    3.23 +--- configure.orig	2011-02-07 23:03:22.000000000 +0100
    3.24 ++++ configure	2011-02-21 18:56:01.000000000 +0100
    3.25 +@@ -2202,6 +2202,7 @@
    3.26   *-beos*)	opt_bash_malloc=no ;;	# they say it's suitable
    3.27   *-cygwin*)	opt_bash_malloc=no ;;	# Cygnus's CYGWIN environment
    3.28   *-opennt*|*-interix*)	opt_bash_malloc=no ;;	# Interix, now owned by Microsoft
    3.29 @@ -33,7 +33,7 @@
    3.30   esac
    3.31   
    3.32   # memory scrambling on free()
    3.33 -@@ -1662,7 +1663,7 @@
    3.34 +@@ -2270,7 +2271,7 @@
    3.35   
    3.36   else
    3.37   	MALLOC_LIB=
    3.38 @@ -43,8 +43,8 @@
    3.39   	MALLOC_DEP=
    3.40   fi
    3.41  Index: syntax.h
    3.42 ---- syntax.h.orig	2004-04-15 05:19:36 +0200
    3.43 -+++ syntax.h	2004-07-27 19:47:10 +0200
    3.44 +--- syntax.h.orig	2009-01-04 20:32:42.000000000 +0100
    3.45 ++++ syntax.h	2011-02-21 18:56:01.000000000 +0100
    3.46  @@ -21,6 +21,8 @@
    3.47   #ifndef _SYNTAX_H_
    3.48   #define _SYNTAX_H_
    3.49 @@ -60,303 +60,70 @@
    3.50  This adds the OpenPKG packaging brand.
    3.51  
    3.52  Index: version.c
    3.53 ---- version.c.orig	2003-12-19 22:34:02 +0100
    3.54 -+++ version.c	2004-07-27 19:47:10 +0200
    3.55 -@@ -77,7 +77,7 @@
    3.56 +--- version.c.orig	2011-01-28 17:32:36.000000000 +0100
    3.57 ++++ version.c	2011-02-21 18:56:01.000000000 +0100
    3.58 +@@ -83,7 +83,7 @@
    3.59   show_shell_version (extended)
    3.60        int extended;
    3.61   {
    3.62 --  printf ("GNU bash, version %s (%s)\n", shell_version_string (), MACHTYPE);
    3.63 -+  printf ("GNU bash, version %s (%s) [@l_openpkg_release@]\n", shell_version_string (), MACHTYPE);
    3.64 +-  printf (_("GNU bash, version %s (%s)\n"), shell_version_string (), MACHTYPE);
    3.65 ++  printf (_("GNU bash, version %s (%s) [@l_openpkg_release@]\n"), shell_version_string (), MACHTYPE);
    3.66     if (extended)
    3.67 -     printf (_("Copyright (C) 2005 Free Software Foundation, Inc.\n"));
    3.68 - }
    3.69 +     {
    3.70 +       printf ("%s\n", _(bash_copyright));
    3.71  
    3.72  -----------------------------------------------------------------------------
    3.73  
    3.74 -Accumulated vendor patches Bash 3.2 001-005
    3.75 +Ensure that Autoconf and friends are not run.
    3.76  
    3.77 -Generated via:
    3.78 -
    3.79 -$ gunzip <bash-3.2.tar.gz | tar xf -
    3.80 -$ pushd bash-3.2
    3.81 -$ cat bash32-[0-9]* | patch -p0 -Vt -b
    3.82 -$ shtool move -e '*.~1~' '%1.orig'
    3.83 -$ pushd /tmp
    3.84 -$ curl -O ftp://ftp.gnu.org/gnu/bison/bison-1.28.tar.gz
    3.85 -$ cd bison-1.28
    3.86 -$ ./configure --prefix=/tmp/bison
    3.87 -$ make
    3.88 -$ make install
    3.89 -$ popd
    3.90 -$ mv y.tab.c y.tab.c.orig
    3.91 -$ mv y.tab.h y.tab.h.orig
    3.92 -$ /tmp/bison/bin/bison -y -d parse.y
    3.93 -$ rm -rf /tmp/bison /tmp/bison-1.28 /tmp/bison-1.28.tar.gz
    3.94 -$ shtool subst -b.dummy \
    3.95 -  -e 's;parse\.y;/Users/chet/src/bash/src/parse.y;g' \
    3.96 -  -e 's;/tmp/bison/share/bison\.simple;/usr/share/bison.simple;g' y.tab.c
    3.97 -$ svs diff >/tmp/bash.patch
    3.98 -$ popd
    3.99 -$ rm -rf bash-3.2
   3.100 -
   3.101 -Index: parse.y
   3.102 ---- parse.y.orig	2006-09-19 22:37:21 +0200
   3.103 -+++ parse.y	2006-12-06 13:32:45 +0100
   3.104 -@@ -1029,6 +1029,7 @@
   3.105 - #define PST_CMDTOKEN	0x1000		/* command token OK - unused */
   3.106 - #define PST_COMPASSIGN	0x2000		/* parsing x=(...) compound assignment */
   3.107 - #define PST_ASSIGNOK	0x4000		/* assignment statement ok in this context */
   3.108 -+#define PST_REGEXP	0x8000		/* parsing an ERE/BRE as a single word */
   3.109 +Index: Makefile.in
   3.110 +--- Makefile.in.orig	2010-12-01 01:22:42.000000000 +0100
   3.111 ++++ Makefile.in	2011-02-21 18:56:01.000000000 +0100
   3.112 +@@ -711,7 +711,6 @@
   3.113   
   3.114 - /* Initial size to allocate for tokens, and the
   3.115 -    amount to grow them by. */
   3.116 -@@ -2591,6 +2592,9 @@
   3.117 -       return (character);
   3.118 -     }
   3.119 + # comment out for distribution
   3.120 + $(srcdir)/configure:	$(srcdir)/configure.in $(srcdir)/aclocal.m4 $(srcdir)/config.h.in
   3.121 +-	cd $(srcdir) && autoconf
   3.122   
   3.123 -+  if (parser_state & PST_REGEXP)
   3.124 -+    goto tokword;
   3.125 -+
   3.126 -   /* Shell meta-characters. */
   3.127 -   if MBTEST(shellmeta (character) && ((parser_state & PST_DBLPAREN) == 0))
   3.128 -     {
   3.129 -@@ -2698,6 +2702,7 @@
   3.130 -   if MBTEST(character == '-' && (last_read_token == LESS_AND || last_read_token == GREATER_AND))
   3.131 -     return (character);
   3.132 - 
   3.133 -+tokword:
   3.134 -   /* Okay, if we got this far, we have to read a word.  Read one,
   3.135 -      and then check it against the known ones. */
   3.136 -   result = read_token_word (character);
   3.137 -@@ -2735,7 +2740,7 @@
   3.138 - /* itrace("parse_matched_pair: open = %c close = %c", open, close); */
   3.139 -   count = 1;
   3.140 -   pass_next_character = backq_backslash = was_dollar = in_comment = 0;
   3.141 --  check_comment = (flags & P_COMMAND) && qc != '\'' && qc != '"' && (flags & P_DQUOTE) == 0;
   3.142 -+  check_comment = (flags & P_COMMAND) && qc != '`' && qc != '\'' && qc != '"' && (flags & P_DQUOTE) == 0;
   3.143 - 
   3.144 -   /* RFLAGS is the set of flags we want to pass to recursive calls. */
   3.145 -   rflags = (qc == '"') ? P_DQUOTE : (flags & P_DQUOTE);
   3.146 -@@ -3202,8 +3207,11 @@
   3.147 -       if (tok == WORD && test_binop (yylval.word->word))
   3.148 - 	op = yylval.word;
   3.149 - #if defined (COND_REGEXP)
   3.150 --      else if (tok == WORD && STREQ (yylval.word->word,"=~"))
   3.151 --	op = yylval.word;
   3.152 -+      else if (tok == WORD && STREQ (yylval.word->word, "=~"))
   3.153 -+	{
   3.154 -+	  op = yylval.word;
   3.155 -+	  parser_state |= PST_REGEXP;
   3.156 -+	}
   3.157 - #endif
   3.158 -       else if (tok == '<' || tok == '>')
   3.159 - 	op = make_word_from_token (tok);  /* ( */
   3.160 -@@ -3234,6 +3242,7 @@
   3.161 - 
   3.162 -       /* rhs */
   3.163 -       tok = read_token (READ);
   3.164 -+      parser_state &= ~PST_REGEXP;
   3.165 -       if (tok == WORD)
   3.166 - 	{
   3.167 - 	  tright = make_cond_node (COND_TERM, yylval.word, (COND_COM *)NULL, (COND_COM *)NULL);
   3.168 -@@ -3419,9 +3428,34 @@
   3.169 - 	  goto next_character;
   3.170 - 	}
   3.171 - 
   3.172 -+#ifdef COND_REGEXP
   3.173 -+      /* When parsing a regexp as a single word inside a conditional command,
   3.174 -+	 we need to special-case characters special to both the shell and
   3.175 -+	 regular expressions.  Right now, that is only '(' and '|'. */ /*)*/
   3.176 -+      if MBTEST((parser_state & PST_REGEXP) && (character == '(' || character == '|'))		/*)*/
   3.177 -+        {
   3.178 -+          if (character == '|')
   3.179 -+            goto got_character;
   3.180 -+
   3.181 -+	  push_delimiter (dstack, character);
   3.182 -+	  ttok = parse_matched_pair (cd, '(', ')', &ttoklen, 0);
   3.183 -+	  pop_delimiter (dstack);
   3.184 -+	  if (ttok == &matched_pair_error)
   3.185 -+	    return -1;		/* Bail immediately. */
   3.186 -+	  RESIZE_MALLOCED_BUFFER (token, token_index, ttoklen + 2,
   3.187 -+				  token_buffer_size, TOKEN_DEFAULT_GROW_SIZE);
   3.188 -+	  token[token_index++] = character;
   3.189 -+	  strcpy (token + token_index, ttok);
   3.190 -+	  token_index += ttoklen;
   3.191 -+	  FREE (ttok);
   3.192 -+	  dollar_present = all_digit_token = 0;
   3.193 -+	  goto next_character;
   3.194 -+        }
   3.195 -+#endif /* COND_REGEXP */
   3.196 -+
   3.197 - #ifdef EXTENDED_GLOB
   3.198 -       /* Parse a ksh-style extended pattern matching specification. */
   3.199 --      if (extended_glob && PATTERN_CHAR (character))
   3.200 -+      if MBTEST(extended_glob && PATTERN_CHAR (character))
   3.201 - 	{
   3.202 - 	  peek_char = shell_getc (1);
   3.203 - 	  if MBTEST(peek_char == '(')		/* ) */
   3.204 -Index: patchlevel.h
   3.205 ---- patchlevel.h.orig	2006-04-13 14:31:04 +0200
   3.206 -+++ patchlevel.h	2006-12-06 13:32:45 +0100
   3.207 -@@ -25,6 +25,6 @@
   3.208 -    regexp `^#define[ 	]*PATCHLEVEL', since that's what support/mkversion.sh
   3.209 -    looks for to find the patch level (for the sccs version string). */
   3.210 - 
   3.211 --#define PATCHLEVEL 0
   3.212 -+#define PATCHLEVEL 5
   3.213 - 
   3.214 - #endif /* _PATCHLEVEL_H_ */
   3.215 -Index: subst.c
   3.216 ---- subst.c.orig	2006-09-19 14:35:09 +0200
   3.217 -+++ subst.c	2006-12-06 13:32:45 +0100
   3.218 -@@ -5707,6 +5707,11 @@
   3.219 -   vtype &= ~VT_STARSUB;
   3.220 - 
   3.221 -   mflags = 0;
   3.222 -+  if (patsub && *patsub == '/')
   3.223 -+    {
   3.224 -+      mflags |= MATCH_GLOBREP;
   3.225 -+      patsub++;
   3.226 -+    }
   3.227 - 
   3.228 -   /* Malloc this because expand_string_if_necessary or one of the expansion
   3.229 -      functions in its call chain may free it on a substitution error. */
   3.230 -@@ -5741,13 +5746,12 @@
   3.231 -     }
   3.232 - 
   3.233 -   /* ksh93 doesn't allow the match specifier to be a part of the expanded
   3.234 --     pattern.  This is an extension. */
   3.235 -+     pattern.  This is an extension.  Make sure we don't anchor the pattern
   3.236 -+     at the beginning or end of the string if we're doing global replacement,
   3.237 -+     though. */
   3.238 -   p = pat;
   3.239 --  if (pat && pat[0] == '/')
   3.240 --    {
   3.241 --      mflags |= MATCH_GLOBREP|MATCH_ANY;
   3.242 --      p++;
   3.243 --    }
   3.244 -+  if (mflags & MATCH_GLOBREP)
   3.245 -+    mflags |= MATCH_ANY;
   3.246 -   else if (pat && pat[0] == '#')
   3.247 -     {
   3.248 -       mflags |= MATCH_BEG;
   3.249 -Index: y.tab.c
   3.250 ---- y.tab.c.orig	2006-09-25 14:15:16 +0200
   3.251 -+++ y.tab.c	2006-12-06 13:39:36 +0100
   3.252 -@@ -2359,6 +2359,7 @@
   3.253 - #define PST_CMDTOKEN	0x1000		/* command token OK - unused */
   3.254 - #define PST_COMPASSIGN	0x2000		/* parsing x=(...) compound assignment */
   3.255 - #define PST_ASSIGNOK	0x4000		/* assignment statement ok in this context */
   3.256 -+#define PST_REGEXP	0x8000		/* parsing an ERE/BRE as a single word */
   3.257 - 
   3.258 - /* Initial size to allocate for tokens, and the
   3.259 -    amount to grow them by. */
   3.260 -@@ -3921,6 +3922,9 @@
   3.261 -       return (character);
   3.262 -     }
   3.263 - 
   3.264 -+  if (parser_state & PST_REGEXP)
   3.265 -+    goto tokword;
   3.266 -+
   3.267 -   /* Shell meta-characters. */
   3.268 -   if MBTEST(shellmeta (character) && ((parser_state & PST_DBLPAREN) == 0))
   3.269 -     {
   3.270 -@@ -4028,6 +4032,7 @@
   3.271 -   if MBTEST(character == '-' && (last_read_token == LESS_AND || last_read_token == GREATER_AND))
   3.272 -     return (character);
   3.273 - 
   3.274 -+tokword:
   3.275 -   /* Okay, if we got this far, we have to read a word.  Read one,
   3.276 -      and then check it against the known ones. */
   3.277 -   result = read_token_word (character);
   3.278 -@@ -4065,7 +4070,7 @@
   3.279 - /* itrace("parse_matched_pair: open = %c close = %c", open, close); */
   3.280 -   count = 1;
   3.281 -   pass_next_character = backq_backslash = was_dollar = in_comment = 0;
   3.282 --  check_comment = (flags & P_COMMAND) && qc != '\'' && qc != '"' && (flags & P_DQUOTE) == 0;
   3.283 -+  check_comment = (flags & P_COMMAND) && qc != '`' && qc != '\'' && qc != '"' && (flags & P_DQUOTE) == 0;
   3.284 - 
   3.285 -   /* RFLAGS is the set of flags we want to pass to recursive calls. */
   3.286 -   rflags = (qc == '"') ? P_DQUOTE : (flags & P_DQUOTE);
   3.287 -@@ -4532,8 +4537,11 @@
   3.288 -       if (tok == WORD && test_binop (yylval.word->word))
   3.289 - 	op = yylval.word;
   3.290 - #if defined (COND_REGEXP)
   3.291 --      else if (tok == WORD && STREQ (yylval.word->word,"=~"))
   3.292 --	op = yylval.word;
   3.293 -+      else if (tok == WORD && STREQ (yylval.word->word, "=~"))
   3.294 -+	{
   3.295 -+	  op = yylval.word;
   3.296 -+	  parser_state |= PST_REGEXP;
   3.297 -+	}
   3.298 - #endif
   3.299 -       else if (tok == '<' || tok == '>')
   3.300 - 	op = make_word_from_token (tok);  /* ( */
   3.301 -@@ -4564,6 +4572,7 @@
   3.302 - 
   3.303 -       /* rhs */
   3.304 -       tok = read_token (READ);
   3.305 -+      parser_state &= ~PST_REGEXP;
   3.306 -       if (tok == WORD)
   3.307 - 	{
   3.308 - 	  tright = make_cond_node (COND_TERM, yylval.word, (COND_COM *)NULL, (COND_COM *)NULL);
   3.309 -@@ -4749,9 +4758,34 @@
   3.310 - 	  goto next_character;
   3.311 - 	}
   3.312 - 
   3.313 -+#ifdef COND_REGEXP
   3.314 -+      /* When parsing a regexp as a single word inside a conditional command,
   3.315 -+	 we need to special-case characters special to both the shell and
   3.316 -+	 regular expressions.  Right now, that is only '(' and '|'. */ /*)*/
   3.317 -+      if MBTEST((parser_state & PST_REGEXP) && (character == '(' || character == '|'))		/*)*/
   3.318 -+        {
   3.319 -+          if (character == '|')
   3.320 -+            goto got_character;
   3.321 -+
   3.322 -+	  push_delimiter (dstack, character);
   3.323 -+	  ttok = parse_matched_pair (cd, '(', ')', &ttoklen, 0);
   3.324 -+	  pop_delimiter (dstack);
   3.325 -+	  if (ttok == &matched_pair_error)
   3.326 -+	    return -1;		/* Bail immediately. */
   3.327 -+	  RESIZE_MALLOCED_BUFFER (token, token_index, ttoklen + 2,
   3.328 -+				  token_buffer_size, TOKEN_DEFAULT_GROW_SIZE);
   3.329 -+	  token[token_index++] = character;
   3.330 -+	  strcpy (token + token_index, ttok);
   3.331 -+	  token_index += ttoklen;
   3.332 -+	  FREE (ttok);
   3.333 -+	  dollar_present = all_digit_token = 0;
   3.334 -+	  goto next_character;
   3.335 -+        }
   3.336 -+#endif /* COND_REGEXP */
   3.337 -+
   3.338 - #ifdef EXTENDED_GLOB
   3.339 -       /* Parse a ksh-style extended pattern matching specification. */
   3.340 --      if (extended_glob && PATTERN_CHAR (character))
   3.341 -+      if MBTEST(extended_glob && PATTERN_CHAR (character))
   3.342 - 	{
   3.343 - 	  peek_char = shell_getc (1);
   3.344 - 	  if MBTEST(peek_char == '(')		/* ) */
   3.345 + # for chet
   3.346 + reconfig: force
   3.347  
   3.348  -----------------------------------------------------------------------------
   3.349  
   3.350 -Do not require autoconf. Fixes build on Solaris 10 8/07 u4 on sparc64
   3.351 +Fix Bash getcwd(3) run-time issue seen on Solaris where size argument
   3.352 +of 0 does not malloc buffer as expected by Bash code.
   3.353  
   3.354 -Index: Makefile.in
   3.355 ---- Makefile.in.orig	2006-08-17 20:03:35 +0200
   3.356 -+++ Makefile.in	2007-10-15 13:00:34 +0200
   3.357 -@@ -682,13 +682,9 @@
   3.358 - stamp-h:	config.status $(srcdir)/config.h.in $(srcdir)/config-top.h $(srcdir)/config-bot.h
   3.359 - 	CONFIG_FILES= CONFIG_HEADERS=config.h $(SHELL) ./config.status
   3.360 +Index: builtins/common.c
   3.361 +--- builtins/common.c.orig	2011-01-05 23:51:26.000000000 +0100
   3.362 ++++ builtins/common.c	2011-02-21 18:56:01.000000000 +0100
   3.363 +@@ -553,10 +553,11 @@
   3.364   
   3.365 --config.status:	$(srcdir)/configure
   3.366 -+config.status:
   3.367 - 	$(SHELL) ./config.status --recheck
   3.368 +   if (the_current_working_directory == 0)
   3.369 +     {
   3.370 ++      char *t = xmalloc(PATH_MAX);
   3.371 + #if defined (GETCWD_BROKEN)
   3.372 +-      the_current_working_directory = getcwd (0, PATH_MAX);
   3.373 ++      the_current_working_directory = getcwd (t, PATH_MAX);
   3.374 + #else
   3.375 +-      the_current_working_directory = getcwd (0, 0);
   3.376 ++      the_current_working_directory = getcwd (t, PATH_MAX);
   3.377 + #endif
   3.378 +       if (the_current_working_directory == 0)
   3.379 + 	{
   3.380 +
   3.381 +-----------------------------------------------------------------------------
   3.382 +
   3.383 +Fix building under Linux.
   3.384 +
   3.385 +Index: externs.h
   3.386 +--- externs.h.orig	2010-11-30 02:59:20.000000000 +0100
   3.387 ++++ externs.h	2011-02-21 18:56:01.000000000 +0100
   3.388 +@@ -25,6 +25,7 @@
   3.389 + #  define _EXTERNS_H_
   3.390   
   3.391 --# comment out for distribution
   3.392 --$(srcdir)/configure:	$(srcdir)/configure.in $(srcdir)/aclocal.m4 $(srcdir)/config.h.in
   3.393 --	cd $(srcdir) && autoconf
   3.394 --
   3.395 - # for chet
   3.396 - reconfig: force
   3.397 - 	sh $(srcdir)/configure -C
   3.398 + #include "stdc.h"
   3.399 ++#include <stdio.h>
   3.400 + 
   3.401 + /* Functions from expr.c. */
   3.402 + extern intmax_t evalexp __P((char *, int *));
   3.403 +

     4.1 --- /dev/null	Thu Jan 01 00:00:00 1970 +0000
     4.2 +++ b/openpkg/bash.patch.vendor	Tue Jul 31 12:23:42 2012 +0200
     4.3 @@ -0,0 +1,1507 @@
     4.4 +Index: assoc.c
     4.5 +--- assoc.c.orig	2009-08-06 02:19:40.000000000 +0200
     4.6 ++++ assoc.c	2012-06-27 10:31:02.000000000 +0200
     4.7 +@@ -77,6 +77,11 @@
     4.8 +   b = hash_search (key, hash, HASH_CREATE);
     4.9 +   if (b == 0)
    4.10 +     return -1;
    4.11 ++  /* If we are overwriting an existing element's value, we're not going to
    4.12 ++     use the key.  Nothing in the array assignment code path frees the key
    4.13 ++     string, so we can free it here to avoid a memory leak. */
    4.14 ++  if (b->key != key)
    4.15 ++    free (key);
    4.16 +   FREE (b->data);
    4.17 +   b->data = value ? savestring (value) : (char *)0;
    4.18 +   return (0);
    4.19 +Index: bashline.c
    4.20 +--- bashline.c.orig	2011-01-16 21:32:47.000000000 +0100
    4.21 ++++ bashline.c	2012-06-27 10:31:03.000000000 +0200
    4.22 +@@ -121,6 +121,9 @@
    4.23 + static int filename_completion_ignore __P((char **));
    4.24 + static int bash_push_line __P((void));
    4.25 + 
    4.26 ++static rl_icppfunc_t *save_directory_hook __P((void));
    4.27 ++static void reset_directory_hook __P((rl_icppfunc_t *));
    4.28 ++
    4.29 + static void cleanup_expansion_error __P((void));
    4.30 + static void maybe_make_readline_line __P((char *));
    4.31 + static void set_up_new_line __P((char *));
    4.32 +@@ -243,10 +246,17 @@
    4.33 + /* Perform spelling correction on directory names during word completion */
    4.34 + int dircomplete_spelling = 0;
    4.35 + 
    4.36 ++/* Expand directory names during word/filename completion. */
    4.37 ++int dircomplete_expand = 0;
    4.38 ++int dircomplete_expand_relpath = 0;
    4.39 ++
    4.40 + static char *bash_completer_word_break_characters = " \t\n\"'@><=;|&(:";
    4.41 + static char *bash_nohostname_word_break_characters = " \t\n\"'><=;|&(:";
    4.42 + /* )) */
    4.43 + 
    4.44 ++static const char *default_filename_quote_characters = " \t\n\\\"'@<>=;|&()#$`?*[!:{~";	/*}*/
    4.45 ++static char *custom_filename_quote_characters = 0;
    4.46 ++
    4.47 + static rl_hook_func_t *old_rl_startup_hook = (rl_hook_func_t *)NULL;
    4.48 + 
    4.49 + static int dot_in_path = 0;
    4.50 +@@ -501,7 +511,7 @@
    4.51 + 
    4.52 +   /* Tell the completer that we might want to follow symbolic links or
    4.53 +      do other expansion on directory names. */
    4.54 +-  rl_directory_rewrite_hook = bash_directory_completion_hook;
    4.55 ++  set_directory_hook ();
    4.56 + 
    4.57 +   rl_filename_rewrite_hook = bash_filename_rewrite_hook;
    4.58 + 
    4.59 +@@ -529,7 +539,7 @@
    4.60 +   enable_hostname_completion (perform_hostname_completion);
    4.61 + 
    4.62 +   /* characters that need to be quoted when appearing in filenames. */
    4.63 +-  rl_filename_quote_characters = " \t\n\\\"'@<>=;|&()#$`?*[!:{~";	/*}*/
    4.64 ++  rl_filename_quote_characters = default_filename_quote_characters;
    4.65 + 
    4.66 +   rl_filename_quoting_function = bash_quote_filename;
    4.67 +   rl_filename_dequoting_function = bash_dequote_filename;
    4.68 +@@ -564,8 +574,10 @@
    4.69 +   tilde_initialize ();
    4.70 +   rl_attempted_completion_function = attempt_shell_completion;
    4.71 +   rl_completion_entry_function = NULL;
    4.72 +-  rl_directory_rewrite_hook = bash_directory_completion_hook;
    4.73 +   rl_ignore_some_completions_function = filename_completion_ignore;
    4.74 ++  rl_filename_quote_characters = default_filename_quote_characters;
    4.75 ++
    4.76 ++  set_directory_hook ();
    4.77 + }
    4.78 + 
    4.79 + /* Contains the line to push into readline. */
    4.80 +@@ -1279,6 +1291,9 @@
    4.81 +   matches = (char **)NULL;
    4.82 +   rl_ignore_some_completions_function = filename_completion_ignore;
    4.83 + 
    4.84 ++  rl_filename_quote_characters = default_filename_quote_characters;
    4.85 ++  set_directory_hook ();
    4.86 ++
    4.87 +   /* Determine if this could be a command word.  It is if it appears at
    4.88 +      the start of the line (ignoring preceding whitespace), or if it
    4.89 +      appears after a character that separates commands.  It cannot be a
    4.90 +@@ -1591,6 +1606,12 @@
    4.91 + 	    }
    4.92 + 	  else
    4.93 + 	    {
    4.94 ++	     if (dircomplete_expand && dot_or_dotdot (filename_hint))
    4.95 ++		{
    4.96 ++		  dircomplete_expand = 0;
    4.97 ++		  set_directory_hook ();
    4.98 ++		  dircomplete_expand = 1;
    4.99 ++		}
   4.100 + 	      mapping_over = 4;
   4.101 + 	      goto inner;
   4.102 + 	    }
   4.103 +@@ -1791,6 +1812,9 @@
   4.104 + 
   4.105 +  inner:
   4.106 +   val = rl_filename_completion_function (filename_hint, istate);
   4.107 ++  if (mapping_over == 4 && dircomplete_expand)
   4.108 ++    set_directory_hook ();
   4.109 ++
   4.110 +   istate = 1;
   4.111 + 
   4.112 +   if (val == 0)
   4.113 +@@ -2693,6 +2717,52 @@
   4.114 +   return conv;
   4.115 + }
   4.116 + 
   4.117 ++/* Functions to save and restore the appropriate directory hook */
   4.118 ++/* This is not static so the shopt code can call it */
   4.119 ++void
   4.120 ++set_directory_hook ()
   4.121 ++{
   4.122 ++  if (dircomplete_expand)
   4.123 ++    {
   4.124 ++      rl_directory_completion_hook = bash_directory_completion_hook;
   4.125 ++      rl_directory_rewrite_hook = (rl_icppfunc_t *)0;
   4.126 ++    }
   4.127 ++  else
   4.128 ++    {
   4.129 ++      rl_directory_rewrite_hook = bash_directory_completion_hook;
   4.130 ++      rl_directory_completion_hook = (rl_icppfunc_t *)0;
   4.131 ++    }
   4.132 ++}
   4.133 ++
   4.134 ++static rl_icppfunc_t *
   4.135 ++save_directory_hook ()
   4.136 ++{
   4.137 ++  rl_icppfunc_t *ret;
   4.138 ++
   4.139 ++  if (dircomplete_expand)
   4.140 ++    {
   4.141 ++      ret = rl_directory_completion_hook;
   4.142 ++      rl_directory_completion_hook = (rl_icppfunc_t *)NULL;
   4.143 ++    }
   4.144 ++  else
   4.145 ++    {
   4.146 ++      ret = rl_directory_rewrite_hook;
   4.147 ++      rl_directory_rewrite_hook = (rl_icppfunc_t *)NULL;
   4.148 ++    }
   4.149 ++
   4.150 ++  return ret;
   4.151 ++}
   4.152 ++
   4.153 ++static void
   4.154 ++restore_directory_hook (hookf)
   4.155 ++     rl_icppfunc_t *hookf;
   4.156 ++{
   4.157 ++  if (dircomplete_expand)
   4.158 ++    rl_directory_completion_hook = hookf;
   4.159 ++  else
   4.160 ++    rl_directory_rewrite_hook = hookf;
   4.161 ++}
   4.162 ++
   4.163 + /* Handle symbolic link references and other directory name
   4.164 +    expansions while hacking completion.  This should return 1 if it modifies
   4.165 +    the DIRNAME argument, 0 otherwise.  It should make sure not to modify
   4.166 +@@ -2702,20 +2772,31 @@
   4.167 +      char **dirname;
   4.168 + {
   4.169 +   char *local_dirname, *new_dirname, *t;
   4.170 +-  int return_value, should_expand_dirname;
   4.171 ++  int return_value, should_expand_dirname, nextch, closer;
   4.172 +   WORD_LIST *wl;
   4.173 +   struct stat sb;
   4.174 + 
   4.175 +-  return_value = should_expand_dirname = 0;
   4.176 ++  return_value = should_expand_dirname = nextch = closer = 0;
   4.177 +   local_dirname = *dirname;
   4.178 + 
   4.179 +-  if (mbschr (local_dirname, '$'))
   4.180 +-    should_expand_dirname = 1;
   4.181 ++  if (t = mbschr (local_dirname, '$'))
   4.182 ++    {
   4.183 ++      should_expand_dirname = '$';
   4.184 ++      nextch = t[1];
   4.185 ++      /* Deliberately does not handle the deprecated $[...] arithmetic
   4.186 ++	 expansion syntax */
   4.187 ++      if (nextch == '(')
   4.188 ++	closer = ')';
   4.189 ++      else if (nextch == '{')
   4.190 ++	closer = '}';
   4.191 ++      else
   4.192 ++	nextch = 0;
   4.193 ++    }
   4.194 +   else
   4.195 +     {
   4.196 +       t = mbschr (local_dirname, '`');
   4.197 +       if (t && unclosed_pair (local_dirname, strlen (local_dirname), "`") == 0)
   4.198 +-	should_expand_dirname = 1;
   4.199 ++	should_expand_dirname = '`';
   4.200 +     }
   4.201 + 
   4.202 + #if defined (HAVE_LSTAT)
   4.203 +@@ -2739,6 +2820,23 @@
   4.204 + 	  free (new_dirname);
   4.205 + 	  dispose_words (wl);
   4.206 + 	  local_dirname = *dirname;
   4.207 ++	  /* XXX - change rl_filename_quote_characters here based on
   4.208 ++	     should_expand_dirname/nextch/closer.  This is the only place
   4.209 ++	     custom_filename_quote_characters is modified. */
   4.210 ++	  if (rl_filename_quote_characters && *rl_filename_quote_characters)
   4.211 ++	    {
   4.212 ++	      int i, j, c;
   4.213 ++	      i = strlen (default_filename_quote_characters);
   4.214 ++	      custom_filename_quote_characters = xrealloc (custom_filename_quote_characters, i+1);
   4.215 ++	      for (i = j = 0; c = default_filename_quote_characters[i]; i++)
   4.216 ++		{
   4.217 ++		  if (c == should_expand_dirname || c == nextch || c == closer)
   4.218 ++		    continue;
   4.219 ++		  custom_filename_quote_characters[j++] = c;
   4.220 ++		}
   4.221 ++	      custom_filename_quote_characters[j] = '\0';
   4.222 ++	      rl_filename_quote_characters = custom_filename_quote_characters;
   4.223 ++	    }
   4.224 + 	}
   4.225 +       else
   4.226 + 	{
   4.227 +@@ -2758,11 +2856,31 @@
   4.228 +       local_dirname = *dirname = new_dirname;
   4.229 +     }
   4.230 + 
   4.231 ++  /* no_symbolic_links == 0 -> use (default) logical view of the file system.
   4.232 ++     local_dirname[0] == '.' && local_dirname[1] == '/' means files in the
   4.233 ++     current directory (./).
   4.234 ++     local_dirname[0] == '.' && local_dirname[1] == 0 means relative pathnames
   4.235 ++     in the current directory (e.g., lib/sh).
   4.236 ++     XXX - should we do spelling correction on these? */
   4.237 ++
   4.238 ++  /* This is test as it was in bash-4.2: skip relative pathnames in current
   4.239 ++     directory.  Change test to
   4.240 ++      (local_dirname[0] != '.' || (local_dirname[1] && local_dirname[1] != '/'))
   4.241 ++     if we want to skip paths beginning with ./ also. */
   4.242 +   if (no_symbolic_links == 0 && (local_dirname[0] != '.' || local_dirname[1]))
   4.243 +     {
   4.244 +       char *temp1, *temp2;
   4.245 +       int len1, len2;
   4.246 + 
   4.247 ++      /* If we have a relative path
   4.248 ++      		(local_dirname[0] != '/' && local_dirname[0] != '.')
   4.249 ++	 that is canonical after appending it to the current directory, then
   4.250 ++	 	temp1 = temp2+'/'
   4.251 ++	 That is,
   4.252 ++	 	strcmp (temp1, temp2) == 0
   4.253 ++	 after adding a slash to temp2 below.  It should be safe to not
   4.254 ++	 change those.
   4.255 ++      */
   4.256 +       t = get_working_directory ("symlink-hook");
   4.257 +       temp1 = make_absolute (local_dirname, t);
   4.258 +       free (t);
   4.259 +@@ -2797,7 +2915,15 @@
   4.260 + 	      temp2[len2 + 1] = '\0';
   4.261 + 	    }
   4.262 + 	}
   4.263 +-      return_value |= STREQ (local_dirname, temp2) == 0;
   4.264 ++
   4.265 ++      /* dircomplete_expand_relpath == 0 means we want to leave relative
   4.266 ++	 pathnames that are unchanged by canonicalization alone.
   4.267 ++	 *local_dirname != '/' && *local_dirname != '.' == relative pathname
   4.268 ++	 (consistent with general.c:absolute_pathname())
   4.269 ++	 temp1 == temp2 (after appending a slash to temp2) means the pathname
   4.270 ++	 is not changed by canonicalization as described above. */
   4.271 ++      if (dircomplete_expand_relpath || ((local_dirname[0] != '/' && local_dirname[0] != '.') && STREQ (temp1, temp2) == 0))
   4.272 ++	return_value |= STREQ (local_dirname, temp2) == 0;
   4.273 +       free (local_dirname);
   4.274 +       *dirname = temp2;
   4.275 +       free (temp1);
   4.276 +@@ -3002,12 +3128,13 @@
   4.277 + 
   4.278 +   orig_func = rl_completion_entry_function;
   4.279 +   orig_attempt_func = rl_attempted_completion_function;
   4.280 +-  orig_dir_func = rl_directory_rewrite_hook;
   4.281 +   orig_ignore_func = rl_ignore_some_completions_function;
   4.282 +   orig_rl_completer_word_break_characters = rl_completer_word_break_characters;
   4.283 ++
   4.284 ++  orig_dir_func = save_directory_hook ();
   4.285 ++
   4.286 +   rl_completion_entry_function = rl_filename_completion_function;
   4.287 +   rl_attempted_completion_function = (rl_completion_func_t *)NULL;
   4.288 +-  rl_directory_rewrite_hook = (rl_icppfunc_t *)NULL;
   4.289 +   rl_ignore_some_completions_function = filename_completion_ignore;
   4.290 +   rl_completer_word_break_characters = " \t\n\"\'";
   4.291 + 
   4.292 +@@ -3015,10 +3142,11 @@
   4.293 + 
   4.294 +   rl_completion_entry_function = orig_func;
   4.295 +   rl_attempted_completion_function = orig_attempt_func;
   4.296 +-  rl_directory_rewrite_hook = orig_dir_func;
   4.297 +   rl_ignore_some_completions_function = orig_ignore_func;
   4.298 +   rl_completer_word_break_characters = orig_rl_completer_word_break_characters;
   4.299 + 
   4.300 ++  restore_directory_hook (orig_dir_func);
   4.301 ++
   4.302 +   return r;
   4.303 + }
   4.304 + 
   4.305 +Index: bashline.h
   4.306 +--- bashline.h.orig	2009-01-04 20:32:22.000000000 +0100
   4.307 ++++ bashline.h	2012-06-27 10:31:03.000000000 +0200
   4.308 +@@ -33,10 +33,15 @@
   4.309 + extern void bashline_reinitialize __P((void));
   4.310 + extern int bash_re_edit __P((char *));
   4.311 + 
   4.312 ++extern void bashline_set_event_hook __P((void));
   4.313 ++extern void bashline_reset_event_hook __P((void));
   4.314 ++
   4.315 + extern int bind_keyseq_to_unix_command __P((char *));
   4.316 + 
   4.317 + extern char **bash_default_completion __P((const char *, int, int, int, int));
   4.318 + 
   4.319 ++void set_directory_hook __P((void));
   4.320 ++
   4.321 + /* Used by programmable completion code. */
   4.322 + extern char *command_word_completion_function __P((const char *, int));
   4.323 + extern char *bash_groupname_completion_function __P((const char *, int));
   4.324 +Index: builtins/declare.def
   4.325 +--- builtins/declare.def.orig	2010-05-31 00:25:21.000000000 +0200
   4.326 ++++ builtins/declare.def	2012-06-27 10:31:02.000000000 +0200
   4.327 +@@ -513,6 +513,11 @@
   4.328 + 	      *subscript_start = '[';	/* ] */
   4.329 + 	      var = assign_array_element (name, value, 0);	/* XXX - not aflags */
   4.330 + 	      *subscript_start = '\0';
   4.331 ++	      if (var == 0)	/* some kind of assignment error */
   4.332 ++		{
   4.333 ++		  assign_error++;
   4.334 ++		  NEXT_VARIABLE ();
   4.335 ++		}
   4.336 + 	    }
   4.337 + 	  else if (simple_array_assign)
   4.338 + 	    {
   4.339 +Index: builtins/fc.def
   4.340 +--- builtins/fc.def.orig	2010-05-31 00:25:38.000000000 +0200
   4.341 ++++ builtins/fc.def	2012-06-27 10:31:02.000000000 +0200
   4.342 +@@ -304,7 +304,7 @@
   4.343 +   last_hist = i - rh - hist_last_line_added;
   4.344 + 
   4.345 +   /* XXX */
   4.346 +-  if (saved_command_line_count > 0 && i == last_hist && hlist[last_hist] == 0)
   4.347 ++  if (i == last_hist && hlist[last_hist] == 0)
   4.348 +     while (last_hist >= 0 && hlist[last_hist] == 0)
   4.349 +       last_hist--;
   4.350 +   if (last_hist < 0)
   4.351 +@@ -475,7 +475,7 @@
   4.352 +      HIST_ENTRY **hlist;
   4.353 + {
   4.354 +   int sign, n, clen, rh;
   4.355 +-  register int i, j;
   4.356 ++  register int i, j, last_hist;
   4.357 +   register char *s;
   4.358 + 
   4.359 +   sign = 1;
   4.360 +@@ -495,7 +495,15 @@
   4.361 +      has been enabled (interactive or not) should use it in the last_hist
   4.362 +      calculation as if it were on. */
   4.363 +   rh = remember_on_history || ((subshell_environment & SUBSHELL_COMSUB) && enable_history_list);
   4.364 +-  i -= rh + hist_last_line_added;
   4.365 ++  last_hist = i - rh - hist_last_line_added;
   4.366 ++
   4.367 ++  if (i == last_hist && hlist[last_hist] == 0)
   4.368 ++    while (last_hist >= 0 && hlist[last_hist] == 0)
   4.369 ++      last_hist--;
   4.370 ++  if (last_hist < 0)
   4.371 ++    return (-1);
   4.372 ++
   4.373 ++  i = last_hist;
   4.374 + 
   4.375 +   /* No specification defaults to most recent command. */
   4.376 +   if (command == NULL)
   4.377 +Index: builtins/printf.def
   4.378 +--- builtins/printf.def.orig	2010-11-23 16:02:55.000000000 +0100
   4.379 ++++ builtins/printf.def	2012-06-27 10:31:02.000000000 +0200
   4.380 +@@ -255,6 +255,8 @@
   4.381 + #endif
   4.382 + 	    {
   4.383 + 	      vflag = 1;
   4.384 ++	      if (vbsize == 0)
   4.385 ++		vbuf = xmalloc (vbsize = 16);
   4.386 + 	      vblen = 0;
   4.387 + 	      if (vbuf)
   4.388 + 		vbuf[0] = 0;
   4.389 +@@ -465,6 +467,9 @@
   4.390 + 		  secs = shell_start_time;	/* roughly $SECONDS */
   4.391 + 		else
   4.392 + 		  secs = arg;
   4.393 ++#if defined (HAVE_TZSET)
   4.394 ++		sv_tz ("TZ");		/* XXX -- just make sure */
   4.395 ++#endif
   4.396 + 		tm = localtime (&secs);
   4.397 + 		n = strftime (timebuf, sizeof (timebuf), timefmt, tm);
   4.398 + 		free (timefmt);
   4.399 +Index: builtins/read.def
   4.400 +--- builtins/read.def.orig	2011-01-04 17:43:36.000000000 +0100
   4.401 ++++ builtins/read.def	2012-06-27 10:31:02.000000000 +0200
   4.402 +@@ -642,6 +642,12 @@
   4.403 + 	  xfree (input_string);
   4.404 + 	  return EXECUTION_FAILURE;	/* readonly or noassign */
   4.405 + 	}
   4.406 ++      if (assoc_p (var))
   4.407 ++	{
   4.408 ++          builtin_error (_("%s: cannot convert associative to indexed array"), arrayname);
   4.409 ++	  xfree (input_string);
   4.410 ++	  return EXECUTION_FAILURE;	/* existing associative array */
   4.411 ++	}
   4.412 +       array_flush (array_cell (var));
   4.413 + 
   4.414 +       alist = list_string (input_string, ifs_chars, 0);
   4.415 +@@ -731,7 +737,7 @@
   4.416 + 	      xfree (t1);
   4.417 + 	    }
   4.418 + 	  else
   4.419 +-	    var = bind_read_variable (varname, t);
   4.420 ++	    var = bind_read_variable (varname, t ? t : "");
   4.421 + 	}
   4.422 +       else
   4.423 + 	{
   4.424 +@@ -792,7 +798,7 @@
   4.425 +       xfree (t);
   4.426 +     }
   4.427 +   else
   4.428 +-    var = bind_read_variable (list->word->word, input_string);
   4.429 ++    var = bind_read_variable (list->word->word, input_string ? input_string : "");
   4.430 + 
   4.431 +   if (var)
   4.432 +     {
   4.433 +Index: builtins/shopt.def
   4.434 +--- builtins/shopt.def.orig	2010-07-03 04:42:44.000000000 +0200
   4.435 ++++ builtins/shopt.def	2012-06-27 10:31:03.000000000 +0200
   4.436 +@@ -61,6 +61,10 @@
   4.437 + #include "common.h"
   4.438 + #include "bashgetopt.h"
   4.439 + 
   4.440 ++#if defined (READLINE)
   4.441 ++#  include "../bashline.h"
   4.442 ++#endif
   4.443 ++
   4.444 + #if defined (HISTORY)
   4.445 + #  include "../bashhist.h"
   4.446 + #endif
   4.447 +@@ -94,7 +98,7 @@
   4.448 + extern int hist_verify, history_reediting, perform_hostname_completion;
   4.449 + extern int no_empty_command_completion;
   4.450 + extern int force_fignore;
   4.451 +-extern int dircomplete_spelling;
   4.452 ++extern int dircomplete_spelling, dircomplete_expand;
   4.453 + 
   4.454 + extern int enable_hostname_completion __P((int));
   4.455 + #endif
   4.456 +@@ -121,6 +125,10 @@
   4.457 + static int set_restricted_shell __P((char *, int));
   4.458 + #endif
   4.459 + 
   4.460 ++#if defined (READLINE)
   4.461 ++static int shopt_set_complete_direxpand __P((char *, int));
   4.462 ++#endif
   4.463 ++
   4.464 + static int shopt_login_shell;
   4.465 + static int shopt_compat31;
   4.466 + static int shopt_compat32;
   4.467 +@@ -150,6 +158,7 @@
   4.468 +   { "compat40", &shopt_compat40, set_compatibility_level },
   4.469 +   { "compat41", &shopt_compat41, set_compatibility_level },
   4.470 + #if defined (READLINE)
   4.471 ++  { "direxpand", &dircomplete_expand, shopt_set_complete_direxpand },
   4.472 +   { "dirspell", &dircomplete_spelling, (shopt_set_func_t *)NULL },
   4.473 + #endif
   4.474 +   { "dotglob", &glob_dot_filenames, (shopt_set_func_t *)NULL },
   4.475 +@@ -535,6 +544,17 @@
   4.476 +   return 0;
   4.477 + }
   4.478 + 
   4.479 ++#if defined (READLINE)
   4.480 ++static int
   4.481 ++shopt_set_complete_direxpand (option_name, mode)
   4.482 ++     char *option_name;
   4.483 ++     int mode;
   4.484 ++{
   4.485 ++  set_directory_hook ();
   4.486 ++  return 0;
   4.487 ++}
   4.488 ++#endif
   4.489 ++
   4.490 + #if defined (RESTRICTED_SHELL)
   4.491 + /* Don't allow the value of restricted_shell to be modified. */
   4.492 + 
   4.493 +Index: command.h
   4.494 +--- command.h.orig	2010-08-03 01:36:51.000000000 +0200
   4.495 ++++ command.h	2012-06-27 10:31:02.000000000 +0200
   4.496 +@@ -97,6 +97,7 @@
   4.497 + #define W_HASCTLESC	0x200000	/* word contains literal CTLESC characters */
   4.498 + #define W_ASSIGNASSOC	0x400000	/* word looks like associative array assignment */
   4.499 + #define W_ARRAYIND	0x800000	/* word is an array index being expanded */
   4.500 ++#define W_ASSNGLOBAL	0x1000000	/* word is a global assignment to declare (declare/typeset -g) */
   4.501 + 
   4.502 + /* Possible values for subshell_environment */
   4.503 + #define SUBSHELL_ASYNC	0x01	/* subshell caused by `command &' */
   4.504 +Index: doc/bash.1
   4.505 +--- doc/bash.1.orig	2011-01-16 21:31:39.000000000 +0100
   4.506 ++++ doc/bash.1	2012-06-27 10:31:03.000000000 +0200
   4.507 +@@ -8948,6 +8948,16 @@
   4.508 + quoted.  This is the behavior of posix mode through version 4.1.
   4.509 + The default bash behavior remains as in previous versions.
   4.510 + .TP 8
   4.511 ++.B direxpand
   4.512 ++If set,
   4.513 ++.B bash
   4.514 ++replaces directory names with the results of word expansion when performing
   4.515 ++filename completion.  This changes the contents of the readline editing
   4.516 ++buffer.
   4.517 ++If not set,
   4.518 ++.B bash
   4.519 ++attempts to preserve what the user typed.
   4.520 ++.TP 8
   4.521 + .B dirspell
   4.522 + If set,
   4.523 + .B bash
   4.524 +Index: doc/bashref.texi
   4.525 +--- doc/bashref.texi.orig	2011-01-16 21:31:57.000000000 +0100
   4.526 ++++ doc/bashref.texi	2012-06-27 10:31:03.000000000 +0200
   4.527 +@@ -4535,6 +4535,13 @@
   4.528 + quoted.  This is the behavior of @sc{posix} mode through version 4.1.
   4.529 + The default Bash behavior remains as in previous versions.
   4.530 + 
   4.531 ++@item direxpand
   4.532 ++If set, Bash
   4.533 ++replaces directory names with the results of word expansion when performing
   4.534 ++filename completion.  This changes the contents of the readline editing
   4.535 ++buffer.
   4.536 ++If not set, Bash attempts to preserve what the user typed.
   4.537 ++
   4.538 + @item dirspell
   4.539 + If set, Bash
   4.540 + attempts spelling correction on directory names during word completion 
   4.541 +Index: error.c
   4.542 +--- error.c.orig	2009-08-22 04:31:31.000000000 +0200
   4.543 ++++ error.c	2012-06-27 10:31:02.000000000 +0200
   4.544 +@@ -200,7 +200,11 @@
   4.545 + 
   4.546 +   va_end (args);
   4.547 +   if (exit_immediately_on_error)
   4.548 +-    exit_shell (1);
   4.549 ++    {
   4.550 ++      if (last_command_exit_value == 0)
   4.551 ++	last_command_exit_value = 1;
   4.552 ++      exit_shell (last_command_exit_value);
   4.553 ++    }
   4.554 + }
   4.555 + 
   4.556 + void
   4.557 +Index: execute_cmd.c
   4.558 +--- execute_cmd.c.orig	2011-02-09 23:32:25.000000000 +0100
   4.559 ++++ execute_cmd.c	2012-06-27 10:31:03.000000000 +0200
   4.560 +@@ -2196,6 +2196,7 @@
   4.561 +   if (ignore_return && cmd)
   4.562 +     cmd->flags |= CMD_IGNORE_RETURN;
   4.563 + 
   4.564 ++#if defined (JOB_CONTROL)
   4.565 +   lastpipe_flag = 0;
   4.566 +   begin_unwind_frame ("lastpipe-exec");
   4.567 +   lstdin = -1;
   4.568 +@@ -2204,7 +2205,7 @@
   4.569 +      current shell environment. */
   4.570 +   if (lastpipe_opt && job_control == 0 && asynchronous == 0 && pipe_out == NO_PIPE && prev > 0)
   4.571 +     {
   4.572 +-      lstdin = move_to_high_fd (0, 0, 255);
   4.573 ++      lstdin = move_to_high_fd (0, 1, -1);
   4.574 +       if (lstdin > 0)
   4.575 + 	{
   4.576 + 	  do_piping (prev, pipe_out);
   4.577 +@@ -2215,15 +2216,19 @@
   4.578 + 	  lastpipe_jid = stop_pipeline (0, (COMMAND *)NULL);	/* XXX */
   4.579 + 	  add_unwind_protect (lastpipe_cleanup, lastpipe_jid);
   4.580 + 	}
   4.581 +-      cmd->flags |= CMD_LASTPIPE;
   4.582 ++      if (cmd)
   4.583 ++	cmd->flags |= CMD_LASTPIPE;
   4.584 +     }	  
   4.585 +   if (prev >= 0)
   4.586 +     add_unwind_protect (close, prev);
   4.587 ++#endif
   4.588 + 
   4.589 +   exec_result = execute_command_internal (cmd, asynchronous, prev, pipe_out, fds_to_close);
   4.590 + 
   4.591 ++#if defined (JOB_CONTROL)
   4.592 +   if (lstdin > 0)
   4.593 +     restore_stdin (lstdin);
   4.594 ++#endif
   4.595 + 
   4.596 +   if (prev >= 0)
   4.597 +     close (prev);
   4.598 +@@ -2246,7 +2251,9 @@
   4.599 +       unfreeze_jobs_list ();
   4.600 +     }
   4.601 + 
   4.602 ++#if defined (JOB_CONTROL)
   4.603 +   discard_unwind_frame ("lastpipe-exec");
   4.604 ++#endif
   4.605 + 
   4.606 +   return (exec_result);
   4.607 + }
   4.608 +@@ -3575,13 +3582,13 @@
   4.609 + {
   4.610 +   WORD_LIST *w;
   4.611 +   struct builtin *b;
   4.612 +-  int assoc;
   4.613 ++  int assoc, global;
   4.614 + 
   4.615 +   if (words == 0)
   4.616 +     return;
   4.617 + 
   4.618 +   b = 0;
   4.619 +-  assoc = 0;
   4.620 ++  assoc = global = 0;
   4.621 + 
   4.622 +   for (w = words; w; w = w->next)
   4.623 +     if (w->word->flags & W_ASSIGNMENT)
   4.624 +@@ -3598,12 +3605,17 @@
   4.625 + #if defined (ARRAY_VARS)
   4.626 + 	if (assoc)
   4.627 + 	  w->word->flags |= W_ASSIGNASSOC;
   4.628 ++	if (global)
   4.629 ++	  w->word->flags |= W_ASSNGLOBAL;
   4.630 + #endif
   4.631 +       }
   4.632 + #if defined (ARRAY_VARS)
   4.633 +     /* Note that we saw an associative array option to a builtin that takes
   4.634 +        assignment statements.  This is a bit of a kludge. */
   4.635 +-    else if (w->word->word[0] == '-' && strchr (w->word->word, 'A'))
   4.636 ++    else if (w->word->word[0] == '-' && (strchr (w->word->word+1, 'A') || strchr (w->word->word+1, 'g')))
   4.637 ++#else
   4.638 ++    else if (w->word->word[0] == '-' && strchr (w->word->word+1, 'g'))
   4.639 ++#endif
   4.640 +       {
   4.641 + 	if (b == 0)
   4.642 + 	  {
   4.643 +@@ -3613,10 +3625,11 @@
   4.644 + 	    else if (b && (b->flags & ASSIGNMENT_BUILTIN))
   4.645 + 	      words->word->flags |= W_ASSNBLTIN;
   4.646 + 	  }
   4.647 +-	if (words->word->flags & W_ASSNBLTIN)
   4.648 ++	if ((words->word->flags & W_ASSNBLTIN) && strchr (w->word->word+1, 'A'))
   4.649 + 	  assoc = 1;
   4.650 ++	if ((words->word->flags & W_ASSNBLTIN) && strchr (w->word->word+1, 'g'))
   4.651 ++	  global = 1;
   4.652 +       }
   4.653 +-#endif
   4.654 + }
   4.655 + 
   4.656 + /* Return 1 if the file found by searching $PATH for PATHNAME, defaulting
   4.657 +Index: expr.c
   4.658 +--- expr.c.orig	2010-12-21 17:12:13.000000000 +0100
   4.659 ++++ expr.c	2012-06-27 10:31:02.000000000 +0200
   4.660 +@@ -476,19 +476,23 @@
   4.661 + 
   4.662 +       if (special)
   4.663 + 	{
   4.664 ++	  if ((op == DIV || op == MOD) && value == 0)
   4.665 ++	    {
   4.666 ++	      if (noeval == 0)
   4.667 ++		evalerror (_("division by 0"));
   4.668 ++	      else
   4.669 ++	        value = 1;
   4.670 ++	    }
   4.671 ++
   4.672 + 	  switch (op)
   4.673 + 	    {
   4.674 + 	    case MUL:
   4.675 + 	      lvalue *= value;
   4.676 + 	      break;
   4.677 + 	    case DIV:
   4.678 +-	      if (value == 0)
   4.679 +-		evalerror (_("division by 0"));
   4.680 + 	      lvalue /= value;
   4.681 + 	      break;
   4.682 + 	    case MOD:
   4.683 +-	      if (value == 0)
   4.684 +-		evalerror (_("division by 0"));
   4.685 + 	      lvalue %= value;
   4.686 + 	      break;
   4.687 + 	    case PLUS:
   4.688 +@@ -804,7 +808,12 @@
   4.689 +       val2 = exppower ();
   4.690 + 
   4.691 +       if (((op == DIV) || (op == MOD)) && (val2 == 0))
   4.692 +-	evalerror (_("division by 0"));
   4.693 ++	{
   4.694 ++	  if (noeval == 0)
   4.695 ++	    evalerror (_("division by 0"));
   4.696 ++	  else
   4.697 ++	    val2 = 1;
   4.698 ++	}
   4.699 + 
   4.700 +       if (op == MUL)
   4.701 + 	val1 *= val2;
   4.702 +Index: lib/glob/gmisc.c
   4.703 +--- lib/glob/gmisc.c.orig	2011-02-05 22:11:17.000000000 +0100
   4.704 ++++ lib/glob/gmisc.c	2012-06-27 10:31:02.000000000 +0200
   4.705 +@@ -77,8 +77,8 @@
   4.706 +      wchar_t *wpat;
   4.707 +      size_t wmax;
   4.708 + {
   4.709 +-  wchar_t wc, *wbrack;
   4.710 +-  int matlen, t, in_cclass, in_collsym, in_equiv;
   4.711 ++  wchar_t wc;
   4.712 ++  int matlen, bracklen, t, in_cclass, in_collsym, in_equiv;
   4.713 + 
   4.714 +   if (*wpat == 0)
   4.715 +     return (0);
   4.716 +@@ -118,58 +118,80 @@
   4.717 + 	  break;
   4.718 + 	case L'[':
   4.719 + 	  /* scan for ending `]', skipping over embedded [:...:] */
   4.720 +-	  wbrack = wpat;
   4.721 ++	  bracklen = 1;
   4.722 + 	  wc = *wpat++;
   4.723 + 	  do
   4.724 + 	    {
   4.725 + 	      if (wc == 0)
   4.726 + 		{
   4.727 +-	          matlen += wpat - wbrack - 1;	/* incremented below */
   4.728 +-	          break;
   4.729 ++		  wpat--;			/* back up to NUL */
   4.730 ++	          matlen += bracklen;
   4.731 ++	          goto bad_bracket;
   4.732 + 	        }
   4.733 + 	      else if (wc == L'\\')
   4.734 + 		{
   4.735 +-		  wc = *wpat++;
   4.736 +-		  if (*wpat == 0)
   4.737 +-		    break;
   4.738 ++		  /* *wpat == backslash-escaped character */
   4.739 ++		  bracklen++;
   4.740 ++		  /* If the backslash or backslash-escape ends the string,
   4.741 ++		     bail.  The ++wpat skips over the backslash escape */
   4.742 ++		  if (*wpat == 0 || *++wpat == 0)
   4.743 ++		    {
   4.744 ++		      matlen += bracklen;
   4.745 ++		      goto bad_bracket;
   4.746 ++		    }
   4.747 + 		}
   4.748 + 	      else if (wc == L'[' && *wpat == L':')	/* character class */
   4.749 + 		{
   4.750 + 		  wpat++;
   4.751 ++		  bracklen++;
   4.752 + 		  in_cclass = 1;
   4.753 + 		}
   4.754 + 	      else if (in_cclass && wc == L':' && *wpat == L']')
   4.755 + 		{
   4.756 + 		  wpat++;
   4.757 ++		  bracklen++;
   4.758 + 		  in_cclass = 0;
   4.759 + 		}
   4.760 + 	      else if (wc == L'[' && *wpat == L'.')	/* collating symbol */
   4.761 + 		{
   4.762 + 		  wpat++;
   4.763 ++		  bracklen++;
   4.764 + 		  if (*wpat == L']')	/* right bracket can appear as collating symbol */
   4.765 +-		    wpat++;
   4.766 ++		    {
   4.767 ++		      wpat++;
   4.768 ++		      bracklen++;
   4.769 ++		    }
   4.770 + 		  in_collsym = 1;
   4.771 + 		}
   4.772 + 	      else if (in_collsym && wc == L'.' && *wpat == L']')
   4.773 + 		{
   4.774 + 		  wpat++;
   4.775 ++		  bracklen++;
   4.776 + 		  in_collsym = 0;
   4.777 + 		}
   4.778 + 	      else if (wc == L'[' && *wpat == L'=')	/* equivalence class */
   4.779 + 		{
   4.780 + 		  wpat++;
   4.781 ++		  bracklen++;
   4.782 + 		  if (*wpat == L']')	/* right bracket can appear as equivalence class */
   4.783 +-		    wpat++;
   4.784 ++		    {
   4.785 ++		      wpat++;
   4.786 ++		      bracklen++;
   4.787 ++		    }
   4.788 + 		  in_equiv = 1;
   4.789 + 		}
   4.790 + 	      else if (in_equiv && wc == L'=' && *wpat == L']')
   4.791 + 		{
   4.792 + 		  wpat++;
   4.793 ++		  bracklen++;
   4.794 + 		  in_equiv = 0;
   4.795 + 		}
   4.796 ++	      else
   4.797 ++		bracklen++;
   4.798 + 	    }
   4.799 + 	  while ((wc = *wpat++) != L']');
   4.800 + 	  matlen++;		/* bracket expression can only match one char */
   4.801 ++bad_bracket:
   4.802 + 	  break;
   4.803 + 	}
   4.804 +     }
   4.805 +@@ -213,8 +235,8 @@
   4.806 +      char *pat;
   4.807 +      size_t max;
   4.808 + {
   4.809 +-  char c, *brack;
   4.810 +-  int matlen, t, in_cclass, in_collsym, in_equiv;
   4.811 ++  char c;
   4.812 ++  int matlen, bracklen, t, in_cclass, in_collsym, in_equiv;
   4.813 + 
   4.814 +   if (*pat == 0)
   4.815 +     return (0);
   4.816 +@@ -254,58 +276,80 @@
   4.817 + 	  break;
   4.818 + 	case '[':
   4.819 + 	  /* scan for ending `]', skipping over embedded [:...:] */
   4.820 +-	  brack = pat;
   4.821 ++	  bracklen = 1;
   4.822 + 	  c = *pat++;
   4.823 + 	  do
   4.824 + 	    {
   4.825 + 	      if (c == 0)
   4.826 + 		{
   4.827 +-	          matlen += pat - brack - 1;	/* incremented below */
   4.828 +-	          break;
   4.829 ++		  pat--;			/* back up to NUL */
   4.830 ++		  matlen += bracklen;
   4.831 ++		  goto bad_bracket;
   4.832 + 	        }
   4.833 + 	      else if (c == '\\')
   4.834 + 		{
   4.835 +-		  c = *pat++;
   4.836 +-		  if (*pat == 0)
   4.837 +-		    break;
   4.838 ++		  /* *pat == backslash-escaped character */
   4.839 ++		  bracklen++;
   4.840 ++		  /* If the backslash or backslash-escape ends the string,
   4.841 ++		     bail.  The ++pat skips over the backslash escape */
   4.842 ++		  if (*pat == 0 || *++pat == 0)
   4.843 ++		    {
   4.844 ++		      matlen += bracklen;
   4.845 ++		      goto bad_bracket;
   4.846 ++		    }
   4.847 + 		}
   4.848 + 	      else if (c == '[' && *pat == ':')	/* character class */
   4.849 + 		{
   4.850 + 		  pat++;
   4.851 ++		  bracklen++;
   4.852 + 		  in_cclass = 1;
   4.853 + 		}
   4.854 + 	      else if (in_cclass && c == ':' && *pat == ']')
   4.855 + 		{
   4.856 + 		  pat++;
   4.857 ++		  bracklen++;
   4.858 + 		  in_cclass = 0;
   4.859 + 		}
   4.860 + 	      else if (c == '[' && *pat == '.')	/* collating symbol */
   4.861 + 		{
   4.862 + 		  pat++;
   4.863 ++		  bracklen++;
   4.864 + 		  if (*pat == ']')	/* right bracket can appear as collating symbol */
   4.865 +-		    pat++;
   4.866 ++		    {
   4.867 ++		      pat++;
   4.868 ++		      bracklen++;
   4.869 ++		    }
   4.870 + 		  in_collsym = 1;
   4.871 + 		}
   4.872 + 	      else if (in_collsym && c == '.' && *pat == ']')
   4.873 + 		{
   4.874 + 		  pat++;
   4.875 ++		  bracklen++;
   4.876 + 		  in_collsym = 0;
   4.877 + 		}
   4.878 + 	      else if (c == '[' && *pat == '=')	/* equivalence class */
   4.879 + 		{
   4.880 + 		  pat++;
   4.881 ++		  bracklen++;
   4.882 + 		  if (*pat == ']')	/* right bracket can appear as equivalence class */
   4.883 +-		    pat++;
   4.884 ++		    {
   4.885 ++		      pat++;
   4.886 ++		      bracklen++;
   4.887 ++		    }
   4.888 + 		  in_equiv = 1;
   4.889 + 		}
   4.890 + 	      else if (in_equiv && c == '=' && *pat == ']')
   4.891 + 		{
   4.892 + 		  pat++;
   4.893 ++		  bracklen++;
   4.894 + 		  in_equiv = 0;
   4.895 + 		}
   4.896 ++	      else
   4.897 ++		bracklen++;
   4.898 + 	    }
   4.899 + 	  while ((c = *pat++) != ']');
   4.900 + 	  matlen++;		/* bracket expression can only match one char */
   4.901 ++bad_bracket:
   4.902 + 	  break;
   4.903 + 	}
   4.904 +     }
   4.905 +Index: lib/readline/callback.c
   4.906 +--- lib/readline/callback.c.orig	2010-06-06 18:18:58.000000000 +0200
   4.907 ++++ lib/readline/callback.c	2012-06-27 10:31:02.000000000 +0200
   4.908 +@@ -148,6 +148,9 @@
   4.909 + 	  eof = _rl_vi_domove_callback (_rl_vimvcxt);
   4.910 + 	  /* Should handle everything, including cleanup, numeric arguments,
   4.911 + 	     and turning off RL_STATE_VIMOTION */
   4.912 ++	  if (RL_ISSTATE (RL_STATE_NUMERICARG) == 0)
   4.913 ++	    _rl_internal_char_cleanup ();
   4.914 ++
   4.915 + 	  return;
   4.916 + 	}
   4.917 + #endif
   4.918 +Index: lib/readline/vi_mode.c
   4.919 +--- lib/readline/vi_mode.c.orig	2010-11-21 01:51:39.000000000 +0100
   4.920 ++++ lib/readline/vi_mode.c	2012-06-27 10:31:02.000000000 +0200
   4.921 +@@ -1114,7 +1114,7 @@
   4.922 +       rl_beg_of_line (1, c);
   4.923 +       _rl_vi_last_motion = c;
   4.924 +       RL_UNSETSTATE (RL_STATE_VIMOTION);
   4.925 +-      return (0);
   4.926 ++      return (vidomove_dispatch (m));
   4.927 +     }
   4.928 + #if defined (READLINE_CALLBACKS)
   4.929 +   /* XXX - these need to handle rl_universal_argument bindings */
   4.930 +Index: lib/sh/zread.c
   4.931 +--- lib/sh/zread.c.orig	2009-03-02 14:54:45.000000000 +0100
   4.932 ++++ lib/sh/zread.c	2012-06-27 10:31:02.000000000 +0200
   4.933 +@@ -160,14 +160,13 @@
   4.934 + zsyncfd (fd)
   4.935 +      int fd;
   4.936 + {
   4.937 +-  off_t off;
   4.938 +-  int r;
   4.939 ++  off_t off, r;
   4.940 + 
   4.941 +   off = lused - lind;
   4.942 +   r = 0;
   4.943 +   if (off > 0)
   4.944 +     r = lseek (fd, -off, SEEK_CUR);
   4.945 + 
   4.946 +-  if (r >= 0)
   4.947 ++  if (r != -1)
   4.948 +     lused = lind = 0;
   4.949 + }
   4.950 +Index: parse.y
   4.951 +--- parse.y.orig	2011-01-02 21:48:11.000000000 +0100
   4.952 ++++ parse.y	2012-06-27 10:31:02.000000000 +0200
   4.953 +@@ -2499,7 +2499,7 @@
   4.954 + 	 We do this only if it is time to do so. Notice that only here
   4.955 + 	 is the mail alarm reset; nothing takes place in check_mail ()
   4.956 + 	 except the checking of mail.  Please don't change this. */
   4.957 +-      if (prompt_is_ps1 && time_to_check_mail ())
   4.958 ++      if (prompt_is_ps1 && parse_and_execute_level == 0 && time_to_check_mail ())
   4.959 + 	{
   4.960 + 	  check_mail ();
   4.961 + 	  reset_mail_timer ();
   4.962 +@@ -3842,6 +3842,7 @@
   4.963 +      int flags;
   4.964 + {
   4.965 +   sh_parser_state_t ps;
   4.966 ++  sh_input_line_state_t ls;
   4.967 +   int orig_ind, nc, sflags;
   4.968 +   char *ret, *s, *ep, *ostring;
   4.969 + 
   4.970 +@@ -3849,10 +3850,12 @@
   4.971 +   orig_ind = *indp;
   4.972 +   ostring = string;
   4.973 + 
   4.974 ++/*itrace("xparse_dolparen: size = %d shell_input_line = `%s'", shell_input_line_size, shell_input_line);*/
   4.975 +   sflags = SEVAL_NONINT|SEVAL_NOHIST|SEVAL_NOFREE;
   4.976 +   if (flags & SX_NOLONGJMP)
   4.977 +     sflags |= SEVAL_NOLONGJMP;
   4.978 +   save_parser_state (&ps);
   4.979 ++  save_input_line_state (&ls);
   4.980 + 
   4.981 +   /*(*/
   4.982 +   parser_state |= PST_CMDSUBST|PST_EOFTOKEN;	/* allow instant ')' */ /*(*/
   4.983 +@@ -3861,6 +3864,8 @@
   4.984 + 
   4.985 +   restore_parser_state (&ps);
   4.986 +   reset_parser ();
   4.987 ++  /* reset_parser clears shell_input_line and associated variables */
   4.988 ++  restore_input_line_state (&ls);
   4.989 +   if (interactive)
   4.990 +     token_to_read = 0;
   4.991 + 
   4.992 +@@ -5135,6 +5140,9 @@
   4.993 + 	    case 'A':
   4.994 + 	      /* Make the current time/date into a string. */
   4.995 + 	      (void) time (&the_time);
   4.996 ++#if defined (HAVE_TZSET)
   4.997 ++	      sv_tz ("TZ");		/* XXX -- just make sure */
   4.998 ++#endif
   4.999 + 	      tm = localtime (&the_time);
  4.1000 + 
  4.1001 + 	      if (c == 'd')
  4.1002 +@@ -5905,6 +5913,12 @@
  4.1003 +   ps->expand_aliases = expand_aliases;
  4.1004 +   ps->echo_input_at_read = echo_input_at_read;
  4.1005 + 
  4.1006 ++  ps->token = token;
  4.1007 ++  ps->token_buffer_size = token_buffer_size;
  4.1008 ++  /* Force reallocation on next call to read_token_word */
  4.1009 ++  token = 0;
  4.1010 ++  token_buffer_size = 0;
  4.1011 ++
  4.1012 +   return (ps);
  4.1013 + }
  4.1014 + 
  4.1015 +@@ -5946,6 +5960,42 @@
  4.1016 + 
  4.1017 +   expand_aliases = ps->expand_aliases;
  4.1018 +   echo_input_at_read = ps->echo_input_at_read;
  4.1019 ++
  4.1020 ++  FREE (token);
  4.1021 ++  token = ps->token;
  4.1022 ++  token_buffer_size = ps->token_buffer_size;
  4.1023 ++}
  4.1024 ++
  4.1025 ++sh_input_line_state_t *
  4.1026 ++save_input_line_state (ls)
  4.1027 ++     sh_input_line_state_t *ls;
  4.1028 ++{
  4.1029 ++  if (ls == 0)
  4.1030 ++    ls = (sh_input_line_state_t *)xmalloc (sizeof (sh_input_line_state_t));
  4.1031 ++  if (ls == 0)
  4.1032 ++    return ((sh_input_line_state_t *)NULL);
  4.1033 ++
  4.1034 ++  ls->input_line = shell_input_line;
  4.1035 ++  ls->input_line_size = shell_input_line_size;
  4.1036 ++  ls->input_line_len = shell_input_line_len;
  4.1037 ++  ls->input_line_index = shell_input_line_index;
  4.1038 ++
  4.1039 ++  /* force reallocation */
  4.1040 ++  shell_input_line = 0;
  4.1041 ++  shell_input_line_size = shell_input_line_len = shell_input_line_index = 0;
  4.1042 ++}
  4.1043 ++
  4.1044 ++void
  4.1045 ++restore_input_line_state (ls)
  4.1046 ++     sh_input_line_state_t *ls;
  4.1047 ++{
  4.1048 ++  FREE (shell_input_line);
  4.1049 ++  shell_input_line = ls->input_line;
  4.1050 ++  shell_input_line_size = ls->input_line_size;
  4.1051 ++  shell_input_line_len = ls->input_line_len;
  4.1052 ++  shell_input_line_index = ls->input_line_index;
  4.1053 ++
  4.1054 ++  set_line_mbstate ();
  4.1055 + }
  4.1056 + 
  4.1057 + /************************************************
  4.1058 +Index: patchlevel.h
  4.1059 +--- patchlevel.h.orig	2010-06-13 02:14:48.000000000 +0200
  4.1060 ++++ patchlevel.h	2012-06-27 10:31:03.000000000 +0200
  4.1061 +@@ -25,6 +25,6 @@
  4.1062 +    regexp `^#define[ 	]*PATCHLEVEL', since that's what support/mkversion.sh
  4.1063 +    looks for to find the patch level (for the sccs version string). */
  4.1064 + 
  4.1065 +-#define PATCHLEVEL 0
  4.1066 ++#define PATCHLEVEL 29
  4.1067 + 
  4.1068 + #endif /* _PATCHLEVEL_H_ */
  4.1069 +Index: pathexp.c
  4.1070 +--- pathexp.c.orig	2010-08-14 05:21:57.000000000 +0200
  4.1071 ++++ pathexp.c	2012-06-27 10:31:02.000000000 +0200
  4.1072 +@@ -196,7 +196,7 @@
  4.1073 + 	{
  4.1074 + 	  if ((qflags & QGLOB_FILENAME) && pathname[i+1] == '/')
  4.1075 + 	    continue;
  4.1076 +-	  if ((qflags & QGLOB_REGEXP) && ere_char (pathname[i+1]) == 0)
  4.1077 ++	  if (pathname[i+1] != CTLESC && (qflags & QGLOB_REGEXP) && ere_char (pathname[i+1]) == 0)
  4.1078 + 	    continue;
  4.1079 + 	  temp[j++] = '\\';
  4.1080 + 	  i++;
  4.1081 +Index: print_cmd.c
  4.1082 +--- print_cmd.c.orig	2010-05-31 00:34:08.000000000 +0200
  4.1083 ++++ print_cmd.c	2012-06-27 10:31:02.000000000 +0200
  4.1084 +@@ -315,6 +315,7 @@
  4.1085 + 	  cprintf ("( ");
  4.1086 + 	  skip_this_indent++;
  4.1087 + 	  make_command_string_internal (command->value.Subshell->command);
  4.1088 ++	  PRINT_DEFERRED_HEREDOCS ("");
  4.1089 + 	  cprintf (" )");
  4.1090 + 	  break;
  4.1091 + 
  4.1092 +@@ -592,6 +593,7 @@
  4.1093 +   newline ("do\n");
  4.1094 +   indentation += indentation_amount;
  4.1095 +   make_command_string_internal (arith_for_command->action);
  4.1096 ++  PRINT_DEFERRED_HEREDOCS ("");
  4.1097 +   semicolon ();
  4.1098 +   indentation -= indentation_amount;
  4.1099 +   newline ("done");
  4.1100 +@@ -653,6 +655,7 @@
  4.1101 +     }
  4.1102 + 
  4.1103 +   make_command_string_internal (group_command->command);
  4.1104 ++  PRINT_DEFERRED_HEREDOCS ("");
  4.1105 + 
  4.1106 +   if (inside_function_def)
  4.1107 +     {
  4.1108 +Index: shell.h
  4.1109 +--- shell.h.orig	2011-01-07 04:16:55.000000000 +0100
  4.1110 ++++ shell.h	2012-06-27 10:31:02.000000000 +0200
  4.1111 +@@ -136,6 +136,9 @@
  4.1112 +   int parser_state;
  4.1113 +   int *token_state;
  4.1114 + 
  4.1115 ++  char *token;
  4.1116 ++  int token_buffer_size;
  4.1117 ++
  4.1118 +   /* input line state -- line number saved elsewhere */
  4.1119 +   int input_line_terminator;
  4.1120 +   int eof_encountered;
  4.1121 +@@ -166,6 +169,16 @@
  4.1122 +   
  4.1123 + } sh_parser_state_t;
  4.1124 + 
  4.1125 ++typedef struct _sh_input_line_state_t {
  4.1126 ++  char *input_line;
  4.1127 ++  int input_line_index;
  4.1128 ++  int input_line_size;
  4.1129 ++  int input_line_len;
  4.1130 ++} sh_input_line_state_t;
  4.1131 ++
  4.1132 + /* Let's try declaring these here. */
  4.1133 + extern sh_parser_state_t *save_parser_state __P((sh_parser_state_t *));
  4.1134 + extern void restore_parser_state __P((sh_parser_state_t *));
  4.1135 ++
  4.1136 ++extern sh_input_line_state_t *save_input_line_state __P((sh_input_line_state_t *));
  4.1137 ++extern void restore_input_line_state __P((sh_input_line_state_t *));
  4.1138 +Index: sig.c
  4.1139 +--- sig.c.orig	2010-11-23 14:21:22.000000000 +0100
  4.1140 ++++ sig.c	2012-06-27 10:31:02.000000000 +0200
  4.1141 +@@ -46,6 +46,7 @@
  4.1142 + 
  4.1143 + #if defined (READLINE)
  4.1144 + #  include "bashline.h"
  4.1145 ++#  include <readline/readline.h>
  4.1146 + #endif
  4.1147 + 
  4.1148 + #if defined (HISTORY)
  4.1149 +@@ -62,6 +63,7 @@
  4.1150 + #if defined (HISTORY)
  4.1151 + extern int history_lines_this_session;
  4.1152 + #endif
  4.1153 ++extern int no_line_editing;
  4.1154 + 
  4.1155 + extern void initialize_siglist ();
  4.1156 + 
  4.1157 +@@ -505,7 +507,10 @@
  4.1158 +     {
  4.1159 + #if defined (HISTORY)
  4.1160 +       /* XXX - will inhibit history file being written */
  4.1161 +-      history_lines_this_session = 0;
  4.1162 ++#  if defined (READLINE)
  4.1163 ++      if (interactive_shell == 0 || interactive == 0 || (sig != SIGHUP && sig != SIGTERM) || no_line_editing || (RL_ISSTATE (RL_STATE_READCMD) == 0))
  4.1164 ++#  endif
  4.1165 ++        history_lines_this_session = 0;
  4.1166 + #endif
  4.1167 +       terminate_immediately = 0;
  4.1168 +       termsig_handler (sig);
  4.1169 +Index: subst.c
  4.1170 +--- subst.c.orig	2011-01-02 22:12:51.000000000 +0100
  4.1171 ++++ subst.c	2012-06-27 10:31:03.000000000 +0200
  4.1172 +@@ -366,6 +366,11 @@
  4.1173 +       f &= ~W_ASSNBLTIN;
  4.1174 +       fprintf (stderr, "W_ASSNBLTIN%s", f ? "|" : "");
  4.1175 +     }
  4.1176 ++  if (f & W_ASSNGLOBAL)
  4.1177 ++    {
  4.1178 ++      f &= ~W_ASSNGLOBAL;
  4.1179 ++      fprintf (stderr, "W_ASSNGLOBAL%s", f ? "|" : "");
  4.1180 ++    }
  4.1181 +   if (f & W_COMPASSIGN)
  4.1182 +     {
  4.1183 +       f &= ~W_COMPASSIGN;
  4.1184 +@@ -1379,10 +1384,12 @@
  4.1185 +   slen = strlen (string + *sindex) + *sindex;
  4.1186 + 
  4.1187 +   /* The handling of dolbrace_state needs to agree with the code in parse.y:
  4.1188 +-     parse_matched_pair() */
  4.1189 +-  dolbrace_state = 0;
  4.1190 +-  if (quoted & (Q_HERE_DOCUMENT|Q_DOUBLE_QUOTES))
  4.1191 +-    dolbrace_state = (flags & SX_POSIXEXP) ? DOLBRACE_QUOTE : DOLBRACE_PARAM;
  4.1192 ++     parse_matched_pair().  The different initial value is to handle the
  4.1193 ++     case where this function is called to parse the word in
  4.1194 ++     ${param op word} (SX_WORD). */
  4.1195 ++  dolbrace_state = (flags & SX_WORD) ? DOLBRACE_WORD : DOLBRACE_PARAM;
  4.1196 ++  if ((quoted & (Q_HERE_DOCUMENT|Q_DOUBLE_QUOTES)) && (flags & SX_POSIXEXP))
  4.1197 ++    dolbrace_state = DOLBRACE_QUOTE;
  4.1198 + 
  4.1199 +   i = *sindex;
  4.1200 +   while (c = string[i])
  4.1201 +@@ -2801,7 +2808,7 @@
  4.1202 +     }
  4.1203 +   else if (assign_list)
  4.1204 +     {
  4.1205 +-      if (word->flags & W_ASSIGNARG)
  4.1206 ++      if ((word->flags & W_ASSIGNARG) && (word->flags & W_ASSNGLOBAL) == 0)
  4.1207 + 	aflags |= ASS_MKLOCAL;
  4.1208 +       if (word->flags & W_ASSIGNASSOC)
  4.1209 + 	aflags |= ASS_MKASSOC;
  4.1210 +@@ -3371,7 +3378,7 @@
  4.1211 +   if (string == 0 || *string == '\0')
  4.1212 +     return (WORD_LIST *)NULL;
  4.1213 + 
  4.1214 +-  td.flags = 0;
  4.1215 ++  td.flags = W_NOSPLIT2;		/* no splitting, remove "" and '' */
  4.1216 +   td.word = string;
  4.1217 +   tresult = call_expand_word_internal (&td, quoted, 1, dollar_at_p, has_dollar_at);
  4.1218 +   return (tresult);
  4.1219 +@@ -3704,7 +3711,10 @@
  4.1220 + 	    break;
  4.1221 + 	}
  4.1222 +       else if (string[i] == CTLNUL)
  4.1223 +-	i++;
  4.1224 ++	{
  4.1225 ++	  i++;
  4.1226 ++	  continue;
  4.1227 ++	}
  4.1228 + 
  4.1229 +       prev_i = i;
  4.1230 +       ADVANCE_CHAR (string, slen, i);
  4.1231 +@@ -4156,7 +4166,7 @@
  4.1232 +   simple = (wpat[0] != L'\\' && wpat[0] != L'*' && wpat[0] != L'?' && wpat[0] != L'[');
  4.1233 + #if defined (EXTENDED_GLOB)
  4.1234 +   if (extended_glob)
  4.1235 +-    simple |= (wpat[1] != L'(' || (wpat[0] != L'*' && wpat[0] != L'?' && wpat[0] != L'+' && wpat[0] != L'!' && wpat[0] != L'@')); /*)*/
  4.1236 ++    simple &= (wpat[1] != L'(' || (wpat[0] != L'*' && wpat[0] != L'?' && wpat[0] != L'+' && wpat[0] != L'!' && wpat[0] != L'@')); /*)*/
  4.1237 + #endif
  4.1238 + 
  4.1239 +   /* If the pattern doesn't match anywhere in the string, go ahead and
  4.1240 +@@ -4607,6 +4617,7 @@
  4.1241 +   if (ifs_firstc == 0)
  4.1242 + #endif
  4.1243 +     word->flags |= W_NOSPLIT;
  4.1244 ++  word->flags |= W_NOSPLIT2;
  4.1245 +   result = call_expand_word_internal (word, quoted, 0, (int *)NULL, (int *)NULL);
  4.1246 +   expand_no_split_dollar_star = 0;
  4.1247 + 
  4.1248 +@@ -5798,6 +5809,16 @@
  4.1249 + 	 is the only expansion that creates more than one word. */
  4.1250 +       if (qdollaratp && ((hasdol && quoted) || l->next))
  4.1251 + 	*qdollaratp = 1;
  4.1252 ++      /* If we have a quoted null result (QUOTED_NULL(temp)) and the word is
  4.1253 ++	 a quoted null (l->next == 0 && QUOTED_NULL(l->word->word)), the
  4.1254 ++	 flags indicate it (l->word->flags & W_HASQUOTEDNULL), and the
  4.1255 ++	 expansion is quoted (quoted & (Q_HERE_DOCUMENT|Q_DOUBLE_QUOTES))
  4.1256 ++	 (which is more paranoia than anything else), we need to return the
  4.1257 ++	 quoted null string and set the flags to indicate it. */
  4.1258 ++      if (l->next == 0 && (quoted & (Q_HERE_DOCUMENT|Q_DOUBLE_QUOTES)) && QUOTED_NULL(temp) && QUOTED_NULL(l->word->word) && (l->word->flags & W_HASQUOTEDNULL))
  4.1259 ++	{
  4.1260 ++	  w->flags |= W_HASQUOTEDNULL;
  4.1261 ++	}
  4.1262 +       dispose_words (l);
  4.1263 +     }
  4.1264 +   else if ((quoted & (Q_HERE_DOCUMENT|Q_DOUBLE_QUOTES)) && hasdol)
  4.1265 +@@ -7176,7 +7197,7 @@
  4.1266 +     {
  4.1267 +       /* Extract the contents of the ${ ... } expansion
  4.1268 + 	 according to the Posix.2 rules. */
  4.1269 +-      value = extract_dollar_brace_string (string, &sindex, quoted, (c == '%' || c == '#') ? SX_POSIXEXP : 0);
  4.1270 ++      value = extract_dollar_brace_string (string, &sindex, quoted, (c == '%' || c == '#' || c =='/' || c == '^' || c == ',' || c ==':') ? SX_POSIXEXP|SX_WORD : SX_WORD);
  4.1271 +       if (string[sindex] == RBRACE)
  4.1272 + 	sindex++;
  4.1273 +       else
  4.1274 +@@ -7268,6 +7289,7 @@
  4.1275 +     default:
  4.1276 +     case '\0':
  4.1277 +     bad_substitution:
  4.1278 ++      last_command_exit_value = EXECUTION_FAILURE;
  4.1279 +       report_error (_("%s: bad substitution"), string ? string : "??");
  4.1280 +       FREE (value);
  4.1281 +       FREE (temp);
  4.1282 +Index: subst.h
  4.1283 +--- subst.h.orig	2010-12-03 02:21:29.000000000 +0100
  4.1284 ++++ subst.h	2012-06-27 10:31:02.000000000 +0200
  4.1285 +@@ -56,6 +56,7 @@
  4.1286 + #define SX_NOLONGJMP	0x0040	/* don't longjmp on fatal error */
  4.1287 + #define SX_ARITHSUB	0x0080	/* extracting $(( ... )) (currently unused) */
  4.1288 + #define SX_POSIXEXP	0x0100	/* extracting new Posix pattern removal expansions in extract_dollar_brace_string */
  4.1289 ++#define SX_WORD		0x0200	/* extracting word in ${param op word} */
  4.1290 + 
  4.1291 + /* Remove backslashes which are quoting backquotes from STRING.  Modifies
  4.1292 +    STRING, and returns a pointer to it. */
  4.1293 +Index: support/shobj-conf
  4.1294 +--- support/shobj-conf.orig	2009-10-28 14:20:21.000000000 +0100
  4.1295 ++++ support/shobj-conf	2012-06-27 10:31:02.000000000 +0200
  4.1296 +@@ -157,7 +157,7 @@
  4.1297 + 	;;
  4.1298 + 
  4.1299 + # Darwin/MacOS X
  4.1300 +-darwin[89]*|darwin10*)
  4.1301 ++darwin[89]*|darwin1[012]*)
  4.1302 + 	SHOBJ_STATUS=supported
  4.1303 + 	SHLIB_STATUS=supported
  4.1304 + 	
  4.1305 +@@ -186,7 +186,7 @@
  4.1306 + 	SHLIB_LIBSUFF='dylib'
  4.1307 + 
  4.1308 + 	case "${host_os}" in
  4.1309 +-	darwin[789]*|darwin10*)	SHOBJ_LDFLAGS=''
  4.1310 ++	darwin[789]*|darwin1[012]*)	SHOBJ_LDFLAGS=''
  4.1311 + 			SHLIB_XLDFLAGS='-dynamiclib -arch_only `/usr/bin/arch` -install_name $(libdir)/$@ -current_version $(SHLIB_MAJOR)$(SHLIB_MINOR) -compatibility_version $(SHLIB_MAJOR) -v'
  4.1312 + 			;;
  4.1313 + 	*)		SHOBJ_LDFLAGS='-dynamic'
  4.1314 +Index: tests/shopt.right
  4.1315 +--- tests/shopt.right.orig	2010-07-03 05:36:30.000000000 +0200
  4.1316 ++++ tests/shopt.right	2012-06-27 10:31:03.000000000 +0200
  4.1317 +@@ -12,6 +12,7 @@
  4.1318 + shopt -u compat32
  4.1319 + shopt -u compat40
  4.1320 + shopt -u compat41
  4.1321 ++shopt -u direxpand
  4.1322 + shopt -u dirspell
  4.1323 + shopt -u dotglob
  4.1324 + shopt -u execfail
  4.1325 +@@ -68,6 +69,7 @@
  4.1326 + shopt -u compat32
  4.1327 + shopt -u compat40
  4.1328 + shopt -u compat41
  4.1329 ++shopt -u direxpand
  4.1330 + shopt -u dirspell
  4.1331 + shopt -u dotglob
  4.1332 + shopt -u execfail
  4.1333 +@@ -101,6 +103,7 @@
  4.1334 + compat32       	off
  4.1335 + compat40       	off
  4.1336 + compat41       	off
  4.1337 ++direxpand      	off
  4.1338 + dirspell       	off
  4.1339 + dotglob        	off
  4.1340 + execfail       	off
  4.1341 +Index: variables.c
  4.1342 +--- variables.c.orig	2011-01-25 02:07:48.000000000 +0100
  4.1343 ++++ variables.c	2012-06-27 10:31:02.000000000 +0200
  4.1344 +@@ -3653,6 +3653,22 @@
  4.1345 +   return n;
  4.1346 + }
  4.1347 + 
  4.1348 ++int
  4.1349 ++chkexport (name)
  4.1350 ++     char *name;
  4.1351 ++{
  4.1352 ++  SHELL_VAR *v;
  4.1353 ++
  4.1354 ++  v = find_variable (name);
  4.1355 ++  if (v && exported_p (v))
  4.1356 ++    {
  4.1357 ++      array_needs_making = 1;
  4.1358 ++      maybe_make_export_env ();
  4.1359 ++      return 1;
  4.1360 ++    }
  4.1361 ++  return 0;
  4.1362 ++}
  4.1363 ++
  4.1364 + void
  4.1365 + maybe_make_export_env ()
  4.1366 + {
  4.1367 +@@ -4214,7 +4230,7 @@
  4.1368 +   { "TEXTDOMAIN", sv_locale },
  4.1369 +   { "TEXTDOMAINDIR", sv_locale },
  4.1370 + 
  4.1371 +-#if defined (HAVE_TZSET) && defined (PROMPT_STRING_DECODE)
  4.1372 ++#if defined (HAVE_TZSET)
  4.1373 +   { "TZ", sv_tz },
  4.1374 + #endif
  4.1375 + 
  4.1376 +@@ -4558,12 +4574,13 @@
  4.1377 + }
  4.1378 + #endif /* HISTORY */
  4.1379 + 
  4.1380 +-#if defined (HAVE_TZSET) && defined (PROMPT_STRING_DECODE)
  4.1381 ++#if defined (HAVE_TZSET)
  4.1382 + void
  4.1383 + sv_tz (name)
  4.1384 +      char *name;
  4.1385 + {
  4.1386 +-  tzset ();
  4.1387 ++  if (chkexport (name))
  4.1388 ++    tzset ();
  4.1389 + }
  4.1390 + #endif
  4.1391 + 
  4.1392 +Index: variables.h
  4.1393 +--- variables.h.orig	2010-12-03 02:22:01.000000000 +0100
  4.1394 ++++ variables.h	2012-06-27 10:31:02.000000000 +0200
  4.1395 +@@ -313,6 +313,7 @@
  4.1396 + 
  4.1397 + extern void sort_variables __P((SHELL_VAR **));
  4.1398 + 
  4.1399 ++extern int chkexport __P((char *));
  4.1400 + extern void maybe_make_export_env __P((void));
  4.1401 + extern void update_export_env_inplace __P((char *, int, char *));
  4.1402 + extern void put_command_name_into_env __P((char *));
  4.1403 +Index: y.tab.c
  4.1404 +--- y.tab.c.orig	2011-01-04 15:57:56.000000000 +0100
  4.1405 ++++ y.tab.c	2012-06-27 10:31:03.000000000 +0200
  4.1406 +@@ -4811,7 +4811,7 @@
  4.1407 + 	 We do this only if it is time to do so. Notice that only here
  4.1408 + 	 is the mail alarm reset; nothing takes place in check_mail ()
  4.1409 + 	 except the checking of mail.  Please don't change this. */
  4.1410 +-      if (prompt_is_ps1 && time_to_check_mail ())
  4.1411 ++      if (prompt_is_ps1 && parse_and_execute_level == 0 && time_to_check_mail ())
  4.1412 + 	{
  4.1413 + 	  check_mail ();
  4.1414 + 	  reset_mail_timer ();
  4.1415 +@@ -6154,6 +6154,7 @@
  4.1416 +      int flags;
  4.1417 + {
  4.1418 +   sh_parser_state_t ps;
  4.1419 ++  sh_input_line_state_t ls;
  4.1420 +   int orig_ind, nc, sflags;
  4.1421 +   char *ret, *s, *ep, *ostring;
  4.1422 + 
  4.1423 +@@ -6161,10 +6162,12 @@
  4.1424 +   orig_ind = *indp;
  4.1425 +   ostring = string;
  4.1426 + 
  4.1427 ++/*itrace("xparse_dolparen: size = %d shell_input_line = `%s'", shell_input_line_size, shell_input_line);*/
  4.1428 +   sflags = SEVAL_NONINT|SEVAL_NOHIST|SEVAL_NOFREE;
  4.1429 +   if (flags & SX_NOLONGJMP)
  4.1430 +     sflags |= SEVAL_NOLONGJMP;
  4.1431 +   save_parser_state (&ps);
  4.1432 ++  save_input_line_state (&ls);
  4.1433 + 
  4.1434 +   /*(*/
  4.1435 +   parser_state |= PST_CMDSUBST|PST_EOFTOKEN;	/* allow instant ')' */ /*(*/
  4.1436 +@@ -6173,6 +6176,8 @@
  4.1437 + 
  4.1438 +   restore_parser_state (&ps);
  4.1439 +   reset_parser ();
  4.1440 ++  /* reset_parser clears shell_input_line and associated variables */
  4.1441 ++  restore_input_line_state (&ls);
  4.1442 +   if (interactive)
  4.1443 +     token_to_read = 0;
  4.1444 + 
  4.1445 +@@ -7447,6 +7452,9 @@
  4.1446 + 	    case 'A':
  4.1447 + 	      /* Make the current time/date into a string. */
  4.1448 + 	      (void) time (&the_time);
  4.1449 ++#if defined (HAVE_TZSET)
  4.1450 ++	      sv_tz ("TZ");		/* XXX -- just make sure */
  4.1451 ++#endif
  4.1452 + 	      tm = localtime (&the_time);
  4.1453 + 
  4.1454 + 	      if (c == 'd')
  4.1455 +@@ -8217,6 +8225,12 @@
  4.1456 +   ps->expand_aliases = expand_aliases;
  4.1457 +   ps->echo_input_at_read = echo_input_at_read;
  4.1458 + 
  4.1459 ++  ps->token = token;
  4.1460 ++  ps->token_buffer_size = token_buffer_size;
  4.1461 ++  /* Force reallocation on next call to read_token_word */
  4.1462 ++  token = 0;
  4.1463 ++  token_buffer_size = 0;
  4.1464 ++
  4.1465 +   return (ps);
  4.1466 + }
  4.1467 + 
  4.1468 +@@ -8258,6 +8272,42 @@
  4.1469 + 
  4.1470 +   expand_aliases = ps->expand_aliases;
  4.1471 +   echo_input_at_read = ps->echo_input_at_read;
  4.1472 ++
  4.1473 ++  FREE (token);
  4.1474 ++  token = ps->token;
  4.1475 ++  token_buffer_size = ps->token_buffer_size;
  4.1476 ++}
  4.1477 ++
  4.1478 ++sh_input_line_state_t *
  4.1479 ++save_input_line_state (ls)
  4.1480 ++     sh_input_line_state_t *ls;
  4.1481 ++{
  4.1482 ++  if (ls == 0)
  4.1483 ++    ls = (sh_input_line_state_t *)xmalloc (sizeof (sh_input_line_state_t));
  4.1484 ++  if (ls == 0)
  4.1485 ++    return ((sh_input_line_state_t *)NULL);
  4.1486 ++
  4.1487 ++  ls->input_line = shell_input_line;
  4.1488 ++  ls->input_line_size = shell_input_line_size;
  4.1489 ++  ls->input_line_len = shell_input_line_len;
  4.1490 ++  ls->input_line_index = shell_input_line_index;
  4.1491 ++
  4.1492 ++  /* force reallocation */
  4.1493 ++  shell_input_line = 0;
  4.1494 ++  shell_input_line_size = shell_input_line_len = shell_input_line_index = 0;
  4.1495 ++}
  4.1496 ++
  4.1497 ++void
  4.1498 ++restore_input_line_state (ls)
  4.1499 ++     sh_input_line_state_t *ls;
  4.1500 ++{
  4.1501 ++  FREE (shell_input_line);
  4.1502 ++  shell_input_line = ls->input_line;
  4.1503 ++  shell_input_line_size = ls->input_line_size;
  4.1504 ++  shell_input_line_len = ls->input_line_len;
  4.1505 ++  shell_input_line_index = ls->input_line_index;
  4.1506 ++
  4.1507 ++  set_line_mbstate ();
  4.1508 + }
  4.1509 + 
  4.1510 + /************************************************

     5.1 --- a/openpkg/beecrypt.patch	Tue Jul 31 12:12:54 2012 +0200
     5.2 +++ b/openpkg/beecrypt.patch	Tue Jul 31 12:23:42 2012 +0200
     5.3 @@ -1,50 +1,64 @@
     5.4 -Index: gas/aesopt.x86.m4
     5.5 ---- gas/aesopt.x86.m4.orig	2004-06-13 13:37:23 +0200
     5.6 -+++ gas/aesopt.x86.m4	2004-07-28 20:02:07 +0200
     5.7 -@@ -134,6 +134,9 @@
     5.8 - 	pxor 6144(%esi,%edx,8),s0
     5.9 - ')
    5.10 +Index: configure
    5.11 +--- configure.orig	2009-07-12 09:19:15 +0200
    5.12 ++++ configure	2010-01-07 18:10:28 +0100
    5.13 +@@ -2821,7 +2821,7 @@
    5.14 + # Check whether --enable-expert-mode was given.
    5.15 + if test "${enable_expert_mode+set}" = set; then
    5.16 +   enableval=$enable_expert_mode;
    5.17 +-  ac_enable_expert_mode=yes
    5.18 ++  ac_enable_expert_mode=$enableval
    5.19   
    5.20 -+')
    5.21 -+ifdef(`USE_MMX',`
    5.22 -+
    5.23 - define(`elr',`
    5.24 - 	movd  0(%ebp),s0
    5.25 - 	movd t0,%eax
    5.26 -@@ -253,6 +256,9 @@
    5.27 - ')
    5.28 + else
    5.29   
    5.30 +@@ -4502,13 +4502,7 @@
    5.31 + if $ac_preproc_ok; then
    5.32 +   :
    5.33 + else
    5.34 +-  { { $as_echo "$as_me:$LINENO: error: in \`$ac_pwd':" >&5
    5.35 +-$as_echo "$as_me: error: in \`$ac_pwd':" >&2;}
    5.36 +-{ { $as_echo "$as_me:$LINENO: error: C preprocessor \"$CPP\" fails sanity check
    5.37 +-See \`config.log' for more details." >&5
    5.38 +-$as_echo "$as_me: error: C preprocessor \"$CPP\" fails sanity check
    5.39 +-See \`config.log' for more details." >&2;}
    5.40 +-   { (exit 1); exit 1; }; }; }
    5.41 ++  :
    5.42 + fi
    5.43   
    5.44 -+')
    5.45 -+ifdef(`USE_MMX',`
    5.46 -+
    5.47 - C_FUNCTION_BEGIN(aesEncrypt)
    5.48 - 	pushl %edi
    5.49 - 	pushl %esi
    5.50 -@@ -364,6 +370,9 @@
    5.51 - 	pxor 6144(%esi,%edx,8),t2
    5.52 - ')
    5.53 + ac_ext=c
    5.54 +@@ -6170,13 +6164,7 @@
    5.55 + if $ac_preproc_ok; then
    5.56 +   :
    5.57 + else
    5.58 +-  { { $as_echo "$as_me:$LINENO: error: in \`$ac_pwd':" >&5
    5.59 +-$as_echo "$as_me: error: in \`$ac_pwd':" >&2;}
    5.60 +-{ { $as_echo "$as_me:$LINENO: error: C preprocessor \"$CPP\" fails sanity check
    5.61 +-See \`config.log' for more details." >&5
    5.62 +-$as_echo "$as_me: error: C preprocessor \"$CPP\" fails sanity check
    5.63 +-See \`config.log' for more details." >&2;}
    5.64 +-   { (exit 1); exit 1; }; }; }
    5.65 ++  :
    5.66 + fi
    5.67   
    5.68 -+')
    5.69 -+ifdef(`USE_MMX',`
    5.70 -+
    5.71 - define(`dsft',`
    5.72 - 	movd $1+ 0(%ebp),s0
    5.73 - 	movd t0,%eax
    5.74 -@@ -490,6 +499,9 @@
    5.75 - 	pxor t3,s2
    5.76 - ')
    5.77 + ac_ext=c
    5.78 +@@ -6901,13 +6889,7 @@
    5.79 + if $ac_preproc_ok; then
    5.80 +   :
    5.81 + else
    5.82 +-  { { $as_echo "$as_me:$LINENO: error: in \`$ac_pwd':" >&5
    5.83 +-$as_echo "$as_me: error: in \`$ac_pwd':" >&2;}
    5.84 +-{ { $as_echo "$as_me:$LINENO: error: C++ preprocessor \"$CXXCPP\" fails sanity check
    5.85 +-See \`config.log' for more details." >&5
    5.86 +-$as_echo "$as_me: error: C++ preprocessor \"$CXXCPP\" fails sanity check
    5.87 +-See \`config.log' for more details." >&2;}
    5.88 +-   { (exit 1); exit 1; }; }; }
    5.89 ++  :
    5.90 + fi
    5.91   
    5.92 -+')
    5.93 -+ifdef(`USE_MMX',`
    5.94 -+
    5.95 - define(`dblock',`
    5.96 - 	sxrk
    5.97 - 
    5.98 + ac_ext=c
    5.99  Index: gnu.h.in
   5.100 ---- gnu.h.in.orig	2004-12-19 21:18:48 +0100
   5.101 -+++ gnu.h.in	2005-03-08 19:34:03 +0100
   5.102 -@@ -48,15 +48,6 @@
   5.103 +--- gnu.h.in.orig	2009-06-18 21:56:25 +0200
   5.104 ++++ gnu.h.in	2010-01-07 18:10:08 +0100
   5.105 +@@ -59,15 +59,6 @@
   5.106   @TYPEDEF_UINT32_T@
   5.107   @TYPEDEF_UINT64_T@
   5.108   

     6.1 --- /dev/null	Thu Jan 01 00:00:00 1970 +0000
     6.2 +++ b/openpkg/build.8	Tue Jul 31 12:23:42 2012 +0200
     6.3 @@ -0,0 +1,513 @@
     6.4 +.\" Automatically generated by Pod::Man 2.25 (Pod::Simple 3.22)
     6.5 +.\"
     6.6 +.\" Standard preamble:
     6.7 +.\" ========================================================================
     6.8 +.de Sp \" Vertical space (when we can't use .PP)
     6.9 +.if t .sp .5v
    6.10 +.if n .sp
    6.11 +..
    6.12 +.de Vb \" Begin verbatim text
    6.13 +.ft CW
    6.14 +.nf
    6.15 +.ne \\$1
    6.16 +..
    6.17 +.de Ve \" End verbatim text
    6.18 +.ft R
    6.19 +.fi
    6.20 +..
    6.21 +.\" Set up some character translations and predefined strings.  \*(-- will
    6.22 +.\" give an unbreakable dash, \*(PI will give pi, \*(L" will give a left
    6.23 +.\" double quote, and \*(R" will give a right double quote.  \*(C+ will
    6.24 +.\" give a nicer C++.  Capital omega is used to do unbreakable dashes and
    6.25 +.\" therefore won't be available.  \*(C` and \*(C' expand to `' in nroff,
    6.26 +.\" nothing in troff, for use with C<>.
    6.27 +.tr \(*W-
    6.28 +.ds C+ C\v'-.1v'\h'-1p'\s-2+\h'-1p'+\s0\v'.1v'\h'-1p'
    6.29 +.ie n \{\
    6.30 +.    ds -- \(*W-
    6.31 +.    ds PI pi
    6.32 +.    if (\n(.H=4u)&(1m=24u) .ds -- \(*W\h'-12u'\(*W\h'-12u'-\" diablo 10 pitch
    6.33 +.    if (\n(.H=4u)&(1m=20u) .ds -- \(*W\h'-12u'\(*W\h'-8u'-\"  diablo 12 pitch
    6.34 +.    ds L" ""
    6.35 +.    ds R" ""
    6.36 +.    ds C` 
    6.37 +.    ds C' 
    6.38 +'br\}
    6.39 +.el\{\
    6.40 +.    ds -- \|\(em\|
    6.41 +.    ds PI \(*p
    6.42 +.    ds L" ``
    6.43 +.    ds R" ''
    6.44 +'br\}
    6.45 +.\"
    6.46 +.\" Escape single quotes in literal strings from groff's Unicode transform.
    6.47 +.ie \n(.g .ds Aq \(aq
    6.48 +.el       .ds Aq '
    6.49 +.\"
    6.50 +.\" If the F register is turned on, we'll generate index entries on stderr for
    6.51 +.\" titles (.TH), headers (.SH), subsections (.SS), items (.Ip), and index
    6.52 +.\" entries marked with X<> in POD.  Of course, you'll have to process the
    6.53 +.\" output yourself in some meaningful fashion.
    6.54 +.ie \nF \{\
    6.55 +.    de IX
    6.56 +.    tm Index:\\$1\t\\n%\t"\\$2"
    6.57 +..
    6.58 +.    nr % 0
    6.59 +.    rr F
    6.60 +.\}
    6.61 +.el \{\
    6.62 +.    de IX
    6.63 +..
    6.64 +.\}
    6.65 +.\"
    6.66 +.\" Accent mark definitions (@(#)ms.acc 1.5 88/02/08 SMI; from UCB 4.2).
    6.67 +.\" Fear.  Run.  Save yourself.  No user-serviceable parts.
    6.68 +.    \" fudge factors for nroff and troff
    6.69 +.if n \{\
    6.70 +.    ds #H 0
    6.71 +.    ds #V .8m
    6.72 +.    ds #F .3m
    6.73 +.    ds #[ \f1
    6.74 +.    ds #] \fP
    6.75 +.\}
    6.76 +.if t \{\
    6.77 +.    ds #H ((1u-(\\\\n(.fu%2u))*.13m)
    6.78 +.    ds #V .6m
    6.79 +.    ds #F 0
    6.80 +.    ds #[ \&
    6.81 +.    ds #] \&
    6.82 +.\}
    6.83 +.    \" simple accents for nroff and troff
    6.84 +.if n \{\
    6.85 +.    ds ' \&
    6.86 +.    ds ` \&
    6.87 +.    ds ^ \&
    6.88 +.    ds , \&
    6.89 +.    ds ~ ~
    6.90 +.    ds /
    6.91 +.\}
    6.92 +.if t \{\
    6.93 +.    ds ' \\k:\h'-(\\n(.wu*8/10-\*(#H)'\'\h"|\\n:u"
    6.94 +.    ds ` \\k:\h'-(\\n(.wu*8/10-\*(#H)'\`\h'|\\n:u'
    6.95 +.    ds ^ \\k:\h'-(\\n(.wu*10/11-\*(#H)'^\h'|\\n:u'
    6.96 +.    ds , \\k:\h'-(\\n(.wu*8/10)',\h'|\\n:u'
    6.97 +.    ds ~ \\k:\h'-(\\n(.wu-\*(#H-.1m)'~\h'|\\n:u'
    6.98 +.    ds / \\k:\h'-(\\n(.wu*8/10-\*(#H)'\z\(sl\h'|\\n:u'
    6.99 +.\}
   6.100 +.    \" troff and (daisy-wheel) nroff accents
   6.101 +.ds : \\k:\h'-(\\n(.wu*8/10-\*(#H+.1m+\*(#F)'\v'-\*(#V'\z.\h'.2m+\*(#F'.\h'|\\n:u'\v'\*(#V'
   6.102 +.ds 8 \h'\*(#H'\(*b\h'-\*(#H'
   6.103 +.ds o \\k:\h'-(\\n(.wu+\w'\(de'u-\*(#H)/2u'\v'-.3n'\*(#[\z\(de\v'.3n'\h'|\\n:u'\*(#]
   6.104 +.ds d- \h'\*(#H'\(pd\h'-\w'~'u'\v'-.25m'\f2\(hy\fP\v'.25m'\h'-\*(#H'
   6.105 +.ds D- D\\k:\h'-\w'D'u'\v'-.11m'\z\(hy\v'.11m'\h'|\\n:u'
   6.106 +.ds th \*(#[\v'.3m'\s+1I\s-1\v'-.3m'\h'-(\w'I'u*2/3)'\s-1o\s+1\*(#]
   6.107 +.ds Th \*(#[\s+2I\s-2\h'-\w'I'u*3/5'\v'-.3m'o\v'.3m'\*(#]
   6.108 +.ds ae a\h'-(\w'a'u*4/10)'e
   6.109 +.ds Ae A\h'-(\w'A'u*4/10)'E
   6.110 +.    \" corrections for vroff
   6.111 +.if v .ds ~ \\k:\h'-(\\n(.wu*9/10-\*(#H)'\s-2\u~\d\s+2\h'|\\n:u'
   6.112 +.if v .ds ^ \\k:\h'-(\\n(.wu*10/11-\*(#H)'\v'-.4m'^\v'.4m'\h'|\\n:u'
   6.113 +.    \" for low resolution devices (crt and lpr)
   6.114 +.if \n(.H>23 .if \n(.V>19 \
   6.115 +\{\
   6.116 +.    ds : e
   6.117 +.    ds 8 ss
   6.118 +.    ds o a
   6.119 +.    ds d- d\h'-1'\(ga
   6.120 +.    ds D- D\h'-1'\(hy
   6.121 +.    ds th \o'bp'
   6.122 +.    ds Th \o'LP'
   6.123 +.    ds ae ae
   6.124 +.    ds Ae AE
   6.125 +.\}
   6.126 +.rm #[ #] #H #V #F C
   6.127 +.\" ========================================================================
   6.128 +.\"
   6.129 +.IX Title "BUILD 8"
   6.130 +.TH BUILD 8 "OpenPKG" "BUILD(8)" "OpenPKG"
   6.131 +.\" For nroff, turn off justification.  Always turn off hyphenation; it makes
   6.132 +.\" way too many mistakes in technical documents.
   6.133 +.if n .ad l
   6.134 +.nh
   6.135 +.SH "NAME"
   6.136 +openpkg build \- OpenPKG Package Building and Installing
   6.137 +.SH "SYNOPSIS"
   6.138 +.IX Header "SYNOPSIS"
   6.139 +\&\fBopenpkg\fR
   6.140 +\&\fBbuild\fR
   6.141 +[\fB\-R\fR \fIrpm\fR]
   6.142 +[\fB\-r\fR \fIrepository\fR]
   6.143 +[\fB\-f\fR \fIindex.rdf\fR]
   6.144 +[\fB\-u\fR]
   6.145 +[\fB\-U\fR]
   6.146 +[\fB\-z\fR]
   6.147 +[\fB\-Z\fR]
   6.148 +[\fB\-i\fR]
   6.149 +[\fB\-q\fR]
   6.150 +[\fB\-s\fR]
   6.151 +[\fB\-S\fR]
   6.152 +[\fB\-M\fR]
   6.153 +[\fB\-L\fR]
   6.154 +[\fB\-W\fR]
   6.155 +[\fB\-X\fR]
   6.156 +[\fB\-K\fR]
   6.157 +[\fB\-k\fR]
   6.158 +[\fB\-e\fR]
   6.159 +[\fB\-b\fR]
   6.160 +[\fB\-B\fR]
   6.161 +[\fB\-G\fR]
   6.162 +[\fB\-P\fR \fIpriv-cmd\fR]
   6.163 +[\fB\-N\fR \fInon-priv-cmd\fR]
   6.164 +[\fB\-p\fR \fIplatform\fR]
   6.165 +[\fB\-D\fR \fIvar\fR=\fIval\fR ...]
   6.166 +[\fB\-E\fR \fIname\fR ...]
   6.167 +[\fB\-H\fR \fIname\fR ...]
   6.168 +([\fB\-a\fR] [\fB\-A\fR] | \fIpattern\fR ...)
   6.169 +.SH "DESCRIPTION"
   6.170 +.IX Header "DESCRIPTION"
   6.171 +The \fBopenpkg build\fR tool provides automated recursive from-scratch
   6.172 +installation of packages and the updating and upgrading of installed
   6.173 +packages.
   6.174 +.PP
   6.175 +It generates a Bourne-Shell script on standard output (\fIstdout\fR)
   6.176 +that can be executed to perform the package installation or
   6.177 +updating/upgrading procedure for all requested packages and their
   6.178 +dependencies.
   6.179 +.PP
   6.180 +Packages that are upgraded automatically trigger rebuilds of all
   6.181 +packages that depend on the upgraded package (\*(L"reverse dependencies\*(R").
   6.182 +The dependency information is read from an \s-1XML/RDF\s0 index generated by
   6.183 +the companion tool \fBopenpkg index\fR.
   6.184 +.SH "ARGUMENTS"
   6.185 +.IX Header "ARGUMENTS"
   6.186 +Packages are selected by providing a list of name patterns. Each
   6.187 +pattern is either a package name or a name prefix followed by a '\fI*\fR'
   6.188 +character. Additionally, in order to resolve ambiguous dependencies, you
   6.189 +can append a discrimination prefix separated by a comma that matches
   6.190 +against the full "\fIname\fR\-\fIversion\fR\-\fIrevision\fR" string of a package.
   6.191 +.SH "OPTIONS"
   6.192 +.IX Header "OPTIONS"
   6.193 +The following command line options exist:
   6.194 +.IP "\fB\-R\fR \fIcommand\fR" 4
   6.195 +.IX Item "-R command"
   6.196 +Specify the "\fBopenpkg rpm\fR" command with fully qualified path.
   6.197 +Several other internal paths are deduced from the \fIcommand\fR path,
   6.198 +so this has to be something like "\fIprefix\fR\f(CW\*(C`/bin/openpkg rpm\*(C'\fR".
   6.199 +.IP "\fB\-r\fR \fIrepository\fR" 4
   6.200 +.IX Item "-r repository"
   6.201 +Specify the path to an OpenPKG \s-1RPM\s0 package repository.
   6.202 +This can be a \s-1URL\s0 (including \*(L"file://\*(R") to download packages from or
   6.203 +an absolute directory path (identified by leading \*(L"/\*(R") or
   6.204 +a relative directory path (identified by leading \*(L"./\*(R") to access packages directly.
   6.205 +The name of the package file is appended to this path.
   6.206 +The default is to use a \s-1URL\s0 pointing to the \fBOpenPKG\fR download service
   6.207 +as determined by the "\fBopenpkg release\fR" command.
   6.208 +.IP "\fB\-f\fR \fIindex.rdf\fR" 4
   6.209 +.IX Item "-f index.rdf"
   6.210 +Specify the path to the primary \s-1XML/RDF\s0 index. This can be a \s-1URL\s0 or a
   6.211 +file path. If the index contains references to other indices, these
   6.212 +are recursively included automatically. The default is to use a \s-1URL\s0
   6.213 +pointing to the \fBOpenPKG\fR \s-1FTP\s0 server as as determined by the "\fBopenpkg
   6.214 +release\fR" command.
   6.215 +.IP "\fB\-u\fR" 4
   6.216 +.IX Item "-u"
   6.217 +The generated script will ignore binary RPMs that are stored on
   6.218 +your system. Instead it will either fetch binary RPMs or rebuild
   6.219 +from source RPMs fetched from the repository.
   6.220 +.IP "\fB\-U\fR" 4
   6.221 +.IX Item "-U"
   6.222 +The generated script will try to upgrade all selected packages
   6.223 +including their dependencies to the most recent version. Use
   6.224 +this for usual upgrade tasks in combination with option "\fB\-a\fR".
   6.225 +.IP "\fB\-z\fR" 4
   6.226 +.IX Item "-z"
   6.227 +The generated script will rebuild all selected packages
   6.228 +including their dependencies even when the most recent version
   6.229 +is already installed.
   6.230 +.IP "\fB\-Z\fR" 4
   6.231 +.IX Item "-Z"
   6.232 +\&\fBopenpkg build\fR ignores all installed packages, the
   6.233 +generated script will rebuild all selected packages from scratch.
   6.234 +.IP "\fB\-i\fR" 4
   6.235 +.IX Item "-i"
   6.236 +The generated script will ignore run-time errors.
   6.237 +.IP "\fB\-q\fR" 4
   6.238 +.IX Item "-q"
   6.239 +Ignore all reverse dependencies. This means that all packages which are
   6.240 +rebuild do \fInot\fR trigger a rebuild of packages which depend on them.
   6.241 +\&\fI\s-1ATTENTION:\s0 this might break already installed packages and has to be
   6.242 +used with care! You should really know what you are doing.\fR
   6.243 +.IP "\fB\-s\fR" 4
   6.244 +.IX Item "-s"
   6.245 +Generate a status map instead of the shell script. The map consists
   6.246 +of 3 columns: \fIold\fR, \fItag\fR and \fInew\fR. The \fIold\fR column shows
   6.247 +the installed version of a package (\fIname\fR\-\fIversion\fR\-\fIrelease\fR)
   6.248 +or just the package name (\fIname\fR) if no package of that name
   6.249 +is installed and the \fInew\fR column shows the repository version
   6.250 +(\fIname\fR\-\fIversion\fR\-\fIrelease\fR) of a package if it is considered for
   6.251 +installation. The \fItag\fR column shows the following possible values:
   6.252 +.RS 4
   6.253 +.IP "\s-1OK\s0" 10
   6.254 +.IX Item "OK"
   6.255 +The installed package is suitable and will not be touched.
   6.256 +.IP "\s-1ADD\s0" 10
   6.257 +.IX Item "ADD"
   6.258 +There is no installed package yet.
   6.259 +.IP "\s-1UPGRADE\s0" 10
   6.260 +.IX Item "UPGRADE"
   6.261 +The installed package is outdated and requires an update.
   6.262 +.IP "\s-1DEPEND\s0" 10
   6.263 +.IX Item "DEPEND"
   6.264 +The installed package needs rebuilding because one of its
   6.265 +dependencies is rebuild.
   6.266 +.IP "\s-1MISMATCH\s0" 10
   6.267 +.IX Item "MISMATCH"
   6.268 +The installed package needs rebuilding because it was build
   6.269 +with different parameters.
   6.270 +.IP "\s-1CONFLICT\s0" 10
   6.271 +.IX Item "CONFLICT"
   6.272 +The required new package cannot be installed because it
   6.273 +conflicts with some already installed package.
   6.274 +.IP "\s-1UNDEF\s0" 10
   6.275 +.IX Item "UNDEF"
   6.276 +The package has an invalid or ambiguous dependency.
   6.277 +.RE
   6.278 +.RS 4
   6.279 +.RE
   6.280 +.IP "\fB\-S\fR" 4
   6.281 +.IX Item "-S"
   6.282 +Similar to option "\fB\-s\fR" but also lists the newest versions in the
   6.283 +repository. The following \fItag\fR might appear in the map:
   6.284 +.RS 4
   6.285 +.IP "\s-1NEW\s0" 10
   6.286 +.IX Item "NEW"
   6.287 +The package exists in the repository but is not required yet.
   6.288 +.RE
   6.289 +.RS 4
   6.290 +.RE
   6.291 +.IP "\fB\-M\fR" 4
   6.292 +.IX Item "-M"
   6.293 +Similar to option "\fB\-s\fR" but print a short dependency map.
   6.294 +.IP "\fB\-L\fR" 4
   6.295 +.IX Item "-L"
   6.296 +Print a list of packages in the repository that depend on the target.
   6.297 +.IP "\fB\-W\fR" 4
   6.298 +.IX Item "-W"
   6.299 +Include all conditional dependencies as if all possible configuration
   6.300 +options had been switched on. This has little use in practice except for
   6.301 +generating an all-inclusive list with option "\fB\-L\fR". \fI\s-1ATTENTION:\s0 Even
   6.302 +mutually exclusive options are evaluated to be 'on', building packages
   6.303 +with option \*(L"\-W\*(R" therefore might fail or cause unusable results!\fR
   6.304 +.IP "\fB\-X\fR" 4
   6.305 +.IX Item "-X"
   6.306 +Use the slower but more robust external Perl \s-1XML\s0 parser module
   6.307 +XML::Simple instead of the simple internal \s-1XML/RDF\s0 parser.
   6.308 +.IP "\fB\-K\fR" 4
   6.309 +.IX Item "-K"
   6.310 +Keep packages that were installed temporarily during the build process.
   6.311 +Without this option those packages are removed.
   6.312 +.IP "\fB\-k\fR" 4
   6.313 +.IX Item "-k"
   6.314 +Keep packages that were downloaded temporarily for installation or building.
   6.315 +Without this option those packages are removed.
   6.316 +.IP "\fB\-e\fR" 4
   6.317 +.IX Item "-e"
   6.318 +Rebuild exact version of a package from repository even when you have
   6.319 +installed a newer version from another repository.
   6.320 +.IP "\fB\-b\fR" 4
   6.321 +.IX Item "-b"
   6.322 +Wrap package rebuilding commands with script execution-time checks for
   6.323 +existing binary packages if the package is rebuild as a dependency. Wrap
   6.324 +package install commands with script execution-time checks for different
   6.325 +\&\s-1MD5\s0 signature checksums of binary packages and installed packages. This
   6.326 +is best to use with option "\fB\-u\fR" to defer all such checks until script
   6.327 +execution-time.
   6.328 +.IP "\fB\-B\fR" 4
   6.329 +.IX Item "-B"
   6.330 +Same as option "\fB\-b\fR" but also check all explicit target packages for
   6.331 +existing binary packages at script execution-time.
   6.332 +.IP "\fB\-g\fR" 4
   6.333 +.IX Item "-g"
   6.334 +The generated script will rebuild all packages selected even when the
   6.335 +most recent version is already installed. Dependencies are not affected.
   6.336 +Use this especially for updating a package with different build options
   6.337 +(see option "\fB\-D\fR").
   6.338 +.IP "\fB\-P\fR \fIpriv-cmd\fR" 4
   6.339 +.IX Item "-P priv-cmd"
   6.340 +Command prefix to use for generated script commands that require
   6.341 +elevated privileges (like "\fBopenpkg rpm \-Uvh\fR"). The most common tool
   6.342 +for this is \fIsudo\fR\|(8). If \fIpriv-cmd\fR starts with a dash it will be run
   6.343 +without the dash and the command line it should execute is passed as
   6.344 +a single quoted string. Use this option for upgrading privileges. For
   6.345 +instance, if you are running the \f(CW\*(C`openpkg build\*(C'\fR\*(L" command as the
   6.346 +management user, use \*(R"\f(CW\*(C`\-P sudo\*(C'\fR\*(L" to make sure that the \*(R"\fBopenpkg rpm
   6.347 +\&\-Uvh\fR" commands in the generated script execute with necessary elevated
   6.348 +privileges.
   6.349 +.IP "\fB\-N\fR \fInon-priv-cmd\fR" 4
   6.350 +.IX Item "-N non-priv-cmd"
   6.351 +Command prefix to use for generated script commands that do \fInot\fR
   6.352 +require elevated privileges (like "\fBopenpkg rpm \-\-rebuild\fR"). The most
   6.353 +common tool for this is \fIsu\fR\|(8). If \fInon-priv-cmd\fR starts with a dash
   6.354 +it will be run without the dash and the command line it should execute
   6.355 +is passed as a single quoted string. Use this option for downgrading
   6.356 +privileges. For instance, if you are running the \f(CW\*(C`openpkg build\*(C'\fR"
   6.357 +command as the \fBroot\fR user, use "\f(CW\*(C`\-N \*(Aq\-su \- \*(C'\fR\fImusr\fR\f(CW\*(C` \-c\*(Aq\*(C'\fR" to make
   6.358 +sure that the non-privileged commands in the generated script execute
   6.359 +with privileges of the management user \fImusr\fR.
   6.360 +.IP "\fB\-p\fR \fIplatform\fR" 4
   6.361 +.IX Item "-p platform"
   6.362 +The platform string that is matched against the \s-1XML/RDF\s0 index for binary
   6.363 +packages. The default is an empty \fIplatform\fR string so that no binary
   6.364 +packages are matched at all.
   6.365 +.IP "\fB\-D\fR \fIvar\fR=\fIval\fR" 4
   6.366 +.IX Item "-D var=val"
   6.367 +Specify build options for selected packages. This can be either
   6.368 +"\fB\-D\fR \fIwith_xxx\fR=\fIyyy\fR\*(L" or just \*(R"\fB\-D\fR \fIwith_xxx\fR\*(L". The latter is
   6.369 +equivalent to a \*(R"\fB\-D\fR \fIwith_xxx\fR=\fIyes\fR\*(L". The parameters are matched
   6.370 +against selected packages that are already installed. If they do
   6.371 +indicate a change, the package is rebuild. There can be multiple \*(R"\fB\-D\fR"
   6.372 +options.
   6.373 +.Sp
   6.374 +If the option name is prefixed with a package name followed by
   6.375 +two colons then it applies only to the specified package, e.g.,
   6.376 +"\fB\-D\fR\fIfoo::with_bar\fR".
   6.377 +.IP "\fB\-E\fR \fIname\fR" 4
   6.378 +.IX Item "-E name"
   6.379 +Ignore a package with the specified \fIname\fR. This can be used to avoid
   6.380 +upgrading to a broken package in the repository or to skip a package
   6.381 +upgrade temporarily. If you use a wildcard pattern or the options
   6.382 +"\fB\-a\fR\*(L" or \*(R"\fB\-A\fR" then \fIname\fR will be excluded. There can be multiple
   6.383 +"\fB\-E\fR" options.
   6.384 +.IP "\fB\-H\fR \fIname\fR" 4
   6.385 +.IX Item "-H name"
   6.386 +Hint about packages that should be preferred when more than one fits
   6.387 +a requirement. There can be multiple "\fB\-H\fR" options.
   6.388 +.IP "\fB\-a\fR" 4
   6.389 +.IX Item "-a"
   6.390 +Select all installed packages. You cannot specify a pattern list together
   6.391 +with the "\fB\-a\fR" option.
   6.392 +.IP "\fB\-A\fR" 4
   6.393 +.IX Item "-A"
   6.394 +Select all packages in the repository. You cannot specify a pattern list
   6.395 +together with the "\fB\-A\fR" option.
   6.396 +.SH "ARGUMENTS"
   6.397 +.IX Header "ARGUMENTS"
   6.398 +In case neither option \fB\-a\fR nor option \fB\-A\fR are specified,
   6.399 +the command line has to contain one or more package \fIpattern\fR
   6.400 +arguments. Each \fIpattern\fR can have the following forms:
   6.401 +.IP "\fIname\fR" 4
   6.402 +.IX Item "name"
   6.403 +A regular package name.
   6.404 +.IP "\fIname\fR\fB*\fR" 4
   6.405 +.IX Item "name*"
   6.406 +A package name wildcard pattern.
   6.407 +.IP "\fIname\fR\fB,\fR\fIname\fR[\fB\-\fR\fIversion\fR[\fB\-\fR\fIrelease\fR]]" 4
   6.408 +.IX Item "name,name[-version[-release]]"
   6.409 +A regular package name followed by a constraint
   6.410 +which particular package should be chosen.
   6.411 +.SH "CONFIGURATION"
   6.412 +.IX Header "CONFIGURATION"
   6.413 +\&\fBopenpkg build\fR reads the configuration file \fI\f(CI$HOME\fI/.openpkg/build\fR.
   6.414 +The file lists default options, one option per line and section tags
   6.415 +of the form \f(CW\*(C`[\*(C'\fR\fIprefix\fR\f(CW\*(C`]\*(C'\fR. Options following such a tag are only
   6.416 +evaluated for the particular \fBOpenPKG\fR instance so that you can
   6.417 +define default options for multiple \fBOpenPKG\fR instances.
   6.418 +.PP
   6.419 +Example:
   6.420 +.PP
   6.421 +.Vb 2
   6.422 +\& # global options
   6.423 +\& \-X
   6.424 +\&
   6.425 +\& [/openpkg/current]
   6.426 +\& # options for CURRENT stack only
   6.427 +\& \-r http://download.openpkg.org/stacks/current/source/
   6.428 +\&
   6.429 +\& [/openpkg/foo]
   6.430 +\& # options for a FOO stack only
   6.431 +\& \-r http://download.openpkg.org/stacks/foo/source/
   6.432 +.Ve
   6.433 +.SH "EXAMPLES"
   6.434 +.IX Header "EXAMPLES"
   6.435 +The following shows a few typical OpenPKG instance
   6.436 +maintenance tasks which involve the \fBopenpkg build\fR command:
   6.437 +.SS "Installation"
   6.438 +.IX Subsection "Installation"
   6.439 +The following examples shows how to initially install an OpenPKG
   6.440 +instance under \fI/openpkg\fR with Apache/PHP & MySQL:
   6.441 +.PP
   6.442 +.Vb 5
   6.443 +\& # bootstrap the OpenPKG instance
   6.444 +\& $ curl \-L \-O http://openpkg.org/go/download/openpkg.src.sh
   6.445 +\& $ sh openpkg\-*\-*.src.sh \-\-prefix=/openpkg \e
   6.446 +\&   \-\-user=openpkg \-\-group=openpkg \-\-tag=openpkg
   6.447 +\& $ sh openpkg\-*\-*.*\-*\-openpkg.sh
   6.448 +\&
   6.449 +\& # install Apache/PHP & MySQL
   6.450 +\& $ /openpkg/bin/openpkg build \e
   6.451 +\&   \-D apache\-php::with_mysql=yes \e
   6.452 +\&   apache apache\-php mysql | sh
   6.453 +.Ve
   6.454 +.SS "Reinstallation"
   6.455 +.IX Subsection "Reinstallation"
   6.456 +The following example shows how to rebuild and reinstall the already
   6.457 +installed package \*(L"foo\*(R":
   6.458 +.PP
   6.459 +.Vb 2
   6.460 +\& # rebuild and reinstall package
   6.461 +\& $ /openpkg/bin/openpkg build \-g \-u foo | sh
   6.462 +.Ve
   6.463 +.SS "Change"
   6.464 +.IX Subsection "Change"
   6.465 +The following fictive example shows how to change the already
   6.466 +installed package \*(L"foo\*(R" by rebuilding and reinstalling it with the
   6.467 +"\f(CW\*(C`foo::with_bar\*(C'\fR" build-time option enabled.
   6.468 +.PP
   6.469 +.Vb 2
   6.470 +\& # change a package
   6.471 +\& $ /openpkg/bin/openpkg build \-g \-D with_bar=yes foo | sh
   6.472 +.Ve
   6.473 +.SS "Update"
   6.474 +.IX Subsection "Update"
   6.475 +The following example shows how to update (no major
   6.476 +OpenPKG version change) an OpenPKG instance under \fI/openpkg\fR:
   6.477 +.PP
   6.478 +.Vb 2
   6.479 +\& # update all packages to their latest version
   6.480 +\& $ /openpkg/bin/openpkg build \-Ua | sh
   6.481 +.Ve
   6.482 +.SS "Upgrade"
   6.483 +.IX Subsection "Upgrade"
   6.484 +The following examples shows a complete procedure for upgrading (major
   6.485 +OpenPKG version change) the instance under \fI/openpkg\fR to OpenPKG
   6.486 +4.X:
   6.487 +.PP
   6.488 +.Vb 3
   6.489 +\& # upgrade the bootstrap package
   6.490 +\& $ /openpkg/bin/openpkg build \e
   6.491 +\&   \-r http://download.openpkg.org/stacks/current/source/ openpkg | sh
   6.492 +\&
   6.493 +\& # upgrade the whole OpenPKG instance, in correct dependency
   6.494 +\& # order and by keeping all chosen build\-time options.
   6.495 +\& $ /openpkg/bin/openpkg build \-ZaKB | sh
   6.496 +.Ve
   6.497 +.SS "Deinstallation"
   6.498 +.IX Subsection "Deinstallation"
   6.499 +The following example shows how to deinstall
   6.500 +an entire OpenPKG intance under \fI/openpkg\fR:
   6.501 +.PP
   6.502 +.Vb 3
   6.503 +\& # remove all packages and the instance itself
   6.504 +\& $ /openpkg/bin/openpkg rpm \-e \e
   6.505 +\&   \`/openpkg/bin/openpkg rpm \-qa\`
   6.506 +.Ve
   6.507 +.SH "CAVEATS"
   6.508 +.IX Header "CAVEATS"
   6.509 +Parallel execution of \fBopenpkg build\fR causes undefined effects.
   6.510 +.SH "HISTORY"
   6.511 +.IX Header "HISTORY"
   6.512 +The \fBopenpkg build\fR command was invented in November 2002 by \fIMichael
   6.513 +van Elst\fR <mlelstv@serpens.de> under contract with \fICable
   6.514 +& Wireless\fR <http://www.cw.com/> for use inside the \fBOpenPKG\fR
   6.515 +project <http://www.openpkg.org/>. It was then further
   6.516 +refined by the \fBOpenPKG Foundation e.V.\fR as part of the OpenPKG Tool Chain.

     7.1 --- /dev/null	Thu Jan 01 00:00:00 1970 +0000
     7.2 +++ b/openpkg/build.pl	Tue Jul 31 12:23:42 2012 +0200
     7.3 @@ -0,0 +1,2603 @@
     7.4 +##
     7.5 +##  build.pl -- OpenPKG Package Building and Installing
     7.6 +##  Copyright (c) 2000-2012 OpenPKG GmbH <http://openpkg.com/>
     7.7 +##
     7.8 +##  This software is property of the OpenPKG GmbH, DE MUC HRB 160208.
     7.9 +##  All rights reserved. Licenses which grant limited permission to use,
    7.10 +##  copy, modify and distribute this software are available from the
    7.11 +##  OpenPKG GmbH.
    7.12 +##
    7.13 +##  THIS SOFTWARE IS PROVIDED "AS IS" AND ANY EXPRESSED OR IMPLIED
    7.14 +##  WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
    7.15 +##  MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED.
    7.16 +##  IN NO EVENT SHALL THE AUTHORS AND COPYRIGHT HOLDERS AND THEIR
    7.17 +##  CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,
    7.18 +##  SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT
    7.19 +##  LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF
    7.20 +##  USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND
    7.21 +##  ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY,
    7.22 +##  OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT
    7.23 +##  OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF
    7.24 +##  SUCH DAMAGE.
    7.25 +##
    7.26 +
    7.27 +#############################################################################
    7.28 +##
    7.29 +##  MAIN PROCEDURE
    7.30 +##
    7.31 +#############################################################################
    7.32 +
    7.33 +require 5;
    7.34 +#use strict;
    7.35 +my (
    7.36 +   $opt_h,
    7.37 +   $opt_R, $opt_r, $opt_f, $opt_u, $opt_U, $opt_a, $opt_A,
    7.38 +   $opt_z, $opt_Z, $opt_P, $opt_N, $opt_E, $opt_H, $opt_i,
    7.39 +   $opt_D, $opt_p, $opt_q, $opt_s, $opt_S, $opt_X, $opt_M,
    7.40 +   $opt_L, $opt_W, $opt_K, $opt_e, $opt_b, $opt_B, $opt_g,
    7.41 +   $opt_k
    7.42 +);
    7.43 +
    7.44 +#   global context variables
    7.45 +my $prg = "openpkg build";
    7.46 +my %env = ('' => {});
    7.47 +
    7.48 +##
    7.49 +##  OPTION PARSING
    7.50 +##
    7.51 +
    7.52 +#   parse command line options
    7.53 +my $getopts = 'hR:r:f:uUaAzZP:N:E:H:iD:p:qsSXMLWKebBgk';
    7.54 +getopts($getopts);
    7.55 +
    7.56 +#   parse configuration script options
    7.57 +if (open(FH, "<$ENV{'HOME'}/.openpkg/build")) {
    7.58 +    my ($env) = $env{''};
    7.59 +    my ($go) = $getopts;
    7.60 +    $go =~ s/[^a-zA-Z]//g;
    7.61 +    while (my $line = <FH>) {
    7.62 +        if ($line =~ m/^\s*\[([^\]]*)\]/) {
    7.63 +            $env{$1} = {} unless ($env{$1});
    7.64 +            $env = $env{$1};
    7.65 +        } elsif (my ($opt, $val) = ($line =~ m/^\-([$go])\s*(.*?)\s*$/)) {
    7.66 +            $val = 1 unless (defined($val));
    7.67 +            if (exists($env->{$opt})) {
    7.68 +                $env->{$opt} .= " " . $val;
    7.69 +            } else {
    7.70 +                $env->{$opt} = $val;
    7.71 +            }
    7.72 +        }
    7.73 +    }
    7.74 +    close(FH);
    7.75 +}
    7.76 +
    7.77 +#   usage sanity check and usage help
    7.78 +sub usage {
    7.79 +    my ($rc) = @_;
    7.80 +    my $usage =
    7.81 +        "openpkg:build:USAGE: $prg [options] [pattern ...]\n" .
    7.82 +        " -a                operate on all installed packages\n" .
    7.83 +        " -A                operate on all repository packages\n" .
    7.84 +        " -R <rpm>          path to \"openpkg rpm\" command\n" .
    7.85 +        " -r <repository>   URL to package repository directory\n" .
    7.86 +        " -f <index.rdf>    URL to package repository index file\n" .
    7.87 +        " -u                ignore local binary RPMs\n" .
    7.88 +        " -U                upgrade all selected packages including dependencies\n" .
    7.89 +        " -z                rebuild from zero all selected installed packages\n" .
    7.90 +        " -Z                rebuild from zero all selected available packages\n" .
    7.91 +        " -i                ignore errors in the generated script\n" .
    7.92 +        " -q                ignore all reverse dependencies\n" .
    7.93 +        " -s                generate status map instead of shell script\n" .
    7.94 +        " -S                generate status map instead of shell script (including new)\n" .
    7.95 +        " -X                use external XML/RDF parser instead of internal one\n" .
    7.96 +        " -M                generate short dependency map instead of shell script\n" .
    7.97 +        " -L                generate list of packages in repository depending on target\n" .
    7.98 +        " -W                include dependencies as if all build options are enabled\n" .
    7.99 +        " -K                keep temporarily installed packages\n" .
   7.100 +        " -k                keep temporarily downloaded packages\n" .
   7.101 +        " -e                rebuild exact version of a package from repository\n" .
   7.102 +        " -b                build-time check existing binaries for dependencies only\n" .
   7.103 +        " -B                build-time check existing binaries for dependencies and target\n" .
   7.104 +        " -g                rebuild packages even when most recent version is installed\n" .
   7.105 +        " -P <priv-cmd>     command prefix for privileged commands\n" .
   7.106 +        " -N <non-priv-cmd> command prefix for non-privileged commands\n" .
   7.107 +        " -p <platform>     match platform against repository index for binary packages\n" .
   7.108 +        " -E <name>         exclude package\n" .
   7.109 +        " -H <name>         hint about packages to resolve ambiquity\n" .
   7.110 +        " -D <name>[=<val>] set build option for packages\n";
   7.111 +    if ($rc == 0) {
   7.112 +        print STDOUT $usage;
   7.113 +    }
   7.114 +    else {
   7.115 +        print STDERR $usage;
   7.116 +    }
   7.117 +    exit($rc);
   7.118 +}
   7.119 +if ($opt_h) {
   7.120 +    usage(0);
   7.121 +}
   7.122 +if (not (   ($#ARGV >= 0  && !($opt_a || $opt_A))
   7.123 +         || ($#ARGV == -1 &&  ($opt_a || $opt_A)))) {
   7.124 +    usage(1);
   7.125 +};
   7.126 +
   7.127 +#   determine RPM run-time information
   7.128 +my $config = rpm_runtime_info();
   7.129 +
   7.130 +#   override command line options with configuration script options
   7.131 +#   now that the effectively used OpenPKG RPM command is known
   7.132 +foreach my $env (sort { $a cmp $b } grep {
   7.133 +       $config->{"rpm"}    =~ m/^\Q$_\E/ # compatibility
   7.134 +    or $config->{"prefix"} =~ m/^\Q$_\E/ # regular
   7.135 +} keys %env) {
   7.136 +    while (my ($opt, $val) = each(%{$env{$env}})) {
   7.137 +        eval "\$opt_$opt = '$val' unless defined \$opt_$opt;";
   7.138 +    }
   7.139 +}
   7.140 +
   7.141 +##
   7.142 +##  OPTION POST-PROCESSING
   7.143 +##
   7.144 +
   7.145 +my ($url, $repository, $installed, $env, $list, $bonly, $clist);
   7.146 +my ($pattern, %with, %exclude, %hint);
   7.147 +
   7.148 +#   determine package goal pattern
   7.149 +if ($opt_a) {
   7.150 +    $pattern = undef;
   7.151 +} else {
   7.152 +    $pattern = join(' ', @ARGV);
   7.153 +}
   7.154 +if ($opt_A) {
   7.155 +    $pattern = '*';
   7.156 +}
   7.157 +
   7.158 +#   parse build options
   7.159 +%with = map {
   7.160 +      m/([^\s=]+)(?:\=(\S+))?/
   7.161 +    ? ($1 => (defined($2) ? $2 : 'yes'))
   7.162 +    : ()
   7.163 +} split(/\s+/, $opt_D);
   7.164 +
   7.165 +#   split accumulated option values
   7.166 +%exclude = map { $_ => 1 } split(/\s+/, $opt_E);
   7.167 +%hint    = map { $_ => 1 } split(/\s+/, $opt_H);
   7.168 +
   7.169 +if (defined($opt_p)) {
   7.170 +    $config->{platform} = $opt_p;
   7.171 +}
   7.172 +
   7.173 +#   determine RPM package repository information
   7.174 +if (defined $opt_r) {
   7.175 +    $url = $opt_r;
   7.176 +    $url .= '/' unless $url =~ m/\/$/;
   7.177 +} else {
   7.178 +    $url = rpm_release_url();
   7.179 +}
   7.180 +#   if we read the index from a file we can no longer deduce
   7.181 +#   repository paths from index paths. For now lets assume
   7.182 +#   that everything is below SRC/ to be compatible with
   7.183 +#   existing file indexes.
   7.184 +if (defined($opt_f) and not defined($opt_r)) {
   7.185 +    $url .= 'SRC/';
   7.186 +}
   7.187 +
   7.188 +#   determine information about INSTALLED packages (virtual and regular),
   7.189 +#   including their options, provides and requirements
   7.190 +my $installed = get_installed();
   7.191 +
   7.192 +#   SPECIAL CASE post-processing for
   7.193 +#   -Z (ignore installed packages)
   7.194 +#   -a (operate for all installed packages)
   7.195 +if ($opt_a and $opt_Z) {
   7.196 +    #   This allows one to correctly upgrade an existing OpenPKG
   7.197 +    #   instance to a newer major version by querying all installed
   7.198 +    #   packages and their options (-a) but then ignore them (-Z) during
   7.199 +    #   the later processing and instead perform more or less a fresh
   7.200 +    #   rebuild from scratch. This ensures that during the process the
   7.201 +    #   installed packages are effectively picked up as dependencies
   7.202 +    #   only after they in turn were already updated.
   7.203 +    foreach my $package (keys(%{$installed})) {
   7.204 +        next if ($package =~ m/::/);
   7.205 +        if (exists($installed->{$package}->{""})) {
   7.206 +            #   virtual package
   7.207 +            $hint{$installed->{$package}->{""}->[0]->{"name"}} = 1
   7.208 +                if (exists($installed->{$package}->{""}->[0]->{"name"}));
   7.209 +        }
   7.210 +        else {
   7.211 +            #   regular package
   7.212 +            $pattern .= " $package";
   7.213 +            foreach my $version (keys(%{$installed->{$package}})) {
   7.214 +                foreach my $rec (@{$installed->{$package}->{$version}}) {
   7.215 +                    if (defined($rec->{"OPTIONS"})) {
   7.216 +                        my $options = $rec->{"OPTIONS"};
   7.217 +                        foreach my $option (keys(%{$options})) {
   7.218 +                            $with{$package."::".$option} = $options->{$option};
   7.219 +                        }
   7.220 +                    }
   7.221 +                }
   7.222 +            }
   7.223 +        }
   7.224 +    }
   7.225 +}
   7.226 +if ($opt_Z) {
   7.227 +    $installed = {};
   7.228 +}
   7.229 +
   7.230 +#   determine information about AVAILABLE packages
   7.231 +#   by fetching and parsing a package repository XML/RDF index
   7.232 +$repository = get_index(
   7.233 +    $url . '00INDEX.rdf',
   7.234 +    $opt_f,
   7.235 +    $opt_X,
   7.236 +    $config->{platform},
   7.237 +    $installed
   7.238 +);
   7.239 +
   7.240 +#   assemble together all determined environment information
   7.241 +$env = {
   7.242 +    config     => $config,
   7.243 +    installed  => $installed,
   7.244 +    repository => $repository,
   7.245 +    built      => {},
   7.246 +    revdep     => undef,
   7.247 +    with       => \%with,
   7.248 +    exclude    => \%exclude,
   7.249 +    hint       => \%hint,
   7.250 +    upgrade    => ($opt_a || $opt_U),
   7.251 +    zero       => ($opt_z || $opt_Z),
   7.252 +    exact      => $opt_e,
   7.253 +    quick      => ($opt_q || $opt_z || $opt_Z),
   7.254 +    status     => ($opt_s || $opt_S),
   7.255 +    fatal      => [],
   7.256 +    goals      => $opt_g,
   7.257 +    sourceonly => ($opt_u || $opt_U || $opt_z || $opt_Z)
   7.258 +};
   7.259 +
   7.260 +##
   7.261 +##  PERFORM REQUESTED OPERATION
   7.262 +##
   7.263 +
   7.264 +if ($opt_L) {
   7.265 +    #   case 1: calculate dependencies only and
   7.266 +    #           print packages depending on target
   7.267 +    ($list) = build_deps($pattern, $env);
   7.268 +    print_deps($list);
   7.269 +} else {
   7.270 +    #   case 2: calculate build commands and
   7.271 +    #           print results in different formats
   7.272 +    ($list, $bonly, $clist) = build_list($pattern, $env);
   7.273 +    die "openpkg:build:FATAL: cannot find package\n" if (not defined($list));
   7.274 +    if ($opt_M) {
   7.275 +        print_map($installed, $repository, $list, $bonly, $clist);
   7.276 +    } elsif ($opt_S) {
   7.277 +        print_status($installed, $repository, $list, $bonly, $clist);
   7.278 +    } elsif ($opt_s) {
   7.279 +        print_status($installed, {}, $list, $bonly, $clist);
   7.280 +    } else {
   7.281 +        if (@{$env->{fatal}}) {
   7.282 +            die "openpkg:build:FATAL: errors occured while building:\n", @{$env->{fatal}}, "\n";
   7.283 +        }
   7.284 +        print_list1($list, $config, $opt_a || $opt_u || $opt_U, $env->{with}, $opt_i, $opt_b, $opt_B);
   7.285 +        print_list2($bonly, $config) if (not $opt_K);
   7.286 +    }
   7.287 +}
   7.288 +
   7.289 +#   die gracefully
   7.290 +exit(0);
   7.291 +
   7.292 +#############################################################################
   7.293 +##
   7.294 +##  FUNCTIONS: PARSING & RUN-TIME INFORMATION
   7.295 +##
   7.296 +#############################################################################
   7.297 +
   7.298 +#   home-brewn getopt(3) style option parser
   7.299 +sub getopts ($) {
   7.300 +    my ($opts) = @_;
   7.301 +    my (%optf) = map { m/(\w)/; $1 => $_ } $opts =~ m/(\w:|\w)/g;
   7.302 +    my (%opts, @argv, $optarg);
   7.303 +
   7.304 +    foreach (@ARGV) {
   7.305 +        if (@argv) {
   7.306 +            push @argv, $_;
   7.307 +        } elsif (defined $optarg) {
   7.308 +            if (exists $opts{$optarg}) {
   7.309 +                $opts{$optarg} .= " $_";
   7.310 +            } else {
   7.311 +                $opts{$optarg} = $_;
   7.312 +            }
   7.313 +            $optarg = undef;
   7.314 +        } elsif (!/^[-]/) {
   7.315 +            push @argv, $_;
   7.316 +        } else {
   7.317 +            while (/^\-(\w)(.*)/) {
   7.318 +                if (exists $optf{$1}) {
   7.319 +                    if (length($optf{$1}) > 1) {
   7.320 +                        if ($2 ne '') {
   7.321 +                            if (exists $opts{$1}) {
   7.322 +                                $opts{$1} .= " $2";
   7.323 +                            } else {
   7.324 +                                $opts{$1} = $2;
   7.325 +                            }
   7.326 +                        } else {
   7.327 +                            $optarg = $1;
   7.328 +                        }
   7.329 +                        last;
   7.330 +                    } else {
   7.331 +                        $opts{$1} = 1;
   7.332 +                    }
   7.333 +                } else {
   7.334 +                    warn "openpkg:build:WARNING: unknown option $_\n";
   7.335 +                }
   7.336 +                $_ = "-$2";
   7.337 +            }
   7.338 +        }
   7.339 +    }
   7.340 +    if (defined $optarg) {
   7.341 +        warn "openpkg:build:WARNING: option $optarg requires an argument\n";
   7.342 +    }
   7.343 +    foreach (keys %opts) {
   7.344 +        eval '$opt_'.$_.' = "'.quotemeta($opts{$_}).'";';
   7.345 +    }
   7.346 +    @ARGV = @argv;
   7.347 +}
   7.348 +
   7.349 +#   determine RPM run-time information
   7.350 +sub rpm_runtime_info () {
   7.351 +    #   determine OpenPKG instance prefix via
   7.352 +    #   1. the environment of the "openpkg build" framework
   7.353 +    #   2. the installation path of the script
   7.354 +    #   3. the installation path of the Perl interpreter
   7.355 +    #   4. the path of the "openpkg" command in $PATH
   7.356 +    my $l_prefix = $ENV{'OPENPKG_PREFIX'};
   7.357 +    if (not $l_prefix) {
   7.358 +        ($l_prefix) = ($0 =~ m/^(.+)\/lib(exec)?\/openpkg(-tools)?\/build(\.pl)?$/);
   7.359 +    }
   7.360 +    if (not $l_prefix) {
   7.361 +        ($l_prefix) = ($^X =~ m/^(.+)\/bin\/perl.*$/);
   7.362 +    }
   7.363 +    if (not $l_prefix) {
   7.364 +        $l_prefix = (`(which openpkg) 2>/dev/null` =~ m/^(.+)\/bin\/openpkg$/);
   7.365 +    }
   7.366 +    if (not -x "$l_prefix/bin/openpkg") {
   7.367 +        die "openpkg:build:FATAL: cannot determine OpenPKG instance prefix";
   7.368 +    }
   7.369 +    print "# operating with OpenPKG instance $l_prefix\n";
   7.370 +
   7.371 +    #   determine OpenPKG RPM command
   7.372 +    my $rpm = $opt_R || $env{''}->{'R'} ||
   7.373 +        ((-f "$l_prefix/bin/openpkg" && -f "$l_prefix/libexec/openpkg/rpm") ?
   7.374 +        "$l_prefix/bin/openpkg rpm" : "$l_prefix/bin/rpm");
   7.375 +    $rpm = (`(which $rpm) 2>/dev/null` =~ m{^(/.*)})[0] if ($rpm !~ m|^/|);
   7.376 +    die "openpkg:build:FATAL: cannot locate OpenPKG RPM in path" unless ($rpm =~ m{^/});
   7.377 +    print "# operating with OpenPKG RPM $rpm\n";
   7.378 +
   7.379 +    #   determine additional tools
   7.380 +    my $mkp = "$l_prefix/bin/openpkg makeproxy";
   7.381 +    my $rel = "$l_prefix/bin/openpkg release";
   7.382 +    my $bzip2 = $rpm;
   7.383 +    $bzip2 =~ s/\/bin\/openpkg rpm$/\/lib\/openpkg\/bzip2/;
   7.384 +    my $curl = $rpm;
   7.385 +    $curl =~ s/\/bin\/openpkg rpm$/\/lib\/openpkg\/curl/;
   7.386 +    $curl = "$l_prefix/bin/openpkg curl" if (system("$l_prefix/bin/openpkg curl file://$l_prefix/etc/openpkg/platform >/dev/null 2>&1") == 0);
   7.387 +
   7.388 +    #   expand RPM macros holding information
   7.389 +    my $c = run("$rpm --eval '%{_rpmdir} %{_rpmfilename} %{_target_os} %{_target_cpu} %{_srcrpmdir}'");
   7.390 +
   7.391 +    #   parse and post-process information
   7.392 +    chomp($c);
   7.393 +    my (@q) = split(/\s+/, $c);
   7.394 +    $q[1] =~ s/%{OS}/$q[2]/;
   7.395 +    $q[1] =~ s/%{ARCH}/$q[3]/;
   7.396 +
   7.397 +    #   expand RPM rc information about tools
   7.398 +    $c = run("$rpm --showrc");
   7.399 +    my @g = ($c =~ m/\%\{l_tool_locate\s+([^\s\}]+)/g);
   7.400 +
   7.401 +    #   return accumulated information
   7.402 +    return {
   7.403 +        rpm      => $rpm,
   7.404 +        mkp      => $mkp,
   7.405 +        rel      => $rel,
   7.406 +        bzip2    => $bzip2,
   7.407 +        curl     => $curl,
   7.408 +        rpmdir   => $q[0],
   7.409 +        srcrpmdir=> $q[4],
   7.410 +        template => $q[1],
   7.411 +        platform => '',
   7.412 +        prefix   => $l_prefix,
   7.413 +        optreg   => '(?:'. join('|', map { "\Quse_$_\E" } @g) .')'
   7.414 +    };
   7.415 +}
   7.416 +
   7.417 +#   determine RPM release URL
   7.418 +sub rpm_release_url ($$) {
   7.419 +    my ($rel, $url);
   7.420 +
   7.421 +    #   determine the release URL the newer way
   7.422 +    $url = run("(".$config->{"rel"}." --fmt='%u') 2>/dev/null || true") || "";
   7.423 +    $url =~ s/^\s+//s;
   7.424 +    $url =~ s/\s+$//s;
   7.425 +
   7.426 +    #   use a local jumpstart RDF
   7.427 +    if (-f $config->{"prefix"}."/etc/openpkg/build.rdf") {
   7.428 +        $url = "file://".$config->{"prefix"}."/etc/openpkg/build.rdf"
   7.429 +    }
   7.430 +
   7.431 +    return $url;
   7.432 +}
   7.433 +
   7.434 +#############################################################################
   7.435 +##
   7.436 +##  FUNCTIONS: VERSION STRING HANDLING
   7.437 +##
   7.438 +#############################################################################
   7.439 +
   7.440 +#   compare two package versions
   7.441 +#   - "openpkg rpm":
   7.442 +#     splits according to !isalnum(3) ([a-zA-Z0-9])
   7.443 +#     and between isdigit(3) ([0-9]) and isalpha(3) ([a-zA-Z])
   7.444 +#   - "openpkg build" (this):
   7.445 +#     splits on "." characters
   7.446 +sub vcmp_version ($$) {
   7.447 +    my ($a, $b) = @_;
   7.448 +    my (@a, @b, $c);
   7.449 +    my ($ax, $bx);
   7.450 +
   7.451 +    #   split according to dots
   7.452 +    @a = split(/\./, $a);
   7.453 +    @b = split(/\./, $b);
   7.454 +
   7.455 +    #   compare as long as components exist
   7.456 +    while (@a && @b) {
   7.457 +        if ($a[0] =~ m/^\d+$/ && $b[0] =~ m/^\d+$/) {
   7.458 +            #   numerical comparison
   7.459 +            $c = $a[0] <=> $b[0];
   7.460 +        } elsif ((($a, $ax) = $a[0] =~ m/^(\d+)(.*)$/) &&
   7.461 +                 (($b, $bx) = $b[0] =~ m/^(\d+)(.*)$/)) {
   7.462 +            #   numerical comparison for prefix,
   7.463 +            #   string comparison for remainder
   7.464 +            $c = $a <=> $b;
   7.465 +            $c = $ax cmp $bx unless ($c);
   7.466 +        } else {
   7.467 +            #   string comparison
   7.468 +            $c = $a[0] cmp $b[0];
   7.469 +        }
   7.470 +
   7.471 +        #   stop comparison if components already mismatched
   7.472 +        return $c if ($c != 0);
   7.473 +
   7.474 +        #   else reduce by one component level
   7.475 +        shift(@a);
   7.476 +        shift(@b);
   7.477 +    }
   7.478 +
   7.479 +    #   finally compare number of remaining components
   7.480 +    #   (in case one is more specific)
   7.481 +    $c = (scalar(@a) <=> scalar(@b));
   7.482 +    return $c;
   7.483 +}
   7.484 +
   7.485 +#   compare two package releases
   7.486 +#   - "openpkg rpm":
   7.487 +#     uses "vcmp_version" semantics 1:1 again
   7.488 +#   - "openpkg build" (this):
   7.489 +#     uses "vcmp_version" semantics 1:1 again (>= 20060719)
   7.490 +#     trivial string comparison               (<= 20060719)
   7.491 +sub vcmp_release ($$) {
   7.492 +    my ($a, $b) = @_;
   7.493 +
   7.494 +    return vcmp_version($a, $b);
   7.495 +}
   7.496 +
   7.497 +#   compare two package "version" or "version-release" strings
   7.498 +#   - "openpkg rpm":
   7.499 +#     compares "epoch", "version", "release" (in this order)
   7.500 +#   - "openpkg build" (this):
   7.501 +#     compares "release", "version", (in this order)
   7.502 +sub vcmp ($$) {
   7.503 +    my ($a, $b) = @_;
   7.504 +    my ($c);
   7.505 +
   7.506 +    #   short-circuit comparison for simple case
   7.507 +    return 0 if ($a eq $b);
   7.508 +
   7.509 +    #   split into "version" and "release"
   7.510 +    my ($av, $ar) = ($a =~ m/^(.*?)(?:\-([\d\.]+))?$/);
   7.511 +    my ($bv, $br) = ($b =~ m/^(.*?)(?:\-([\d\.]+))?$/);
   7.512 +
   7.513 +    #   compare "release"
   7.514 +    if (defined($ar) and defined($br)) {
   7.515 +        $c = vcmp_release($ar, $br);
   7.516 +        return $c if ($c); # short-circuit
   7.517 +    }
   7.518 +
   7.519 +    #   compare "version"
   7.520 +    if (defined($av) && defined($bv)) {
   7.521 +        $c = vcmp_version($av, $bv);
   7.522 +        return $c if ($c); # short-circuit
   7.523 +    }
   7.524 +
   7.525 +    #   equality
   7.526 +    return 0;
   7.527 +}
   7.528 +
   7.529 +#   create "version" or "version-release" string
   7.530 +#   from a provide object (see parse_provides)
   7.531 +sub vs ($) {
   7.532 +    my ($t) = @_;
   7.533 +    return (
   7.534 +          defined($t->{release})
   7.535 +        ? "$t->{version}-$t->{release}"
   7.536 +        : $t->{version}
   7.537 +    );
   7.538 +}
   7.539 +
   7.540 +#   create "name-version" or "name-version-release" string
   7.541 +#   from a provide object (see parse_provides)
   7.542 +sub vsn ($) {
   7.543 +    my ($t) = @_;
   7.544 +    return "$t->{name}-".vs($t);
   7.545 +}
   7.546 +
   7.547 +#############################################################################
   7.548 +##
   7.549 +##  FUNCTIONS: INSTALLATION INFORMATION
   7.550 +##
   7.551 +#############################################################################
   7.552 +
   7.553 +#   parse OpenPKG RPM 'provide' string
   7.554 +#   "<virtual-name>"               (virtual package)
   7.555 +#   "<name> = <version>-<release>" (regular package)
   7.556 +#   "<name>::<option> = <value>"   (regular package build option)
   7.557 +sub parse_provides ($) {
   7.558 +    my ($s) = @_;
   7.559 +    my ($nam, $val, $pre, $with, $pxy, $ver, $rel);
   7.560 +
   7.561 +    ($nam, $val) = ($s =~ m/^([^\s\(]+(?:\([^\)]*\))?)\s*(?:=\s*(\S*?))?$/);
   7.562 +    if (($pre, $with) = ($nam =~ m/^(\S+?)::(\S*)$/)) {
   7.563 +        #   build option
   7.564 +        $val =~ s/(?:\%([0-9a-fA-F][0-9a-fA-F]))/chr(hex($1))/eg; # hex decode
   7.565 +        ($ver, $rel, $pxy) = ($val, undef, undef);
   7.566 +    } else {
   7.567 +        #   virtual or real package
   7.568 +        ($ver, $rel, $pxy) = ($val =~ m/^([^\s\-]+)-([^\s\+]+)(\+PROXY)?$/);
   7.569 +    }
   7.570 +
   7.571 +    #   return accumulated information
   7.572 +    return {
   7.573 +        name    => $nam,     # the full name of the resource
   7.574 +        version => $ver,     # the version        (or value)
   7.575 +        release => $rel,     # and release number (or undef)
   7.576 +        proxy   => $pxy,     # whether the resource is a PROXY resource (or undef)
   7.577 +        prefix  => $pre,     # the packagename (if resource is an option)
   7.578 +        with    => $with     # the buildoption (if resource is an option)
   7.579 +    };
   7.580 +}
   7.581 +
   7.582 +#   parse option from RPM 'provides' list
   7.583 +sub parse_provideslist ($) {
   7.584 +    my ($l) = @_;
   7.585 +    my ($p);
   7.586 +    my ($nam, $val, %opts);
   7.587 +
   7.588 +    foreach (@$l) {
   7.589 +        $p = parse_provides($_);
   7.590 +        next if (not (defined $p->{with} && defined $p->{prefix}));
   7.591 +        $opts{$p->{with}} = $p->{version};
   7.592 +    }
   7.593 +    return \%opts;
   7.594 +}
   7.595 +
   7.596 +#   translate dependency object into provides object
   7.597 +sub depends2provides ($) {
   7.598 +    my ($dep) = @_;
   7.599 +    my ($ver, $rel, $pxy, $pre, $with);
   7.600 +
   7.601 +    ($ver, $rel, $pxy) = ($dep->{val} =~ m/^([^\s\-]+)-([^\s\+]+)(\+PROXY)?$/);
   7.602 +    ($pre, $with) = ($dep->{name} =~ m/^(\S+?)::(\S*)$/);
   7.603 +
   7.604 +    return {
   7.605 +        name    => $dep->{name},
   7.606 +        version => (defined $ver ? $ver : $dep->{val}),
   7.607 +        release => $rel,
   7.608 +        proxy   => $pxy,
   7.609 +        prefix  => $pre,
   7.610 +        with    => $with
   7.611 +    }
   7.612 +}
   7.613 +
   7.614 +#   parse OpenPKG RPM 'require' string
   7.615 +#   "<virtual-name>"                              (virtual package)
   7.616 +#   "<name> =|<|<=|>|>= <version>[-<release>]"    (regular package)
   7.617 +#   "<name>::<option> =|<|<=|>|>= <value>"        (regular package build option)
   7.618 +sub parse_depends ($) {
   7.619 +    my ($dep) = @_;
   7.620 +    my ($name, $op, $val);
   7.621 +
   7.622 +    if (ref($dep)) {
   7.623 +        #   dependency from new index stored as a node
   7.624 +        #   - content of the node is the name
   7.625 +        #   - certain attributes denote the comparison operator
   7.626 +        #   - the value of such an attribute is the comparison operand
   7.627 +        #   - the operator (and operand) are optional and there can only be one
   7.628 +        $name = $dep->{content};
   7.629 +        $op = undef;
   7.630 +        $op = 'equ' if (exists($dep->{equ}));
   7.631 +        $op = 'geq' if (exists($dep->{geq}));
   7.632 +        $op = 'leq' if (exists($dep->{leq}));
   7.633 +        $op = 'gt'  if (exists($dep->{gt}));
   7.634 +        $op = 'lt'  if (exists($dep->{lt}));
   7.635 +        if (defined($op)) {
   7.636 +            $val = $dep->{$op};
   7.637 +        }
   7.638 +    } elsif ($dep =~ m/\S/) {
   7.639 +        #   dependency from old index stored as text string
   7.640 +        #   "name operator operand" or "name"
   7.641 +        ($name, $op, $val) = ($dep =~ m/(\S+)\s*(?:(\S+)\s*(\S+))?\s*$/);
   7.642 +        if (defined($op)) {
   7.643 +            $op = {
   7.644 +                '=='  => 'equ', '='   => 'equ',
   7.645 +                '>='  => 'geq', '=>'  => 'geq',
   7.646 +                '<='  => 'leq', '=<'  => 'leq',
   7.647 +                '>'   => 'gt',  '<'   => 'lt'
   7.648 +            }->{$op};
   7.649 +            if (not defined($op)) {
   7.650 +                print "# don't know how to handle dependency: $dep (invalid operator)\n";
   7.651 +                return;
   7.652 +            }
   7.653 +        }
   7.654 +    }
   7.655 +    return {
   7.656 +        name => $name,
   7.657 +        op   => $op,
   7.658 +        val  => $val
   7.659 +    };
   7.660 +}
   7.661 +
   7.662 +#   retrieve the local installed package base.
   7.663 +#   for packages that provide option resources (packagename::buildoption)
   7.664 +#   the options are parsed into the OPTIONS hash.
   7.665 +#   other packages will query options on demand.
   7.666 +sub get_installed () {
   7.667 +    my (%map);
   7.668 +    my (@l, $p);
   7.669 +    my ($nam, $val, %options);
   7.670 +    my ($vs, $rec, @list);
   7.671 +    my ($name, $version, $release);
   7.672 +    my ($req);
   7.673 +
   7.674 +    #   generated total result:
   7.675 +    #   $map = {
   7.676 +    #       #   regular package
   7.677 +    #       "<package-name>" <foo> => {
   7.678 +    #            "<version>-<release>" <1.2.3-20060622> => [
   7.679 +    #                <<1>{
   7.680 +    #                    "name"    => $name,
   7.681 +    #                    "version" => $version,
   7.682 +    #                    "release" => $release,
   7.683 +    #                    "PROXY"   => $proxy,
   7.684 +    #                    "depends" => [
   7.685 +    #                          <<3>>{
   7.686 +    #                              "cond"  => '',
   7.687 +    #                              "value" => {
   7.688 +    #                                  name => $name,
   7.689 +    #                                  op   => $op,
   7.690 +    #                                  val  => $val
   7.691 +    #                              },
   7.692 +    #                          },
   7.693 +    #                          ...
   7.694 +    #                    ],
   7.695 +    #                    "keeps" => [
   7.696 +    #                          \<<3>
   7.697 +    #                          ...
   7.698 +    #                    ],
   7.699 +    #                    "OPTIONS" => {
   7.700 +    #                        "<option>" => "<value>",
   7.701 +    #                        "<option>" => "<value>",
   7.702 +    #                        ...
   7.703 +    #                    },
   7.704 +    #                },
   7.705 +    #                ...
   7.706 +    #            ],
   7.707 +    #       },
   7.708 +    #       #   build option
   7.709 +    #       "<package-name>::<option>" <foo::with_baz> => {
   7.710 +    #            "<value>" <yes> => [
   7.711 +    #                \<<1>>
   7.712 +    #                ...
   7.713 +    #            ],
   7.714 +    #       },
   7.715 +    #       #   virtual package
   7.716 +    #       "<package-name>" <BAR> => {
   7.717 +    #            "" => [
   7.718 +    #                \<<1>>,
   7.719 +    #                ...
   7.720 +    #            ],
   7.721 +    #       },
   7.722 +    #       ...
   7.723 +    #   };
   7.724 +
   7.725 +    #   query and parse all provides of all packages
   7.726 +    #   HINT: We assume(!) that OpenPKG RPM outputs "provides" in order:
   7.727 +    #         1. virtual package & build option
   7.728 +    #         2. regular package
   7.729 +    #   FIXME: The better long-term solution for all this fiddling would be something like:
   7.730 +    #          "openpkg rpm -qa -qf '%{NAME} %{VERSION} %{RELEASE}[ .%{PROVIDENAME} .%{PROVIDEFLAGS:depflags} .%{PROVIDEVERSION}]\\n'"
   7.731 +    @l = run($config->{"rpm"}. " --provides -qa");
   7.732 +    @list = ();
   7.733 +    foreach (@l) {
   7.734 +        #   parse into provide object
   7.735 +        $p = parse_provides($_) or next;
   7.736 +
   7.737 +        #   short-circuit processing for RPM special case
   7.738 +        next if ($p->{name} =~ m/^gpg\(/);
   7.739 +
   7.740 +        #   is this an option?
   7.741 +        if (defined($p->{with})) {
   7.742 +            $options{$p->{prefix}}->{$p->{with}} = $p->{version};
   7.743 +            push(@list, $p);
   7.744 +            next;
   7.745 +        }
   7.746 +
   7.747 +        #   is this a virtual target?
   7.748 +        $vs = vs($p);
   7.749 +        if ($vs eq '') {
   7.750 +            push(@list, $p);
   7.751 +            next;
   7.752 +        }
   7.753 +
   7.754 +        #   assemble package details
   7.755 +        $name    = $p->{name};
   7.756 +        $version = defined($p->{version}) ? $p->{version} : '*';
   7.757 +        $release = defined($p->{release}) ? $p->{release} : '*';
   7.758 +        push(@list, {
   7.759 +            name    => $name,
   7.760 +            version => $version,
   7.761 +            release => $release
   7.762 +        });
   7.763 +
   7.764 +        #   create target record
   7.765 +        $rec = {
   7.766 +            name       => $name,
   7.767 +            version    => $version,
   7.768 +            release    => $release,
   7.769 +            PROXY      => $p->{proxy},
   7.770 +            depends    => [],
   7.771 +            keeps      => []
   7.772 +        };
   7.773 +        foreach (@list) {
   7.774 +            push(@{$map{$_->{name}}->{vs($_)}}, $rec);
   7.775 +        }
   7.776 +
   7.777 +        #   remove assembled details
   7.778 +        @list = ();
   7.779 +    }
   7.780 +    if (@list) {
   7.781 +        print "# ATTENTION: ", scalar(@list), " froods (unassignable RPM 'provides') left\n";
   7.782 +    }
   7.783 +
   7.784 +    #   options are provided for a package,
   7.785 +    #   apply them to all instances of the package
   7.786 +    #   FIXME: duplicate copying because record exists multiple times (but harmless)
   7.787 +    #   FIXME: merges all "provides" of all package instances together -- which might be wrong
   7.788 +    foreach $nam (keys(%options)) {
   7.789 +        foreach $val (keys(%{$map{$nam}})) {
   7.790 +            foreach (@{$map{$nam}->{$val}}) {
   7.791 +                $_->{OPTIONS} = $options{$nam};
   7.792 +            }
   7.793 +        }
   7.794 +    }
   7.795 +
   7.796 +    #   query all 'requires' of all installed packages
   7.797 +    #   to determine the package dependencies
   7.798 +    @l = run($config->{"rpm"} . " --qf '%{NAME}:::%{VERSION}:::%{RELEASE}[ :::%{REQUIRENAME}:::%{REQUIREFLAGS:depflags}:::%{REQUIREVERSION}:::]\\n' -qa");
   7.799 +    @list = ();
   7.800 +    foreach (@l) {
   7.801 +        ($name, $version, $release, $req) = m/^([^:]+):::([^:]+):::([^:]+)(.*?)$/;
   7.802 +        next if ($name eq 'gpg-pubkey');
   7.803 +        $release =~ s/\+PROXY$//;
   7.804 +        #   for each requirement triple...
   7.805 +        while ($req =~ m/\s+:::(.+?):::\s*(.*?)\s*:::(.*?):::/g) {
   7.806 +            $p = parse_depends("$1 $2 $3");
   7.807 +            next if ($p->{name} =~ m/^(rpmlib|gpg)\(/);
   7.808 +            $vs = vs({ version => $version, release => $release });
   7.809 +            $p = { cond => '', value => $p };
   7.810 +            foreach $rec (@{$map{$name}->{$vs}}) {
   7.811 +                push(@{$rec->{depends}}, $p);
   7.812 +                push(@{$rec->{keeps}},   $p);
   7.813 +            }
   7.814 +        }
   7.815 +    }
   7.816 +    if (@list) {
   7.817 +        print "# ATTENTION: ",scalar(@list)," fnords (unassignable RPM 'requires') left\n";
   7.818 +    }
   7.819 +
   7.820 +    #   return final result
   7.821 +    return \%map;
   7.822 +}
   7.823 +
   7.824 +#############################################################################
   7.825 +##
   7.826 +##  FUNCTIONS: REPOSITORY INDEX INFORMATION
   7.827 +##
   7.828 +#############################################################################
   7.829 +
   7.830 +#   fetch XML/RDF index from file or URL
   7.831 +#   (recursively fetches sub-indexes, too)
   7.832 +sub get_index ($$$$$) {
   7.833 +    my ($url, $fn, $xml, $pfmatch, $installed) = @_;
   7.834 +    my (%map, $include);
   7.835 +    my ($fetch, $bzip2, $path);
   7.836 +    my ($parser);
   7.837 +
   7.838 +    #   determine command/path to fetch/open index
   7.839 +    $bzip2 = $config->{"bzip2"};
   7.840 +    $fetch = defined($fn) ? $fn : $url;
   7.841 +    $fetch !~ m/\.bz2$/ || -x $bzip2
   7.842 +        or die "openpkg:build:FATAL: $bzip2 not found\n";
   7.843 +    if ($fetch =~ m/^\w+:/) {
   7.844 +        #   looks like URL scheme
   7.845 +        print "# fetching XML/RDF index from URL $fetch\n";
   7.846 +        $path = $config->{"curl"} . " -s -o - \"$fetch\" |";
   7.847 +        $path .= "$bzip2 -dc |" if ($fetch =~ m/\.bz2$/);
   7.848 +    } else {
   7.849 +        print "# reading XML/RDF index from file $fetch\n";
   7.850 +        if ($fetch =~ m/\.bz2$/) {
   7.851 +            $path = "$bzip2 -dc $fetch |";
   7.852 +        } else {
   7.853 +            $path = "<$fetch";
   7.854 +        }
   7.855 +    }
   7.856 +
   7.857 +    #   open index
   7.858 +    open(RFH, $path) or
   7.859 +        die "openpkg:build:FATAL: cannot open '$fetch' ($!)\n";
   7.860 +
   7.861 +    #   if XML parser can be used, try to lazy-load it
   7.862 +    if ($xml) {
   7.863 +        eval { require XML::Simple; };
   7.864 +        $xml = 0 if ($@);
   7.865 +    }
   7.866 +
   7.867 +    #   determine and run XML parser
   7.868 +    #   (returns contained index includes)
   7.869 +    $parser = ($xml ? \&xml_parser : \&simple_text_parser);
   7.870 +    $include = $parser->(\*RFH, $url, \%map, $pfmatch, $installed);
   7.871 +
   7.872 +    #   close index
   7.873 +    close(RFH)
   7.874 +        or die "openpkg:build:FATAL: an I/O error occured\n";
   7.875 +
   7.876 +    #   cannot do real recursions on file handles, so we simply append
   7.877 +    #   (instead of inserting at the correct position) all sub-RDFs, as
   7.878 +    #   the result is flattend into a big hash anyway
   7.879 +    foreach (@$include) {
   7.880 +        my ($submap);
   7.881 +        my ($suburl, $subfn) = relurl($url, $fn, $_);
   7.882 +        $submap = get_index($suburl, $subfn, $xml, $pfmatch, $installed); # RECURSION
   7.883 +        while (my ($name, $vmap) = each(%$submap)) {
   7.884 +            while (my ($vs, $recs) = each(%$vmap)) {
   7.885 +                push(@{$map{$name}->{$vs}}, @$recs);
   7.886 +            }
   7.887 +        }
   7.888 +    }
   7.889 +
   7.890 +    #   return final result
   7.891 +    #   $map = {
   7.892 +    #       <package-name> => {
   7.893 +    #           "<version>-<release>" => {
   7.894 +    #                href      => ...,
   7.895 +    #                name      => ...,
   7.896 +    #                version   => ...,
   7.897 +    #                release   => ...,
   7.898 +    #                platform  => ...,
   7.899 +    #                prefix    => ...,
   7.900 +    #                depends   => [ ... ],
   7.901 +    #                keeps     => [ ... ],
   7.902 +    #                conflicts => [ ... ],
   7.903 +    #                source    => ...,
   7.904 +    #                nosource  => ...,
   7.905 +    #                desc      => $desc,
   7.906 +    #                OPTIONS   => $options,
   7.907 +    #                DEFOPTS   => { %$options },
   7.908 +    #           };
   7.909 +    #       };
   7.910 +    #   };
   7.911 +    return \%map;
   7.912 +}
   7.913 +
   7.914 +#   compute absolute paths
   7.915 +#   - (url, fn) point to a base document
   7.916 +#     the location is the file path fn if fn is
   7.917 +#     defined, otherwise it is url.
   7.918 +#   - augment the pointer with suburl
   7.919 +#   - suburl can be an absolute url
   7.920 +#     then the new pointer is (suburl, undef)
   7.921 +#   - suburl can be a absolute file path
   7.922 +#     then the new pointer is (suburl, suburl)
   7.923 +#   - suburl can be a relative path
   7.924 +#     then it augments url or fn accordingly
   7.925 +sub relurl ($$$) {
   7.926 +    my ($url, $fn, $suburl) = @_;
   7.927 +    my ($subfn);
   7.928 +
   7.929 +    if ($suburl =~ m/^\w+:\/\//) {
   7.930 +        # NOP
   7.931 +    } elsif ($suburl =~ m/^\//) {
   7.932 +        $subfn = $suburl;
   7.933 +    } else {
   7.934 +        if (defined($fn)) {
   7.935 +            $subfn = $fn;
   7.936 +            $subfn =~ s/(\/)?\/*[^\/]*$/$1$suburl/;
   7.937 +            $suburl = $subfn;
   7.938 +        } else {
   7.939 +            $subfn = $url;
   7.940 +            $subfn =~ s/(\/)?\/*[^\/]*$/$1$suburl/;
   7.941 +            $suburl = $subfn;
   7.942 +            $subfn  = undef;
   7.943 +        }
   7.944 +    }
   7.945 +    1 while ($suburl =~ s/\/\.\//\//s);
   7.946 +    1 while ($suburl =~ s/\/[^\/]+\/\.\.\//\//s);
   7.947 +    return ($suburl, $subfn);
   7.948 +}
   7.949 +
   7.950 +#   XML/RDF parser (simple way)
   7.951 +sub simple_text_parser ($$$$$) {
   7.952 +    my ($fh, $url, $map, $pfmatch, $installed) = @_;
   7.953 +    my (@include);
   7.954 +    my ($section);
   7.955 +    my ($name, $version);
   7.956 +    my ($href, $release, $desc, $bags);
   7.957 +    my (%options, @provides);
   7.958 +    my ($platform, $prefix);
   7.959 +    my ($rec);
   7.960 +    my ($tag, $cond, $attrname, $attrval, $body);
   7.961 +    my ($usecond);
   7.962 +    my ($options);
   7.963 +
   7.964 +    print "# using internal XML/RDF parser\n";
   7.965 +
   7.966 +    #   read XML/RDF line-wise as we know that our
   7.967 +    #   OpenPKG XML/RDF indices follow a strict formatting
   7.968 +    while (<$fh>) {
   7.969 +        #   unescape some XML entities
   7.970 +        s/&gt;/>/g;
   7.971 +        s/&lt;/</g;
   7.972 +
   7.973 +        if (!(defined($href)) && m/<rdf:Description.*?href="([^"]*)"/) {
   7.974 +            #   start of new package description
   7.975 +            $href      = $1;
   7.976 +            $section   = undef;
   7.977 +            $name      = undef;
   7.978 +            $release   = undef;
   7.979 +            $desc      = '';
   7.980 +            $platform  = undef;
   7.981 +            $prefix    = undef;
   7.982 +            $bags      = {};
   7.983 +            @provides  = ();
   7.984 +        }
   7.985 +
   7.986 +        if (!(defined($href)) && m/<Repository.*?href="([^"]*)"(?:\s*platform="([^"]*)")?/) {
   7.987 +            #   external XML/RDF index reference for particular binary platform
   7.988 +            if (goodpf($2, $pfmatch)) {
   7.989 +                push(@include, $1);
   7.990 +            }
   7.991 +            next;
   7.992 +        }
   7.993 +
   7.994 +        #   skip content unless referenced piece was found
   7.995 +        next if (not defined($href));
   7.996 +
   7.997 +        #   parse XML/RDF element into components
   7.998 +        ($tag, $cond, $attrname, $attrval, $body) = m{
   7.999 +            <                      # start delimiter
  7.1000 +            (\/?[\w:]+)            # begin element name
  7.1001 +            \s*                    # optional space before attributes
  7.1002 +            (?:cond="([^"]+)")?    # known attribute
  7.1003 +            (?:(\w+)="([^"]+)")?   # unknown attribute
  7.1004 +            >                      # end delimiter
  7.1005 +            (.*?)                  # optional element body
  7.1006 +            (?:<\/\1>)?            # optional end tag
  7.1007 +            $                      # end of string
  7.1008 +        }mx;
  7.1009 +
  7.1010 +        #   recognize the various XML/RDF elements
  7.1011 +        if ($tag eq 'Description') {
  7.1012 +            $usecond = $cond;
  7.1013 +            $section = 'description';
  7.1014 +        } elsif ($tag eq '/Description') {
  7.1015 +            $usecond = $cond;
  7.1016 +            $section = undef;
  7.1017 +        } elsif ($section eq 'description') {
  7.1018 +            $desc .= $_;
  7.1019 +        } elsif ($tag eq 'PreReq') {
  7.1020 +            $usecond = $cond;
  7.1021 +            $section = 'prereq';
  7.1022 +        } elsif ($tag eq '/PreReq') {
  7.1023 +            $usecond = undef;
  7.1024 +            $section = undef;
  7.1025 +        } elsif ($tag eq 'BuildPreReq') {
  7.1026 +            $usecond = $cond;
  7.1027 +            $section = 'bprereq';
  7.1028 +        } elsif ($tag eq '/BuildPreReq') {
  7.1029 +            $usecond = undef;
  7.1030 +            $section = undef;
  7.1031 +        } elsif ($tag eq 'Provides') {
  7.1032 +            $usecond = $cond;
  7.1033 +            $section = 'provides';
  7.1034 +        } elsif ($tag eq '/Provides') {
  7.1035 +            $usecond = undef;
  7.1036 +            $section = undef;
  7.1037 +        } elsif ($tag eq 'Conflicts') {
  7.1038 +            $usecond = $cond;
  7.1039 +            $section = 'conflicts';
  7.1040 +        } elsif ($tag eq '/Conflicts') {
  7.1041 +            $usecond = undef;
  7.1042 +            $section = undef;
  7.1043 +        } elsif ($tag eq 'NoSource') {
  7.1044 +            $usecond = $cond;
  7.1045 +            $section = 'nosource';
  7.1046 +        } elsif ($tag eq '/NoSource') {
  7.1047 +            $usecond = undef;
  7.1048 +            $section = undef;
  7.1049 +        } elsif ($tag eq 'Source') {
  7.1050 +            $usecond = $cond;
  7.1051 +            $section = 'source';
  7.1052 +        } elsif ($tag eq '/Source') {
  7.1053 +            $usecond = undef;
  7.1054 +            $section = undef;
  7.1055 +        } elsif ($tag eq 'Name') {
  7.1056 +            $name = $body;
  7.1057 +        } elsif ($tag eq 'Version') {
  7.1058 +            $version = $body;
  7.1059 +        } elsif ($tag eq 'Release') {
  7.1060 +            $release = $body;
  7.1061 +        } elsif ($tag eq 'Platform') {
  7.1062 +            $platform = $body;
  7.1063 +        } elsif ($tag eq 'Prefixes') {
  7.1064 +            $prefix = $body;
  7.1065 +        } elsif ($tag eq 'rdf:li' || $tag eq 'resource') {
  7.1066 +            if (defined($attrname)) {
  7.1067 +                $body = {
  7.1068 +                    $attrname => $attrval,
  7.1069 +                    content   => $body
  7.1070 +                };
  7.1071 +            }
  7.1072 +            if ($section eq 'provides') {
  7.1073 +                push(@provides, $body) if (!defined($usecond));
  7.1074 +            } elsif ($section ne '') {
  7.1075 +                push(@{$bags->{"$usecond"}->{$section}}, $body);
  7.1076 +            }
  7.1077 +        } elsif ($tag eq '/rdf:Description') {
  7.1078 +            if (   defined($href)
  7.1079 +                && defined($name)
  7.1080 +                && defined($version)
  7.1081 +                && defined($release)) {
  7.1082 +                #   process the accumulated package information
  7.1083 +                @provides = map {
  7.1084 +                    depends2provides(parse_depends($_))
  7.1085 +                } @provides;
  7.1086 +                %options = map {
  7.1087 +                    ($_->{with} => $_->{version})
  7.1088 +                } grep {
  7.1089 +                    defined($_->{with})
  7.1090 +                } @provides;
  7.1091 +                push(@provides, {
  7.1092 +                    name    => $name,
  7.1093 +                    version => $version,
  7.1094 +                    release => $release
  7.1095 +                });
  7.1096 +                $options =
  7.1097 +                      %options
  7.1098 +                    ? { %options }
  7.1099 +                    : parse_options($desc);
  7.1100 +                if ($options) {
  7.1101 +                    my (@t) = get_targets($installed->{$name}, sub { 1; });
  7.1102 +                }
  7.1103 +                #   store accumulated package information
  7.1104 +                eval {
  7.1105 +                    $rec = {
  7.1106 +                        href      => (relurl($url, undef, $href))[0],
  7.1107 +                        name      => $name,
  7.1108 +                        version   => $version,
  7.1109 +                        release   => $release,
  7.1110 +                        depends   => depend_list(swith($bags, 'bprereq')),
  7.1111 +                        keeps     => depend_list(swith($bags, 'prereq')),
  7.1112 +                        conflicts => swith($bags, 'conflicts'),
  7.1113 +                        source    => swith($bags, 'source'),
  7.1114 +                        nosource  => swith($bags, 'nosource'),
  7.1115 +                        desc      => $desc,
  7.1116 +                        platform  => $platform,
  7.1117 +                        prefix    => $prefix,
  7.1118 +                        OPTIONS   => $options,
  7.1119 +                        DEFOPTS   => { %$options }
  7.1120 +                    };
  7.1121 +                };
  7.1122 +                if ($@) {
  7.1123 +                    die "openpkg:build:FATAL: when reading entry '$name':\n" . $@;
  7.1124 +                }
  7.1125 +                foreach (@provides) {
  7.1126 +                    push(@{$map->{$_->{name}}->{vs($_)}}, $rec);
  7.1127 +                }
  7.1128 +            }
  7.1129 +            #   prepare to recognize next package
  7.1130 +            $href = undef;
  7.1131 +        }
  7.1132 +    }
  7.1133 +
  7.1134 +    #   return contained XML/RDF indices
  7.1135 +    return \@include;
  7.1136 +}
  7.1137 +
  7.1138 +#   XML/RDF parser (usual way)
  7.1139 +sub xml_parser ($$$$$) {
  7.1140 +    my ($fh, $url, $map, $pfmatch, $installed) = @_;
  7.1141 +    my (@include);
  7.1142 +    my ($xml, $rep, $sub);
  7.1143 +    my (@provides, %options, $rec);
  7.1144 +    my ($href, $name, $version, $release, $desc);
  7.1145 +    my ($options);
  7.1146 +
  7.1147 +    print "# using external XML/RDF parser\n";
  7.1148 +
  7.1149 +    #   parse XML/RDF with XML::Simple parser
  7.1150 +    $xml = XML::Simple::XMLin($fh, forcearray => 1);
  7.1151 +    $rep = $xml->{'Repository'}->[0]->{'rdf:Description'};
  7.1152 +    $sub = $xml->{'Repository'}->[0]->{'Repository'};
  7.1153 +
  7.1154 +    #   iterate over all package descriptions
  7.1155 +    foreach (@$rep) {
  7.1156 +        #   fetch package information
  7.1157 +        $href    = $_->{'href'};
  7.1158 +        $name    = xel($_->{'Name'});
  7.1159 +        $version = xel($_->{'Version'});
  7.1160 +        $release = xel($_->{'Release'});
  7.1161 +        next if (not (
  7.1162 +               defined($href)
  7.1163 +            && defined($name)
  7.1164 +            && defined($version)
  7.1165 +            && defined($release)
  7.1166 +        ));
  7.1167 +
  7.1168 +        #   determine package "provides"
  7.1169 +        @provides = ();
  7.1170 +        if ($_->{'Provides'}) {
  7.1171 +            @provides = map {
  7.1172 +                $_ = $_->{'rdf:bag'}->[0];
  7.1173 +                $_ = $_->{'rdf:li'} ? $_->{'rdf:li'} : $_->{'resource'};
  7.1174 +                @$_;
  7.1175 +            } grep {
  7.1176 +                !exists $_->{'cond'}
  7.1177 +            } @{$_->{'Provides'}};
  7.1178 +        }
  7.1179 +        @provides = map {
  7.1180 +            depends2provides(parse_depends($_))
  7.1181 +        } @provides;
  7.1182 +        %options = map {
  7.1183 +            ($_->{with} => $_->{version})
  7.1184 +        } grep {
  7.1185 +            defined $_->{with}
  7.1186 +        } @provides;
  7.1187 +        push(@provides, {
  7.1188 +            name    => $name,
  7.1189 +            version => $version,
  7.1190 +            release => $release
  7.1191 +        });
  7.1192 +
  7.1193 +        #   determine targets
  7.1194 +        $desc = xel($_->{'Description'});
  7.1195 +        $options =
  7.1196 +              %options
  7.1197 +            ? { %options }
  7.1198 +            : parse_options($desc);
  7.1199 +        if ($options) {
  7.1200 +            my (@t) = get_targets($installed->{$name}, sub { 1; });
  7.1201 +        }
  7.1202 +
  7.1203 +        #   store accumulated package information
  7.1204 +        eval {
  7.1205 +            $rec = {
  7.1206 +                href      => (relurl($url, undef, $href))[0],
  7.1207 +                name      => $name,
  7.1208 +                version   => $version,
  7.1209 +                release   => $release,
  7.1210 +                platform  => xel($_->{'Platform'}),
  7.1211 +                prefix    => xel($_->{'Prefixes'}),
  7.1212 +                depends   => depend_list(xwith($_->{'BuildPreReq'})),
  7.1213 +                keeps     => depend_list(xwith($_->{'PreReq'})),
  7.1214 +                conflicts => xwith($_->{'Conflicts'}),
  7.1215 +                source    => xwith($_->{'Source'}),
  7.1216 +                nosource  => xwith($_->{'NoSource'}),
  7.1217 +                desc      => $desc,
  7.1218 +                OPTIONS   => $options,
  7.1219 +                DEFOPTS   => { %$options }
  7.1220 +            };
  7.1221 +        };
  7.1222 +        if ($@) {
  7.1223 +            die "openpkg:build:FATAL: when reading entry '$name'\n".$@;
  7.1224 +        }
  7.1225 +        foreach (@provides) {
  7.1226 +            push(@{$map->{$_->{name}}->{vs($_)}}, $rec);
  7.1227 +        }
  7.1228 +    }
  7.1229 +
  7.1230 +    #   determine contained XML/RDF indices
  7.1231 +    if ($sub) {
  7.1232 +        @include = map {
  7.1233 +            goodpf($_->{platform}, $pfmatch)
  7.1234 +            ? ( $_->{href} )
  7.1235 +            : ( )
  7.1236 +        } @$sub;
  7.1237 +    }
  7.1238 +
  7.1239 +    #   return contained XML/RDF indices
  7.1240 +    return \@include;
  7.1241 +}
  7.1242 +
  7.1243 +#   convert XML parser output to dependency records
  7.1244 +sub depend_list ($) {
  7.1245 +    my ($dl) = @_;
  7.1246 +    foreach (@$dl) {
  7.1247 +        $_->{value} = parse_depends($_->{value});
  7.1248 +    }
  7.1249 +    return $dl;
  7.1250 +}
  7.1251 +
  7.1252 +#   convert simple XML parser Bag into flat list
  7.1253 +sub swith ($$) {
  7.1254 +    my ($bags,$name) = @_;
  7.1255 +    my ($cond);
  7.1256 +    my (@out);
  7.1257 +
  7.1258 +    foreach $cond (keys %$bags) {
  7.1259 +        foreach (@{$bags->{$cond}->{$name}}) {
  7.1260 +            push @out, {
  7.1261 +                cond  => $cond,
  7.1262 +                value => $_
  7.1263 +            };
  7.1264 +        }
  7.1265 +    }
  7.1266 +    return \@out;
  7.1267 +}
  7.1268 +
  7.1269 +#   convert (conditional) XML/RDF Bag into flat list
  7.1270 +sub xwith ($) {
  7.1271 +    my ($bags) = @_;
  7.1272 +    my ($bag, $li, $el);
  7.1273 +    my (@out);
  7.1274 +
  7.1275 +    foreach $bag (@$bags) {
  7.1276 +        foreach $li (@{$bag->{'rdf:bag'}}) {
  7.1277 +            $el = $li->{'resource'} || $li->{'rdf:li'};
  7.1278 +            foreach (@$el) {
  7.1279 +                push @out, {
  7.1280 +                    cond   => $bag->{'cond'},
  7.1281 +                    value  => $_
  7.1282 +                };
  7.1283 +            }
  7.1284 +        }
  7.1285 +    }
  7.1286 +    return \@out;
  7.1287 +}
  7.1288 +
  7.1289 +#   return node value from XML parser
  7.1290 +sub xel($) {
  7.1291 +    my ($a) = @_;
  7.1292 +    my ($l) = $a->[0];
  7.1293 +    return '' if ref($l);
  7.1294 +    return $l;
  7.1295 +}
  7.1296 +
  7.1297 +#   is the platform a good one?
  7.1298 +sub goodpf ($$) {
  7.1299 +    my ($l, $p) = @_;
  7.1300 +    return 1 if $l eq '';
  7.1301 +    return ($l =~ m/(?:^|\s)\Q$p\E(?:\s|$)/);
  7.1302 +}
  7.1303 +
  7.1304 +
  7.1305 +#############################################################################
  7.1306 +##
  7.1307 +##  FUNCTIONS: HELPER FUNCTIONS FOR XML PARSING & DEPENDENCY PROCESSING
  7.1308 +##
  7.1309 +#############################################################################
  7.1310 +
  7.1311 +#   parse option from RPM output
  7.1312 +#   < "%option with_foo bar"
  7.1313 +#   > $with{"with_foo"} = "bar"
  7.1314 +sub parse_options ($) {
  7.1315 +    my ($l) = @_;
  7.1316 +    $l = join("\n", @$l) if (ref($l));
  7.1317 +    return {} if ($l !~ m/(--define|\%option\s+)/s);
  7.1318 +    my $with = {};
  7.1319 +    $l =~ s/--define\s*'(\S+)\s+(\S+?)'/$with->{$1} = $2, ''/sge;  # before openpkg-20021230
  7.1320 +    $l =~ s/\%option\s+(\S+)\s+(\S+)/$with->{$1} = $2, ''/sge;     # after  openpkg-20021230
  7.1321 +    return $with;
  7.1322 +}
  7.1323 +
  7.1324 +#   fetch targets of a name that satisfy a condition and sort by target
  7.1325 +#   version. Input is a hash of versions(?) on which the condition has
  7.1326 +#   to be true and which points to an array of records with package
  7.1327 +#   version information. Output is the list of version sorted package
  7.1328 +#   version information records.
  7.1329 +sub get_targets ($$) {
  7.1330 +    my ($relmap, $cond) = @_;
  7.1331 +    return (
  7.1332 +        sort {
  7.1333 +            vcmp(vs($a), vs($b));
  7.1334 +        } map {
  7.1335 +            @{$relmap->{$_}}
  7.1336 +        } grep {
  7.1337 +            $cond->($_);
  7.1338 +        } keys %$relmap
  7.1339 +   );
  7.1340 +}
  7.1341 +
  7.1342 +#############################################################################
  7.1343 +##
  7.1344 +##  FUNCTIONS: DEPENDENCY PROCESSING
  7.1345 +##
  7.1346 +#############################################################################
  7.1347 +
  7.1348 +#   search environment for packages that match a pattern
  7.1349 +sub search_pattern ($$) {
  7.1350 +    my ($pattern, $env) = @_;
  7.1351 +    my (@todo);
  7.1352 +
  7.1353 +    if (defined($pattern)) {
  7.1354 +        #   explicitly given package pattern
  7.1355 +        @todo = map {
  7.1356 +            my ($p) = $_;
  7.1357 +            my ($s, $iswildcard);
  7.1358 +            $s = $1 if ($p =~ s/(,[^\s,]+)$//);
  7.1359 +            if ($p =~ s/\*+$//) {
  7.1360 +                $p = '^'.quotemeta($p).'';
  7.1361 +                $iswildcard = 1;
  7.1362 +            } else {
  7.1363 +                $p = '^'.quotemeta($p).'$';
  7.1364 +            }
  7.1365 +            map { "$_$s" }
  7.1366 +                grep { m/$p/ && !($iswildcard && exists($env->{exclude}->{$_})) }
  7.1367 +                    keys %{$env->{repository}}
  7.1368 +        } split(/\s+/, $pattern);
  7.1369 +    } else {
  7.1370 +        #   undefined pattern means "-a" option that selects
  7.1371 +        #   all packages from repository that are installed
  7.1372 +        #   and not explicitly excluded on command line
  7.1373 +        @todo = grep {
  7.1374 +            my ($n) = $_;
  7.1375 +               (ref($env->{installed}->{$n}))
  7.1376 +            && !exists($env->{exclude}->{$n})
  7.1377 +            && grep { $_ ne '-' } keys %{$env->{installed}->{$n}}
  7.1378 +        } keys(%{$env->{repository}});
  7.1379 +    }
  7.1380 +    return \@todo;
  7.1381 +}
  7.1382 +
  7.1383 +#   pull in OPTIONS for a package or an RPM file
  7.1384 +my $get_with_cache = {};
  7.1385 +sub get_with ($;$) {
  7.1386 +    my ($t, $fn) = @_;
  7.1387 +    my (@l, %with);
  7.1388 +    my ($optmap, $opt);
  7.1389 +
  7.1390 +    if ($t->{OPTIONS}) {
  7.1391 +        $opt = $t->{OPTIONS};
  7.1392 +    } else {
  7.1393 +        if (defined($fn)) {
  7.1394 +            @l = run($config->{"rpm"} . " -q --provides -p $fn");
  7.1395 +        } else {
  7.1396 +            if (not exists($get_with_cache->{-provides})) {
  7.1397 +                #   pre-cache the "provides" query for all(!) packages at once for speedup
  7.1398 +                my @c = run($config->{"rpm"} . " -qa --qf " .
  7.1399 +                    '\'%{NAME}[ :::%{PROVIDENAME}:::%{PROVIDEFLAGS:depflags}:::%{PROVIDEVERSION}:::]\n\'');
  7.1400 +                $get_with_cache->{-provides} = {};
  7.1401 +                foreach my $c (@c) {
  7.1402 +                    if ($c =~ m/^(\S+)(.*)$/s) {
  7.1403 +                        my ($name, $provides) = ($1, $2);
  7.1404 +                        while ($provides =~ m/\s+:::(.+?):::\s*(.*?)\s*:::(.*?):::/g) {
  7.1405 +                            $get_with_cache->{-provides}->{$name} = [] if (not exists($get_with_cache->{-provides}->{$name}));
  7.1406 +                            push(@{$get_with_cache->{-provides}->{$name}}, "$1 $2 $3");
  7.1407 +                        }
  7.1408 +                    }
  7.1409 +                }
  7.1410 +            }
  7.1411 +            @l = $get_with_cache->{-provides}->{$t->{name}};
  7.1412 +            if (not @l) {
  7.1413 +                #   (should not happen in practice, but anyway)
  7.1414 +                @l = run($config->{"rpm"} . " -q --provides $t->{name}");
  7.1415 +                $get_with_cache->{-provides}->{$t->{name}} = [ @l ];
  7.1416 +            }
  7.1417 +        }
  7.1418 +        $opt = parse_provideslist(\@l);
  7.1419 +        if (scalar(keys(%$opt)) == 0) {
  7.1420 +            if (defined($fn)) {
  7.1421 +                @l = run($config->{"rpm"} . " -qi -p $fn");
  7.1422 +            } else {
  7.1423 +                if (not exists($get_with_cache->{-infos})) {
  7.1424 +                    #   pre-cache the "infos" query for all(!) packages at once for speedup
  7.1425 +                    my @c = run($config->{"rpm"} . " -qi -a");
  7.1426 +                    my $p = "";
  7.1427 +                    $get_with_cache->{-infos} = {};
  7.1428 +                    foreach my $c (@c) {
  7.1429 +                        $p = $1 if ($c =~ m/^Name:\s+(\S+)/s);
  7.1430 +                        $get_with_cache->{-infos}->{$p} = [] if (not exists($get_with_cache->{-infos}->{$p}));
  7.1431 +                        push(@{$get_with_cache->{-infos}->{$p}}, $c);
  7.1432 +                    }
  7.1433 +                }
  7.1434 +                @l = $get_with_cache->{-infos}->{$t->{name}};
  7.1435 +                if (not @l) {
  7.1436 +                    #   (should not happen in practice, but anyway)
  7.1437 +                    @l = run($config->{"rpm"} . " -qi $t->{name}");
  7.1438 +                    $get_with_cache->{-infos}->{$t->{name}} = [ @l ];
  7.1439 +                }
  7.1440 +            }
  7.1441 +            $opt = parse_options(\@l);
  7.1442 +        }
  7.1443 +        $t->{OPTIONS} = $opt;
  7.1444 +    }
  7.1445 +    return $opt;
  7.1446 +}
  7.1447 +
  7.1448 +#   copy options from new to old
  7.1449 +#   where option already exists in old or option key
  7.1450 +#   matches regular expression
  7.1451 +sub override_options ($$$) {
  7.1452 +    my ($old, $new, $reg) = @_;
  7.1453 +    my ($k);
  7.1454 +
  7.1455 +    foreach $k (keys(%$new)) {
  7.1456 +        if ((exists($old->{$k}) && $old->{$k} ne $new->{$k}) || $k =~ m/^$reg$/) {
  7.1457 +            $old->{$k} = $new->{$k};
  7.1458 +        }
  7.1459 +    }
  7.1460 +}
  7.1461 +
  7.1462 +#   filter package options
  7.1463 +sub filter_name_with ($$$) {
  7.1464 +    my ($name, $with, $global) = @_;
  7.1465 +    my (@keys);
  7.1466 +
  7.1467 +    if ($global) {
  7.1468 +        push(@keys, grep { !/::/ } keys %$with);
  7.1469 +    }
  7.1470 +    push(@keys, grep { m/::/ } keys %$with);
  7.1471 +    return {
  7.1472 +        map {
  7.1473 +            my ($k) = $_;
  7.1474 +              $k !~ m/::/ || $k =~ s/^\Q$name\E:://
  7.1475 +            ? ( $k => $with->{$_} )
  7.1476 +            : ( )
  7.1477 +        } @keys
  7.1478 +    };
  7.1479 +}
  7.1480 +
  7.1481 +#   filter out package relevant options
  7.1482 +sub name_with ($$) {
  7.1483 +    filter_name_with($_[0], $_[1], 1);
  7.1484 +}
  7.1485 +
  7.1486 +#   filter out package specific options
  7.1487 +sub name_only_with ($$) {
  7.1488 +    filter_name_with($_[0], $_[1], 0);
  7.1489 +}
  7.1490 +
  7.1491 +#   evaluate a condition attribute from an option set
  7.1492 +sub conditional ($$) {
  7.1493 +    my ($cond, $with) = @_;
  7.1494 +    my (@s, $res);
  7.1495 +
  7.1496 +    return 1 if ($cond eq '' || !defined($with));
  7.1497 +    foreach (split(/\s+/,$cond)) {
  7.1498 +        if ($_ eq '+') {
  7.1499 +            die "openpkg:build:FATAL: stack underflow in: $cond\n" if scalar(@s) < 2;
  7.1500 +            my ($a) = pop(@s);
  7.1501 +            my ($b) = pop(@s);
  7.1502 +            push(@s, $a && $b);
  7.1503 +        } elsif ($_ eq '|') {
  7.1504 +            die "openpkg:build:FATAL: stack underflow in: $cond\n" if scalar(@s) < 2;
  7.1505 +            my ($a) = pop(@s);
  7.1506 +            my ($b) = pop(@s);
  7.1507 +            push(@s, $a || $b);
  7.1508 +        } elsif ($_ eq '!') {
  7.1509 +            die "openpkg:build:FATAL: stack underflow in: $cond\n" if scalar(@s) < 1;
  7.1510 +            my ($a) = pop(@s);
  7.1511 +            push(@s, !$a);
  7.1512 +        } else {
  7.1513 +            push(@s, ($with->{$_} eq 'yes') ? 1 : 0);
  7.1514 +        }
  7.1515 +    }
  7.1516 +    die "openpkg:build:FATAL: stack underflow in: $cond\n" if scalar(@s) < 1;
  7.1517 +    $res = pop(@s);
  7.1518 +
  7.1519 +    die "openpkg:build:FATAL: stack not empty in: $cond\n" if scalar(@s) > 0;
  7.1520 +    return $res;
  7.1521 +}
  7.1522 +
  7.1523 +#   retrieve conditional target attributes in map
  7.1524 +sub target_attribute ($$$;$) {
  7.1525 +    my ($target, $env, $attr, $with) = @_;
  7.1526 +    my ($optreg) = $env->{config}->{optreg};
  7.1527 +    my ($name, @out);
  7.1528 +
  7.1529 +    return if (not $target);
  7.1530 +    $name = $target->{name};
  7.1531 +
  7.1532 +    my ($mywith) = ($with ? $with : get_with($target));
  7.1533 +    override_options($mywith, name_with($name, $env->{with}), $optreg);
  7.1534 +
  7.1535 +    foreach (@{$target->{$attr}}) {
  7.1536 +        next if (not conditional($_->{'cond'}, $mywith));
  7.1537 +        push(@out, $_->{'value'});
  7.1538 +    }
  7.1539 +    return \@out;
  7.1540 +}
  7.1541 +
  7.1542 +#   see whether target is in map
  7.1543 +sub target_exists ($$) {
  7.1544 +    my ($target, $map) = @_;
  7.1545 +    my ($vmap) = $map->{$target->{name}};
  7.1546 +    return if (not $vmap);
  7.1547 +    return (
  7.1548 +           !defined $target->{version}
  7.1549 +        || defined $vmap->{vs($target)}
  7.1550 +    );
  7.1551 +}
  7.1552 +
  7.1553 +#   see whether target has conflicts
  7.1554 +sub target_conflicts ($$) {
  7.1555 +    my ($target, $env) = @_;
  7.1556 +    return target_attribute($target, $env, 'conflicts');
  7.1557 +}
  7.1558 +
  7.1559 +#   retrieve build dependencies for target
  7.1560 +sub target_depends ($$) {
  7.1561 +    my ($target, $env) = @_;
  7.1562 +    return target_attribute($target, $env, 'depends');
  7.1563 +}
  7.1564 +
  7.1565 +#   retrieve runtime dependencies for target
  7.1566 +sub target_keeps ($$) {
  7.1567 +    my ($target, $env) = @_;
  7.1568 +    return target_attribute($target, $env, 'keeps');
  7.1569 +}
  7.1570 +
  7.1571 +#   retrieve source list for target
  7.1572 +sub target_source ($$) {
  7.1573 +    my ($target, $env) = @_;
  7.1574 +    return target_attribute($target, $env, 'source');
  7.1575 +}
  7.1576 +
  7.1577 +#   retrieve nosource list for target
  7.1578 +sub target_nosource ($$) {
  7.1579 +    my ($target, $env) = @_;
  7.1580 +    return target_attribute($target, $env, 'nosource');
  7.1581 +}
  7.1582 +
  7.1583 +#   check whether target conflicts against map
  7.1584 +sub target_has_conflicts ($$$) {
  7.1585 +    my ($target, $map, $env) = @_;
  7.1586 +    my ($conflicts, $t);
  7.1587 +
  7.1588 +    $conflicts = target_conflicts($target, $env);
  7.1589 +    foreach (@$conflicts) {
  7.1590 +        my ($t) = find_target($_, $map, 0);
  7.1591 +        return $t if $t;
  7.1592 +    }
  7.1593 +    return;
  7.1594 +}
  7.1595 +
  7.1596 +#   record target status
  7.1597 +sub target_setstatus ($$$) {
  7.1598 +    my ($target, $status, $pri) = @_;
  7.1599 +
  7.1600 +    if ($pri > $target->{STATUSPRI}) {
  7.1601 +        $target->{STATUSPRI} = $pri;
  7.1602 +        $target->{STATUS}    = $status;
  7.1603 +    }
  7.1604 +}
  7.1605 +
  7.1606 +#   strip doubles from depend/keep lists
  7.1607 +#   and return a map name => depend/keep
  7.1608 +sub unique_map {
  7.1609 +    my (%out);
  7.1610 +    foreach (@_) {
  7.1611 +        foreach (@$_) {
  7.1612 +            $out{$_->{name}} = $_;
  7.1613 +        }
  7.1614 +    }
  7.1615 +    return %out;
  7.1616 +}
  7.1617 +
  7.1618 +#   check whether installed package matches build options. If default
  7.1619 +#   = 1 then options which are not required must be identical to the
  7.1620 +#   DEFOPTS.
  7.1621 +sub target_suitable ($$$) {
  7.1622 +    my ($target, $with, $default) = @_;
  7.1623 +    my ($iwith, $dwith);
  7.1624 +    my ($k, $v);
  7.1625 +
  7.1626 +    if ($target->{GOAL}) {
  7.1627 +        $with = name_with($target->{name}, $with);
  7.1628 +    } else {
  7.1629 +        $with = name_only_with($target->{name}, $with);
  7.1630 +    }
  7.1631 +    $iwith = $target->{OPTIONS};
  7.1632 +    $dwith = $target->{DEFOPTS};
  7.1633 +    while (($k,$v) = each(%$iwith)) {
  7.1634 +        if (exists($with->{$k})) {
  7.1635 +            return 0 if ($iwith->{$k} ne $with->{$k});
  7.1636 +        } elsif ($default) {
  7.1637 +            return 0 if ($iwith->{$k} ne $dwith->{$k});
  7.1638 +        }
  7.1639 +    }
  7.1640 +    return 1;
  7.1641 +}
  7.1642 +
  7.1643 +#   determine whether target should be rebuild
  7.1644 +sub target_better ($$$) {
  7.1645 +    my ($env, $target, $map) = @_;
  7.1646 +    my ($vs) = vs($target);
  7.1647 +    my ($vmap) = $map->{$target->{name}};
  7.1648 +
  7.1649 +    #   rebuild if target isn't installed
  7.1650 +    return 'new' unless $vmap;
  7.1651 +
  7.1652 +    #   if "-e" then
  7.1653 +    #   always update if installed version is different from repository
  7.1654 +    if ($env->{exact} && !grep { vcmp($vs, $_) == 0; } keys(%$vmap)) {
  7.1655 +        return 'exact';
  7.1656 +    }
  7.1657 +
  7.1658 +    #   if target is goal
  7.1659 +    #   always update if installed version is older than repository
  7.1660 +    if ($target->{GOAL} && !grep { vcmp($vs, $_) <= 0; } keys(%$vmap)) {
  7.1661 +        return 'goal';
  7.1662 +    }
  7.1663 +
  7.1664 +    #   if -U then
  7.1665 +    #   always update if installed version is older than repository
  7.1666 +    if ($env->{upgrade} && !grep { vcmp($vs, $_) <= 0; } keys(%$vmap)) {
  7.1667 +        return 'upgrade';
  7.1668 +    }
  7.1669 +
  7.1670 +    #   if -z/-Z then
  7.1671 +    #   always update if installed version is equal or older than repository
  7.1672 +    if ($env->{zero} && grep { vcmp($vs, $_) >= 0; } keys(%$vmap)) {
  7.1673 +        return 'zero';
  7.1674 +    }
  7.1675 +
  7.1676 +    #   keep installed target
  7.1677 +    return;
  7.1678 +}
  7.1679 +
  7.1680 +#   check if target record describes a source package
  7.1681 +sub is_source ($) {
  7.1682 +    my ($t) = @_;
  7.1683 +    return !(defined $t->{'prefix'});
  7.1684 +}
  7.1685 +
  7.1686 +#   there can be multiple sources for a target release
  7.1687 +sub chose_source ($$$$$) {
  7.1688 +    my ($env, $name, $select, $vmap, $cond) = @_;
  7.1689 +    my (@targ, @recs, @nrecs, $rec, %nam);
  7.1690 +
  7.1691 +    #   resolve name into a list of versions
  7.1692 +    #   for virtual targets this resolves to a list
  7.1693 +    #   of real targets that provide the virtual target
  7.1694 +    @targ = get_targets($vmap, sub { 1; });
  7.1695 +    return unless @targ;
  7.1696 +
  7.1697 +    #   find usable binary targets add all source targets
  7.1698 +    @recs = (
  7.1699 +        ( grep {
  7.1700 +               !$env->{sourceonly}
  7.1701 +            && !is_source($_)
  7.1702 +            && $_->{'platform'} eq $env->{config}->{platform}
  7.1703 +            && $_->{'prefix'} eq $env->{config}->{prefix}
  7.1704 +        } get_targets($vmap, $cond) ),
  7.1705 +        ( grep {
  7.1706 +            is_source($_)
  7.1707 +        } @targ )
  7.1708 +    );
  7.1709 +    return if (not @recs);
  7.1710 +
  7.1711 +    #   limit list to exact matches if provided by "-e"
  7.1712 +    if (defined($select)) {
  7.1713 +        @recs = grep {
  7.1714 +            vsn($_) =~ m/^\Q$select\E/
  7.1715 +        } @recs;
  7.1716 +    }
  7.1717 +
  7.1718 +    #   try to resolve ambiguity against installed targets
  7.1719 +    #   and targets previously selected
  7.1720 +    if (scalar(@recs) > 1) {
  7.1721 +        @nrecs = grep {
  7.1722 +               $env->{built}->{$_->{name}}
  7.1723 +            || $env->{installed}->{$_->{name}}
  7.1724 +        } @recs;
  7.1725 +        @recs = @nrecs if (@nrecs);
  7.1726 +    }
  7.1727 +
  7.1728 +    #   try to resolve ambiguity against hints
  7.1729 +    if ($env->{hint}) {
  7.1730 +        @nrecs = grep {
  7.1731 +            exists($env->{hint}->{$_->{name}})
  7.1732 +        } @recs;
  7.1733 +        @recs = @nrecs if (@nrecs);
  7.1734 +    }
  7.1735 +
  7.1736 +    #   try to resolve ambiguity against targets that match
  7.1737 +    #   the exact name
  7.1738 +    if (scalar(@recs) > 1) {
  7.1739 +        @nrecs = grep {
  7.1740 +            $name eq $_->{name}
  7.1741 +        } @recs;
  7.1742 +        @recs = @nrecs if (@nrecs);
  7.1743 +    }
  7.1744 +
  7.1745 +    #   try to resolve ambiguity by preferring binaries
  7.1746 +    if (scalar(@recs) > 1 && !$env->{sourceonly}) {
  7.1747 +        @nrecs = grep {
  7.1748 +            defined($_->{'platform'})
  7.1749 +        } @recs;
  7.1750 +        @recs = @nrecs if (@nrecs);
  7.1751 +    }
  7.1752 +
  7.1753 +    #   if we still have non-unique targets, complain
  7.1754 +    if (scalar(@recs) > 1) {
  7.1755 +        %nam = map { $_->{name} => 1 } @recs;
  7.1756 +        if (scalar(keys(%nam)) > 1) {
  7.1757 +            print "# ambigous sources for $name\n";
  7.1758 +            my ($i) = 0;
  7.1759 +            foreach (@recs) {
  7.1760 +                print "# $i: ".vsn($_)." = $_->{href}\n";
  7.1761 +                $i++;
  7.1762 +            }
  7.1763 +            return;
  7.1764 +        }
  7.1765 +    }
  7.1766 +
  7.1767 +    #   prefer full-source packages
  7.1768 +    if (scalar(@recs) > 1) {
  7.1769 +        @nrecs = grep {
  7.1770 +               ! $_->{nosource}
  7.1771 +            || ! @{$_->{nosource}}
  7.1772 +        } @recs;
  7.1773 +        unless (@nrecs) {
  7.1774 +            @nrecs = grep {
  7.1775 +                $_->{href} !~ m/\.nosrc.rpm$/
  7.1776 +            } @recs;
  7.1777 +        }
  7.1778 +        @recs = @nrecs if (@nrecs);
  7.1779 +    }
  7.1780 +
  7.1781 +    #   nothing left -> exit
  7.1782 +    return if (scalar(@recs) == 0);
  7.1783 +
  7.1784 +    #   chose last (= max version) in list of targets
  7.1785 +    $rec = $recs[-1];
  7.1786 +    print "# source for $name is ".vsn($rec)."\n";
  7.1787 +    return $rec;
  7.1788 +}
  7.1789 +
  7.1790 +#   locate target for a dependency
  7.1791 +sub dep2target ($$$) {
  7.1792 +    my ($dep, $env, $source) = @_;
  7.1793 +    my ($name, $op, @targ);
  7.1794 +    my ($i, $r, $b, $cond, $version);
  7.1795 +    my ($t, $tdef, $why);
  7.1796 +
  7.1797 +    ($name, $op, $version) = ($dep->{name}, $dep->{op}, $dep->{val});
  7.1798 +
  7.1799 +    $i = $env->{installed}->{$name};
  7.1800 +    $r = $env->{repository}->{$name};
  7.1801 +    $b = $env->{built}->{$name};
  7.1802 +
  7.1803 +    return if (not ($i || $r || $b));
  7.1804 +
  7.1805 +    if (!defined($op)) {
  7.1806 +        $cond = sub { 1; };
  7.1807 +    } elsif ($op eq 'geq') {
  7.1808 +        $cond = sub { vcmp($_[0],$version) >= 0; };
  7.1809 +    } elsif ($op eq 'leq') {
  7.1810 +        $cond = sub { vcmp($_[0],$version) <= 0; };
  7.1811 +    } elsif ($op eq 'gt') {
  7.1812 +        $cond = sub { vcmp($_[0],$version) >  0; };
  7.1813 +    } elsif ($op eq 'lt') {
  7.1814 +        $cond = sub { vcmp($_[0],$version) <  0; };
  7.1815 +    } elsif ($op eq 'equ') {
  7.1816 +        $cond = sub { vcmp($_[0],$version) == 0; };
  7.1817 +    } else {
  7.1818 +        die "openpkg:build:FATAL: internal error in dep2target\n";
  7.1819 +    }
  7.1820 +
  7.1821 +    $tdef = undef;
  7.1822 +
  7.1823 +    #   search installed target that matches requirement
  7.1824 +    #   use it if we are not upgrading (no -U and no -z/-Z)
  7.1825 +    if ($i && (@targ = get_targets($i, $cond))) {
  7.1826 +        foreach $t (@targ) {
  7.1827 +            get_with($t);
  7.1828 +            if (target_suitable($t, $env->{with}, 0)) {
  7.1829 +                $tdef = $t;
  7.1830 +                if (not ($env->{upgrade} || $env->{zero} || $source)) {
  7.1831 +                    return ($t, 1);
  7.1832 +                }
  7.1833 +            }
  7.1834 +        }
  7.1835 +    }
  7.1836 +
  7.1837 +    #   search target in current build list that matches requirement
  7.1838 +    #   use it if it exists
  7.1839 +    if ($b && (@targ = get_targets($b, $cond))) {
  7.1840 +        $t = $targ[0];
  7.1841 +        return ($t, 1);
  7.1842 +    }
  7.1843 +
  7.1844 +    #   search target in repository and install it, if it is newer than
  7.1845 +    #   corresponding installed versions avoid repository packages that
  7.1846 +    #   would install 'new' (i.e. are not an upgrade of an existing
  7.1847 +    #   package)
  7.1848 +    $t = chose_source($env, $name, undef, $r, $cond);
  7.1849 +    if ($t) {
  7.1850 +        if (!$tdef || (
  7.1851 +            ($why = target_better($env, $t, $env->{installed})) &&
  7.1852 +            $why ne 'new'
  7.1853 +            ) || $source) {
  7.1854 +            return ($t, 0);
  7.1855 +        }
  7.1856 +    }
  7.1857 +
  7.1858 +    #   if nothing is suitable in repository then fall back to
  7.1859 +    #   anything we already have installed but that we skipped
  7.1860 +    #   above to look for upgrades.
  7.1861 +    if ($tdef) {
  7.1862 +        return ($tdef, 1);
  7.1863 +    }
  7.1864 +
  7.1865 +    return;
  7.1866 +}
  7.1867 +
  7.1868 +#   compute reverse dependency map
  7.1869 +sub get_revdep ($) {
  7.1870 +    my ($env) = @_;
  7.1871 +    my ($i) = $env->{'installed'};
  7.1872 +    my ($r) = $env->{'repository'};
  7.1873 +    my ($pkg, %dep, %dlist, %rev);
  7.1874 +    my (@targ, $t, $t1, $t2, $with, $name, $vmap);
  7.1875 +    my ($d, $k, %d, $old, %name, %pkg);
  7.1876 +
  7.1877 +    print "# computing reverse dependencies\n";
  7.1878 +
  7.1879 +    #   iterate over all installed packages
  7.1880 +    foreach $pkg (keys(%$i)) {
  7.1881 +        $vmap = $r->{$pkg};
  7.1882 +        if (not $vmap) {
  7.1883 +            print "# ATTENTION: $pkg has no upgrade path (installed package not found in repository)\n";
  7.1884 +            next;
  7.1885 +        }
  7.1886 +
  7.1887 +        #   get forward dependencies from installed packages
  7.1888 +        #   dep{a}{b} is true if b depends directly on a
  7.1889 +        #   dlist{a}  is list of packages that depend on a
  7.1890 +        @targ = get_targets($i->{$pkg}, sub { 1; });
  7.1891 +        foreach $t (@targ) {
  7.1892 +            $with = get_with($t);
  7.1893 +            $d = target_attribute($t, $env, 'depends', $with);
  7.1894 +            $k = target_attribute($t, $env, 'keeps', $with);
  7.1895 +            next if (not (@$d || @$k));
  7.1896 +            %d = unique_map($d,$k);
  7.1897 +
  7.1898 +            #   resolve package
  7.1899 +            if (not exists($pkg{$pkg})) {
  7.1900 +                ($t2, $old) = dep2target({ name => $pkg }, $env, 1);
  7.1901 +                $t2 = undef if ($old);
  7.1902 +                $pkg{$pkg} = $t2;
  7.1903 +            }
  7.1904 +            $t2 = $pkg{$pkg};
  7.1905 +            next if (not $t2);
  7.1906 +            foreach (keys(%d)) {
  7.1907 +                next if ($_ eq 'OpenPKG');
  7.1908 +                #   resolve target
  7.1909 +                unless (exists($name{$_})) {
  7.1910 +                    ($t1, $old) = dep2target($d{$_}, $env, 0);
  7.1911 +                    $name{$_} = ($t1 ? $t1->{name} : $_);
  7.1912 +                }
  7.1913 +                $name = $name{$_};
  7.1914 +                if (not $dep{$name}{$t->{name}}) {
  7.1915 +                    $dep{$name}{$t->{name}} = 1;
  7.1916 +                    push(@{$dlist{$name}}, $t2);
  7.1917 +                }
  7.1918 +            }
  7.1919 +        }
  7.1920 +    }
  7.1921 +
  7.1922 +    #   sort reverse dependencies
  7.1923 +    foreach $pkg (keys(%dep)) {
  7.1924 +        $rev{$pkg} = [
  7.1925 +            sort {
  7.1926 +                   $dep{$b->{name}}{$a->{name}}
  7.1927 +                || -$dep{$a->{name}}{$b->{name}}
  7.1928 +                || $a->{name} cmp $b->{name}
  7.1929 +            } @{$dlist{$pkg}}
  7.1930 +        ];
  7.1931 +    }
  7.1932 +
  7.1933 +    #   return hash of package reverse dependencies
  7.1934 +    return \%rev;
  7.1935 +}
  7.1936 +
  7.1937 +#   build package dependencies
  7.1938 +#   (all input and output is passed in 'env' hash)
  7.1939 +sub build_deps ($$) {
  7.1940 +    my ($pattern, $env) = @_;
  7.1941 +    my ($todo, @list, $list, @out);
  7.1942 +
  7.1943 +    #   determine all packages which match the pattern
  7.1944 +    $todo = search_pattern($pattern, $env);
  7.1945 +
  7.1946 +    #   unfold target names into all(!) real targets names
  7.1947 +    @list =
  7.1948 +    map {
  7.1949 +        map {
  7.1950 +            map {
  7.1951 +                $_->{name}
  7.1952 +            } @$_
  7.1953 +        } values(%{$env->{repository}->{$_}})
  7.1954 +    } @$todo;
  7.1955 +
  7.1956 +    #   also add target name
  7.1957 +    push @list, @$todo;
  7.1958 +
  7.1959 +    #   strip duplicate names
  7.1960 +    @list = keys %{ { map { $_ => 1 } @list } };
  7.1961 +
  7.1962 +    #   cache reverse dependencies
  7.1963 +    if (not $env->{revdep}) {
  7.1964 +        $env->{revdep} = get_revdep($env);
  7.1965 +    }
  7.1966 +
  7.1967 +    #   map targets into list of dependency names
  7.1968 +    @list = map {
  7.1969 +          $env->{revdep}->{$_}
  7.1970 +        ? (@{$env->{revdep}->{$_}})
  7.1971 +        : ()
  7.1972 +    } @list;
  7.1973 +
  7.1974 +    #   iterate over dependencies
  7.1975 +    foreach (@list) {
  7.1976 +        #   avoiding cycles
  7.1977 +        next if ($env->{builddeps}->{$_->{name}});
  7.1978 +        $env->{builddeps}->{$_->{name}} = 1;
  7.1979 +
  7.1980 +        #   generate result
  7.1981 +        push(@out, $_);
  7.1982 +
  7.1983 +        #   generate result recursively
  7.1984 +        $list = build_deps($_->{name}, $env); # RECURSION
  7.1985 +        push(@out, @$list);
  7.1986 +    }
  7.1987 +
  7.1988 +    #   return final results
  7.1989 +    return \@out;
  7.1990 +}
  7.1991 +
  7.1992 +#   report options that are not used for
  7.1993 +sub warn_about_options ($$$) {
  7.1994 +    my ($target, $with, $c) = @_;
  7.1995 +    my ($iwith) = $target->{OPTIONS};
  7.1996 +    my ($k, $v);
  7.1997 +
  7.1998 +    return if (not defined($iwith));
  7.1999 +    $with = name_with($target->{name}, $with);
  7.2000 +    while (($k,$v) = each %$with) {
  7.2001 +        if (not ($k =~ m/^$c->{optreg}$/ || exists $iwith->{$k})) {
  7.2002 +            print "# ATTENTION: $target->{name} ignores option '$k'\n";
  7.2003 +        }
  7.2004 +    }
  7.2005 +}
  7.2006 +
  7.2007 +#   find target in map
  7.2008 +sub find_target ($$$) {
  7.2009 +    my ($name, $map, $pos) = @_;
  7.2010 +    my ($vmap) = $map->{$name};
  7.2011 +    my (@vs);
  7.2012 +
  7.2013 +    return if (not $vmap);
  7.2014 +    @vs = sort { vcmp($b,$a) } keys(%$vmap);
  7.2015 +    return $vmap->{$vs[$pos]}->[-1];
  7.2016 +}
  7.2017 +
  7.2018 +#   add dependency as build option
  7.2019 +sub depend_option ($$$) {
  7.2020 +    my ($target, $dep, $env) = @_;
  7.2021 +    my ($with, $opt, $relmap, @t, $t);
  7.2022 +    my ($pro) = depends2provides($dep);
  7.2023 +    my ($conflict) = 0;
  7.2024 +
  7.2025 +    return 1 if (not defined($pro->{with}));
  7.2026 +
  7.2027 +    my ($val) = defined($pro->{version}) ? $pro->{version} : 'yes';
  7.2028 +
  7.2029 +    $with = $env->{with};
  7.2030 +    $opt  = $pro->{prefix}.'::'.$pro->{with};
  7.2031 +    if (defined($with->{$opt}) && $with->{$opt} ne $val) {
  7.2032 +        print "# ", vsn($target), " has conflicting requirement $opt = $with->{$opt} != $val\n";
  7.2033 +        $conflict = 1;
  7.2034 +    }
  7.2035 +
  7.2036 +    $relmap = $env->{built}->{$pro->{prefix}};
  7.2037 +    @t = get_targets($relmap, sub { 1; });
  7.2038 +    foreach $t (@t) {
  7.2039 +        $with = $t->{OPTIONS};
  7.2040 +        $opt  = $pro->{with};
  7.2041 +        if (defined($with->{$opt}) && $with->{$opt} ne $val) {
  7.2042 +            print "# ", vsn($t), " has conflicting requirement $opt = $with->{$opt} != $val\n";
  7.2043 +            $conflict = 1;
  7.2044 +        }
  7.2045 +    }
  7.2046 +
  7.2047 +    return 0 if ($conflict);
  7.2048 +
  7.2049 +    print "# ", vsn($target), " adds option $opt = $val\n";
  7.2050 +    $with->{$opt} = $val;
  7.2051 +    return 1;
  7.2052 +}
  7.2053 +
  7.2054 +#   remember fatal error
  7.2055 +sub pusherr ($$$) {
  7.2056 +    my ($env, $target, $mess) = @_;
  7.2057 +    print "# $mess\n";
  7.2058 +    push(@{$env->{fatal}}, vsn($target).": $mess\n");
  7.2059 +}
  7.2060 +
  7.2061 +#   generate dependencies
  7.2062 +sub make_dep ($$$$$$$) {
  7.2063 +    my ($who, $target, $depth, $env, $list, $blist, $clist) = @_;
  7.2064 +    my ($d, $k, %d, %k, $t, $old);
  7.2065 +    my (@deps, $conflict, $why);
  7.2066 +
  7.2067 +    #   check whether target is already in list of to be build packages
  7.2068 +    if (target_exists($target, $env->{built})) {
  7.2069 +        print "# $target->{name} is already in list\n";
  7.2070 +        return;
  7.2071 +    }
  7.2072 +
  7.2073 +    #   check whether target is in conflict with already installed package
  7.2074 +    if ($t = target_has_conflicts($target, $env->{installed}, $env)) {
  7.2075 +        target_setstatus($target, 'CONFLICT', 4);
  7.2076 +        push(@$clist, $target);
  7.2077 +        pusherr($env, $target, "$target->{name} conflicts with ".vsn($t));
  7.2078 +        return;
  7.2079 +    }
  7.2080 +
  7.2081 +    #   check whether target is in conflict with to be build package
  7.2082 +    if ($t = target_has_conflicts($target, $env->{built}, $env)) {
  7.2083 +        target_setstatus($target, 'CONFLICT', 4);
  7.2084 +        push(@$clist, $target);
  7.2085 +        pusherr($env, $target, "$target->{name} conflicts with ".vsn($t));
  7.2086 +        return;
  7.2087 +    }
  7.2088 +
  7.2089 +    #   see if a target is already installed and requires a rebuild
  7.2090 +    if ($t = find_target($target->{name}, $env->{installed}, -1)) {
  7.2091 +        if (exists($env->{exclude}->{$target->{name}})) {
  7.2092 +            print "# excluding $target->{name} (no upgrade allowed)\n";
  7.2093 +            return;
  7.2094 +        }
  7.2095 +
  7.2096 +        #   pull in options (for status report)
  7.2097 +        if ($target->{REBUILD}) {
  7.2098 +            target_setstatus($target, 'DEPEND', 1);
  7.2099 +            print "# rebuilding $target->{name} (dependency)\n";
  7.2100 +        } elsif ($env->{zero}) {
  7.2101 +            target_setstatus($target, 'ZERO', 1);
  7.2102 +            print "# rebuilding $target->{name} (zero)\n";
  7.2103 +        } elsif (vs($target) ne vs($t)) {
  7.2104 +            target_setstatus($target, 'UPDATE', 3);
  7.2105 +            print "# rebuilding $target->{name} (update)\n";
  7.2106 +        } elsif (!target_suitable($t, $env->{with}, 0)) {
  7.2107 +            target_setstatus($target, 'MISMATCH', 2);
  7.2108 +            print "# rebuilding $target->{name} (parameter mismatch)\n";
  7.2109 +        } elsif ($env->{goals} && $target->{GOAL}) {
  7.2110 +            target_setstatus($target, 'GOAL', 3);
  7.2111 +            print "# rebuilding $target->{name} (goal)\n";
  7.2112 +        } else {
  7.2113 +            print "# $target->{name} is already installed\n";
  7.2114 +            return;
  7.2115 +        }
  7.2116 +
  7.2117 +        #   use options from installed base
  7.2118 +        override_options(get_with($target), get_with($t), $env->{config}->{optreg});
  7.2119 +
  7.2120 +        #   remember this is a rebuild for a proxy package
  7.2121 +        $target->{PROXY} = $t->{PROXY};
  7.2122 +        $target->{REBUILD} = 1;
  7.2123 +    } else {
  7.2124 +        print "# creating $target->{name}\n";
  7.2125 +        target_setstatus($target, 'ADD', 3);
  7.2126 +    }
  7.2127 +
  7.2128 +    if (exists($env->{exclude}->{$target->{name}})) {
  7.2129 +        die "openpkg:build:FATAL: target ".vsn($target)." is forbidden\n";
  7.2130 +    }
  7.2131 +
  7.2132 +    #   mark this as a target before reverse dependencies trigger it again
  7.2133 +    push(@{$env->{built}->{$target->{name}}->{vs($target)}}, $target);
  7.2134 +    $target->{LIMBO} = 1;
  7.2135 +
  7.2136 +    #   recurse over dependencies
  7.2137 +    $d = target_depends($target, $env);
  7.2138 +    $k = target_keeps($target, $env);
  7.2139 +    if (@$d || @$k) {
  7.2140 +        %d = unique_map($d, $k);
  7.2141 +        %k = unique_map($k);
  7.2142 +        @deps     = ();
  7.2143 +        $conflict = 0;
  7.2144 +        foreach (keys %d) {
  7.2145 +            #   old index misses a OpenPKG provider in the index... skip it
  7.2146 +            next if ($_ eq 'OpenPKG');
  7.2147 +            ($t, $old) = dep2target($d{$_}, $env, 0);
  7.2148 +            if ($t) {
  7.2149 +                if ($old) {
  7.2150 +                    print "# $target->{name} uses ".vsn($t)." for $_\n";
  7.2151 +                    if ($t->{LIMBO}) {
  7.2152 +                        print "# ATTENTION: ".vsn($t)." is in LIMBO\n";
  7.2153 +                    }
  7.2154 +                    next;
  7.2155 +                }
  7.2156 +                if (not depend_option($t, $d{$_}, $env)) {
  7.2157 +                    push(@$clist, $target);
  7.2158 +                    pusherr($env, $target, "$target->{name} has conflicting requirement");
  7.2159 +                    target_setstatus($target, 'UNDEF', 4);
  7.2160 +                    $conflict = 1;
  7.2161 +                    next;
  7.2162 +                }
  7.2163 +                if ($k{$_}) {
  7.2164 +                    push(@$blist, $t);
  7.2165 +                    print "# $target->{name} installs ".vsn($t)." for $_\n";
  7.2166 +                } else {
  7.2167 +                    print "# $target->{name} requires ".vsn($t)." for $_\n";
  7.2168 +                }
  7.2169 +                push(@deps, $t);
  7.2170 +            } else {
  7.2171 +                push(@$clist, $target);
  7.2172 +                pusherr($env, $target, "$target->{name} searches a frood called '$_'");
  7.2173 +                target_setstatus($target, 'UNDEF', 4);
  7.2174 +                $conflict = 1;
  7.2175 +            }
  7.2176 +        }
  7.2177 +        if (not $conflict) {
  7.2178 +            foreach $t (@deps) {
  7.2179 +                make_dep($target, $t, $depth+1, $env, $list, $blist, $clist); # RECURSION
  7.2180 +            }
  7.2181 +        }
  7.2182 +    }
  7.2183 +
  7.2184 +    print "# adding ".vsn($target)." to list\n";
  7.2185 +    $target->{WHO} = $who;
  7.2186 +    $target->{WHY} = $target->{STATUS};
  7.2187 +    push(@$list, $target);
  7.2188 +
  7.2189 +    #   remember new options
  7.2190 +    override_options(get_with($target), name_with($target->{name}, $env->{with}), '');
  7.2191 +
  7.2192 +    #   moan about non-source packages
  7.2193 +    foreach (@{target_nosource($target, $env)}) {
  7.2194 +        my ($p) = target_source($target, $env)->[$_];
  7.2195 +        $p =~ s/.*\///;
  7.2196 +        print "# ATTENTION: unpackaged source $_: $p\n";
  7.2197 +    }
  7.2198 +
  7.2199 +    #   cleanup limbo
  7.2200 +    $target->{LIMBO} = 0;
  7.2201 +
  7.2202 +    #   a dependency could not be resolved, don't bother with reverse
  7.2203 +    #   dependencies for this target
  7.2204 +    return if ($conflict);
  7.2205 +
  7.2206 +    if (!$env->{quick} && $target->{name} ne 'openpkg' ) {
  7.2207 +        if (not $env->{revdep}) {
  7.2208 +            $env->{revdep} = get_revdep($env);
  7.2209 +        }
  7.2210 +        foreach $t (@{$env->{revdep}->{$target->{name}}}) {
  7.2211 +            #   this is a rebuild, triggering further revdeps
  7.2212 +            $t->{REBUILD} = 1;
  7.2213 +
  7.2214 +            #   this is a rebuild, keep this installed
  7.2215 +            push(@$blist, $t);
  7.2216 +
  7.2217 +            print "# rebuilding reverse dependency ".vsn($t)."\n";
  7.2218 +            make_dep($target, $t, $depth+1, $env, $list, $blist, $clist); # RECURSION
  7.2219 +        }
  7.2220 +    }
  7.2221 +}
  7.2222 +
  7.2223 +#   generate build lists for targets matched by pattern
  7.2224 +#   (all input and output is passed in 'env' hash)
  7.2225 +sub build_list ($$) {
  7.2226 +    my ($pattern, $env) = @_;
  7.2227 +    my (@goals, @targets, @keeps, @conflicts, @bonly, $t);
  7.2228 +    my ($name, $select, $r, $i);
  7.2229 +    my ($todo, %keep);
  7.2230 +
  7.2231 +    #   determine all packages which match the pattern
  7.2232 +    $todo = search_pattern($pattern, $env);
  7.2233 +
  7.2234 +    #   chose sources for goals from repository
  7.2235 +    foreach $name (@$todo) {
  7.2236 +        $select = undef;
  7.2237 +        $select = $1 if ($name =~ s/,([^\s,]+)$//);
  7.2238 +        $t = undef;
  7.2239 +
  7.2240 +        #   keeping installed packages for goals is ugly
  7.2241 +        #   - we currently do not support installed source RPMs
  7.2242 +        #   - source RPMs might already have expired from repository
  7.2243 +        #   consequence:
  7.2244 +        #   - goals are always upgraded to repository versions
  7.2245 +        #if (not $env->{upgrade}) {
  7.2246 +        #    $i = $env->{installed}->{$name};
  7.2247 +        #    $t = chose_source($env, $name, $select, $i, sub { 1; });
  7.2248 +        #}
  7.2249 +        if (not $t) {
  7.2250 +            $r = $env->{repository}->{$name};
  7.2251 +            $t = chose_source($env, $name, $select, $r, sub { 1; });
  7.2252 +        }
  7.2253 +
  7.2254 +        if ($t) {
  7.2255 +            warn_about_options($t, $env->{with}, $env->{config});
  7.2256 +            $t->{GOAL} = 1;
  7.2257 +            push @goals, $t;
  7.2258 +        } else {
  7.2259 +            #   error
  7.2260 +            if ($env->{status}) {
  7.2261 +                print "# dropping goal '$name'\n";
  7.2262 +            } else {
  7.2263 +                die "openpkg:build:FATAL: cannot find source for '$name'\n";
  7.2264 +            }
  7.2265 +        }
  7.2266 +    }
  7.2267 +    return if (not @goals);
  7.2268 +
  7.2269 +    #   recurse over dependencies
  7.2270 +    @targets = ();
  7.2271 +    @keeps   = @goals;
  7.2272 +    foreach $t (@goals) {
  7.2273 +        print "# recursing over dependencies for ".vsn($t)."\n";
  7.2274 +        make_dep(undef, $t, 0, $env, \@targets, \@keeps, \@conflicts);
  7.2275 +    }
  7.2276 +
  7.2277 +    #   determine "binary only" packages which should be not kept
  7.2278 +    #   as they were not installed and are used temporarily only.
  7.2279 +    %keep = map { $_ => 1 } @keeps;
  7.2280 +    @bonly = reverse grep {
  7.2281 +        !$keep{$_} && !$env->{installed}->{$_->{name}}
  7.2282 +    } @targets;
  7.2283 +
  7.2284 +    #   return results
  7.2285 +    return (\@targets, \@bonly, \@conflicts);
  7.2286 +}
  7.2287 +
  7.2288 +
  7.2289 +#############################################################################
  7.2290 +##
  7.2291 +##  FUNCTIONS: RESULT PRINTING
  7.2292 +##
  7.2293 +#############################################################################
  7.2294 +
  7.2295 +#   determine execution command
  7.2296 +sub cmd ($$) {
  7.2297 +    my ($w,$s) = @_;
  7.2298 +    if (!defined($w)) {
  7.2299 +        return $s;
  7.2300 +    } elsif ($w =~ m/^-(.*)/) {
  7.2301 +        return "$1 \"$s\"";
  7.2302 +    } else {
  7.2303 +        return "$w $s";
  7.2304 +    }
  7.2305 +}
  7.2306 +sub priv  ($) { cmd($opt_P, $_[0]); }
  7.2307 +sub npriv ($) { cmd($opt_N, $_[0]); }
  7.2308 +
  7.2309 +#   execute a command
  7.2310 +my $run_cache = {};
  7.2311 +sub run ($) {
  7.2312 +    my $cmd = cmd($opt_N, $_[0]);
  7.2313 +    my $out = $run_cache->{$cmd};
  7.2314 +    if (not defined($out)) {
  7.2315 +        my @out = `$cmd`;
  7.2316 +        $out = [ @out ];
  7.2317 +        $run_cache->{$cmd} = $out;
  7.2318 +    }
  7.2319 +    return (wantarray ? @{$out} : join(//, @{$out}));
  7.2320 +}
  7.2321 +
  7.2322 +#   print dependency list
  7.2323 +sub print_deps ($) {
  7.2324 +    my ($list) = @_;
  7.2325 +
  7.2326 +    print join("\n", sort map { vsn($_) } @$list), "\n";
  7.2327 +}
  7.2328 +
  7.2329 +#   print dependency map
  7.2330 +sub print_map ($$$$$) {
  7.2331 +    my ($installed, $repository, $list, $bonly, $clist) = @_;
  7.2332 +    my (%dep);
  7.2333 +
  7.2334 +    foreach (@$bonly) {
  7.2335 +        $_->{status} = 'TEMP';
  7.2336 +    }
  7.2337 +    foreach (reverse(@$list)) {
  7.2338 +        printf("%-35s %-8s %s\n",
  7.2339 +            $_->{WHO} ? vsn($_->{WHO}) : "GOAL",
  7.2340 +            $_->{WHY} ? $_->{WHY} : '???',
  7.2341 +            vsn($_)
  7.2342 +        );
  7.2343 +    }
  7.2344 +}
  7.2345 +
  7.2346 +#   instead of printing a command list, print a status map
  7.2347 +#   that shows all packages and how the build process would
  7.2348 +#   change their status
  7.2349 +sub print_status ($$$$$) {
  7.2350 +    my ($installed, $repository, $list, $bonly, $clist) = @_;
  7.2351 +    my (%bonly) = map { $_ => 1 } @$bonly;
  7.2352 +    my (%map, $n, @names, $t);
  7.2353 +    my ($old, $tag, $new);
  7.2354 +
  7.2355 +    #   augment map with additional information
  7.2356 +    #   about conflicting and binary only (temporary) packages
  7.2357 +    foreach (@$list, @$clist) {
  7.2358 +        next if (not $_->{release} =~ m/\S/);
  7.2359 +        $map{$_->{name}} = {
  7.2360 +            rel    => "$_->{version}-$_->{release}",
  7.2361 +            status => $_->{STATUS}
  7.2362 +        };
  7.2363 +    }
  7.2364 +    foreach (@$bonly) {
  7.2365 +        next if (not $_->{release} =~ m/\S/);
  7.2366 +        $map{$_->{name}} = {
  7.2367 +            rel    => "$_->{version}-$_->{release}",
  7.2368 +            status => 'TEMP'
  7.2369 +        };
  7.2370 +    }
  7.2371 +
  7.2372 +    #   augment map with additional information
  7.2373 +    #   about up-to-date and new packages
  7.2374 +    @names = keys(%map);
  7.2375 +    foreach $n (keys(%$installed)) {
  7.2376 +        next if ($n =~ m/::/);
  7.2377 +        next if (exists($map{$n}));
  7.2378 +        next if (not (grep { $_ ne '' } keys(%{$installed->{$n}})));
  7.2379 +        $map{$n}->{'status'} = 'OK';
  7.2380 +        push(@names, $n);
  7.2381 +    }
  7.2382 +    foreach $n (keys(%$repository)) {
  7.2383 +        next if ($n =~ m/::/);
  7.2384 +        next if (exists($map{$n}));
  7.2385 +        next if (not (grep { $_ ne '' } keys(%{$repository->{$n}})));
  7.2386 +        $t = find_target($n, $repository, 0);
  7.2387 +        $map{$n}->{'status'} = 'NEW';
  7.2388 +        $map{$n}->{'rel'}    = vs($t);
  7.2389 +        push(@names, $n);
  7.2390 +    }
  7.2391 +
  7.2392 +    #   generate status output
  7.2393 +    foreach $n (sort(@names)) {
  7.2394 +        $old = join(',',
  7.2395 +            map { "$n-$_" }
  7.2396 +            sort
  7.2397 +            grep { $_ ne '-' }
  7.2398 +            keys(%{$installed->{$n}})
  7.2399 +        );
  7.2400 +        $old = $n if ($old eq '');
  7.2401 +        $tag = $map{$n}->{status};
  7.2402 +        $new = defined($map{$n}->{rel}) ? " $n-$map{$n}->{rel}" : '';
  7.2403 +        printf("%-35s %-8s%s\n", $old, $tag, $new);
  7.2404 +    }
  7.2405 +}
  7.2406 +
  7.2407 +#   compute path to source RPM from rpm config and target data
  7.2408 +sub target2srcrpm ($$) {
  7.2409 +    my ($target, $c) = @_;
  7.2410 +    return $c->{srcrpmdir}.'/'.$target->{name}.'-'.$target->{version}.'-'.$target->{release}.'.src.rpm';
  7.2411 +}
  7.2412 +
  7.2413 +#   compute path to binary RPM from rpm config and target data
  7.2414 +sub target2rpm ($$) {
  7.2415 +    my ($target, $c) = @_;
  7.2416 +    my ($tmpl) = $c->{template};
  7.2417 +    my ($popt) = $target->{PROXY} ? '+PROXY' : '';
  7.2418 +
  7.2419 +    $tmpl =~ s/%{NAME}/$target->{name}/;
  7.2420 +    $tmpl =~ s/%{VERSION}/$target->{version}/;
  7.2421 +    $tmpl =~ s/%{RELEASE}/$target->{release}$popt/;
  7.2422 +
  7.2423 +    return $c->{rpmdir}.'/'.$tmpl;
  7.2424 +}
  7.2425 +
  7.2426 +#   merge parameters from installed package
  7.2427 +#   with new parameter set and global parameters
  7.2428 +#   from configuration
  7.2429 +#   then map the result to --define command line arguments
  7.2430 +#   suitable for rpm
  7.2431 +sub make_defines ($$$$) {
  7.2432 +    my ($old, $new, $def, $c) = @_;
  7.2433 +    my ($with);
  7.2434 +
  7.2435 +    $old = {} unless $old;
  7.2436 +    $def = {} unless $def;
  7.2437 +
  7.2438 +    #   override old parameters with new parameters
  7.2439 +    #   drop new parameters that do not exist in old set
  7.2440 +    $old = { %$old };
  7.2441 +    override_options($old, $new, $c->{optreg});
  7.2442 +
  7.2443 +    #   convert parameters to --define command line options
  7.2444 +    #   skip parameter templates from index
  7.2445 +    #   skip parameters that are identical to defaults
  7.2446 +    $with = join(' ',
  7.2447 +        map { "--define '$_ $old->{$_}'" }
  7.2448 +        sort grep {
  7.2449 +            $old->{$_} =~ m/\S/ &&
  7.2450 +            $old->{$_} !~ m/^%/ &&
  7.2451 +            $old->{$_} ne $def->{$_}
  7.2452 +        } keys %$old
  7.2453 +    );
  7.2454 +
  7.2455 +    $with = ' '.$with if ($with ne '');
  7.2456 +
  7.2457 +    return $with;
  7.2458 +}
  7.2459 +
  7.2460 +#   compute new target based on old target augmented with options from
  7.2461 +#   a binary RPM file
  7.2462 +sub binary_target ($$) {
  7.2463 +    my ($t, $fn) = @_;
  7.2464 +    my (%target) = %$t;
  7.2465 +
  7.2466 +    #   pull in options from binary RPM file
  7.2467 +    delete $target{'OPTIONS'};
  7.2468 +    get_with(\%target, $fn);
  7.2469 +    return \%target;
  7.2470 +}
  7.2471 +
  7.2472 +#   return path to master package for a proxy package
  7.2473 +sub find_proxy ($$) {
  7.2474 +    my ($t, $bpkg) = @_;
  7.2475 +    my (@l) = run($config->{"rpm"} . " -ql $t->{name}");
  7.2476 +    my ($link) = (grep { $_ =~ m/\/\.prefix-$t->{name}$/ } @l)[0];
  7.2477 +    return if (not defined($link));
  7.2478 +    chomp $link;
  7.2479 +    my ($prefix) = readlink($link);
  7.2480 +    return if (not defined($prefix));
  7.2481 +    $bpkg =~ s/.*\///;
  7.2482 +    $bpkg =~ s/\+PROXY(\.[^-]+-[^-]+)-[^-]+\.rpm$/$1-*.rpm/;
  7.2483 +    return (glob("$prefix/RPM/PKG/$bpkg"))[0];
  7.2484 +}
  7.2485 +
  7.2486 +#   indent text to form a block
  7.2487 +sub indent ($) {
  7.2488 +    my ($txt) = @_;
  7.2489 +    $txt =~ s/^/    /gm;
  7.2490 +    return $txt;
  7.2491 +}
  7.2492 +
  7.2493 +#   print commands from package build list
  7.2494 +#   c      -> configuration to derive paths from
  7.2495 +#   uncond -> always do the --rebuild
  7.2496 +#   with   -> parameter set passed to build tool
  7.2497 +#   ignore -> generate script that does not stop on error
  7.2498 +#   usebin -> build-time check to skip rebuild when binary exists
  7.2499 +#   allbin -> usebin also for goals
  7.2500 +sub print_list1 ($$$$$$$) {
  7.2501 +    my ($list, $c, $uncond, $with, $ignore, $usebin, $allbin) = @_;
  7.2502 +    my ($pkg, $spkg, $bpkg, $uvhpkg, $ppkg);
  7.2503 +    my ($opt);
  7.2504 +    my ($cmd1, $cmd2, $mark);
  7.2505 +    my ($cmd3, $srcpkg);
  7.2506 +
  7.2507 +    $mark = '::::';
  7.2508 +
  7.2509 +    my $err;
  7.2510 +    if ($ignore) { $err = "|| true" } else { $err = "|| exit \$?" };
  7.2511 +    foreach (@$list) {
  7.2512 +        $pkg = $_->{name};
  7.2513 +        $spkg = $_->{href};
  7.2514 +        unless ($spkg =~ m/\S/) {
  7.2515 +            die "openpkg:build:FATAL: internal error, ",vsn($_)," without source URL\n";
  7.2516 +        }
  7.2517 +        $bpkg = target2rpm($_, $c); $uvhpkg = $bpkg;
  7.2518 +        $srcpkg = target2srcrpm($_, $c);
  7.2519 +        $cmd3 = '';
  7.2520 +
  7.2521 +        #   rebuild binary package IF
  7.2522 +        #   'unconditional' option
  7.2523 +        #   OR target is tagged as rebuilding
  7.2524 +        #   OR there is no binary package
  7.2525 +        #   OR dependency check found that installed package is not suitable
  7.2526 +        #   OR existing binary package doesn't satisfy wanted options
  7.2527 +        $cmd1 = undef;
  7.2528 +        if (   $uncond
  7.2529 +            || !-f $bpkg
  7.2530 +            || !target_suitable(binary_target($_, $bpkg), $with, 1)) {
  7.2531 +
  7.2532 +            $opt = make_defines($_->{OPTIONS}, $with,
  7.2533 +                                $_->{DEFOPTS}, $c);
  7.2534 +
  7.2535 +            #   proxy packages are rebuilt from their maste
  7.2536 +            #   hierachy
  7.2537 +            #   someone preferred a binary from the repository
  7.2538 +            #   just copy it to the local store
  7.2539 +            if ($_->{PROXY}) {
  7.2540 +                $ppkg = find_proxy($_,$bpkg) or
  7.2541 +                die "openpkg:build:FATAL: proxy package ",vsn($_)," does not exist\n";
  7.2542 +
  7.2543 +                #   rpm doesn't support additional parameters to the
  7.2544 +                #   mkproxy script
  7.2545 +                #   $cmd1 = npriv($config->{"mkp"} . " $ppkg -- -o $bpkg");
  7.2546 +                $cmd1 = "( cd $c->{rpmdir} && ".
  7.2547 +                        npriv($config->{"mkp"} . " $ppkg").
  7.2548 +                        " )";
  7.2549 +            } elsif (defined $_->{prefix}) {
  7.2550 +                $cmd1 = '';
  7.2551 +                if ($spkg =~ m|^\.?/|) {
  7.2552 +                    $uvhpkg = $spkg;
  7.2553 +                }
  7.2554 +                else {
  7.2555 +                    $cmd1 .= npriv($config->{"curl"} . " -# -o $bpkg $spkg $err\n");
  7.2556 +                    $cmd3 = npriv("rm -f $bpkg >/dev/null 2>&1 $err\n") unless ($opt_k);
  7.2557 +                }
  7.2558 +            } else {
  7.2559 +                $cmd1 = '';
  7.2560 +                if ($spkg =~ m|^\.?/|) {
  7.2561 +                    $cmd1 .= npriv($config->{"rpm"} . "$opt --rebuild $spkg $err\n");
  7.2562 +                }
  7.2563 +                else {
  7.2564 +                    $cmd1 .= "if test ! -f $srcpkg; then\n";
  7.2565 +                    $cmd1 .= indent(npriv($config->{"curl"} . " -# -o $srcpkg $spkg $err\n"));
  7.2566 +                    $cmd1 .= "fi\n";
  7.2567 +                    $cmd1 .= npriv($config->{"rpm"} . "$opt --rebuild $srcpkg $err\n");
  7.2568 +                    $cmd1 .= npriv("rm -f $srcpkg >/dev/null 2>&1 $err\n") unless ($opt_k);
  7.2569 +                }
  7.2570 +            }
  7.2571 +        }
  7.2572 +
  7.2573 +        #   wrap build command with build-time check for existing
  7.2574 +        #   binary target
  7.2575 +        if (defined($cmd1) && ($allbin || ($usebin && !$_->{GOAL}))) {
  7.2576 +            $cmd1 = "if test ! -f $uvhpkg; then\n".indent($cmd1)."fi\n";
  7.2577 +        }
  7.2578 +
  7.2579 +        #   if package exist force rpm to copy over new files
  7.2580 +        #   better than erasing everything and losing configuration
  7.2581 +        #   files
  7.2582 +        $opt = ($_->{REBUILD} || ($allbin || ($usebin && !$_->{GOAL}))) ? ' --force' : '';
  7.2583 +        $cmd2 = '';
  7.2584 +        $cmd2 .= priv($config->{"rpm"} . "$opt -Uvh $uvhpkg $err\n");
  7.2585 +        if ($allbin || ($usebin && !$_->{GOAL})) {
  7.2586 +            $cmd2 = "if test \".`".$config->{"rpm"}." -q --qf '\%{SIGMD5}' $pkg`\" != \".`".$config->{"rpm"}." -qp --qf '\%{SIGMD5}' $uvhpkg`\"; then\n".indent($cmd2)."fi\n";
  7.2587 +        }
  7.2588 +        $cmd2 = $cmd1.$cmd2 if ($cmd1);
  7.2589 +        $cmd2 = $cmd2.$cmd3 if ($cmd3);
  7.2590 +        print "echo $mark $spkg $mark\n".$cmd2."echo $mark $spkg = \$? $mark\n";
  7.2591 +    }
  7.2592 +}
  7.2593 +
  7.2594 +#   print commands for the temporary package list
  7.2595 +#   temporary packages are only used for building other packages
  7.2596 +#   and are removed when everything is done
  7.2597 +sub print_list2 ($$) {
  7.2598 +    my ($list, $c) = @_;
  7.2599 +    my ($pkg);
  7.2600 +
  7.2601 +    foreach (@$list) {
  7.2602 +        $pkg = "$_->{name}-$_->{version}-$_->{release}";
  7.2603 +        print priv($config->{"rpm"} . " -e $pkg\n");
  7.2604 +    }
  7.2605 +}
  7.2606 +