1.1 --- /dev/null Thu Jan 01 00:00:00 1970 +0000
1.2 +++ b/browser/extensions/shumway/content/shumway.js Wed Dec 31 06:09:35 2014 +0100
1.3 @@ -0,0 +1,51428 @@
1.4 +/*
1.5 + * Copyright 2013 Mozilla Foundation
1.6 + *
1.7 + * Licensed under the Apache License, Version 2.0 (the "License");
1.8 + * you may not use this file except in compliance with the License.
1.9 + * You may obtain a copy of the License at
1.10 + *
1.11 + * http://www.apache.org/licenses/LICENSE-2.0
1.12 + *
1.13 + * Unless required by applicable law or agreed to in writing, software
1.14 + * distributed under the License is distributed on an "AS IS" BASIS,
1.15 + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
1.16 + * See the License for the specific language governing permissions and
1.17 + * limitations under the License.
1.18 + */
1.19 +
1.20 +// This file is automatically generated
1.21 +
1.22 +(function (global) {
1.23 + if (global.DataView)
1.24 + return;
1.25 + if (!global.ArrayBuffer)
1.26 + fail('ArrayBuffer not supported');
1.27 + if (!Object.defineProperties)
1.28 + fail('This module requires ECMAScript 5');
1.29 + var nativele = new Int8Array(new Int32Array([
1.30 + 1
1.31 + ]).buffer)[0] === 1;
1.32 + var temp = new Uint8Array(8);
1.33 + global.DataView = function DataView(buffer, offset, length) {
1.34 + if (!(buffer instanceof ArrayBuffer))
1.35 + fail('Bad ArrayBuffer');
1.36 + offset = offset || 0;
1.37 + length = length || buffer.byteLength - offset;
1.38 + if (offset < 0 || length < 0 || offset + length > buffer.byteLength)
1.39 + fail('Illegal offset and/or length');
1.40 + Object.defineProperties(this, {
1.41 + buffer: {
1.42 + value: buffer,
1.43 + enumerable: false,
1.44 + writable: false,
1.45 + configurable: false
1.46 + },
1.47 + byteOffset: {
1.48 + value: offset,
1.49 + enumerable: false,
1.50 + writable: false,
1.51 + configurable: false
1.52 + },
1.53 + byteLength: {
1.54 + value: length,
1.55 + enumerable: false,
1.56 + writable: false,
1.57 + configurable: false
1.58 + },
1.59 + _bytes: {
1.60 + value: new Uint8Array(buffer, offset, length),
1.61 + enumerable: false,
1.62 + writable: false,
1.63 + configurable: false
1.64 + }
1.65 + });
1.66 + };
1.67 + global.DataView.prototype = {
1.68 + constructor: DataView,
1.69 + getInt8: function getInt8(offset) {
1.70 + return get(this, Int8Array, 1, offset);
1.71 + },
1.72 + getUint8: function getUint8(offset) {
1.73 + return get(this, Uint8Array, 1, offset);
1.74 + },
1.75 + getInt16: function getInt16(offset, le) {
1.76 + return get(this, Int16Array, 2, offset, le);
1.77 + },
1.78 + getUint16: function getUint16(offset, le) {
1.79 + return get(this, Uint16Array, 2, offset, le);
1.80 + },
1.81 + getInt32: function getInt32(offset, le) {
1.82 + return get(this, Int32Array, 4, offset, le);
1.83 + },
1.84 + getUint32: function getUint32(offset, le) {
1.85 + return get(this, Uint32Array, 4, offset, le);
1.86 + },
1.87 + getFloat32: function getFloat32(offset, le) {
1.88 + return get(this, Float32Array, 4, offset, le);
1.89 + },
1.90 + getFloat64: function getFloat32(offset, le) {
1.91 + return get(this, Float64Array, 8, offset, le);
1.92 + },
1.93 + setInt8: function setInt8(offset, value) {
1.94 + set(this, Int8Array, 1, offset, value);
1.95 + },
1.96 + setUint8: function setUint8(offset, value) {
1.97 + set(this, Uint8Array, 1, offset, value);
1.98 + },
1.99 + setInt16: function setInt16(offset, value, le) {
1.100 + set(this, Int16Array, 2, offset, value, le);
1.101 + },
1.102 + setUint16: function setUint16(offset, value, le) {
1.103 + set(this, Uint16Array, 2, offset, value, le);
1.104 + },
1.105 + setInt32: function setInt32(offset, value, le) {
1.106 + set(this, Int32Array, 4, offset, value, le);
1.107 + },
1.108 + setUint32: function setUint32(offset, value, le) {
1.109 + set(this, Uint32Array, 4, offset, value, le);
1.110 + },
1.111 + setFloat32: function setFloat32(offset, value, le) {
1.112 + set(this, Float32Array, 4, offset, value, le);
1.113 + },
1.114 + setFloat64: function setFloat64(offset, value, le) {
1.115 + set(this, Float64Array, 8, offset, value, le);
1.116 + }
1.117 + };
1.118 + function get(view, type, size, offset, le) {
1.119 + if (offset === undefined)
1.120 + fail('Missing required offset argument');
1.121 + if (offset < 0 || offset + size > view.byteLength)
1.122 + fail('Invalid index: ' + offset);
1.123 + if (size === 1 || !(!le) === nativele) {
1.124 + if ((view.byteOffset + offset) % size === 0)
1.125 + return new type(view.buffer, view.byteOffset + offset, 1)[0];
1.126 + else {
1.127 + for (var i = 0; i < size; i++)
1.128 + temp[i] = view._bytes[offset + i];
1.129 + return new type(temp.buffer)[0];
1.130 + }
1.131 + } else {
1.132 + for (var i = 0; i < size; i++)
1.133 + temp[size - i - 1] = view._bytes[offset + i];
1.134 + return new type(temp.buffer)[0];
1.135 + }
1.136 + }
1.137 + function set(view, type, size, offset, value, le) {
1.138 + if (offset === undefined)
1.139 + fail('Missing required offset argument');
1.140 + if (value === undefined)
1.141 + fail('Missing required value argument');
1.142 + if (offset < 0 || offset + size > view.byteLength)
1.143 + fail('Invalid index: ' + offset);
1.144 + if (size === 1 || !(!le) === nativele) {
1.145 + if ((view.byteOffset + offset) % size === 0) {
1.146 + new type(view.buffer, view.byteOffset + offset, 1)[0] = value;
1.147 + } else {
1.148 + new type(temp.buffer)[0] = value;
1.149 + for (var i = 0; i < size; i++)
1.150 + view._bytes[i + offset] = temp[i];
1.151 + }
1.152 + } else {
1.153 + new type(temp.buffer)[0] = value;
1.154 + for (var i = 0; i < size; i++)
1.155 + view._bytes[offset + i] = temp[size - 1 - i];
1.156 + }
1.157 + }
1.158 + function fail(msg) {
1.159 + throw new Error(msg);
1.160 + }
1.161 +}(this));
1.162 +;
1.163 +var ByteArray = ByteArray || function (undefined) {
1.164 + ByteArrayClass.INITIAL_SIZE = 128;
1.165 + ByteArrayClass.DEFAULT_OBJECT_ENCODING = 3;
1.166 + function ByteArrayClass(bytes) {
1.167 + if (bytes instanceof ByteArray) {
1.168 + return bytes;
1.169 + }
1.170 + var initData = bytes || this.symbol && this.symbol.data;
1.171 + if (initData) {
1.172 + this.a = new ArrayBuffer(initData.length);
1.173 + this.length = initData.length;
1.174 + new Uint8Array(this.a).set(initData);
1.175 + } else {
1.176 + this.a = new ArrayBuffer(ByteArrayClass.INITIAL_SIZE);
1.177 + this.length = 0;
1.178 + }
1.179 + this.position = 0;
1.180 + this.cacheViews();
1.181 + this.nativele = new Int8Array(new Int32Array([]).buffer)[0] === 1;
1.182 + this.le = this.nativele;
1.183 + this.objectEncoding = ByteArrayClass.DEFAULT_OBJECT_ENCODING;
1.184 + this.bitBuffer = 0;
1.185 + this.bitLength = 0;
1.186 + }
1.187 + ;
1.188 + function throwEOFError() {
1.189 + runtime.throwErrorFromVM('flash.errors.EOFError', 'End of file was encountered.');
1.190 + }
1.191 + function throwRangeError() {
1.192 + var error = Errors.ParamRangeError;
1.193 + runtime.throwErrorFromVM('RangeError', getErrorMessage(error.code), error.code);
1.194 + }
1.195 + function throwCompressedDataError() {
1.196 + var error = Errors.CompressedDataError;
1.197 + runtime.throwErrorFromVM('CompressedDataError', getErrorMessage(error.code), error.code);
1.198 + }
1.199 + function checkRange(x, min, max) {
1.200 + if (x !== clamp(x, min, max)) {
1.201 + throwRangeError();
1.202 + }
1.203 + }
1.204 + function get(b, m, size) {
1.205 + if (b.position + size > b.length) {
1.206 + throwEOFError();
1.207 + }
1.208 + var v = b.view[m](b.position, b.le);
1.209 + b.position += size;
1.210 + return v;
1.211 + }
1.212 + function set(b, m, size, v) {
1.213 + var len = b.position + size;
1.214 + b.ensureCapacity(len);
1.215 + b.view[m](b.position, v, b.le);
1.216 + b.position = len;
1.217 + if (len > b.length) {
1.218 + b.length = len;
1.219 + }
1.220 + }
1.221 + var BAp = ByteArrayClass.prototype;
1.222 + BAp.cacheViews = function cacheViews() {
1.223 + var a = this.a;
1.224 + this.int8v = new Int8Array(a);
1.225 + this.uint8v = new Uint8Array(a);
1.226 + this.view = new DataView(a);
1.227 + };
1.228 + BAp.getBytes = function getBytes() {
1.229 + return new Uint8Array(this.a, 0, this.length);
1.230 + };
1.231 + BAp.ensureCapacity = function ensureCapacity(size) {
1.232 + var origa = this.a;
1.233 + if (origa.byteLength < size) {
1.234 + var newSize = origa.byteLength;
1.235 + while (newSize < size) {
1.236 + newSize *= 2;
1.237 + }
1.238 + var copya = new ArrayBuffer(newSize);
1.239 + var origv = this.int8v;
1.240 + this.a = copya;
1.241 + this.cacheViews();
1.242 + this.int8v.set(origv);
1.243 + }
1.244 + };
1.245 + BAp.clear = function clear() {
1.246 + this.length = 0;
1.247 + this.position = 0;
1.248 + };
1.249 + BAp.readBoolean = function readBoolean() {
1.250 + if (this.position + 1 > this.length) {
1.251 + throwEOFError();
1.252 + }
1.253 + return this.int8v[this.position++] !== 0;
1.254 + };
1.255 + BAp.readByte = function readByte() {
1.256 + if (this.position + 1 > this.length) {
1.257 + throwEOFError();
1.258 + }
1.259 + return this.int8v[this.position++];
1.260 + };
1.261 + BAp.readUnsignedByte = function readUnsignedByte() {
1.262 + if (this.position + 1 > this.length) {
1.263 + throwEOFError();
1.264 + }
1.265 + return this.uint8v[this.position++];
1.266 + };
1.267 + BAp.readBytes = function readBytes(bytes, offset, length) {
1.268 + var pos = this.position;
1.269 + if (!offset) {
1.270 + offset = 0;
1.271 + }
1.272 + if (!length) {
1.273 + length = this.length - pos;
1.274 + }
1.275 + if (pos + length > this.length) {
1.276 + throwEOFError();
1.277 + }
1.278 + if (bytes.length < offset + length) {
1.279 + bytes.ensureCapacity(offset + length);
1.280 + bytes.length = offset + length;
1.281 + }
1.282 + bytes.int8v.set(new Int8Array(this.a, pos, length), offset);
1.283 + this.position += length;
1.284 + };
1.285 + BAp.writeBoolean = function writeBoolean(v) {
1.286 + var len = this.position + 1;
1.287 + this.ensureCapacity(len);
1.288 + this.int8v[this.position++] = v ? 1 : 0;
1.289 + if (len > this.length) {
1.290 + this.length = len;
1.291 + }
1.292 + };
1.293 + BAp.writeByte = function writeByte(v) {
1.294 + var len = this.position + 1;
1.295 + this.ensureCapacity(len);
1.296 + this.int8v[this.position++] = v;
1.297 + if (len > this.length) {
1.298 + this.length = len;
1.299 + }
1.300 + };
1.301 + BAp.writeUnsignedByte = function writeUnsignedByte(v) {
1.302 + var len = this.position + 1;
1.303 + this.ensureCapacity(len);
1.304 + this.uint8v[this.position++] = v;
1.305 + if (len > this.length) {
1.306 + this.length = len;
1.307 + }
1.308 + };
1.309 + BAp.writeRawBytes = function writeRawBytes(bytes) {
1.310 + var len = this.position + bytes.length;
1.311 + this.ensureCapacity(len);
1.312 + this.int8v.set(bytes, this.position);
1.313 + this.position = len;
1.314 + if (len > this.length) {
1.315 + this.length = len;
1.316 + }
1.317 + };
1.318 + BAp.readRawBytes = function readRawBytes() {
1.319 + return new Int8Array(this.a, 0, this.length);
1.320 + };
1.321 + BAp.writeBytes = function writeBytes(bytes, offset, length) {
1.322 + if (arguments.length < 2) {
1.323 + offset = 0;
1.324 + }
1.325 + if (arguments.length < 3) {
1.326 + length = 0;
1.327 + }
1.328 + checkRange(offset, 0, bytes.length);
1.329 + checkRange(offset + length, 0, bytes.length);
1.330 + if (length === 0) {
1.331 + length = bytes.length - offset;
1.332 + }
1.333 + this.writeRawBytes(new Int8Array(bytes.a, offset, length));
1.334 + };
1.335 + BAp.readDouble = function readDouble() {
1.336 + return get(this, 'getFloat64', 8);
1.337 + };
1.338 + BAp.readFloat = function readFloat() {
1.339 + return get(this, 'getFloat32', 4);
1.340 + };
1.341 + BAp.readInt = function readInt() {
1.342 + return get(this, 'getInt32', 4);
1.343 + };
1.344 + BAp.readShort = function readShort() {
1.345 + return get(this, 'getInt16', 2);
1.346 + };
1.347 + BAp.readUnsignedInt = function readUnsignedInt() {
1.348 + return get(this, 'getUint32', 4);
1.349 + };
1.350 + BAp.readUnsignedShort = function readUnsignedShort() {
1.351 + return get(this, 'getUint16', 2);
1.352 + };
1.353 + BAp.writeDouble = function writeDouble(v) {
1.354 + set(this, 'setFloat64', 8, v);
1.355 + };
1.356 + BAp.writeFloat = function writeFloat(v) {
1.357 + set(this, 'setFloat32', 4, v);
1.358 + };
1.359 + BAp.writeInt = function writeInt(v) {
1.360 + set(this, 'setInt32', 4, v);
1.361 + };
1.362 + BAp.writeShort = function writeShort(v) {
1.363 + set(this, 'setInt16', 2, v);
1.364 + };
1.365 + BAp.writeUnsignedInt = function writeUnsignedInt(v) {
1.366 + set(this, 'setUint32', 4, v);
1.367 + };
1.368 + BAp.writeUnsignedShort = function writeUnsignedShort(v) {
1.369 + set(this, 'setUint16', 2, v);
1.370 + };
1.371 + var codeLengthOrder = [
1.372 + 16,
1.373 + 17,
1.374 + 18,
1.375 + 0,
1.376 + 8,
1.377 + 7,
1.378 + 9,
1.379 + 6,
1.380 + 10,
1.381 + 5,
1.382 + 11,
1.383 + 4,
1.384 + 12,
1.385 + 3,
1.386 + 13,
1.387 + 2,
1.388 + 14,
1.389 + 1,
1.390 + 15
1.391 + ];
1.392 + var distanceCodes = [];
1.393 + var distanceExtraBits = [];
1.394 + for (var i = 0, j = 0, code = 1; i < 30; ++i) {
1.395 + distanceCodes[i] = code;
1.396 + code += 1 << (distanceExtraBits[i] = ~(~((j += i > 2 ? 1 : 0) / 2)));
1.397 + }
1.398 + var bitLengths = [];
1.399 + for (var i = 0; i < 32; ++i) {
1.400 + bitLengths[i] = 5;
1.401 + }
1.402 + var fixedDistanceTable = makeHuffmanTable(bitLengths);
1.403 + var lengthCodes = [];
1.404 + var lengthExtraBits = [];
1.405 + for (var i = 0, j = 0, code = 3; i < 29; ++i) {
1.406 + lengthCodes[i] = code - (i == 28 ? 1 : 0);
1.407 + code += 1 << (lengthExtraBits[i] = ~(~((j += i > 4 ? 1 : 0) / 4 % 6)));
1.408 + }
1.409 + for (var i = 0; i < 288; ++i) {
1.410 + bitLengths[i] = i < 144 || i > 279 ? 8 : i < 256 ? 9 : 7;
1.411 + }
1.412 + var fixedLiteralTable = makeHuffmanTable(bitLengths);
1.413 + function makeHuffmanTable(bitLengths) {
1.414 + var maxBits = Math.max.apply(null, bitLengths);
1.415 + var numLengths = bitLengths.length;
1.416 + var size = 1 << maxBits;
1.417 + var codes = new Uint32Array(size);
1.418 + for (var code = 0, len = 1, skip = 2; len <= maxBits; code <<= 1, ++len, skip <<= 1) {
1.419 + for (var val = 0; val < numLengths; ++val) {
1.420 + if (bitLengths[val] === len) {
1.421 + var lsb = 0;
1.422 + for (var i = 0; i < len; ++i) {
1.423 + lsb = lsb * 2 + (code >> i & 1);
1.424 + }
1.425 + for (var i = lsb; i < size; i += skip) {
1.426 + codes[i] = len << 16 | val;
1.427 + }
1.428 + ++code;
1.429 + }
1.430 + }
1.431 + }
1.432 + return {
1.433 + codes: codes,
1.434 + maxBits: maxBits
1.435 + };
1.436 + }
1.437 + function inflateBlock(input, output) {
1.438 + var header = readBits(input, 3);
1.439 + switch (header >> 1) {
1.440 + case 0:
1.441 + input.bitBuffer = input.bitLength = 0;
1.442 + var len = input.readUnsignedShort();
1.443 + var nlen = input.readUnsignedShort();
1.444 + if ((~nlen & 65535) !== len) {
1.445 + throwCompressedDataError();
1.446 + }
1.447 + output.writeBytes(input, input.position, len);
1.448 + input.position += len;
1.449 + break;
1.450 + case 1:
1.451 + inflate(input, output, fixedLiteralTable, fixedDistanceTable);
1.452 + break;
1.453 + case 2:
1.454 + var bitLengths = [];
1.455 + var numLiteralCodes = readBits(input, 5) + 257;
1.456 + var numDistanceCodes = readBits(input, 5) + 1;
1.457 + var numCodes = numLiteralCodes + numDistanceCodes;
1.458 + var numLengthCodes = readBits(input, 4) + 4;
1.459 + for (var i = 0; i < 19; ++i) {
1.460 + bitLengths[codeLengthOrder[i]] = i < numLengthCodes ? readBits(input, 3) : 0;
1.461 + }
1.462 + var codeLengthTable = makeHuffmanTable(bitLengths);
1.463 + bitLengths = [];
1.464 + var i = 0;
1.465 + var prev = 0;
1.466 + while (i < numCodes) {
1.467 + var j = 1;
1.468 + var sym = readCode(input, codeLengthTable);
1.469 + switch (sym) {
1.470 + case 16:
1.471 + j = readBits(input, 2) + 3;
1.472 + sym = prev;
1.473 + break;
1.474 + case 17:
1.475 + j = readBits(input, 3) + 3;
1.476 + sym = 0;
1.477 + break;
1.478 + case 18:
1.479 + j = readBits(input, 7) + 11;
1.480 + sym = 0;
1.481 + break;
1.482 + default:
1.483 + prev = sym;
1.484 + }
1.485 + while (j--) {
1.486 + bitLengths[i++] = sym;
1.487 + }
1.488 + }
1.489 + var distanceTable = makeHuffmanTable(bitLengths.splice(numLiteralCodes, numDistanceCodes));
1.490 + var literalTable = makeHuffmanTable(bitLengths);
1.491 + inflate(input, output, literalTable, distanceTable);
1.492 + break;
1.493 + default:
1.494 + fail('unknown block type', 'inflate');
1.495 + }
1.496 + }
1.497 + function readBits(input, size) {
1.498 + var buffer = input.bitBuffer;
1.499 + var bufflen = input.bitLength;
1.500 + while (size > bufflen) {
1.501 + buffer |= input.readUnsignedByte() << bufflen;
1.502 + bufflen += 8;
1.503 + }
1.504 + input.bitBuffer = buffer >>> size;
1.505 + input.bitLength = bufflen - size;
1.506 + return buffer & (1 << size) - 1;
1.507 + }
1.508 + function inflate(input, output, literalTable, distanceTable) {
1.509 + var sym;
1.510 + while ((sym = readCode(input, literalTable)) !== 256) {
1.511 + if (sym < 256) {
1.512 + output.writeUnsignedByte(sym);
1.513 + } else {
1.514 + sym -= 257;
1.515 + var len = lengthCodes[sym] + readBits(input, lengthExtraBits[sym]);
1.516 + sym = readCode(input, distanceTable);
1.517 + var distance = distanceCodes[sym] + readBits(input, distanceExtraBits[sym]);
1.518 + output.writeBytes(output, output.position - distance, len);
1.519 + }
1.520 + }
1.521 + }
1.522 + function readCode(input, codeTable) {
1.523 + var buffer = input.bitBuffer;
1.524 + var bitlen = input.bitLength;
1.525 + var maxBits = codeTable.maxBits;
1.526 + while (maxBits > bitlen) {
1.527 + buffer |= input.readUnsignedByte() << bitlen;
1.528 + bitlen += 8;
1.529 + }
1.530 + var code = codeTable.codes[buffer & (1 << maxBits) - 1];
1.531 + var len = code >> 16;
1.532 + if (!len) {
1.533 + throwCompressedDataError();
1.534 + }
1.535 + input.bitBuffer = buffer >>> len;
1.536 + input.bitLength = bitlen - len;
1.537 + return code & 65535;
1.538 + }
1.539 + function adler32(data, start, end) {
1.540 + var a = 1;
1.541 + var b = 0;
1.542 + for (var i = start; i < end; ++i) {
1.543 + a = (a + (data[i] & 255)) % 65521;
1.544 + b = (b + a) % 65521;
1.545 + }
1.546 + return b << 16 | a;
1.547 + }
1.548 + BAp.compress = function (algorithm) {
1.549 + this.position = 0;
1.550 + var output = new ByteArray();
1.551 + switch (algorithm) {
1.552 + case 'zlib':
1.553 + output.writeUnsignedByte(120);
1.554 + output.writeUnsignedByte(156);
1.555 + case 'deflate':
1.556 + output.le = true;
1.557 + var len = this.length;
1.558 + output.ensureCapacity(len + Math.ceil(len / 65535) * 5 + 4);
1.559 + while (len > 65535) {
1.560 + output.writeUnsignedByte(0);
1.561 + output.writeUnsignedShort(65535);
1.562 + output.writeUnsignedShort(0);
1.563 + output.writeBytes(this, this.position, 65535);
1.564 + this.position += 65535;
1.565 + len -= 65535;
1.566 + }
1.567 + output.writeUnsignedByte(0);
1.568 + output.writeUnsignedShort(len);
1.569 + output.writeUnsignedShort(~len & 65535);
1.570 + output.writeBytes(this, this.position, len);
1.571 + if (algorithm === 'zlib') {
1.572 + output.writeUnsignedInt(adler32(this.uint8v, 0, this.length));
1.573 + }
1.574 + break;
1.575 + default:
1.576 + return;
1.577 + }
1.578 + this.ensureCapacity(output.uint8v.length);
1.579 + this.uint8v.set(output.uint8v);
1.580 + this.length = output.length;
1.581 + this.position = 0;
1.582 + };
1.583 + BAp.uncompress = function (algorithm) {
1.584 + var output = new ByteArray();
1.585 + switch (algorithm) {
1.586 + case 'zlib':
1.587 + var header = this.readUnsignedShort();
1.588 + if ((header & 3840) !== 2048 || header % 31 !== 0 || header & 32) {
1.589 + throwCompressedDataError();
1.590 + }
1.591 + case 'deflate':
1.592 + var le = this.le;
1.593 + this.le = true;
1.594 + while (this.position < this.length - 6) {
1.595 + inflateBlock(this, output);
1.596 + }
1.597 + this.le = le;
1.598 + break;
1.599 + default:
1.600 + return;
1.601 + }
1.602 + this.ensureCapacity(output.uint8v.length);
1.603 + this.uint8v.set(output.uint8v);
1.604 + this.length = output.length;
1.605 + this.position = 0;
1.606 + };
1.607 + return ByteArrayClass;
1.608 + }();
1.609 +var Shumway;
1.610 +(function (Shumway) {
1.611 + (function (Options) {
1.612 + var Argument = function () {
1.613 + function Argument(shortName, longName, type, options) {
1.614 + this.shortName = shortName;
1.615 + this.longName = longName;
1.616 + this.type = type;
1.617 + options = options || {};
1.618 + this.positional = options.positional;
1.619 + this.parseFn = options.parse;
1.620 + this.value = options.defaultValue;
1.621 + }
1.622 + Argument.prototype.parse = function (value) {
1.623 + if (this.type === 'boolean') {
1.624 + true;
1.625 + this.value = value;
1.626 + } else if (this.type === 'number') {
1.627 + true;
1.628 + this.value = parseInt(value, 10);
1.629 + } else {
1.630 + this.value = value;
1.631 + }
1.632 + if (this.parseFn) {
1.633 + this.parseFn(this.value);
1.634 + }
1.635 + };
1.636 + return Argument;
1.637 + }();
1.638 + Options.Argument = Argument;
1.639 + var ArgumentParser = function () {
1.640 + function ArgumentParser() {
1.641 + this.args = [];
1.642 + }
1.643 + ArgumentParser.prototype.addArgument = function (shortName, longName, type, options) {
1.644 + var argument = new Argument(shortName, longName, type, options);
1.645 + this.args.push(argument);
1.646 + return argument;
1.647 + };
1.648 + ArgumentParser.prototype.addBoundOption = function (option) {
1.649 + var options = {
1.650 + parse: function (x) {
1.651 + option.value = x;
1.652 + }
1.653 + };
1.654 + this.args.push(new Argument(option.shortName, option.longName, option.type, options));
1.655 + };
1.656 + ArgumentParser.prototype.addBoundOptionSet = function (optionSet) {
1.657 + var self = this;
1.658 + optionSet.options.forEach(function (x) {
1.659 + if (x instanceof OptionSet) {
1.660 + self.addBoundOptionSet(x);
1.661 + } else {
1.662 + true;
1.663 + self.addBoundOption(x);
1.664 + }
1.665 + });
1.666 + };
1.667 + ArgumentParser.prototype.getUsage = function () {
1.668 + var str = '';
1.669 + this.args.forEach(function (x) {
1.670 + if (!x.positional) {
1.671 + str += '[-' + x.shortName + '|--' + x.longName + (x.type === 'boolean' ? '' : ' ' + x.type[0].toUpperCase()) + ']';
1.672 + } else {
1.673 + str += x.longName;
1.674 + }
1.675 + str += ' ';
1.676 + });
1.677 + return str;
1.678 + };
1.679 + ArgumentParser.prototype.parse = function (args) {
1.680 + var nonPositionalArgumentMap = {};
1.681 + var positionalArgumentList = [];
1.682 + this.args.forEach(function (x) {
1.683 + if (x.positional) {
1.684 + positionalArgumentList.push(x);
1.685 + } else {
1.686 + nonPositionalArgumentMap['-' + x.shortName] = x;
1.687 + nonPositionalArgumentMap['--' + x.longName] = x;
1.688 + }
1.689 + });
1.690 + var leftoverArguments = [];
1.691 + while (args.length) {
1.692 + var argString = args.shift();
1.693 + var argument = null, value = argString;
1.694 + if (argString == '--') {
1.695 + leftoverArguments = leftoverArguments.concat(args);
1.696 + break;
1.697 + } else if (argString.slice(0, 1) == '-' || argString.slice(0, 2) == '--') {
1.698 + argument = nonPositionalArgumentMap[argString];
1.699 + true;
1.700 + if (!argument) {
1.701 + continue;
1.702 + }
1.703 + if (argument.type !== 'boolean') {
1.704 + value = args.shift();
1.705 + true;
1.706 + } else {
1.707 + value = true;
1.708 + }
1.709 + } else if (positionalArgumentList.length) {
1.710 + argument = positionalArgumentList.shift();
1.711 + } else {
1.712 + leftoverArguments.push(value);
1.713 + }
1.714 + if (argument) {
1.715 + argument.parse(value);
1.716 + }
1.717 + }
1.718 + true;
1.719 + return leftoverArguments;
1.720 + };
1.721 + return ArgumentParser;
1.722 + }();
1.723 + Options.ArgumentParser = ArgumentParser;
1.724 + var OptionSet = function () {
1.725 + function OptionSet(name) {
1.726 + this.name = name;
1.727 + this.options = [];
1.728 + }
1.729 + OptionSet.prototype.register = function (option) {
1.730 + this.options.push(option);
1.731 + return option;
1.732 + };
1.733 + OptionSet.prototype.trace = function (writer) {
1.734 + writer.enter(this.name + ' {');
1.735 + this.options.forEach(function (option) {
1.736 + option.trace(writer);
1.737 + });
1.738 + writer.leave('}');
1.739 + };
1.740 + return OptionSet;
1.741 + }();
1.742 + Options.OptionSet = OptionSet;
1.743 + var Option = function () {
1.744 + function Option(shortName, longName, type, defaultValue, description) {
1.745 + this.longName = longName;
1.746 + this.shortName = shortName;
1.747 + this.type = type;
1.748 + this.defaultValue = defaultValue;
1.749 + this.value = defaultValue;
1.750 + this.description = description;
1.751 + }
1.752 + Option.prototype.parse = function (value) {
1.753 + this.value = value;
1.754 + };
1.755 + Option.prototype.trace = function (writer) {
1.756 + writer.writeLn(('-' + this.shortName + '|--' + this.longName).padRight(' ', 30) + ' = ' + this.type + ' ' + this.value + ' [' + this.defaultValue + ']' + ' (' + this.description + ')');
1.757 + };
1.758 + return Option;
1.759 + }();
1.760 + Options.Option = Option;
1.761 + }(Shumway.Options || (Shumway.Options = {})));
1.762 + var Options = Shumway.Options;
1.763 +}(Shumway || (Shumway = {})));
1.764 +if (typeof exports !== 'undefined') {
1.765 + exports['Shumway'] = Shumway;
1.766 +}
1.767 +var ArgumentParser = Shumway.Options.ArgumentParser;
1.768 +var Option = Shumway.Options.Option;
1.769 +var OptionSet = Shumway.Options.OptionSet;
1.770 +var Option = Shumway.Options.Option;
1.771 +var OptionSet = Shumway.Options.OptionSet;
1.772 +var coreOptions = new OptionSet('Core Options');
1.773 +var Timeline = function () {
1.774 + var barColor = 'rgba(255,255,255, 0.075)';
1.775 + var backgroundColor = 'rgb(61, 61, 61)';
1.776 + var backgroundColorInfo = 'rgba(0,0,0, 0.85)';
1.777 + var fpsLineColor = 'rgb(255,64,0)';
1.778 + var textColor = '#ccc';
1.779 + function timeline(canvas) {
1.780 + this.depth = 0;
1.781 + this.start = 0;
1.782 + this.index = 0;
1.783 + this.marks = new Shumway.CircularBuffer(Int32Array);
1.784 + this.times = new Shumway.CircularBuffer(Float64Array);
1.785 + this.frameRate = 12;
1.786 + this.maxFrameTime = 1000 * 2 / this.frameRate;
1.787 + this.refreshFrequency = 10;
1.788 + this.refreshCounter = 0;
1.789 + this.count = 0;
1.790 + this.kinds = createEmptyObject();
1.791 + this.kindCount = 0;
1.792 + this.canvas = canvas;
1.793 + this.context = canvas.getContext('2d', {
1.794 + original: true
1.795 + });
1.796 + this.fillStyles = [
1.797 + 'rgb(85, 152, 213)',
1.798 + '#bfd8a7',
1.799 + '#d906d7'
1.800 + ];
1.801 + window.addEventListener('resize', this.resizeHandler.bind(this), false);
1.802 + this.resizeHandler();
1.803 + }
1.804 + timeline.prototype.setFrameRate = function setFrameRate(frameRate) {
1.805 + this.frameRate = frameRate;
1.806 + this.maxFrameTime = 1000 * 2 / frameRate;
1.807 + };
1.808 + timeline.prototype.refreshEvery = function refreshEvery(freq) {
1.809 + this.refreshFrequency = freq;
1.810 + this.refreshCounter = 0;
1.811 + };
1.812 + var ENTER = 3203334144 | 0;
1.813 + var LEAVE = 3735879680 | 0;
1.814 + timeline.prototype.registerKind = function getKind(name, fillStyle) {
1.815 + if (this.kinds[name] === undefined) {
1.816 + this.fillStyles[this.kindCount] = fillStyle;
1.817 + this.kinds[name] = this.kindCount++;
1.818 + } else {
1.819 + this.fillStyles[this.kinds[name]] = fillStyle;
1.820 + }
1.821 + };
1.822 + timeline.prototype.getKind = function getKind(name) {
1.823 + if (this.kinds[name] === undefined) {
1.824 + this.kinds[name] = this.kindCount++;
1.825 + if (this.kindCount > this.fillStyles.length) {
1.826 + this.fillStyles.push(randomStyle());
1.827 + }
1.828 + }
1.829 + return this.kinds[name];
1.830 + };
1.831 + timeline.prototype.enter = function enter(name) {
1.832 + this.depth++;
1.833 + this.marks.write(ENTER | this.getKind(name));
1.834 + this.times.write(performance.now());
1.835 + };
1.836 + timeline.prototype.leave = function leave(name) {
1.837 + this.marks.write(LEAVE | this.getKind(name));
1.838 + this.times.write(performance.now());
1.839 + this.depth--;
1.840 + if (this.depth === 0) {
1.841 + this.count++;
1.842 + if (++this.refreshCounter == this.refreshFrequency) {
1.843 + this.refreshCounter = 0;
1.844 + this.paint();
1.845 + }
1.846 + }
1.847 + };
1.848 + timeline.prototype.gatherFrames = function gatherFrames(maxFrames) {
1.849 + var stack = [];
1.850 + var frames = [];
1.851 + var times = this.times;
1.852 + maxFrames++;
1.853 + this.marks.forEachInReverse(function (mark, i) {
1.854 + var time = times.get(i);
1.855 + if ((mark & 4294901760) === ENTER) {
1.856 + var node = stack.pop();
1.857 + node.startTime = time;
1.858 + if (!stack.length) {
1.859 + if (frames.length && !frames[0].total) {
1.860 + frames[0].total = frames[0].startTime - time;
1.861 + }
1.862 + frames.unshift(node);
1.863 + } else {
1.864 + var top = stack.top();
1.865 + if (!top.children) {
1.866 + top.children = [
1.867 + node
1.868 + ];
1.869 + } else {
1.870 + top.children.push(node);
1.871 + }
1.872 + }
1.873 + } else if ((mark & 4294901760) === LEAVE) {
1.874 + if (frames.length > maxFrames) {
1.875 + return true;
1.876 + }
1.877 + stack.push({
1.878 + kind: mark & 65535,
1.879 + endTime: time
1.880 + });
1.881 + }
1.882 + });
1.883 + return frames;
1.884 + };
1.885 + timeline.prototype.resizeHandler = function resizeHandler(event) {
1.886 + var parent = this.canvas.parentElement;
1.887 + this.cw = parent.offsetWidth;
1.888 + this.ch = parent.offsetHeight - 1;
1.889 + var devicePixelRatio = window.devicePixelRatio || 1;
1.890 + var backingStoreRatio = this.context.webkitBackingStorePixelRatio || this.context.mozBackingStorePixelRatio || this.context.msBackingStorePixelRatio || this.context.oBackingStorePixelRatio || this.context.backingStorePixelRatio || 1;
1.891 + if (devicePixelRatio !== backingStoreRatio) {
1.892 + var ratio = devicePixelRatio / backingStoreRatio;
1.893 + this.canvas.width = this.cw * ratio;
1.894 + this.canvas.height = this.ch * ratio;
1.895 + this.canvas.style.width = this.cw + 'px';
1.896 + this.canvas.style.height = this.ch + 'px';
1.897 + this.context.scale(ratio, ratio);
1.898 + } else {
1.899 + this.canvas.width = this.cw;
1.900 + this.canvas.height = this.ch;
1.901 + }
1.902 + this.context.font = '10px Consolas, "Liberation Mono", Courier, monospace';
1.903 + };
1.904 + timeline.prototype.paint = function paint() {
1.905 + var w = 10;
1.906 + var gap = 1;
1.907 + var maxFrames = this.cw / (w + gap) | 0;
1.908 + var frames = this.gatherFrames(maxFrames);
1.909 + var context = this.context;
1.910 + var maxFrameTime = this.maxFrameTime;
1.911 + var fillStyles = this.fillStyles;
1.912 + context.clearRect(0, 0, this.cw, this.ch);
1.913 + var maxFrameRate = 0;
1.914 + var maxFrameRateCount = 0;
1.915 + var avgFrameRate = 0;
1.916 + var avgFrameRateCount = 0;
1.917 + var offsetW;
1.918 + context.save();
1.919 + context.translate(0, this.ch);
1.920 + context.scale(1, -this.ch / maxFrameTime);
1.921 + for (var i = 0; i < frames.length - 1; i++) {
1.922 + var frame = frames[i];
1.923 + maxFrameRate += frame.endTime - frame.startTime;
1.924 + maxFrameRateCount++;
1.925 + if (frame.total) {
1.926 + avgFrameRate += frame.total;
1.927 + avgFrameRateCount++;
1.928 + }
1.929 + offsetW = i * (w + gap);
1.930 + context.fillStyle = barColor;
1.931 + context.fillRect(offsetW, 0, w, frames[i + 1].startTime - frame.startTime);
1.932 + drawNode(frame, frame.startTime);
1.933 + }
1.934 + function drawNode(node, frameStartTime) {
1.935 + var nodeTime = node.endTime - node.startTime;
1.936 + var offsetH = node.startTime - frameStartTime;
1.937 + context.fillStyle = fillStyles[node.kind];
1.938 + context.fillRect(offsetW, offsetH, w, nodeTime);
1.939 + if (node.children) {
1.940 + var children = node.children;
1.941 + for (var i = 0, n = children.length; i < n; i++) {
1.942 + drawNode(children[i], frameStartTime);
1.943 + }
1.944 + }
1.945 + }
1.946 + var lineH = 1000 / this.frameRate;
1.947 + context.beginPath();
1.948 + context.lineWidth = 0.5;
1.949 + context.moveTo(0, lineH);
1.950 + context.lineTo(this.cw, lineH);
1.951 + context.strokeStyle = fpsLineColor;
1.952 + context.stroke();
1.953 + context.restore();
1.954 + context.fillStyle = backgroundColorInfo;
1.955 + context.fillRect(0, 0, this.cw, 20);
1.956 + var textOffset;
1.957 + var sFrameCount = this.count;
1.958 + var sMaxFrameRate = Math.round(1000 * maxFrameRateCount / maxFrameRate);
1.959 + var sAvgFrameRate = Math.round(1000 * avgFrameRateCount / avgFrameRate);
1.960 + var space = 5;
1.961 + textOffset = 5;
1.962 + context.fillStyle = textColor;
1.963 + context.fillText(sFrameCount, textOffset, 13);
1.964 + textOffset += context.measureText(sFrameCount).width + space;
1.965 + context.fillText(sMaxFrameRate, textOffset, 13);
1.966 + textOffset += context.measureText(sMaxFrameRate).width + space;
1.967 + context.fillText(sAvgFrameRate, textOffset, 13);
1.968 + var basicOffset = textOffset + context.measureText(sAvgFrameRate).width + space;
1.969 + textOffset = this.cw;
1.970 + for (var k in this.kinds) {
1.971 + context.fillStyle = this.fillStyles[this.getKind(k)];
1.972 + textOffset -= context.measureText(k).width + space;
1.973 + if (textOffset > basicOffset) {
1.974 + this.context.fillText(k, textOffset, 13);
1.975 + }
1.976 + }
1.977 + };
1.978 + return timeline;
1.979 + }();
1.980 +var create = Object.create;
1.981 +var defineProperty = Object.defineProperty;
1.982 +var keys = Object.keys;
1.983 +var isArray = Array.isArray;
1.984 +var fromCharCode = String.fromCharCode;
1.985 +var logE = Math.log;
1.986 +var max = Math.max;
1.987 +var min = Math.min;
1.988 +var pow = Math.pow;
1.989 +var push = Array.prototype.push;
1.990 +var slice = Array.prototype.slice;
1.991 +var splice = Array.prototype.splice;
1.992 +function fail(msg, context) {
1.993 + throw new Error((context ? context + ': ' : '') + msg);
1.994 +}
1.995 +function assert(cond, msg, context) {
1.996 + if (!cond)
1.997 + fail(msg, context);
1.998 +}
1.999 +function scriptProperties(namespace, props) {
1.1000 + return props.reduce(function (o, p) {
1.1001 + o[p] = namespace + ' ' + p;
1.1002 + return o;
1.1003 + }, {});
1.1004 +}
1.1005 +function cloneObject(obj) {
1.1006 + var clone = Object.create(null);
1.1007 + for (var prop in obj)
1.1008 + clone[prop] = obj[prop];
1.1009 + return clone;
1.1010 +}
1.1011 +function sortNumeric(a, b) {
1.1012 + return a - b;
1.1013 +}
1.1014 +function sortByZindex(a, b) {
1.1015 + return a._zindex - b._zindex;
1.1016 +}
1.1017 +function rgbaObjToStr(color) {
1.1018 + return 'rgba(' + color.red + ',' + color.green + ',' + color.blue + ',' + color.alpha / 255 + ')';
1.1019 +}
1.1020 +function rgbIntAlphaToStr(color, alpha) {
1.1021 + color |= 0;
1.1022 + if (alpha >= 1) {
1.1023 + var colorStr = color.toString(16);
1.1024 + while (colorStr.length < 6) {
1.1025 + colorStr = '0' + colorStr;
1.1026 + }
1.1027 + return '#' + colorStr;
1.1028 + }
1.1029 + var red = color >> 16 & 255;
1.1030 + var green = color >> 8 & 255;
1.1031 + var blue = color & 255;
1.1032 + return 'rgba(' + red + ',' + green + ',' + blue + ',' + alpha + ')';
1.1033 +}
1.1034 +function argbUintToStr(argb) {
1.1035 + return 'rgba(' + (argb >>> 16 & 255) + ',' + (argb >>> 8 & 255) + ',' + (argb & 255) + ',' + (argb >>> 24 & 255) / 255 + ')';
1.1036 +}
1.1037 +(function functionNameSupport() {
1.1038 + if (eval('function t() {} t.name === \'t\'')) {
1.1039 + return;
1.1040 + }
1.1041 + Object.defineProperty(Function.prototype, 'name', {
1.1042 + get: function () {
1.1043 + if (this.__name) {
1.1044 + return this.__name;
1.1045 + }
1.1046 + var m = /function\s([^\(]+)/.exec(this.toString());
1.1047 + var name = m && m[1] !== 'anonymous' ? m[1] : null;
1.1048 + this.__name = name;
1.1049 + return name;
1.1050 + },
1.1051 + configurable: true,
1.1052 + enumerable: false
1.1053 + });
1.1054 +}());
1.1055 +var randomStyleCache;
1.1056 +var nextStyle = 0;
1.1057 +function randomStyle() {
1.1058 + if (!randomStyleCache) {
1.1059 + randomStyleCache = [
1.1060 + '#ff5e3a',
1.1061 + '#ff9500',
1.1062 + '#ffdb4c',
1.1063 + '#87fc70',
1.1064 + '#52edc7',
1.1065 + '#1ad6fd',
1.1066 + '#c644fc',
1.1067 + '#ef4db6',
1.1068 + '#4a4a4a',
1.1069 + '#dbddde',
1.1070 + '#ff3b30',
1.1071 + '#ff9500',
1.1072 + '#ffcc00',
1.1073 + '#4cd964',
1.1074 + '#34aadc',
1.1075 + '#007aff',
1.1076 + '#5856d6',
1.1077 + '#ff2d55',
1.1078 + '#8e8e93',
1.1079 + '#c7c7cc',
1.1080 + '#5ad427',
1.1081 + '#c86edf',
1.1082 + '#d1eefc',
1.1083 + '#e0f8d8',
1.1084 + '#fb2b69',
1.1085 + '#f7f7f7',
1.1086 + '#1d77ef',
1.1087 + '#d6cec3',
1.1088 + '#55efcb',
1.1089 + '#ff4981',
1.1090 + '#ffd3e0',
1.1091 + '#f7f7f7',
1.1092 + '#ff1300',
1.1093 + '#1f1f21',
1.1094 + '#bdbec2',
1.1095 + '#ff3a2d'
1.1096 + ];
1.1097 + }
1.1098 + return randomStyleCache[nextStyle++ % randomStyleCache.length];
1.1099 +}
1.1100 +(function PromiseClosure() {
1.1101 + var global = Function('return this')();
1.1102 + if (global.Promise) {
1.1103 + if (typeof global.Promise.all !== 'function') {
1.1104 + global.Promise.all = function (iterable) {
1.1105 + var count = 0, results = [], resolve, reject;
1.1106 + var promise = new global.Promise(function (resolve_, reject_) {
1.1107 + resolve = resolve_;
1.1108 + reject = reject_;
1.1109 + });
1.1110 + iterable.forEach(function (p, i) {
1.1111 + count++;
1.1112 + p.then(function (result) {
1.1113 + results[i] = result;
1.1114 + count--;
1.1115 + if (count === 0) {
1.1116 + resolve(results);
1.1117 + }
1.1118 + }, reject);
1.1119 + });
1.1120 + if (count === 0) {
1.1121 + resolve(results);
1.1122 + }
1.1123 + return promise;
1.1124 + };
1.1125 + }
1.1126 + if (typeof global.Promise.resolve !== 'function') {
1.1127 + global.Promise.resolve = function (x) {
1.1128 + return new global.Promise(function (resolve) {
1.1129 + resolve(x);
1.1130 + });
1.1131 + };
1.1132 + }
1.1133 + return;
1.1134 + }
1.1135 + function getDeferred(C) {
1.1136 + if (typeof C !== 'function') {
1.1137 + throw new TypeError('Invalid deferred constructor');
1.1138 + }
1.1139 + var resolver = createDeferredConstructionFunctions();
1.1140 + var promise = new C(resolver);
1.1141 + var resolve = resolver.resolve;
1.1142 + if (typeof resolve !== 'function') {
1.1143 + throw new TypeError('Invalid resolve construction function');
1.1144 + }
1.1145 + var reject = resolver.reject;
1.1146 + if (typeof reject !== 'function') {
1.1147 + throw new TypeError('Invalid reject construction function');
1.1148 + }
1.1149 + return {
1.1150 + promise: promise,
1.1151 + resolve: resolve,
1.1152 + reject: reject
1.1153 + };
1.1154 + }
1.1155 + function updateDeferredFromPotentialThenable(x, deferred) {
1.1156 + if (typeof x !== 'object' || x === null) {
1.1157 + return false;
1.1158 + }
1.1159 + try {
1.1160 + var then = x.then;
1.1161 + if (typeof then !== 'function') {
1.1162 + return false;
1.1163 + }
1.1164 + var thenCallResult = then.call(x, deferred.resolve, deferred.reject);
1.1165 + } catch (e) {
1.1166 + var reject = deferred.reject;
1.1167 + reject(e);
1.1168 + }
1.1169 + return true;
1.1170 + }
1.1171 + function isPromise(x) {
1.1172 + return typeof x === 'object' && x !== null && typeof x.promiseStatus !== 'undefined';
1.1173 + }
1.1174 + function rejectPromise(promise, reason) {
1.1175 + if (promise.promiseStatus !== 'unresolved') {
1.1176 + return;
1.1177 + }
1.1178 + var reactions = promise.rejectReactions;
1.1179 + promise.result = reason;
1.1180 + promise.resolveReactions = undefined;
1.1181 + promise.rejectReactions = undefined;
1.1182 + promise.promiseStatus = 'has-rejection';
1.1183 + triggerPromiseReactions(reactions, reason);
1.1184 + }
1.1185 + function resolvePromise(promise, resolution) {
1.1186 + if (promise.promiseStatus !== 'unresolved') {
1.1187 + return;
1.1188 + }
1.1189 + var reactions = promise.resolveReactions;
1.1190 + promise.result = resolution;
1.1191 + promise.resolveReactions = undefined;
1.1192 + promise.rejectReactions = undefined;
1.1193 + promise.promiseStatus = 'has-resolution';
1.1194 + triggerPromiseReactions(reactions, resolution);
1.1195 + }
1.1196 + function triggerPromiseReactions(reactions, argument) {
1.1197 + for (var i = 0; i < reactions.length; i++) {
1.1198 + queueMicrotask({
1.1199 + reaction: reactions[i],
1.1200 + argument: argument
1.1201 + });
1.1202 + }
1.1203 + }
1.1204 + function queueMicrotask(task) {
1.1205 + if (microtasksQueue.length === 0) {
1.1206 + setTimeout(handleMicrotasksQueue, 0);
1.1207 + }
1.1208 + microtasksQueue.push(task);
1.1209 + }
1.1210 + function executePromiseReaction(reaction, argument) {
1.1211 + var deferred = reaction.deferred;
1.1212 + var handler = reaction.handler;
1.1213 + var handlerResult, updateResult;
1.1214 + try {
1.1215 + handlerResult = handler(argument);
1.1216 + } catch (e) {
1.1217 + var reject = deferred.reject;
1.1218 + return reject(e);
1.1219 + }
1.1220 + if (handlerResult === deferred.promise) {
1.1221 + var reject = deferred.reject;
1.1222 + return reject(new TypeError('Self resolution'));
1.1223 + }
1.1224 + try {
1.1225 + updateResult = updateDeferredFromPotentialThenable(handlerResult, deferred);
1.1226 + if (!updateResult) {
1.1227 + var resolve = deferred.resolve;
1.1228 + return resolve(handlerResult);
1.1229 + }
1.1230 + } catch (e) {
1.1231 + var reject = deferred.reject;
1.1232 + return reject(e);
1.1233 + }
1.1234 + }
1.1235 + var microtasksQueue = [];
1.1236 + function handleMicrotasksQueue() {
1.1237 + while (microtasksQueue.length > 0) {
1.1238 + var task = microtasksQueue[0];
1.1239 + try {
1.1240 + executePromiseReaction(task.reaction, task.argument);
1.1241 + } catch (e) {
1.1242 + if (typeof Promise.onerror === 'function') {
1.1243 + Promise.onerror(e);
1.1244 + }
1.1245 + }
1.1246 + microtasksQueue.shift();
1.1247 + }
1.1248 + }
1.1249 + function throwerFunction(e) {
1.1250 + throw e;
1.1251 + }
1.1252 + function identityFunction(x) {
1.1253 + return x;
1.1254 + }
1.1255 + function createRejectPromiseFunction(promise) {
1.1256 + return function (reason) {
1.1257 + rejectPromise(promise, reason);
1.1258 + };
1.1259 + }
1.1260 + function createResolvePromiseFunction(promise) {
1.1261 + return function (resolution) {
1.1262 + resolvePromise(promise, resolution);
1.1263 + };
1.1264 + }
1.1265 + function createDeferredConstructionFunctions() {
1.1266 + var fn = function (resolve, reject) {
1.1267 + fn.resolve = resolve;
1.1268 + fn.reject = reject;
1.1269 + };
1.1270 + return fn;
1.1271 + }
1.1272 + function createPromiseResolutionHandlerFunctions(promise, fulfillmentHandler, rejectionHandler) {
1.1273 + return function (x) {
1.1274 + if (x === promise) {
1.1275 + return rejectionHandler(new TypeError('Self resolution'));
1.1276 + }
1.1277 + var cstr = promise.promiseConstructor;
1.1278 + if (isPromise(x)) {
1.1279 + var xConstructor = x.promiseConstructor;
1.1280 + if (xConstructor === cstr) {
1.1281 + return x.then(fulfillmentHandler, rejectionHandler);
1.1282 + }
1.1283 + }
1.1284 + var deferred = getDeferred(cstr);
1.1285 + var updateResult = updateDeferredFromPotentialThenable(x, deferred);
1.1286 + if (updateResult) {
1.1287 + var deferredPromise = deferred.promise;
1.1288 + return deferredPromise.then(fulfillmentHandler, rejectionHandler);
1.1289 + }
1.1290 + return fulfillmentHandler(x);
1.1291 + };
1.1292 + }
1.1293 + function createPromiseAllCountdownFunction(index, values, deferred, countdownHolder) {
1.1294 + return function (x) {
1.1295 + values[index] = x;
1.1296 + countdownHolder.countdown--;
1.1297 + if (countdownHolder.countdown === 0) {
1.1298 + deferred.resolve(values);
1.1299 + }
1.1300 + };
1.1301 + }
1.1302 + function Promise(resolver) {
1.1303 + if (typeof resolver !== 'function') {
1.1304 + throw new TypeError('resolver is not a function');
1.1305 + }
1.1306 + var promise = this;
1.1307 + if (typeof promise !== 'object') {
1.1308 + throw new TypeError('Promise to initialize is not an object');
1.1309 + }
1.1310 + promise.promiseStatus = 'unresolved';
1.1311 + promise.resolveReactions = [];
1.1312 + promise.rejectReactions = [];
1.1313 + promise.result = undefined;
1.1314 + var resolve = createResolvePromiseFunction(promise);
1.1315 + var reject = createRejectPromiseFunction(promise);
1.1316 + try {
1.1317 + var result = resolver(resolve, reject);
1.1318 + } catch (e) {
1.1319 + rejectPromise(promise, e);
1.1320 + }
1.1321 + promise.promiseConstructor = Promise;
1.1322 + return promise;
1.1323 + }
1.1324 + Promise.all = function (iterable) {
1.1325 + var deferred = getDeferred(this);
1.1326 + var values = [];
1.1327 + var countdownHolder = {
1.1328 + countdown: 0
1.1329 + };
1.1330 + var index = 0;
1.1331 + iterable.forEach(function (nextValue) {
1.1332 + var nextPromise = this.cast(nextValue);
1.1333 + var fn = createPromiseAllCountdownFunction(index, values, deferred, countdownHolder);
1.1334 + nextPromise.then(fn, deferred.reject);
1.1335 + index++;
1.1336 + countdownHolder.countdown++;
1.1337 + }, this);
1.1338 + if (index === 0) {
1.1339 + deferred.resolve(values);
1.1340 + }
1.1341 + return deferred.promise;
1.1342 + };
1.1343 + Promise.cast = function (x) {
1.1344 + if (isPromise(x)) {
1.1345 + return x;
1.1346 + }
1.1347 + var deferred = getDeferred(this);
1.1348 + deferred.resolve(x);
1.1349 + return deferred.promise;
1.1350 + };
1.1351 + Promise.reject = function (r) {
1.1352 + var deferred = getDeferred(this);
1.1353 + var rejectResult = deferred.reject(r);
1.1354 + return deferred.promise;
1.1355 + };
1.1356 + Promise.resolve = function (x) {
1.1357 + var deferred = getDeferred(this);
1.1358 + var rejectResult = deferred.resolve(x);
1.1359 + return deferred.promise;
1.1360 + };
1.1361 + Promise.prototype = {
1.1362 + 'catch': function (onRejected) {
1.1363 + this.then(undefined, onRejected);
1.1364 + },
1.1365 + then: function (onFulfilled, onRejected) {
1.1366 + var promise = this;
1.1367 + if (!isPromise(promise)) {
1.1368 + throw new TypeError('this is not a Promises');
1.1369 + }
1.1370 + var cstr = promise.promiseConstructor;
1.1371 + var deferred = getDeferred(cstr);
1.1372 + var rejectionHandler = typeof onRejected === 'function' ? onRejected : throwerFunction;
1.1373 + var fulfillmentHandler = typeof onFulfilled === 'function' ? onFulfilled : identityFunction;
1.1374 + var resolutionHandler = createPromiseResolutionHandlerFunctions(promise, fulfillmentHandler, rejectionHandler);
1.1375 + var resolveReaction = {
1.1376 + deferred: deferred,
1.1377 + handler: resolutionHandler
1.1378 + };
1.1379 + var rejectReaction = {
1.1380 + deferred: deferred,
1.1381 + handler: rejectionHandler
1.1382 + };
1.1383 + switch (promise.promiseStatus) {
1.1384 + case 'unresolved':
1.1385 + promise.resolveReactions.push(resolveReaction);
1.1386 + promise.rejectReactions.push(rejectReaction);
1.1387 + break;
1.1388 + case 'has-resolution':
1.1389 + var resolution = promise.result;
1.1390 + queueMicrotask({
1.1391 + reaction: resolveReaction,
1.1392 + argument: resolution
1.1393 + });
1.1394 + break;
1.1395 + case 'has-rejection':
1.1396 + var rejection = promise.result;
1.1397 + queueMicrotask({
1.1398 + reaction: rejectReaction,
1.1399 + argument: rejection
1.1400 + });
1.1401 + break;
1.1402 + }
1.1403 + return deferred.promise;
1.1404 + }
1.1405 + };
1.1406 + global.Promise = Promise;
1.1407 +}());
1.1408 +var QuadTree = function (x, y, width, height, parent) {
1.1409 + this.x = x | 0;
1.1410 + this.y = y | 0;
1.1411 + this.width = width | 0;
1.1412 + this.height = height | 0;
1.1413 + if (parent) {
1.1414 + this.root = parent.root;
1.1415 + this.parent = parent;
1.1416 + this.level = parent.level + 1;
1.1417 + } else {
1.1418 + this.root = this;
1.1419 + this.parent = null;
1.1420 + this.level = 0;
1.1421 + }
1.1422 + this.reset();
1.1423 +};
1.1424 +QuadTree.prototype.reset = function () {
1.1425 + this.stuckObjects = null;
1.1426 + this.objects = null;
1.1427 + this.nodes = [];
1.1428 +};
1.1429 +QuadTree.prototype._findIndex = function (xMin, xMax, yMin, yMax) {
1.1430 + var midX = this.x + (this.width / 2 | 0);
1.1431 + var midY = this.y + (this.height / 2 | 0);
1.1432 + var top = yMin < midY && yMax < midY;
1.1433 + var bottom = yMin > midY;
1.1434 + if (xMin < midX && xMax < midX) {
1.1435 + if (top) {
1.1436 + return 1;
1.1437 + } else if (bottom) {
1.1438 + return 2;
1.1439 + }
1.1440 + } else if (xMin > midX) {
1.1441 + if (top) {
1.1442 + return 0;
1.1443 + } else if (bottom) {
1.1444 + return 3;
1.1445 + }
1.1446 + }
1.1447 + return -1;
1.1448 +};
1.1449 +QuadTree.prototype.insert = function (obj) {
1.1450 + var nodes = this.nodes;
1.1451 + if (nodes.length) {
1.1452 + var index = this._findIndex(obj.xMin, obj.xMax, obj.yMin, obj.yMax);
1.1453 + if (index > -1) {
1.1454 + nodes[index].insert(obj);
1.1455 + } else {
1.1456 + obj.prev = null;
1.1457 + if (this.stuckObjects) {
1.1458 + obj.next = this.stuckObjects;
1.1459 + this.stuckObjects.prev = obj;
1.1460 + } else {
1.1461 + obj.next = null;
1.1462 + }
1.1463 + this.stuckObjects = obj;
1.1464 + obj.parent = this;
1.1465 + }
1.1466 + return;
1.1467 + }
1.1468 + var numChildren = 1;
1.1469 + var item = this.objects;
1.1470 + if (!item) {
1.1471 + obj.prev = null;
1.1472 + obj.next = null;
1.1473 + this.objects = obj;
1.1474 + } else {
1.1475 + while (item.next) {
1.1476 + numChildren++;
1.1477 + item = item.next;
1.1478 + }
1.1479 + obj.prev = item;
1.1480 + obj.next = null;
1.1481 + item.next = obj;
1.1482 + }
1.1483 + if (numChildren > 4 && this.level < 10) {
1.1484 + this._subdivide();
1.1485 + item = this.objects;
1.1486 + while (item) {
1.1487 + var next = item.next;
1.1488 + this.insert(item);
1.1489 + item = next;
1.1490 + }
1.1491 + this.objects = null;
1.1492 + return;
1.1493 + }
1.1494 + obj.parent = this;
1.1495 +};
1.1496 +QuadTree.prototype.update = function (obj) {
1.1497 + var node = obj.parent;
1.1498 + if (node) {
1.1499 + if (obj.xMin >= node.x && obj.xMax <= node.x + node.width && obj.yMin >= node.y && obj.yMax <= node.y + node.height) {
1.1500 + if (node.nodes.length) {
1.1501 + var index = this._findIndex(obj.xMin, obj.xMax, obj.yMin, obj.yMax);
1.1502 + if (index > -1) {
1.1503 + node.remove(obj);
1.1504 + node = this.nodes[index];
1.1505 + node.insert(obj);
1.1506 + }
1.1507 + } else {
1.1508 + node.remove(obj);
1.1509 + node.insert(obj);
1.1510 + }
1.1511 + return;
1.1512 + }
1.1513 + node.remove(obj);
1.1514 + }
1.1515 + this.root.insert(obj);
1.1516 +};
1.1517 +QuadTree.prototype.remove = function (obj) {
1.1518 + var prev = obj.prev;
1.1519 + var next = obj.next;
1.1520 + if (prev) {
1.1521 + prev.next = next;
1.1522 + obj.prev = null;
1.1523 + } else {
1.1524 + var node = obj.parent;
1.1525 + if (node.objects === obj) {
1.1526 + node.objects = next;
1.1527 + } else if (node.stuckObjects === obj) {
1.1528 + node.stuckObjects = next;
1.1529 + }
1.1530 + }
1.1531 + if (next) {
1.1532 + next.prev = prev;
1.1533 + obj.next = null;
1.1534 + }
1.1535 + obj.parent = null;
1.1536 +};
1.1537 +QuadTree.prototype.retrieve = function (xMin, xMax, yMin, yMax) {
1.1538 + var stack = [];
1.1539 + var out = [];
1.1540 + var node = this;
1.1541 + do {
1.1542 + if (node.nodes.length) {
1.1543 + var index = node._findIndex(xMin, xMax, yMin, yMax);
1.1544 + if (index > -1) {
1.1545 + stack.push(node.nodes[index]);
1.1546 + } else {
1.1547 + stack.push.apply(stack, node.nodes);
1.1548 + }
1.1549 + }
1.1550 + var item = node.objects;
1.1551 + for (var i = 0; i < 2; i++) {
1.1552 + while (item) {
1.1553 + if (!(item.xMin > xMax || item.xMax < xMin || item.yMin > yMax || item.yMax < yMin)) {
1.1554 + out.push(item);
1.1555 + }
1.1556 + item = item.next;
1.1557 + }
1.1558 + item = node.stuckObjects;
1.1559 + }
1.1560 + node = stack.pop();
1.1561 + } while (node);
1.1562 + return out;
1.1563 +};
1.1564 +QuadTree.prototype._subdivide = function () {
1.1565 + var halfWidth = this.width / 2 | 0;
1.1566 + var halfHeight = this.height / 2 | 0;
1.1567 + var midX = this.x + halfWidth;
1.1568 + var midY = this.y + halfHeight;
1.1569 + this.nodes[0] = new QuadTree(midX, this.y, halfWidth, halfHeight, this);
1.1570 + this.nodes[1] = new QuadTree(this.x, this.y, halfWidth, halfHeight, this);
1.1571 + this.nodes[2] = new QuadTree(this.x, midY, halfWidth, halfHeight, this);
1.1572 + this.nodes[3] = new QuadTree(midX, midY, halfWidth, halfHeight, this);
1.1573 +};
1.1574 +var RegionCluster = function () {
1.1575 + this.regions = [];
1.1576 +};
1.1577 +RegionCluster.prototype.reset = function () {
1.1578 + this.regions.length = 0;
1.1579 +};
1.1580 +RegionCluster.prototype.insert = function (region) {
1.1581 + var regions = this.regions;
1.1582 + if (regions.length < 3) {
1.1583 + regions.push({
1.1584 + xMin: region.xMin,
1.1585 + xMax: region.xMax,
1.1586 + yMin: region.yMin,
1.1587 + yMax: region.yMax
1.1588 + });
1.1589 + return;
1.1590 + }
1.1591 + var a = region;
1.1592 + var b = regions[0];
1.1593 + var c = regions[1];
1.1594 + var d = regions[2];
1.1595 + var ab = (max(a.xMax, b.xMax) - min(a.xMin, b.xMin)) * (max(a.yMax, b.yMax) - min(a.yMin, b.yMin));
1.1596 + var rb = regions[0];
1.1597 + var ac = (max(a.xMax, c.xMax) - min(a.xMin, c.xMin)) * (max(a.yMax, c.yMax) - min(a.yMin, c.yMin));
1.1598 + var ad = (max(a.xMax, d.xMax) - min(a.xMin, d.xMin)) * (max(a.yMax, d.yMax) - min(a.yMin, d.yMin));
1.1599 + if (ac < ab) {
1.1600 + ab = ac;
1.1601 + rb = c;
1.1602 + }
1.1603 + if (ad < ab) {
1.1604 + ab = ad;
1.1605 + rb = d;
1.1606 + }
1.1607 + var bc = (max(b.xMax, c.xMax) - min(b.xMin, c.xMin)) * (max(b.yMax, c.yMax) - min(b.yMin, c.yMin));
1.1608 + var bd = (max(b.xMax, d.xMax) - min(b.xMin, d.xMin)) * (max(b.yMax, d.yMax) - min(b.yMin, d.yMin));
1.1609 + var cd = (max(c.xMax, d.xMax) - min(c.xMin, d.xMin)) * (max(c.yMax, d.yMax) - min(c.yMin, d.yMin));
1.1610 + if (ab < bc && ab < bd && ab < cd) {
1.1611 + if (a.xMin < rb.xMin) {
1.1612 + rb.xMin = a.xMin;
1.1613 + }
1.1614 + if (a.xMax > rb.xMax) {
1.1615 + rb.xMax = a.xMax;
1.1616 + }
1.1617 + if (a.yMin < rb.yMin) {
1.1618 + rb.yMin = a.yMin;
1.1619 + }
1.1620 + if (a.yMax > rb.yMax) {
1.1621 + rb.yMax = a.yMax;
1.1622 + }
1.1623 + return;
1.1624 + }
1.1625 + rb = regions[0];
1.1626 + var rc = regions[1];
1.1627 + if (bd < bc) {
1.1628 + bc = bd;
1.1629 + rc = regions[2];
1.1630 + }
1.1631 + if (cd < bc) {
1.1632 + rb = regions[1];
1.1633 + rc = regions[2];
1.1634 + }
1.1635 + if (rc.xMin < rb.xMin) {
1.1636 + rb.xMin = rc.xMin;
1.1637 + }
1.1638 + if (rc.xMax > rb.xMax) {
1.1639 + rb.xMax = rc.xMax;
1.1640 + }
1.1641 + if (rc.yMin < rb.yMin) {
1.1642 + rb.yMin = rc.yMin;
1.1643 + }
1.1644 + if (rc.yMax > rb.yMax) {
1.1645 + rb.yMax = rc.yMax;
1.1646 + }
1.1647 + rc.xMin = a.xMin;
1.1648 + rc.xMax = a.xMax;
1.1649 + rc.yMin = a.yMin;
1.1650 + rc.yMax = a.yMax;
1.1651 +};
1.1652 +RegionCluster.prototype.retrieve = function () {
1.1653 + return this.regions;
1.1654 +};
1.1655 +var EXTERNAL_INTERFACE_FEATURE = 1;
1.1656 +var CLIPBOARD_FEATURE = 2;
1.1657 +var SHAREDOBJECT_FEATURE = 3;
1.1658 +var VIDEO_FEATURE = 4;
1.1659 +var SOUND_FEATURE = 5;
1.1660 +var NETCONNECTION_FEATURE = 6;
1.1661 +if (!this.performance) {
1.1662 + this.performance = {};
1.1663 +}
1.1664 +if (!this.performance.now) {
1.1665 + this.performance.now = Date.now;
1.1666 +}
1.1667 +var SWF_TAG_CODE_CSM_TEXT_SETTINGS = 74;
1.1668 +var SWF_TAG_CODE_DEFINE_BINARY_DATA = 87;
1.1669 +var SWF_TAG_CODE_DEFINE_BITS = 6;
1.1670 +var SWF_TAG_CODE_DEFINE_BITS_JPEG2 = 21;
1.1671 +var SWF_TAG_CODE_DEFINE_BITS_JPEG3 = 35;
1.1672 +var SWF_TAG_CODE_DEFINE_BITS_JPEG4 = 90;
1.1673 +var SWF_TAG_CODE_DEFINE_BITS_LOSSLESS = 20;
1.1674 +var SWF_TAG_CODE_DEFINE_BITS_LOSSLESS2 = 36;
1.1675 +var SWF_TAG_CODE_DEFINE_BUTTON = 7;
1.1676 +var SWF_TAG_CODE_DEFINE_BUTTON2 = 34;
1.1677 +var SWF_TAG_CODE_DEFINE_BUTTON_CXFORM = 23;
1.1678 +var SWF_TAG_CODE_DEFINE_BUTTON_SOUND = 17;
1.1679 +var SWF_TAG_CODE_DEFINE_EDIT_TEXT = 37;
1.1680 +var SWF_TAG_CODE_DEFINE_FONT = 10;
1.1681 +var SWF_TAG_CODE_DEFINE_FONT2 = 48;
1.1682 +var SWF_TAG_CODE_DEFINE_FONT3 = 75;
1.1683 +var SWF_TAG_CODE_DEFINE_FONT4 = 91;
1.1684 +var SWF_TAG_CODE_DEFINE_FONT_ALIGN_ZONES = 73;
1.1685 +var SWF_TAG_CODE_DEFINE_FONT_INFO = 13;
1.1686 +var SWF_TAG_CODE_DEFINE_FONT_INFO2 = 62;
1.1687 +var SWF_TAG_CODE_DEFINE_FONT_NAME = 88;
1.1688 +var SWF_TAG_CODE_DEFINE_MORPH_SHAPE = 46;
1.1689 +var SWF_TAG_CODE_DEFINE_MORPH_SHAPE2 = 84;
1.1690 +var SWF_TAG_CODE_DEFINE_SCALING_GRID = 78;
1.1691 +var SWF_TAG_CODE_DEFINE_SCENE_AND_FRAME_LABEL_DATA = 86;
1.1692 +var SWF_TAG_CODE_DEFINE_SHAPE = 2;
1.1693 +var SWF_TAG_CODE_DEFINE_SHAPE2 = 22;
1.1694 +var SWF_TAG_CODE_DEFINE_SHAPE3 = 32;
1.1695 +var SWF_TAG_CODE_DEFINE_SHAPE4 = 83;
1.1696 +var SWF_TAG_CODE_DEFINE_SOUND = 14;
1.1697 +var SWF_TAG_CODE_DEFINE_SPRITE = 39;
1.1698 +var SWF_TAG_CODE_DEFINE_TEXT = 11;
1.1699 +var SWF_TAG_CODE_DEFINE_TEXT2 = 33;
1.1700 +var SWF_TAG_CODE_DEFINE_VIDEO_STREAM = 60;
1.1701 +var SWF_TAG_CODE_DO_ABC = 82;
1.1702 +var SWF_TAG_CODE_DO_ABC_ = 72;
1.1703 +var SWF_TAG_CODE_DO_ACTION = 12;
1.1704 +var SWF_TAG_CODE_DO_INIT_ACTION = 59;
1.1705 +var SWF_TAG_CODE_ENABLE_DEBUGGER = 58;
1.1706 +var SWF_TAG_CODE_ENABLE_DEBUGGER2 = 64;
1.1707 +var SWF_TAG_CODE_END = 0;
1.1708 +var SWF_TAG_CODE_EXPORT_ASSETS = 56;
1.1709 +var SWF_TAG_CODE_FILE_ATTRIBUTES = 69;
1.1710 +var SWF_TAG_CODE_FRAME_LABEL = 43;
1.1711 +var SWF_TAG_CODE_IMPORT_ASSETS = 57;
1.1712 +var SWF_TAG_CODE_IMPORT_ASSETS2 = 71;
1.1713 +var SWF_TAG_CODE_JPEG_TABLES = 8;
1.1714 +var SWF_TAG_CODE_METADATA = 77;
1.1715 +var SWF_TAG_CODE_PLACE_OBJECT = 4;
1.1716 +var SWF_TAG_CODE_PLACE_OBJECT2 = 26;
1.1717 +var SWF_TAG_CODE_PLACE_OBJECT3 = 70;
1.1718 +var SWF_TAG_CODE_PROTECT = 24;
1.1719 +var SWF_TAG_CODE_REMOVE_OBJECT = 5;
1.1720 +var SWF_TAG_CODE_REMOVE_OBJECT2 = 28;
1.1721 +var SWF_TAG_CODE_SCRIPT_LIMITS = 65;
1.1722 +var SWF_TAG_CODE_SET_BACKGROUND_COLOR = 9;
1.1723 +var SWF_TAG_CODE_SET_TAB_INDEX = 66;
1.1724 +var SWF_TAG_CODE_SHOW_FRAME = 1;
1.1725 +var SWF_TAG_CODE_SOUND_STREAM_BLOCK = 19;
1.1726 +var SWF_TAG_CODE_SOUND_STREAM_HEAD = 18;
1.1727 +var SWF_TAG_CODE_SOUND_STREAM_HEAD2 = 45;
1.1728 +var SWF_TAG_CODE_START_SOUND = 15;
1.1729 +var SWF_TAG_CODE_START_SOUND2 = 89;
1.1730 +var SWF_TAG_CODE_SYMBOL_CLASS = 76;
1.1731 +var SWF_TAG_CODE_VIDEO_FRAME = 61;
1.1732 +self.SWF = {};
1.1733 +var codeLengthOrder = [
1.1734 + 16,
1.1735 + 17,
1.1736 + 18,
1.1737 + 0,
1.1738 + 8,
1.1739 + 7,
1.1740 + 9,
1.1741 + 6,
1.1742 + 10,
1.1743 + 5,
1.1744 + 11,
1.1745 + 4,
1.1746 + 12,
1.1747 + 3,
1.1748 + 13,
1.1749 + 2,
1.1750 + 14,
1.1751 + 1,
1.1752 + 15
1.1753 + ];
1.1754 +var distanceCodes = [];
1.1755 +var distanceExtraBits = [];
1.1756 +for (var i = 0, j = 0, code = 1; i < 30; ++i) {
1.1757 + distanceCodes[i] = code;
1.1758 + code += 1 << (distanceExtraBits[i] = ~(~((j += i > 2 ? 1 : 0) / 2)));
1.1759 +}
1.1760 +var bitLengths = [];
1.1761 +for (var i = 0; i < 32; ++i)
1.1762 + bitLengths[i] = 5;
1.1763 +var fixedDistanceTable = makeHuffmanTable(bitLengths);
1.1764 +var lengthCodes = [];
1.1765 +var lengthExtraBits = [];
1.1766 +for (var i = 0, j = 0, code = 3; i < 29; ++i) {
1.1767 + lengthCodes[i] = code - (i == 28 ? 1 : 0);
1.1768 + code += 1 << (lengthExtraBits[i] = ~(~((j += i > 4 ? 1 : 0) / 4 % 6)));
1.1769 +}
1.1770 +for (var i = 0; i < 288; ++i)
1.1771 + bitLengths[i] = i < 144 || i > 279 ? 8 : i < 256 ? 9 : 7;
1.1772 +var fixedLiteralTable = makeHuffmanTable(bitLengths);
1.1773 +function makeHuffmanTable(bitLengths) {
1.1774 + var maxBits = Math.max.apply(null, bitLengths);
1.1775 + var numLengths = bitLengths.length;
1.1776 + var size = 1 << maxBits;
1.1777 + var codes = new Uint32Array(size);
1.1778 + for (var code = 0, len = 1, skip = 2; len <= maxBits; code <<= 1, ++len, skip <<= 1) {
1.1779 + for (var val = 0; val < numLengths; ++val) {
1.1780 + if (bitLengths[val] === len) {
1.1781 + var lsb = 0;
1.1782 + for (var i = 0; i < len; ++i)
1.1783 + lsb = lsb * 2 + (code >> i & 1);
1.1784 + for (var i = lsb; i < size; i += skip)
1.1785 + codes[i] = len << 16 | val;
1.1786 + ++code;
1.1787 + }
1.1788 + }
1.1789 + }
1.1790 + return {
1.1791 + codes: codes,
1.1792 + maxBits: maxBits
1.1793 + };
1.1794 +}
1.1795 +function verifyDeflateHeader(bytes) {
1.1796 + var header = bytes[0] << 8 | bytes[1];
1.1797 +}
1.1798 +function createInflatedStream(bytes, outputLength) {
1.1799 + verifyDeflateHeader(bytes);
1.1800 + var stream = new Stream(bytes, 2);
1.1801 + var output = {
1.1802 + data: new Uint8Array(outputLength),
1.1803 + available: 0,
1.1804 + completed: false
1.1805 + };
1.1806 + var state = {
1.1807 + header: null,
1.1808 + distanceTable: null,
1.1809 + literalTable: null,
1.1810 + sym: null,
1.1811 + len: null,
1.1812 + sym2: null
1.1813 + };
1.1814 + do {
1.1815 + inflateBlock(stream, output, state);
1.1816 + } while (!output.completed && stream.pos < stream.end);
1.1817 + return new Stream(output.data, 0, output.available);
1.1818 +}
1.1819 +var InflateNoDataError = {};
1.1820 +function inflateBlock(stream, output, state) {
1.1821 + var header = state.header !== null ? state.header : state.header = readBits(stream.bytes, stream, 3);
1.1822 + switch (header >> 1) {
1.1823 + case 0:
1.1824 + stream.align();
1.1825 + var pos = stream.pos;
1.1826 + if (stream.end - pos < 4) {
1.1827 + throw InflateNoDataError;
1.1828 + }
1.1829 + var len = stream.getUint16(pos, true);
1.1830 + var nlen = stream.getUint16(pos + 2, true);
1.1831 + if (stream.end - pos < 4 + len) {
1.1832 + throw InflateNoDataError;
1.1833 + }
1.1834 + var begin = pos + 4;
1.1835 + var end = stream.pos = begin + len;
1.1836 + var sbytes = stream.bytes, dbytes = output.data;
1.1837 + dbytes.set(sbytes.subarray(begin, end), output.available);
1.1838 + output.available += len;
1.1839 + break;
1.1840 + case 1:
1.1841 + inflate(stream, output, fixedLiteralTable, fixedDistanceTable, state);
1.1842 + break;
1.1843 + case 2:
1.1844 + var distanceTable, literalTable;
1.1845 + if (state.distanceTable !== null) {
1.1846 + distanceTable = state.distanceTable;
1.1847 + literalTable = state.literalTable;
1.1848 + } else {
1.1849 + var sbytes = stream.bytes;
1.1850 + var savedBufferPos = stream.pos;
1.1851 + var savedBitBuffer = stream.bitBuffer;
1.1852 + var savedBitLength = stream.bitLength;
1.1853 + var bitLengths = [];
1.1854 + var numLiteralCodes, numDistanceCodes;
1.1855 + try {
1.1856 + numLiteralCodes = readBits(sbytes, stream, 5) + 257;
1.1857 + numDistanceCodes = readBits(sbytes, stream, 5) + 1;
1.1858 + var numCodes = numLiteralCodes + numDistanceCodes;
1.1859 + var numLengthCodes = readBits(sbytes, stream, 4) + 4;
1.1860 + for (var i = 0; i < 19; ++i)
1.1861 + bitLengths[codeLengthOrder[i]] = i < numLengthCodes ? readBits(sbytes, stream, 3) : 0;
1.1862 + var codeLengthTable = makeHuffmanTable(bitLengths);
1.1863 + bitLengths = [];
1.1864 + var i = 0;
1.1865 + var prev = 0;
1.1866 + while (i < numCodes) {
1.1867 + var j = 1;
1.1868 + var sym = readCode(sbytes, stream, codeLengthTable);
1.1869 + switch (sym) {
1.1870 + case 16:
1.1871 + j = readBits(sbytes, stream, 2) + 3;
1.1872 + sym = prev;
1.1873 + break;
1.1874 + case 17:
1.1875 + j = readBits(sbytes, stream, 3) + 3;
1.1876 + sym = 0;
1.1877 + break;
1.1878 + case 18:
1.1879 + j = readBits(sbytes, stream, 7) + 11;
1.1880 + sym = 0;
1.1881 + break;
1.1882 + default:
1.1883 + prev = sym;
1.1884 + }
1.1885 + while (j--)
1.1886 + bitLengths[i++] = sym;
1.1887 + }
1.1888 + } catch (e) {
1.1889 + stream.pos = savedBufferPos;
1.1890 + stream.bitBuffer = savedBitBuffer;
1.1891 + stream.bitLength = savedBitLength;
1.1892 + throw e;
1.1893 + }
1.1894 + distanceTable = state.distanceTable = makeHuffmanTable(bitLengths.splice(numLiteralCodes, numDistanceCodes));
1.1895 + literalTable = state.literalTable = makeHuffmanTable(bitLengths);
1.1896 + }
1.1897 + inflate(stream, output, literalTable, distanceTable, state);
1.1898 + state.distanceTable = null;
1.1899 + state.literalTable = null;
1.1900 + break;
1.1901 + default:
1.1902 + fail('unknown block type', 'inflate');
1.1903 + }
1.1904 + state.header = null;
1.1905 + output.completed = !(!(header & 1));
1.1906 +}
1.1907 +function readBits(bytes, stream, size) {
1.1908 + var bitBuffer = stream.bitBuffer;
1.1909 + var bitLength = stream.bitLength;
1.1910 + if (size > bitLength) {
1.1911 + var pos = stream.pos;
1.1912 + var end = stream.end;
1.1913 + do {
1.1914 + if (pos >= end) {
1.1915 + stream.pos = pos;
1.1916 + stream.bitBuffer = bitBuffer;
1.1917 + stream.bitLength = bitLength;
1.1918 + throw InflateNoDataError;
1.1919 + }
1.1920 + bitBuffer |= bytes[pos++] << bitLength;
1.1921 + bitLength += 8;
1.1922 + } while (size > bitLength);
1.1923 + stream.pos = pos;
1.1924 + }
1.1925 + stream.bitBuffer = bitBuffer >>> size;
1.1926 + stream.bitLength = bitLength - size;
1.1927 + return bitBuffer & (1 << size) - 1;
1.1928 +}
1.1929 +function inflate(stream, output, literalTable, distanceTable, state) {
1.1930 + var pos = output.available;
1.1931 + var dbytes = output.data;
1.1932 + var sbytes = stream.bytes;
1.1933 + var sym = state.sym !== null ? state.sym : readCode(sbytes, stream, literalTable);
1.1934 + while (sym !== 256) {
1.1935 + if (sym < 256) {
1.1936 + dbytes[pos++] = sym;
1.1937 + } else {
1.1938 + state.sym = sym;
1.1939 + sym -= 257;
1.1940 + var len = state.len !== null ? state.len : state.len = lengthCodes[sym] + readBits(sbytes, stream, lengthExtraBits[sym]);
1.1941 + var sym2 = state.sym2 !== null ? state.sym2 : state.sym2 = readCode(sbytes, stream, distanceTable);
1.1942 + var distance = distanceCodes[sym2] + readBits(sbytes, stream, distanceExtraBits[sym2]);
1.1943 + var i = pos - distance;
1.1944 + while (len--)
1.1945 + dbytes[pos++] = dbytes[i++];
1.1946 + state.sym2 = null;
1.1947 + state.len = null;
1.1948 + state.sym = null;
1.1949 + }
1.1950 + output.available = pos;
1.1951 + sym = readCode(sbytes, stream, literalTable);
1.1952 + }
1.1953 +}
1.1954 +function readCode(bytes, stream, codeTable) {
1.1955 + var bitBuffer = stream.bitBuffer;
1.1956 + var bitLength = stream.bitLength;
1.1957 + var maxBits = codeTable.maxBits;
1.1958 + if (maxBits > bitLength) {
1.1959 + var pos = stream.pos;
1.1960 + var end = stream.end;
1.1961 + do {
1.1962 + if (pos >= end) {
1.1963 + stream.pos = pos;
1.1964 + stream.bitBuffer = bitBuffer;
1.1965 + stream.bitLength = bitLength;
1.1966 + throw InflateNoDataError;
1.1967 + }
1.1968 + bitBuffer |= bytes[pos++] << bitLength;
1.1969 + bitLength += 8;
1.1970 + } while (maxBits > bitLength);
1.1971 + stream.pos = pos;
1.1972 + }
1.1973 + var code = codeTable.codes[bitBuffer & (1 << maxBits) - 1];
1.1974 + var len = code >> 16;
1.1975 + stream.bitBuffer = bitBuffer >>> len;
1.1976 + stream.bitLength = bitLength - len;
1.1977 + return code & 65535;
1.1978 +}
1.1979 +var StreamNoDataError = {};
1.1980 +var Stream = function StreamClosure() {
1.1981 + function Stream_align() {
1.1982 + this.bitBuffer = this.bitLength = 0;
1.1983 + }
1.1984 + function Stream_ensure(size) {
1.1985 + if (this.pos + size > this.end) {
1.1986 + throw StreamNoDataError;
1.1987 + }
1.1988 + }
1.1989 + function Stream_remaining() {
1.1990 + return this.end - this.pos;
1.1991 + }
1.1992 + function Stream_substream(begin, end) {
1.1993 + var stream = new Stream(this.bytes);
1.1994 + stream.pos = begin;
1.1995 + stream.end = end;
1.1996 + return stream;
1.1997 + }
1.1998 + function Stream_push(data) {
1.1999 + var bytes = this.bytes;
1.2000 + var newBytesLength = this.end + data.length;
1.2001 + if (newBytesLength > bytes.length) {
1.2002 + throw 'stream buffer overfow';
1.2003 + }
1.2004 + bytes.set(data, this.end);
1.2005 + this.end = newBytesLength;
1.2006 + }
1.2007 + function Stream(buffer, offset, length, maxLength) {
1.2008 + if (offset === undefined)
1.2009 + offset = 0;
1.2010 + if (buffer.buffer instanceof ArrayBuffer) {
1.2011 + offset += buffer.byteOffset;
1.2012 + buffer = buffer.buffer;
1.2013 + }
1.2014 + if (length === undefined)
1.2015 + length = buffer.byteLength - offset;
1.2016 + if (maxLength === undefined)
1.2017 + maxLength = length;
1.2018 + var bytes = new Uint8Array(buffer, offset, maxLength);
1.2019 + var stream = new DataView(buffer, offset, maxLength);
1.2020 + stream.bytes = bytes;
1.2021 + stream.pos = 0;
1.2022 + stream.end = length;
1.2023 + stream.bitBuffer = 0;
1.2024 + stream.bitLength = 0;
1.2025 + stream.align = Stream_align;
1.2026 + stream.ensure = Stream_ensure;
1.2027 + stream.remaining = Stream_remaining;
1.2028 + stream.substream = Stream_substream;
1.2029 + stream.push = Stream_push;
1.2030 + return stream;
1.2031 + }
1.2032 + return Stream;
1.2033 + }();
1.2034 +var FORMAT_COLORMAPPED = 3;
1.2035 +var FORMAT_15BPP = 4;
1.2036 +var FORMAT_24BPP = 5;
1.2037 +var FACTOR_5BBP = 255 / 31;
1.2038 +var crcTable = [];
1.2039 +for (var i = 0; i < 256; i++) {
1.2040 + var c = i;
1.2041 + for (var h = 0; h < 8; h++) {
1.2042 + if (c & 1)
1.2043 + c = 3988292384 ^ c >> 1 & 2147483647;
1.2044 + else
1.2045 + c = c >> 1 & 2147483647;
1.2046 + }
1.2047 + crcTable[i] = c;
1.2048 +}
1.2049 +function crc32(data, start, end) {
1.2050 + var crc = -1;
1.2051 + for (var i = start; i < end; i++) {
1.2052 + var a = (crc ^ data[i]) & 255;
1.2053 + var b = crcTable[a];
1.2054 + crc = crc >>> 8 ^ b;
1.2055 + }
1.2056 + return crc ^ -1;
1.2057 +}
1.2058 +function createPngChunk(type, data) {
1.2059 + var chunk = new Uint8Array(12 + data.length);
1.2060 + var p = 0;
1.2061 + var len = data.length;
1.2062 + chunk[p] = len >> 24 & 255;
1.2063 + chunk[p + 1] = len >> 16 & 255;
1.2064 + chunk[p + 2] = len >> 8 & 255;
1.2065 + chunk[p + 3] = len & 255;
1.2066 + chunk[p + 4] = type.charCodeAt(0) & 255;
1.2067 + chunk[p + 5] = type.charCodeAt(1) & 255;
1.2068 + chunk[p + 6] = type.charCodeAt(2) & 255;
1.2069 + chunk[p + 7] = type.charCodeAt(3) & 255;
1.2070 + if (data instanceof Uint8Array)
1.2071 + chunk.set(data, 8);
1.2072 + p = 8 + len;
1.2073 + var crc = crc32(chunk, 4, p);
1.2074 + chunk[p] = crc >> 24 & 255;
1.2075 + chunk[p + 1] = crc >> 16 & 255;
1.2076 + chunk[p + 2] = crc >> 8 & 255;
1.2077 + chunk[p + 3] = crc & 255;
1.2078 + return chunk;
1.2079 +}
1.2080 +function adler32(data, start, end) {
1.2081 + var a = 1;
1.2082 + var b = 0;
1.2083 + for (var i = start; i < end; ++i) {
1.2084 + a = (a + (data[i] & 255)) % 65521;
1.2085 + b = (b + a) % 65521;
1.2086 + }
1.2087 + return b << 16 | a;
1.2088 +}
1.2089 +function defineBitmap(tag) {
1.2090 + var width = tag.width;
1.2091 + var height = tag.height;
1.2092 + var hasAlpha = tag.hasAlpha;
1.2093 + var plte = '';
1.2094 + var trns = '';
1.2095 + var literals;
1.2096 + var bmpData = tag.bmpData;
1.2097 + switch (tag.format) {
1.2098 + case FORMAT_COLORMAPPED:
1.2099 + var colorType = 3;
1.2100 + var bytesPerLine = width + 3 & ~3;
1.2101 + var colorTableSize = tag.colorTableSize + 1;
1.2102 + var paletteSize = colorTableSize * (tag.hasAlpha ? 4 : 3);
1.2103 + var datalen = paletteSize + bytesPerLine * height;
1.2104 + var stream = createInflatedStream(bmpData, datalen);
1.2105 + var bytes = stream.bytes;
1.2106 + var pos = 0;
1.2107 + stream.ensure(paletteSize);
1.2108 + if (hasAlpha) {
1.2109 + var palette = new Uint8Array(paletteSize / 4 * 3);
1.2110 + var pp = 0;
1.2111 + var alphaValues = new Uint8Array(paletteSize / 4);
1.2112 + var pa = 0;
1.2113 + while (pos < paletteSize) {
1.2114 + palette[pp++] = bytes[pos];
1.2115 + palette[pp++] = bytes[pos + 1];
1.2116 + palette[pp++] = bytes[pos + 2];
1.2117 + alphaValues[pa++] = bytes[pos + 3];
1.2118 + pos += 4;
1.2119 + }
1.2120 + plte = createPngChunk('PLTE', palette);
1.2121 + trns = createPngChunk('tRNS', alphaValues);
1.2122 + } else {
1.2123 + plte = createPngChunk('PLTE', bytes.subarray(pos, pos + paletteSize));
1.2124 + pos += paletteSize;
1.2125 + }
1.2126 + literals = new Uint8Array(width * height + height);
1.2127 + var pl = 0;
1.2128 + while (pos < datalen) {
1.2129 + stream.ensure(bytesPerLine);
1.2130 + var begin = pos;
1.2131 + var end = begin + width;
1.2132 + pl++;
1.2133 + literals.set(bytes.subarray(begin, end), pl);
1.2134 + pl += end - begin;
1.2135 + stream.pos = pos += bytesPerLine;
1.2136 + }
1.2137 + break;
1.2138 + case FORMAT_15BPP:
1.2139 + var colorType = 2;
1.2140 + var bytesPerLine = width * 2 + 3 & ~3;
1.2141 + var stream = createInflatedStream(bmpData, bytesPerLine * height);
1.2142 + var pos = 0;
1.2143 + literals = new Uint8Array(width * height * 3 + height);
1.2144 + var pl = 0;
1.2145 + for (var y = 0; y < height; ++y) {
1.2146 + pl++;
1.2147 + stream.ensure(bytesPerLine);
1.2148 + for (var x = 0; x < width; ++x) {
1.2149 + var word = stream.getUint16(pos);
1.2150 + pos += 2;
1.2151 + literals[pl++] = 0 | FACTOR_5BBP * (word >> 10 & 31);
1.2152 + literals[pl++] = 0 | FACTOR_5BBP * (word >> 5 & 31);
1.2153 + literals[pl++] = 0 | FACTOR_5BBP * (word & 31);
1.2154 + }
1.2155 + stream.pos = pos += bytesPerLine;
1.2156 + }
1.2157 + break;
1.2158 + case FORMAT_24BPP:
1.2159 + var padding;
1.2160 + if (hasAlpha) {
1.2161 + var colorType = 6;
1.2162 + padding = 0;
1.2163 + literals = new Uint8Array(width * height * 4 + height);
1.2164 + } else {
1.2165 + var colorType = 2;
1.2166 + padding = 1;
1.2167 + literals = new Uint8Array(width * height * 3 + height);
1.2168 + }
1.2169 + var bytesPerLine = width * 4;
1.2170 + var stream = createInflatedStream(bmpData, bytesPerLine * height);
1.2171 + var bytes = stream.bytes;
1.2172 + var pos = 0;
1.2173 + var pl = 0;
1.2174 + for (var y = 0; y < height; ++y) {
1.2175 + stream.ensure(bytesPerLine);
1.2176 + pl++;
1.2177 + for (var x = 0; x < width; ++x) {
1.2178 + pos += padding;
1.2179 + if (hasAlpha) {
1.2180 + var alpha = bytes[pos];
1.2181 + if (alpha) {
1.2182 + var opacity = alpha / 255;
1.2183 + literals[pl++] = 0 | bytes[pos + 1] / opacity;
1.2184 + literals[pl++] = 0 | bytes[pos + 2] / opacity;
1.2185 + literals[pl++] = 0 | bytes[pos + 3] / opacity;
1.2186 + literals[pl++] = alpha;
1.2187 + } else {
1.2188 + pl += 4;
1.2189 + }
1.2190 + } else {
1.2191 + literals[pl++] = bytes[pos];
1.2192 + literals[pl++] = bytes[pos + 1];
1.2193 + literals[pl++] = bytes[pos + 2];
1.2194 + }
1.2195 + pos += 4 - padding;
1.2196 + }
1.2197 + stream.pos = pos;
1.2198 + }
1.2199 + break;
1.2200 + default:
1.2201 + fail('invalid format', 'bitmap');
1.2202 + }
1.2203 + var ihdr = new Uint8Array([
1.2204 + width >> 24 & 255,
1.2205 + width >> 16 & 255,
1.2206 + width >> 8 & 255,
1.2207 + width & 255,
1.2208 + height >> 24 & 255,
1.2209 + height >> 16 & 255,
1.2210 + height >> 8 & 255,
1.2211 + height & 255,
1.2212 + 8,
1.2213 + colorType,
1.2214 + 0,
1.2215 + 0,
1.2216 + 0
1.2217 + ]);
1.2218 + var len = literals.length;
1.2219 + var maxBlockLength = 65535;
1.2220 + var idat = new Uint8Array(2 + len + Math.ceil(len / maxBlockLength) * 5 + 4);
1.2221 + var pi = 0;
1.2222 + idat[pi++] = 120;
1.2223 + idat[pi++] = 156;
1.2224 + var pos = 0;
1.2225 + while (len > maxBlockLength) {
1.2226 + idat[pi++] = 0;
1.2227 + idat[pi++] = 255;
1.2228 + idat[pi++] = 255;
1.2229 + idat[pi++] = 0;
1.2230 + idat[pi++] = 0;
1.2231 + idat.set(literals.subarray(pos, pos + maxBlockLength), pi);
1.2232 + pi += maxBlockLength;
1.2233 + pos += maxBlockLength;
1.2234 + len -= maxBlockLength;
1.2235 + }
1.2236 + idat[pi++] = 1;
1.2237 + idat[pi++] = len & 255;
1.2238 + idat[pi++] = len >> 8 & 255;
1.2239 + idat[pi++] = ~len & 65535 & 255;
1.2240 + idat[pi++] = (~len & 65535) >> 8 & 255;
1.2241 + idat.set(literals.subarray(pos), pi);
1.2242 + pi += literals.length - pos;
1.2243 + var adler = adler32(literals, 0, literals.length);
1.2244 + idat[pi++] = adler >> 24 & 255;
1.2245 + idat[pi++] = adler >> 16 & 255;
1.2246 + idat[pi++] = adler >> 8 & 255;
1.2247 + idat[pi++] = adler & 255;
1.2248 + var chunks = [
1.2249 + new Uint8Array([
1.2250 + 137,
1.2251 + 80,
1.2252 + 78,
1.2253 + 71,
1.2254 + 13,
1.2255 + 10,
1.2256 + 26,
1.2257 + 10
1.2258 + ]),
1.2259 + createPngChunk('IHDR', ihdr),
1.2260 + plte,
1.2261 + trns,
1.2262 + createPngChunk('IDAT', idat),
1.2263 + createPngChunk('IEND', '')
1.2264 + ];
1.2265 + return {
1.2266 + type: 'image',
1.2267 + id: tag.id,
1.2268 + width: width,
1.2269 + height: height,
1.2270 + mimeType: 'image/png',
1.2271 + data: new Blob(chunks, {
1.2272 + type: 'image/png'
1.2273 + })
1.2274 + };
1.2275 +}
1.2276 +function defineButton(tag, dictionary) {
1.2277 + var characters = tag.characters;
1.2278 + var states = {
1.2279 + up: {},
1.2280 + over: {},
1.2281 + down: {},
1.2282 + hitTest: {}
1.2283 + };
1.2284 + var i = 0, character;
1.2285 + while (character = characters[i++]) {
1.2286 + if (character.eob)
1.2287 + break;
1.2288 + var characterItem = dictionary[character.symbolId];
1.2289 + var entry = {
1.2290 + symbolId: characterItem.id,
1.2291 + hasMatrix: !(!character.matrix),
1.2292 + matrix: character.matrix
1.2293 + };
1.2294 + if (character.stateUp)
1.2295 + states.up[character.depth] = entry;
1.2296 + if (character.stateOver)
1.2297 + states.over[character.depth] = entry;
1.2298 + if (character.stateDown)
1.2299 + states.down[character.depth] = entry;
1.2300 + if (character.stateHitTest)
1.2301 + states.hitTest[character.depth] = entry;
1.2302 + }
1.2303 + var button = {
1.2304 + type: 'button',
1.2305 + id: tag.id,
1.2306 + buttonActions: tag.buttonActions,
1.2307 + states: states
1.2308 + };
1.2309 + return button;
1.2310 +}
1.2311 +var nextFontId = 1;
1.2312 +function maxPower2(num) {
1.2313 + var maxPower = 0;
1.2314 + var val = num;
1.2315 + while (val >= 2) {
1.2316 + val /= 2;
1.2317 + ++maxPower;
1.2318 + }
1.2319 + return pow(2, maxPower);
1.2320 +}
1.2321 +function toString16(val) {
1.2322 + return fromCharCode(val >> 8 & 255, val & 255);
1.2323 +}
1.2324 +function toString32(val) {
1.2325 + return toString16(val >> 16) + toString16(val);
1.2326 +}
1.2327 +function defineFont(tag, dictionary) {
1.2328 + var tables = {};
1.2329 + var codes = [];
1.2330 + var glyphIndex = {};
1.2331 + var ranges = [];
1.2332 + var glyphs = tag.glyphs;
1.2333 + var glyphCount = glyphs.length;
1.2334 + if (tag.codes) {
1.2335 + codes = codes.concat(tag.codes);
1.2336 + for (var i = 0, code; code = codes[i]; ++i)
1.2337 + glyphIndex[code] = i;
1.2338 + codes.sort(function (a, b) {
1.2339 + return a - b;
1.2340 + });
1.2341 + var i = 0;
1.2342 + var code;
1.2343 + while (code = codes[i++]) {
1.2344 + var start = code;
1.2345 + var end = start;
1.2346 + var indices = [
1.2347 + i - 1
1.2348 + ];
1.2349 + while ((code = codes[i]) && end + 1 === code) {
1.2350 + ++end;
1.2351 + indices.push(i);
1.2352 + ++i;
1.2353 + }
1.2354 + ranges.push([
1.2355 + start,
1.2356 + end,
1.2357 + indices
1.2358 + ]);
1.2359 + }
1.2360 + } else {
1.2361 + var indices = [];
1.2362 + var UAC_OFFSET = 57344;
1.2363 + for (var i = 0; i < glyphCount; i++) {
1.2364 + var code = UAC_OFFSET + i;
1.2365 + codes.push(code);
1.2366 + glyphIndex[code] = i;
1.2367 + indices.push(i);
1.2368 + }
1.2369 + ranges.push([
1.2370 + UAC_OFFSET,
1.2371 + UAC_OFFSET + glyphCount - 1,
1.2372 + indices
1.2373 + ]);
1.2374 + }
1.2375 + var resolution = tag.resolution || 1;
1.2376 + var ascent = Math.ceil(tag.ascent / resolution) || 1024;
1.2377 + var descent = -Math.ceil(tag.descent / resolution) | 0;
1.2378 + var leading = tag.leading / resolution | 0;
1.2379 + tables['OS/2'] = '\0\x01\0\0' + toString16(tag.bold ? 700 : 400) + '\0\x05' + '\0\0' + '\0\0' + '\0\0' + '\0\0' + '\0\0' + '\0\0' + '\0\0' + '\0\0' + '\0\0' + '\0\0' + '\0\0' + '\0\0' + '\0\0\0\0\0\0\0\0\0\0' + '\0\0\0\0' + '\0\0\0\0' + '\0\0\0\0' + '\0\0\0\0' + 'ALF ' + toString16((tag.italic ? 1 : 0) | (tag.bold ? 32 : 0)) + toString16(codes[0]) + toString16(codes[codes.length - 1]) + toString16(ascent) + toString16(descent) + toString16(leading) + toString16(ascent) + toString16(-descent) + '\0\0\0\0' + '\0\0\0\0';
1.2380 + ;
1.2381 + var startCount = '';
1.2382 + var endCount = '';
1.2383 + var idDelta = '';
1.2384 + var idRangeOffset = '';
1.2385 + var i = 0;
1.2386 + var range;
1.2387 + while (range = ranges[i++]) {
1.2388 + var start = range[0];
1.2389 + var end = range[1];
1.2390 + var code = range[2][0];
1.2391 + startCount += toString16(start);
1.2392 + endCount += toString16(end);
1.2393 + idDelta += toString16(code - start + 1 & 65535);
1.2394 + idRangeOffset += toString16(0);
1.2395 + }
1.2396 + endCount += '\xff\xff';
1.2397 + startCount += '\xff\xff';
1.2398 + idDelta += '\0\x01';
1.2399 + idRangeOffset += '\0\0';
1.2400 + var segCount = ranges.length + 1;
1.2401 + var searchRange = maxPower2(segCount) * 2;
1.2402 + var rangeShift = 2 * segCount - searchRange;
1.2403 + var format314 = '\0\0' + toString16(segCount * 2) + toString16(searchRange) + toString16(logE(segCount) / logE(2)) + toString16(rangeShift) + endCount + '\0\0' + startCount + idDelta + idRangeOffset;
1.2404 + ;
1.2405 + tables['cmap'] = '\0\0\0\x01\0\x03\0\x01\0\0\0\f\0\x04' + toString16(format314.length + 4) + format314;
1.2406 + ;
1.2407 + var glyf = '\0\x01\0\0\0\0\0\0\0\0\0\0\0\x001\0';
1.2408 + var loca = '\0\0';
1.2409 + var offset = 16;
1.2410 + var maxPoints = 0;
1.2411 + var xMins = [];
1.2412 + var xMaxs = [];
1.2413 + var yMins = [];
1.2414 + var yMaxs = [];
1.2415 + var maxContours = 0;
1.2416 + var i = 0;
1.2417 + var code;
1.2418 + while (code = codes[i++]) {
1.2419 + var glyph = glyphs[glyphIndex[code]];
1.2420 + var records = glyph.records;
1.2421 + var numberOfContours = 1;
1.2422 + var endPoint = 0;
1.2423 + var endPtsOfContours = '';
1.2424 + var flags = '';
1.2425 + var xCoordinates = '';
1.2426 + var yCoordinates = '';
1.2427 + var x = 0;
1.2428 + var y = 0;
1.2429 + var xMin = 1024;
1.2430 + var xMax = -1024;
1.2431 + var yMin = 1024;
1.2432 + var yMax = -1024;
1.2433 + for (var j = 0, record; record = records[j]; ++j) {
1.2434 + if (record.type) {
1.2435 + if (record.isStraight) {
1.2436 + if (record.isGeneral) {
1.2437 + flags += '\x01';
1.2438 + var dx = record.deltaX / resolution;
1.2439 + var dy = -record.deltaY / resolution;
1.2440 + xCoordinates += toString16(dx);
1.2441 + yCoordinates += toString16(dy);
1.2442 + x += dx;
1.2443 + y += dy;
1.2444 + } else if (record.isVertical) {
1.2445 + flags += '\x11';
1.2446 + var dy = -record.deltaY / resolution;
1.2447 + yCoordinates += toString16(dy);
1.2448 + y += dy;
1.2449 + } else {
1.2450 + flags += '!';
1.2451 + var dx = record.deltaX / resolution;
1.2452 + xCoordinates += toString16(dx);
1.2453 + x += dx;
1.2454 + }
1.2455 + } else {
1.2456 + flags += '\0';
1.2457 + var cx = record.controlDeltaX / resolution;
1.2458 + var cy = -record.controlDeltaY / resolution;
1.2459 + xCoordinates += toString16(cx);
1.2460 + yCoordinates += toString16(cy);
1.2461 + flags += '\x01';
1.2462 + var dx = record.anchorDeltaX / resolution;
1.2463 + var dy = -record.anchorDeltaY / resolution;
1.2464 + xCoordinates += toString16(dx);
1.2465 + yCoordinates += toString16(dy);
1.2466 + ++endPoint;
1.2467 + x += cx + dx;
1.2468 + y += cy + dy;
1.2469 + }
1.2470 + if (x < xMin)
1.2471 + xMin = x;
1.2472 + if (x > xMax)
1.2473 + xMax = x;
1.2474 + if (y < yMin)
1.2475 + yMin = y;
1.2476 + if (y > yMax)
1.2477 + yMax = y;
1.2478 + ++endPoint;
1.2479 + } else {
1.2480 + if (record.eos)
1.2481 + break;
1.2482 + if (record.move) {
1.2483 + if (endPoint) {
1.2484 + ++numberOfContours;
1.2485 + endPtsOfContours += toString16(endPoint - 1);
1.2486 + }
1.2487 + flags += '\x01';
1.2488 + var moveX = record.moveX / resolution;
1.2489 + var moveY = -record.moveY / resolution;
1.2490 + var dx = moveX - x;
1.2491 + var dy = moveY - y;
1.2492 + xCoordinates += toString16(dx);
1.2493 + yCoordinates += toString16(dy);
1.2494 + x = moveX;
1.2495 + y = moveY;
1.2496 + if (endPoint > maxPoints)
1.2497 + maxPoints = endPoint;
1.2498 + if (x < xMin)
1.2499 + xMin = x;
1.2500 + if (x > xMax)
1.2501 + xMax = x;
1.2502 + if (y < yMin)
1.2503 + yMin = y;
1.2504 + if (y > yMax)
1.2505 + yMax = y;
1.2506 + ++endPoint;
1.2507 + }
1.2508 + }
1.2509 + }
1.2510 + endPtsOfContours += toString16((endPoint || 1) - 1);
1.2511 + if (!j) {
1.2512 + xMin = xMax = yMin = yMax = 0;
1.2513 + flags += '1';
1.2514 + }
1.2515 + var entry = toString16(numberOfContours) + toString16(xMin) + toString16(yMin) + toString16(xMax) + toString16(yMax) + endPtsOfContours + '\0\0' + flags + xCoordinates + yCoordinates;
1.2516 + ;
1.2517 + if (entry.length & 1)
1.2518 + entry += '\0';
1.2519 + glyf += entry;
1.2520 + loca += toString16(offset / 2);
1.2521 + offset += entry.length;
1.2522 + xMins.push(xMin);
1.2523 + xMaxs.push(xMax);
1.2524 + yMins.push(yMin);
1.2525 + yMaxs.push(yMax);
1.2526 + if (numberOfContours > maxContours)
1.2527 + maxContours = numberOfContours;
1.2528 + if (endPoint > maxPoints)
1.2529 + maxPoints = endPoint;
1.2530 + }
1.2531 + loca += toString16(offset / 2);
1.2532 + tables['glyf'] = glyf;
1.2533 + tables['head'] = '\0\x01\0\0\0\x01\0\0\0\0\0\0_\x0f<\xf5\0\v\x04\0\0\0\0\0' + toString32(Date.now()) + '\0\0\0\0' + toString32(Date.now()) + toString16(min.apply(null, xMins)) + toString16(min.apply(null, yMins)) + toString16(max.apply(null, xMaxs)) + toString16(max.apply(null, yMaxs)) + toString16((tag.italic ? 2 : 0) | (tag.bold ? 1 : 0)) + '\0\b' + '\0\x02' + '\0\0' + '\0\0';
1.2534 + ;
1.2535 + var advance = tag.advance;
1.2536 + tables['hhea'] = '\0\x01\0\0' + toString16(ascent) + toString16(descent) + toString16(leading) + toString16(advance ? max.apply(null, advance) : 1024) + '\0\0' + '\0\0' + '\x03\xb8' + '\0\x01' + '\0\0' + '\0\0' + '\0\0' + '\0\0' + '\0\0' + '\0\0' + '\0\0' + toString16(glyphCount + 1);
1.2537 + ;
1.2538 + var hmtx = '\0\0\0\0';
1.2539 + for (var i = 0; i < glyphCount; ++i)
1.2540 + hmtx += toString16(advance ? advance[i] / resolution : 1024) + '\0\0';
1.2541 + tables['hmtx'] = hmtx;
1.2542 + if (tag.kerning) {
1.2543 + var kerning = tag.kerning;
1.2544 + var nPairs = kerning.length;
1.2545 + var searchRange = maxPower2(nPairs) * 2;
1.2546 + var kern = '\0\0\0\x01\0\0' + toString16(14 + nPairs * 6) + '\0\x01' + toString16(nPairs) + toString16(searchRange) + toString16(logE(nPairs) / logE(2)) + toString16(2 * nPairs - searchRange);
1.2547 + ;
1.2548 + var i = 0;
1.2549 + var record;
1.2550 + while (record = kerning[i++]) {
1.2551 + kern += toString16(glyphIndex[record.code1]) + toString16(glyphIndex[record.code2]) + toString16(record.adjustment);
1.2552 + ;
1.2553 + }
1.2554 + tables['kern'] = kern;
1.2555 + }
1.2556 + tables['loca'] = loca;
1.2557 + tables['maxp'] = '\0\x01\0\0' + toString16(glyphCount + 1) + toString16(maxPoints) + toString16(maxContours) + '\0\0' + '\0\0' + '\0\0' + '\0\0' + '\0\0' + '\0\0' + '\0\0' + '\0\0' + '\0\0' + '\0\0' + '\0\0';
1.2558 + ;
1.2559 + var uniqueId = 'swf-font-' + nextFontId++;
1.2560 + var fontName = tag.name || uniqueId;
1.2561 + var psName = fontName.replace(/ /g, '');
1.2562 + var strings = [
1.2563 + tag.copyright || 'Original licence',
1.2564 + fontName,
1.2565 + 'Unknown',
1.2566 + uniqueId,
1.2567 + fontName,
1.2568 + '1.0',
1.2569 + psName,
1.2570 + 'Unknown',
1.2571 + 'Unknown',
1.2572 + 'Unknown'
1.2573 + ];
1.2574 + var count = strings.length;
1.2575 + var name = '\0\0' + toString16(count) + toString16(count * 12 + 6);
1.2576 + var offset = 0;
1.2577 + var i = 0;
1.2578 + var str;
1.2579 + while (str = strings[i++]) {
1.2580 + name += '\0\x01\0\0\0\0' + toString16(i - 1) + toString16(str.length) + toString16(offset);
1.2581 + offset += str.length;
1.2582 + }
1.2583 + tables['name'] = name + strings.join('');
1.2584 + tables['post'] = '\0\x03\0\0\0\0\0\0\0\0\0\0\0\0\0\0\0\0\0\0\0\0\0\0\0\0\0\0\0\0\0\0';
1.2585 + ;
1.2586 + var names = keys(tables);
1.2587 + var numTables = names.length;
1.2588 + var header = '\0\x01\0\0' + toString16(numTables) + '\0\x80' + '\0\x03' + '\0 ';
1.2589 + ;
1.2590 + var data = '';
1.2591 + var offset = numTables * 16 + header.length;
1.2592 + var i = 0;
1.2593 + var name;
1.2594 + while (name = names[i++]) {
1.2595 + var table = tables[name];
1.2596 + var length = table.length;
1.2597 + header += name + '\0\0\0\0' + toString32(offset) + toString32(length);
1.2598 + ;
1.2599 + while (length & 3) {
1.2600 + table += '\0';
1.2601 + ++length;
1.2602 + }
1.2603 + data += table;
1.2604 + while (offset & 3)
1.2605 + ++offset;
1.2606 + offset += length;
1.2607 + }
1.2608 + var otf = header + data;
1.2609 + var unitPerEm = 1024;
1.2610 + var metrics = {
1.2611 + ascent: ascent / unitPerEm,
1.2612 + descent: -descent / unitPerEm,
1.2613 + leading: leading / unitPerEm
1.2614 + };
1.2615 + return {
1.2616 + type: 'font',
1.2617 + id: tag.id,
1.2618 + name: fontName,
1.2619 + uniqueName: psName + uniqueId,
1.2620 + codes: codes,
1.2621 + metrics: metrics,
1.2622 + bold: tag.bold === 1,
1.2623 + italic: tag.italic === 1,
1.2624 + data: otf
1.2625 + };
1.2626 +}
1.2627 +function getUint16(buff, pos) {
1.2628 + return buff[pos] << 8 | buff[pos + 1];
1.2629 +}
1.2630 +function parseJpegChunks(imgDef, bytes) {
1.2631 + var i = 0;
1.2632 + var n = bytes.length;
1.2633 + var chunks = [];
1.2634 + var code;
1.2635 + do {
1.2636 + var begin = i;
1.2637 + while (i < n && bytes[i] !== 255)
1.2638 + ++i;
1.2639 + while (i < n && bytes[i] === 255)
1.2640 + ++i;
1.2641 + code = bytes[i++];
1.2642 + if (code === 218) {
1.2643 + i = n;
1.2644 + } else if (code === 217) {
1.2645 + i += 2;
1.2646 + continue;
1.2647 + } else if (code < 208 || code > 216) {
1.2648 + var length = getUint16(bytes, i);
1.2649 + if (code >= 192 && code <= 195) {
1.2650 + imgDef.height = getUint16(bytes, i + 3);
1.2651 + imgDef.width = getUint16(bytes, i + 5);
1.2652 + }
1.2653 + i += length;
1.2654 + }
1.2655 + chunks.push(bytes.subarray(begin, i));
1.2656 + } while (i < n);
1.2657 + return chunks;
1.2658 +}
1.2659 +function defineImage(tag, dictionary) {
1.2660 + var img = {
1.2661 + type: 'image',
1.2662 + id: tag.id,
1.2663 + mimeType: tag.mimeType
1.2664 + };
1.2665 + var imgData = tag.imgData;
1.2666 + var chunks;
1.2667 + if (tag.mimeType === 'image/jpeg') {
1.2668 + chunks = parseJpegChunks(img, imgData);
1.2669 + var alphaData = tag.alphaData;
1.2670 + if (alphaData) {
1.2671 + img.mask = createInflatedStream(alphaData, img.width * img.height).bytes;
1.2672 + }
1.2673 + if (tag.incomplete) {
1.2674 + var tables = dictionary[0];
1.2675 + var header = tables.data;
1.2676 + if (header && header.size) {
1.2677 + chunks[0] = chunks[0].subarray(2);
1.2678 + chunks.unshift(header.slice(0, header.size - 2));
1.2679 + }
1.2680 + }
1.2681 + } else {
1.2682 + chunks = [
1.2683 + imgData
1.2684 + ];
1.2685 + }
1.2686 + img.data = new Blob(chunks, {
1.2687 + type: tag.mimeType
1.2688 + });
1.2689 + return img;
1.2690 +}
1.2691 +function defineLabel(tag, dictionary) {
1.2692 + var records = tag.records;
1.2693 + var m = tag.matrix;
1.2694 + var cmds = [
1.2695 + 'c.save()',
1.2696 + 'c.transform(' + [
1.2697 + m.a,
1.2698 + m.b,
1.2699 + m.c,
1.2700 + m.d,
1.2701 + m.tx / 20,
1.2702 + m.ty / 20
1.2703 + ].join(',') + ')',
1.2704 + 'c.scale(0.05, 0.05)'
1.2705 + ];
1.2706 + var dependencies = [];
1.2707 + var x = 0;
1.2708 + var y = 0;
1.2709 + var i = 0;
1.2710 + var record;
1.2711 + var codes;
1.2712 + while (record = records[i++]) {
1.2713 + if (record.eot)
1.2714 + break;
1.2715 + if (record.hasFont) {
1.2716 + var font = dictionary[record.fontId];
1.2717 + codes = font.codes;
1.2718 + cmds.push('c.font="' + record.fontHeight + 'px \'' + font.uniqueName + '\'"');
1.2719 + dependencies.push(font.id);
1.2720 + }
1.2721 + if (record.hasColor) {
1.2722 + cmds.push('ct.setFillStyle(c,"' + rgbaObjToStr(record.color) + '")');
1.2723 + cmds.push('ct.setAlpha(c)');
1.2724 + } else {
1.2725 + cmds.push('ct.setAlpha(c,true)');
1.2726 + }
1.2727 + if (record.hasMoveX)
1.2728 + x = record.moveX;
1.2729 + if (record.hasMoveY)
1.2730 + y = record.moveY;
1.2731 + var entries = record.entries;
1.2732 + var j = 0;
1.2733 + var entry;
1.2734 + while (entry = entries[j++]) {
1.2735 + var code = codes[entry.glyphIndex];
1.2736 + var text = code >= 32 && code != 34 && code != 92 ? fromCharCode(code) : '\\u' + (code + 65536).toString(16).substring(1);
1.2737 + cmds.push('c.fillText("' + text + '",' + x + ',' + y + ')');
1.2738 + x += entry.advance;
1.2739 + }
1.2740 + }
1.2741 + cmds.push('c.restore()');
1.2742 + var label = {
1.2743 + type: 'label',
1.2744 + id: tag.id,
1.2745 + bbox: tag.bbox,
1.2746 + data: cmds.join('\n')
1.2747 + };
1.2748 + if (dependencies.length)
1.2749 + label.require = dependencies;
1.2750 + return label;
1.2751 +}
1.2752 +var GRAPHICS_FILL_CLIPPED_BITMAP = 65;
1.2753 +var GRAPHICS_FILL_FOCAL_RADIAL_GRADIENT = 19;
1.2754 +var GRAPHICS_FILL_LINEAR_GRADIENT = 16;
1.2755 +var GRAPHICS_FILL_NONSMOOTHED_CLIPPED_BITMAP = 67;
1.2756 +var GRAPHICS_FILL_NONSMOOTHED_REPEATING_BITMAP = 66;
1.2757 +var GRAPHICS_FILL_RADIAL_GRADIENT = 18;
1.2758 +var GRAPHICS_FILL_REPEATING_BITMAP = 64;
1.2759 +var GRAPHICS_FILL_SOLID = 0;
1.2760 +function applySegmentToStyles(segment, styles, linePaths, fillPaths, isMorph) {
1.2761 + if (!segment) {
1.2762 + return;
1.2763 + }
1.2764 + var commands = segment.commands;
1.2765 + var data = segment.data;
1.2766 + var morphData = segment.morphData;
1.2767 + if (morphData) {
1.2768 + }
1.2769 + var path;
1.2770 + var targetSegment;
1.2771 + var command;
1.2772 + var i;
1.2773 + if (styles.fill0) {
1.2774 + path = fillPaths[styles.fill0 - 1];
1.2775 + if (!(styles.fill1 || styles.line)) {
1.2776 + targetSegment = path.head();
1.2777 + targetSegment.commands = [];
1.2778 + targetSegment.data = [];
1.2779 + targetSegment.morphData = isMorph ? [] : null;
1.2780 + } else {
1.2781 + targetSegment = path.addSegment([], [], isMorph ? [] : null);
1.2782 + }
1.2783 + var targetCommands = targetSegment.commands;
1.2784 + var targetData = targetSegment.data;
1.2785 + var targetMorphData = targetSegment.morphData;
1.2786 + targetCommands.push(SHAPE_MOVE_TO);
1.2787 + var j = data.length - 2;
1.2788 + targetData.push(data[j], data[j + 1]);
1.2789 + if (isMorph) {
1.2790 + targetMorphData.push(morphData[j], morphData[j + 1]);
1.2791 + }
1.2792 + for (i = commands.length; i-- > 1; j -= 2) {
1.2793 + command = commands[i];
1.2794 + targetCommands.push(command);
1.2795 + targetData.push(data[j - 2], data[j - 1]);
1.2796 + if (isMorph) {
1.2797 + targetMorphData.push(morphData[j - 2], morphData[j - 1]);
1.2798 + }
1.2799 + if (command === SHAPE_CURVE_TO) {
1.2800 + targetData.push(data[j - 4], data[j - 3]);
1.2801 + if (isMorph) {
1.2802 + targetMorphData.push(morphData[j - 4], morphData[j - 3]);
1.2803 + }
1.2804 + j -= 2;
1.2805 + }
1.2806 + }
1.2807 + if (isMorph) {
1.2808 + }
1.2809 + }
1.2810 + if (styles.line && styles.fill1) {
1.2811 + path = linePaths[styles.line - 1];
1.2812 + path.addSegment(commands, data, morphData);
1.2813 + }
1.2814 +}
1.2815 +function convertRecordsToStyledPaths(records, fillPaths, linePaths, dictionary, dependencies, recordsMorph, transferables) {
1.2816 + var isMorph = recordsMorph !== null;
1.2817 + var styles = {
1.2818 + fill0: 0,
1.2819 + fill1: 0,
1.2820 + line: 0
1.2821 + };
1.2822 + var segment = null;
1.2823 + var allPaths;
1.2824 + var defaultPath;
1.2825 + var numRecords = records.length - 1;
1.2826 + var x = 0;
1.2827 + var y = 0;
1.2828 + var morphX = 0;
1.2829 + var morphY = 0;
1.2830 + var path;
1.2831 + for (var i = 0, j = 0; i < numRecords; i++) {
1.2832 + var record = records[i];
1.2833 + var morphRecord;
1.2834 + if (isMorph) {
1.2835 + morphRecord = recordsMorph[j++];
1.2836 + }
1.2837 + if (record.type === 0) {
1.2838 + if (segment) {
1.2839 + applySegmentToStyles(segment, styles, linePaths, fillPaths, isMorph);
1.2840 + }
1.2841 + if (record.hasNewStyles) {
1.2842 + if (!allPaths) {
1.2843 + allPaths = [];
1.2844 + }
1.2845 + push.apply(allPaths, fillPaths);
1.2846 + fillPaths = createPathsList(record.fillStyles, false, dictionary, dependencies);
1.2847 + push.apply(allPaths, linePaths);
1.2848 + linePaths = createPathsList(record.lineStyles, true, dictionary, dependencies);
1.2849 + if (defaultPath) {
1.2850 + allPaths.push(defaultPath);
1.2851 + defaultPath = null;
1.2852 + }
1.2853 + styles = {
1.2854 + fill0: 0,
1.2855 + fill1: 0,
1.2856 + line: 0
1.2857 + };
1.2858 + }
1.2859 + if (record.hasFillStyle0) {
1.2860 + styles.fill0 = record.fillStyle0;
1.2861 + }
1.2862 + if (record.hasFillStyle1) {
1.2863 + styles.fill1 = record.fillStyle1;
1.2864 + }
1.2865 + if (record.hasLineStyle) {
1.2866 + styles.line = record.lineStyle;
1.2867 + }
1.2868 + if (styles.fill1) {
1.2869 + path = fillPaths[styles.fill1 - 1];
1.2870 + } else if (styles.line) {
1.2871 + path = linePaths[styles.line - 1];
1.2872 + } else if (styles.fill0) {
1.2873 + path = fillPaths[styles.fill0 - 1];
1.2874 + }
1.2875 + if (record.move) {
1.2876 + x = record.moveX | 0;
1.2877 + y = record.moveY | 0;
1.2878 + }
1.2879 + if (path) {
1.2880 + segment = path.addSegment([], [], isMorph ? [] : null);
1.2881 + segment.commands.push(SHAPE_MOVE_TO);
1.2882 + segment.data.push(x, y);
1.2883 + if (isMorph) {
1.2884 + if (morphRecord.type === 0) {
1.2885 + morphX = morphRecord.moveX | 0;
1.2886 + morphY = morphRecord.moveY | 0;
1.2887 + } else {
1.2888 + morphX = x;
1.2889 + morphY = y;
1.2890 + j--;
1.2891 + }
1.2892 + segment.morphData.push(morphX, morphY);
1.2893 + }
1.2894 + }
1.2895 + } else {
1.2896 + if (!segment) {
1.2897 + if (!defaultPath) {
1.2898 + var style = {
1.2899 + color: {
1.2900 + red: 0,
1.2901 + green: 0,
1.2902 + blue: 0,
1.2903 + alpha: 255
1.2904 + },
1.2905 + width: 20
1.2906 + };
1.2907 + defaultPath = new SegmentedPath(null, processStyle(style, true));
1.2908 + }
1.2909 + segment = defaultPath.addSegment([], [], isMorph ? [] : null);
1.2910 + segment.commands.push(SHAPE_MOVE_TO);
1.2911 + segment.data.push(x, y);
1.2912 + if (isMorph) {
1.2913 + segment.morphData.push(morphX, morphY);
1.2914 + }
1.2915 + }
1.2916 + if (isMorph) {
1.2917 + while (morphRecord && morphRecord.type === 0) {
1.2918 + morphRecord = recordsMorph[j++];
1.2919 + }
1.2920 + if (!morphRecord) {
1.2921 + morphRecord = record;
1.2922 + }
1.2923 + }
1.2924 + if (record.isStraight && (!isMorph || morphRecord.isStraight)) {
1.2925 + x += record.deltaX | 0;
1.2926 + y += record.deltaY | 0;
1.2927 + segment.commands.push(SHAPE_LINE_TO);
1.2928 + segment.data.push(x, y);
1.2929 + if (isMorph) {
1.2930 + morphX += morphRecord.deltaX | 0;
1.2931 + morphY += morphRecord.deltaY | 0;
1.2932 + segment.morphData.push(morphX, morphY);
1.2933 + }
1.2934 + } else {
1.2935 + var cx, cy;
1.2936 + var deltaX, deltaY;
1.2937 + if (!record.isStraight) {
1.2938 + cx = x + record.controlDeltaX | 0;
1.2939 + cy = y + record.controlDeltaY | 0;
1.2940 + x = cx + record.anchorDeltaX | 0;
1.2941 + y = cy + record.anchorDeltaY | 0;
1.2942 + } else {
1.2943 + deltaX = record.deltaX | 0;
1.2944 + deltaY = record.deltaY | 0;
1.2945 + cx = x + (deltaX >> 1);
1.2946 + cy = y + (deltaY >> 1);
1.2947 + x += deltaX;
1.2948 + y += deltaY;
1.2949 + }
1.2950 + segment.commands.push(SHAPE_CURVE_TO);
1.2951 + segment.data.push(cx, cy, x, y);
1.2952 + if (isMorph) {
1.2953 + if (!morphRecord.isStraight) {
1.2954 + cx = morphX + morphRecord.controlDeltaX | 0;
1.2955 + cy = morphY + morphRecord.controlDeltaY | 0;
1.2956 + morphX = cx + morphRecord.anchorDeltaX | 0;
1.2957 + morphY = cy + morphRecord.anchorDeltaY | 0;
1.2958 + } else {
1.2959 + deltaX = morphRecord.deltaX | 0;
1.2960 + deltaY = morphRecord.deltaY | 0;
1.2961 + cx = morphX + (deltaX >> 1);
1.2962 + cy = morphY + (deltaY >> 1);
1.2963 + morphX += deltaX;
1.2964 + morphY += deltaY;
1.2965 + }
1.2966 + segment.morphData.push(cx, cy, morphX, morphY);
1.2967 + }
1.2968 + }
1.2969 + }
1.2970 + }
1.2971 + applySegmentToStyles(segment, styles, linePaths, fillPaths, isMorph);
1.2972 + if (allPaths) {
1.2973 + push.apply(allPaths, fillPaths);
1.2974 + } else {
1.2975 + allPaths = fillPaths;
1.2976 + }
1.2977 + push.apply(allPaths, linePaths);
1.2978 + if (defaultPath) {
1.2979 + allPaths.push(defaultPath);
1.2980 + }
1.2981 + var removeCount = 0;
1.2982 + for (i = 0; i < allPaths.length; i++) {
1.2983 + path = allPaths[i];
1.2984 + if (!path.head()) {
1.2985 + removeCount++;
1.2986 + continue;
1.2987 + }
1.2988 + allPaths[i - removeCount] = segmentedPathToShapePath(path, isMorph, transferables);
1.2989 + }
1.2990 + allPaths.length -= removeCount;
1.2991 + return allPaths;
1.2992 +}
1.2993 +function segmentedPathToShapePath(path, isMorph, transferables) {
1.2994 + var start = path.head();
1.2995 + var end = start;
1.2996 + var finalRoot = null;
1.2997 + var finalHead = null;
1.2998 + var skippedMoves = 0;
1.2999 + var current = start.prev;
1.3000 + while (start) {
1.3001 + while (current) {
1.3002 + if (path.segmentsConnect(current, start)) {
1.3003 + if (current.next !== start) {
1.3004 + path.removeSegment(current);
1.3005 + path.insertSegment(current, start);
1.3006 + }
1.3007 + start = current;
1.3008 + current = start.prev;
1.3009 + skippedMoves++;
1.3010 + continue;
1.3011 + }
1.3012 + if (path.segmentsConnect(end, current)) {
1.3013 + path.removeSegment(current);
1.3014 + end.next = current;
1.3015 + current = current.prev;
1.3016 + end.next.prev = end;
1.3017 + end.next.next = null;
1.3018 + end = end.next;
1.3019 + skippedMoves++;
1.3020 + continue;
1.3021 + }
1.3022 + current = current.prev;
1.3023 + }
1.3024 + current = start.prev;
1.3025 + if (!finalRoot) {
1.3026 + finalRoot = start;
1.3027 + finalHead = end;
1.3028 + } else {
1.3029 + finalHead.next = start;
1.3030 + start.prev = finalHead;
1.3031 + finalHead = end;
1.3032 + finalHead.next = null;
1.3033 + }
1.3034 + if (!current) {
1.3035 + break;
1.3036 + }
1.3037 + start = end = current;
1.3038 + current = start.prev;
1.3039 + }
1.3040 + var totalCommandsLength = -skippedMoves;
1.3041 + var totalDataLength = -skippedMoves << 1;
1.3042 + current = finalRoot;
1.3043 + while (current) {
1.3044 + totalCommandsLength += current.commands.length;
1.3045 + totalDataLength += current.data.length;
1.3046 + current = current.next;
1.3047 + }
1.3048 + var shape = new ShapePath(path.fillStyle, path.lineStyle, totalCommandsLength, totalDataLength, isMorph, transferables);
1.3049 + var allCommands = shape.commands;
1.3050 + var allData = shape.data;
1.3051 + var allMorphData = shape.morphData;
1.3052 + var commandsIndex = 0;
1.3053 + var dataIndex = 0;
1.3054 + current = finalRoot;
1.3055 + while (current) {
1.3056 + var commands = current.commands;
1.3057 + var data = current.data;
1.3058 + var morphData = current.morphData;
1.3059 + var offset = +(data[0] === allData[dataIndex - 2] && data[1] === allData[dataIndex - 1]);
1.3060 + for (var i = offset; i < commands.length; i++, commandsIndex++) {
1.3061 + allCommands[commandsIndex] = commands[i];
1.3062 + }
1.3063 + for (i = offset << 1; i < data.length; i++, dataIndex++) {
1.3064 + allData[dataIndex] = data[i];
1.3065 + if (isMorph) {
1.3066 + allMorphData[dataIndex] = morphData[i];
1.3067 + }
1.3068 + }
1.3069 + current = current.next;
1.3070 + }
1.3071 + return shape;
1.3072 +}
1.3073 +var CAPS_STYLE_TYPES = [
1.3074 + 'round',
1.3075 + 'none',
1.3076 + 'square'
1.3077 + ];
1.3078 +var JOIN_STYLE_TYPES = [
1.3079 + 'round',
1.3080 + 'bevel',
1.3081 + 'miter'
1.3082 + ];
1.3083 +function processStyle(style, isLineStyle, dictionary, dependencies) {
1.3084 + if (isLineStyle) {
1.3085 + style.lineCap = CAPS_STYLE_TYPES[style.endCapStyle | 0];
1.3086 + style.lineJoin = JOIN_STYLE_TYPES[style.joinStyle | 0];
1.3087 + style.miterLimit = (style.miterLimitFactor || 1.5) * 2;
1.3088 + if (!style.color && style.hasFill) {
1.3089 + var fillStyle = processStyle(style.fillStyle, false, dictionary, dependencies);
1.3090 + style.style = fillStyle.style;
1.3091 + style.type = fillStyle.type;
1.3092 + style.transform = fillStyle.transform;
1.3093 + style.records = fillStyle.records;
1.3094 + style.focalPoint = fillStyle.focalPoint;
1.3095 + style.bitmapId = fillStyle.bitmapId;
1.3096 + style.repeat = fillStyle.repeat;
1.3097 + style.fillStyle = null;
1.3098 + return style;
1.3099 + }
1.3100 + }
1.3101 + var color;
1.3102 + if (style.type === undefined || style.type === GRAPHICS_FILL_SOLID) {
1.3103 + color = style.color;
1.3104 + style.style = 'rgba(' + color.red + ',' + color.green + ',' + color.blue + ',' + color.alpha / 255 + ')';
1.3105 + style.color = null;
1.3106 + return style;
1.3107 + }
1.3108 + var scale;
1.3109 + switch (style.type) {
1.3110 + case GRAPHICS_FILL_LINEAR_GRADIENT:
1.3111 + case GRAPHICS_FILL_RADIAL_GRADIENT:
1.3112 + case GRAPHICS_FILL_FOCAL_RADIAL_GRADIENT:
1.3113 + scale = 819.2;
1.3114 + break;
1.3115 + case GRAPHICS_FILL_REPEATING_BITMAP:
1.3116 + case GRAPHICS_FILL_CLIPPED_BITMAP:
1.3117 + case GRAPHICS_FILL_NONSMOOTHED_REPEATING_BITMAP:
1.3118 + case GRAPHICS_FILL_NONSMOOTHED_CLIPPED_BITMAP:
1.3119 + if (dictionary[style.bitmapId]) {
1.3120 + dependencies.push(dictionary[style.bitmapId].id);
1.3121 + scale = 0.05;
1.3122 + }
1.3123 + break;
1.3124 + default:
1.3125 + fail('invalid fill style', 'shape');
1.3126 + }
1.3127 + if (!style.matrix) {
1.3128 + return style;
1.3129 + }
1.3130 + var matrix = style.matrix;
1.3131 + style.transform = {
1.3132 + a: matrix.a * scale,
1.3133 + b: matrix.b * scale,
1.3134 + c: matrix.c * scale,
1.3135 + d: matrix.d * scale,
1.3136 + e: matrix.tx,
1.3137 + f: matrix.ty
1.3138 + };
1.3139 + style.matrix = null;
1.3140 + return style;
1.3141 +}
1.3142 +function createPathsList(styles, isLineStyle, dictionary, dependencies) {
1.3143 + var paths = [];
1.3144 + for (var i = 0; i < styles.length; i++) {
1.3145 + var style = processStyle(styles[i], isLineStyle, dictionary, dependencies);
1.3146 + if (!isLineStyle) {
1.3147 + paths[i] = new SegmentedPath(style, null);
1.3148 + } else {
1.3149 + paths[i] = new SegmentedPath(null, style);
1.3150 + }
1.3151 + }
1.3152 + return paths;
1.3153 +}
1.3154 +function defineShape(tag, dictionary) {
1.3155 + var dependencies = [];
1.3156 + var transferables = [];
1.3157 + var fillPaths = createPathsList(tag.fillStyles, false, dictionary, dependencies);
1.3158 + var linePaths = createPathsList(tag.lineStyles, true, dictionary, dependencies);
1.3159 + var paths = convertRecordsToStyledPaths(tag.records, fillPaths, linePaths, dictionary, dependencies, tag.recordsMorph || null, transferables);
1.3160 + if (tag.bboxMorph) {
1.3161 + var mbox = tag.bboxMorph;
1.3162 + extendBoundsByPoint(tag.bbox, mbox.xMin, mbox.yMin);
1.3163 + extendBoundsByPoint(tag.bbox, mbox.xMax, mbox.yMax);
1.3164 + mbox = tag.strokeBboxMorph;
1.3165 + if (mbox) {
1.3166 + extendBoundsByPoint(tag.strokeBbox, mbox.xMin, mbox.yMin);
1.3167 + extendBoundsByPoint(tag.strokeBbox, mbox.xMax, mbox.yMax);
1.3168 + }
1.3169 + }
1.3170 + return {
1.3171 + type: 'shape',
1.3172 + id: tag.id,
1.3173 + strokeBbox: tag.strokeBbox,
1.3174 + strokeBboxMorph: tag.strokeBboxMorph,
1.3175 + bbox: tag.bbox,
1.3176 + bboxMorph: tag.bboxMorph,
1.3177 + isMorph: tag.isMorph,
1.3178 + paths: paths,
1.3179 + require: dependencies.length ? dependencies : null,
1.3180 + transferables: transferables
1.3181 + };
1.3182 +}
1.3183 +function logShape(paths, bbox) {
1.3184 + var output = '{"bounds":' + JSON.stringify(bbox) + ',"paths":[' + paths.map(function (path) {
1.3185 + return path.serialize();
1.3186 + }).join() + ']}';
1.3187 + console.log(output);
1.3188 +}
1.3189 +function SegmentedPath(fillStyle, lineStyle) {
1.3190 + this.fillStyle = fillStyle;
1.3191 + this.lineStyle = lineStyle;
1.3192 + this._head = null;
1.3193 +}
1.3194 +SegmentedPath.prototype = {
1.3195 + addSegment: function (commands, data, morphData) {
1.3196 + var segment = {
1.3197 + commands: commands,
1.3198 + data: data,
1.3199 + morphData: morphData,
1.3200 + prev: this._head,
1.3201 + next: null
1.3202 + };
1.3203 + if (this._head) {
1.3204 + this._head.next = segment;
1.3205 + }
1.3206 + this._head = segment;
1.3207 + return segment;
1.3208 + },
1.3209 + removeSegment: function (segment) {
1.3210 + if (segment.prev) {
1.3211 + segment.prev.next = segment.next;
1.3212 + }
1.3213 + if (segment.next) {
1.3214 + segment.next.prev = segment.prev;
1.3215 + }
1.3216 + },
1.3217 + insertSegment: function (segment, next) {
1.3218 + var prev = next.prev;
1.3219 + segment.prev = prev;
1.3220 + segment.next = next;
1.3221 + if (prev) {
1.3222 + prev.next = segment;
1.3223 + }
1.3224 + next.prev = segment;
1.3225 + },
1.3226 + head: function () {
1.3227 + return this._head;
1.3228 + },
1.3229 + segmentsConnect: function (first, second) {
1.3230 + var firstLength = first.data.length;
1.3231 + return first.data[firstLength - 2] === second.data[0] && first.data[firstLength - 1] === second.data[1];
1.3232 + }
1.3233 +};
1.3234 +var SHAPE_MOVE_TO = 1;
1.3235 +var SHAPE_LINE_TO = 2;
1.3236 +var SHAPE_CURVE_TO = 3;
1.3237 +var SHAPE_WIDE_MOVE_TO = 4;
1.3238 +var SHAPE_WIDE_LINE_TO = 5;
1.3239 +var SHAPE_CUBIC_CURVE_TO = 6;
1.3240 +var SHAPE_CIRCLE = 7;
1.3241 +var SHAPE_ELLIPSE = 8;
1.3242 +function ShapePath(fillStyle, lineStyle, commandsCount, dataLength, isMorph, transferables) {
1.3243 + this.fillStyle = fillStyle;
1.3244 + this.lineStyle = lineStyle;
1.3245 + if (commandsCount) {
1.3246 + this.commands = new Uint8Array(commandsCount);
1.3247 + this.data = new Int32Array(dataLength);
1.3248 + this.morphData = isMorph ? new Int32Array(dataLength) : null;
1.3249 + } else {
1.3250 + this.commands = [];
1.3251 + this.data = [];
1.3252 + }
1.3253 + this.bounds = null;
1.3254 + this.strokeBounds = null;
1.3255 + this.isMorph = !(!isMorph);
1.3256 + this.fullyInitialized = false;
1.3257 + if (inWorker) {
1.3258 + this.buffers = [
1.3259 + this.commands.buffer,
1.3260 + this.data.buffer
1.3261 + ];
1.3262 + transferables.push(this.commands.buffer, this.data.buffer);
1.3263 + if (isMorph) {
1.3264 + this.buffers.push(this.morphData.buffer);
1.3265 + transferables.push(this.morphData.buffer);
1.3266 + }
1.3267 + } else {
1.3268 + this.buffers = null;
1.3269 + }
1.3270 +}
1.3271 +ShapePath.prototype = {
1.3272 + get isEmpty() {
1.3273 + return this.commands.length === 0;
1.3274 + },
1.3275 + moveTo: function (x, y) {
1.3276 + if (this.commands[this.commands.length - 1] === SHAPE_MOVE_TO) {
1.3277 + this.data[this.data.length - 2] = x;
1.3278 + this.data[this.data.length - 1] = y;
1.3279 + return;
1.3280 + }
1.3281 + this.commands.push(SHAPE_MOVE_TO);
1.3282 + this.data.push(x, y);
1.3283 + },
1.3284 + lineTo: function (x, y) {
1.3285 + this.commands.push(SHAPE_LINE_TO);
1.3286 + this.data.push(x, y);
1.3287 + },
1.3288 + curveTo: function (controlX, controlY, anchorX, anchorY) {
1.3289 + this.commands.push(SHAPE_CURVE_TO);
1.3290 + this.data.push(controlX, controlY, anchorX, anchorY);
1.3291 + },
1.3292 + cubicCurveTo: function (control1X, control1Y, control2X, control2Y, anchorX, anchorY) {
1.3293 + this.commands.push(SHAPE_CUBIC_CURVE_TO);
1.3294 + this.data.push(control1X, control1Y, control2X, control2Y, anchorX, anchorY);
1.3295 + },
1.3296 + rect: function (x, y, w, h) {
1.3297 + var x2 = x + w;
1.3298 + var y2 = y + h;
1.3299 + this.commands.push(SHAPE_MOVE_TO, SHAPE_LINE_TO, SHAPE_LINE_TO, SHAPE_LINE_TO, SHAPE_LINE_TO);
1.3300 + this.data.push(x, y, x2, y, x2, y2, x, y2, x, y);
1.3301 + },
1.3302 + circle: function (x, y, radius) {
1.3303 + this.commands.push(SHAPE_CIRCLE);
1.3304 + this.data.push(x, y, radius);
1.3305 + },
1.3306 + ellipse: function (x, y, radiusX, radiusY) {
1.3307 + this.commands.push(SHAPE_ELLIPSE);
1.3308 + this.data.push(x, y, radiusX, radiusY);
1.3309 + },
1.3310 + draw: function (ctx, clip, ratio, colorTransform) {
1.3311 + if (clip && !this.fillStyle) {
1.3312 + return;
1.3313 + }
1.3314 + ctx.beginPath();
1.3315 + var commands = this.commands;
1.3316 + var data = this.data;
1.3317 + var morphData = this.morphData;
1.3318 + var formOpen = false;
1.3319 + var formOpenX = 0;
1.3320 + var formOpenY = 0;
1.3321 + if (!this.isMorph) {
1.3322 + for (var j = 0, k = 0; j < commands.length; j++) {
1.3323 + switch (commands[j]) {
1.3324 + case SHAPE_MOVE_TO:
1.3325 + formOpen = true;
1.3326 + formOpenX = data[k++] / 20;
1.3327 + formOpenY = data[k++] / 20;
1.3328 + ctx.moveTo(formOpenX, formOpenY);
1.3329 + break;
1.3330 + case SHAPE_WIDE_MOVE_TO:
1.3331 + ctx.moveTo(data[k++] / 20, data[k++] / 20);
1.3332 + k += 2;
1.3333 + break;
1.3334 + case SHAPE_LINE_TO:
1.3335 + ctx.lineTo(data[k++] / 20, data[k++] / 20);
1.3336 + break;
1.3337 + case SHAPE_WIDE_LINE_TO:
1.3338 + ctx.lineTo(data[k++] / 20, data[k++] / 20);
1.3339 + k += 2;
1.3340 + break;
1.3341 + case SHAPE_CURVE_TO:
1.3342 + ctx.quadraticCurveTo(data[k++] / 20, data[k++] / 20, data[k++] / 20, data[k++] / 20);
1.3343 + break;
1.3344 + case SHAPE_CUBIC_CURVE_TO:
1.3345 + ctx.bezierCurveTo(data[k++] / 20, data[k++] / 20, data[k++] / 20, data[k++] / 20, data[k++] / 20, data[k++] / 20);
1.3346 + break;
1.3347 + case SHAPE_CIRCLE:
1.3348 + if (formOpen) {
1.3349 + ctx.lineTo(formOpenX, formOpenY);
1.3350 + formOpen = false;
1.3351 + }
1.3352 + ctx.moveTo((data[k] + data[k + 2]) / 20, data[k + 1] / 20);
1.3353 + ctx.arc(data[k++] / 20, data[k++] / 20, data[k++] / 20, 0, Math.PI * 2, false);
1.3354 + break;
1.3355 + case SHAPE_ELLIPSE:
1.3356 + if (formOpen) {
1.3357 + ctx.lineTo(formOpenX, formOpenY);
1.3358 + formOpen = false;
1.3359 + }
1.3360 + var x = data[k++];
1.3361 + var y = data[k++];
1.3362 + var rX = data[k++];
1.3363 + var rY = data[k++];
1.3364 + var radius;
1.3365 + if (rX !== rY) {
1.3366 + ctx.save();
1.3367 + var ellipseScale;
1.3368 + if (rX > rY) {
1.3369 + ellipseScale = rX / rY;
1.3370 + radius = rY;
1.3371 + x /= ellipseScale;
1.3372 + ctx.scale(ellipseScale, 1);
1.3373 + } else {
1.3374 + ellipseScale = rY / rX;
1.3375 + radius = rX;
1.3376 + y /= ellipseScale;
1.3377 + ctx.scale(1, ellipseScale);
1.3378 + }
1.3379 + }
1.3380 + ctx.moveTo((x + radius) / 20, y / 20);
1.3381 + ctx.arc(x / 20, y / 20, radius / 20, 0, Math.PI * 2, false);
1.3382 + if (rX !== rY) {
1.3383 + ctx.restore();
1.3384 + }
1.3385 + break;
1.3386 + default:
1.3387 + if (commands[j] === 0 && j === commands.length - 1) {
1.3388 + break;
1.3389 + }
1.3390 + console.warn('Unknown drawing command encountered: ' + commands[j]);
1.3391 + }
1.3392 + }
1.3393 + } else {
1.3394 + for (var j = 0, k = 0; j < commands.length; j++) {
1.3395 + switch (commands[j]) {
1.3396 + case SHAPE_MOVE_TO:
1.3397 + ctx.moveTo(morph(data[k] / 20, morphData[k++] / 20, ratio), morph(data[k] / 20, morphData[k++] / 20, ratio));
1.3398 + break;
1.3399 + case SHAPE_LINE_TO:
1.3400 + ctx.lineTo(morph(data[k] / 20, morphData[k++] / 20, ratio), morph(data[k] / 20, morphData[k++] / 20, ratio));
1.3401 + break;
1.3402 + case SHAPE_CURVE_TO:
1.3403 + ctx.quadraticCurveTo(morph(data[k] / 20, morphData[k++] / 20, ratio), morph(data[k] / 20, morphData[k++] / 20, ratio), morph(data[k] / 20, morphData[k++] / 20, ratio), morph(data[k] / 20, morphData[k++] / 20, ratio));
1.3404 + break;
1.3405 + default:
1.3406 + console.warn('Drawing command not supported for morph shapes: ' + commands[j]);
1.3407 + }
1.3408 + }
1.3409 + }
1.3410 + if (!clip) {
1.3411 + var fillStyle = this.fillStyle;
1.3412 + if (fillStyle) {
1.3413 + colorTransform.setFillStyle(ctx, fillStyle.style);
1.3414 + ctx.imageSmoothingEnabled = ctx.mozImageSmoothingEnabled = fillStyle.smooth;
1.3415 + var m = fillStyle.transform;
1.3416 + ctx.save();
1.3417 + colorTransform.setAlpha(ctx);
1.3418 + if (m) {
1.3419 + ctx.transform(m.a, m.b, m.c, m.d, m.e / 20, m.f / 20);
1.3420 + }
1.3421 + ctx.fill();
1.3422 + ctx.restore();
1.3423 + }
1.3424 + var lineStyle = this.lineStyle;
1.3425 + if (lineStyle) {
1.3426 + colorTransform.setStrokeStyle(ctx, lineStyle.style);
1.3427 + ctx.save();
1.3428 + colorTransform.setAlpha(ctx);
1.3429 + ctx.lineWidth = Math.max(lineStyle.width / 20, 1);
1.3430 + ctx.lineCap = lineStyle.lineCap;
1.3431 + ctx.lineJoin = lineStyle.lineJoin;
1.3432 + ctx.miterLimit = lineStyle.miterLimit;
1.3433 + ctx.stroke();
1.3434 + ctx.restore();
1.3435 + }
1.3436 + } else {
1.3437 + ctx.fill();
1.3438 + }
1.3439 + ctx.closePath();
1.3440 + },
1.3441 + isPointInPath: function (x, y) {
1.3442 + if (!(this.fillStyle || this.lineStyle)) {
1.3443 + return false;
1.3444 + }
1.3445 + var bounds = this.strokeBounds || this.bounds || this._calculateBounds();
1.3446 + if (x < bounds.xMin || x > bounds.xMax || y < bounds.yMin || y > bounds.yMax) {
1.3447 + return false;
1.3448 + }
1.3449 + if (this.fillStyle && this.isPointInFill(x, y)) {
1.3450 + return true;
1.3451 + }
1.3452 + return this.lineStyle && this.lineStyle.width !== undefined && this.isPointInStroke(x, y);
1.3453 + },
1.3454 + isPointInFill: function (x, y) {
1.3455 + var commands = this.commands;
1.3456 + var data = this.data;
1.3457 + var length = commands.length;
1.3458 + var inside = false;
1.3459 + var fromX = 0;
1.3460 + var fromY = 0;
1.3461 + var toX = 0;
1.3462 + var toY = 0;
1.3463 + var localX;
1.3464 + var localY;
1.3465 + var cpX;
1.3466 + var cpY;
1.3467 + var rX;
1.3468 + var rY;
1.3469 + var formOpen = false;
1.3470 + var formOpenX = 0;
1.3471 + var formOpenY = 0;
1.3472 + for (var commandIndex = 0, dataIndex = 0; commandIndex < length; commandIndex++) {
1.3473 + switch (commands[commandIndex]) {
1.3474 + case SHAPE_WIDE_MOVE_TO:
1.3475 + dataIndex += 2;
1.3476 + case SHAPE_MOVE_TO:
1.3477 + toX = data[dataIndex++];
1.3478 + toY = data[dataIndex++];
1.3479 + if (formOpen && intersectsLine(x, y, fromX, fromY, formOpenX, formOpenY)) {
1.3480 + inside = !inside;
1.3481 + }
1.3482 + formOpen = true;
1.3483 + formOpenX = toX;
1.3484 + formOpenY = toY;
1.3485 + break;
1.3486 + case SHAPE_WIDE_LINE_TO:
1.3487 + dataIndex += 2;
1.3488 + case SHAPE_LINE_TO:
1.3489 + toX = data[dataIndex++];
1.3490 + toY = data[dataIndex++];
1.3491 + if (intersectsLine(x, y, fromX, fromY, toX, toY)) {
1.3492 + inside = !inside;
1.3493 + }
1.3494 + break;
1.3495 + case SHAPE_CURVE_TO:
1.3496 + cpX = data[dataIndex++];
1.3497 + cpY = data[dataIndex++];
1.3498 + toX = data[dataIndex++];
1.3499 + toY = data[dataIndex++];
1.3500 + if (cpY > y === fromY > y && toY > y === fromY > y) {
1.3501 + break;
1.3502 + }
1.3503 + if (fromX >= x && cpX >= x && toX >= x) {
1.3504 + inside = !inside;
1.3505 + break;
1.3506 + }
1.3507 + var a = fromY - 2 * cpY + toY;
1.3508 + var c = fromY - y;
1.3509 + var b = 2 * (cpY - fromY);
1.3510 + var d = b * b - 4 * a * c;
1.3511 + if (d < 0) {
1.3512 + break;
1.3513 + }
1.3514 + d = Math.sqrt(d);
1.3515 + a = 1 / (a + a);
1.3516 + var t1 = (d - b) * a;
1.3517 + var t2 = (-b - d) * a;
1.3518 + if (t1 >= 0 && t1 <= 1 && quadraticBezier(fromX, cpX, toX, t1) > x) {
1.3519 + inside = !inside;
1.3520 + }
1.3521 + if (t2 >= 0 && t2 <= 1 && quadraticBezier(fromX, cpX, toX, t2) > x) {
1.3522 + inside = !inside;
1.3523 + }
1.3524 + break;
1.3525 + case SHAPE_CUBIC_CURVE_TO:
1.3526 + cpX = data[dataIndex++];
1.3527 + cpY = data[dataIndex++];
1.3528 + var cp2X = data[dataIndex++];
1.3529 + var cp2Y = data[dataIndex++];
1.3530 + toX = data[dataIndex++];
1.3531 + toY = data[dataIndex++];
1.3532 + if (cpY > y === fromY > y && cp2Y > y === fromY > y && toY > y === fromY > y) {
1.3533 + break;
1.3534 + }
1.3535 + if (fromX >= x && cpX >= x && cp2X >= x && toX >= x) {
1.3536 + inside = !inside;
1.3537 + break;
1.3538 + }
1.3539 + var roots = cubicXAtY(fromX, fromY, cpX, cpY, cp2X, cp2Y, toX, toY, y);
1.3540 + for (var i = roots.length; i--;) {
1.3541 + if (roots[i] >= x) {
1.3542 + inside = !inside;
1.3543 + }
1.3544 + }
1.3545 + break;
1.3546 + case SHAPE_CIRCLE:
1.3547 + toX = data[dataIndex++];
1.3548 + toY = data[dataIndex++];
1.3549 + var r = data[dataIndex++];
1.3550 + localX = x - toX;
1.3551 + localY = y - toY;
1.3552 + if (localX * localX + localY * localY < r * r) {
1.3553 + inside = !inside;
1.3554 + }
1.3555 + toX += r;
1.3556 + break;
1.3557 + case SHAPE_ELLIPSE:
1.3558 + cpX = data[dataIndex++];
1.3559 + cpY = data[dataIndex++];
1.3560 + rX = data[dataIndex++];
1.3561 + rY = data[dataIndex++];
1.3562 + localX = x - cpX;
1.3563 + localY = y - cpY;
1.3564 + if (localX * localX / (rX * rX) + localY * localY / (rY * rY) <= 1) {
1.3565 + inside = !inside;
1.3566 + }
1.3567 + toX = cpX + rX;
1.3568 + toY = cpY;
1.3569 + break;
1.3570 + default:
1.3571 + if (!inWorker) {
1.3572 + console.warn('Drawing command not handled in isPointInPath: ' + commands[commandIndex]);
1.3573 + }
1.3574 + }
1.3575 + fromX = toX;
1.3576 + fromY = toY;
1.3577 + }
1.3578 + if (formOpen && intersectsLine(x, y, fromX, fromY, formOpenX, formOpenY)) {
1.3579 + inside = !inside;
1.3580 + }
1.3581 + return inside;
1.3582 + },
1.3583 + isPointInStroke: function (x, y) {
1.3584 + var commands = this.commands;
1.3585 + var data = this.data;
1.3586 + var length = commands.length;
1.3587 + var width = this.lineStyle.width;
1.3588 + var halfWidth = width / 2;
1.3589 + var halfWidthSq = halfWidth * halfWidth;
1.3590 + var minX = x - halfWidth;
1.3591 + var maxX = x + halfWidth;
1.3592 + var minY = y - halfWidth;
1.3593 + var maxY = y + halfWidth;
1.3594 + var fromX = 0;
1.3595 + var fromY = 0;
1.3596 + var toX = 0;
1.3597 + var toY = 0;
1.3598 + var localX;
1.3599 + var localY;
1.3600 + var cpX;
1.3601 + var cpY;
1.3602 + var rX;
1.3603 + var rY;
1.3604 + var curveX;
1.3605 + var curveY;
1.3606 + var t;
1.3607 + for (var commandIndex = 0, dataIndex = 0; commandIndex < length; commandIndex++) {
1.3608 + switch (commands[commandIndex]) {
1.3609 + case SHAPE_WIDE_MOVE_TO:
1.3610 + dataIndex += 2;
1.3611 + case SHAPE_MOVE_TO:
1.3612 + toX = data[dataIndex++];
1.3613 + toY = data[dataIndex++];
1.3614 + break;
1.3615 + case SHAPE_WIDE_LINE_TO:
1.3616 + dataIndex += 2;
1.3617 + case SHAPE_LINE_TO:
1.3618 + toX = data[dataIndex++];
1.3619 + toY = data[dataIndex++];
1.3620 + if (fromX === toX && fromY === toY) {
1.3621 + break;
1.3622 + }
1.3623 + if (maxX < fromX && maxX < toX || minX > fromX && minX > toX || maxY < fromY && maxY < toY || minY > fromY && minY > toY) {
1.3624 + break;
1.3625 + }
1.3626 + if (toX === fromX || toY === fromY) {
1.3627 + return true;
1.3628 + }
1.3629 + t = ((x - fromX) * (toX - fromX) + (y - fromY) * (toY - fromY)) / distanceSq(fromX, fromY, toX, toY);
1.3630 + if (t < 0) {
1.3631 + if (distanceSq(x, y, fromX, fromY) <= halfWidthSq) {
1.3632 + return true;
1.3633 + }
1.3634 + break;
1.3635 + }
1.3636 + if (t > 1) {
1.3637 + if (distanceSq(x, y, toX, toY) <= halfWidthSq) {
1.3638 + return true;
1.3639 + }
1.3640 + break;
1.3641 + }
1.3642 + if (distanceSq(x, y, fromX + t * (toX - fromX), fromY + t * (toY - fromY)) <= halfWidthSq) {
1.3643 + return true;
1.3644 + }
1.3645 + break;
1.3646 + case SHAPE_CURVE_TO:
1.3647 + cpX = data[dataIndex++];
1.3648 + cpY = data[dataIndex++];
1.3649 + toX = data[dataIndex++];
1.3650 + toY = data[dataIndex++];
1.3651 + var extremeX = quadraticBezierExtreme(fromX, cpX, toX);
1.3652 + if (maxX < fromX && maxX < extremeX && maxX < toX || minX > fromX && minX > extremeX && minX > toX) {
1.3653 + break;
1.3654 + }
1.3655 + var extremeY = quadraticBezierExtreme(fromY, cpY, toY);
1.3656 + if (maxY < fromY && maxY < extremeY && maxY < toY || minY > fromY && minY > extremeY && minY > toY) {
1.3657 + break;
1.3658 + }
1.3659 + for (t = 0; t < 1; t += 0.02) {
1.3660 + curveX = quadraticBezier(fromX, cpX, toX, t);
1.3661 + if (curveX < minX || curveX > maxX) {
1.3662 + continue;
1.3663 + }
1.3664 + curveY = quadraticBezier(fromY, cpY, toY, t);
1.3665 + if (curveY < minY || curveY > maxY) {
1.3666 + continue;
1.3667 + }
1.3668 + if ((x - curveX) * (x - curveX) + (y - curveY) * (y - curveY) < halfWidthSq) {
1.3669 + return true;
1.3670 + }
1.3671 + }
1.3672 + break;
1.3673 + case SHAPE_CUBIC_CURVE_TO:
1.3674 + cpX = data[dataIndex++];
1.3675 + cpY = data[dataIndex++];
1.3676 + var cp2X = data[dataIndex++];
1.3677 + var cp2Y = data[dataIndex++];
1.3678 + toX = data[dataIndex++];
1.3679 + toY = data[dataIndex++];
1.3680 + var extremesX = cubicBezierExtremes(fromX, cpX, cp2X, toX);
1.3681 + while (extremesX.length < 2) {
1.3682 + extremesX.push(toX);
1.3683 + }
1.3684 + if (maxX < fromX && maxX < toX && maxX < extremesX[0] && maxX < extremesX[1] || minX > fromX && minX > toX && minX > extremesX[0] && minX > extremesX[1]) {
1.3685 + break;
1.3686 + }
1.3687 + var extremesY = cubicBezierExtremes(fromY, cpY, cp2Y, toY);
1.3688 + while (extremesY.length < 2) {
1.3689 + extremesY.push(toY);
1.3690 + }
1.3691 + if (maxY < fromY && maxY < toY && maxY < extremesY[0] && maxY < extremesY[1] || minY > fromY && minY > toY && minY > extremesY[0] && minY > extremesY[1]) {
1.3692 + break;
1.3693 + }
1.3694 + for (t = 0; t < 1; t += 0.02) {
1.3695 + curveX = cubicBezier(fromX, cpX, cp2X, toX, t);
1.3696 + if (curveX < minX || curveX > maxX) {
1.3697 + continue;
1.3698 + }
1.3699 + curveY = cubicBezier(fromY, cpY, cp2Y, toY, t);
1.3700 + if (curveY < minY || curveY > maxY) {
1.3701 + continue;
1.3702 + }
1.3703 + if ((x - curveX) * (x - curveX) + (y - curveY) * (y - curveY) < halfWidthSq) {
1.3704 + return true;
1.3705 + }
1.3706 + }
1.3707 + break;
1.3708 + case SHAPE_CIRCLE:
1.3709 + cpX = data[dataIndex++];
1.3710 + cpY = data[dataIndex++];
1.3711 + var r = data[dataIndex++];
1.3712 + toX = cpX + r;
1.3713 + toY = cpY;
1.3714 + if (maxX < cpX - r || minX > cpX + r || maxY < cpY - r || minY > cpY + r) {
1.3715 + break;
1.3716 + }
1.3717 + localX = x - cpX;
1.3718 + localY = y - cpY;
1.3719 + var rMin = r - halfWidth;
1.3720 + var rMax = r + halfWidth;
1.3721 + var distSq = localX * localX + localY * localY;
1.3722 + if (distSq >= rMin * rMin && distSq <= rMax * rMax) {
1.3723 + return true;
1.3724 + }
1.3725 + break;
1.3726 + case SHAPE_ELLIPSE:
1.3727 + cpX = data[dataIndex++];
1.3728 + cpY = data[dataIndex++];
1.3729 + rX = data[dataIndex++];
1.3730 + rY = data[dataIndex++];
1.3731 + toX = cpX + rX;
1.3732 + toY = cpY;
1.3733 + localX = Math.abs(x - cpX);
1.3734 + localY = Math.abs(y - cpY);
1.3735 + localX -= halfWidth;
1.3736 + localY -= halfWidth;
1.3737 + if (localX * localX / (rX * rX) + localY * localY / (rY * rY) > 1) {
1.3738 + break;
1.3739 + }
1.3740 + localX += width;
1.3741 + localY += width;
1.3742 + if (localX * localX / (rX * rX) + localY * localY / (rY * rY) > 1) {
1.3743 + return true;
1.3744 + }
1.3745 + break;
1.3746 + default:
1.3747 + if (!inWorker) {
1.3748 + console.warn('Drawing command not handled in isPointInPath: ' + commands[commandIndex]);
1.3749 + }
1.3750 + }
1.3751 + fromX = toX;
1.3752 + fromY = toY;
1.3753 + }
1.3754 + return false;
1.3755 + },
1.3756 + getBounds: function (includeStroke) {
1.3757 + var bounds = includeStroke ? this.strokeBounds : this.bounds;
1.3758 + if (!bounds) {
1.3759 + this._calculateBounds();
1.3760 + bounds = includeStroke ? this.strokeBounds : this.bounds;
1.3761 + }
1.3762 + return bounds;
1.3763 + },
1.3764 + _calculateBounds: function () {
1.3765 + var commands = this.commands;
1.3766 + var data = this.data;
1.3767 + var length = commands.length;
1.3768 + var bounds;
1.3769 + if (commands[0] === SHAPE_MOVE_TO || commands[0] > SHAPE_CUBIC_CURVE_TO) {
1.3770 + bounds = {
1.3771 + xMin: data[0],
1.3772 + yMin: data[1]
1.3773 + };
1.3774 + } else {
1.3775 + bounds = {
1.3776 + xMin: 0,
1.3777 + yMin: 0
1.3778 + };
1.3779 + }
1.3780 + bounds.xMax = bounds.xMin;
1.3781 + bounds.yMax = bounds.yMin;
1.3782 + var fromX = bounds.xMin;
1.3783 + var fromY = bounds.yMin;
1.3784 + for (var commandIndex = 0, dataIndex = 0; commandIndex < length; commandIndex++) {
1.3785 + var toX;
1.3786 + var toY;
1.3787 + var cpX;
1.3788 + var cpY;
1.3789 + switch (commands[commandIndex]) {
1.3790 + case SHAPE_WIDE_MOVE_TO:
1.3791 + dataIndex += 2;
1.3792 + case SHAPE_MOVE_TO:
1.3793 + toX = data[dataIndex++];
1.3794 + toY = data[dataIndex++];
1.3795 + extendBoundsByPoint(bounds, toX, toY);
1.3796 + break;
1.3797 + case SHAPE_WIDE_LINE_TO:
1.3798 + dataIndex += 2;
1.3799 + case SHAPE_LINE_TO:
1.3800 + toX = data[dataIndex++];
1.3801 + toY = data[dataIndex++];
1.3802 + extendBoundsByPoint(bounds, toX, toY);
1.3803 + break;
1.3804 + case SHAPE_CURVE_TO:
1.3805 + cpX = data[dataIndex++];
1.3806 + cpY = data[dataIndex++];
1.3807 + toX = data[dataIndex++];
1.3808 + toY = data[dataIndex++];
1.3809 + extendBoundsByPoint(bounds, toX, toY);
1.3810 + if (cpX < fromX || cpX > toX) {
1.3811 + extendBoundsByX(bounds, quadraticBezierExtreme(fromX, cpX, toX));
1.3812 + }
1.3813 + if (cpY < fromY || cpY > toY) {
1.3814 + extendBoundsByY(bounds, quadraticBezierExtreme(fromY, cpY, toY));
1.3815 + }
1.3816 + break;
1.3817 + case SHAPE_CUBIC_CURVE_TO:
1.3818 + cpX = data[dataIndex++];
1.3819 + cpY = data[dataIndex++];
1.3820 + var cp2X = data[dataIndex++];
1.3821 + var cp2Y = data[dataIndex++];
1.3822 + toX = data[dataIndex++];
1.3823 + toY = data[dataIndex++];
1.3824 + extendBoundsByPoint(bounds, toX, toY);
1.3825 + var extremes;
1.3826 + var i;
1.3827 + if (cpX < fromX || cp2X < fromX || cpX > toX || cp2X > toX) {
1.3828 + extremes = cubicBezierExtremes(fromX, cpX, cp2X, toX);
1.3829 + for (i = extremes.length; i--;) {
1.3830 + extendBoundsByX(bounds, extremes[i]);
1.3831 + }
1.3832 + }
1.3833 + if (cpY < fromY || cp2Y < fromY || cpY > toY || cp2Y > toY) {
1.3834 + extremes = cubicBezierExtremes(fromY, cpY, cp2Y, toY);
1.3835 + for (i = extremes.length; i--;) {
1.3836 + extendBoundsByY(bounds, extremes[i]);
1.3837 + }
1.3838 + }
1.3839 + break;
1.3840 + case SHAPE_CIRCLE:
1.3841 + toX = data[dataIndex++];
1.3842 + toY = data[dataIndex++];
1.3843 + var radius = data[dataIndex++];
1.3844 + extendBoundsByPoint(bounds, toX - radius, toY - radius);
1.3845 + extendBoundsByPoint(bounds, toX + radius, toY + radius);
1.3846 + toX += radius;
1.3847 + break;
1.3848 + case SHAPE_ELLIPSE:
1.3849 + toX = data[dataIndex++];
1.3850 + toY = data[dataIndex++];
1.3851 + var radiusX = data[dataIndex++];
1.3852 + var radiusY = data[dataIndex++];
1.3853 + extendBoundsByPoint(bounds, toX - radiusX, toY - radiusY);
1.3854 + extendBoundsByPoint(bounds, toX + radiusX, toY + radiusY);
1.3855 + toX += radiusX;
1.3856 + break;
1.3857 + default:
1.3858 + if (!inWorker) {
1.3859 + console.warn('Drawing command not handled in bounds calculation: ' + commands[commandIndex]);
1.3860 + }
1.3861 + }
1.3862 + fromX = toX;
1.3863 + fromY = toY;
1.3864 + }
1.3865 + this.bounds = bounds;
1.3866 + if (this.lineStyle) {
1.3867 + var halfLineWidth = this.lineStyle.width / 2;
1.3868 + this.strokeBounds = {
1.3869 + xMin: bounds.xMin - halfLineWidth,
1.3870 + yMin: bounds.yMin - halfLineWidth,
1.3871 + xMax: bounds.xMax + halfLineWidth,
1.3872 + yMax: bounds.yMax + halfLineWidth
1.3873 + };
1.3874 + return this.strokeBounds;
1.3875 + } else {
1.3876 + this.strokeBounds = bounds;
1.3877 + }
1.3878 + return bounds;
1.3879 + },
1.3880 + serialize: function () {
1.3881 + var output = '{';
1.3882 + if (this.fillStyle) {
1.3883 + output += '"fill":' + JSON.stringify(this.fillStyle) + ',';
1.3884 + }
1.3885 + if (this.lineStyle) {
1.3886 + output += '"stroke":' + JSON.stringify(this.lineStyle) + ',';
1.3887 + }
1.3888 + output += '"commands":[' + Array.apply([], this.commands).join() + '],';
1.3889 + output += '"data":[' + Array.apply([], this.data).join() + ']';
1.3890 + return output + '}';
1.3891 + }
1.3892 +};
1.3893 +ShapePath.fromPlainObject = function (obj) {
1.3894 + var path = new ShapePath(obj.fill || null, obj.stroke || null);
1.3895 + path.commands = new Uint8Array(obj.commands);
1.3896 + path.data = new Int32Array(obj.data);
1.3897 + if (!inWorker) {
1.3898 + finishShapePath(path);
1.3899 + }
1.3900 + return path;
1.3901 +};
1.3902 +function distanceSq(x1, y1, x2, y2) {
1.3903 + var dX = x2 - x1;
1.3904 + var dY = y2 - y1;
1.3905 + return dX * dX + dY * dY;
1.3906 +}
1.3907 +function intersectsLine(x, y, x1, y1, x2, y2) {
1.3908 + return y2 > y !== y1 > y && x < (x1 - x2) * (y - y2) / (y1 - y2) + x2;
1.3909 +}
1.3910 +function quadraticBezier(from, cp, to, t) {
1.3911 + var inverseT = 1 - t;
1.3912 + return from * inverseT * inverseT + 2 * cp * inverseT * t + to * t * t;
1.3913 +}
1.3914 +function quadraticBezierExtreme(from, cp, to) {
1.3915 + var t = (from - cp) / (from - 2 * cp + to);
1.3916 + if (t < 0) {
1.3917 + return from;
1.3918 + }
1.3919 + if (t > 1) {
1.3920 + return to;
1.3921 + }
1.3922 + return quadraticBezier(from, cp, to, t);
1.3923 +}
1.3924 +function cubicBezier(from, cp, cp2, to, t) {
1.3925 + var tSq = t * t;
1.3926 + var inverseT = 1 - t;
1.3927 + var inverseTSq = inverseT * inverseT;
1.3928 + return from * inverseT * inverseTSq + 3 * cp * t * inverseTSq + 3 * cp2 * inverseT * tSq + to * t * tSq;
1.3929 +}
1.3930 +function cubicBezierExtremes(from, cp, cp2, to) {
1.3931 + var d1 = cp - from;
1.3932 + var d2 = cp2 - cp;
1.3933 + d2 *= 2;
1.3934 + var d3 = to - cp2;
1.3935 + if (d1 + d3 === d2) {
1.3936 + d3 *= 1.0001;
1.3937 + }
1.3938 + var fHead = 2 * d1 - d2;
1.3939 + var part1 = d2 - 2 * d1;
1.3940 + var fCenter = Math.sqrt(part1 * part1 - 4 * d1 * (d1 - d2 + d3));
1.3941 + var fTail = 2 * (d1 - d2 + d3);
1.3942 + var t1 = (fHead + fCenter) / fTail;
1.3943 + var t2 = (fHead - fCenter) / fTail;
1.3944 + var result = [];
1.3945 + if (t1 >= 0 && t1 <= 1) {
1.3946 + result.push(cubicBezier(from, cp, cp2, to, t1));
1.3947 + }
1.3948 + if (t2 >= 0 && t2 <= 1) {
1.3949 + result.push(cubicBezier(from, cp, cp2, to, t2));
1.3950 + }
1.3951 + return result;
1.3952 +}
1.3953 +function cubicXAtY(x0, y0, cx, cy, cx1, cy1, x1, y1, y) {
1.3954 + var dX = 3 * (cx - x0);
1.3955 + var dY = 3 * (cy - y0);
1.3956 + var bX = 3 * (cx1 - cx) - dX;
1.3957 + var bY = 3 * (cy1 - cy) - dY;
1.3958 + var c3X = x1 - x0 - dX - bX;
1.3959 + var c3Y = y1 - y0 - dY - bY;
1.3960 + function f(t) {
1.3961 + return t * (dY + t * (bY + t * c3Y)) + y0 - y;
1.3962 + }
1.3963 + function pointAt(t) {
1.3964 + if (t < 0) {
1.3965 + t = 0;
1.3966 + } else if (t > 1) {
1.3967 + t = 1;
1.3968 + }
1.3969 + return x0 + t * (dX + t * (bX + t * c3X));
1.3970 + }
1.3971 + function bisectCubicBezierRange(f, l, r, limit) {
1.3972 + if (Math.abs(r - l) <= limit) {
1.3973 + return;
1.3974 + }
1.3975 + var middle = 0.5 * (l + r);
1.3976 + if (f(l) * f(r) <= 0) {
1.3977 + left = l;
1.3978 + right = r;
1.3979 + return;
1.3980 + }
1.3981 + bisectCubicBezierRange(f, l, middle, limit);
1.3982 + bisectCubicBezierRange(f, middle, r, limit);
1.3983 + }
1.3984 + var left = 0;
1.3985 + var right = 1;
1.3986 + bisectCubicBezierRange(f, 0, 1, 0.05);
1.3987 + var t0 = findRoot(left, right, f, 50, 0.000001);
1.3988 + var evalResult = Math.abs(f(t0));
1.3989 + if (evalResult > 0.00001) {
1.3990 + return [];
1.3991 + }
1.3992 + var result = [];
1.3993 + if (t0 <= 1) {
1.3994 + result.push(pointAt(t0));
1.3995 + }
1.3996 + var a = c3Y;
1.3997 + var b = t0 * a + bY;
1.3998 + var c = t0 * b + dY;
1.3999 + var d = b * b - 4 * a * c;
1.4000 + if (d < 0) {
1.4001 + return result;
1.4002 + }
1.4003 + d = Math.sqrt(d);
1.4004 + a = 1 / (a + a);
1.4005 + var t1 = (d - b) * a;
1.4006 + var t2 = (-b - d) * a;
1.4007 + if (t1 >= 0 && t1 <= 1) {
1.4008 + result.push(pointAt(t1));
1.4009 + }
1.4010 + if (t2 >= 0 && t2 <= 1) {
1.4011 + result.push(pointAt(t2));
1.4012 + }
1.4013 + return result;
1.4014 +}
1.4015 +function findRoot(x0, x2, f, maxIterations, epsilon) {
1.4016 + var x1;
1.4017 + var y0;
1.4018 + var y1;
1.4019 + var y2;
1.4020 + var b;
1.4021 + var c;
1.4022 + var y10;
1.4023 + var y20;
1.4024 + var y21;
1.4025 + var xm;
1.4026 + var ym;
1.4027 + var temp;
1.4028 + var xmlast = x0;
1.4029 + y0 = f(x0);
1.4030 + if (y0 === 0) {
1.4031 + return x0;
1.4032 + }
1.4033 + y2 = f(x2);
1.4034 + if (y2 === 0) {
1.4035 + return x2;
1.4036 + }
1.4037 + if (y2 * y0 > 0) {
1.4038 + return x0;
1.4039 + }
1.4040 + var __iter = 0;
1.4041 + for (var i = 0; i < maxIterations; ++i) {
1.4042 + __iter++;
1.4043 + x1 = 0.5 * (x2 + x0);
1.4044 + y1 = f(x1);
1.4045 + if (y1 === 0) {
1.4046 + return x1;
1.4047 + }
1.4048 + if (Math.abs(x1 - x0) < epsilon) {
1.4049 + return x1;
1.4050 + }
1.4051 + if (y1 * y0 > 0) {
1.4052 + temp = x0;
1.4053 + x0 = x2;
1.4054 + x2 = temp;
1.4055 + temp = y0;
1.4056 + y0 = y2;
1.4057 + y2 = temp;
1.4058 + }
1.4059 + y10 = y1 - y0;
1.4060 + y21 = y2 - y1;
1.4061 + y20 = y2 - y0;
1.4062 + if (y2 * y20 < 2 * y1 * y10) {
1.4063 + x2 = x1;
1.4064 + y2 = y1;
1.4065 + } else {
1.4066 + b = (x1 - x0) / y10;
1.4067 + c = (y10 - y21) / (y21 * y20);
1.4068 + xm = x0 - b * y0 * (1 - c * y1);
1.4069 + ym = f(xm);
1.4070 + if (ym === 0) {
1.4071 + return xm;
1.4072 + }
1.4073 + if (Math.abs(xm - xmlast) < epsilon) {
1.4074 + return xm;
1.4075 + }
1.4076 + xmlast = xm;
1.4077 + if (ym * y0 < 0) {
1.4078 + x2 = xm;
1.4079 + y2 = ym;
1.4080 + } else {
1.4081 + x0 = xm;
1.4082 + y0 = ym;
1.4083 + x2 = x1;
1.4084 + y2 = y1;
1.4085 + }
1.4086 + }
1.4087 + }
1.4088 + return x1;
1.4089 +}
1.4090 +function extendBoundsByPoint(bounds, x, y) {
1.4091 + if (x < bounds.xMin) {
1.4092 + bounds.xMin = x;
1.4093 + } else if (x > bounds.xMax) {
1.4094 + bounds.xMax = x;
1.4095 + }
1.4096 + if (y < bounds.yMin) {
1.4097 + bounds.yMin = y;
1.4098 + } else if (y > bounds.yMax) {
1.4099 + bounds.yMax = y;
1.4100 + }
1.4101 +}
1.4102 +function extendBoundsByX(bounds, x) {
1.4103 + if (x < bounds.xMin) {
1.4104 + bounds.xMin = x;
1.4105 + } else if (x > bounds.xMax) {
1.4106 + bounds.xMax = x;
1.4107 + }
1.4108 +}
1.4109 +function extendBoundsByY(bounds, y) {
1.4110 + if (y < bounds.yMin) {
1.4111 + bounds.yMin = y;
1.4112 + } else if (y > bounds.yMax) {
1.4113 + bounds.yMax = y;
1.4114 + }
1.4115 +}
1.4116 +function morph(start, end, ratio) {
1.4117 + return start + (end - start) * ratio;
1.4118 +}
1.4119 +function finishShapePath(path, dictionaryResolved) {
1.4120 + if (path.fullyInitialized) {
1.4121 + return path;
1.4122 + }
1.4123 + if (!(path instanceof ShapePath)) {
1.4124 + var untypedPath = path;
1.4125 + path = new ShapePath(path.fillStyle, path.lineStyle, 0, 0, path.isMorph);
1.4126 + path.commands = new Uint8Array(untypedPath.buffers[0]);
1.4127 + path.data = new Int32Array(untypedPath.buffers[1]);
1.4128 + if (untypedPath.isMorph) {
1.4129 + path.morphData = new Int32Array(untypedPath.buffers[2]);
1.4130 + }
1.4131 + path.buffers = null;
1.4132 + }
1.4133 + path.fillStyle && initStyle(path.fillStyle, dictionaryResolved);
1.4134 + path.lineStyle && initStyle(path.lineStyle, dictionaryResolved);
1.4135 + path.fullyInitialized = true;
1.4136 + return path;
1.4137 +}
1.4138 +var inWorker = typeof window === 'undefined';
1.4139 +var factoryCtx = !inWorker ? document.createElement('canvas').getContext('2d') : null;
1.4140 +function buildLinearGradientFactory(colorStops) {
1.4141 + var defaultGradient = factoryCtx.createLinearGradient(-1, 0, 1, 0);
1.4142 + for (var i = 0; i < colorStops.length; i++) {
1.4143 + defaultGradient.addColorStop(colorStops[i].ratio, colorStops[i].color);
1.4144 + }
1.4145 + var fn = function createLinearGradient(ctx, colorTransform) {
1.4146 + var gradient = ctx.createLinearGradient(-1, 0, 1, 0);
1.4147 + for (var i = 0; i < colorStops.length; i++) {
1.4148 + colorTransform.addGradientColorStop(gradient, colorStops[i].ratio, colorStops[i].color);
1.4149 + }
1.4150 + return gradient;
1.4151 + };
1.4152 + fn.defaultFillStyle = defaultGradient;
1.4153 + return fn;
1.4154 +}
1.4155 +function buildRadialGradientFactory(focalPoint, colorStops) {
1.4156 + var defaultGradient = factoryCtx.createRadialGradient(focalPoint, 0, 0, 0, 0, 1);
1.4157 + for (var i = 0; i < colorStops.length; i++) {
1.4158 + defaultGradient.addColorStop(colorStops[i].ratio, colorStops[i].color);
1.4159 + }
1.4160 + var fn = function createRadialGradient(ctx, colorTransform) {
1.4161 + var gradient = ctx.createRadialGradient(focalPoint, 0, 0, 0, 0, 1);
1.4162 + for (var i = 0; i < colorStops.length; i++) {
1.4163 + colorTransform.addGradientColorStop(gradient, colorStops[i].ratio, colorStops[i].color);
1.4164 + }
1.4165 + return gradient;
1.4166 + };
1.4167 + fn.defaultFillStyle = defaultGradient;
1.4168 + return fn;
1.4169 +}
1.4170 +function buildBitmapPatternFactory(img, repeat) {
1.4171 + var defaultPattern = factoryCtx.createPattern(img, repeat);
1.4172 + var cachedTransform, cachedTransformKey;
1.4173 + var fn = function createBitmapPattern(ctx, colorTransform) {
1.4174 + if (!colorTransform.mode) {
1.4175 + return defaultPattern;
1.4176 + }
1.4177 + var key = colorTransform.getTransformFingerprint();
1.4178 + if (key === cachedTransformKey) {
1.4179 + return cachedTransform;
1.4180 + }
1.4181 + var canvas = document.createElement('canvas');
1.4182 + canvas.width = img.width;
1.4183 + canvas.height = img.height;
1.4184 + var ctx = canvas.getContext('2d');
1.4185 + colorTransform.setAlpha(ctx, true);
1.4186 + ctx.drawImage(img, 0, 0);
1.4187 + cachedTransform = ctx.createPattern(canvas, repeat);
1.4188 + cachedTransformKey = key;
1.4189 + return cachedTransform;
1.4190 + };
1.4191 + fn.defaultFillStyle = defaultPattern;
1.4192 + return fn;
1.4193 +}
1.4194 +function initStyle(style, dictionaryResolved) {
1.4195 + if (style.type === undefined) {
1.4196 + return;
1.4197 + }
1.4198 + switch (style.type) {
1.4199 + case GRAPHICS_FILL_SOLID:
1.4200 + break;
1.4201 + case GRAPHICS_FILL_LINEAR_GRADIENT:
1.4202 + case GRAPHICS_FILL_RADIAL_GRADIENT:
1.4203 + case GRAPHICS_FILL_FOCAL_RADIAL_GRADIENT:
1.4204 + var records = style.records, colorStops = [];
1.4205 + for (var j = 0, n = records.length; j < n; j++) {
1.4206 + var record = records[j];
1.4207 + var colorStr = rgbaObjToStr(record.color);
1.4208 + colorStops.push({
1.4209 + ratio: record.ratio / 255,
1.4210 + color: colorStr
1.4211 + });
1.4212 + }
1.4213 + var gradientConstructor;
1.4214 + var isLinear = style.type === GRAPHICS_FILL_LINEAR_GRADIENT;
1.4215 + if (isLinear) {
1.4216 + gradientConstructor = buildLinearGradientFactory(colorStops);
1.4217 + } else {
1.4218 + gradientConstructor = buildRadialGradientFactory((style.focalPoint | 0) / 20, colorStops);
1.4219 + }
1.4220 + style.style = gradientConstructor;
1.4221 + break;
1.4222 + case GRAPHICS_FILL_REPEATING_BITMAP:
1.4223 + case GRAPHICS_FILL_CLIPPED_BITMAP:
1.4224 + case GRAPHICS_FILL_NONSMOOTHED_REPEATING_BITMAP:
1.4225 + case GRAPHICS_FILL_NONSMOOTHED_CLIPPED_BITMAP:
1.4226 + var bitmap = dictionaryResolved[style.bitmapId];
1.4227 + var repeat = style.type === GRAPHICS_FILL_REPEATING_BITMAP || style.type === GRAPHICS_FILL_NONSMOOTHED_REPEATING_BITMAP;
1.4228 + style.style = buildBitmapPatternFactory(bitmap.props.img, repeat ? 'repeat' : 'no-repeat');
1.4229 + break;
1.4230 + default:
1.4231 + fail('invalid fill style', 'shape');
1.4232 + }
1.4233 +}
1.4234 +var SOUND_SIZE_8_BIT = 0;
1.4235 +var SOUND_SIZE_16_BIT = 1;
1.4236 +var SOUND_TYPE_MONO = 0;
1.4237 +var SOUND_TYPE_STEREO = 1;
1.4238 +var SOUND_FORMAT_PCM_BE = 0;
1.4239 +var SOUND_FORMAT_ADPCM = 1;
1.4240 +var SOUND_FORMAT_MP3 = 2;
1.4241 +var SOUND_FORMAT_PCM_LE = 3;
1.4242 +var SOUND_FORMAT_NELLYMOSER_16 = 4;
1.4243 +var SOUND_FORMAT_NELLYMOSER_8 = 5;
1.4244 +var SOUND_FORMAT_NELLYMOSER = 6;
1.4245 +var SOUND_FORMAT_SPEEX = 11;
1.4246 +var SOUND_RATES = [
1.4247 + 5512,
1.4248 + 11250,
1.4249 + 22500,
1.4250 + 44100
1.4251 + ];
1.4252 +var WaveHeader = new Uint8Array([
1.4253 + 82,
1.4254 + 73,
1.4255 + 70,
1.4256 + 70,
1.4257 + 0,
1.4258 + 0,
1.4259 + 0,
1.4260 + 0,
1.4261 + 87,
1.4262 + 65,
1.4263 + 86,
1.4264 + 69,
1.4265 + 102,
1.4266 + 109,
1.4267 + 116,
1.4268 + 32,
1.4269 + 16,
1.4270 + 0,
1.4271 + 0,
1.4272 + 0,
1.4273 + 1,
1.4274 + 0,
1.4275 + 2,
1.4276 + 0,
1.4277 + 68,
1.4278 + 172,
1.4279 + 0,
1.4280 + 0,
1.4281 + 16,
1.4282 + 177,
1.4283 + 2,
1.4284 + 0,
1.4285 + 4,
1.4286 + 0,
1.4287 + 16,
1.4288 + 0,
1.4289 + 100,
1.4290 + 97,
1.4291 + 116,
1.4292 + 97,
1.4293 + 0,
1.4294 + 0,
1.4295 + 0,
1.4296 + 0
1.4297 + ]);
1.4298 +function packageWave(data, sampleRate, channels, size, swapBytes) {
1.4299 + var sizeInBytes = size >> 3;
1.4300 + var sizePerSecond = channels * sampleRate * sizeInBytes;
1.4301 + var sizePerSample = channels * sizeInBytes;
1.4302 + var dataLength = data.length + (data.length & 1);
1.4303 + var buffer = new ArrayBuffer(WaveHeader.length + dataLength);
1.4304 + var bytes = new Uint8Array(buffer);
1.4305 + bytes.set(WaveHeader);
1.4306 + if (swapBytes) {
1.4307 + for (var i = 0, j = WaveHeader.length; i < data.length; i += 2, j += 2) {
1.4308 + bytes[j] = data[i + 1];
1.4309 + bytes[j + 1] = data[i];
1.4310 + }
1.4311 + } else {
1.4312 + bytes.set(data, WaveHeader.length);
1.4313 + }
1.4314 + var view = new DataView(buffer);
1.4315 + view.setUint32(4, dataLength + 36, true);
1.4316 + view.setUint16(22, channels, true);
1.4317 + view.setUint32(24, sampleRate, true);
1.4318 + view.setUint32(28, sizePerSecond, true);
1.4319 + view.setUint16(32, sizePerSample, true);
1.4320 + view.setUint16(34, size, true);
1.4321 + view.setUint32(40, dataLength, true);
1.4322 + return {
1.4323 + data: bytes,
1.4324 + mimeType: 'audio/wav'
1.4325 + };
1.4326 +}
1.4327 +function defineSound(tag, dictionary) {
1.4328 + var channels = tag.soundType == SOUND_TYPE_STEREO ? 2 : 1;
1.4329 + var samplesCount = tag.samplesCount;
1.4330 + var sampleRate = SOUND_RATES[tag.soundRate];
1.4331 + var data = tag.soundData;
1.4332 + var pcm, packaged;
1.4333 + switch (tag.soundFormat) {
1.4334 + case SOUND_FORMAT_PCM_BE:
1.4335 + pcm = new Float32Array(samplesCount * channels);
1.4336 + if (tag.soundSize == SOUND_SIZE_16_BIT) {
1.4337 + for (var i = 0, j = 0; i < pcm.length; i++, j += 2)
1.4338 + pcm[i] = (data[j] << 24 | data[j + 1] << 16) / 2147483648;
1.4339 + packaged = packageWave(data, sampleRate, channels, 16, true);
1.4340 + } else {
1.4341 + for (var i = 0; i < pcm.length; i++)
1.4342 + pcm[i] = (data[i] - 128) / 128;
1.4343 + packaged = packageWave(data, sampleRate, channels, 8, false);
1.4344 + }
1.4345 + break;
1.4346 + case SOUND_FORMAT_PCM_LE:
1.4347 + pcm = new Float32Array(samplesCount * channels);
1.4348 + if (tag.soundSize == SOUND_SIZE_16_BIT) {
1.4349 + for (var i = 0, j = 0; i < pcm.length; i++, j += 2)
1.4350 + pcm[i] = (data[j + 1] << 24 | data[j] << 16) / 2147483648;
1.4351 + packaged = packageWave(data, sampleRate, channels, 16, false);
1.4352 + } else {
1.4353 + for (var i = 0; i < pcm.length; i++)
1.4354 + pcm[i] = (data[i] - 128) / 128;
1.4355 + packaged = packageWave(data, sampleRate, channels, 8, false);
1.4356 + }
1.4357 + break;
1.4358 + case SOUND_FORMAT_MP3:
1.4359 + packaged = {
1.4360 + data: new Uint8Array(data.subarray(2)),
1.4361 + mimeType: 'audio/mpeg'
1.4362 + };
1.4363 + break;
1.4364 + case SOUND_FORMAT_ADPCM:
1.4365 + var pcm16 = new Int16Array(samplesCount * channels);
1.4366 + decodeACPCMSoundData(data, pcm16, channels);
1.4367 + pcm = new Float32Array(samplesCount * channels);
1.4368 + for (var i = 0; i < pcm.length; i++)
1.4369 + pcm[i] = pcm16[i] / 32768;
1.4370 + packaged = packageWave(new Uint8Array(pcm16.buffer), sampleRate, channels, 16, !new Uint8Array(new Uint16Array([
1.4371 + 1
1.4372 + ]).buffer)[0]);
1.4373 + break;
1.4374 + default:
1.4375 + throw new Error('Unsupported audio format: ' + tag.soundFormat);
1.4376 + }
1.4377 + var sound = {
1.4378 + type: 'sound',
1.4379 + id: tag.id,
1.4380 + sampleRate: sampleRate,
1.4381 + channels: channels,
1.4382 + pcm: pcm
1.4383 + };
1.4384 + if (packaged)
1.4385 + sound.packaged = packaged;
1.4386 + return sound;
1.4387 +}
1.4388 +var ACPCMIndexTables = [
1.4389 + [
1.4390 + -1,
1.4391 + 2
1.4392 + ],
1.4393 + [
1.4394 + -1,
1.4395 + -1,
1.4396 + 2,
1.4397 + 4
1.4398 + ],
1.4399 + [
1.4400 + -1,
1.4401 + -1,
1.4402 + -1,
1.4403 + -1,
1.4404 + 2,
1.4405 + 4,
1.4406 + 6,
1.4407 + 8
1.4408 + ],
1.4409 + [
1.4410 + -1,
1.4411 + -1,
1.4412 + -1,
1.4413 + -1,
1.4414 + -1,
1.4415 + -1,
1.4416 + -1,
1.4417 + -1,
1.4418 + 1,
1.4419 + 2,
1.4420 + 4,
1.4421 + 6,
1.4422 + 8,
1.4423 + 10,
1.4424 + 13,
1.4425 + 16
1.4426 + ]
1.4427 + ];
1.4428 +var ACPCMStepSizeTable = [
1.4429 + 7,
1.4430 + 8,
1.4431 + 9,
1.4432 + 10,
1.4433 + 11,
1.4434 + 12,
1.4435 + 13,
1.4436 + 14,
1.4437 + 16,
1.4438 + 17,
1.4439 + 19,
1.4440 + 21,
1.4441 + 23,
1.4442 + 25,
1.4443 + 28,
1.4444 + 31,
1.4445 + 34,
1.4446 + 37,
1.4447 + 41,
1.4448 + 45,
1.4449 + 50,
1.4450 + 55,
1.4451 + 60,
1.4452 + 66,
1.4453 + 73,
1.4454 + 80,
1.4455 + 88,
1.4456 + 97,
1.4457 + 107,
1.4458 + 118,
1.4459 + 130,
1.4460 + 143,
1.4461 + 157,
1.4462 + 173,
1.4463 + 190,
1.4464 + 209,
1.4465 + 230,
1.4466 + 253,
1.4467 + 279,
1.4468 + 307,
1.4469 + 337,
1.4470 + 371,
1.4471 + 408,
1.4472 + 449,
1.4473 + 494,
1.4474 + 544,
1.4475 + 598,
1.4476 + 658,
1.4477 + 724,
1.4478 + 796,
1.4479 + 876,
1.4480 + 963,
1.4481 + 1060,
1.4482 + 1166,
1.4483 + 1282,
1.4484 + 1411,
1.4485 + 1552,
1.4486 + 1707,
1.4487 + 1878,
1.4488 + 2066,
1.4489 + 2272,
1.4490 + 2499,
1.4491 + 2749,
1.4492 + 3024,
1.4493 + 3327,
1.4494 + 3660,
1.4495 + 4026,
1.4496 + 4428,
1.4497 + 4871,
1.4498 + 5358,
1.4499 + 5894,
1.4500 + 6484,
1.4501 + 7132,
1.4502 + 7845,
1.4503 + 8630,
1.4504 + 9493,
1.4505 + 10442,
1.4506 + 11487,
1.4507 + 12635,
1.4508 + 13899,
1.4509 + 15289,
1.4510 + 16818,
1.4511 + 18500,
1.4512 + 20350,
1.4513 + 22385,
1.4514 + 24623,
1.4515 + 27086,
1.4516 + 29794,
1.4517 + 32767
1.4518 + ];
1.4519 +function decodeACPCMSoundData(data, pcm16, channels) {
1.4520 + function readBits(n, signed) {
1.4521 + while (dataBufferLength < n) {
1.4522 + dataBuffer = dataBuffer << 8 | data[dataPosition++];
1.4523 + dataBufferLength += 8;
1.4524 + }
1.4525 + dataBufferLength -= n;
1.4526 + return dataBuffer >>> dataBufferLength & (1 << n) - 1;
1.4527 + }
1.4528 + var dataPosition = 0;
1.4529 + var dataBuffer = 0;
1.4530 + var dataBufferLength = 0;
1.4531 + var pcmPosition = 0;
1.4532 + var codeSize = readBits(2);
1.4533 + var indexTable = ACPCMIndexTables[codeSize];
1.4534 + while (pcmPosition < pcm16.length) {
1.4535 + var x = pcm16[pcmPosition++] = readBits(16) << 16 >> 16, x2;
1.4536 + var stepIndex = readBits(6), stepIndex2;
1.4537 + if (channels > 1) {
1.4538 + x2 = pcm16[pcmPosition++] = readBits(16) << 16 >> 16;
1.4539 + stepIndex2 = readBits(6);
1.4540 + }
1.4541 + var signMask = 1 << codeSize + 1;
1.4542 + for (var i = 0; i < 4095; i++) {
1.4543 + var nibble = readBits(codeSize + 2);
1.4544 + var step = ACPCMStepSizeTable[stepIndex];
1.4545 + var sum = 0;
1.4546 + for (var currentBit = signMask >> 1; currentBit; currentBit >>= 1, step >>= 1) {
1.4547 + if (nibble & currentBit)
1.4548 + sum += step;
1.4549 + }
1.4550 + x += (nibble & signMask ? -1 : 1) * (sum + step);
1.4551 + pcm16[pcmPosition++] = x = x < -32768 ? -32768 : x > 32767 ? 32767 : x;
1.4552 + stepIndex += indexTable[nibble & ~signMask];
1.4553 + stepIndex = stepIndex < 0 ? 0 : stepIndex > 88 ? 88 : stepIndex;
1.4554 + if (channels > 1) {
1.4555 + nibble = readBits(codeSize + 2);
1.4556 + step = ACPCMStepSizeTable[stepIndex2];
1.4557 + sum = 0;
1.4558 + for (var currentBit = signMask >> 1; currentBit; currentBit >>= 1, step >>= 1) {
1.4559 + if (nibble & currentBit)
1.4560 + sum += step;
1.4561 + }
1.4562 + x2 += (nibble & signMask ? -1 : 1) * (sum + step);
1.4563 + pcm16[pcmPosition++] = x2 = x2 < -32768 ? -32768 : x2 > 32767 ? 32767 : x2;
1.4564 + stepIndex2 += indexTable[nibble & ~signMask];
1.4565 + stepIndex2 = stepIndex2 < 0 ? 0 : stepIndex2 > 88 ? 88 : stepIndex2;
1.4566 + }
1.4567 + }
1.4568 + }
1.4569 +}
1.4570 +var nextSoundStreamId = 0;
1.4571 +function SwfSoundStream(samplesCount, sampleRate, channels) {
1.4572 + this.streamId = nextSoundStreamId++;
1.4573 + this.samplesCount = samplesCount;
1.4574 + this.sampleRate = sampleRate;
1.4575 + this.channels = channels;
1.4576 + this.format = null;
1.4577 + this.currentSample = 0;
1.4578 +}
1.4579 +SwfSoundStream.prototype = {
1.4580 + get info() {
1.4581 + return {
1.4582 + samplesCount: this.samplesCount,
1.4583 + sampleRate: this.sampleRate,
1.4584 + channels: this.channels,
1.4585 + format: this.format,
1.4586 + streamId: this.streamId
1.4587 + };
1.4588 + },
1.4589 + decode: function (data) {
1.4590 + throw new Error('SwfSoundStream.decode: not implemented');
1.4591 + }
1.4592 +};
1.4593 +function SwfSoundStream_decode_PCM(data) {
1.4594 + var pcm = new Float32Array(data.length);
1.4595 + for (var i = 0; i < pcm.length; i++)
1.4596 + pcm[i] = (data[i] - 128) / 128;
1.4597 + this.currentSample += pcm.length / this.channels;
1.4598 + return {
1.4599 + streamId: this.streamId,
1.4600 + samplesCount: pcm.length / this.channels,
1.4601 + pcm: pcm
1.4602 + };
1.4603 +}
1.4604 +function SwfSoundStream_decode_PCM_be(data) {
1.4605 + var pcm = new Float32Array(data.length / 2);
1.4606 + for (var i = 0, j = 0; i < pcm.length; i++, j += 2)
1.4607 + pcm[i] = (data[j] << 24 | data[j + 1] << 16) / 2147483648;
1.4608 + this.currentSample += pcm.length / this.channels;
1.4609 + return {
1.4610 + streamId: this.streamId,
1.4611 + samplesCount: pcm.length / this.channels,
1.4612 + pcm: pcm
1.4613 + };
1.4614 +}
1.4615 +function SwfSoundStream_decode_PCM_le(data) {
1.4616 + var pcm = new Float32Array(data.length / 2);
1.4617 + for (var i = 0, j = 0; i < pcm.length; i++, j += 2)
1.4618 + pcm[i] = (data[j + 1] << 24 | data[j] << 16) / 2147483648;
1.4619 + this.currentSample += pcm.length / this.channels;
1.4620 + return {
1.4621 + streamId: this.streamId,
1.4622 + samplesCount: pcm.length / this.channels,
1.4623 + pcm: pcm
1.4624 + };
1.4625 +}
1.4626 +function SwfSoundStream_decode_MP3(data) {
1.4627 + var samplesCount = data[1] << 8 | data[0];
1.4628 + var seek = data[3] << 8 | data[2];
1.4629 + this.currentSample += samplesCount;
1.4630 + return {
1.4631 + streamId: this.streamId,
1.4632 + samplesCount: samplesCount,
1.4633 + data: new Uint8Array(data.subarray(4)),
1.4634 + seek: seek
1.4635 + };
1.4636 +}
1.4637 +function createSoundStream(tag) {
1.4638 + var channels = tag.streamType == SOUND_TYPE_STEREO ? 2 : 1;
1.4639 + var samplesCount = tag.samplesCount;
1.4640 + var sampleRate = SOUND_RATES[tag.streamRate];
1.4641 + var stream = new SwfSoundStream(samplesCount, sampleRate, channels);
1.4642 + switch (tag.streamCompression) {
1.4643 + case SOUND_FORMAT_PCM_BE:
1.4644 + stream.format = 'wave';
1.4645 + if (tag.soundSize == SOUND_SIZE_16_BIT) {
1.4646 + stream.decode = SwfSoundStream_decode_PCM_be;
1.4647 + } else {
1.4648 + stream.decode = SwfSoundStream_decode_PCM;
1.4649 + }
1.4650 + break;
1.4651 + case SOUND_FORMAT_PCM_LE:
1.4652 + stream.format = 'wave';
1.4653 + if (tag.soundSize == SOUND_SIZE_16_BIT) {
1.4654 + stream.decode = SwfSoundStream_decode_PCM_le;
1.4655 + } else {
1.4656 + stream.decode = SwfSoundStream_decode_PCM;
1.4657 + }
1.4658 + break;
1.4659 + case SOUND_FORMAT_MP3:
1.4660 + stream.format = 'mp3';
1.4661 + stream.decode = SwfSoundStream_decode_MP3;
1.4662 + break;
1.4663 + default:
1.4664 + throw new Error('Unsupported audio format: ' + tag.soundFormat);
1.4665 + }
1.4666 + return stream;
1.4667 +}
1.4668 +function defineText(tag, dictionary) {
1.4669 + var dependencies = [];
1.4670 + if (tag.hasFont) {
1.4671 + var font = dictionary[tag.fontId];
1.4672 + tag.font = font.uniqueName;
1.4673 + dependencies.push(font.id);
1.4674 + }
1.4675 + var props = {
1.4676 + type: 'text',
1.4677 + id: tag.id,
1.4678 + variableName: tag.variableName,
1.4679 + tag: tag
1.4680 + };
1.4681 + if (dependencies.length)
1.4682 + props.require = dependencies;
1.4683 + return props;
1.4684 +}
1.4685 +var isWorker = typeof window === 'undefined';
1.4686 +if (isWorker) {
1.4687 + importScripts('../../../lib/mp3/mp3.js');
1.4688 + self.addEventListener('message', function (e) {
1.4689 + var data = e.data;
1.4690 + var sessionId = data.sessionId;
1.4691 + try {
1.4692 + switch (data.action) {
1.4693 + case 'create':
1.4694 + var session = new Session(sessionId);
1.4695 + sessions[sessionId] = session;
1.4696 + break;
1.4697 + case 'close':
1.4698 + var session = sessions[sessionId];
1.4699 + if (session) {
1.4700 + session.close();
1.4701 + sessions[sessionId] = null;
1.4702 + }
1.4703 + break;
1.4704 + case 'decode':
1.4705 + var session = sessions[sessionId];
1.4706 + if (!session) {
1.4707 + throw new Error('mp3 decoding session is unavailable');
1.4708 + }
1.4709 + session.decode(data.data);
1.4710 + break;
1.4711 + }
1.4712 + } catch (ex) {
1.4713 + self.postMessage({
1.4714 + sessionId: sessionId,
1.4715 + action: 'error',
1.4716 + message: ex.message
1.4717 + });
1.4718 + }
1.4719 + }, false);
1.4720 + var sessions = {};
1.4721 + function Session(id) {
1.4722 + this.id = id;
1.4723 + if (typeof MP3Decoder === 'undefined') {
1.4724 + throw new Error('mp3 decoder is not available');
1.4725 + }
1.4726 + var decoder = new MP3Decoder();
1.4727 + decoder.onframedata = function (frameData, channels, sampleRate, bitRate) {
1.4728 + self.postMessage({
1.4729 + sessionId: this.id,
1.4730 + action: 'frame',
1.4731 + frameData: frameData,
1.4732 + channels: channels,
1.4733 + sampleRate: sampleRate,
1.4734 + bitRate: bitRate
1.4735 + });
1.4736 + }.bind(this);
1.4737 + decoder.onid3tag = function (data) {
1.4738 + self.postMessage({
1.4739 + sessionId: this.id,
1.4740 + action: 'id3',
1.4741 + id3Data: data
1.4742 + });
1.4743 + }.bind(this);
1.4744 + this.decoder = decoder;
1.4745 + }
1.4746 + Session.prototype = {
1.4747 + decode: function (data) {
1.4748 + this.decoder.push(data);
1.4749 + },
1.4750 + close: function () {
1.4751 + self.postMessage({
1.4752 + sessionId: this.id,
1.4753 + action: 'closed'
1.4754 + });
1.4755 + }
1.4756 + };
1.4757 + self.console = {
1.4758 + log: function (s) {
1.4759 + self.postMessage({
1.4760 + action: 'console',
1.4761 + method: 'log',
1.4762 + message: s
1.4763 + });
1.4764 + },
1.4765 + error: function (s) {
1.4766 + self.postMessage({
1.4767 + action: 'console',
1.4768 + method: 'error',
1.4769 + message: s
1.4770 + });
1.4771 + }
1.4772 + };
1.4773 +} else {
1.4774 + var mp3Worker;
1.4775 + function createMP3Worker() {
1.4776 + var worker = new Worker(SHUMWAY_ROOT + 'swf/mp3worker.js');
1.4777 + worker.addEventListener('message', function (e) {
1.4778 + if (e.data.action === 'console') {
1.4779 + console[e.data.method].call(console, e.data.message);
1.4780 + }
1.4781 + });
1.4782 + return worker;
1.4783 + }
1.4784 + var nextSessionId = 0;
1.4785 + function MP3DecoderSession() {
1.4786 + mp3Worker = mp3Worker || createMP3Worker();
1.4787 + var sessionId = nextSessionId++;
1.4788 + this.id = sessionId;
1.4789 + this.onworkermessage = function (e) {
1.4790 + if (e.data.sessionId !== sessionId)
1.4791 + return;
1.4792 + var action = e.data.action;
1.4793 + switch (action) {
1.4794 + case 'closed':
1.4795 + if (this.onclosed)
1.4796 + this.onclosed();
1.4797 + mp3Worker.removeEventListener('message', this.onworkermessage, false);
1.4798 + break;
1.4799 + case 'frame':
1.4800 + this.onframedata(e.data.frameData, e.data.channels, e.data.sampleRate, e.data.bitRate);
1.4801 + break;
1.4802 + case 'id3':
1.4803 + if (this.onid3tag)
1.4804 + this.onid3tag(e.data.id3Data);
1.4805 + break;
1.4806 + case 'error':
1.4807 + if (this.onerror)
1.4808 + this.onerror(e.data.message);
1.4809 + break;
1.4810 + }
1.4811 + }.bind(this);
1.4812 + mp3Worker.addEventListener('message', this.onworkermessage, false);
1.4813 + mp3Worker.postMessage({
1.4814 + sessionId: sessionId,
1.4815 + action: 'create'
1.4816 + });
1.4817 + }
1.4818 + MP3DecoderSession.prototype = {
1.4819 + pushAsync: function (data) {
1.4820 + mp3Worker.postMessage({
1.4821 + sessionId: this.id,
1.4822 + action: 'decode',
1.4823 + data: data
1.4824 + });
1.4825 + },
1.4826 + close: function () {
1.4827 + mp3Worker.postMessage({
1.4828 + sessionId: this.id,
1.4829 + action: 'close'
1.4830 + });
1.4831 + }
1.4832 + };
1.4833 + MP3DecoderSession.processAll = function (data, onloaded) {
1.4834 + var currentBufferSize = 8000;
1.4835 + var currentBuffer = new Float32Array(currentBufferSize);
1.4836 + var bufferPosition = 0;
1.4837 + var id3Tags = [];
1.4838 + var sessionAborted = false;
1.4839 + var session = new MP3DecoderSession();
1.4840 + session.onframedata = function (frameData, channels, sampleRate, bitRate) {
1.4841 + var needed = frameData.length + bufferPosition;
1.4842 + if (needed > currentBufferSize) {
1.4843 + do {
1.4844 + currentBufferSize *= 2;
1.4845 + } while (needed > currentBufferSize);
1.4846 + var newBuffer = new Float32Array(currentBufferSize);
1.4847 + newBuffer.set(currentBuffer);
1.4848 + currentBuffer = newBuffer;
1.4849 + }
1.4850 + currentBuffer.set(frameData, bufferPosition);
1.4851 + bufferPosition += frameData.length;
1.4852 + };
1.4853 + session.onid3tag = function (tagData) {
1.4854 + id3Tags.push(tagData);
1.4855 + };
1.4856 + session.onclosed = function () {
1.4857 + if (sessionAborted)
1.4858 + return;
1.4859 + onloaded(currentBuffer.subarray(0, bufferPosition), id3Tags);
1.4860 + };
1.4861 + session.onerror = function (error) {
1.4862 + if (sessionAborted)
1.4863 + return;
1.4864 + sessionAborted = true;
1.4865 + onloaded(null, null, error);
1.4866 + };
1.4867 + session.pushAsync(data);
1.4868 + session.close();
1.4869 + };
1.4870 +}
1.4871 +SWF.embed = function (file, doc, container, options) {
1.4872 + var canvas = doc.createElement('canvas');
1.4873 + var ctx = canvas.getContext('2d');
1.4874 + var loader = new flash.display.Loader();
1.4875 + var loaderInfo = loader._contentLoaderInfo;
1.4876 + var stage = new flash.display.Stage();
1.4877 + var pixelRatio = 1;
1.4878 + var forceHidpiSetting = forceHidpi.value;
1.4879 + stage._loader = loader;
1.4880 + loaderInfo._parameters = options.movieParams;
1.4881 + loaderInfo._url = options.url || (typeof file === 'string' ? file : null);
1.4882 + loaderInfo._loaderURL = options.loaderURL || loaderInfo._url;
1.4883 + loader._parent = stage;
1.4884 + loader._stage = stage;
1.4885 + function setCanvasSize(width, height) {
1.4886 + if (pixelRatio === 1) {
1.4887 + canvas.width = width | 0;
1.4888 + canvas.height = height | 0;
1.4889 + return;
1.4890 + }
1.4891 + var canvasWidth = Math.floor(width * pixelRatio);
1.4892 + var canvasHeight = Math.floor(height * pixelRatio);
1.4893 + canvas.style.width = canvasWidth / pixelRatio + 'px';
1.4894 + canvas.style.height = canvasHeight / pixelRatio + 'px';
1.4895 + canvas.width = canvasWidth;
1.4896 + canvas.height = canvasHeight;
1.4897 + }
1.4898 + function fitCanvas(container) {
1.4899 + setCanvasSize(container.clientWidth, container.clientHeight);
1.4900 + stage._invalid = true;
1.4901 + }
1.4902 + loaderInfo._addEventListener('init', function () {
1.4903 + if (forceHidpiSetting || loaderInfo._swfVersion >= 18) {
1.4904 + pixelRatio = 'devicePixelRatio' in window ? window.devicePixelRatio : 1;
1.4905 + }
1.4906 + canvas._pixelRatio = pixelRatio;
1.4907 + stage._contentsScaleFactor = pixelRatio;
1.4908 + if (container.clientHeight) {
1.4909 + fitCanvas(container);
1.4910 + window.addEventListener('resize', function () {
1.4911 + fitCanvas(container);
1.4912 + });
1.4913 + } else {
1.4914 + setCanvasSize(stage._stageWidth / 20, stage._stageHeight / 20);
1.4915 + }
1.4916 + container.setAttribute('style', 'position: relative');
1.4917 + canvas.addEventListener('click', function () {
1.4918 + ShumwayKeyboardListener.focus = stage;
1.4919 + stage._mouseTarget._dispatchEvent('click');
1.4920 + });
1.4921 + canvas.addEventListener('dblclick', function () {
1.4922 + if (stage._mouseTarget._doubleClickEnabled) {
1.4923 + stage._mouseTarget._dispatchEvent('doubleClick');
1.4924 + }
1.4925 + });
1.4926 + canvas.addEventListener('mousedown', function () {
1.4927 + stage._mouseEvents.push('mousedown');
1.4928 + });
1.4929 + canvas.addEventListener('mousemove', function (domEvt) {
1.4930 + var node = this;
1.4931 + var left = 0;
1.4932 + var top = 0;
1.4933 + if (node.offsetParent) {
1.4934 + do {
1.4935 + left += node.offsetLeft;
1.4936 + top += node.offsetTop;
1.4937 + } while (node = node.offsetParent);
1.4938 + }
1.4939 + var m = stage._concatenatedTransform;
1.4940 + var mouseX = ((domEvt.pageX - left) * pixelRatio - m.tx / 20) / m.a;
1.4941 + var mouseY = ((domEvt.pageY - top) * pixelRatio - m.ty / 20) / m.d;
1.4942 + if (mouseX !== stage._mouseX || mouseY !== stage._mouseY) {
1.4943 + stage._mouseMoved = true;
1.4944 + stage._mouseX = mouseX * 20;
1.4945 + stage._mouseY = mouseY * 20;
1.4946 + }
1.4947 + });
1.4948 + canvas.addEventListener('mouseup', function () {
1.4949 + stage._mouseEvents.push('mouseup');
1.4950 + });
1.4951 + canvas.addEventListener('mouseover', function () {
1.4952 + stage._mouseMoved = true;
1.4953 + stage._mouseOver = true;
1.4954 + });
1.4955 + canvas.addEventListener('mouseout', function () {
1.4956 + stage._mouseMoved = true;
1.4957 + stage._mouseOver = false;
1.4958 + });
1.4959 + window.addEventListener('message', function (evt) {
1.4960 + var data = evt.data;
1.4961 + if (typeof data !== 'object' || data === null) {
1.4962 + return;
1.4963 + }
1.4964 + var type = data.type;
1.4965 + switch (type) {
1.4966 + case 'mousemove':
1.4967 + case 'mouseup':
1.4968 + case 'mousedown':
1.4969 + var isMouseMove = type === 'mousemove';
1.4970 + stage._mouseMoved = true;
1.4971 + stage._mouseOver = true;
1.4972 + stage._mouseX = data.x * 20;
1.4973 + stage._mouseY = data.y * 20;
1.4974 + if (!isMouseMove) {
1.4975 + stage._mouseEvents.push(type);
1.4976 + }
1.4977 + break;
1.4978 + case 'mouseover':
1.4979 + case 'mouseout':
1.4980 + stage._mouseMoved = true;
1.4981 + stage._mouseOver = type === 'mouseover';
1.4982 + break;
1.4983 + case 'keyup':
1.4984 + case 'keydown':
1.4985 + stage._dispatchEvent(new flash.events.KeyboardEvent(type === 'keyup' ? 'keyUp' : 'keyDown', true, false, data.charCode, data.keyCode, data.keyLocation, data.ctrlKey || false, data.altKey || false, data.shiftKey || false));
1.4986 + break;
1.4987 + }
1.4988 + }, false);
1.4989 + var bgcolor = loaderInfo._backgroundColor;
1.4990 + if (options.objectParams) {
1.4991 + var m;
1.4992 + if (options.objectParams.bgcolor && (m = /#([0-9A-F]{6})/i.exec(options.objectParams.bgcolor))) {
1.4993 + var hexColor = parseInt(m[1], 16);
1.4994 + bgcolor = {
1.4995 + red: hexColor >> 16 & 255,
1.4996 + green: hexColor >> 8 & 255,
1.4997 + blue: hexColor & 255,
1.4998 + alpha: 255
1.4999 + };
1.5000 + }
1.5001 + if (options.objectParams.wmode === 'transparent') {
1.5002 + bgcolor = {
1.5003 + red: 0,
1.5004 + green: 0,
1.5005 + blue: 0,
1.5006 + alpha: 0
1.5007 + };
1.5008 + }
1.5009 + }
1.5010 + stage._color = bgcolor;
1.5011 + ctx.fillStyle = rgbaObjToStr(bgcolor);
1.5012 + ctx.fillRect(0, 0, canvas.width, canvas.height);
1.5013 + var root = loader._content;
1.5014 + root._dispatchEvent('added', undefined, true);
1.5015 + root._dispatchEvent('addedToStage');
1.5016 + container.appendChild(canvas);
1.5017 + stage._domContainer = container;
1.5018 + if (options.onStageInitialized) {
1.5019 + options.onStageInitialized(stage);
1.5020 + }
1.5021 + var startPromise = options.startPromise || Promise.resolve();
1.5022 + startPromise.then(function () {
1.5023 + renderStage(stage, ctx, options);
1.5024 + });
1.5025 + });
1.5026 + if (options.onParsed) {
1.5027 + loaderInfo._addEventListener('parsed', function () {
1.5028 + options.onParsed();
1.5029 + });
1.5030 + }
1.5031 + if (options.onComplete) {
1.5032 + loaderInfo._addEventListener('complete', function () {
1.5033 + options.onComplete();
1.5034 + });
1.5035 + }
1.5036 + loader._load(typeof file === 'string' ? new flash.net.URLRequest(file) : file);
1.5037 + return loader;
1.5038 +};
1.5039 +var rendererOptions = coreOptions.register(new OptionSet('Renderer Options'));
1.5040 +var traceRenderer = rendererOptions.register(new Option('tr', 'traceRenderer', 'number', 0, 'trace renderer execution'));
1.5041 +var disableRenderVisitor = rendererOptions.register(new Option('drv', 'disableRenderVisitor', 'boolean', false, 'disable render visitor'));
1.5042 +var disableMouseVisitor = rendererOptions.register(new Option('dmv', 'disableMouseVisitor', 'boolean', false, 'disable mouse visitor'));
1.5043 +var showRedrawRegions = rendererOptions.register(new Option('rr', 'showRedrawRegions', 'boolean', false, 'show redraw regions'));
1.5044 +var renderAsWireframe = rendererOptions.register(new Option('raw', 'renderAsWireframe', 'boolean', false, 'render as wireframe'));
1.5045 +var showQuadTree = rendererOptions.register(new Option('qt', 'showQuadTree', 'boolean', false, 'show quad tree'));
1.5046 +var turboMode = rendererOptions.register(new Option('', 'turbo', 'boolean', false, 'turbo mode'));
1.5047 +var forceHidpi = rendererOptions.register(new Option('', 'forceHidpi', 'boolean', false, 'force hidpi'));
1.5048 +var skipFrameDraw = rendererOptions.register(new Option('', 'skipFrameDraw', 'boolean', false, 'skip frame when not on time'));
1.5049 +var hud = rendererOptions.register(new Option('', 'hud', 'boolean', false, 'show hud mode'));
1.5050 +var dummyAnimation = rendererOptions.register(new Option('', 'dummy', 'boolean', false, 'show test balls animation'));
1.5051 +var enableConstructChildren = rendererOptions.register(new Option('', 'constructChildren', 'boolean', true, 'Construct Children'));
1.5052 +var enableEnterFrame = rendererOptions.register(new Option('', 'enterFrame', 'boolean', true, 'Enter Frame'));
1.5053 +var enableAdvanceFrame = rendererOptions.register(new Option('', 'advanceFrame', 'boolean', true, 'Advance Frame'));
1.5054 +var CanvasCache = {
1.5055 + cache: [],
1.5056 + getCanvas: function getCanvas(protoCanvas) {
1.5057 + var tempCanvas = this.cache.shift();
1.5058 + if (!tempCanvas) {
1.5059 + tempCanvas = {
1.5060 + canvas: document.createElement('canvas')
1.5061 + };
1.5062 + tempCanvas.ctx = tempCanvas.canvas.getContext('2d');
1.5063 + }
1.5064 + tempCanvas.canvas.width = protoCanvas.width;
1.5065 + tempCanvas.canvas.height = protoCanvas.height;
1.5066 + tempCanvas.ctx.save();
1.5067 + return tempCanvas;
1.5068 + },
1.5069 + releaseCanvas: function releaseCanvas(tempCanvas) {
1.5070 + tempCanvas.ctx.restore();
1.5071 + this.cache.push(tempCanvas);
1.5072 + }
1.5073 + };
1.5074 +function isCanvasVisible(canvas) {
1.5075 + if (canvas.ownerDocument.hidden) {
1.5076 + return false;
1.5077 + }
1.5078 + if (canvas.mozVisible === false) {
1.5079 + return false;
1.5080 + }
1.5081 + return true;
1.5082 +}
1.5083 +function visitContainer(container, visitor, context) {
1.5084 + var children = container._children;
1.5085 + visitor.childrenStart(container);
1.5086 + for (var i = 0, n = children.length; i < n; i++) {
1.5087 + var child = children[i];
1.5088 + if (!child) {
1.5089 + continue;
1.5090 + }
1.5091 + if (visitor.ignoreVisibleAttribute || child._visible && !child._maskedObject) {
1.5092 + visitor.visit(child, visitContainer, context);
1.5093 + }
1.5094 + }
1.5095 + visitor.childrenEnd(container);
1.5096 +}
1.5097 +var BlendModeNameMap = {
1.5098 + 'normal': 'normal',
1.5099 + 'multiply': 'multiply',
1.5100 + 'screen': 'screen',
1.5101 + 'lighten': 'lighten',
1.5102 + 'darken': 'darken',
1.5103 + 'difference': 'difference',
1.5104 + 'overlay': 'overlay',
1.5105 + 'hardlight': 'hard-light'
1.5106 + };
1.5107 +function getBlendModeName(blendMode) {
1.5108 + return BlendModeNameMap[blendMode] || 'normal';
1.5109 +}
1.5110 +function RenderVisitor(root, ctx, invalidPath, refreshStage) {
1.5111 + this.root = root;
1.5112 + this.ctx = ctx;
1.5113 + this.depth = 0;
1.5114 + this.invalidPath = invalidPath;
1.5115 + this.refreshStage = refreshStage;
1.5116 + this.clipDepth = null;
1.5117 + this.clipStack = null;
1.5118 +}
1.5119 +RenderVisitor.prototype = {
1.5120 + ignoreVisibleAttribute: false,
1.5121 + start: function () {
1.5122 + visitContainer(this.root, this, new RenderingContext(this.refreshStage, this.invalidPath));
1.5123 + },
1.5124 + startFragment: function (matrix) {
1.5125 + var root = this.root;
1.5126 + var currentTransform = root._currentTransform;
1.5127 + var t = currentTransform;
1.5128 + if (matrix) {
1.5129 + t = root._currentTransform = {
1.5130 + a: matrix.a,
1.5131 + b: matrix.b,
1.5132 + c: matrix.c,
1.5133 + d: matrix.d,
1.5134 + tx: matrix.tx * 20 | 0,
1.5135 + ty: matrix.ty * 20 | 0
1.5136 + };
1.5137 + root._invalidateTransform();
1.5138 + }
1.5139 + var inverse;
1.5140 + if (t) {
1.5141 + inverse = new flash.geom.Matrix(t.a, t.b, t.c, t.d, t.tx / 20, t.ty / 20);
1.5142 + inverse.invert();
1.5143 + this.ctx.save();
1.5144 + this.ctx.transform(inverse.a, inverse.b, inverse.c, inverse.d, inverse.tx, inverse.ty);
1.5145 + }
1.5146 + this.visit(root, visitContainer, new RenderingContext(this.refreshStage, this.invalidPath));
1.5147 + if (t) {
1.5148 + this.ctx.restore();
1.5149 + }
1.5150 + if (matrix) {
1.5151 + root._currentTransform = currentTransform;
1.5152 + root._invalidateTransform();
1.5153 + }
1.5154 + },
1.5155 + childrenStart: function (parent) {
1.5156 + if (this.depth === 0) {
1.5157 + var ctx = this.ctx;
1.5158 + ctx.save();
1.5159 + if (this.invalidPath && !this.refreshStage && !renderAsWireframe.value) {
1.5160 + this.invalidPath.draw(ctx, false, 0, null);
1.5161 + ctx.clip();
1.5162 + }
1.5163 + var bgcolor = this.root._color;
1.5164 + if (bgcolor) {
1.5165 + if (bgcolor.alpha < 255) {
1.5166 + ctx.clearRect(0, 0, ctx.canvas.width, ctx.canvas.height);
1.5167 + }
1.5168 + if (bgcolor.alpha > 0) {
1.5169 + ctx.fillStyle = rgbaObjToStr(bgcolor);
1.5170 + if (this.invalidPath && !this.refreshStage && !renderAsWireframe.value) {
1.5171 + ctx.fill();
1.5172 + } else {
1.5173 + ctx.fillRect(0, 0, ctx.canvas.width, ctx.canvas.height);
1.5174 + }
1.5175 + }
1.5176 + }
1.5177 + ctx.mozFillRule = 'evenodd';
1.5178 + }
1.5179 + this.depth++;
1.5180 + if (this.clipDepth && this.clipDepth.length > 0) {
1.5181 + this.clipStack = {
1.5182 + depth: this.depth,
1.5183 + clip: this.clipDepth,
1.5184 + next: this.clipStack
1.5185 + };
1.5186 + this.clipDepth = null;
1.5187 + }
1.5188 + },
1.5189 + childrenEnd: function (parent) {
1.5190 + if (this.clipDepth) {
1.5191 + while (this.clipDepth.length > 0) {
1.5192 + var clipDepthInfo = this.clipDepth.pop();
1.5193 + this.clipEnd(clipDepthInfo);
1.5194 + this.ctx = clipDepthInfo.ctx;
1.5195 + }
1.5196 + this.clipDepth = null;
1.5197 + }
1.5198 + if (this.clipStack && this.clipStack.depth === this.depth) {
1.5199 + this.clipDepth = this.clipStack.clip;
1.5200 + this.clipStack = this.clipStack.next;
1.5201 + }
1.5202 + this.depth--;
1.5203 + if (this.depth === 0) {
1.5204 + this.ctx.restore();
1.5205 + this.invalidPath = null;
1.5206 + }
1.5207 + },
1.5208 + visit: function (child, visitContainer, context) {
1.5209 + var ctx = this.ctx;
1.5210 + var parentHasClippingMask = context.isClippingMask;
1.5211 + var parentColorTransform = context.colorTransform;
1.5212 + var clippingMask = parentHasClippingMask === true;
1.5213 + if (child._cxform) {
1.5214 + context.colorTransform = parentColorTransform.applyCXForm(child._cxform);
1.5215 + }
1.5216 + if (!clippingMask) {
1.5217 + while (this.clipDepth && this.clipDepth.length > 0 && child._depth > this.clipDepth[0].clipDepth) {
1.5218 + var clipDepthInfo = this.clipDepth.shift();
1.5219 + this.clipEnd(clipDepthInfo);
1.5220 + context.parentCtxs.shift();
1.5221 + ctx = this.ctx = clipDepthInfo.ctx;
1.5222 + }
1.5223 + if (this.clipDepth && this.clipDepth.length > 0 && child._depth <= this.clipDepth[0].clipDepth) {
1.5224 + ctx = this.ctx = this.clipDepth[0].maskee.ctx;
1.5225 + }
1.5226 + if (child._clipDepth) {
1.5227 + context.isClippingMask = clippingMask = true;
1.5228 + var clipDepthInfo = this.clipStart(child);
1.5229 + if (!this.clipDepth) {
1.5230 + this.clipDepth = [
1.5231 + clipDepthInfo
1.5232 + ];
1.5233 + } else {
1.5234 + this.clipDepth.unshift(clipDepthInfo);
1.5235 + }
1.5236 + context.parentCtxs.unshift(ctx);
1.5237 + ctx = this.ctx = clipDepthInfo.mask.ctx;
1.5238 + }
1.5239 + }
1.5240 + if (clippingMask && child._isContainer) {
1.5241 + ctx.save();
1.5242 + renderDisplayObject(child, ctx, context);
1.5243 + for (var i = 0, n = child._children.length; i < n; i++) {
1.5244 + var child1 = child._children[i];
1.5245 + if (!child1) {
1.5246 + continue;
1.5247 + }
1.5248 + if (this.ignoreVisibleAttribute || child1._visible && !child1._maskedObject) {
1.5249 + this.visit(child1, visitContainer, context);
1.5250 + }
1.5251 + }
1.5252 + ctx.restore();
1.5253 + ctx.fill();
1.5254 + context.isClippingMask = parentHasClippingMask;
1.5255 + context.colorTransform = parentColorTransform;
1.5256 + return;
1.5257 + }
1.5258 + ctx.save();
1.5259 + ctx.globalCompositeOperation = getBlendModeName(child._blendMode);
1.5260 + if (child._mask) {
1.5261 + var clipInfo = this.clipStart(child);
1.5262 + var mask = clipInfo.mask;
1.5263 + var maskee = clipInfo.maskee;
1.5264 + context.parentCtxs.push(ctx);
1.5265 + var savedClipDepth = this.clipDepth;
1.5266 + this.clipDepth = null;
1.5267 + this.ctx = mask.ctx;
1.5268 + this.visit(child._mask, visitContainer, new RenderingContext(this.refreshStage));
1.5269 + this.ctx = ctx;
1.5270 + this.clipDepth = savedClipDepth;
1.5271 + renderDisplayObject(child, maskee.ctx, context);
1.5272 + if (child._isContainer) {
1.5273 + this.ctx = maskee.ctx;
1.5274 + visitContainer(child, this, context);
1.5275 + this.ctx = ctx;
1.5276 + }
1.5277 + context.parentCtxs.pop();
1.5278 + this.clipEnd(clipInfo);
1.5279 + } else {
1.5280 + renderDisplayObject(child, ctx, context);
1.5281 + if (child._isContainer) {
1.5282 + visitContainer(child, this, context);
1.5283 + }
1.5284 + }
1.5285 + ctx.restore();
1.5286 + if (clippingMask) {
1.5287 + ctx.fill();
1.5288 + }
1.5289 + context.isClippingMask = parentHasClippingMask;
1.5290 + context.colorTransform = parentColorTransform;
1.5291 + },
1.5292 + clipStart: function (child) {
1.5293 + var m = child._parent._getConcatenatedTransform(null, true);
1.5294 + var tx = m.tx / 20;
1.5295 + var ty = m.ty / 20;
1.5296 + var mask = CanvasCache.getCanvas(this.ctx.canvas);
1.5297 + mask.ctx.setTransform(m.a, m.b, m.c, m.d, tx, ty);
1.5298 + var maskee = CanvasCache.getCanvas(this.ctx.canvas);
1.5299 + maskee.ctx.setTransform(m.a, m.b, m.c, m.d, tx, ty);
1.5300 + var clipInfo = {
1.5301 + ctx: this.ctx,
1.5302 + mask: mask,
1.5303 + maskee: maskee,
1.5304 + clipDepth: child._clipDepth
1.5305 + };
1.5306 + return clipInfo;
1.5307 + },
1.5308 + clipEnd: function (clipInfo) {
1.5309 + var ctx = clipInfo.ctx;
1.5310 + var mask = clipInfo.mask;
1.5311 + var maskee = clipInfo.maskee;
1.5312 + maskee.ctx.globalCompositeOperation = 'destination-in';
1.5313 + maskee.ctx.setTransform(1, 0, 0, 1, 0, 0);
1.5314 + maskee.ctx.drawImage(mask.canvas, 0, 0);
1.5315 + ctx.save();
1.5316 + ctx.setTransform(1, 0, 0, 1, 0, 0);
1.5317 + ctx.drawImage(maskee.canvas, 0, 0);
1.5318 + ctx.restore();
1.5319 + CanvasCache.releaseCanvas(mask);
1.5320 + CanvasCache.releaseCanvas(maskee);
1.5321 + }
1.5322 +};
1.5323 +function RenderingColorTransform() {
1.5324 + this.mode = null;
1.5325 + this.transform = [
1.5326 + 1,
1.5327 + 1,
1.5328 + 1,
1.5329 + 1,
1.5330 + 0,
1.5331 + 0,
1.5332 + 0,
1.5333 + 0
1.5334 + ];
1.5335 +}
1.5336 +RenderingColorTransform.prototype = {
1.5337 + applyCXForm: function (cxform) {
1.5338 + var t = this.transform;
1.5339 + t = [
1.5340 + t[0] * cxform.redMultiplier / 256,
1.5341 + t[1] * cxform.greenMultiplier / 256,
1.5342 + t[2] * cxform.blueMultiplier / 256,
1.5343 + t[3] * cxform.alphaMultiplier / 256,
1.5344 + t[4] * cxform.redMultiplier / 256 + cxform.redOffset,
1.5345 + t[5] * cxform.greenMultiplier / 256 + cxform.greenOffset,
1.5346 + t[6] * cxform.blueMultiplier / 256 + cxform.blueOffset,
1.5347 + t[7] * cxform.alphaMultiplier / 256 + cxform.alphaOffset
1.5348 + ];
1.5349 + var mode;
1.5350 + var PRECISION = 0.0001;
1.5351 + if (Math.abs(t[0] - 1) < PRECISION && Math.abs(t[1] - 1) < PRECISION && Math.abs(t[2] - 1) < PRECISION && t[3] >= 0 && Math.abs(t[4]) < PRECISION && Math.abs(t[5]) < PRECISION && Math.abs(t[6]) < PRECISION && Math.abs(t[7]) < PRECISION) {
1.5352 + mode = Math.abs(t[3] - 1) < PRECISION ? null : 'simple';
1.5353 + } else {
1.5354 + mode = 'complex';
1.5355 + }
1.5356 + var clone = Object.create(RenderingColorTransform.prototype);
1.5357 + clone.mode = mode;
1.5358 + clone.transform = t;
1.5359 + return clone;
1.5360 + },
1.5361 + setFillStyle: function (ctx, style) {
1.5362 + if (this.mode === 'complex') {
1.5363 + style = typeof style === 'function' ? style(ctx, this) : this.convertColor(style);
1.5364 + } else if (typeof style === 'number') {
1.5365 + style = this.convertNumericColor(style);
1.5366 + } else if (typeof style === 'function') {
1.5367 + style = style.defaultFillStyle;
1.5368 + }
1.5369 + ctx.fillStyle = style;
1.5370 + },
1.5371 + setStrokeStyle: function (ctx, style) {
1.5372 + if (this.mode === 'complex') {
1.5373 + style = typeof style === 'function' ? style(ctx, this) : this.convertColor(style);
1.5374 + } else if (typeof style === 'number') {
1.5375 + style = this.convertNumericColor(style);
1.5376 + } else if (typeof style === 'function') {
1.5377 + style = style.defaultFillStyle;
1.5378 + }
1.5379 + ctx.strokeStyle = style;
1.5380 + },
1.5381 + addGradientColorStop: function (gradient, ratio, style) {
1.5382 + if (this.mode === 'complex') {
1.5383 + style = this.convertColor(style);
1.5384 + } else if (typeof style === 'number') {
1.5385 + style = this.convertNumericColor(style);
1.5386 + }
1.5387 + gradient.addColorStop(ratio, style);
1.5388 + },
1.5389 + setAlpha: function (ctx, force) {
1.5390 + if (this.mode === 'simple' || force) {
1.5391 + var t = this.transform;
1.5392 + ctx.globalAlpha = Math.min(1, Math.max(0, ctx.globalAlpha * t[3]));
1.5393 + }
1.5394 + },
1.5395 + convertNumericColor: function (num) {
1.5396 + return '#' + (num | 16777216).toString(16).substr(1);
1.5397 + },
1.5398 + convertColor: function (style) {
1.5399 + var t = this.transform;
1.5400 + var m;
1.5401 + switch (typeof style) {
1.5402 + case 'string':
1.5403 + if (style[0] === '#') {
1.5404 + m = [
1.5405 + undefined,
1.5406 + parseInt(style.substr(1, 2), 16),
1.5407 + parseInt(style.substr(3, 2), 16),
1.5408 + parseInt(style.substr(5, 2), 16),
1.5409 + 1
1.5410 + ];
1.5411 + }
1.5412 + m = m || /rgba\(([^,]+),([^,]+),([^,]+),([^)]+)\)/.exec(style);
1.5413 + if (!m) {
1.5414 + return style;
1.5415 + }
1.5416 + break;
1.5417 + case 'number':
1.5418 + m = [
1.5419 + style,
1.5420 + style >> 16 & 255,
1.5421 + style >> 8 & 255,
1.5422 + style & 255,
1.5423 + 1
1.5424 + ];
1.5425 + break;
1.5426 + default:
1.5427 + return style;
1.5428 + }
1.5429 + var r = Math.min(255, Math.max(0, m[1] * t[0] + t[4])) | 0;
1.5430 + var g = Math.min(255, Math.max(0, m[2] * t[1] + t[5])) | 0;
1.5431 + var b = Math.min(255, Math.max(0, m[3] * t[2] + t[6])) | 0;
1.5432 + var a = Math.min(1, Math.max(0, m[4] * t[3] + t[7] / 256));
1.5433 + return 'rgba(' + r + ',' + g + ',' + b + ',' + a + ')';
1.5434 + },
1.5435 + getTransformFingerprint: function () {
1.5436 + return this.transform.join('|');
1.5437 + }
1.5438 +};
1.5439 +function RenderingContext(refreshStage, invalidPath) {
1.5440 + this.refreshStage = refreshStage === true;
1.5441 + this.invalidPath = invalidPath;
1.5442 + this.isClippingMask = false;
1.5443 + this.colorTransform = new RenderingColorTransform();
1.5444 + this.parentCtxs = [];
1.5445 +}
1.5446 +function renderDisplayObject(child, ctx, context) {
1.5447 + var m = child._currentTransform;
1.5448 + if (m) {
1.5449 + ctx.transform(m.a, m.b, m.c, m.d, m.tx / 20, m.ty / 20);
1.5450 + }
1.5451 + if (!renderAsWireframe.value) {
1.5452 + if (child._alpha !== 1) {
1.5453 + ctx.globalAlpha *= child._alpha;
1.5454 + }
1.5455 + if (context.invalidPath && !child._invalid && !context.refreshStage) {
1.5456 + return;
1.5457 + }
1.5458 + if (child._graphics) {
1.5459 + var graphics = child._graphics;
1.5460 + if (graphics._bitmap) {
1.5461 + ctx.save();
1.5462 + ctx.translate(child._bbox.xMin / 20, child._bbox.yMin / 20);
1.5463 + context.colorTransform.setAlpha(ctx, true);
1.5464 + ctx.drawImage(graphics._bitmap, 0, 0);
1.5465 + ctx.restore();
1.5466 + } else {
1.5467 + var ratio = child.ratio;
1.5468 + if (ratio === undefined) {
1.5469 + ratio = 0;
1.5470 + }
1.5471 + graphics.draw(ctx, context.isClippingMask, ratio, context.colorTransform);
1.5472 + }
1.5473 + }
1.5474 + if (child.draw) {
1.5475 + child.draw(ctx, child.ratio, context.colorTransform, context.parentCtxs);
1.5476 + }
1.5477 + } else {
1.5478 + if (!child._invalid && !context.refreshStage) {
1.5479 + return;
1.5480 + }
1.5481 + if (child.getBounds) {
1.5482 + var b = child.getBounds(null);
1.5483 + if (b && b.xMax - b.xMin > 0 && b.yMax - b.yMin > 0) {
1.5484 + if (!child._wireframeStrokeStyle) {
1.5485 + child._wireframeStrokeStyle = randomStyle();
1.5486 + }
1.5487 + ctx.save();
1.5488 + ctx.strokeStyle = child._wireframeStrokeStyle;
1.5489 + var x = b.xMin / 20;
1.5490 + var y = b.yMin / 20;
1.5491 + ctx.strokeRect(x + 0.5, y + 0.5, b.xMax / 20 - x - 1, b.yMax / 20 - y - 1);
1.5492 + ctx.restore();
1.5493 + }
1.5494 + }
1.5495 + }
1.5496 + child._invalid = false;
1.5497 +}
1.5498 +function renderQuadTree(ctx, qtree) {
1.5499 + ctx.strokeRect(qtree.x / 20, qtree.y / 20, qtree.width / 20, qtree.height / 20);
1.5500 + var nodes = qtree.nodes;
1.5501 + for (var i = 0; i < nodes.length; i++) {
1.5502 + renderQuadTree(ctx, nodes[i]);
1.5503 + }
1.5504 +}
1.5505 +var renderingTerminated = false;
1.5506 +var samplesLeftPlusOne = 0;
1.5507 +function triggerSampling(count) {
1.5508 + samplesLeftPlusOne = -count - 1;
1.5509 +}
1.5510 +function sampleStart() {
1.5511 + if (!samplesLeftPlusOne) {
1.5512 + return;
1.5513 + }
1.5514 + if (samplesLeftPlusOne < 0) {
1.5515 + console.profile('Sample');
1.5516 + samplesLeftPlusOne *= -1;
1.5517 + }
1.5518 + if (samplesLeftPlusOne > 0) {
1.5519 + console.info('Sampling Frame: ' + (samplesLeftPlusOne - 1));
1.5520 + }
1.5521 +}
1.5522 +function sampleEnd() {
1.5523 + if (!samplesLeftPlusOne) {
1.5524 + return;
1.5525 + }
1.5526 + samplesLeftPlusOne--;
1.5527 + if (samplesLeftPlusOne === 1) {
1.5528 + console.profileEnd('Sample');
1.5529 + }
1.5530 +}
1.5531 +var timeline;
1.5532 +var hudTimeline;
1.5533 +function timelineEnter(name) {
1.5534 + timeline && timeline.enter(name);
1.5535 + hudTimeline && hudTimeline.enter(name);
1.5536 +}
1.5537 +function timelineLeave(name) {
1.5538 + timeline && timeline.leave(name);
1.5539 + hudTimeline && hudTimeline.leave(name);
1.5540 +}
1.5541 +function timelineWrapBroadcastMessage(domain, message) {
1.5542 + timelineEnter(message);
1.5543 + domain.broadcastMessage(message);
1.5544 + timelineLeave(message);
1.5545 +}
1.5546 +function initializeHUD(stage, parentCanvas) {
1.5547 + var canvas = document.createElement('canvas');
1.5548 + var canvasContainer = document.createElement('div');
1.5549 + canvasContainer.appendChild(canvas);
1.5550 + canvasContainer.style.position = 'absolute';
1.5551 + canvasContainer.style.top = '0px';
1.5552 + canvasContainer.style.left = '0px';
1.5553 + canvasContainer.style.width = '100%';
1.5554 + canvasContainer.style.height = '150px';
1.5555 + canvasContainer.style.backgroundColor = 'rgba(0, 0, 0, 0.4)';
1.5556 + canvasContainer.style.pointerEvents = 'none';
1.5557 + parentCanvas.parentElement.appendChild(canvasContainer);
1.5558 + hudTimeline = new Timeline(canvas);
1.5559 + hudTimeline.setFrameRate(stage._frameRate);
1.5560 + hudTimeline.refreshEvery(10);
1.5561 +}
1.5562 +function createRenderDummyBalls(ctx, stage) {
1.5563 + var dummyBalls;
1.5564 + var radius = 10;
1.5565 + var speed = 1;
1.5566 + var m = stage._concatenatedTransform;
1.5567 + var scaleX = m.a, scaleY = m.d;
1.5568 + dummyBalls = [];
1.5569 + for (var i = 0; i < 10; i++) {
1.5570 + dummyBalls.push({
1.5571 + position: {
1.5572 + x: radius + Math.random() * ((ctx.canvas.width - 2 * radius) / scaleX),
1.5573 + y: radius + Math.random() * ((ctx.canvas.height - 2 * radius) / scaleY)
1.5574 + },
1.5575 + velocity: {
1.5576 + x: speed * (Math.random() - 0.5),
1.5577 + y: speed * (Math.random() - 0.5)
1.5578 + }
1.5579 + });
1.5580 + }
1.5581 + ctx.fillStyle = 'black';
1.5582 + ctx.lineWidth = 2;
1.5583 + ctx.fillRect(0, 0, ctx.canvas.width, ctx.canvas.height);
1.5584 + return function renderDummyBalls() {
1.5585 + ctx.fillStyle = 'black';
1.5586 + ctx.fillRect(0, 0, ctx.canvas.width, ctx.canvas.height);
1.5587 + ctx.strokeStyle = 'green';
1.5588 + dummyBalls.forEach(function (ball) {
1.5589 + var position = ball.position;
1.5590 + var velocity = ball.velocity;
1.5591 + ctx.beginPath();
1.5592 + ctx.arc(position.x, position.y, radius, 0, Math.PI * 2, true);
1.5593 + ctx.stroke();
1.5594 + var x = position.x + velocity.x;
1.5595 + var y = position.y + velocity.y;
1.5596 + if (x < radius || x > ctx.canvas.width / scaleX - radius) {
1.5597 + velocity.x *= -1;
1.5598 + }
1.5599 + if (y < radius || y > ctx.canvas.height / scaleY - radius) {
1.5600 + velocity.y *= -1;
1.5601 + }
1.5602 + position.x += velocity.x;
1.5603 + position.y += velocity.y;
1.5604 + });
1.5605 + };
1.5606 +}
1.5607 +function renderStage(stage, ctx, events) {
1.5608 + var frameWidth, frameHeight;
1.5609 + if (!timeline && hud.value) {
1.5610 + initializeHUD(stage, ctx.canvas);
1.5611 + }
1.5612 + function updateRenderTransform() {
1.5613 + frameWidth = ctx.canvas.width;
1.5614 + frameHeight = ctx.canvas.height;
1.5615 + var scaleX = frameWidth / stage._stageWidth * 20;
1.5616 + var scaleY = frameHeight / stage._stageHeight * 20;
1.5617 + switch (stage._scaleMode) {
1.5618 + case 'exactFit':
1.5619 + break;
1.5620 + case 'noBorder':
1.5621 + if (scaleX > scaleY) {
1.5622 + scaleY = scaleX;
1.5623 + } else {
1.5624 + scaleX = scaleY;
1.5625 + }
1.5626 + break;
1.5627 + case 'noScale':
1.5628 + var pixelRatio = ctx.canvas._pixelRatio || 1;
1.5629 + scaleX = pixelRatio;
1.5630 + scaleY = pixelRatio;
1.5631 + break;
1.5632 + case 'showAll':
1.5633 + if (scaleX < scaleY) {
1.5634 + scaleY = scaleX;
1.5635 + } else {
1.5636 + scaleX = scaleY;
1.5637 + }
1.5638 + break;
1.5639 + }
1.5640 + var align = stage._align;
1.5641 + var offsetX, offsetY;
1.5642 + if (align.indexOf('L') >= 0) {
1.5643 + offsetX = 0;
1.5644 + } else if (align.indexOf('R') >= 0) {
1.5645 + offsetX = frameWidth - scaleX * stage._stageWidth / 20;
1.5646 + } else {
1.5647 + offsetX = (frameWidth - scaleX * stage._stageWidth / 20) / 2;
1.5648 + }
1.5649 + if (align.indexOf('T') >= 0) {
1.5650 + offsetY = 0;
1.5651 + } else if (align.indexOf('B') >= 0) {
1.5652 + offsetY = frameHeight - scaleY * stage._stageHeight / 20;
1.5653 + } else {
1.5654 + offsetY = (frameHeight - scaleY * stage._stageHeight / 20) / 2;
1.5655 + }
1.5656 + ctx.setTransform(scaleX, 0, 0, scaleY, offsetX, offsetY);
1.5657 + var m = stage._concatenatedTransform;
1.5658 + m.a = scaleX;
1.5659 + m.d = scaleY;
1.5660 + m.tx = offsetX * 20;
1.5661 + m.ty = offsetY * 20;
1.5662 + }
1.5663 + updateRenderTransform();
1.5664 + var frameScheduler = new FrameScheduler();
1.5665 + stage._frameScheduler = frameScheduler;
1.5666 + var requestAnimationFrame = window.requestAnimationFrame || window.mozRequestAnimationFrame || window.webkitRequestAnimationFrame || window.oRequestAnimationFrame || window.msRequestAnimationFrame || window.setTimeout;
1.5667 + var renderDummyBalls = dummyAnimation.value && createRenderDummyBalls(ctx, stage);
1.5668 + console.timeEnd('Initialize Renderer');
1.5669 + console.timeEnd('Total');
1.5670 + var firstRun = true;
1.5671 + var frameCount = 0;
1.5672 + var frameFPSAverage = new Shumway.Metrics.Average(120);
1.5673 + var frameRequested = true;
1.5674 + function drawFrame(renderFrame, repaint) {
1.5675 + sampleStart();
1.5676 + var refreshStage = false;
1.5677 + if (stage._invalid) {
1.5678 + updateRenderTransform();
1.5679 + stage._invalid = false;
1.5680 + refreshStage = true;
1.5681 + }
1.5682 + var mouseMoved = false;
1.5683 + if (stage._mouseMoved) {
1.5684 + stage._mouseMoved = false;
1.5685 + mouseMoved = stage._mouseOver;
1.5686 + } else {
1.5687 + stage._handleMouseButtons();
1.5688 + }
1.5689 + if (renderFrame || refreshStage || mouseMoved) {
1.5690 + FrameCounter.clear();
1.5691 + var frameStartTime = performance.now();
1.5692 + timelineEnter('frame');
1.5693 + traceRenderer.value && appendToFrameTerminal('Begin Frame #' + frameCount++, 'purple');
1.5694 + var domain = avm2.systemDomain;
1.5695 + if (renderFrame) {
1.5696 + timelineEnter('events');
1.5697 + if (firstRun) {
1.5698 + firstRun = false;
1.5699 + } else {
1.5700 + enableAdvanceFrame.value && timelineWrapBroadcastMessage(domain, 'advanceFrame');
1.5701 + enableEnterFrame.value && timelineWrapBroadcastMessage(domain, 'enterFrame');
1.5702 + enableConstructChildren.value && timelineWrapBroadcastMessage(domain, 'constructChildren');
1.5703 + }
1.5704 + timelineWrapBroadcastMessage(domain, 'frameConstructed');
1.5705 + timelineWrapBroadcastMessage(domain, 'executeFrame');
1.5706 + timelineWrapBroadcastMessage(domain, 'exitFrame');
1.5707 + timelineLeave('events');
1.5708 + }
1.5709 + if (stage._deferRenderEvent) {
1.5710 + stage._deferRenderEvent = false;
1.5711 + domain.broadcastMessage('render', 'render');
1.5712 + }
1.5713 + var drawEnabled = isCanvasVisible(ctx.canvas) && (refreshStage || renderFrame) && (frameRequested || repaint || !skipFrameDraw.value);
1.5714 + if (drawEnabled && !repaint && skipFrameDraw.value && frameScheduler.shallSkipDraw) {
1.5715 + drawEnabled = false;
1.5716 + frameScheduler.skipDraw();
1.5717 + traceRenderer.value && appendToFrameTerminal('Skip Frame Draw', 'red');
1.5718 + }
1.5719 + if (drawEnabled) {
1.5720 + frameScheduler.startDraw();
1.5721 + var invalidPath = null;
1.5722 + traceRenderer.value && frameWriter.enter('> Invalidation');
1.5723 + timelineEnter('invalidate');
1.5724 + invalidPath = stage._processInvalidations(refreshStage);
1.5725 + timelineLeave('invalidate');
1.5726 + traceRenderer.value && frameWriter.leave('< Invalidation');
1.5727 + if (!disableRenderVisitor.value && !invalidPath.isEmpty) {
1.5728 + timelineEnter('render');
1.5729 + traceRenderer.value && frameWriter.enter('> Rendering');
1.5730 + new RenderVisitor(stage, ctx, invalidPath, refreshStage).start();
1.5731 + traceRenderer.value && frameWriter.leave('< Rendering');
1.5732 + timelineLeave('render');
1.5733 + }
1.5734 + if (showQuadTree.value) {
1.5735 + ctx.strokeStyle = 'green';
1.5736 + renderQuadTree(ctx, stage._qtree);
1.5737 + }
1.5738 + if (invalidPath && !refreshStage && showRedrawRegions.value) {
1.5739 + ctx.strokeStyle = 'red';
1.5740 + invalidPath.draw(ctx);
1.5741 + ctx.stroke();
1.5742 + }
1.5743 + frameScheduler.endDraw();
1.5744 + }
1.5745 + if (mouseMoved && !disableMouseVisitor.value) {
1.5746 + renderFrame && timelineEnter('mouse');
1.5747 + traceRenderer.value && frameWriter.enter('> Mouse Handling');
1.5748 + stage._handleMouse();
1.5749 + traceRenderer.value && frameWriter.leave('< Mouse Handling');
1.5750 + renderFrame && timelineLeave('mouse');
1.5751 + ctx.canvas.style.cursor = stage._cursor;
1.5752 + }
1.5753 + if (traceRenderer.value) {
1.5754 + frameWriter.enter('> Frame Counters');
1.5755 + for (var name in FrameCounter.counts) {
1.5756 + frameWriter.writeLn(name + ': ' + FrameCounter.counts[name]);
1.5757 + }
1.5758 + frameWriter.leave('< Frame Counters');
1.5759 + var frameElapsedTime = performance.now() - frameStartTime;
1.5760 + var frameFPS = 1000 / frameElapsedTime;
1.5761 + frameFPSAverage.push(frameFPS);
1.5762 + traceRenderer.value && appendToFrameTerminal('End Frame Time: ' + frameElapsedTime.toFixed(2) + ' (' + frameFPS.toFixed(2) + ' fps, ' + frameFPSAverage.average().toFixed(2) + ' average fps)', 'purple');
1.5763 + }
1.5764 + timelineLeave('frame');
1.5765 + } else {
1.5766 + traceRenderer.value && appendToFrameTerminal('Skip Frame', 'black');
1.5767 + }
1.5768 + sampleEnd();
1.5769 + }
1.5770 + (function draw() {
1.5771 + var renderFrame = true;
1.5772 + if (events.onBeforeFrame) {
1.5773 + var e = {
1.5774 + cancel: false
1.5775 + };
1.5776 + events.onBeforeFrame(e);
1.5777 + renderFrame = !e.cancel;
1.5778 + }
1.5779 + if (renderDummyBalls) {
1.5780 + if (renderFrame) {
1.5781 + renderDummyBalls();
1.5782 + events.onAfterFrame && events.onAfterFrame();
1.5783 + }
1.5784 + setTimeout(draw);
1.5785 + return;
1.5786 + }
1.5787 + frameScheduler.startFrame(stage._frameRate);
1.5788 + drawFrame(renderFrame, false);
1.5789 + frameScheduler.endFrame();
1.5790 + frameRequested = false;
1.5791 + if (!frameScheduler.isOnTime) {
1.5792 + traceRenderer.value && appendToFrameTerminal('Frame Is Late', 'red');
1.5793 + }
1.5794 + if (renderFrame && events.onAfterFrame) {
1.5795 + events.onAfterFrame();
1.5796 + }
1.5797 + if (renderingTerminated) {
1.5798 + if (events.onTerminated) {
1.5799 + events.onTerminated();
1.5800 + }
1.5801 + return;
1.5802 + }
1.5803 + setTimeout(draw, turboMode.value ? 0 : frameScheduler.nextFrameIn);
1.5804 + }());
1.5805 + (function frame() {
1.5806 + if (renderingTerminated) {
1.5807 + return;
1.5808 + }
1.5809 + frameRequested = true;
1.5810 + if ((stage._invalid || stage._mouseMoved) && !renderDummyBalls) {
1.5811 + drawFrame(false, true);
1.5812 + }
1.5813 + requestAnimationFrame(frame);
1.5814 + }());
1.5815 +}
1.5816 +var FrameScheduler = function () {
1.5817 + var STATS_TO_REMEMBER = 50;
1.5818 + var MAX_DRAWS_TO_SKIP = 2;
1.5819 + var INTERVAL_PADDING_MS = 4;
1.5820 + var SPEED_ADJUST_RATE = 0.9;
1.5821 + function FrameScheduler() {
1.5822 + this._drawStats = [];
1.5823 + this._drawStatsSum = 0;
1.5824 + this._drawStarted = 0;
1.5825 + this._drawsSkipped = 0;
1.5826 + this._expectedNextFrameAt = performance.now();
1.5827 + this._onTime = true;
1.5828 + this._trackDelta = false;
1.5829 + this._delta = 0;
1.5830 + this._onTimeDelta = 0;
1.5831 + }
1.5832 + FrameScheduler.prototype = {
1.5833 + get shallSkipDraw() {
1.5834 + if (this._drawsSkipped >= MAX_DRAWS_TO_SKIP) {
1.5835 + return false;
1.5836 + }
1.5837 + var averageDraw = this._drawStats.length < STATS_TO_REMEMBER ? 0 : this._drawStatsSum / this._drawStats.length;
1.5838 + var estimatedDrawEnd = performance.now() + averageDraw;
1.5839 + return estimatedDrawEnd + INTERVAL_PADDING_MS > this._expectedNextFrameAt;
1.5840 + },
1.5841 + get nextFrameIn() {
1.5842 + return Math.max(0, this._expectedNextFrameAt - performance.now());
1.5843 + },
1.5844 + get isOnTime() {
1.5845 + return this._onTime;
1.5846 + },
1.5847 + startFrame: function (frameRate) {
1.5848 + var interval = 1000 / frameRate;
1.5849 + var adjustedInterval = interval;
1.5850 + var delta = this._onTimeDelta + this._delta;
1.5851 + if (delta !== 0) {
1.5852 + if (delta < 0) {
1.5853 + adjustedInterval *= SPEED_ADJUST_RATE;
1.5854 + } else if (delta > 0) {
1.5855 + adjustedInterval /= SPEED_ADJUST_RATE;
1.5856 + }
1.5857 + this._onTimeDelta += interval - adjustedInterval;
1.5858 + }
1.5859 + this._expectedNextFrameAt += adjustedInterval;
1.5860 + this._onTime = true;
1.5861 + },
1.5862 + endFrame: function () {
1.5863 + var estimatedNextFrameStart = performance.now() + INTERVAL_PADDING_MS;
1.5864 + if (estimatedNextFrameStart > this._expectedNextFrameAt) {
1.5865 + if (this._trackDelta) {
1.5866 + this._onTimeDelta += this._expectedNextFrameAt - estimatedNextFrameStart;
1.5867 + console.log(this._onTimeDelta);
1.5868 + }
1.5869 + this._expectedNextFrameAt = estimatedNextFrameStart;
1.5870 + this._onTime = false;
1.5871 + }
1.5872 + },
1.5873 + startDraw: function () {
1.5874 + this._drawsSkipped = 0;
1.5875 + this._drawStarted = performance.now();
1.5876 + },
1.5877 + endDraw: function () {
1.5878 + var drawTime = performance.now() - this._drawStarted;
1.5879 + this._drawStats.push(drawTime);
1.5880 + this._drawStatsSum += drawTime;
1.5881 + while (this._drawStats.length > STATS_TO_REMEMBER) {
1.5882 + this._drawStatsSum -= this._drawStats.shift();
1.5883 + }
1.5884 + },
1.5885 + skipDraw: function () {
1.5886 + this._drawsSkipped++;
1.5887 + },
1.5888 + setDelta: function (value) {
1.5889 + if (!this._trackDelta) {
1.5890 + return;
1.5891 + }
1.5892 + this._delta = value;
1.5893 + },
1.5894 + startTrackDelta: function () {
1.5895 + this._trackDelta = true;
1.5896 + },
1.5897 + endTrackDelta: function () {
1.5898 + if (!this._trackDelta) {
1.5899 + return;
1.5900 + }
1.5901 + this._trackDelta = false;
1.5902 + this._delta = 0;
1.5903 + this._onTimeDelta = 0;
1.5904 + }
1.5905 + };
1.5906 + return FrameScheduler;
1.5907 + }();
1.5908 +var tagHandler = function (global) {
1.5909 + function defineShape($bytes, $stream, $, swfVersion, tagCode) {
1.5910 + $ || ($ = {});
1.5911 + $.id = readUi16($bytes, $stream);
1.5912 + var $0 = $.bbox = {};
1.5913 + bbox($bytes, $stream, $0, swfVersion, tagCode);
1.5914 + var isMorph = $.isMorph = tagCode === 46 || tagCode === 84;
1.5915 + if (isMorph) {
1.5916 + var $1 = $.bboxMorph = {};
1.5917 + bbox($bytes, $stream, $1, swfVersion, tagCode);
1.5918 + }
1.5919 + var hasStrokes = $.hasStrokes = tagCode === 83 || tagCode === 84;
1.5920 + if (hasStrokes) {
1.5921 + var $2 = $.strokeBbox = {};
1.5922 + bbox($bytes, $stream, $2, swfVersion, tagCode);
1.5923 + if (isMorph) {
1.5924 + var $3 = $.strokeBboxMorph = {};
1.5925 + bbox($bytes, $stream, $3, swfVersion, tagCode);
1.5926 + }
1.5927 + var reserved = readUb($bytes, $stream, 5);
1.5928 + $.fillWinding = readUb($bytes, $stream, 1);
1.5929 + $.nonScalingStrokes = readUb($bytes, $stream, 1);
1.5930 + $.scalingStrokes = readUb($bytes, $stream, 1);
1.5931 + }
1.5932 + if (isMorph) {
1.5933 + $.offsetMorph = readUi32($bytes, $stream);
1.5934 + morphShapeWithStyle($bytes, $stream, $, swfVersion, tagCode, isMorph, hasStrokes);
1.5935 + } else {
1.5936 + shapeWithStyle($bytes, $stream, $, swfVersion, tagCode, isMorph, hasStrokes);
1.5937 + }
1.5938 + return $;
1.5939 + }
1.5940 + function placeObject($bytes, $stream, $, swfVersion, tagCode) {
1.5941 + var flags, hasEvents, clip, hasName, hasRatio, hasCxform, hasMatrix, place;
1.5942 + var move, hasBackgroundColor, hasVisibility, hasImage, hasClassName, cache;
1.5943 + var blend, hasFilters, eoe;
1.5944 + $ || ($ = {});
1.5945 + if (tagCode > 4) {
1.5946 + if (tagCode > 26) {
1.5947 + flags = readUi16($bytes, $stream);
1.5948 + } else {
1.5949 + flags = readUi8($bytes, $stream);
1.5950 + }
1.5951 + hasEvents = $.hasEvents = flags >> 7 & 1;
1.5952 + clip = $.clip = flags >> 6 & 1;
1.5953 + hasName = $.hasName = flags >> 5 & 1;
1.5954 + hasRatio = $.hasRatio = flags >> 4 & 1;
1.5955 + hasCxform = $.hasCxform = flags >> 3 & 1;
1.5956 + hasMatrix = $.hasMatrix = flags >> 2 & 1;
1.5957 + place = $.place = flags >> 1 & 1;
1.5958 + move = $.move = flags & 1;
1.5959 + if (tagCode === 70) {
1.5960 + hasBackgroundColor = $.hasBackgroundColor = flags >> 15 & 1;
1.5961 + hasVisibility = $.hasVisibility = flags >> 14 & 1;
1.5962 + hasImage = $.hasImage = flags >> 12 & 1;
1.5963 + hasClassName = $.hasClassName = flags >> 11 & 1;
1.5964 + cache = $.cache = flags >> 10 & 1;
1.5965 + blend = $.blend = flags >> 9 & 1;
1.5966 + hasFilters = $.hasFilters = flags >> 8 & 1;
1.5967 + } else {
1.5968 + cache = $.cache = 0;
1.5969 + blend = $.blend = 0;
1.5970 + hasFilters = $.hasFilters = 0;
1.5971 + }
1.5972 + $.depth = readUi16($bytes, $stream);
1.5973 + if (hasClassName) {
1.5974 + $.className = readString($bytes, $stream, 0);
1.5975 + }
1.5976 + if (place) {
1.5977 + $.symbolId = readUi16($bytes, $stream);
1.5978 + }
1.5979 + if (hasMatrix) {
1.5980 + var $0 = $.matrix = {};
1.5981 + matrix($bytes, $stream, $0, swfVersion, tagCode);
1.5982 + }
1.5983 + if (hasCxform) {
1.5984 + var $1 = $.cxform = {};
1.5985 + cxform($bytes, $stream, $1, swfVersion, tagCode);
1.5986 + }
1.5987 + if (hasRatio) {
1.5988 + $.ratio = readUi16($bytes, $stream);
1.5989 + }
1.5990 + if (hasName) {
1.5991 + $.name = readString($bytes, $stream, 0);
1.5992 + }
1.5993 + if (clip) {
1.5994 + $.clipDepth = readUi16($bytes, $stream);
1.5995 + }
1.5996 + if (hasFilters) {
1.5997 + var count = readUi8($bytes, $stream);
1.5998 + var $2 = $.filters = [];
1.5999 + var $3 = count;
1.6000 + while ($3--) {
1.6001 + var $4 = {};
1.6002 + anyFilter($bytes, $stream, $4, swfVersion, tagCode);
1.6003 + $2.push($4);
1.6004 + }
1.6005 + }
1.6006 + if (blend) {
1.6007 + $.blendMode = readUi8($bytes, $stream);
1.6008 + }
1.6009 + if (cache) {
1.6010 + $.bmpCache = readUi8($bytes, $stream);
1.6011 + }
1.6012 + if (hasEvents) {
1.6013 + var reserved = readUi16($bytes, $stream);
1.6014 + if (swfVersion >= 6) {
1.6015 + var allFlags = readUi32($bytes, $stream);
1.6016 + } else {
1.6017 + var allFlags = readUi16($bytes, $stream);
1.6018 + }
1.6019 + var $28 = $.events = [];
1.6020 + do {
1.6021 + var $29 = {};
1.6022 + var temp = events($bytes, $stream, $29, swfVersion, tagCode);
1.6023 + eoe = temp.eoe;
1.6024 + $28.push($29);
1.6025 + } while (!eoe);
1.6026 + }
1.6027 + if (hasBackgroundColor) {
1.6028 + var $126 = $.backgroundColor = {};
1.6029 + argb($bytes, $stream, $126, swfVersion, tagCode);
1.6030 + }
1.6031 + if (hasVisibility) {
1.6032 + $.visibility = readUi8($bytes, $stream);
1.6033 + }
1.6034 + } else {
1.6035 + $.place = 1;
1.6036 + $.symbolId = readUi16($bytes, $stream);
1.6037 + $.depth = readUi16($bytes, $stream);
1.6038 + $.hasMatrix = 1;
1.6039 + var $30 = $.matrix = {};
1.6040 + matrix($bytes, $stream, $30, swfVersion, tagCode);
1.6041 + if ($stream.remaining()) {
1.6042 + $.hasCxform = 1;
1.6043 + var $31 = $.cxform = {};
1.6044 + cxform($bytes, $stream, $31, swfVersion, tagCode);
1.6045 + }
1.6046 + }
1.6047 + return $;
1.6048 + }
1.6049 + function removeObject($bytes, $stream, $, swfVersion, tagCode) {
1.6050 + $ || ($ = {});
1.6051 + if (tagCode === 5) {
1.6052 + $.symbolId = readUi16($bytes, $stream);
1.6053 + }
1.6054 + $.depth = readUi16($bytes, $stream);
1.6055 + return $;
1.6056 + }
1.6057 + function defineImage($bytes, $stream, $, swfVersion, tagCode) {
1.6058 + var imgData;
1.6059 + $ || ($ = {});
1.6060 + $.id = readUi16($bytes, $stream);
1.6061 + if (tagCode > 21) {
1.6062 + var alphaDataOffset = readUi32($bytes, $stream);
1.6063 + if (tagCode === 90) {
1.6064 + $.deblock = readFixed8($bytes, $stream);
1.6065 + }
1.6066 + imgData = $.imgData = readBinary($bytes, $stream, alphaDataOffset);
1.6067 + $.alphaData = readBinary($bytes, $stream, 0);
1.6068 + } else {
1.6069 + imgData = $.imgData = readBinary($bytes, $stream, 0);
1.6070 + }
1.6071 + switch (imgData[0] << 8 | imgData[1]) {
1.6072 + case 65496:
1.6073 + case 65497:
1.6074 + $.mimeType = 'image/jpeg';
1.6075 + break;
1.6076 + case 35152:
1.6077 + $.mimeType = 'image/png';
1.6078 + break;
1.6079 + case 18249:
1.6080 + $.mimeType = 'image/gif';
1.6081 + break;
1.6082 + default:
1.6083 + $.mimeType = 'application/octet-stream';
1.6084 + }
1.6085 + if (tagCode === 6) {
1.6086 + $.incomplete = 1;
1.6087 + }
1.6088 + return $;
1.6089 + }
1.6090 + function defineButton($bytes, $stream, $, swfVersion, tagCode) {
1.6091 + var eob, hasFilters, count, blend;
1.6092 + $ || ($ = {});
1.6093 + $.id = readUi16($bytes, $stream);
1.6094 + if (tagCode == 7) {
1.6095 + var $0 = $.characters = [];
1.6096 + do {
1.6097 + var $1 = {};
1.6098 + var temp = button($bytes, $stream, $1, swfVersion, tagCode);
1.6099 + eob = temp.eob;
1.6100 + $0.push($1);
1.6101 + } while (!eob);
1.6102 + $.actionsData = readBinary($bytes, $stream, 0);
1.6103 + } else {
1.6104 + var trackFlags = readUi8($bytes, $stream);
1.6105 + $.trackAsMenu = trackFlags >> 7 & 1;
1.6106 + var actionOffset = readUi16($bytes, $stream);
1.6107 + var $28 = $.characters = [];
1.6108 + do {
1.6109 + var $29 = {};
1.6110 + var flags = readUi8($bytes, $stream);
1.6111 + var eob = $29.eob = !flags;
1.6112 + if (swfVersion >= 8) {
1.6113 + blend = $29.blend = flags >> 5 & 1;
1.6114 + hasFilters = $29.hasFilters = flags >> 4 & 1;
1.6115 + } else {
1.6116 + blend = $29.blend = 0;
1.6117 + hasFilters = $29.hasFilters = 0;
1.6118 + }
1.6119 + $29.stateHitTest = flags >> 3 & 1;
1.6120 + $29.stateDown = flags >> 2 & 1;
1.6121 + $29.stateOver = flags >> 1 & 1;
1.6122 + $29.stateUp = flags & 1;
1.6123 + if (!eob) {
1.6124 + $29.symbolId = readUi16($bytes, $stream);
1.6125 + $29.depth = readUi16($bytes, $stream);
1.6126 + var $30 = $29.matrix = {};
1.6127 + matrix($bytes, $stream, $30, swfVersion, tagCode);
1.6128 + if (tagCode === 34) {
1.6129 + var $31 = $29.cxform = {};
1.6130 + cxform($bytes, $stream, $31, swfVersion, tagCode);
1.6131 + }
1.6132 + if (hasFilters) {
1.6133 + var count = readUi8($bytes, $stream);
1.6134 + var $2 = $.filters = [];
1.6135 + var $3 = count;
1.6136 + while ($3--) {
1.6137 + var $4 = {};
1.6138 + anyFilter($bytes, $stream, $4, swfVersion, tagCode);
1.6139 + $2.push($4);
1.6140 + }
1.6141 + }
1.6142 + if (blend) {
1.6143 + $29.blendMode = readUi8($bytes, $stream);
1.6144 + }
1.6145 + }
1.6146 + $28.push($29);
1.6147 + } while (!eob);
1.6148 + if (!(!actionOffset)) {
1.6149 + var $56 = $.buttonActions = [];
1.6150 + do {
1.6151 + var $57 = {};
1.6152 + buttonCondAction($bytes, $stream, $57, swfVersion, tagCode);
1.6153 + $56.push($57);
1.6154 + } while ($stream.remaining() > 0);
1.6155 + }
1.6156 + }
1.6157 + return $;
1.6158 + }
1.6159 + function defineJPEGTables($bytes, $stream, $, swfVersion, tagCode) {
1.6160 + $ || ($ = {});
1.6161 + $.id = 0;
1.6162 + $.imgData = readBinary($bytes, $stream, 0);
1.6163 + $.mimeType = 'application/octet-stream';
1.6164 + return $;
1.6165 + }
1.6166 + function setBackgroundColor($bytes, $stream, $, swfVersion, tagCode) {
1.6167 + $ || ($ = {});
1.6168 + var $0 = $.color = {};
1.6169 + rgb($bytes, $stream, $0, swfVersion, tagCode);
1.6170 + return $;
1.6171 + }
1.6172 + function defineBinaryData($bytes, $stream, $, swfVersion, tagCode) {
1.6173 + $ || ($ = {});
1.6174 + $.id = readUi16($bytes, $stream);
1.6175 + var reserved = readUi32($bytes, $stream);
1.6176 + $.data = readBinary($bytes, $stream, 0);
1.6177 + return $;
1.6178 + }
1.6179 + function defineFont($bytes, $stream, $, swfVersion, tagCode) {
1.6180 + $ || ($ = {});
1.6181 + $.id = readUi16($bytes, $stream);
1.6182 + var firstOffset = readUi16($bytes, $stream);
1.6183 + var glyphCount = $.glyphCount = firstOffset / 2;
1.6184 + var restOffsets = [];
1.6185 + var $0 = glyphCount - 1;
1.6186 + while ($0--) {
1.6187 + restOffsets.push(readUi16($bytes, $stream));
1.6188 + }
1.6189 + $.offsets = [
1.6190 + firstOffset
1.6191 + ].concat(restOffsets);
1.6192 + var $1 = $.glyphs = [];
1.6193 + var $2 = glyphCount;
1.6194 + while ($2--) {
1.6195 + var $3 = {};
1.6196 + shape($bytes, $stream, $3, swfVersion, tagCode);
1.6197 + $1.push($3);
1.6198 + }
1.6199 + return $;
1.6200 + }
1.6201 + function defineLabel($bytes, $stream, $, swfVersion, tagCode) {
1.6202 + var eot;
1.6203 + $ || ($ = {});
1.6204 + $.id = readUi16($bytes, $stream);
1.6205 + var $0 = $.bbox = {};
1.6206 + bbox($bytes, $stream, $0, swfVersion, tagCode);
1.6207 + var $1 = $.matrix = {};
1.6208 + matrix($bytes, $stream, $1, swfVersion, tagCode);
1.6209 + var glyphBits = $.glyphBits = readUi8($bytes, $stream);
1.6210 + var advanceBits = $.advanceBits = readUi8($bytes, $stream);
1.6211 + var $2 = $.records = [];
1.6212 + do {
1.6213 + var $3 = {};
1.6214 + var temp = textRecord($bytes, $stream, $3, swfVersion, tagCode, glyphBits, advanceBits);
1.6215 + eot = temp.eot;
1.6216 + $2.push($3);
1.6217 + } while (!eot);
1.6218 + return $;
1.6219 + }
1.6220 + function doAction($bytes, $stream, $, swfVersion, tagCode) {
1.6221 + $ || ($ = {});
1.6222 + if (tagCode === 59) {
1.6223 + $.spriteId = readUi16($bytes, $stream);
1.6224 + }
1.6225 + $.actionsData = readBinary($bytes, $stream, 0);
1.6226 + return $;
1.6227 + }
1.6228 + function defineSound($bytes, $stream, $, swfVersion, tagCode) {
1.6229 + $ || ($ = {});
1.6230 + $.id = readUi16($bytes, $stream);
1.6231 + var soundFlags = readUi8($bytes, $stream);
1.6232 + $.soundFormat = soundFlags >> 4 & 15;
1.6233 + $.soundRate = soundFlags >> 2 & 3;
1.6234 + $.soundSize = soundFlags >> 1 & 1;
1.6235 + $.soundType = soundFlags & 1;
1.6236 + $.samplesCount = readUi32($bytes, $stream);
1.6237 + $.soundData = readBinary($bytes, $stream, 0);
1.6238 + return $;
1.6239 + }
1.6240 + function startSound($bytes, $stream, $, swfVersion, tagCode) {
1.6241 + $ || ($ = {});
1.6242 + if (tagCode == 15) {
1.6243 + $.soundId = readUi16($bytes, $stream);
1.6244 + }
1.6245 + if (tagCode == 89) {
1.6246 + $.soundClassName = readString($bytes, $stream, 0);
1.6247 + }
1.6248 + var $0 = $.soundInfo = {};
1.6249 + soundInfo($bytes, $stream, $0, swfVersion, tagCode);
1.6250 + return $;
1.6251 + }
1.6252 + function soundStreamHead($bytes, $stream, $, swfVersion, tagCode) {
1.6253 + $ || ($ = {});
1.6254 + var playbackFlags = readUi8($bytes, $stream);
1.6255 + $.playbackRate = playbackFlags >> 2 & 3;
1.6256 + $.playbackSize = playbackFlags >> 1 & 1;
1.6257 + $.playbackType = playbackFlags & 1;
1.6258 + var streamFlags = readUi8($bytes, $stream);
1.6259 + var streamCompression = $.streamCompression = streamFlags >> 4 & 15;
1.6260 + $.streamRate = streamFlags >> 2 & 3;
1.6261 + $.streamSize = streamFlags >> 1 & 1;
1.6262 + $.streamType = streamFlags & 1;
1.6263 + $.samplesCount = readUi32($bytes, $stream);
1.6264 + if (streamCompression == 2) {
1.6265 + $.latencySeek = readSi16($bytes, $stream);
1.6266 + }
1.6267 + return $;
1.6268 + }
1.6269 + function soundStreamBlock($bytes, $stream, $, swfVersion, tagCode) {
1.6270 + $ || ($ = {});
1.6271 + $.data = readBinary($bytes, $stream, 0);
1.6272 + return $;
1.6273 + }
1.6274 + function defineBitmap($bytes, $stream, $, swfVersion, tagCode) {
1.6275 + $ || ($ = {});
1.6276 + $.id = readUi16($bytes, $stream);
1.6277 + var format = $.format = readUi8($bytes, $stream);
1.6278 + $.width = readUi16($bytes, $stream);
1.6279 + $.height = readUi16($bytes, $stream);
1.6280 + $.hasAlpha = tagCode === 36;
1.6281 + if (format === 3) {
1.6282 + $.colorTableSize = readUi8($bytes, $stream);
1.6283 + }
1.6284 + $.bmpData = readBinary($bytes, $stream, 0);
1.6285 + return $;
1.6286 + }
1.6287 + function defineText($bytes, $stream, $, swfVersion, tagCode) {
1.6288 + $ || ($ = {});
1.6289 + $.id = readUi16($bytes, $stream);
1.6290 + var $0 = $.bbox = {};
1.6291 + bbox($bytes, $stream, $0, swfVersion, tagCode);
1.6292 + var flags = readUi16($bytes, $stream);
1.6293 + var hasText = $.hasText = flags >> 7 & 1;
1.6294 + $.wordWrap = flags >> 6 & 1;
1.6295 + $.multiline = flags >> 5 & 1;
1.6296 + $.password = flags >> 4 & 1;
1.6297 + $.readonly = flags >> 3 & 1;
1.6298 + var hasColor = $.hasColor = flags >> 2 & 1;
1.6299 + var hasMaxLength = $.hasMaxLength = flags >> 1 & 1;
1.6300 + var hasFont = $.hasFont = flags & 1;
1.6301 + var hasFontClass = $.hasFontClass = flags >> 15 & 1;
1.6302 + $.autoSize = flags >> 14 & 1;
1.6303 + var hasLayout = $.hasLayout = flags >> 13 & 1;
1.6304 + $.noSelect = flags >> 12 & 1;
1.6305 + $.border = flags >> 11 & 1;
1.6306 + $.wasStatic = flags >> 10 & 1;
1.6307 + $.html = flags >> 9 & 1;
1.6308 + $.useOutlines = flags >> 8 & 1;
1.6309 + if (hasFont) {
1.6310 + $.fontId = readUi16($bytes, $stream);
1.6311 + }
1.6312 + if (hasFontClass) {
1.6313 + $.fontClass = readString($bytes, $stream, 0);
1.6314 + }
1.6315 + if (hasFont) {
1.6316 + $.fontHeight = readUi16($bytes, $stream);
1.6317 + }
1.6318 + if (hasColor) {
1.6319 + var $1 = $.color = {};
1.6320 + rgba($bytes, $stream, $1, swfVersion, tagCode);
1.6321 + }
1.6322 + if (hasMaxLength) {
1.6323 + $.maxLength = readUi16($bytes, $stream);
1.6324 + }
1.6325 + if (hasLayout) {
1.6326 + $.align = readUi8($bytes, $stream);
1.6327 + $.leftMargin = readUi16($bytes, $stream);
1.6328 + $.rightMargin = readUi16($bytes, $stream);
1.6329 + $.indent = readSi16($bytes, $stream);
1.6330 + $.leading = readSi16($bytes, $stream);
1.6331 + }
1.6332 + $.variableName = readString($bytes, $stream, 0);
1.6333 + if (hasText) {
1.6334 + $.initialText = readString($bytes, $stream, 0);
1.6335 + }
1.6336 + return $;
1.6337 + }
1.6338 + function frameLabel($bytes, $stream, $, swfVersion, tagCode) {
1.6339 + $ || ($ = {});
1.6340 + $.name = readString($bytes, $stream, 0);
1.6341 + return $;
1.6342 + }
1.6343 + function defineFont2($bytes, $stream, $, swfVersion, tagCode) {
1.6344 + $ || ($ = {});
1.6345 + $.id = readUi16($bytes, $stream);
1.6346 + var hasLayout = $.hasLayout = readUb($bytes, $stream, 1);
1.6347 + if (swfVersion > 5) {
1.6348 + $.shiftJis = readUb($bytes, $stream, 1);
1.6349 + } else {
1.6350 + var reserved = readUb($bytes, $stream, 1);
1.6351 + }
1.6352 + $.smallText = readUb($bytes, $stream, 1);
1.6353 + $.ansi = readUb($bytes, $stream, 1);
1.6354 + var wideOffset = $.wideOffset = readUb($bytes, $stream, 1);
1.6355 + var wide = $.wide = readUb($bytes, $stream, 1);
1.6356 + $.italic = readUb($bytes, $stream, 1);
1.6357 + $.bold = readUb($bytes, $stream, 1);
1.6358 + if (swfVersion > 5) {
1.6359 + $.language = readUi8($bytes, $stream);
1.6360 + } else {
1.6361 + var reserved = readUi8($bytes, $stream);
1.6362 + $.language = 0;
1.6363 + }
1.6364 + var nameLength = readUi8($bytes, $stream);
1.6365 + $.name = readString($bytes, $stream, nameLength);
1.6366 + if (tagCode === 75) {
1.6367 + $.resolution = 20;
1.6368 + }
1.6369 + var glyphCount = $.glyphCount = readUi16($bytes, $stream);
1.6370 + if (wideOffset) {
1.6371 + var $0 = $.offsets = [];
1.6372 + var $1 = glyphCount;
1.6373 + while ($1--) {
1.6374 + $0.push(readUi32($bytes, $stream));
1.6375 + }
1.6376 + $.mapOffset = readUi32($bytes, $stream);
1.6377 + } else {
1.6378 + var $2 = $.offsets = [];
1.6379 + var $3 = glyphCount;
1.6380 + while ($3--) {
1.6381 + $2.push(readUi16($bytes, $stream));
1.6382 + }
1.6383 + $.mapOffset = readUi16($bytes, $stream);
1.6384 + }
1.6385 + var $4 = $.glyphs = [];
1.6386 + var $5 = glyphCount;
1.6387 + while ($5--) {
1.6388 + var $6 = {};
1.6389 + shape($bytes, $stream, $6, swfVersion, tagCode);
1.6390 + $4.push($6);
1.6391 + }
1.6392 + if (wide) {
1.6393 + var $47 = $.codes = [];
1.6394 + var $48 = glyphCount;
1.6395 + while ($48--) {
1.6396 + $47.push(readUi16($bytes, $stream));
1.6397 + }
1.6398 + } else {
1.6399 + var $49 = $.codes = [];
1.6400 + var $50 = glyphCount;
1.6401 + while ($50--) {
1.6402 + $49.push(readUi8($bytes, $stream));
1.6403 + }
1.6404 + }
1.6405 + if (hasLayout) {
1.6406 + $.ascent = readUi16($bytes, $stream);
1.6407 + $.descent = readUi16($bytes, $stream);
1.6408 + $.leading = readSi16($bytes, $stream);
1.6409 + var $51 = $.advance = [];
1.6410 + var $52 = glyphCount;
1.6411 + while ($52--) {
1.6412 + $51.push(readSi16($bytes, $stream));
1.6413 + }
1.6414 + var $53 = $.bbox = [];
1.6415 + var $54 = glyphCount;
1.6416 + while ($54--) {
1.6417 + var $55 = {};
1.6418 + bbox($bytes, $stream, $55, swfVersion, tagCode);
1.6419 + $53.push($55);
1.6420 + }
1.6421 + var kerningCount = readUi16($bytes, $stream);
1.6422 + var $56 = $.kerning = [];
1.6423 + var $57 = kerningCount;
1.6424 + while ($57--) {
1.6425 + var $58 = {};
1.6426 + kerning($bytes, $stream, $58, swfVersion, tagCode, wide);
1.6427 + $56.push($58);
1.6428 + }
1.6429 + }
1.6430 + return $;
1.6431 + }
1.6432 + function fileAttributes($bytes, $stream, $, swfVersion, tagCode) {
1.6433 + $ || ($ = {});
1.6434 + var reserved = readUb($bytes, $stream, 1);
1.6435 + $.useDirectBlit = readUb($bytes, $stream, 1);
1.6436 + $.useGpu = readUb($bytes, $stream, 1);
1.6437 + $.hasMetadata = readUb($bytes, $stream, 1);
1.6438 + $.doAbc = readUb($bytes, $stream, 1);
1.6439 + $.noCrossDomainCaching = readUb($bytes, $stream, 1);
1.6440 + $.relativeUrls = readUb($bytes, $stream, 1);
1.6441 + $.network = readUb($bytes, $stream, 1);
1.6442 + var pad = readUb($bytes, $stream, 24);
1.6443 + return $;
1.6444 + }
1.6445 + function doABC($bytes, $stream, $, swfVersion, tagCode) {
1.6446 + $ || ($ = {});
1.6447 + if (tagCode === 82) {
1.6448 + $.flags = readUi32($bytes, $stream);
1.6449 + } else {
1.6450 + $.flags = 0;
1.6451 + }
1.6452 + if (tagCode === 82) {
1.6453 + $.name = readString($bytes, $stream, 0);
1.6454 + } else {
1.6455 + $.name = '';
1.6456 + }
1.6457 + $.data = readBinary($bytes, $stream, 0);
1.6458 + return $;
1.6459 + }
1.6460 + function exportAssets($bytes, $stream, $, swfVersion, tagCode) {
1.6461 + $ || ($ = {});
1.6462 + var exportsCount = readUi16($bytes, $stream);
1.6463 + var $0 = $.exports = [];
1.6464 + var $1 = exportsCount;
1.6465 + while ($1--) {
1.6466 + var $2 = {};
1.6467 + $2.symbolId = readUi16($bytes, $stream);
1.6468 + $2.className = readString($bytes, $stream, 0);
1.6469 + $0.push($2);
1.6470 + }
1.6471 + return $;
1.6472 + }
1.6473 + function symbolClass($bytes, $stream, $, swfVersion, tagCode) {
1.6474 + $ || ($ = {});
1.6475 + var symbolCount = readUi16($bytes, $stream);
1.6476 + var $0 = $.exports = [];
1.6477 + var $1 = symbolCount;
1.6478 + while ($1--) {
1.6479 + var $2 = {};
1.6480 + $2.symbolId = readUi16($bytes, $stream);
1.6481 + $2.className = readString($bytes, $stream, 0);
1.6482 + $0.push($2);
1.6483 + }
1.6484 + return $;
1.6485 + }
1.6486 + function defineScalingGrid($bytes, $stream, $, swfVersion, tagCode) {
1.6487 + $ || ($ = {});
1.6488 + $.symbolId = readUi16($bytes, $stream);
1.6489 + var $0 = $.splitter = {};
1.6490 + bbox($bytes, $stream, $0, swfVersion, tagCode);
1.6491 + return $;
1.6492 + }
1.6493 + function defineScene($bytes, $stream, $, swfVersion, tagCode) {
1.6494 + $ || ($ = {});
1.6495 + var sceneCount = readEncodedU32($bytes, $stream);
1.6496 + var $0 = $.scenes = [];
1.6497 + var $1 = sceneCount;
1.6498 + while ($1--) {
1.6499 + var $2 = {};
1.6500 + $2.offset = readEncodedU32($bytes, $stream);
1.6501 + $2.name = readString($bytes, $stream, 0);
1.6502 + $0.push($2);
1.6503 + }
1.6504 + var labelCount = readEncodedU32($bytes, $stream);
1.6505 + var $3 = $.labels = [];
1.6506 + var $4 = labelCount;
1.6507 + while ($4--) {
1.6508 + var $5 = {};
1.6509 + $5.frame = readEncodedU32($bytes, $stream);
1.6510 + $5.name = readString($bytes, $stream, 0);
1.6511 + $3.push($5);
1.6512 + }
1.6513 + return $;
1.6514 + }
1.6515 + function bbox($bytes, $stream, $, swfVersion, tagCode) {
1.6516 + align($bytes, $stream);
1.6517 + var bits = readUb($bytes, $stream, 5);
1.6518 + var xMin = readSb($bytes, $stream, bits);
1.6519 + var xMax = readSb($bytes, $stream, bits);
1.6520 + var yMin = readSb($bytes, $stream, bits);
1.6521 + var yMax = readSb($bytes, $stream, bits);
1.6522 + $.xMin = xMin;
1.6523 + $.xMax = xMax;
1.6524 + $.yMin = yMin;
1.6525 + $.yMax = yMax;
1.6526 + align($bytes, $stream);
1.6527 + }
1.6528 + function rgb($bytes, $stream, $, swfVersion, tagCode) {
1.6529 + $.red = readUi8($bytes, $stream);
1.6530 + $.green = readUi8($bytes, $stream);
1.6531 + $.blue = readUi8($bytes, $stream);
1.6532 + $.alpha = 255;
1.6533 + return;
1.6534 + }
1.6535 + function rgba($bytes, $stream, $, swfVersion, tagCode) {
1.6536 + $.red = readUi8($bytes, $stream);
1.6537 + $.green = readUi8($bytes, $stream);
1.6538 + $.blue = readUi8($bytes, $stream);
1.6539 + $.alpha = readUi8($bytes, $stream);
1.6540 + return;
1.6541 + }
1.6542 + function argb($bytes, $stream, $, swfVersion, tagCode) {
1.6543 + $.alpha = readUi8($bytes, $stream);
1.6544 + $.red = readUi8($bytes, $stream);
1.6545 + $.green = readUi8($bytes, $stream);
1.6546 + $.blue = readUi8($bytes, $stream);
1.6547 + }
1.6548 + function fillSolid($bytes, $stream, $, swfVersion, tagCode, isMorph) {
1.6549 + if (tagCode > 22 || isMorph) {
1.6550 + var $125 = $.color = {};
1.6551 + rgba($bytes, $stream, $125, swfVersion, tagCode);
1.6552 + } else {
1.6553 + var $126 = $.color = {};
1.6554 + rgb($bytes, $stream, $126, swfVersion, tagCode);
1.6555 + }
1.6556 + if (isMorph) {
1.6557 + var $127 = $.colorMorph = {};
1.6558 + rgba($bytes, $stream, $127, swfVersion, tagCode);
1.6559 + }
1.6560 + return;
1.6561 + }
1.6562 + function matrix($bytes, $stream, $, swfVersion, tagCode) {
1.6563 + align($bytes, $stream);
1.6564 + var hasScale = readUb($bytes, $stream, 1);
1.6565 + if (hasScale) {
1.6566 + var bits = readUb($bytes, $stream, 5);
1.6567 + $.a = readFb($bytes, $stream, bits);
1.6568 + $.d = readFb($bytes, $stream, bits);
1.6569 + } else {
1.6570 + $.a = 1;
1.6571 + $.d = 1;
1.6572 + }
1.6573 + var hasRotate = readUb($bytes, $stream, 1);
1.6574 + if (hasRotate) {
1.6575 + var bits = readUb($bytes, $stream, 5);
1.6576 + $.b = readFb($bytes, $stream, bits);
1.6577 + $.c = readFb($bytes, $stream, bits);
1.6578 + } else {
1.6579 + $.b = 0;
1.6580 + $.c = 0;
1.6581 + }
1.6582 + var bits = readUb($bytes, $stream, 5);
1.6583 + var e = readSb($bytes, $stream, bits);
1.6584 + var f = readSb($bytes, $stream, bits);
1.6585 + $.tx = e;
1.6586 + $.ty = f;
1.6587 + align($bytes, $stream);
1.6588 + }
1.6589 + function cxform($bytes, $stream, $, swfVersion, tagCode) {
1.6590 + align($bytes, $stream);
1.6591 + var hasOffsets = readUb($bytes, $stream, 1);
1.6592 + var hasMultipliers = readUb($bytes, $stream, 1);
1.6593 + var bits = readUb($bytes, $stream, 4);
1.6594 + if (hasMultipliers) {
1.6595 + $.redMultiplier = readSb($bytes, $stream, bits);
1.6596 + $.greenMultiplier = readSb($bytes, $stream, bits);
1.6597 + $.blueMultiplier = readSb($bytes, $stream, bits);
1.6598 + if (tagCode > 4) {
1.6599 + $.alphaMultiplier = readSb($bytes, $stream, bits);
1.6600 + } else {
1.6601 + $.alphaMultiplier = 256;
1.6602 + }
1.6603 + } else {
1.6604 + $.redMultiplier = 256;
1.6605 + $.greenMultiplier = 256;
1.6606 + $.blueMultiplier = 256;
1.6607 + $.alphaMultiplier = 256;
1.6608 + }
1.6609 + if (hasOffsets) {
1.6610 + $.redOffset = readSb($bytes, $stream, bits);
1.6611 + $.greenOffset = readSb($bytes, $stream, bits);
1.6612 + $.blueOffset = readSb($bytes, $stream, bits);
1.6613 + if (tagCode > 4) {
1.6614 + $.alphaOffset = readSb($bytes, $stream, bits);
1.6615 + } else {
1.6616 + $.alphaOffset = 0;
1.6617 + }
1.6618 + } else {
1.6619 + $.redOffset = 0;
1.6620 + $.greenOffset = 0;
1.6621 + $.blueOffset = 0;
1.6622 + $.alphaOffset = 0;
1.6623 + }
1.6624 + align($bytes, $stream);
1.6625 + }
1.6626 + function fillGradient($bytes, $stream, $, swfVersion, tagCode, isMorph, type) {
1.6627 + var $128 = $.matrix = {};
1.6628 + matrix($bytes, $stream, $128, swfVersion, tagCode);
1.6629 + if (isMorph) {
1.6630 + var $129 = $.matrixMorph = {};
1.6631 + matrix($bytes, $stream, $129, swfVersion, tagCode);
1.6632 + }
1.6633 + gradient($bytes, $stream, $, swfVersion, tagCode, isMorph, type);
1.6634 + }
1.6635 + function gradient($bytes, $stream, $, swfVersion, tagCode, isMorph, type) {
1.6636 + if (tagCode === 83) {
1.6637 + $.spreadMode = readUb($bytes, $stream, 2);
1.6638 + $.interpolationMode = readUb($bytes, $stream, 2);
1.6639 + } else {
1.6640 + var pad = readUb($bytes, $stream, 4);
1.6641 + }
1.6642 + var count = $.count = readUb($bytes, $stream, 4);
1.6643 + var $130 = $.records = [];
1.6644 + var $131 = count;
1.6645 + while ($131--) {
1.6646 + var $132 = {};
1.6647 + gradientRecord($bytes, $stream, $132, swfVersion, tagCode, isMorph);
1.6648 + $130.push($132);
1.6649 + }
1.6650 + if (type === 19) {
1.6651 + $.focalPoint = readFixed8($bytes, $stream);
1.6652 + if (isMorph) {
1.6653 + $.focalPointMorph = readFixed8($bytes, $stream);
1.6654 + }
1.6655 + }
1.6656 + }
1.6657 + function gradientRecord($bytes, $stream, $, swfVersion, tagCode, isMorph) {
1.6658 + $.ratio = readUi8($bytes, $stream);
1.6659 + if (tagCode > 22) {
1.6660 + var $133 = $.color = {};
1.6661 + rgba($bytes, $stream, $133, swfVersion, tagCode);
1.6662 + } else {
1.6663 + var $134 = $.color = {};
1.6664 + rgb($bytes, $stream, $134, swfVersion, tagCode);
1.6665 + }
1.6666 + if (isMorph) {
1.6667 + $.ratioMorph = readUi8($bytes, $stream);
1.6668 + var $135 = $.colorMorph = {};
1.6669 + rgba($bytes, $stream, $135, swfVersion, tagCode);
1.6670 + }
1.6671 + }
1.6672 + function morphShapeWithStyle($bytes, $stream, $, swfVersion, tagCode, isMorph, hasStrokes) {
1.6673 + var eos, bits;
1.6674 + var temp = styles($bytes, $stream, $, swfVersion, tagCode, isMorph, hasStrokes);
1.6675 + var lineBits = temp.lineBits;
1.6676 + var fillBits = temp.fillBits;
1.6677 + var $160 = $.records = [];
1.6678 + do {
1.6679 + var $161 = {};
1.6680 + var temp = shapeRecord($bytes, $stream, $161, swfVersion, tagCode, isMorph, fillBits, lineBits, hasStrokes, bits);
1.6681 + var eos = temp.eos;
1.6682 + var flags = temp.flags;
1.6683 + var type = temp.type;
1.6684 + var fillBits = temp.fillBits;
1.6685 + var lineBits = temp.lineBits;
1.6686 + var bits = temp.bits;
1.6687 + $160.push($161);
1.6688 + } while (!eos);
1.6689 + var temp = styleBits($bytes, $stream, $, swfVersion, tagCode);
1.6690 + var fillBits = temp.fillBits;
1.6691 + var lineBits = temp.lineBits;
1.6692 + var $162 = $.recordsMorph = [];
1.6693 + do {
1.6694 + var $163 = {};
1.6695 + var temp = shapeRecord($bytes, $stream, $163, swfVersion, tagCode, isMorph, fillBits, lineBits, hasStrokes, bits);
1.6696 + eos = temp.eos;
1.6697 + var flags = temp.flags;
1.6698 + var type = temp.type;
1.6699 + var fillBits = temp.fillBits;
1.6700 + var lineBits = temp.lineBits;
1.6701 + bits = temp.bits;
1.6702 + $162.push($163);
1.6703 + } while (!eos);
1.6704 + }
1.6705 + function shapeWithStyle($bytes, $stream, $, swfVersion, tagCode, isMorph, hasStrokes) {
1.6706 + var eos;
1.6707 + var temp = styles($bytes, $stream, $, swfVersion, tagCode, isMorph, hasStrokes);
1.6708 + var fillBits = temp.fillBits;
1.6709 + var lineBits = temp.lineBits;
1.6710 + var $160 = $.records = [];
1.6711 + do {
1.6712 + var $161 = {};
1.6713 + var temp = shapeRecord($bytes, $stream, $161, swfVersion, tagCode, isMorph, fillBits, lineBits, hasStrokes, bits);
1.6714 + eos = temp.eos;
1.6715 + var flags = temp.flags;
1.6716 + var type = temp.type;
1.6717 + var fillBits = temp.fillBits;
1.6718 + var lineBits = temp.lineBits;
1.6719 + var bits = temp.bits;
1.6720 + $160.push($161);
1.6721 + } while (!eos);
1.6722 + }
1.6723 + function shapeRecord($bytes, $stream, $, swfVersion, tagCode, isMorph, fillBits, lineBits, hasStrokes, bits) {
1.6724 + var type = $.type = readUb($bytes, $stream, 1);
1.6725 + var flags = readUb($bytes, $stream, 5);
1.6726 + var eos = $.eos = !(type || flags);
1.6727 + if (type) {
1.6728 + var temp = shapeRecordEdge($bytes, $stream, $, swfVersion, tagCode, flags, bits);
1.6729 + var bits = temp.bits;
1.6730 + } else {
1.6731 + var temp = shapeRecordSetup($bytes, $stream, $, swfVersion, tagCode, flags, isMorph, fillBits, lineBits, hasStrokes, bits);
1.6732 + var fillBits = temp.fillBits;
1.6733 + var lineBits = temp.lineBits;
1.6734 + var bits = temp.bits;
1.6735 + }
1.6736 + return {
1.6737 + type: type,
1.6738 + flags: flags,
1.6739 + eos: eos,
1.6740 + fillBits: fillBits,
1.6741 + lineBits: lineBits,
1.6742 + bits: bits
1.6743 + };
1.6744 + }
1.6745 + function shapeRecordEdge($bytes, $stream, $, swfVersion, tagCode, flags, bits) {
1.6746 + var isStraight = 0, tmp = 0, bits = 0, isGeneral = 0, isVertical = 0;
1.6747 + isStraight = $.isStraight = flags >> 4;
1.6748 + tmp = flags & 15;
1.6749 + bits = tmp + 2;
1.6750 + if (isStraight) {
1.6751 + isGeneral = $.isGeneral = readUb($bytes, $stream, 1);
1.6752 + if (isGeneral) {
1.6753 + $.deltaX = readSb($bytes, $stream, bits);
1.6754 + $.deltaY = readSb($bytes, $stream, bits);
1.6755 + } else {
1.6756 + isVertical = $.isVertical = readUb($bytes, $stream, 1);
1.6757 + if (isVertical) {
1.6758 + $.deltaY = readSb($bytes, $stream, bits);
1.6759 + } else {
1.6760 + $.deltaX = readSb($bytes, $stream, bits);
1.6761 + }
1.6762 + }
1.6763 + } else {
1.6764 + $.controlDeltaX = readSb($bytes, $stream, bits);
1.6765 + $.controlDeltaY = readSb($bytes, $stream, bits);
1.6766 + $.anchorDeltaX = readSb($bytes, $stream, bits);
1.6767 + $.anchorDeltaY = readSb($bytes, $stream, bits);
1.6768 + }
1.6769 + return {
1.6770 + bits: bits
1.6771 + };
1.6772 + }
1.6773 + function shapeRecordSetup($bytes, $stream, $, swfVersion, tagCode, flags, isMorph, fillBits, lineBits, hasStrokes, bits) {
1.6774 + var hasNewStyles = 0, hasLineStyle = 0, hasFillStyle1 = 0;
1.6775 + var hasFillStyle0 = 0, move = 0;
1.6776 + if (tagCode > 2) {
1.6777 + hasNewStyles = $.hasNewStyles = flags >> 4;
1.6778 + } else {
1.6779 + hasNewStyles = $.hasNewStyles = 0;
1.6780 + }
1.6781 + hasLineStyle = $.hasLineStyle = flags >> 3 & 1;
1.6782 + hasFillStyle1 = $.hasFillStyle1 = flags >> 2 & 1;
1.6783 + hasFillStyle0 = $.hasFillStyle0 = flags >> 1 & 1;
1.6784 + move = $.move = flags & 1;
1.6785 + if (move) {
1.6786 + bits = readUb($bytes, $stream, 5);
1.6787 + $.moveX = readSb($bytes, $stream, bits);
1.6788 + $.moveY = readSb($bytes, $stream, bits);
1.6789 + }
1.6790 + if (hasFillStyle0) {
1.6791 + $.fillStyle0 = readUb($bytes, $stream, fillBits);
1.6792 + }
1.6793 + if (hasFillStyle1) {
1.6794 + $.fillStyle1 = readUb($bytes, $stream, fillBits);
1.6795 + }
1.6796 + if (hasLineStyle) {
1.6797 + $.lineStyle = readUb($bytes, $stream, lineBits);
1.6798 + }
1.6799 + if (hasNewStyles) {
1.6800 + var temp = styles($bytes, $stream, $, swfVersion, tagCode, isMorph, hasStrokes);
1.6801 + var lineBits = temp.lineBits;
1.6802 + var fillBits = temp.fillBits;
1.6803 + }
1.6804 + return {
1.6805 + lineBits: lineBits,
1.6806 + fillBits: fillBits,
1.6807 + bits: bits
1.6808 + };
1.6809 + }
1.6810 + function styles($bytes, $stream, $, swfVersion, tagCode, isMorph, hasStrokes) {
1.6811 + fillStyleArray($bytes, $stream, $, swfVersion, tagCode, isMorph);
1.6812 + lineStyleArray($bytes, $stream, $, swfVersion, tagCode, isMorph, hasStrokes);
1.6813 + var temp = styleBits($bytes, $stream, $, swfVersion, tagCode);
1.6814 + var fillBits = temp.fillBits;
1.6815 + var lineBits = temp.lineBits;
1.6816 + return {
1.6817 + fillBits: fillBits,
1.6818 + lineBits: lineBits
1.6819 + };
1.6820 + }
1.6821 + function fillStyleArray($bytes, $stream, $, swfVersion, tagCode, isMorph) {
1.6822 + var count;
1.6823 + var tmp = readUi8($bytes, $stream);
1.6824 + if (tagCode > 2 && tmp === 255) {
1.6825 + count = readUi16($bytes, $stream);
1.6826 + } else {
1.6827 + count = tmp;
1.6828 + }
1.6829 + var $4 = $.fillStyles = [];
1.6830 + var $5 = count;
1.6831 + while ($5--) {
1.6832 + var $6 = {};
1.6833 + fillStyle($bytes, $stream, $6, swfVersion, tagCode, isMorph);
1.6834 + $4.push($6);
1.6835 + }
1.6836 + }
1.6837 + function lineStyleArray($bytes, $stream, $, swfVersion, tagCode, isMorph, hasStrokes) {
1.6838 + var count;
1.6839 + var tmp = readUi8($bytes, $stream);
1.6840 + if (tagCode > 2 && tmp === 255) {
1.6841 + count = readUi16($bytes, $stream);
1.6842 + } else {
1.6843 + count = tmp;
1.6844 + }
1.6845 + var $138 = $.lineStyles = [];
1.6846 + var $139 = count;
1.6847 + while ($139--) {
1.6848 + var $140 = {};
1.6849 + lineStyle($bytes, $stream, $140, swfVersion, tagCode, isMorph, hasStrokes);
1.6850 + $138.push($140);
1.6851 + }
1.6852 + }
1.6853 + function styleBits($bytes, $stream, $, swfVersion, tagCode) {
1.6854 + align($bytes, $stream);
1.6855 + var fillBits = readUb($bytes, $stream, 4);
1.6856 + var lineBits = readUb($bytes, $stream, 4);
1.6857 + return {
1.6858 + fillBits: fillBits,
1.6859 + lineBits: lineBits
1.6860 + };
1.6861 + }
1.6862 + function fillStyle($bytes, $stream, $, swfVersion, tagCode, isMorph) {
1.6863 + var type = $.type = readUi8($bytes, $stream);
1.6864 + switch (type) {
1.6865 + case 0:
1.6866 + fillSolid($bytes, $stream, $, swfVersion, tagCode, isMorph);
1.6867 + break;
1.6868 + case 16:
1.6869 + case 18:
1.6870 + case 19:
1.6871 + fillGradient($bytes, $stream, $, swfVersion, tagCode, isMorph, type);
1.6872 + break;
1.6873 + case 64:
1.6874 + case 65:
1.6875 + case 66:
1.6876 + case 67:
1.6877 + fillBitmap($bytes, $stream, $, swfVersion, tagCode, isMorph, type);
1.6878 + break;
1.6879 + default:
1.6880 + }
1.6881 + }
1.6882 + function lineStyle($bytes, $stream, $, swfVersion, tagCode, isMorph, hasStrokes) {
1.6883 + $.width = readUi16($bytes, $stream);
1.6884 + if (isMorph) {
1.6885 + $.widthMorph = readUi16($bytes, $stream);
1.6886 + }
1.6887 + if (hasStrokes) {
1.6888 + align($bytes, $stream);
1.6889 + $.startCapStyle = readUb($bytes, $stream, 2);
1.6890 + var joinStyle = $.joinStyle = readUb($bytes, $stream, 2);
1.6891 + var hasFill = $.hasFill = readUb($bytes, $stream, 1);
1.6892 + $.noHscale = readUb($bytes, $stream, 1);
1.6893 + $.noVscale = readUb($bytes, $stream, 1);
1.6894 + $.pixelHinting = readUb($bytes, $stream, 1);
1.6895 + var reserved = readUb($bytes, $stream, 5);
1.6896 + $.noClose = readUb($bytes, $stream, 1);
1.6897 + $.endCapStyle = readUb($bytes, $stream, 2);
1.6898 + if (joinStyle === 2) {
1.6899 + $.miterLimitFactor = readFixed8($bytes, $stream);
1.6900 + }
1.6901 + if (hasFill) {
1.6902 + var $141 = $.fillStyle = {};
1.6903 + fillStyle($bytes, $stream, $141, swfVersion, tagCode, isMorph);
1.6904 + } else {
1.6905 + var $155 = $.color = {};
1.6906 + rgba($bytes, $stream, $155, swfVersion, tagCode);
1.6907 + if (isMorph) {
1.6908 + var $156 = $.colorMorph = {};
1.6909 + rgba($bytes, $stream, $156, swfVersion, tagCode);
1.6910 + }
1.6911 + }
1.6912 + } else {
1.6913 + if (tagCode > 22) {
1.6914 + var $157 = $.color = {};
1.6915 + rgba($bytes, $stream, $157, swfVersion, tagCode);
1.6916 + } else {
1.6917 + var $158 = $.color = {};
1.6918 + rgb($bytes, $stream, $158, swfVersion, tagCode);
1.6919 + }
1.6920 + if (isMorph) {
1.6921 + var $159 = $.colorMorph = {};
1.6922 + rgba($bytes, $stream, $159, swfVersion, tagCode);
1.6923 + }
1.6924 + }
1.6925 + }
1.6926 + function fillBitmap($bytes, $stream, $, swfVersion, tagCode, isMorph, type) {
1.6927 + $.bitmapId = readUi16($bytes, $stream);
1.6928 + var $18 = $.matrix = {};
1.6929 + matrix($bytes, $stream, $18, swfVersion, tagCode);
1.6930 + if (isMorph) {
1.6931 + var $19 = $.matrixMorph = {};
1.6932 + matrix($bytes, $stream, $19, swfVersion, tagCode);
1.6933 + }
1.6934 + $.condition = type === 64 || type === 67;
1.6935 + }
1.6936 + function filterGlow($bytes, $stream, $, swfVersion, tagCode, type) {
1.6937 + var count;
1.6938 + if (type === 4 || type === 7) {
1.6939 + count = readUi8($bytes, $stream);
1.6940 + } else {
1.6941 + count = 1;
1.6942 + }
1.6943 + var $5 = $.colors = [];
1.6944 + var $6 = count;
1.6945 + while ($6--) {
1.6946 + var $7 = {};
1.6947 + rgba($bytes, $stream, $7, swfVersion, tagCode);
1.6948 + $5.push($7);
1.6949 + }
1.6950 + if (type === 3) {
1.6951 + var $8 = $.higlightColor = {};
1.6952 + rgba($bytes, $stream, $8, swfVersion, tagCode);
1.6953 + }
1.6954 + if (type === 4 || type === 7) {
1.6955 + var $9 = $.ratios = [];
1.6956 + var $10 = count;
1.6957 + while ($10--) {
1.6958 + $9.push(readUi8($bytes, $stream));
1.6959 + }
1.6960 + }
1.6961 + $.blurX = readFixed($bytes, $stream);
1.6962 + $.blurY = readFixed($bytes, $stream);
1.6963 + if (type !== 2) {
1.6964 + $.angle = readFixed($bytes, $stream);
1.6965 + $.distance = readFixed($bytes, $stream);
1.6966 + }
1.6967 + $.strength = readFixed8($bytes, $stream);
1.6968 + $.innerShadow = readUb($bytes, $stream, 1);
1.6969 + $.knockout = readUb($bytes, $stream, 1);
1.6970 + $.compositeSource = readUb($bytes, $stream, 1);
1.6971 + if (type === 3) {
1.6972 + $.onTop = readUb($bytes, $stream, 1);
1.6973 + } else {
1.6974 + var reserved = readUb($bytes, $stream, 1);
1.6975 + }
1.6976 + if (type === 4 || type === 7) {
1.6977 + $.passes = readUb($bytes, $stream, 4);
1.6978 + } else {
1.6979 + var reserved = readUb($bytes, $stream, 4);
1.6980 + }
1.6981 + }
1.6982 + function filterBlur($bytes, $stream, $, swfVersion, tagCode) {
1.6983 + $.blurX = readFixed($bytes, $stream);
1.6984 + $.blurY = readFixed($bytes, $stream);
1.6985 + $.passes = readUb($bytes, $stream, 5);
1.6986 + var reserved = readUb($bytes, $stream, 3);
1.6987 + }
1.6988 + function filterConvolution($bytes, $stream, $, swfVersion, tagCode) {
1.6989 + var columns = $.columns = readUi8($bytes, $stream);
1.6990 + var rows = $.rows = readUi8($bytes, $stream);
1.6991 + $.divisor = readFloat($bytes, $stream);
1.6992 + $.bias = readFloat($bytes, $stream);
1.6993 + var $17 = $.weights = [];
1.6994 + var $18 = columns * rows;
1.6995 + while ($18--) {
1.6996 + $17.push(readFloat($bytes, $stream));
1.6997 + }
1.6998 + var $19 = $.defaultColor = {};
1.6999 + rgba($bytes, $stream, $19, swfVersion, tagCode);
1.7000 + var reserved = readUb($bytes, $stream, 6);
1.7001 + $.clamp = readUb($bytes, $stream, 1);
1.7002 + $.preserveAlpha = readUb($bytes, $stream, 1);
1.7003 + }
1.7004 + function filterColorMatrix($bytes, $stream, $, swfVersion, tagCode) {
1.7005 + var $20 = $.matrix = [];
1.7006 + var $21 = 20;
1.7007 + while ($21--) {
1.7008 + $20.push(readFloat($bytes, $stream));
1.7009 + }
1.7010 + }
1.7011 + function anyFilter($bytes, $stream, $, swfVersion, tagCode) {
1.7012 + var type = $.type = readUi8($bytes, $stream);
1.7013 + switch (type) {
1.7014 + case 0:
1.7015 + case 2:
1.7016 + case 3:
1.7017 + case 4:
1.7018 + case 7:
1.7019 + filterGlow($bytes, $stream, $, swfVersion, tagCode, type);
1.7020 + break;
1.7021 + case 1:
1.7022 + filterBlur($bytes, $stream, $, swfVersion, tagCode);
1.7023 + break;
1.7024 + case 5:
1.7025 + filterConvolution($bytes, $stream, $, swfVersion, tagCode);
1.7026 + break;
1.7027 + case 6:
1.7028 + filterColorMatrix($bytes, $stream, $, swfVersion, tagCode);
1.7029 + break;
1.7030 + default:
1.7031 + }
1.7032 + }
1.7033 + function events($bytes, $stream, $, swfVersion, tagCode) {
1.7034 + var flags, keyPress;
1.7035 + if (swfVersion >= 6) {
1.7036 + flags = readUi32($bytes, $stream);
1.7037 + } else {
1.7038 + flags = readUi16($bytes, $stream);
1.7039 + }
1.7040 + var eoe = $.eoe = !flags;
1.7041 + $.onKeyUp = flags >> 7 & 1;
1.7042 + $.onKeyDown = flags >> 6 & 1;
1.7043 + $.onMouseUp = flags >> 5 & 1;
1.7044 + $.onMouseDown = flags >> 4 & 1;
1.7045 + $.onMouseMove = flags >> 3 & 1;
1.7046 + $.onUnload = flags >> 2 & 1;
1.7047 + $.onEnterFrame = flags >> 1 & 1;
1.7048 + $.onLoad = flags & 1;
1.7049 + if (swfVersion >= 6) {
1.7050 + $.onDragOver = flags >> 15 & 1;
1.7051 + $.onRollOut = flags >> 14 & 1;
1.7052 + $.onRollOver = flags >> 13 & 1;
1.7053 + $.onReleaseOutside = flags >> 12 & 1;
1.7054 + $.onRelease = flags >> 11 & 1;
1.7055 + $.onPress = flags >> 10 & 1;
1.7056 + $.onInitialize = flags >> 9 & 1;
1.7057 + $.onData = flags >> 8 & 1;
1.7058 + if (swfVersion >= 7) {
1.7059 + $.onConstruct = flags >> 18 & 1;
1.7060 + } else {
1.7061 + $.onConstruct = 0;
1.7062 + }
1.7063 + keyPress = $.keyPress = flags >> 17 & 1;
1.7064 + $.onDragOut = flags >> 16 & 1;
1.7065 + }
1.7066 + if (!eoe) {
1.7067 + var length = $.length = readUi32($bytes, $stream);
1.7068 + if (keyPress) {
1.7069 + $.keyCode = readUi8($bytes, $stream);
1.7070 + }
1.7071 + $.actionsData = readBinary($bytes, $stream, length - (keyPress ? 1 : 0));
1.7072 + }
1.7073 + return {
1.7074 + eoe: eoe
1.7075 + };
1.7076 + }
1.7077 + function kerning($bytes, $stream, $, swfVersion, tagCode, wide) {
1.7078 + if (wide) {
1.7079 + $.code1 = readUi16($bytes, $stream);
1.7080 + $.code2 = readUi16($bytes, $stream);
1.7081 + } else {
1.7082 + $.code1 = readUi8($bytes, $stream);
1.7083 + $.code2 = readUi8($bytes, $stream);
1.7084 + }
1.7085 + $.adjustment = readUi16($bytes, $stream);
1.7086 + }
1.7087 + function textEntry($bytes, $stream, $, swfVersion, tagCode, glyphBits, advanceBits) {
1.7088 + $.glyphIndex = readUb($bytes, $stream, glyphBits);
1.7089 + $.advance = readSb($bytes, $stream, advanceBits);
1.7090 + }
1.7091 + function textRecordSetup($bytes, $stream, $, swfVersion, tagCode, flags) {
1.7092 + var hasFont = $.hasFont = flags >> 3 & 1;
1.7093 + var hasColor = $.hasColor = flags >> 2 & 1;
1.7094 + var hasMoveY = $.hasMoveY = flags >> 1 & 1;
1.7095 + var hasMoveX = $.hasMoveX = flags & 1;
1.7096 + if (hasFont) {
1.7097 + $.fontId = readUi16($bytes, $stream);
1.7098 + }
1.7099 + if (hasColor) {
1.7100 + if (tagCode === 33) {
1.7101 + var $4 = $.color = {};
1.7102 + rgba($bytes, $stream, $4, swfVersion, tagCode);
1.7103 + } else {
1.7104 + var $5 = $.color = {};
1.7105 + rgb($bytes, $stream, $5, swfVersion, tagCode);
1.7106 + }
1.7107 + }
1.7108 + if (hasMoveX) {
1.7109 + $.moveX = readSi16($bytes, $stream);
1.7110 + }
1.7111 + if (hasMoveY) {
1.7112 + $.moveY = readSi16($bytes, $stream);
1.7113 + }
1.7114 + if (hasFont) {
1.7115 + $.fontHeight = readUi16($bytes, $stream);
1.7116 + }
1.7117 + }
1.7118 + function textRecord($bytes, $stream, $, swfVersion, tagCode, glyphBits, advanceBits) {
1.7119 + var glyphCount;
1.7120 + align($bytes, $stream);
1.7121 + var flags = readUb($bytes, $stream, 8);
1.7122 + var eot = $.eot = !flags;
1.7123 + textRecordSetup($bytes, $stream, $, swfVersion, tagCode, flags);
1.7124 + if (!eot) {
1.7125 + var tmp = readUi8($bytes, $stream);
1.7126 + if (swfVersion > 6) {
1.7127 + glyphCount = $.glyphCount = tmp;
1.7128 + } else {
1.7129 + glyphCount = $.glyphCount = tmp & 127;
1.7130 + }
1.7131 + var $6 = $.entries = [];
1.7132 + var $7 = glyphCount;
1.7133 + while ($7--) {
1.7134 + var $8 = {};
1.7135 + textEntry($bytes, $stream, $8, swfVersion, tagCode, glyphBits, advanceBits);
1.7136 + $6.push($8);
1.7137 + }
1.7138 + }
1.7139 + return {
1.7140 + eot: eot
1.7141 + };
1.7142 + }
1.7143 + function soundEnvelope($bytes, $stream, $, swfVersion, tagCode) {
1.7144 + $.pos44 = readUi32($bytes, $stream);
1.7145 + $.volumeLeft = readUi16($bytes, $stream);
1.7146 + $.volumeRight = readUi16($bytes, $stream);
1.7147 + }
1.7148 + function soundInfo($bytes, $stream, $, swfVersion, tagCode) {
1.7149 + var reserved = readUb($bytes, $stream, 2);
1.7150 + $.stop = readUb($bytes, $stream, 1);
1.7151 + $.noMultiple = readUb($bytes, $stream, 1);
1.7152 + var hasEnvelope = $.hasEnvelope = readUb($bytes, $stream, 1);
1.7153 + var hasLoops = $.hasLoops = readUb($bytes, $stream, 1);
1.7154 + var hasOutPoint = $.hasOutPoint = readUb($bytes, $stream, 1);
1.7155 + var hasInPoint = $.hasInPoint = readUb($bytes, $stream, 1);
1.7156 + if (hasInPoint) {
1.7157 + $.inPoint = readUi32($bytes, $stream);
1.7158 + }
1.7159 + if (hasOutPoint) {
1.7160 + $.outPoint = readUi32($bytes, $stream);
1.7161 + }
1.7162 + if (hasLoops) {
1.7163 + $.loopCount = readUi16($bytes, $stream);
1.7164 + }
1.7165 + if (hasEnvelope) {
1.7166 + var envelopeCount = $.envelopeCount = readUi8($bytes, $stream);
1.7167 + var $1 = $.envelopes = [];
1.7168 + var $2 = envelopeCount;
1.7169 + while ($2--) {
1.7170 + var $3 = {};
1.7171 + soundEnvelope($bytes, $stream, $3, swfVersion, tagCode);
1.7172 + $1.push($3);
1.7173 + }
1.7174 + }
1.7175 + }
1.7176 + function button($bytes, $stream, $, swfVersion, tagCode) {
1.7177 + var hasFilters, blend;
1.7178 + var flags = readUi8($bytes, $stream);
1.7179 + var eob = $.eob = !flags;
1.7180 + if (swfVersion >= 8) {
1.7181 + blend = $.blend = flags >> 5 & 1;
1.7182 + hasFilters = $.hasFilters = flags >> 4 & 1;
1.7183 + } else {
1.7184 + blend = $.blend = 0;
1.7185 + hasFilters = $.hasFilters = 0;
1.7186 + }
1.7187 + $.stateHitTest = flags >> 3 & 1;
1.7188 + $.stateDown = flags >> 2 & 1;
1.7189 + $.stateOver = flags >> 1 & 1;
1.7190 + $.stateUp = flags & 1;
1.7191 + if (!eob) {
1.7192 + $.symbolId = readUi16($bytes, $stream);
1.7193 + $.depth = readUi16($bytes, $stream);
1.7194 + var $2 = $.matrix = {};
1.7195 + matrix($bytes, $stream, $2, swfVersion, tagCode);
1.7196 + if (tagCode === 34) {
1.7197 + var $3 = $.cxform = {};
1.7198 + cxform($bytes, $stream, $3, swfVersion, tagCode);
1.7199 + }
1.7200 + if (hasFilters) {
1.7201 + $.filterCount = readUi8($bytes, $stream);
1.7202 + var $4 = $.filters = {};
1.7203 + anyFilter($bytes, $stream, $4, swfVersion, tagCode);
1.7204 + }
1.7205 + if (blend) {
1.7206 + $.blendMode = readUi8($bytes, $stream);
1.7207 + }
1.7208 + }
1.7209 + return {
1.7210 + eob: eob
1.7211 + };
1.7212 + }
1.7213 + function buttonCondAction($bytes, $stream, $, swfVersion, tagCode) {
1.7214 + var buttonCondSize = readUi16($bytes, $stream);
1.7215 + var buttonConditions = readUi16($bytes, $stream);
1.7216 + $.idleToOverDown = buttonConditions >> 7 & 1;
1.7217 + $.outDownToIdle = buttonConditions >> 6 & 1;
1.7218 + $.outDownToOverDown = buttonConditions >> 5 & 1;
1.7219 + $.overDownToOutDown = buttonConditions >> 4 & 1;
1.7220 + $.overDownToOverUp = buttonConditions >> 3 & 1;
1.7221 + $.overUpToOverDown = buttonConditions >> 2 & 1;
1.7222 + $.overUpToIdle = buttonConditions >> 1 & 1;
1.7223 + $.idleToOverUp = buttonConditions & 1;
1.7224 + $.mouseEventFlags = buttonConditions & 511;
1.7225 + $.keyPress = buttonConditions >> 9 & 127;
1.7226 + $.overDownToIdle = buttonConditions >> 8 & 1;
1.7227 + if (!buttonCondSize) {
1.7228 + $.actionsData = readBinary($bytes, $stream, 0);
1.7229 + } else {
1.7230 + $.actionsData = readBinary($bytes, $stream, buttonCondSize - 4);
1.7231 + }
1.7232 + }
1.7233 + function shape($bytes, $stream, $, swfVersion, tagCode) {
1.7234 + var eos;
1.7235 + var temp = styleBits($bytes, $stream, $, swfVersion, tagCode);
1.7236 + var fillBits = temp.fillBits;
1.7237 + var lineBits = temp.lineBits;
1.7238 + var $4 = $.records = [];
1.7239 + do {
1.7240 + var $5 = {};
1.7241 + var isMorph = false;
1.7242 + var hasStrokes = false;
1.7243 + var temp = shapeRecord($bytes, $stream, $5, swfVersion, tagCode, isMorph, fillBits, lineBits, hasStrokes, bits);
1.7244 + eos = temp.eos;
1.7245 + var fillBits = temp.fillBits;
1.7246 + var lineBits = temp.lineBits;
1.7247 + var bits = bits;
1.7248 + $4.push($5);
1.7249 + } while (!eos);
1.7250 + }
1.7251 + return {
1.7252 + 0: undefined,
1.7253 + 1: undefined,
1.7254 + 2: defineShape,
1.7255 + 4: placeObject,
1.7256 + 5: removeObject,
1.7257 + 6: defineImage,
1.7258 + 7: defineButton,
1.7259 + 8: defineJPEGTables,
1.7260 + 9: setBackgroundColor,
1.7261 + 10: defineFont,
1.7262 + 11: defineLabel,
1.7263 + 12: doAction,
1.7264 + 13: undefined,
1.7265 + 14: defineSound,
1.7266 + 15: startSound,
1.7267 + 17: undefined,
1.7268 + 18: soundStreamHead,
1.7269 + 19: soundStreamBlock,
1.7270 + 20: defineBitmap,
1.7271 + 21: defineImage,
1.7272 + 22: defineShape,
1.7273 + 23: undefined,
1.7274 + 24: undefined,
1.7275 + 26: placeObject,
1.7276 + 28: removeObject,
1.7277 + 32: defineShape,
1.7278 + 33: defineLabel,
1.7279 + 34: defineButton,
1.7280 + 35: defineImage,
1.7281 + 36: defineBitmap,
1.7282 + 37: defineText,
1.7283 + 39: undefined,
1.7284 + 43: frameLabel,
1.7285 + 45: soundStreamHead,
1.7286 + 46: defineShape,
1.7287 + 48: defineFont2,
1.7288 + 56: exportAssets,
1.7289 + 57: undefined,
1.7290 + 58: undefined,
1.7291 + 59: doAction,
1.7292 + 60: undefined,
1.7293 + 61: undefined,
1.7294 + 62: undefined,
1.7295 + 64: undefined,
1.7296 + 65: undefined,
1.7297 + 66: undefined,
1.7298 + 69: fileAttributes,
1.7299 + 70: placeObject,
1.7300 + 71: undefined,
1.7301 + 72: doABC,
1.7302 + 73: undefined,
1.7303 + 74: undefined,
1.7304 + 75: defineFont2,
1.7305 + 76: symbolClass,
1.7306 + 77: undefined,
1.7307 + 78: defineScalingGrid,
1.7308 + 82: doABC,
1.7309 + 83: defineShape,
1.7310 + 84: defineShape,
1.7311 + 86: defineScene,
1.7312 + 87: defineBinaryData,
1.7313 + 88: undefined,
1.7314 + 89: startSound,
1.7315 + 90: defineImage,
1.7316 + 91: undefined
1.7317 + };
1.7318 + }(this);
1.7319 +var readHeader = function readHeader($bytes, $stream, $, swfVersion, tagCode) {
1.7320 + $ || ($ = {});
1.7321 + var $0 = $.bbox = {};
1.7322 + align($bytes, $stream);
1.7323 + var bits = readUb($bytes, $stream, 5);
1.7324 + var xMin = readSb($bytes, $stream, bits);
1.7325 + var xMax = readSb($bytes, $stream, bits);
1.7326 + var yMin = readSb($bytes, $stream, bits);
1.7327 + var yMax = readSb($bytes, $stream, bits);
1.7328 + $0.xMin = xMin;
1.7329 + $0.xMax = xMax;
1.7330 + $0.yMin = yMin;
1.7331 + $0.yMax = yMax;
1.7332 + align($bytes, $stream);
1.7333 + var frameRateFraction = readUi8($bytes, $stream);
1.7334 + $.frameRate = readUi8($bytes, $stream) + frameRateFraction / 256;
1.7335 + $.frameCount = readUi16($bytes, $stream);
1.7336 + return $;
1.7337 +};
1.7338 +function readTags(context, stream, swfVersion, final, onprogress, onexception) {
1.7339 + var tags = context.tags;
1.7340 + var bytes = stream.bytes;
1.7341 + var lastSuccessfulPosition;
1.7342 + var tag = null;
1.7343 + if (context._readTag) {
1.7344 + tag = context._readTag;
1.7345 + context._readTag = null;
1.7346 + }
1.7347 + try {
1.7348 + while (stream.pos < stream.end) {
1.7349 + lastSuccessfulPosition = stream.pos;
1.7350 + stream.ensure(2);
1.7351 + var tagCodeAndLength = readUi16(bytes, stream);
1.7352 + if (!tagCodeAndLength) {
1.7353 + final = true;
1.7354 + break;
1.7355 + }
1.7356 + var tagCode = tagCodeAndLength >> 6;
1.7357 + var length = tagCodeAndLength & 63;
1.7358 + if (length === 63) {
1.7359 + stream.ensure(4);
1.7360 + length = readUi32(bytes, stream);
1.7361 + }
1.7362 + if (tag) {
1.7363 + if (tagCode === 1 && tag.code === 1) {
1.7364 + tag.repeat++;
1.7365 + stream.pos += length;
1.7366 + continue;
1.7367 + }
1.7368 + tags.push(tag);
1.7369 + if (onprogress && tag.id !== undefined) {
1.7370 + onprogress(context);
1.7371 + }
1.7372 + tag = null;
1.7373 + }
1.7374 + stream.ensure(length);
1.7375 + var substream = stream.substream(stream.pos, stream.pos += length);
1.7376 + var subbytes = substream.bytes;
1.7377 + var nextTag = {
1.7378 + code: tagCode
1.7379 + };
1.7380 + if (tagCode === 39) {
1.7381 + nextTag.type = 'sprite';
1.7382 + nextTag.id = readUi16(subbytes, substream);
1.7383 + nextTag.frameCount = readUi16(subbytes, substream);
1.7384 + nextTag.tags = [];
1.7385 + readTags(nextTag, substream, swfVersion, true);
1.7386 + } else if (tagCode === 1) {
1.7387 + nextTag.repeat = 1;
1.7388 + } else {
1.7389 + var handler = tagHandler[tagCode];
1.7390 + if (handler) {
1.7391 + handler(subbytes, substream, nextTag, swfVersion, tagCode);
1.7392 + }
1.7393 + }
1.7394 + tag = nextTag;
1.7395 + }
1.7396 + if (tag && final) {
1.7397 + tag.finalTag = true;
1.7398 + tags.push(tag);
1.7399 + if (onprogress) {
1.7400 + onprogress(context);
1.7401 + }
1.7402 + } else {
1.7403 + context._readTag = tag;
1.7404 + }
1.7405 + } catch (e) {
1.7406 + if (e !== StreamNoDataError) {
1.7407 + onexception && onexception(e);
1.7408 + throw e;
1.7409 + }
1.7410 + stream.pos = lastSuccessfulPosition;
1.7411 + context._readTag = tag;
1.7412 + }
1.7413 +}
1.7414 +function HeadTailBuffer(defaultSize) {
1.7415 + this.bufferSize = defaultSize || 16;
1.7416 + this.buffer = new Uint8Array(this.bufferSize);
1.7417 + this.pos = 0;
1.7418 +}
1.7419 +HeadTailBuffer.prototype = {
1.7420 + push: function (data, need) {
1.7421 + var bufferLengthNeed = this.pos + data.length;
1.7422 + if (this.bufferSize < bufferLengthNeed) {
1.7423 + var newBufferSize = this.bufferSize;
1.7424 + while (newBufferSize < bufferLengthNeed) {
1.7425 + newBufferSize <<= 1;
1.7426 + }
1.7427 + var newBuffer = new Uint8Array(newBufferSize);
1.7428 + if (this.bufferSize > 0) {
1.7429 + newBuffer.set(this.buffer);
1.7430 + }
1.7431 + this.buffer = newBuffer;
1.7432 + this.bufferSize = newBufferSize;
1.7433 + }
1.7434 + this.buffer.set(data, this.pos);
1.7435 + this.pos += data.length;
1.7436 + if (need)
1.7437 + return this.pos >= need;
1.7438 + },
1.7439 + getHead: function (size) {
1.7440 + return this.buffer.subarray(0, size);
1.7441 + },
1.7442 + getTail: function (offset) {
1.7443 + return this.buffer.subarray(offset, this.pos);
1.7444 + },
1.7445 + removeHead: function (size) {
1.7446 + var tail = this.getTail(size);
1.7447 + this.buffer = new Uint8Array(this.bufferSize);
1.7448 + this.buffer.set(tail);
1.7449 + this.pos = tail.length;
1.7450 + },
1.7451 + get arrayBuffer() {
1.7452 + return this.buffer.buffer;
1.7453 + },
1.7454 + get length() {
1.7455 + return this.pos;
1.7456 + },
1.7457 + createStream: function () {
1.7458 + return new Stream(this.arrayBuffer, 0, this.length);
1.7459 + }
1.7460 +};
1.7461 +function CompressedPipe(target, length) {
1.7462 + this.target = target;
1.7463 + this.length = length;
1.7464 + this.initialize = true;
1.7465 + this.buffer = new HeadTailBuffer(8096);
1.7466 + this.state = {
1.7467 + bitBuffer: 0,
1.7468 + bitLength: 0,
1.7469 + compression: {
1.7470 + header: null,
1.7471 + distanceTable: null,
1.7472 + literalTable: null,
1.7473 + sym: null,
1.7474 + len: null,
1.7475 + sym2: null
1.7476 + }
1.7477 + };
1.7478 + this.output = {
1.7479 + data: new Uint8Array(length),
1.7480 + available: 0,
1.7481 + completed: false
1.7482 + };
1.7483 +}
1.7484 +CompressedPipe.prototype = {
1.7485 + push: function (data, progressInfo) {
1.7486 + var buffer = this.buffer;
1.7487 + if (this.initialize) {
1.7488 + if (!buffer.push(data, 2))
1.7489 + return;
1.7490 + var headerBytes = buffer.getHead(2);
1.7491 + verifyDeflateHeader(headerBytes);
1.7492 + buffer.removeHead(2);
1.7493 + this.initialize = false;
1.7494 + } else {
1.7495 + buffer.push(data);
1.7496 + }
1.7497 + var stream = buffer.createStream();
1.7498 + stream.bitBuffer = this.state.bitBuffer;
1.7499 + stream.bitLength = this.state.bitLength;
1.7500 + var output = this.output;
1.7501 + var lastAvailable = output.available;
1.7502 + try {
1.7503 + do {
1.7504 + inflateBlock(stream, output, this.state.compression);
1.7505 + } while (stream.pos < buffer.length && !output.completed);
1.7506 + } catch (e) {
1.7507 + if (e !== InflateNoDataError)
1.7508 + throw e;
1.7509 + } finally {
1.7510 + this.state.bitBuffer = stream.bitBuffer;
1.7511 + this.state.bitLength = stream.bitLength;
1.7512 + }
1.7513 + buffer.removeHead(stream.pos);
1.7514 + this.target.push(output.data.subarray(lastAvailable, output.available), progressInfo);
1.7515 + }
1.7516 +};
1.7517 +function BodyParser(swfVersion, length, options) {
1.7518 + this.swf = {
1.7519 + swfVersion: swfVersion,
1.7520 + parseTime: 0
1.7521 + };
1.7522 + this.buffer = new HeadTailBuffer(32768);
1.7523 + this.initialize = true;
1.7524 + this.totalRead = 0;
1.7525 + this.length = length;
1.7526 + this.options = options;
1.7527 +}
1.7528 +BodyParser.prototype = {
1.7529 + push: function (data, progressInfo) {
1.7530 + if (data.length === 0)
1.7531 + return;
1.7532 + var swf = this.swf;
1.7533 + var swfVersion = swf.swfVersion;
1.7534 + var buffer = this.buffer;
1.7535 + var options = this.options;
1.7536 + var stream;
1.7537 + if (this.initialize) {
1.7538 + var PREFETCH_SIZE = 27;
1.7539 + if (!buffer.push(data, PREFETCH_SIZE))
1.7540 + return;
1.7541 + stream = buffer.createStream();
1.7542 + var bytes = stream.bytes;
1.7543 + readHeader(bytes, stream, swf);
1.7544 + var nextTagHeader = readUi16(bytes, stream);
1.7545 + var FILE_ATTRIBUTES_LENGTH = 4;
1.7546 + if (nextTagHeader == (SWF_TAG_CODE_FILE_ATTRIBUTES << 6 | FILE_ATTRIBUTES_LENGTH)) {
1.7547 + stream.ensure(FILE_ATTRIBUTES_LENGTH);
1.7548 + var substream = stream.substream(stream.pos, stream.pos += FILE_ATTRIBUTES_LENGTH);
1.7549 + var handler = tagHandler[SWF_TAG_CODE_FILE_ATTRIBUTES];
1.7550 + var fileAttributesTag = {
1.7551 + code: SWF_TAG_CODE_FILE_ATTRIBUTES
1.7552 + };
1.7553 + handler(substream.bytes, substream, fileAttributesTag, swfVersion, SWF_TAG_CODE_FILE_ATTRIBUTES);
1.7554 + swf.fileAttributes = fileAttributesTag;
1.7555 + } else {
1.7556 + stream.pos -= 2;
1.7557 + swf.fileAttributes = {};
1.7558 + }
1.7559 + if (options.onstart)
1.7560 + options.onstart(swf);
1.7561 + swf.tags = [];
1.7562 + this.initialize = false;
1.7563 + } else {
1.7564 + buffer.push(data);
1.7565 + stream = buffer.createStream();
1.7566 + }
1.7567 + var finalBlock = false;
1.7568 + if (progressInfo) {
1.7569 + swf.bytesLoaded = progressInfo.bytesLoaded;
1.7570 + swf.bytesTotal = progressInfo.bytesTotal;
1.7571 + finalBlock = progressInfo.bytesLoaded >= progressInfo.bytesTotal;
1.7572 + }
1.7573 + var readStartTime = performance.now();
1.7574 + readTags(swf, stream, swfVersion, finalBlock, options.onprogress, options.onexception);
1.7575 + swf.parseTime += performance.now() - readStartTime;
1.7576 + var read = stream.pos;
1.7577 + buffer.removeHead(read);
1.7578 + this.totalRead += read;
1.7579 + if (options.oncomplete && swf.tags[swf.tags.length - 1].finalTag) {
1.7580 + options.oncomplete(swf);
1.7581 + }
1.7582 + }
1.7583 +};
1.7584 +SWF.parseAsync = function swf_parseAsync(options) {
1.7585 + var buffer = new HeadTailBuffer();
1.7586 + var pipe = {
1.7587 + push: function (data, progressInfo) {
1.7588 + if (this.target !== undefined) {
1.7589 + return this.target.push(data, progressInfo);
1.7590 + }
1.7591 + if (!buffer.push(data, 8)) {
1.7592 + return null;
1.7593 + }
1.7594 + var bytes = buffer.getHead(8);
1.7595 + var magic1 = bytes[0];
1.7596 + var magic2 = bytes[1];
1.7597 + var magic3 = bytes[2];
1.7598 + if ((magic1 === 70 || magic1 === 67) && magic2 === 87 && magic3 === 83) {
1.7599 + var swfVersion = bytes[3];
1.7600 + var compressed = magic1 === 67;
1.7601 + parseSWF(compressed, swfVersion, progressInfo);
1.7602 + buffer = null;
1.7603 + return;
1.7604 + }
1.7605 + var isImage = false;
1.7606 + var imageType;
1.7607 + if (magic1 === 255 && magic2 === 216 && magic3 === 255) {
1.7608 + isImage = true;
1.7609 + imageType = 'image/jpeg';
1.7610 + } else if (magic1 === 137 && magic2 === 80 && magic3 === 78) {
1.7611 + isImage = true;
1.7612 + imageType = 'image/png';
1.7613 + }
1.7614 + if (isImage) {
1.7615 + parseImage(data, progressInfo.bytesTotal, imageType);
1.7616 + }
1.7617 + buffer = null;
1.7618 + },
1.7619 + close: function () {
1.7620 + if (buffer) {
1.7621 + var symbol = {
1.7622 + command: 'empty',
1.7623 + data: buffer.buffer.subarray(0, buffer.pos)
1.7624 + };
1.7625 + options.oncomplete && options.oncomplete(symbol);
1.7626 + }
1.7627 + if (this.target !== undefined && this.target.close) {
1.7628 + this.target.close();
1.7629 + }
1.7630 + }
1.7631 + };
1.7632 + function parseSWF(compressed, swfVersion, progressInfo) {
1.7633 + var stream = buffer.createStream();
1.7634 + stream.pos += 4;
1.7635 + var fileLength = readUi32(null, stream);
1.7636 + var bodyLength = fileLength - 8;
1.7637 + var target = new BodyParser(swfVersion, bodyLength, options);
1.7638 + if (compressed) {
1.7639 + target = new CompressedPipe(target, bodyLength);
1.7640 + }
1.7641 + target.push(buffer.getTail(8), progressInfo);
1.7642 + pipe['target'] = target;
1.7643 + }
1.7644 + function parseImage(data, bytesTotal, type) {
1.7645 + var buffer = new Uint8Array(bytesTotal);
1.7646 + buffer.set(data);
1.7647 + var bufferPos = data.length;
1.7648 + pipe['target'] = {
1.7649 + push: function (data) {
1.7650 + buffer.set(data, bufferPos);
1.7651 + bufferPos += data.length;
1.7652 + },
1.7653 + close: function () {
1.7654 + var props = {};
1.7655 + var chunks;
1.7656 + if (type == 'image/jpeg') {
1.7657 + chunks = parseJpegChunks(props, buffer);
1.7658 + } else {
1.7659 + chunks = [
1.7660 + buffer
1.7661 + ];
1.7662 + }
1.7663 + var symbol = {
1.7664 + type: 'image',
1.7665 + props: props,
1.7666 + data: new Blob(chunks, {
1.7667 + type: type
1.7668 + })
1.7669 + };
1.7670 + options.oncomplete && options.oncomplete(symbol);
1.7671 + }
1.7672 + };
1.7673 + }
1.7674 + return pipe;
1.7675 +};
1.7676 +SWF.parse = function (buffer, options) {
1.7677 + if (!options)
1.7678 + options = {};
1.7679 + var pipe = SWF.parseAsync(options);
1.7680 + var bytes = new Uint8Array(buffer);
1.7681 + var progressInfo = {
1.7682 + bytesLoaded: bytes.length,
1.7683 + bytesTotal: bytes.length
1.7684 + };
1.7685 + pipe.push(bytes, progressInfo);
1.7686 + pipe.close();
1.7687 +};
1.7688 +var $RELEASE = false;
1.7689 +var isWorker = typeof window === 'undefined';
1.7690 +if (isWorker && !true) {
1.7691 + importScripts.apply(null, [
1.7692 + '../../lib/DataView.js/DataView.js',
1.7693 + '../flash/util.js',
1.7694 + 'config.js',
1.7695 + 'swf.js',
1.7696 + 'types.js',
1.7697 + 'structs.js',
1.7698 + 'tags.js',
1.7699 + 'inflate.js',
1.7700 + 'stream.js',
1.7701 + 'templates.js',
1.7702 + 'generator.js',
1.7703 + 'handlers.js',
1.7704 + 'parser.js',
1.7705 + 'bitmap.js',
1.7706 + 'button.js',
1.7707 + 'font.js',
1.7708 + 'image.js',
1.7709 + 'label.js',
1.7710 + 'shape.js',
1.7711 + 'sound.js',
1.7712 + 'text.js'
1.7713 + ]);
1.7714 +}
1.7715 +function defineSymbol(swfTag, symbols) {
1.7716 + var symbol;
1.7717 + switch (swfTag.code) {
1.7718 + case SWF_TAG_CODE_DEFINE_BITS:
1.7719 + case SWF_TAG_CODE_DEFINE_BITS_JPEG2:
1.7720 + case SWF_TAG_CODE_DEFINE_BITS_JPEG3:
1.7721 + case SWF_TAG_CODE_DEFINE_BITS_JPEG4:
1.7722 + case SWF_TAG_CODE_JPEG_TABLES:
1.7723 + symbol = defineImage(swfTag, symbols);
1.7724 + break;
1.7725 + case SWF_TAG_CODE_DEFINE_BITS_LOSSLESS:
1.7726 + case SWF_TAG_CODE_DEFINE_BITS_LOSSLESS2:
1.7727 + symbol = defineBitmap(swfTag);
1.7728 + break;
1.7729 + case SWF_TAG_CODE_DEFINE_BUTTON:
1.7730 + case SWF_TAG_CODE_DEFINE_BUTTON2:
1.7731 + symbol = defineButton(swfTag, symbols);
1.7732 + break;
1.7733 + case SWF_TAG_CODE_DEFINE_EDIT_TEXT:
1.7734 + symbol = defineText(swfTag, symbols);
1.7735 + break;
1.7736 + case SWF_TAG_CODE_DEFINE_FONT:
1.7737 + case SWF_TAG_CODE_DEFINE_FONT2:
1.7738 + case SWF_TAG_CODE_DEFINE_FONT3:
1.7739 + case SWF_TAG_CODE_DEFINE_FONT4:
1.7740 + symbol = defineFont(swfTag, symbols);
1.7741 + break;
1.7742 + case SWF_TAG_CODE_DEFINE_MORPH_SHAPE:
1.7743 + case SWF_TAG_CODE_DEFINE_MORPH_SHAPE2:
1.7744 + case SWF_TAG_CODE_DEFINE_SHAPE:
1.7745 + case SWF_TAG_CODE_DEFINE_SHAPE2:
1.7746 + case SWF_TAG_CODE_DEFINE_SHAPE3:
1.7747 + case SWF_TAG_CODE_DEFINE_SHAPE4:
1.7748 + symbol = defineShape(swfTag, symbols);
1.7749 + break;
1.7750 + case SWF_TAG_CODE_DEFINE_SOUND:
1.7751 + symbol = defineSound(swfTag, symbols);
1.7752 + break;
1.7753 + case SWF_TAG_CODE_DEFINE_BINARY_DATA:
1.7754 + symbol = {
1.7755 + type: 'binary',
1.7756 + id: swfTag.id,
1.7757 + data: swfTag.data
1.7758 + };
1.7759 + break;
1.7760 + case SWF_TAG_CODE_DEFINE_SPRITE:
1.7761 + var depths = {};
1.7762 + var frame = {
1.7763 + type: 'frame'
1.7764 + };
1.7765 + var frames = [];
1.7766 + var tags = swfTag.tags;
1.7767 + var frameScripts = null;
1.7768 + var frameIndex = 0;
1.7769 + var soundStream = null;
1.7770 + for (var i = 0, n = tags.length; i < n; i++) {
1.7771 + var tag = tags[i];
1.7772 + switch (tag.code) {
1.7773 + case SWF_TAG_CODE_DO_ACTION:
1.7774 + if (!frameScripts)
1.7775 + frameScripts = [];
1.7776 + frameScripts.push(frameIndex);
1.7777 + frameScripts.push(tag.actionsData);
1.7778 + break;
1.7779 + case SWF_TAG_CODE_START_SOUND:
1.7780 + var startSounds = frame.startSounds || (frame.startSounds = []);
1.7781 + startSounds.push(tag);
1.7782 + break;
1.7783 + case SWF_TAG_CODE_SOUND_STREAM_HEAD:
1.7784 + try {
1.7785 + soundStream = createSoundStream(tag);
1.7786 + frame.soundStream = soundStream.info;
1.7787 + } catch (e) {
1.7788 + }
1.7789 + break;
1.7790 + case SWF_TAG_CODE_SOUND_STREAM_BLOCK:
1.7791 + if (soundStream) {
1.7792 + frame.soundStreamBlock = soundStream.decode(tag.data);
1.7793 + }
1.7794 + break;
1.7795 + case SWF_TAG_CODE_FRAME_LABEL:
1.7796 + frame.labelName = tag.name;
1.7797 + break;
1.7798 + case SWF_TAG_CODE_PLACE_OBJECT:
1.7799 + case SWF_TAG_CODE_PLACE_OBJECT2:
1.7800 + case SWF_TAG_CODE_PLACE_OBJECT3:
1.7801 + depths[tag.depth] = tag;
1.7802 + break;
1.7803 + case SWF_TAG_CODE_REMOVE_OBJECT:
1.7804 + case SWF_TAG_CODE_REMOVE_OBJECT2:
1.7805 + depths[tag.depth] = null;
1.7806 + break;
1.7807 + case SWF_TAG_CODE_SHOW_FRAME:
1.7808 + frameIndex += tag.repeat;
1.7809 + frame.repeat = tag.repeat;
1.7810 + frame.depths = depths;
1.7811 + frames.push(frame);
1.7812 + depths = {};
1.7813 + frame = {
1.7814 + type: 'frame'
1.7815 + };
1.7816 + break;
1.7817 + }
1.7818 + }
1.7819 + symbol = {
1.7820 + type: 'sprite',
1.7821 + id: swfTag.id,
1.7822 + frameCount: swfTag.frameCount,
1.7823 + frames: frames,
1.7824 + frameScripts: frameScripts
1.7825 + };
1.7826 + break;
1.7827 + case SWF_TAG_CODE_DEFINE_TEXT:
1.7828 + case SWF_TAG_CODE_DEFINE_TEXT2:
1.7829 + symbol = defineLabel(swfTag, symbols);
1.7830 + break;
1.7831 + }
1.7832 + if (!symbol) {
1.7833 + return {
1.7834 + command: 'error',
1.7835 + message: 'unknown symbol type: ' + swfTag.code
1.7836 + };
1.7837 + }
1.7838 + symbol.isSymbol = true;
1.7839 + symbols[swfTag.id] = symbol;
1.7840 + return symbol;
1.7841 +}
1.7842 +function createParsingContext(commitData) {
1.7843 + var depths = {};
1.7844 + var symbols = {};
1.7845 + var frame = {
1.7846 + type: 'frame'
1.7847 + };
1.7848 + var tagsProcessed = 0;
1.7849 + var soundStream = null;
1.7850 + var lastProgressSent = 0;
1.7851 + return {
1.7852 + onstart: function (result) {
1.7853 + commitData({
1.7854 + command: 'init',
1.7855 + result: result
1.7856 + });
1.7857 + },
1.7858 + onprogress: function (result) {
1.7859 + if (Date.now() - lastProgressSent > 1000 / 24 || result.bytesLoaded === result.bytesTotal) {
1.7860 + commitData({
1.7861 + command: 'progress',
1.7862 + result: {
1.7863 + bytesLoaded: result.bytesLoaded,
1.7864 + bytesTotal: result.bytesTotal
1.7865 + }
1.7866 + });
1.7867 + lastProgressSent = Date.now();
1.7868 + }
1.7869 + var tags = result.tags;
1.7870 + for (var n = tags.length; tagsProcessed < n; tagsProcessed++) {
1.7871 + var tag = tags[tagsProcessed];
1.7872 + if ('id' in tag) {
1.7873 + var symbol = defineSymbol(tag, symbols);
1.7874 + commitData(symbol, symbol.transferables);
1.7875 + continue;
1.7876 + }
1.7877 + switch (tag.code) {
1.7878 + case SWF_TAG_CODE_DEFINE_SCENE_AND_FRAME_LABEL_DATA:
1.7879 + frame.sceneData = tag;
1.7880 + break;
1.7881 + case SWF_TAG_CODE_DEFINE_SCALING_GRID:
1.7882 + var symbolUpdate = {
1.7883 + isSymbol: true,
1.7884 + id: tag.symbolId,
1.7885 + updates: {
1.7886 + scale9Grid: tag.splitter
1.7887 + }
1.7888 + };
1.7889 + commitData(symbolUpdate);
1.7890 + break;
1.7891 + case SWF_TAG_CODE_DO_ABC:
1.7892 + case SWF_TAG_CODE_DO_ABC_:
1.7893 + var abcBlocks = frame.abcBlocks;
1.7894 + if (abcBlocks)
1.7895 + abcBlocks.push({
1.7896 + data: tag.data,
1.7897 + flags: tag.flags
1.7898 + });
1.7899 + else
1.7900 + frame.abcBlocks = [
1.7901 + {
1.7902 + data: tag.data,
1.7903 + flags: tag.flags
1.7904 + }
1.7905 + ];
1.7906 + break;
1.7907 + case SWF_TAG_CODE_DO_ACTION:
1.7908 + var actionBlocks = frame.actionBlocks;
1.7909 + if (actionBlocks)
1.7910 + actionBlocks.push(tag.actionsData);
1.7911 + else
1.7912 + frame.actionBlocks = [
1.7913 + tag.actionsData
1.7914 + ];
1.7915 + break;
1.7916 + case SWF_TAG_CODE_DO_INIT_ACTION:
1.7917 + var initActionBlocks = frame.initActionBlocks || (frame.initActionBlocks = []);
1.7918 + initActionBlocks.push({
1.7919 + spriteId: tag.spriteId,
1.7920 + actionsData: tag.actionsData
1.7921 + });
1.7922 + break;
1.7923 + case SWF_TAG_CODE_START_SOUND:
1.7924 + var startSounds = frame.startSounds;
1.7925 + if (!startSounds)
1.7926 + frame.startSounds = startSounds = [];
1.7927 + startSounds.push(tag);
1.7928 + break;
1.7929 + case SWF_TAG_CODE_SOUND_STREAM_HEAD:
1.7930 + try {
1.7931 + soundStream = createSoundStream(tag);
1.7932 + frame.soundStream = soundStream.info;
1.7933 + } catch (e) {
1.7934 + }
1.7935 + break;
1.7936 + case SWF_TAG_CODE_SOUND_STREAM_BLOCK:
1.7937 + if (soundStream) {
1.7938 + frame.soundStreamBlock = soundStream.decode(tag.data);
1.7939 + }
1.7940 + break;
1.7941 + case SWF_TAG_CODE_EXPORT_ASSETS:
1.7942 + var exports = frame.exports;
1.7943 + if (exports)
1.7944 + frame.exports = exports.concat(tag.exports);
1.7945 + else
1.7946 + frame.exports = tag.exports.slice(0);
1.7947 + break;
1.7948 + case SWF_TAG_CODE_SYMBOL_CLASS:
1.7949 + var symbolClasses = frame.symbolClasses;
1.7950 + if (symbolClasses)
1.7951 + frame.symbolClasses = symbolClasses.concat(tag.exports);
1.7952 + else
1.7953 + frame.symbolClasses = tag.exports.slice(0);
1.7954 + break;
1.7955 + case SWF_TAG_CODE_FRAME_LABEL:
1.7956 + frame.labelName = tag.name;
1.7957 + break;
1.7958 + case SWF_TAG_CODE_PLACE_OBJECT:
1.7959 + case SWF_TAG_CODE_PLACE_OBJECT2:
1.7960 + case SWF_TAG_CODE_PLACE_OBJECT3:
1.7961 + depths[tag.depth] = tag;
1.7962 + break;
1.7963 + case SWF_TAG_CODE_REMOVE_OBJECT:
1.7964 + case SWF_TAG_CODE_REMOVE_OBJECT2:
1.7965 + depths[tag.depth] = null;
1.7966 + break;
1.7967 + case SWF_TAG_CODE_SET_BACKGROUND_COLOR:
1.7968 + frame.bgcolor = tag.color;
1.7969 + break;
1.7970 + case SWF_TAG_CODE_SHOW_FRAME:
1.7971 + frame.repeat = tag.repeat;
1.7972 + frame.depths = depths;
1.7973 + frame.complete = !(!tag.finalTag);
1.7974 + commitData(frame);
1.7975 + depths = {};
1.7976 + frame = {
1.7977 + type: 'frame'
1.7978 + };
1.7979 + break;
1.7980 + }
1.7981 + }
1.7982 + },
1.7983 + oncomplete: function (result) {
1.7984 + commitData(result);
1.7985 + var stats;
1.7986 + if (typeof result.swfVersion === 'number') {
1.7987 + var bbox = result.bbox;
1.7988 + stats = {
1.7989 + topic: 'parseInfo',
1.7990 + parseTime: result.parseTime,
1.7991 + bytesTotal: result.bytesTotal,
1.7992 + swfVersion: result.swfVersion,
1.7993 + frameRate: result.frameRate,
1.7994 + width: (bbox.xMax - bbox.xMin) / 20,
1.7995 + height: (bbox.yMax - bbox.yMin) / 20,
1.7996 + isAvm2: !(!result.fileAttributes.doAbc)
1.7997 + };
1.7998 + }
1.7999 + commitData({
1.8000 + command: 'complete',
1.8001 + stats: stats
1.8002 + });
1.8003 + },
1.8004 + onexception: function (e) {
1.8005 + commitData({
1.8006 + type: 'exception',
1.8007 + message: e.message,
1.8008 + stack: e.stack
1.8009 + });
1.8010 + }
1.8011 + };
1.8012 +}
1.8013 +function parseBytes(bytes, commitData) {
1.8014 + SWF.parse(bytes, createParsingContext(commitData));
1.8015 +}
1.8016 +function ResourceLoader(scope) {
1.8017 + this.subscription = null;
1.8018 + var self = this;
1.8019 + if (!isWorker) {
1.8020 + this.messenger = {
1.8021 + postMessage: function (data) {
1.8022 + self.onmessage({
1.8023 + data: data
1.8024 + });
1.8025 + }
1.8026 + };
1.8027 + } else {
1.8028 + this.messenger = scope;
1.8029 + scope.onmessage = function (event) {
1.8030 + self.listener(event.data);
1.8031 + };
1.8032 + }
1.8033 +}
1.8034 +ResourceLoader.prototype = {
1.8035 + terminate: function () {
1.8036 + this.messenger = null;
1.8037 + this.listener = null;
1.8038 + },
1.8039 + onmessage: function (event) {
1.8040 + this.listener(event.data);
1.8041 + },
1.8042 + postMessage: function (data) {
1.8043 + this.listener && this.listener(data);
1.8044 + },
1.8045 + listener: function (data) {
1.8046 + if (this.subscription) {
1.8047 + this.subscription.callback(data.data, data.progress);
1.8048 + } else if (data === 'pipe:') {
1.8049 + this.subscription = {
1.8050 + subscribe: function (callback) {
1.8051 + this.callback = callback;
1.8052 + }
1.8053 + };
1.8054 + this.parseLoadedData(this.messenger, this.subscription);
1.8055 + } else {
1.8056 + this.parseLoadedData(this.messenger, data);
1.8057 + }
1.8058 + },
1.8059 + parseLoadedData: function (loader, request, context) {
1.8060 + function commitData(data, transferables) {
1.8061 + try {
1.8062 + loader.postMessage(data, transferables);
1.8063 + } catch (ex) {
1.8064 + if (ex != 'DataCloneError') {
1.8065 + throw ex;
1.8066 + }
1.8067 + loader.postMessage(data);
1.8068 + }
1.8069 + }
1.8070 + if (request instanceof ArrayBuffer) {
1.8071 + parseBytes(request, commitData);
1.8072 + } else if ('subscribe' in request) {
1.8073 + var pipe = SWF.parseAsync(createParsingContext(commitData));
1.8074 + request.subscribe(function (data, progress) {
1.8075 + if (data) {
1.8076 + pipe.push(data, progress);
1.8077 + } else {
1.8078 + pipe.close();
1.8079 + }
1.8080 + });
1.8081 + } else if (typeof FileReaderSync !== 'undefined') {
1.8082 + var reader = new FileReaderSync();
1.8083 + var buffer = reader.readAsArrayBuffer(request);
1.8084 + parseBytes(buffer, commitData);
1.8085 + } else {
1.8086 + var reader = new FileReader();
1.8087 + reader.onload = function () {
1.8088 + parseBytes(this.result, commitData);
1.8089 + };
1.8090 + reader.readAsArrayBuffer(request);
1.8091 + }
1.8092 + }
1.8093 +};
1.8094 +if (isWorker) {
1.8095 + var loader = new ResourceLoader(this);
1.8096 +}
1.8097 +function ActionsDataStream(array, swfVersion) {
1.8098 + this.array = array;
1.8099 + this.position = 0;
1.8100 + this.end = array.length;
1.8101 + if (swfVersion >= 6) {
1.8102 + this.readString = this.readUTF8String;
1.8103 + } else {
1.8104 + this.readString = this.readANSIString;
1.8105 + }
1.8106 + var buffer = new ArrayBuffer(4);
1.8107 + new Int32Array(buffer)[0] = 1;
1.8108 + if (!new Uint8Array(buffer)[0]) {
1.8109 + throw new Error('big-endian platform');
1.8110 + }
1.8111 +}
1.8112 +ActionsDataStream.prototype = {
1.8113 + readUI8: function ActionsDataStream_readUI8() {
1.8114 + return this.array[this.position++];
1.8115 + },
1.8116 + readUI16: function ActionsDataStream_readUI16() {
1.8117 + var position = this.position, array = this.array;
1.8118 + var value = array[position + 1] << 8 | array[position];
1.8119 + this.position = position + 2;
1.8120 + return value;
1.8121 + },
1.8122 + readSI16: function ActionsDataStream_readSI16() {
1.8123 + var position = this.position, array = this.array;
1.8124 + var value = array[position + 1] << 8 | array[position];
1.8125 + this.position = position + 2;
1.8126 + return value < 32768 ? value : value - 65536;
1.8127 + },
1.8128 + readInteger: function ActionsDataStream_readInteger() {
1.8129 + var position = this.position, array = this.array;
1.8130 + var value = array[position] | array[position + 1] << 8 | array[position + 2] << 16 | array[position + 3] << 24;
1.8131 + this.position = position + 4;
1.8132 + return value;
1.8133 + },
1.8134 + readFloat: function ActionsDataStream_readFloat() {
1.8135 + var position = this.position;
1.8136 + var array = this.array;
1.8137 + var buffer = new ArrayBuffer(4);
1.8138 + var bytes = new Uint8Array(buffer);
1.8139 + bytes[0] = array[position];
1.8140 + bytes[1] = array[position + 1];
1.8141 + bytes[2] = array[position + 2];
1.8142 + bytes[3] = array[position + 3];
1.8143 + this.position = position + 4;
1.8144 + return new Float32Array(buffer)[0];
1.8145 + },
1.8146 + readDouble: function ActionsDataStream_readDouble() {
1.8147 + var position = this.position;
1.8148 + var array = this.array;
1.8149 + var buffer = new ArrayBuffer(8);
1.8150 + var bytes = new Uint8Array(buffer);
1.8151 + bytes[4] = array[position];
1.8152 + bytes[5] = array[position + 1];
1.8153 + bytes[6] = array[position + 2];
1.8154 + bytes[7] = array[position + 3];
1.8155 + bytes[0] = array[position + 4];
1.8156 + bytes[1] = array[position + 5];
1.8157 + bytes[2] = array[position + 6];
1.8158 + bytes[3] = array[position + 7];
1.8159 + this.position = position + 8;
1.8160 + return new Float64Array(buffer)[0];
1.8161 + },
1.8162 + readBoolean: function ActionsDataStream_readBoolean() {
1.8163 + return !(!this.readUI8());
1.8164 + },
1.8165 + readANSIString: function ActionsDataStream_readANSIString() {
1.8166 + var value = '';
1.8167 + var ch;
1.8168 + while (ch = this.readUI8()) {
1.8169 + value += String.fromCharCode(ch);
1.8170 + }
1.8171 + return value;
1.8172 + },
1.8173 + readUTF8String: function ActionsDataStream_readUTF8String() {
1.8174 + var value = '';
1.8175 + var ch;
1.8176 + while (ch = this.readUI8()) {
1.8177 + if (ch < 128) {
1.8178 + value += String.fromCharCode(ch);
1.8179 + continue;
1.8180 + }
1.8181 + if ((ch & 192) === 128) {
1.8182 + throw new Error('Invalid UTF8 encoding');
1.8183 + }
1.8184 + var currentPrefix = 192;
1.8185 + var validBits = 5;
1.8186 + do {
1.8187 + var mask = currentPrefix >> 1 | 128;
1.8188 + if ((ch & mask) === currentPrefix) {
1.8189 + break;
1.8190 + }
1.8191 + currentPrefix = mask;
1.8192 + --validBits;
1.8193 + } while (validBits >= 0);
1.8194 + var code = ch & (1 << validBits) - 1;
1.8195 + for (var i = 5; i >= validBits; --i) {
1.8196 + ch = this.readUI8();
1.8197 + if ((ch & 192) !== 128) {
1.8198 + throw new Error('Invalid UTF8 encoding');
1.8199 + }
1.8200 + code = code << 6 | ch & 63;
1.8201 + }
1.8202 + if (code >= 65536) {
1.8203 + value += String.fromCharCode(code - 65536 >> 10 & 1023 | 55296, code & 1023 | 56320);
1.8204 + } else {
1.8205 + value += String.fromCharCode(code);
1.8206 + }
1.8207 + }
1.8208 + return value;
1.8209 + },
1.8210 + readBytes: function ActionsDataStream_readBytes(length) {
1.8211 + var position = this.position;
1.8212 + var remaining = Math.max(this.end - position, 0);
1.8213 + if (remaining < length) {
1.8214 + length = remaining;
1.8215 + }
1.8216 + var subarray = this.array.subarray(position, position + length);
1.8217 + this.position = position + length;
1.8218 + return subarray;
1.8219 + }
1.8220 +};
1.8221 +if (typeof GLOBAL !== 'undefined') {
1.8222 + GLOBAL.ActionsDataStream = ActionsDataStream;
1.8223 +}
1.8224 +var AVM1_TRACE_ENABLED = false;
1.8225 +var AVM1_ERRORS_IGNORED = true;
1.8226 +var MAX_AVM1_HANG_TIMEOUT = 1000;
1.8227 +var MAX_AVM1_ERRORS_LIMIT = 1000;
1.8228 +var MAX_AVM1_STACK_LIMIT = 256;
1.8229 +function AS2ScopeListItem(scope, next) {
1.8230 + this.scope = scope;
1.8231 + this.next = next;
1.8232 +}
1.8233 +AS2ScopeListItem.prototype = {
1.8234 + create: function (scope) {
1.8235 + return new AS2ScopeListItem(scope, this);
1.8236 + }
1.8237 +};
1.8238 +function AS2Context(swfVersion) {
1.8239 + this.swfVersion = swfVersion;
1.8240 + this.globals = new avm1lib.AS2Globals(this);
1.8241 + this.initialScope = new AS2ScopeListItem(this.globals, null);
1.8242 + this.assets = {};
1.8243 + this.isActive = false;
1.8244 + this.executionProhibited = false;
1.8245 + this.abortExecutionAt = 0;
1.8246 + this.stackDepth = 0;
1.8247 + this.isTryCatchListening = false;
1.8248 + this.errorsIgnored = 0;
1.8249 + this.deferScriptExecution = true;
1.8250 + this.pendingScripts = [];
1.8251 +}
1.8252 +AS2Context.instance = null;
1.8253 +AS2Context.prototype = {
1.8254 + addAsset: function (className, symbolProps) {
1.8255 + this.assets[className] = symbolProps;
1.8256 + },
1.8257 + resolveTarget: function (target) {
1.8258 + if (!target) {
1.8259 + target = this.defaultTarget;
1.8260 + } else if (typeof target === 'string') {
1.8261 + target = lookupAS2Children(target, this.defaultTarget, this.globals.asGetPublicProperty('_root'));
1.8262 + }
1.8263 + if (typeof target !== 'object' || target === null || !('$nativeObject' in target)) {
1.8264 + throw new Error('Invalid AS2 target object: ' + Object.prototype.toString.call(target));
1.8265 + }
1.8266 + return target;
1.8267 + },
1.8268 + resolveLevel: function (level) {
1.8269 + return this.resolveTarget(this.globals['_level' + level]);
1.8270 + },
1.8271 + addToPendingScripts: function (fn) {
1.8272 + if (!this.deferScriptExecution) {
1.8273 + return fn();
1.8274 + }
1.8275 + this.pendingScripts.push(fn);
1.8276 + },
1.8277 + flushPendingScripts: function () {
1.8278 + var scripts = this.pendingScripts;
1.8279 + while (scripts.length) {
1.8280 + scripts.shift()();
1.8281 + }
1.8282 + this.deferScriptExecution = false;
1.8283 + }
1.8284 +};
1.8285 +function AS2Error(error) {
1.8286 + this.error = error;
1.8287 +}
1.8288 +function AS2CriticalError(message, error) {
1.8289 + this.message = message;
1.8290 + this.error = error;
1.8291 +}
1.8292 +AS2CriticalError.prototype = Object.create(Error.prototype);
1.8293 +function isAS2MovieClip(obj) {
1.8294 + return typeof obj === 'object' && obj && obj instanceof avm1lib.AS2MovieClip;
1.8295 +}
1.8296 +function as2GetType(v) {
1.8297 + if (v === null) {
1.8298 + return 'null';
1.8299 + }
1.8300 + var type = typeof v;
1.8301 + if (type === 'function') {
1.8302 + return 'object';
1.8303 + }
1.8304 + if (type === 'object' && isAS2MovieClip(v)) {
1.8305 + return 'movieclip';
1.8306 + }
1.8307 + return type;
1.8308 +}
1.8309 +function as2ToPrimitive(value) {
1.8310 + return as2GetType(value) !== 'object' ? value : value.valueOf();
1.8311 +}
1.8312 +function as2ToAddPrimitive(value) {
1.8313 + if (as2GetType(value) !== 'object') {
1.8314 + return value;
1.8315 + }
1.8316 + if (value instanceof Date && AS2Context.instance.swfVersion >= 6) {
1.8317 + return value.toString();
1.8318 + } else {
1.8319 + return value.valueOf();
1.8320 + }
1.8321 +}
1.8322 +function as2ToBoolean(value) {
1.8323 + switch (as2GetType(value)) {
1.8324 + default:
1.8325 + case 'undefined':
1.8326 + case 'null':
1.8327 + return false;
1.8328 + case 'boolean':
1.8329 + return value;
1.8330 + case 'number':
1.8331 + return value !== 0 && !isNaN(value);
1.8332 + case 'string':
1.8333 + return value.length !== 0;
1.8334 + case 'movieclip':
1.8335 + case 'object':
1.8336 + return true;
1.8337 + }
1.8338 +}
1.8339 +function as2ToNumber(value) {
1.8340 + value = as2ToPrimitive(value);
1.8341 + switch (as2GetType(value)) {
1.8342 + case 'undefined':
1.8343 + case 'null':
1.8344 + return AS2Context.instance.swfVersion >= 7 ? NaN : 0;
1.8345 + case 'boolean':
1.8346 + return value ? 1 : +0;
1.8347 + case 'number':
1.8348 + return value;
1.8349 + case 'string':
1.8350 + if (value === '' && AS2Context.instance.swfVersion < 5) {
1.8351 + return 0;
1.8352 + }
1.8353 + return +value;
1.8354 + default:
1.8355 + return AS2Context.instance.swfVersion >= 5 ? NaN : 0;
1.8356 + }
1.8357 +}
1.8358 +function as2ToInteger(value) {
1.8359 + var result = as2ToNumber(value);
1.8360 + if (isNaN(result)) {
1.8361 + return 0;
1.8362 + }
1.8363 + if (!isFinite(result) || result === 0) {
1.8364 + return result;
1.8365 + }
1.8366 + return (result < 0 ? -1 : 1) * Math.abs(result) | 0;
1.8367 +}
1.8368 +function as2ToInt32(value) {
1.8369 + var result = as2ToNumber(value);
1.8370 + return isNaN(result) || !isFinite(result) || result === 0 ? 0 : result | 0;
1.8371 +}
1.8372 +function as2ToString(value) {
1.8373 + switch (as2GetType(value)) {
1.8374 + case 'undefined':
1.8375 + return AS2Context.instance.swfVersion >= 7 ? 'undefined' : '';
1.8376 + case 'null':
1.8377 + return 'null';
1.8378 + case 'boolean':
1.8379 + return value ? 'true' : 'false';
1.8380 + case 'number':
1.8381 + return value.toString();
1.8382 + case 'string':
1.8383 + return value;
1.8384 + case 'movieclip':
1.8385 + return value.$targetPath;
1.8386 + case 'object':
1.8387 + var result = value.toString !== Function.prototype.toString ? value.toString() : value;
1.8388 + if (typeof result === 'string') {
1.8389 + return result;
1.8390 + }
1.8391 + return typeof value === 'function' ? '[type Function]' : '[type Object]';
1.8392 + }
1.8393 +}
1.8394 +function as2Compare(x, y) {
1.8395 + var x2 = as2ToPrimitive(x);
1.8396 + var y2 = as2ToPrimitive(y);
1.8397 + if (typeof x2 === 'string' && typeof y2 === 'string') {
1.8398 + return x2 < y2;
1.8399 + } else {
1.8400 + return as2ToNumber(x2) < as2ToNumber(y2);
1.8401 + }
1.8402 +}
1.8403 +function as2InstanceOf(obj, constructor) {
1.8404 + if (obj instanceof constructor) {
1.8405 + return true;
1.8406 + }
1.8407 + return false;
1.8408 +}
1.8409 +function as2ResolveProperty(obj, name) {
1.8410 + var avm2PublicName = Multiname.getPublicQualifiedName(name);
1.8411 + if (avm2PublicName in obj) {
1.8412 + return name;
1.8413 + }
1.8414 + if (isNumeric(name)) {
1.8415 + return null;
1.8416 + }
1.8417 + var lowerCaseName = avm2PublicName.toLowerCase();
1.8418 + for (var i in obj) {
1.8419 + if (i.toLowerCase() === lowerCaseName) {
1.8420 + notImplemented('FIX THIS');
1.8421 + }
1.8422 + }
1.8423 + return null;
1.8424 +}
1.8425 +function as2GetPrototype(obj) {
1.8426 + return obj && obj.asGetPublicProperty('prototype');
1.8427 +}
1.8428 +function isAvm2Class(obj) {
1.8429 + return typeof obj === 'object' && obj !== null && 'instanceConstructor' in obj;
1.8430 +}
1.8431 +function as2CreatePrototypeProxy(obj) {
1.8432 + var prototype = obj.asGetPublicProperty('prototype');
1.8433 + if (typeof Proxy === 'undefined') {
1.8434 + console.error('ES6 proxies are not found');
1.8435 + return prototype;
1.8436 + }
1.8437 + return Proxy.create({
1.8438 + getOwnPropertyDescriptor: function (name) {
1.8439 + return Object.getOwnPropertyDescriptor(prototype, name);
1.8440 + },
1.8441 + getPropertyDescriptor: function (name) {
1.8442 + for (var p = prototype; p; p = Object.getPrototypeOf(p)) {
1.8443 + var desc = Object.getOwnPropertyDescriptor(p, name);
1.8444 + if (desc)
1.8445 + return desc;
1.8446 + }
1.8447 + },
1.8448 + getOwnPropertyNames: function () {
1.8449 + return Object.getOwnPropertyNames(prototype);
1.8450 + },
1.8451 + getPropertyNames: function () {
1.8452 + var names = Object.getOwnPropertyNames(prototype);
1.8453 + for (var p = Object.getPrototypeOf(prototype); p; p = Object.getPrototypeOf(p)) {
1.8454 + names = names.concat(Object.getOwnPropertyNames(p));
1.8455 + }
1.8456 + return names;
1.8457 + },
1.8458 + defineProperty: function (name, desc) {
1.8459 + if (desc) {
1.8460 + if (typeof desc.value === 'function' && desc.value._setClass) {
1.8461 + desc.value._setClass(obj);
1.8462 + }
1.8463 + if (typeof desc.get === 'function' && desc.get._setClass) {
1.8464 + desc.get._setClass(obj);
1.8465 + }
1.8466 + if (typeof desc.set === 'function' && desc.set._setClass) {
1.8467 + desc.set._setClass(obj);
1.8468 + }
1.8469 + }
1.8470 + return Object.defineProperty(prototype, name, desc);
1.8471 + },
1.8472 + delete: function (name) {
1.8473 + return delete prototype[name];
1.8474 + },
1.8475 + fix: function () {
1.8476 + return undefined;
1.8477 + }
1.8478 + });
1.8479 +}
1.8480 +function executeActions(actionsData, context, scope) {
1.8481 + if (context.executionProhibited) {
1.8482 + return;
1.8483 + }
1.8484 + var actionTracer = ActionTracerFactory.get();
1.8485 + var scopeContainer = context.initialScope.create(scope);
1.8486 + var savedContext = AS2Context.instance;
1.8487 + try {
1.8488 + AS2Context.instance = context;
1.8489 + context.isActive = true;
1.8490 + context.abortExecutionAt = Date.now() + MAX_AVM1_HANG_TIMEOUT;
1.8491 + context.errorsIgnored = 0;
1.8492 + context.defaultTarget = scope;
1.8493 + context.globals.asSetPublicProperty('this', scope);
1.8494 + actionTracer.message('ActionScript Execution Starts');
1.8495 + actionTracer.indent();
1.8496 + interpretActions(actionsData, scopeContainer, null, []);
1.8497 + } catch (e) {
1.8498 + if (e instanceof AS2CriticalError) {
1.8499 + console.error('Disabling AVM1 execution');
1.8500 + context.executionProhibited = true;
1.8501 + }
1.8502 + throw e;
1.8503 + } finally {
1.8504 + context.isActive = false;
1.8505 + actionTracer.unindent();
1.8506 + actionTracer.message('ActionScript Execution Stops');
1.8507 + AS2Context.instance = savedContext;
1.8508 + }
1.8509 +}
1.8510 +function lookupAS2Children(targetPath, defaultTarget, root) {
1.8511 + var path = targetPath.split(/[\/.]/g);
1.8512 + if (path[path.length - 1] === '') {
1.8513 + path.pop();
1.8514 + }
1.8515 + var obj = defaultTarget;
1.8516 + if (path[0] === '' || path[0] === '_level0' || path[0] === '_root') {
1.8517 + obj = root;
1.8518 + path.shift();
1.8519 + }
1.8520 + while (path.length > 0) {
1.8521 + var prevObj = obj;
1.8522 + obj = obj.$lookupChild(path[0]);
1.8523 + if (!obj) {
1.8524 + throw new Error(path[0] + ' (expr ' + targetPath + ') is not found in ' + prevObj._target);
1.8525 + }
1.8526 + path.shift();
1.8527 + }
1.8528 + return obj;
1.8529 +}
1.8530 +function createBuiltinType(obj, args) {
1.8531 + if (obj === Array) {
1.8532 + var result = args;
1.8533 + if (args.length == 1 && typeof args[0] === 'number') {
1.8534 + result = [];
1.8535 + result.length = args[0];
1.8536 + }
1.8537 + return result;
1.8538 + }
1.8539 + if (obj === Boolean || obj === Number || obj === String || obj === Function) {
1.8540 + return obj.apply(null, args);
1.8541 + }
1.8542 + if (obj === Date) {
1.8543 + switch (args.length) {
1.8544 + case 0:
1.8545 + return new Date();
1.8546 + case 1:
1.8547 + return new Date(args[0]);
1.8548 + default:
1.8549 + return new Date(args[0], args[1], args.length > 2 ? args[2] : 1, args.length > 3 ? args[3] : 0, args.length > 4 ? args[4] : 0, args.length > 5 ? args[5] : 0, args.length > 6 ? args[6] : 0);
1.8550 + }
1.8551 + }
1.8552 + if (obj === Object) {
1.8553 + return {};
1.8554 + }
1.8555 +}
1.8556 +var AS2_SUPER_STUB = {};
1.8557 +function interpretActions(actionsData, scopeContainer, constantPool, registers) {
1.8558 + var currentContext = AS2Context.instance;
1.8559 + function setTarget(targetPath) {
1.8560 + if (!targetPath) {
1.8561 + currentContext.defaultTarget = scope;
1.8562 + return;
1.8563 + }
1.8564 + try {
1.8565 + currentContext.defaultTarget = lookupAS2Children(targetPath, defaultTarget, _global.asGetPublicProperty('_root'));
1.8566 + } catch (e) {
1.8567 + currentContext.defaultTarget = null;
1.8568 + throw e;
1.8569 + }
1.8570 + }
1.8571 + function defineFunction(functionName, parametersNames, registersAllocation, actionsData) {
1.8572 + var ownerClass;
1.8573 + var fn = function () {
1.8574 + var newScope = {};
1.8575 + newScope.asSetPublicProperty('this', this);
1.8576 + newScope.asSetPublicProperty('arguments', arguments);
1.8577 + newScope.asSetPublicProperty('super', AS2_SUPER_STUB);
1.8578 + newScope.asSetPublicProperty('__class', ownerClass);
1.8579 + var newScopeContainer = scopeContainer.create(newScope);
1.8580 + var i;
1.8581 + for (i = 0; i < arguments.length || i < parametersNames.length; i++) {
1.8582 + newScope.asSetPublicProperty(parametersNames[i], arguments[i]);
1.8583 + }
1.8584 + var registers = [];
1.8585 + if (registersAllocation) {
1.8586 + for (i = 0; i < registersAllocation.length; i++) {
1.8587 + var registerAllocation = registersAllocation[i];
1.8588 + if (!registerAllocation) {
1.8589 + continue;
1.8590 + }
1.8591 + if (registerAllocation.type == 'param') {
1.8592 + registers[i] = arguments[registerAllocation.index];
1.8593 + } else {
1.8594 + switch (registerAllocation.name) {
1.8595 + case 'this':
1.8596 + registers[i] = this;
1.8597 + break;
1.8598 + case 'arguments':
1.8599 + registers[i] = arguments;
1.8600 + break;
1.8601 + case 'super':
1.8602 + registers[i] = AS2_SUPER_STUB;
1.8603 + break;
1.8604 + case '_global':
1.8605 + registers[i] = _global;
1.8606 + break;
1.8607 + case '_parent':
1.8608 + registers[i] = scope.asGetPublicProperty('_parent');
1.8609 + break;
1.8610 + case '_root':
1.8611 + registers[i] = _global.asGetPublicProperty('_root');
1.8612 + break;
1.8613 + }
1.8614 + }
1.8615 + }
1.8616 + }
1.8617 + var savedContext = AS2Context.instance;
1.8618 + var savedIsActive = currentContext.isActive;
1.8619 + try {
1.8620 + AS2Context.instance = currentContext;
1.8621 + if (!savedIsActive) {
1.8622 + currentContext.abortExecutionAt = Date.now() + MAX_AVM1_HANG_TIMEOUT;
1.8623 + currentContext.errorsIgnored = 0;
1.8624 + currentContext.isActive = true;
1.8625 + }
1.8626 + currentContext.defaultTarget = scope;
1.8627 + actionTracer.indent();
1.8628 + currentContext.stackDepth++;
1.8629 + if (currentContext.stackDepth >= MAX_AVM1_STACK_LIMIT) {
1.8630 + throw new AS2CriticalError('long running script -- AVM1 recursion limit is reached');
1.8631 + }
1.8632 + return interpretActions(actionsData, newScopeContainer, constantPool, registers);
1.8633 + } finally {
1.8634 + currentContext.isActive = savedIsActive;
1.8635 + currentContext.stackDepth--;
1.8636 + actionTracer.unindent();
1.8637 + currentContext.defaultTarget = defaultTarget;
1.8638 + AS2Context.instance = savedContext;
1.8639 + }
1.8640 + };
1.8641 + ownerClass = fn;
1.8642 + fn._setClass = function (class_) {
1.8643 + ownerClass = class_;
1.8644 + };
1.8645 + fn.instanceConstructor = fn;
1.8646 + fn.debugName = 'avm1 ' + (functionName || '<function>');
1.8647 + if (functionName) {
1.8648 + fn.name = functionName;
1.8649 + }
1.8650 + return fn;
1.8651 + }
1.8652 + function deleteProperty(propertyName) {
1.8653 + for (var p = scopeContainer; p; p = p.next) {
1.8654 + if (p.scope.asHasProperty(undefined, propertyName, 0)) {
1.8655 + p.scope.asSetPublicProperty(propertyName, undefined);
1.8656 + return p.scope.asDeleteProperty(undefined, propertyName, 0);
1.8657 + }
1.8658 + }
1.8659 + return false;
1.8660 + }
1.8661 + function resolveVariableName(variableName, nonStrict) {
1.8662 + var obj, name, i;
1.8663 + if (variableName.indexOf(':') >= 0) {
1.8664 + var parts = variableName.split(':');
1.8665 + obj = lookupAS2Children(parts[0], defaultTarget, _global.asGetPublicProperty('_root'));
1.8666 + if (!obj) {
1.8667 + throw new Error(parts[0] + ' is undefined');
1.8668 + }
1.8669 + name = parts[1];
1.8670 + } else if (variableName.indexOf('.') >= 0) {
1.8671 + var objPath = variableName.split('.');
1.8672 + name = objPath.pop();
1.8673 + obj = _global;
1.8674 + for (i = 0; i < objPath.length; i++) {
1.8675 + obj = obj.asGetPublicProperty(objPath[i]) || obj[objPath[i]];
1.8676 + if (!obj) {
1.8677 + throw new Error(objPath.slice(0, i + 1) + ' is undefined');
1.8678 + }
1.8679 + }
1.8680 + }
1.8681 + if (!obj) {
1.8682 + return null;
1.8683 + }
1.8684 + var resolvedName = as2ResolveProperty(obj, name);
1.8685 + var resolved = resolvedName !== null;
1.8686 + if (resolved || nonStrict) {
1.8687 + return {
1.8688 + obj: obj,
1.8689 + name: resolvedName || name,
1.8690 + resolved: resolved
1.8691 + };
1.8692 + }
1.8693 + return null;
1.8694 + }
1.8695 + function getThis() {
1.8696 + var _this = scope.asGetPublicProperty('this');
1.8697 + if (_this) {
1.8698 + return _this;
1.8699 + }
1.8700 + for (var p = scopeContainer; p; p = p.next) {
1.8701 + resolvedName = as2ResolveProperty(p.scope, 'this');
1.8702 + if (resolvedName !== null) {
1.8703 + return p.scope.asGetPublicProperty(resolvedName);
1.8704 + }
1.8705 + }
1.8706 + }
1.8707 + function getVariable(variableName) {
1.8708 + if (scope.asHasProperty(undefined, variableName, 0)) {
1.8709 + return scope.asGetPublicProperty(variableName);
1.8710 + }
1.8711 + var target = resolveVariableName(variableName);
1.8712 + if (target) {
1.8713 + return target.obj.asGetPublicProperty(target.name);
1.8714 + }
1.8715 + var resolvedName, _this = getThis();
1.8716 + for (var p = scopeContainer; p; p = p.next) {
1.8717 + resolvedName = as2ResolveProperty(p.scope, variableName);
1.8718 + if (resolvedName !== null) {
1.8719 + return p.scope.asGetPublicProperty(resolvedName);
1.8720 + }
1.8721 + }
1.8722 + if (_this && (resolvedName = as2ResolveProperty(_this, variableName))) {
1.8723 + return _this.asGetPublicProperty(resolvedName);
1.8724 + }
1.8725 + var mc = isAS2MovieClip(defaultTarget) && defaultTarget.$lookupChild(variableName);
1.8726 + if (mc) {
1.8727 + return mc;
1.8728 + }
1.8729 + }
1.8730 + function setVariable(variableName, value) {
1.8731 + if (scope.asHasProperty(undefined, variableName, 0)) {
1.8732 + scope.asSetPublicProperty(variableName, value);
1.8733 + return;
1.8734 + }
1.8735 + var target = resolveVariableName(variableName, true);
1.8736 + if (target) {
1.8737 + target.obj.asSetPublicProperty(target.name, value);
1.8738 + return;
1.8739 + }
1.8740 + var resolvedName, _this = getThis();
1.8741 + if (_this && (resolvedName = as2ResolveProperty(_this, variableName))) {
1.8742 + return _this.asSetPublicProperty(resolvedName, value);
1.8743 + }
1.8744 + for (var p = scopeContainer; p.next; p = p.next) {
1.8745 + resolvedName = as2ResolveProperty(p.scope, variableName);
1.8746 + if (resolvedName !== null) {
1.8747 + return p.scope.asSetPublicProperty(resolvedName, value);
1.8748 + }
1.8749 + }
1.8750 + (_this || scope).asSetPublicProperty(variableName, value);
1.8751 + }
1.8752 + function getFunction(functionName) {
1.8753 + var fn = getVariable(functionName);
1.8754 + if (!(fn instanceof Function)) {
1.8755 + throw new Error('Function "' + functionName + '" is not found');
1.8756 + }
1.8757 + return fn;
1.8758 + }
1.8759 + function getObjectByName(objectName) {
1.8760 + var obj = getVariable(objectName);
1.8761 + if (!(obj instanceof Object)) {
1.8762 + throw new Error('Object "' + objectName + '" is not found');
1.8763 + }
1.8764 + return obj;
1.8765 + }
1.8766 + function processWith(obj, withBlock) {
1.8767 + var newScopeContainer = scopeContainer.create(Object(obj));
1.8768 + interpretActions(withBlock, newScopeContainer, constantPool, registers);
1.8769 + }
1.8770 + function processTry(catchIsRegisterFlag, finallyBlockFlag, catchBlockFlag, catchTarget, tryBlock, catchBlock, finallyBlock) {
1.8771 + var savedTryCatchState = currentContext.isTryCatchListening;
1.8772 + try {
1.8773 + currentContext.isTryCatchListening = true;
1.8774 + interpretActions(tryBlock, scopeContainer, constantPool, registers);
1.8775 + } catch (e) {
1.8776 + currentContext.isTryCatchListening = savedTryCatchState;
1.8777 + if (!catchBlockFlag) {
1.8778 + throw e;
1.8779 + }
1.8780 + if (!(e instanceof AS2Error)) {
1.8781 + throw e;
1.8782 + }
1.8783 + if (typeof catchTarget === 'string') {
1.8784 + scope[catchTarget] = e.error;
1.8785 + } else {
1.8786 + registers[catchTarget] = e.error;
1.8787 + }
1.8788 + interpretActions(catchBlock, scopeContainer, constantPool, registers);
1.8789 + } finally {
1.8790 + currentContext.isTryCatchListening = savedTryCatchState;
1.8791 + if (finallyBlockFlag) {
1.8792 + interpretActions(finallyBlock, scopeContainer, constantPool, registers);
1.8793 + }
1.8794 + }
1.8795 + }
1.8796 + function validateArgsCount(numArgs, maxAmount) {
1.8797 + if (isNaN(numArgs) || numArgs < 0 || numArgs > maxAmount || numArgs != (0 | numArgs)) {
1.8798 + throw new Error('Invalid number of arguments: ' + numArgs);
1.8799 + }
1.8800 + }
1.8801 + function readArgs(stack) {
1.8802 + var numArgs = +stack.pop();
1.8803 + validateArgsCount(numArgs, stack.length);
1.8804 + var args = [];
1.8805 + for (var i = 0; i < numArgs; i++) {
1.8806 + args.push(stack.pop());
1.8807 + }
1.8808 + return args;
1.8809 + }
1.8810 + var stream = new ActionsDataStream(actionsData, currentContext.swfVersion);
1.8811 + var _global = currentContext.globals;
1.8812 + var defaultTarget = currentContext.defaultTarget;
1.8813 + var stack = [];
1.8814 + var scope = scopeContainer.scope;
1.8815 + var isSwfVersion5 = currentContext.swfVersion >= 5;
1.8816 + var actionTracer = ActionTracerFactory.get();
1.8817 + var nextPosition;
1.8818 + if (scope.$nativeObject && scope.$nativeObject._deferScriptExecution) {
1.8819 + currentContext.deferScriptExecution = true;
1.8820 + }
1.8821 + function skipActions(count) {
1.8822 + while (count > 0 && stream.position < stream.end) {
1.8823 + var actionCode = stream.readUI8();
1.8824 + var length = actionCode >= 128 ? stream.readUI16() : 0;
1.8825 + stream.position += length;
1.8826 + count--;
1.8827 + }
1.8828 + nextPosition = stream.position;
1.8829 + }
1.8830 + var recoveringFromError = false;
1.8831 + var stackItemsExpected;
1.8832 + while (stream.position < stream.end) {
1.8833 + try {
1.8834 + var instructionsExecuted = 0;
1.8835 + var abortExecutionAt = currentContext.abortExecutionAt;
1.8836 + while (stream.position < stream.end) {
1.8837 + if (instructionsExecuted++ % 100 === 0 && Date.now() >= abortExecutionAt) {
1.8838 + throw new AS2CriticalError('long running script -- AVM1 instruction hang timeout');
1.8839 + }
1.8840 + var actionCode = stream.readUI8();
1.8841 + var length = actionCode >= 128 ? stream.readUI16() : 0;
1.8842 + nextPosition = stream.position + length;
1.8843 + stackItemsExpected = 0;
1.8844 + actionTracer.print(stream.position, actionCode, stack);
1.8845 + var frame, type, count, index, target, method, constr, codeSize, offset;
1.8846 + var name, variableName, methodName, functionName, targetName;
1.8847 + var paramName, resolvedName, objectName;
1.8848 + var value, a, b, c, f, sa, sb, obj, args, fn, result, flags, i;
1.8849 + var dragParams, register;
1.8850 + switch (actionCode | 0) {
1.8851 + case 129:
1.8852 + frame = stream.readUI16();
1.8853 + var nextActionCode = stream.readUI8();
1.8854 + nextPosition++;
1.8855 + methodName = nextActionCode === 6 ? 'gotoAndPlay' : 'gotoAndStop';
1.8856 + _global[methodName](frame + 1);
1.8857 + break;
1.8858 + case 131:
1.8859 + var urlString = stream.readString();
1.8860 + var targetString = stream.readString();
1.8861 + _global.getURL(urlString, targetString);
1.8862 + break;
1.8863 + case 4:
1.8864 + _global.nextFrame();
1.8865 + break;
1.8866 + case 5:
1.8867 + _global.prevFrame();
1.8868 + break;
1.8869 + case 6:
1.8870 + _global.play();
1.8871 + break;
1.8872 + case 7:
1.8873 + _global.stop();
1.8874 + break;
1.8875 + case 8:
1.8876 + _global.toggleHighQuality();
1.8877 + break;
1.8878 + case 9:
1.8879 + _global.stopAllSounds();
1.8880 + break;
1.8881 + case 138:
1.8882 + frame = stream.readUI16();
1.8883 + count = stream.readUI8();
1.8884 + if (!_global.ifFrameLoaded(frame)) {
1.8885 + skipActions(count);
1.8886 + }
1.8887 + break;
1.8888 + case 139:
1.8889 + targetName = stream.readString();
1.8890 + setTarget(targetName);
1.8891 + break;
1.8892 + case 140:
1.8893 + var label = stream.readString();
1.8894 + _global.gotoLabel(label);
1.8895 + break;
1.8896 + case 150:
1.8897 + while (stream.position < nextPosition) {
1.8898 + type = stream.readUI8();
1.8899 + switch (type) {
1.8900 + case 0:
1.8901 + value = stream.readString();
1.8902 + break;
1.8903 + case 1:
1.8904 + value = stream.readFloat();
1.8905 + break;
1.8906 + case 2:
1.8907 + value = null;
1.8908 + break;
1.8909 + case 3:
1.8910 + value = void 0;
1.8911 + break;
1.8912 + case 4:
1.8913 + value = registers[stream.readUI8()];
1.8914 + break;
1.8915 + case 5:
1.8916 + value = stream.readBoolean();
1.8917 + break;
1.8918 + case 6:
1.8919 + value = stream.readDouble();
1.8920 + break;
1.8921 + case 7:
1.8922 + value = stream.readInteger();
1.8923 + break;
1.8924 + case 8:
1.8925 + value = constantPool[stream.readUI8()];
1.8926 + break;
1.8927 + case 9:
1.8928 + value = constantPool[stream.readUI16()];
1.8929 + break;
1.8930 + default:
1.8931 + throw new Error('Unknown value type: ' + type);
1.8932 + }
1.8933 + stack.push(value);
1.8934 + }
1.8935 + break;
1.8936 + case 23:
1.8937 + stack.pop();
1.8938 + break;
1.8939 + case 10:
1.8940 + a = as2ToNumber(stack.pop());
1.8941 + b = as2ToNumber(stack.pop());
1.8942 + stack.push(a + b);
1.8943 + break;
1.8944 + case 11:
1.8945 + a = as2ToNumber(stack.pop());
1.8946 + b = as2ToNumber(stack.pop());
1.8947 + stack.push(b - a);
1.8948 + break;
1.8949 + case 12:
1.8950 + a = as2ToNumber(stack.pop());
1.8951 + b = as2ToNumber(stack.pop());
1.8952 + stack.push(a * b);
1.8953 + break;
1.8954 + case 13:
1.8955 + a = as2ToNumber(stack.pop());
1.8956 + b = as2ToNumber(stack.pop());
1.8957 + c = b / a;
1.8958 + stack.push(isSwfVersion5 ? c : isFinite(c) ? c : '#ERROR#');
1.8959 + break;
1.8960 + case 14:
1.8961 + a = as2ToNumber(stack.pop());
1.8962 + b = as2ToNumber(stack.pop());
1.8963 + f = a == b;
1.8964 + stack.push(isSwfVersion5 ? f : f ? 1 : 0);
1.8965 + break;
1.8966 + case 15:
1.8967 + a = as2ToNumber(stack.pop());
1.8968 + b = as2ToNumber(stack.pop());
1.8969 + f = b < a;
1.8970 + stack.push(isSwfVersion5 ? f : f ? 1 : 0);
1.8971 + break;
1.8972 + case 16:
1.8973 + a = as2ToBoolean(stack.pop());
1.8974 + b = as2ToBoolean(stack.pop());
1.8975 + f = a && b;
1.8976 + stack.push(isSwfVersion5 ? f : f ? 1 : 0);
1.8977 + break;
1.8978 + case 17:
1.8979 + a = as2ToBoolean(stack.pop());
1.8980 + b = as2ToBoolean(stack.pop());
1.8981 + f = a || b;
1.8982 + stack.push(isSwfVersion5 ? f : f ? 1 : 0);
1.8983 + break;
1.8984 + case 18:
1.8985 + f = !as2ToBoolean(stack.pop());
1.8986 + stack.push(isSwfVersion5 ? f : f ? 1 : 0);
1.8987 + break;
1.8988 + case 19:
1.8989 + sa = as2ToString(stack.pop());
1.8990 + sb = as2ToString(stack.pop());
1.8991 + f = sa == sb;
1.8992 + stack.push(isSwfVersion5 ? f : f ? 1 : 0);
1.8993 + break;
1.8994 + case 20:
1.8995 + case 49:
1.8996 + sa = as2ToString(stack.pop());
1.8997 + stack.push(_global.length(sa));
1.8998 + break;
1.8999 + case 33:
1.9000 + sa = as2ToString(stack.pop());
1.9001 + sb = as2ToString(stack.pop());
1.9002 + stack.push(sb + sa);
1.9003 + break;
1.9004 + case 21:
1.9005 + count = stack.pop();
1.9006 + index = stack.pop();
1.9007 + value = as2ToString(stack.pop());
1.9008 + stack.push(_global.substring(value, index, count));
1.9009 + break;
1.9010 + case 53:
1.9011 + count = stack.pop();
1.9012 + index = stack.pop();
1.9013 + value = as2ToString(stack.pop());
1.9014 + stack.push(_global.mbsubstring(value, index, count));
1.9015 + break;
1.9016 + case 41:
1.9017 + sa = as2ToString(stack.pop());
1.9018 + sb = as2ToString(stack.pop());
1.9019 + f = sb < sa;
1.9020 + stack.push(isSwfVersion5 ? f : f ? 1 : 0);
1.9021 + break;
1.9022 + case 24:
1.9023 + stack.push(_global.int(stack.pop()));
1.9024 + break;
1.9025 + case 50:
1.9026 + stack.push(_global.chr(stack.pop()));
1.9027 + break;
1.9028 + case 54:
1.9029 + stack.push(_global.mbchr(stack.pop()));
1.9030 + break;
1.9031 + case 51:
1.9032 + stack.push(_global.ord(stack.pop()));
1.9033 + break;
1.9034 + case 55:
1.9035 + stack.push(_global.mbord(stack.pop()));
1.9036 + break;
1.9037 + case 153:
1.9038 + offset = stream.readSI16();
1.9039 + nextPosition += offset;
1.9040 + break;
1.9041 + case 157:
1.9042 + offset = stream.readSI16();
1.9043 + f = !(!stack.pop());
1.9044 + if (f) {
1.9045 + nextPosition += offset;
1.9046 + }
1.9047 + break;
1.9048 + case 158:
1.9049 + label = stack.pop();
1.9050 + _global.call(label);
1.9051 + break;
1.9052 + case 28:
1.9053 + variableName = '' + stack.pop();
1.9054 + stackItemsExpected++;
1.9055 + stack.push(getVariable(variableName));
1.9056 + break;
1.9057 + case 29:
1.9058 + value = stack.pop();
1.9059 + variableName = '' + stack.pop();
1.9060 + setVariable(variableName, value);
1.9061 + break;
1.9062 + case 154:
1.9063 + flags = stream.readUI8();
1.9064 + target = stack.pop();
1.9065 + var url = stack.pop();
1.9066 + var sendVarsMethod;
1.9067 + if (flags & 1) {
1.9068 + sendVarsMethod = 'GET';
1.9069 + } else if (flags & 2) {
1.9070 + sendVarsMethod = 'POST';
1.9071 + }
1.9072 + var loadTargetFlag = flags & 1 << 6;
1.9073 + if (!loadTargetFlag) {
1.9074 + _global.getURL(url, target, sendVarsMethod);
1.9075 + break;
1.9076 + }
1.9077 + var loadVariablesFlag = flags & 1 << 7;
1.9078 + if (loadVariablesFlag) {
1.9079 + _global.loadVariables(url, target, sendVarsMethod);
1.9080 + } else {
1.9081 + _global.loadMovie(url, target, sendVarsMethod);
1.9082 + }
1.9083 + break;
1.9084 + case 159:
1.9085 + flags = stream.readUI8();
1.9086 + var gotoParams = [
1.9087 + stack.pop()
1.9088 + ];
1.9089 + if (!(!(flags & 2))) {
1.9090 + gotoParams.push(stream.readUI16());
1.9091 + }
1.9092 + var gotoMethod = !(!(flags & 1)) ? _global.gotoAndPlay : _global.gotoAndStop;
1.9093 + gotoMethod.apply(_global, gotoParams);
1.9094 + break;
1.9095 + case 32:
1.9096 + target = stack.pop();
1.9097 + setTarget(target);
1.9098 + break;
1.9099 + case 34:
1.9100 + index = stack.pop();
1.9101 + target = stack.pop();
1.9102 + stackItemsExpected++;
1.9103 + stack.push(_global.getAS2Property(target, index));
1.9104 + break;
1.9105 + case 35:
1.9106 + value = stack.pop();
1.9107 + index = stack.pop();
1.9108 + target = stack.pop();
1.9109 + _global.setAS2Property(target, index, value);
1.9110 + break;
1.9111 + case 36:
1.9112 + var depth = stack.pop();
1.9113 + target = stack.pop();
1.9114 + var source = stack.pop();
1.9115 + _global.duplicateMovieClip(source, target, depth);
1.9116 + break;
1.9117 + case 37:
1.9118 + target = stack.pop();
1.9119 + _global.removeMovieClip(target);
1.9120 + break;
1.9121 + case 39:
1.9122 + target = stack.pop();
1.9123 + var lockcenter = stack.pop();
1.9124 + var constrain = !stack.pop() ? null : {
1.9125 + y2: stack.pop(),
1.9126 + x2: stack.pop(),
1.9127 + y1: stack.pop(),
1.9128 + x1: stack.pop()
1.9129 + };
1.9130 + dragParams = [
1.9131 + target,
1.9132 + lockcenter
1.9133 + ];
1.9134 + if (constrain) {
1.9135 + dragParams = dragParams.push(constrain.x1, constrain.y1, constrain.x2, constrain.y2);
1.9136 + }
1.9137 + _global.startDrag.apply(_global, dragParams);
1.9138 + break;
1.9139 + case 40:
1.9140 + _global.stopDrag();
1.9141 + break;
1.9142 + case 141:
1.9143 + count = stream.readUI8();
1.9144 + frame = stack.pop();
1.9145 + if (!_global.ifFrameLoaded(frame)) {
1.9146 + skipActions(count);
1.9147 + }
1.9148 + break;
1.9149 + case 38:
1.9150 + value = stack.pop();
1.9151 + _global.trace(value);
1.9152 + break;
1.9153 + case 52:
1.9154 + stack.push(_global.getTimer());
1.9155 + break;
1.9156 + case 48:
1.9157 + stack.push(_global.random(stack.pop()));
1.9158 + break;
1.9159 + case 61:
1.9160 + functionName = stack.pop();
1.9161 + args = readArgs(stack);
1.9162 + stackItemsExpected++;
1.9163 + fn = getFunction(functionName);
1.9164 + result = fn.apply(scope, args);
1.9165 + stack.push(result);
1.9166 + break;
1.9167 + case 82:
1.9168 + methodName = stack.pop();
1.9169 + obj = stack.pop();
1.9170 + args = readArgs(stack);
1.9171 + stackItemsExpected++;
1.9172 + if (methodName !== null && methodName !== undefined && methodName !== '') {
1.9173 + if (obj === null || obj === undefined) {
1.9174 + throw new Error('Cannot call method ' + methodName + ' of ' + typeof obj);
1.9175 + } else if (obj !== AS2_SUPER_STUB) {
1.9176 + target = Object(obj);
1.9177 + } else {
1.9178 + target = as2GetPrototype(getVariable('__class').__super);
1.9179 + obj = getVariable('this');
1.9180 + }
1.9181 + resolvedName = as2ResolveProperty(target, methodName);
1.9182 + if (resolvedName === null) {
1.9183 + throw new Error('Method ' + methodName + ' is not defined.');
1.9184 + }
1.9185 + result = target.asGetPublicProperty(resolvedName).apply(obj, args);
1.9186 + } else if (obj !== AS2_SUPER_STUB) {
1.9187 + result = obj.apply(obj, args);
1.9188 + } else {
1.9189 + result = getVariable('__class').__super.apply(getVariable('this'), args);
1.9190 + }
1.9191 + stack.push(result);
1.9192 + break;
1.9193 + case 136:
1.9194 + count = stream.readUI16();
1.9195 + constantPool = [];
1.9196 + for (i = 0; i < count; i++) {
1.9197 + constantPool.push(stream.readString());
1.9198 + }
1.9199 + break;
1.9200 + case 155:
1.9201 + functionName = stream.readString();
1.9202 + count = stream.readUI16();
1.9203 + args = [];
1.9204 + for (i = 0; i < count; i++) {
1.9205 + args.push(stream.readString());
1.9206 + }
1.9207 + codeSize = stream.readUI16();
1.9208 + nextPosition += codeSize;
1.9209 + fn = defineFunction(functionName, args, null, stream.readBytes(codeSize));
1.9210 + if (functionName) {
1.9211 + scope.asSetPublicProperty(functionName, fn);
1.9212 + } else {
1.9213 + stack.push(fn);
1.9214 + }
1.9215 + break;
1.9216 + case 60:
1.9217 + value = stack.pop();
1.9218 + name = stack.pop();
1.9219 + scope.asSetPublicProperty(name, value);
1.9220 + break;
1.9221 + case 65:
1.9222 + name = stack.pop();
1.9223 + scope.asSetPublicProperty(name, undefined);
1.9224 + break;
1.9225 + case 58:
1.9226 + name = stack.pop();
1.9227 + obj = stack.pop();
1.9228 + obj.asSetPublicProperty(name, undefined);
1.9229 + stack.push(obj.asDeleteProperty(undefined, name, 0));
1.9230 + break;
1.9231 + case 59:
1.9232 + name = stack.pop();
1.9233 + result = deleteProperty(name);
1.9234 + stack.push(result);
1.9235 + break;
1.9236 + case 70:
1.9237 + objectName = stack.pop();
1.9238 + stack.push(null);
1.9239 + obj = getObjectByName(objectName);
1.9240 + forEachPublicProperty(obj, function (name) {
1.9241 + stack.push(name);
1.9242 + });
1.9243 + break;
1.9244 + case 73:
1.9245 + a = stack.pop();
1.9246 + b = stack.pop();
1.9247 + stack.push(a == b);
1.9248 + break;
1.9249 + case 78:
1.9250 + name = stack.pop();
1.9251 + obj = stack.pop();
1.9252 + if (name === 'prototype') {
1.9253 + stack.push(as2CreatePrototypeProxy(obj));
1.9254 + } else {
1.9255 + resolvedName = as2ResolveProperty(Object(obj), name);
1.9256 + stack.push(resolvedName === null ? undefined : obj.asGetPublicProperty(resolvedName));
1.9257 + }
1.9258 + break;
1.9259 + case 66:
1.9260 + obj = readArgs(stack);
1.9261 + stack.push(obj);
1.9262 + break;
1.9263 + case 67:
1.9264 + count = +stack.pop();
1.9265 + validateArgsCount(count, stack.length >> 1);
1.9266 + obj = {};
1.9267 + for (i = 0; i < count; i++) {
1.9268 + value = stack.pop();
1.9269 + name = stack.pop();
1.9270 + obj.asSetPublicProperty(name, value);
1.9271 + }
1.9272 + stack.push(obj);
1.9273 + break;
1.9274 + case 83:
1.9275 + methodName = stack.pop();
1.9276 + obj = stack.pop();
1.9277 + args = readArgs(stack);
1.9278 + stackItemsExpected++;
1.9279 + if (methodName !== null && methodName !== undefined && methodName !== '') {
1.9280 + resolvedName = as2ResolveProperty(obj, methodName);
1.9281 + if (resolvedName === null) {
1.9282 + throw new Error('Method ' + methodName + ' is not defined.');
1.9283 + }
1.9284 + if (obj === null || obj === undefined) {
1.9285 + throw new Error('Cannot call new using method ' + resolvedName + ' of ' + typeof obj);
1.9286 + }
1.9287 + method = obj.asGetPublicProperty(resolvedName);
1.9288 + } else {
1.9289 + if (obj === null || obj === undefined) {
1.9290 + throw new Error('Cannot call new using ' + typeof obj);
1.9291 + }
1.9292 + method = obj;
1.9293 + }
1.9294 + if (isAvm2Class(obj)) {
1.9295 + result = construct(obj, args);
1.9296 + } else {
1.9297 + result = Object.create(as2GetPrototype(method) || as2GetPrototype(Object));
1.9298 + method.apply(result, args);
1.9299 + }
1.9300 + result.constructor = method;
1.9301 + stack.push(result);
1.9302 + break;
1.9303 + case 64:
1.9304 + objectName = stack.pop();
1.9305 + obj = getObjectByName(objectName);
1.9306 + args = readArgs(stack);
1.9307 + stackItemsExpected++;
1.9308 + result = createBuiltinType(obj, args);
1.9309 + if (typeof result === 'undefined') {
1.9310 + if (isAvm2Class(obj)) {
1.9311 + result = construct(obj, args);
1.9312 + } else {
1.9313 + result = Object.create(as2GetPrototype(obj) || as2GetPrototype(Object));
1.9314 + obj.apply(result, args);
1.9315 + }
1.9316 + result.constructor = obj;
1.9317 + }
1.9318 + stack.push(result);
1.9319 + break;
1.9320 + case 79:
1.9321 + value = stack.pop();
1.9322 + name = stack.pop();
1.9323 + obj = stack.pop();
1.9324 + obj.asSetPublicProperty(name, value);
1.9325 + break;
1.9326 + case 69:
1.9327 + obj = stack.pop();
1.9328 + stack.push(as2GetType(obj) === 'movieclip' ? obj._target : void 0);
1.9329 + break;
1.9330 + case 148:
1.9331 + codeSize = stream.readUI16();
1.9332 + obj = stack.pop();
1.9333 + nextPosition += codeSize;
1.9334 + processWith(obj, stream.readBytes(codeSize));
1.9335 + break;
1.9336 + case 74:
1.9337 + stack.push(as2ToNumber(stack.pop()));
1.9338 + break;
1.9339 + case 75:
1.9340 + stack.push(as2ToString(stack.pop()));
1.9341 + break;
1.9342 + case 68:
1.9343 + obj = stack.pop();
1.9344 + result = as2GetType(obj);
1.9345 + stack.push(result);
1.9346 + break;
1.9347 + case 71:
1.9348 + a = as2ToAddPrimitive(stack.pop());
1.9349 + b = as2ToAddPrimitive(stack.pop());
1.9350 + if (typeof a === 'string' || typeof b === 'string') {
1.9351 + stack.push(as2ToString(b) + as2ToString(a));
1.9352 + } else {
1.9353 + stack.push(as2ToNumber(b) + as2ToNumber(a));
1.9354 + }
1.9355 + break;
1.9356 + case 72:
1.9357 + a = stack.pop();
1.9358 + b = stack.pop();
1.9359 + stack.push(as2Compare(b, a));
1.9360 + break;
1.9361 + case 63:
1.9362 + a = as2ToNumber(stack.pop());
1.9363 + b = as2ToNumber(stack.pop());
1.9364 + stack.push(b % a);
1.9365 + break;
1.9366 + case 96:
1.9367 + a = as2ToInt32(stack.pop());
1.9368 + b = as2ToInt32(stack.pop());
1.9369 + stack.push(b & a);
1.9370 + break;
1.9371 + case 99:
1.9372 + a = as2ToInt32(stack.pop());
1.9373 + b = as2ToInt32(stack.pop());
1.9374 + stack.push(b << a);
1.9375 + break;
1.9376 + case 97:
1.9377 + a = as2ToInt32(stack.pop());
1.9378 + b = as2ToInt32(stack.pop());
1.9379 + stack.push(b | a);
1.9380 + break;
1.9381 + case 100:
1.9382 + a = as2ToInt32(stack.pop());
1.9383 + b = as2ToInt32(stack.pop());
1.9384 + stack.push(b >> a);
1.9385 + break;
1.9386 + case 101:
1.9387 + a = as2ToInt32(stack.pop());
1.9388 + b = as2ToInt32(stack.pop());
1.9389 + stack.push(b >>> a);
1.9390 + break;
1.9391 + case 98:
1.9392 + a = as2ToInt32(stack.pop());
1.9393 + b = as2ToInt32(stack.pop());
1.9394 + stack.push(b ^ a);
1.9395 + break;
1.9396 + case 81:
1.9397 + a = as2ToNumber(stack.pop());
1.9398 + a--;
1.9399 + stack.push(a);
1.9400 + break;
1.9401 + case 80:
1.9402 + a = as2ToNumber(stack.pop());
1.9403 + a++;
1.9404 + stack.push(a);
1.9405 + break;
1.9406 + case 76:
1.9407 + stack.push(stack[stack.length - 1]);
1.9408 + break;
1.9409 + case 62:
1.9410 + return stack.pop();
1.9411 + case 77:
1.9412 + stack.push(stack.pop(), stack.pop());
1.9413 + break;
1.9414 + case 135:
1.9415 + register = stream.readUI8();
1.9416 + registers[register] = stack[stack.length - 1];
1.9417 + break;
1.9418 + case 84:
1.9419 + constr = stack.pop();
1.9420 + obj = stack.pop();
1.9421 + stack.push(as2InstanceOf(Object(obj), constr));
1.9422 + break;
1.9423 + case 85:
1.9424 + obj = stack.pop();
1.9425 + stack.push(null);
1.9426 + forEachPublicProperty(obj, function (name) {
1.9427 + stack.push(name);
1.9428 + });
1.9429 + break;
1.9430 + case 102:
1.9431 + a = stack.pop();
1.9432 + b = stack.pop();
1.9433 + stack.push(b === a);
1.9434 + break;
1.9435 + case 103:
1.9436 + a = stack.pop();
1.9437 + b = stack.pop();
1.9438 + stack.push(as2Compare(a, b));
1.9439 + break;
1.9440 + case 104:
1.9441 + sa = as2ToString(stack.pop());
1.9442 + sb = as2ToString(stack.pop());
1.9443 + f = sb > sa;
1.9444 + stack.push(isSwfVersion5 ? f : f ? 1 : 0);
1.9445 + break;
1.9446 + case 142:
1.9447 + functionName = stream.readString();
1.9448 + count = stream.readUI16();
1.9449 + var registerCount = stream.readUI8();
1.9450 + flags = stream.readUI16();
1.9451 + var registerAllocation = [];
1.9452 + args = [];
1.9453 + for (i = 0; i < count; i++) {
1.9454 + register = stream.readUI8();
1.9455 + paramName = stream.readString();
1.9456 + args.push(paramName);
1.9457 + if (register) {
1.9458 + registerAllocation[register] = {
1.9459 + type: 'param',
1.9460 + name: paramName,
1.9461 + index: i
1.9462 + };
1.9463 + }
1.9464 + }
1.9465 + codeSize = stream.readUI16();
1.9466 + nextPosition += codeSize;
1.9467 + var j = 1;
1.9468 + if (flags & 1) {
1.9469 + registerAllocation[j++] = {
1.9470 + type: 'var',
1.9471 + name: 'this'
1.9472 + };
1.9473 + }
1.9474 + if (flags & 4) {
1.9475 + registerAllocation[j++] = {
1.9476 + type: 'var',
1.9477 + name: 'arguments'
1.9478 + };
1.9479 + }
1.9480 + if (flags & 16) {
1.9481 + registerAllocation[j++] = {
1.9482 + type: 'var',
1.9483 + name: 'super'
1.9484 + };
1.9485 + }
1.9486 + if (flags & 64) {
1.9487 + registerAllocation[j++] = {
1.9488 + type: 'var',
1.9489 + name: '_root'
1.9490 + };
1.9491 + }
1.9492 + if (flags & 128) {
1.9493 + registerAllocation[j++] = {
1.9494 + type: 'var',
1.9495 + name: '_parent'
1.9496 + };
1.9497 + }
1.9498 + if (flags & 256) {
1.9499 + registerAllocation[j++] = {
1.9500 + type: 'var',
1.9501 + name: '_global'
1.9502 + };
1.9503 + }
1.9504 + fn = defineFunction(functionName, args, registerAllocation, stream.readBytes(codeSize));
1.9505 + if (functionName) {
1.9506 + scope.asSetPublicProperty(functionName, fn);
1.9507 + } else {
1.9508 + stack.push(fn);
1.9509 + }
1.9510 + break;
1.9511 + case 105:
1.9512 + var constrSuper = stack.pop();
1.9513 + constr = stack.pop();
1.9514 + obj = Object.create(constrSuper.traitsPrototype || as2GetPrototype(constrSuper), {
1.9515 + constructor: {
1.9516 + value: constr,
1.9517 + enumerable: false
1.9518 + }
1.9519 + });
1.9520 + constr.__super = constrSuper;
1.9521 + constr.prototype = obj;
1.9522 + break;
1.9523 + case 43:
1.9524 + obj = stack.pop();
1.9525 + constr = stack.pop();
1.9526 + stack.push(as2InstanceOf(obj, constr) ? obj : null);
1.9527 + break;
1.9528 + case 44:
1.9529 + constr = stack.pop();
1.9530 + count = +stack.pop();
1.9531 + validateArgsCount(count, stack.length);
1.9532 + var interfaces = [];
1.9533 + for (i = 0; i < count; i++) {
1.9534 + interfaces.push(stack.pop());
1.9535 + }
1.9536 + constr.$interfaces = interfaces;
1.9537 + break;
1.9538 + case 143:
1.9539 + flags = stream.readUI8();
1.9540 + var catchIsRegisterFlag = !(!(flags & 4));
1.9541 + var finallyBlockFlag = !(!(flags & 2));
1.9542 + var catchBlockFlag = !(!(flags & 1));
1.9543 + var trySize = stream.readUI16();
1.9544 + var catchSize = stream.readUI16();
1.9545 + var finallySize = stream.readUI16();
1.9546 + var catchTarget = catchIsRegisterFlag ? stream.readUI8() : stream.readString();
1.9547 + nextPosition += trySize + catchSize + finallySize;
1.9548 + processTry(catchIsRegisterFlag, finallyBlockFlag, catchBlockFlag, catchTarget, stream.readBytes(trySize), stream.readBytes(catchSize), stream.readBytes(finallySize));
1.9549 + break;
1.9550 + case 42:
1.9551 + obj = stack.pop();
1.9552 + throw new AS2Error(obj);
1.9553 + case 45:
1.9554 + args = readArgs(stack);
1.9555 + stackItemsExpected++;
1.9556 + result = _global.fscommand.apply(null, args);
1.9557 + stack.push(result);
1.9558 + break;
1.9559 + case 137:
1.9560 + var mode = stream.readUI8();
1.9561 + break;
1.9562 + case 0:
1.9563 + return;
1.9564 + default:
1.9565 + throw new Error('Unknown action code: ' + actionCode);
1.9566 + }
1.9567 + stream.position = nextPosition;
1.9568 + recoveringFromError = false;
1.9569 + }
1.9570 + } catch (e) {
1.9571 + if (!AVM1_ERRORS_IGNORED && !currentContext.isTryCatchListening || e instanceof AS2CriticalError) {
1.9572 + throw e;
1.9573 + }
1.9574 + if (e instanceof AS2Error) {
1.9575 + throw e;
1.9576 + }
1.9577 + var AVM1_ERROR_TYPE = 1;
1.9578 + TelemetryService.reportTelemetry({
1.9579 + topic: 'error',
1.9580 + error: AVM1_ERROR_TYPE
1.9581 + });
1.9582 + stream.position = nextPosition;
1.9583 + if (stackItemsExpected > 0) {
1.9584 + while (stackItemsExpected--) {
1.9585 + stack.push(undefined);
1.9586 + }
1.9587 + }
1.9588 + if (!recoveringFromError) {
1.9589 + if (currentContext.errorsIgnored++ >= MAX_AVM1_ERRORS_LIMIT) {
1.9590 + throw new AS2CriticalError('long running script -- AVM1 errors limit is reached');
1.9591 + }
1.9592 + console.error('AVM1 error: ' + e);
1.9593 + avm2.exceptions.push({
1.9594 + source: 'avm1',
1.9595 + message: e.message,
1.9596 + stack: e.stack
1.9597 + });
1.9598 + recoveringFromError = true;
1.9599 + }
1.9600 + }
1.9601 + }
1.9602 +}
1.9603 +var ActionTracerFactory = function () {
1.9604 + var indentation = 0;
1.9605 + var tracer = {
1.9606 + print: function (position, actionCode, stack) {
1.9607 + var stackDump = [];
1.9608 + for (var q = 0; q < stack.length; q++) {
1.9609 + var item = stack[q];
1.9610 + stackDump.push(item && typeof item === 'object' ? '[' + (item.constructor && item.constructor.name ? item.constructor.name : 'Object') + ']' : item);
1.9611 + }
1.9612 + var indent = new Array(indentation + 1).join('..');
1.9613 + console.log('AVM1 trace: ' + indent + position + ': ' + ActionNamesMap[actionCode] + '(' + actionCode.toString(16) + '), ' + 'stack=' + stackDump);
1.9614 + },
1.9615 + indent: function () {
1.9616 + indentation++;
1.9617 + },
1.9618 + unindent: function () {
1.9619 + indentation--;
1.9620 + },
1.9621 + message: function (str) {
1.9622 + console.log('AVM1 trace: ------- ' + str);
1.9623 + }
1.9624 + };
1.9625 + var nullTracer = {
1.9626 + print: function () {
1.9627 + },
1.9628 + indent: function () {
1.9629 + },
1.9630 + unindent: function () {
1.9631 + },
1.9632 + message: function () {
1.9633 + }
1.9634 + };
1.9635 + function ActionTracerFactory() {
1.9636 + }
1.9637 + ActionTracerFactory.get = function () {
1.9638 + return AVM1_TRACE_ENABLED ? tracer : nullTracer;
1.9639 + };
1.9640 + return ActionTracerFactory;
1.9641 + }();
1.9642 +var ActionNamesMap = {
1.9643 + 0: 'EOA',
1.9644 + 4: 'ActionNextFrame',
1.9645 + 5: 'ActionPreviousFrame',
1.9646 + 6: 'ActionPlay',
1.9647 + 7: 'ActionStop',
1.9648 + 8: 'ActionToggleQuality',
1.9649 + 9: 'ActionStopSounds',
1.9650 + 10: 'ActionAdd',
1.9651 + 11: 'ActionSubtract',
1.9652 + 12: 'ActionMultiply',
1.9653 + 13: 'ActionDivide',
1.9654 + 14: 'ActionEquals',
1.9655 + 15: 'ActionLess',
1.9656 + 16: 'ActionAnd',
1.9657 + 17: 'ActionOr',
1.9658 + 18: 'ActionNot',
1.9659 + 19: 'ActionStringEquals',
1.9660 + 20: 'ActionStringLength',
1.9661 + 21: 'ActionStringExtract',
1.9662 + 23: 'ActionPop',
1.9663 + 24: 'ActionToInteger',
1.9664 + 28: 'ActionGetVariable',
1.9665 + 29: 'ActionSetVariable',
1.9666 + 32: 'ActionSetTarget2',
1.9667 + 33: 'ActionStringAdd',
1.9668 + 34: 'ActionGetProperty',
1.9669 + 35: 'ActionSetProperty',
1.9670 + 36: 'ActionCloneSprite',
1.9671 + 37: 'ActionRemoveSprite',
1.9672 + 38: 'ActionTrace',
1.9673 + 39: 'ActionStartDrag',
1.9674 + 40: 'ActionEndDrag',
1.9675 + 41: 'ActionStringLess',
1.9676 + 42: 'ActionThrow',
1.9677 + 43: 'ActionCastOp',
1.9678 + 44: 'ActionImplementsOp',
1.9679 + 45: 'ActionFSCommand2',
1.9680 + 48: 'ActionRandomNumber',
1.9681 + 49: 'ActionMBStringLength',
1.9682 + 50: 'ActionCharToAscii',
1.9683 + 51: 'ActionAsciiToChar',
1.9684 + 52: 'ActionGetTime',
1.9685 + 53: 'ActionMBStringExtrac',
1.9686 + 54: 'ActionMBCharToAscii',
1.9687 + 55: 'ActionMBAsciiToChar',
1.9688 + 58: 'ActionDelete',
1.9689 + 59: 'ActionDelete2',
1.9690 + 60: 'ActionDefineLocal',
1.9691 + 61: 'ActionCallFunction',
1.9692 + 62: 'ActionReturn',
1.9693 + 63: 'ActionModulo',
1.9694 + 64: 'ActionNewObject',
1.9695 + 65: 'ActionDefineLocal2',
1.9696 + 66: 'ActionInitArray',
1.9697 + 67: 'ActionInitObject',
1.9698 + 68: 'ActionTypeOf',
1.9699 + 69: 'ActionTargetPath',
1.9700 + 70: 'ActionEnumerate',
1.9701 + 71: 'ActionAdd2',
1.9702 + 72: 'ActionLess2',
1.9703 + 73: 'ActionEquals2',
1.9704 + 74: 'ActionToNumber',
1.9705 + 75: 'ActionToString',
1.9706 + 76: 'ActionPushDuplicate',
1.9707 + 77: 'ActionStackSwap',
1.9708 + 78: 'ActionGetMember',
1.9709 + 79: 'ActionSetMember',
1.9710 + 80: 'ActionIncrement',
1.9711 + 81: 'ActionDecrement',
1.9712 + 82: 'ActionCallMethod',
1.9713 + 83: 'ActionNewMethod',
1.9714 + 84: 'ActionInstanceOf',
1.9715 + 85: 'ActionEnumerate2',
1.9716 + 96: 'ActionBitAnd',
1.9717 + 97: 'ActionBitOr',
1.9718 + 98: 'ActionBitXor',
1.9719 + 99: 'ActionBitLShift',
1.9720 + 100: 'ActionBitRShift',
1.9721 + 101: 'ActionBitURShift',
1.9722 + 102: 'ActionStrictEquals',
1.9723 + 103: 'ActionGreater',
1.9724 + 104: 'ActionStringGreater',
1.9725 + 105: 'ActionExtends',
1.9726 + 129: 'ActionGotoFrame',
1.9727 + 131: 'ActionGetURL',
1.9728 + 135: 'ActionStoreRegister',
1.9729 + 136: 'ActionConstantPool',
1.9730 + 137: 'ActionStrictMode',
1.9731 + 138: 'ActionWaitForFrame',
1.9732 + 139: 'ActionSetTarget',
1.9733 + 140: 'ActionGoToLabel',
1.9734 + 141: 'ActionWaitForFrame2',
1.9735 + 142: 'ActionDefineFunction',
1.9736 + 143: 'ActionTry',
1.9737 + 148: 'ActionWith',
1.9738 + 150: 'ActionPush',
1.9739 + 153: 'ActionJump',
1.9740 + 154: 'ActionGetURL2',
1.9741 + 155: 'ActionDefineFunction',
1.9742 + 157: 'ActionIf',
1.9743 + 158: 'ActionCall',
1.9744 + 159: 'ActionGotoFrame2'
1.9745 + };
1.9746 +if (typeof GLOBAL !== 'undefined') {
1.9747 + GLOBAL.createBuiltinType = createBuiltinType;
1.9748 + GLOBAL.executeActions = executeActions;
1.9749 + GLOBAL.AS2Context = AS2Context;
1.9750 +}
1.9751 +var jsGlobal = function () {
1.9752 + return this || (1, eval)('this');
1.9753 + }();
1.9754 +var inBrowser = typeof console != 'undefined';
1.9755 +var release = true;
1.9756 +var debug = !true;
1.9757 +if (!jsGlobal.performance) {
1.9758 + jsGlobal.performance = {};
1.9759 +}
1.9760 +if (!jsGlobal.performance.now) {
1.9761 + jsGlobal.performance.now = dateNow;
1.9762 +}
1.9763 +function log(message) {
1.9764 + var optionalParams = [];
1.9765 + for (var _i = 0; _i < arguments.length - 1; _i++) {
1.9766 + optionalParams[_i] = arguments[_i + 1];
1.9767 + }
1.9768 + jsGlobal.print(message);
1.9769 +}
1.9770 +function warn(message) {
1.9771 + var optionalParams = [];
1.9772 + for (var _i = 0; _i < arguments.length - 1; _i++) {
1.9773 + optionalParams[_i] = arguments[_i + 1];
1.9774 + }
1.9775 + if (inBrowser) {
1.9776 + console.warn(message);
1.9777 + } else {
1.9778 + jsGlobal.print(message);
1.9779 + }
1.9780 +}
1.9781 +var Shumway;
1.9782 +(function (Shumway) {
1.9783 + (function (CharacterCodes) {
1.9784 + CharacterCodes[CharacterCodes['_0'] = 48] = '_0';
1.9785 + CharacterCodes[CharacterCodes['_1'] = 49] = '_1';
1.9786 + CharacterCodes[CharacterCodes['_2'] = 50] = '_2';
1.9787 + CharacterCodes[CharacterCodes['_3'] = 51] = '_3';
1.9788 + CharacterCodes[CharacterCodes['_4'] = 52] = '_4';
1.9789 + CharacterCodes[CharacterCodes['_5'] = 53] = '_5';
1.9790 + CharacterCodes[CharacterCodes['_6'] = 54] = '_6';
1.9791 + CharacterCodes[CharacterCodes['_7'] = 55] = '_7';
1.9792 + CharacterCodes[CharacterCodes['_8'] = 56] = '_8';
1.9793 + CharacterCodes[CharacterCodes['_9'] = 57] = '_9';
1.9794 + }(Shumway.CharacterCodes || (Shumway.CharacterCodes = {})));
1.9795 + var CharacterCodes = Shumway.CharacterCodes;
1.9796 + Shumway.UINT32_CHAR_BUFFER_LENGTH = 10;
1.9797 + Shumway.UINT32_MAX = 4294967295;
1.9798 + Shumway.UINT32_MAX_DIV_10 = 429496729;
1.9799 + Shumway.UINT32_MAX_MOD_10 = 5;
1.9800 + function isString(value) {
1.9801 + return typeof value === 'string';
1.9802 + }
1.9803 + Shumway.isString = isString;
1.9804 + function isFunction(value) {
1.9805 + return typeof value === 'function';
1.9806 + }
1.9807 + Shumway.isFunction = isFunction;
1.9808 + function isNumber(value) {
1.9809 + return typeof value === 'number';
1.9810 + }
1.9811 + Shumway.isNumber = isNumber;
1.9812 + function isNumberOrString(value) {
1.9813 + return typeof value === 'number' || typeof value === 'string';
1.9814 + }
1.9815 + Shumway.isNumberOrString = isNumberOrString;
1.9816 + function isObject(value) {
1.9817 + return typeof value === 'object' || typeof value === 'function';
1.9818 + }
1.9819 + Shumway.isObject = isObject;
1.9820 + function toNumber(x) {
1.9821 + return +x;
1.9822 + }
1.9823 + Shumway.toNumber = toNumber;
1.9824 + function isNumericString(value) {
1.9825 + return String(Number(value)) === value;
1.9826 + }
1.9827 + Shumway.isNumericString = isNumericString;
1.9828 + function isNumeric(value) {
1.9829 + if (typeof value === 'number') {
1.9830 + return true;
1.9831 + } else if (typeof value === 'string') {
1.9832 + return isIndex(value) || isNumericString(value);
1.9833 + } else {
1.9834 + Debug.notImplemented(typeof value);
1.9835 + }
1.9836 + }
1.9837 + Shumway.isNumeric = isNumeric;
1.9838 + function isIndex(value) {
1.9839 + var index = 0;
1.9840 + if (typeof value === 'number') {
1.9841 + index = value | 0;
1.9842 + if (value === index && index >= 0) {
1.9843 + return true;
1.9844 + }
1.9845 + return value >>> 0 === value;
1.9846 + }
1.9847 + if (typeof value !== 'string') {
1.9848 + return false;
1.9849 + }
1.9850 + var length = value.length;
1.9851 + if (length === 0) {
1.9852 + return false;
1.9853 + }
1.9854 + if (value === '0') {
1.9855 + return true;
1.9856 + }
1.9857 + if (length > Shumway.UINT32_CHAR_BUFFER_LENGTH) {
1.9858 + return false;
1.9859 + }
1.9860 + var i = 0;
1.9861 + index = value.charCodeAt(i++) - 48;
1.9862 + if (index < 1 || index > 9) {
1.9863 + return false;
1.9864 + }
1.9865 + var oldIndex = 0;
1.9866 + var c = 0;
1.9867 + while (i < length) {
1.9868 + c = value.charCodeAt(i++) - 48;
1.9869 + if (c < 0 || c > 9) {
1.9870 + return false;
1.9871 + }
1.9872 + oldIndex = index;
1.9873 + index = 10 * index + c;
1.9874 + }
1.9875 + if (oldIndex < Shumway.UINT32_MAX_DIV_10 || oldIndex === Shumway.UINT32_MAX_DIV_10 && c <= Shumway.UINT32_MAX_MOD_10) {
1.9876 + return true;
1.9877 + }
1.9878 + return false;
1.9879 + }
1.9880 + Shumway.isIndex = isIndex;
1.9881 + function isNullOrUndefined(value) {
1.9882 + return value == undefined;
1.9883 + }
1.9884 + Shumway.isNullOrUndefined = isNullOrUndefined;
1.9885 + (function (Debug) {
1.9886 + function backtrace() {
1.9887 + try {
1.9888 + throw new Error();
1.9889 + } catch (e) {
1.9890 + return e.stack ? e.stack.split('\n').slice(2).join('\n') : '';
1.9891 + }
1.9892 + }
1.9893 + Debug.backtrace = backtrace;
1.9894 + function error(message) {
1.9895 + if (!inBrowser) {
1.9896 + warn(Debug.backtrace());
1.9897 + }
1.9898 + throw new Error(message);
1.9899 + }
1.9900 + Debug.error = error;
1.9901 + function assert(condition) {
1.9902 + var args = [];
1.9903 + for (var _i = 0; _i < arguments.length - 1; _i++) {
1.9904 + args[_i] = arguments[_i + 1];
1.9905 + }
1.9906 + if (condition === '') {
1.9907 + condition = true;
1.9908 + }
1.9909 + if (!condition) {
1.9910 + var message = Array.prototype.slice.call(arguments);
1.9911 + message.shift();
1.9912 + Debug.error(message.join(''));
1.9913 + }
1.9914 + }
1.9915 + Debug.assert = assert;
1.9916 + function assertNotImplemented(condition, message) {
1.9917 + if (!condition) {
1.9918 + Debug.error('NotImplemented: ' + message);
1.9919 + }
1.9920 + }
1.9921 + Debug.assertNotImplemented = assertNotImplemented;
1.9922 + function warning(message) {
1.9923 + true;
1.9924 + }
1.9925 + Debug.warning = warning;
1.9926 + function notUsed(message) {
1.9927 + true;
1.9928 + }
1.9929 + Debug.notUsed = notUsed;
1.9930 + function notImplemented(message) {
1.9931 + true;
1.9932 + }
1.9933 + Debug.notImplemented = notImplemented;
1.9934 + function somewhatImplemented(message) {
1.9935 + Debug.warning('somewhatImplemented: ' + message);
1.9936 + }
1.9937 + Debug.somewhatImplemented = somewhatImplemented;
1.9938 + function unexpected(message) {
1.9939 + Debug.assert(false, 'Unexpected: ' + message);
1.9940 + }
1.9941 + Debug.unexpected = unexpected;
1.9942 + }(Shumway.Debug || (Shumway.Debug = {})));
1.9943 + var Debug = Shumway.Debug;
1.9944 + function getTicks() {
1.9945 + return performance.now();
1.9946 + }
1.9947 + Shumway.getTicks = getTicks;
1.9948 + (function (ArrayUtilities) {
1.9949 + function popManyInto(src, count, dst) {
1.9950 + true;
1.9951 + for (var i = count - 1; i >= 0; i--) {
1.9952 + dst[i] = src.pop();
1.9953 + }
1.9954 + dst.length = count;
1.9955 + }
1.9956 + ArrayUtilities.popManyInto = popManyInto;
1.9957 + }(Shumway.ArrayUtilities || (Shumway.ArrayUtilities = {})));
1.9958 + var ArrayUtilities = Shumway.ArrayUtilities;
1.9959 + (function (ObjectUtilities) {
1.9960 + function boxValue(value) {
1.9961 + if (Shumway.isNullOrUndefined(value) || Shumway.isObject(value)) {
1.9962 + return value;
1.9963 + }
1.9964 + return Object(value);
1.9965 + }
1.9966 + ObjectUtilities.boxValue = boxValue;
1.9967 + function toKeyValueArray(object) {
1.9968 + var hasOwnProperty = Object.prototype.hasOwnProperty;
1.9969 + var array = [];
1.9970 + for (var k in object) {
1.9971 + if (hasOwnProperty.call(object, k)) {
1.9972 + array.push([
1.9973 + k,
1.9974 + object[k]
1.9975 + ]);
1.9976 + }
1.9977 + }
1.9978 + return array;
1.9979 + }
1.9980 + ObjectUtilities.toKeyValueArray = toKeyValueArray;
1.9981 + function hasOwnProperty(object, name) {
1.9982 + return Object.prototype.hasOwnProperty.call(object, name);
1.9983 + }
1.9984 + ObjectUtilities.hasOwnProperty = hasOwnProperty;
1.9985 + function createEmptyObject() {
1.9986 + return Object.create(null);
1.9987 + }
1.9988 + ObjectUtilities.createEmptyObject = createEmptyObject;
1.9989 + function createMap() {
1.9990 + return Object.create(null);
1.9991 + }
1.9992 + ObjectUtilities.createMap = createMap;
1.9993 + function createArrayMap() {
1.9994 + return [];
1.9995 + }
1.9996 + ObjectUtilities.createArrayMap = createArrayMap;
1.9997 + function defineReadOnlyProperty(object, name, value) {
1.9998 + Object.defineProperty(object, name, {
1.9999 + value: value,
1.10000 + writable: false,
1.10001 + configurable: true,
1.10002 + enumerable: false
1.10003 + });
1.10004 + }
1.10005 + ObjectUtilities.defineReadOnlyProperty = defineReadOnlyProperty;
1.10006 + function getOwnPropertyDescriptors(object) {
1.10007 + var o = ObjectUtilities.createMap();
1.10008 + var properties = Object.getOwnPropertyNames(object);
1.10009 + for (var i = 0; i < properties.length; i++) {
1.10010 + o[properties[i]] = Object.getOwnPropertyDescriptor(object, properties[i]);
1.10011 + }
1.10012 + return o;
1.10013 + }
1.10014 + ObjectUtilities.getOwnPropertyDescriptors = getOwnPropertyDescriptors;
1.10015 + function cloneObject(object) {
1.10016 + var clone = ObjectUtilities.createEmptyObject();
1.10017 + for (var property in object) {
1.10018 + clone[property] = object[property];
1.10019 + }
1.10020 + return clone;
1.10021 + }
1.10022 + ObjectUtilities.cloneObject = cloneObject;
1.10023 + function copyProperties(object, template) {
1.10024 + for (var property in template) {
1.10025 + object[property] = template[property];
1.10026 + }
1.10027 + }
1.10028 + ObjectUtilities.copyProperties = copyProperties;
1.10029 + function getLatestGetterOrSetterPropertyDescriptor(object, name) {
1.10030 + var descriptor = {};
1.10031 + while (object) {
1.10032 + var tmp = Object.getOwnPropertyDescriptor(object, name);
1.10033 + if (tmp) {
1.10034 + descriptor.get = descriptor.get || tmp.get;
1.10035 + descriptor.set = descriptor.set || tmp.set;
1.10036 + }
1.10037 + if (descriptor.get && descriptor.set) {
1.10038 + break;
1.10039 + }
1.10040 + object = Object.getPrototypeOf(object);
1.10041 + }
1.10042 + return descriptor;
1.10043 + }
1.10044 + ObjectUtilities.getLatestGetterOrSetterPropertyDescriptor = getLatestGetterOrSetterPropertyDescriptor;
1.10045 + function defineNonEnumerableGetterOrSetter(obj, name, value, isGetter) {
1.10046 + var descriptor = ObjectUtilities.getLatestGetterOrSetterPropertyDescriptor(obj, name);
1.10047 + descriptor.configurable = true;
1.10048 + descriptor.enumerable = false;
1.10049 + if (isGetter) {
1.10050 + descriptor.get = value;
1.10051 + } else {
1.10052 + descriptor.set = value;
1.10053 + }
1.10054 + Object.defineProperty(obj, name, descriptor);
1.10055 + }
1.10056 + ObjectUtilities.defineNonEnumerableGetterOrSetter = defineNonEnumerableGetterOrSetter;
1.10057 + function defineNonEnumerableGetter(obj, name, getter) {
1.10058 + Object.defineProperty(obj, name, {
1.10059 + get: getter,
1.10060 + configurable: true,
1.10061 + enumerable: false
1.10062 + });
1.10063 + }
1.10064 + ObjectUtilities.defineNonEnumerableGetter = defineNonEnumerableGetter;
1.10065 + function defineNonEnumerableSetter(obj, name, setter) {
1.10066 + Object.defineProperty(obj, name, {
1.10067 + set: setter,
1.10068 + configurable: true,
1.10069 + enumerable: false
1.10070 + });
1.10071 + }
1.10072 + ObjectUtilities.defineNonEnumerableSetter = defineNonEnumerableSetter;
1.10073 + function defineNonEnumerableProperty(obj, name, value) {
1.10074 + Object.defineProperty(obj, name, {
1.10075 + value: value,
1.10076 + writable: true,
1.10077 + configurable: true,
1.10078 + enumerable: false
1.10079 + });
1.10080 + }
1.10081 + ObjectUtilities.defineNonEnumerableProperty = defineNonEnumerableProperty;
1.10082 + function defineNonEnumerableForwardingProperty(obj, name, otherName) {
1.10083 + Object.defineProperty(obj, name, {
1.10084 + get: FunctionUtilities.makeForwardingGetter(otherName),
1.10085 + set: FunctionUtilities.makeForwardingSetter(otherName),
1.10086 + writable: true,
1.10087 + configurable: true,
1.10088 + enumerable: false
1.10089 + });
1.10090 + }
1.10091 + ObjectUtilities.defineNonEnumerableForwardingProperty = defineNonEnumerableForwardingProperty;
1.10092 + function defineNewNonEnumerableProperty(obj, name, value) {
1.10093 + true;
1.10094 + ObjectUtilities.defineNonEnumerableProperty(obj, name, value);
1.10095 + }
1.10096 + ObjectUtilities.defineNewNonEnumerableProperty = defineNewNonEnumerableProperty;
1.10097 + }(Shumway.ObjectUtilities || (Shumway.ObjectUtilities = {})));
1.10098 + var ObjectUtilities = Shumway.ObjectUtilities;
1.10099 + (function (FunctionUtilities) {
1.10100 + function makeForwardingGetter(target) {
1.10101 + return new Function('return this["' + target + '"]');
1.10102 + }
1.10103 + FunctionUtilities.makeForwardingGetter = makeForwardingGetter;
1.10104 + function makeForwardingSetter(target) {
1.10105 + return new Function('value', 'this["' + target + '"] = value;');
1.10106 + }
1.10107 + FunctionUtilities.makeForwardingSetter = makeForwardingSetter;
1.10108 + function bindSafely(fn, object) {
1.10109 + true;
1.10110 + var f = fn.bind(object);
1.10111 + f.boundTo = object;
1.10112 + return f;
1.10113 + }
1.10114 + FunctionUtilities.bindSafely = bindSafely;
1.10115 + }(Shumway.FunctionUtilities || (Shumway.FunctionUtilities = {})));
1.10116 + var FunctionUtilities = Shumway.FunctionUtilities;
1.10117 + (function (StringUtilities) {
1.10118 + function toSafeString(value) {
1.10119 + if (typeof value === 'string') {
1.10120 + return '"' + value + '"';
1.10121 + }
1.10122 + if (typeof value === 'number' || typeof value === 'boolean') {
1.10123 + return String(value);
1.10124 + }
1.10125 + return typeof value;
1.10126 + }
1.10127 + StringUtilities.toSafeString = toSafeString;
1.10128 + function toSafeArrayString(array) {
1.10129 + var str = [];
1.10130 + for (var i = 0; i < array.length; i++) {
1.10131 + str.push(toSafeString(array[i]));
1.10132 + }
1.10133 + return str.join(', ');
1.10134 + }
1.10135 + StringUtilities.toSafeArrayString = toSafeArrayString;
1.10136 + function utf8decode(str) {
1.10137 + var bytes = new Uint8Array(str.length * 4);
1.10138 + var b = 0;
1.10139 + for (var i = 0, j = str.length; i < j; i++) {
1.10140 + var code = str.charCodeAt(i);
1.10141 + if (code <= 127) {
1.10142 + bytes[b++] = code;
1.10143 + continue;
1.10144 + }
1.10145 + if (55296 <= code && code <= 56319) {
1.10146 + var codeLow = str.charCodeAt(i + 1);
1.10147 + if (56320 <= codeLow && codeLow <= 57343) {
1.10148 + code = ((code & 1023) << 10) + (codeLow & 1023) + 65536;
1.10149 + ++i;
1.10150 + }
1.10151 + }
1.10152 + if ((code & 4292870144) !== 0) {
1.10153 + bytes[b++] = 248 | code >>> 24 & 3;
1.10154 + bytes[b++] = 128 | code >>> 18 & 63;
1.10155 + bytes[b++] = 128 | code >>> 12 & 63;
1.10156 + bytes[b++] = 128 | code >>> 6 & 63;
1.10157 + bytes[b++] = 128 | code & 63;
1.10158 + } else if ((code & 4294901760) !== 0) {
1.10159 + bytes[b++] = 240 | code >>> 18 & 7;
1.10160 + bytes[b++] = 128 | code >>> 12 & 63;
1.10161 + bytes[b++] = 128 | code >>> 6 & 63;
1.10162 + bytes[b++] = 128 | code & 63;
1.10163 + } else if ((code & 4294965248) !== 0) {
1.10164 + bytes[b++] = 224 | code >>> 12 & 15;
1.10165 + bytes[b++] = 128 | code >>> 6 & 63;
1.10166 + bytes[b++] = 128 | code & 63;
1.10167 + } else {
1.10168 + bytes[b++] = 192 | code >>> 6 & 31;
1.10169 + bytes[b++] = 128 | code & 63;
1.10170 + }
1.10171 + }
1.10172 + return bytes.subarray(0, b);
1.10173 + }
1.10174 + StringUtilities.utf8decode = utf8decode;
1.10175 + function utf8encode(bytes) {
1.10176 + var j = 0, str = '';
1.10177 + while (j < bytes.length) {
1.10178 + var b1 = bytes[j++] & 255;
1.10179 + if (b1 <= 127) {
1.10180 + str += String.fromCharCode(b1);
1.10181 + } else {
1.10182 + var currentPrefix = 192;
1.10183 + var validBits = 5;
1.10184 + do {
1.10185 + var mask = currentPrefix >> 1 | 128;
1.10186 + if ((b1 & mask) === currentPrefix)
1.10187 + break;
1.10188 + currentPrefix = currentPrefix >> 1 | 128;
1.10189 + --validBits;
1.10190 + } while (validBits >= 0);
1.10191 + if (validBits <= 0) {
1.10192 + str += String.fromCharCode(b1);
1.10193 + continue;
1.10194 + }
1.10195 + var code = b1 & (1 << validBits) - 1;
1.10196 + var invalid = false;
1.10197 + for (var i = 5; i >= validBits; --i) {
1.10198 + var bi = bytes[j++];
1.10199 + if ((bi & 192) != 128) {
1.10200 + invalid = true;
1.10201 + break;
1.10202 + }
1.10203 + code = code << 6 | bi & 63;
1.10204 + }
1.10205 + if (invalid) {
1.10206 + for (var k = j - (7 - i); k < j; ++k) {
1.10207 + str += String.fromCharCode(bytes[k] & 255);
1.10208 + }
1.10209 + continue;
1.10210 + }
1.10211 + if (code >= 65536) {
1.10212 + str += String.fromCharCode(code - 65536 >> 10 & 1023 | 55296, code & 1023 | 56320);
1.10213 + } else {
1.10214 + str += String.fromCharCode(code);
1.10215 + }
1.10216 + }
1.10217 + }
1.10218 + return str;
1.10219 + }
1.10220 + StringUtilities.utf8encode = utf8encode;
1.10221 + function base64ArrayBuffer(arrayBuffer) {
1.10222 + var base64 = '';
1.10223 + var encodings = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/';
1.10224 + var bytes = new Uint8Array(arrayBuffer);
1.10225 + var byteLength = bytes.byteLength;
1.10226 + var byteRemainder = byteLength % 3;
1.10227 + var mainLength = byteLength - byteRemainder;
1.10228 + var a, b, c, d;
1.10229 + var chunk;
1.10230 + for (var i = 0; i < mainLength; i = i + 3) {
1.10231 + chunk = bytes[i] << 16 | bytes[i + 1] << 8 | bytes[i + 2];
1.10232 + a = (chunk & 16515072) >> 18;
1.10233 + b = (chunk & 258048) >> 12;
1.10234 + c = (chunk & 4032) >> 6;
1.10235 + d = chunk & 63;
1.10236 + base64 += encodings[a] + encodings[b] + encodings[c] + encodings[d];
1.10237 + }
1.10238 + if (byteRemainder == 1) {
1.10239 + chunk = bytes[mainLength];
1.10240 + a = (chunk & 252) >> 2;
1.10241 + b = (chunk & 3) << 4;
1.10242 + base64 += encodings[a] + encodings[b] + '==';
1.10243 + } else if (byteRemainder == 2) {
1.10244 + chunk = bytes[mainLength] << 8 | bytes[mainLength + 1];
1.10245 + a = (chunk & 64512) >> 10;
1.10246 + b = (chunk & 1008) >> 4;
1.10247 + c = (chunk & 15) << 2;
1.10248 + base64 += encodings[a] + encodings[b] + encodings[c] + '=';
1.10249 + }
1.10250 + return base64;
1.10251 + }
1.10252 + StringUtilities.base64ArrayBuffer = base64ArrayBuffer;
1.10253 + function escapeString(str) {
1.10254 + if (str !== undefined) {
1.10255 + str = str.replace(/[^\w$]/gi, '$');
1.10256 + if (/^\d/.test(str)) {
1.10257 + str = '$' + str;
1.10258 + }
1.10259 + }
1.10260 + return str;
1.10261 + }
1.10262 + StringUtilities.escapeString = escapeString;
1.10263 + function fromCharCodeArray(buffer) {
1.10264 + var str = '', SLICE = 1024 * 16;
1.10265 + for (var i = 0; i < buffer.length; i += SLICE) {
1.10266 + var chunk = Math.min(buffer.length - i, SLICE);
1.10267 + str += String.fromCharCode.apply(null, buffer.subarray(i, i + chunk));
1.10268 + }
1.10269 + return str;
1.10270 + }
1.10271 + StringUtilities.fromCharCodeArray = fromCharCodeArray;
1.10272 + var _encoding = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789$_';
1.10273 + function variableLengthEncodeInt32(n) {
1.10274 + var e = _encoding;
1.10275 + var bitCount = 32 - IntegerUtilities.leadingZeros(n);
1.10276 + var l = Math.ceil(bitCount / 6);
1.10277 + var s = e[l];
1.10278 + for (var i = l - 1; i >= 0; i--) {
1.10279 + var offset = i * 6;
1.10280 + s += e[n >> offset & 63];
1.10281 + }
1.10282 + true;
1.10283 + return s;
1.10284 + }
1.10285 + StringUtilities.variableLengthEncodeInt32 = variableLengthEncodeInt32;
1.10286 + function toEncoding(n) {
1.10287 + return _encoding[n];
1.10288 + }
1.10289 + StringUtilities.toEncoding = toEncoding;
1.10290 + function fromEncoding(s) {
1.10291 + var c = s.charCodeAt(0);
1.10292 + var e = 0;
1.10293 + if (c >= 65 && c <= 90) {
1.10294 + return c - 65;
1.10295 + } else if (c >= 97 && c <= 122) {
1.10296 + return c - 71;
1.10297 + } else if (c >= 48 && c <= 57) {
1.10298 + return c + 4;
1.10299 + } else if (c === 36) {
1.10300 + return 62;
1.10301 + } else if (c === 95) {
1.10302 + return 63;
1.10303 + }
1.10304 + }
1.10305 + StringUtilities.fromEncoding = fromEncoding;
1.10306 + function variableLengthDecodeInt32(s) {
1.10307 + var l = StringUtilities.fromEncoding(s[0]);
1.10308 + var n = 0;
1.10309 + for (var i = 0; i < l; i++) {
1.10310 + var offset = (l - i - 1) * 6;
1.10311 + n |= StringUtilities.fromEncoding(s[1 + i]) << offset;
1.10312 + }
1.10313 + return n;
1.10314 + }
1.10315 + StringUtilities.variableLengthDecodeInt32 = variableLengthDecodeInt32;
1.10316 + }(Shumway.StringUtilities || (Shumway.StringUtilities = {})));
1.10317 + var StringUtilities = Shumway.StringUtilities;
1.10318 + (function (HashUtilities) {
1.10319 + var _md5R = new Uint8Array([
1.10320 + 7,
1.10321 + 12,
1.10322 + 17,
1.10323 + 22,
1.10324 + 7,
1.10325 + 12,
1.10326 + 17,
1.10327 + 22,
1.10328 + 7,
1.10329 + 12,
1.10330 + 17,
1.10331 + 22,
1.10332 + 7,
1.10333 + 12,
1.10334 + 17,
1.10335 + 22,
1.10336 + 5,
1.10337 + 9,
1.10338 + 14,
1.10339 + 20,
1.10340 + 5,
1.10341 + 9,
1.10342 + 14,
1.10343 + 20,
1.10344 + 5,
1.10345 + 9,
1.10346 + 14,
1.10347 + 20,
1.10348 + 5,
1.10349 + 9,
1.10350 + 14,
1.10351 + 20,
1.10352 + 4,
1.10353 + 11,
1.10354 + 16,
1.10355 + 23,
1.10356 + 4,
1.10357 + 11,
1.10358 + 16,
1.10359 + 23,
1.10360 + 4,
1.10361 + 11,
1.10362 + 16,
1.10363 + 23,
1.10364 + 4,
1.10365 + 11,
1.10366 + 16,
1.10367 + 23,
1.10368 + 6,
1.10369 + 10,
1.10370 + 15,
1.10371 + 21,
1.10372 + 6,
1.10373 + 10,
1.10374 + 15,
1.10375 + 21,
1.10376 + 6,
1.10377 + 10,
1.10378 + 15,
1.10379 + 21,
1.10380 + 6,
1.10381 + 10,
1.10382 + 15,
1.10383 + 21
1.10384 + ]);
1.10385 + var _md5K = new Int32Array([
1.10386 + -680876936,
1.10387 + -389564586,
1.10388 + 606105819,
1.10389 + -1044525330,
1.10390 + -176418897,
1.10391 + 1200080426,
1.10392 + -1473231341,
1.10393 + -45705983,
1.10394 + 1770035416,
1.10395 + -1958414417,
1.10396 + -42063,
1.10397 + -1990404162,
1.10398 + 1804603682,
1.10399 + -40341101,
1.10400 + -1502002290,
1.10401 + 1236535329,
1.10402 + -165796510,
1.10403 + -1069501632,
1.10404 + 643717713,
1.10405 + -373897302,
1.10406 + -701558691,
1.10407 + 38016083,
1.10408 + -660478335,
1.10409 + -405537848,
1.10410 + 568446438,
1.10411 + -1019803690,
1.10412 + -187363961,
1.10413 + 1163531501,
1.10414 + -1444681467,
1.10415 + -51403784,
1.10416 + 1735328473,
1.10417 + -1926607734,
1.10418 + -378558,
1.10419 + -2022574463,
1.10420 + 1839030562,
1.10421 + -35309556,
1.10422 + -1530992060,
1.10423 + 1272893353,
1.10424 + -155497632,
1.10425 + -1094730640,
1.10426 + 681279174,
1.10427 + -358537222,
1.10428 + -722521979,
1.10429 + 76029189,
1.10430 + -640364487,
1.10431 + -421815835,
1.10432 + 530742520,
1.10433 + -995338651,
1.10434 + -198630844,
1.10435 + 1126891415,
1.10436 + -1416354905,
1.10437 + -57434055,
1.10438 + 1700485571,
1.10439 + -1894986606,
1.10440 + -1051523,
1.10441 + -2054922799,
1.10442 + 1873313359,
1.10443 + -30611744,
1.10444 + -1560198380,
1.10445 + 1309151649,
1.10446 + -145523070,
1.10447 + -1120210379,
1.10448 + 718787259,
1.10449 + -343485551
1.10450 + ]);
1.10451 + function hashBytesTo32BitsMD5(data, offset, length) {
1.10452 + var r = _md5R;
1.10453 + var k = _md5K;
1.10454 + var h0 = 1732584193, h1 = -271733879, h2 = -1732584194, h3 = 271733878;
1.10455 + var paddedLength = length + 72 & ~63;
1.10456 + var padded = new Uint8Array(paddedLength);
1.10457 + var i, j, n;
1.10458 + for (i = 0; i < length; ++i) {
1.10459 + padded[i] = data[offset++];
1.10460 + }
1.10461 + padded[i++] = 128;
1.10462 + n = paddedLength - 8;
1.10463 + while (i < n) {
1.10464 + padded[i++] = 0;
1.10465 + }
1.10466 + padded[i++] = length << 3 & 255;
1.10467 + padded[i++] = length >> 5 & 255;
1.10468 + padded[i++] = length >> 13 & 255;
1.10469 + padded[i++] = length >> 21 & 255;
1.10470 + padded[i++] = length >>> 29 & 255;
1.10471 + padded[i++] = 0;
1.10472 + padded[i++] = 0;
1.10473 + padded[i++] = 0;
1.10474 + var w = new Int32Array(16);
1.10475 + for (i = 0; i < paddedLength;) {
1.10476 + for (j = 0; j < 16; ++j, i += 4) {
1.10477 + w[j] = padded[i] | padded[i + 1] << 8 | padded[i + 2] << 16 | padded[i + 3] << 24;
1.10478 + }
1.10479 + var a = h0, b = h1, c = h2, d = h3, f, g;
1.10480 + for (j = 0; j < 64; ++j) {
1.10481 + if (j < 16) {
1.10482 + f = b & c | ~b & d;
1.10483 + g = j;
1.10484 + } else if (j < 32) {
1.10485 + f = d & b | ~d & c;
1.10486 + g = 5 * j + 1 & 15;
1.10487 + } else if (j < 48) {
1.10488 + f = b ^ c ^ d;
1.10489 + g = 3 * j + 5 & 15;
1.10490 + } else {
1.10491 + f = c ^ (b | ~d);
1.10492 + g = 7 * j & 15;
1.10493 + }
1.10494 + var tmp = d, rotateArg = a + f + k[j] + w[g] | 0, rotate = r[j];
1.10495 + d = c;
1.10496 + c = b;
1.10497 + b = b + (rotateArg << rotate | rotateArg >>> 32 - rotate) | 0;
1.10498 + a = tmp;
1.10499 + }
1.10500 + h0 = h0 + a | 0;
1.10501 + h1 = h1 + b | 0;
1.10502 + h2 = h2 + c | 0;
1.10503 + h3 = h3 + d | 0;
1.10504 + }
1.10505 + return h0;
1.10506 + }
1.10507 + HashUtilities.hashBytesTo32BitsMD5 = hashBytesTo32BitsMD5;
1.10508 + function hashBytesTo32BitsAdler(data, offset, length) {
1.10509 + var a = 1;
1.10510 + var b = 0;
1.10511 + var end = offset + length;
1.10512 + for (var i = offset; i < end; ++i) {
1.10513 + a = (a + (data[i] & 255)) % 65521;
1.10514 + b = (b + a) % 65521;
1.10515 + }
1.10516 + return b << 16 | a;
1.10517 + }
1.10518 + HashUtilities.hashBytesTo32BitsAdler = hashBytesTo32BitsAdler;
1.10519 + }(Shumway.HashUtilities || (Shumway.HashUtilities = {})));
1.10520 + var HashUtilities = Shumway.HashUtilities;
1.10521 + (function (IntegerUtilities) {
1.10522 + function bitCount(i) {
1.10523 + i = i - (i >> 1 & 1431655765);
1.10524 + i = (i & 858993459) + (i >> 2 & 858993459);
1.10525 + return (i + (i >> 4) & 252645135) * 16843009 >> 24;
1.10526 + }
1.10527 + IntegerUtilities.bitCount = bitCount;
1.10528 + function ones(i) {
1.10529 + i = i - (i >> 1 & 1431655765);
1.10530 + i = (i & 858993459) + (i >> 2 & 858993459);
1.10531 + return (i + (i >> 4) & 252645135) * 16843009 >> 24;
1.10532 + }
1.10533 + IntegerUtilities.ones = ones;
1.10534 + function leadingZeros(i) {
1.10535 + i |= i >> 1;
1.10536 + i |= i >> 2;
1.10537 + i |= i >> 4;
1.10538 + i |= i >> 8;
1.10539 + i |= i >> 16;
1.10540 + return 32 - IntegerUtilities.ones(i);
1.10541 + }
1.10542 + IntegerUtilities.leadingZeros = leadingZeros;
1.10543 + function trailingZeros(i) {
1.10544 + return IntegerUtilities.ones((i & -i) - 1);
1.10545 + }
1.10546 + IntegerUtilities.trailingZeros = trailingZeros;
1.10547 + function getFlags(i, flags) {
1.10548 + var str = '';
1.10549 + for (var i = 0; i < flags.length; i++) {
1.10550 + if (i & 1 << i) {
1.10551 + str += flags[i] + ' ';
1.10552 + }
1.10553 + }
1.10554 + if (str.length === 0) {
1.10555 + return '';
1.10556 + }
1.10557 + return str.trim();
1.10558 + }
1.10559 + IntegerUtilities.getFlags = getFlags;
1.10560 + function isPowerOfTwo(x) {
1.10561 + return x && (x & x - 1) === 0;
1.10562 + }
1.10563 + IntegerUtilities.isPowerOfTwo = isPowerOfTwo;
1.10564 + }(Shumway.IntegerUtilities || (Shumway.IntegerUtilities = {})));
1.10565 + var IntegerUtilities = Shumway.IntegerUtilities;
1.10566 + var IndentingWriter = function () {
1.10567 + function IndentingWriter(suppressOutput, outFn) {
1.10568 + if (typeof suppressOutput === 'undefined') {
1.10569 + suppressOutput = false;
1.10570 + }
1.10571 + this._tab = ' ';
1.10572 + this._padding = '';
1.10573 + this._suppressOutput = suppressOutput;
1.10574 + this._out = outFn || IndentingWriter._consoleOutFn;
1.10575 + }
1.10576 + IndentingWriter.prototype.writeLn = function (str) {
1.10577 + if (!this._suppressOutput) {
1.10578 + this._out(this._padding + str);
1.10579 + }
1.10580 + };
1.10581 + IndentingWriter.prototype.writeLns = function (str) {
1.10582 + var lines = str.split('\n');
1.10583 + for (var i = 0; i < lines.length; i++) {
1.10584 + this.writeLn(lines[i]);
1.10585 + }
1.10586 + };
1.10587 + IndentingWriter.prototype.debugLn = function (str) {
1.10588 + this.colorLn(IndentingWriter.PURPLE, str);
1.10589 + };
1.10590 + IndentingWriter.prototype.yellowLn = function (str) {
1.10591 + this.colorLn(IndentingWriter.YELLOW, str);
1.10592 + };
1.10593 + IndentingWriter.prototype.greenLn = function (str) {
1.10594 + this.colorLn(IndentingWriter.GREEN, str);
1.10595 + };
1.10596 + IndentingWriter.prototype.redLn = function (str) {
1.10597 + this.colorLn(IndentingWriter.RED, str);
1.10598 + };
1.10599 + IndentingWriter.prototype.colorLn = function (color, str) {
1.10600 + if (!this._suppressOutput) {
1.10601 + if (!inBrowser) {
1.10602 + this._out(this._padding + color + str + IndentingWriter.ENDC);
1.10603 + } else {
1.10604 + this._out(this._padding + str);
1.10605 + }
1.10606 + }
1.10607 + };
1.10608 + IndentingWriter.prototype.enter = function (str) {
1.10609 + if (!this._suppressOutput) {
1.10610 + this._out(this._padding + str);
1.10611 + }
1.10612 + this.indent();
1.10613 + };
1.10614 + IndentingWriter.prototype.leaveAndEnter = function (str) {
1.10615 + this.leave(str);
1.10616 + this.indent();
1.10617 + };
1.10618 + IndentingWriter.prototype.leave = function (str) {
1.10619 + this.outdent();
1.10620 + if (!this._suppressOutput) {
1.10621 + this._out(this._padding + str);
1.10622 + }
1.10623 + };
1.10624 + IndentingWriter.prototype.indent = function () {
1.10625 + this._padding += this._tab;
1.10626 + };
1.10627 + IndentingWriter.prototype.outdent = function () {
1.10628 + if (this._padding.length > 0) {
1.10629 + this._padding = this._padding.substring(0, this._padding.length - this._tab.length);
1.10630 + }
1.10631 + };
1.10632 + IndentingWriter.prototype.writeArray = function (arr, detailed, noNumbers) {
1.10633 + if (typeof detailed === 'undefined') {
1.10634 + detailed = false;
1.10635 + }
1.10636 + if (typeof noNumbers === 'undefined') {
1.10637 + noNumbers = false;
1.10638 + }
1.10639 + detailed = detailed || false;
1.10640 + for (var i = 0, j = arr.length; i < j; i++) {
1.10641 + var prefix = '';
1.10642 + if (detailed) {
1.10643 + if (arr[i] === null) {
1.10644 + prefix = 'null';
1.10645 + } else if (arr[i] === undefined) {
1.10646 + prefix = 'undefined';
1.10647 + } else {
1.10648 + prefix = arr[i].constructor.name;
1.10649 + }
1.10650 + prefix += ' ';
1.10651 + }
1.10652 + var number = noNumbers ? '' : ('' + i).padRight(' ', 4);
1.10653 + this.writeLn(number + prefix + arr[i]);
1.10654 + }
1.10655 + };
1.10656 + IndentingWriter.PURPLE = '\x1b[94m';
1.10657 + IndentingWriter.YELLOW = '\x1b[93m';
1.10658 + IndentingWriter.GREEN = '\x1b[92m';
1.10659 + IndentingWriter.RED = '\x1b[91m';
1.10660 + IndentingWriter.ENDC = '\x1b[0m';
1.10661 + IndentingWriter._consoleOutFn = inBrowser ? console.info.bind(console) : print;
1.10662 + return IndentingWriter;
1.10663 + }();
1.10664 + Shumway.IndentingWriter = IndentingWriter;
1.10665 + var SortedListNode = function () {
1.10666 + function SortedListNode(value, next) {
1.10667 + this.value = value;
1.10668 + this.next = next;
1.10669 + }
1.10670 + return SortedListNode;
1.10671 + }();
1.10672 + var SortedList = function () {
1.10673 + function SortedList(compare) {
1.10674 + true;
1.10675 + this._compare = compare;
1.10676 + this._head = null;
1.10677 + this._length = 0;
1.10678 + }
1.10679 + SortedList.prototype.push = function (value) {
1.10680 + true;
1.10681 + this._length++;
1.10682 + if (!this._head) {
1.10683 + this._head = new SortedListNode(value, null);
1.10684 + return;
1.10685 + }
1.10686 + var curr = this._head;
1.10687 + var prev = null;
1.10688 + var node = new SortedListNode(value, null);
1.10689 + var compare = this._compare;
1.10690 + while (curr) {
1.10691 + if (compare(curr.value, node.value) > 0) {
1.10692 + if (prev) {
1.10693 + node.next = curr;
1.10694 + prev.next = node;
1.10695 + } else {
1.10696 + node.next = this._head;
1.10697 + this._head = node;
1.10698 + }
1.10699 + return;
1.10700 + }
1.10701 + prev = curr;
1.10702 + curr = curr.next;
1.10703 + }
1.10704 + prev.next = node;
1.10705 + };
1.10706 + SortedList.prototype.forEach = function (visitor) {
1.10707 + var curr = this._head;
1.10708 + var last = null;
1.10709 + while (curr) {
1.10710 + var result = visitor(curr.value);
1.10711 + if (result === SortedList.RETURN) {
1.10712 + return;
1.10713 + } else if (result === SortedList.DELETE) {
1.10714 + if (!last) {
1.10715 + curr = this._head = this._head.next;
1.10716 + } else {
1.10717 + curr = last.next = curr.next;
1.10718 + }
1.10719 + } else {
1.10720 + last = curr;
1.10721 + curr = curr.next;
1.10722 + }
1.10723 + }
1.10724 + };
1.10725 + SortedList.prototype.isEmpty = function () {
1.10726 + return !this._head;
1.10727 + };
1.10728 + SortedList.prototype.pop = function () {
1.10729 + if (!this._head) {
1.10730 + return undefined;
1.10731 + }
1.10732 + this._length--;
1.10733 + var ret = this._head;
1.10734 + this._head = this._head.next;
1.10735 + return ret.value;
1.10736 + };
1.10737 + SortedList.prototype.contains = function (value) {
1.10738 + var curr = this._head;
1.10739 + while (curr) {
1.10740 + if (curr.value === value) {
1.10741 + return true;
1.10742 + }
1.10743 + curr = curr.next;
1.10744 + }
1.10745 + return false;
1.10746 + };
1.10747 + SortedList.prototype.toString = function () {
1.10748 + var str = '[';
1.10749 + var curr = this._head;
1.10750 + while (curr) {
1.10751 + str += curr.value.toString();
1.10752 + curr = curr.next;
1.10753 + if (curr) {
1.10754 + str += ',';
1.10755 + }
1.10756 + }
1.10757 + str += ']';
1.10758 + return str;
1.10759 + };
1.10760 + SortedList.RETURN = 1;
1.10761 + SortedList.DELETE = 2;
1.10762 + return SortedList;
1.10763 + }();
1.10764 + Shumway.SortedList = SortedList;
1.10765 + var CIRCULAR_BUFFER_MASK = 4095;
1.10766 + var CIRCULAR_BUFFER_SIZE = 4096;
1.10767 + var CircularBuffer = function () {
1.10768 + function CircularBuffer(Type) {
1.10769 + this.index = 0;
1.10770 + this.start = 0;
1.10771 + this.array = new Type(CIRCULAR_BUFFER_SIZE);
1.10772 + }
1.10773 + CircularBuffer.prototype.get = function (i) {
1.10774 + return this.array[i];
1.10775 + };
1.10776 + CircularBuffer.prototype.forEachInReverse = function (visitor) {
1.10777 + if (this.isEmpty()) {
1.10778 + return;
1.10779 + }
1.10780 + var i = this.index === 0 ? CIRCULAR_BUFFER_SIZE - 1 : this.index - 1;
1.10781 + while (i !== this.start) {
1.10782 + if (visitor(this.array[i], i)) {
1.10783 + break;
1.10784 + }
1.10785 + i = i === 0 ? CIRCULAR_BUFFER_SIZE - 1 : i - 1;
1.10786 + }
1.10787 + };
1.10788 + CircularBuffer.prototype.write = function (value) {
1.10789 + this.array[this.index] = value;
1.10790 + this.index = this.index + 1 & CIRCULAR_BUFFER_MASK;
1.10791 + if (this.index === this.start) {
1.10792 + this.start = this.start + 1 & CIRCULAR_BUFFER_MASK;
1.10793 + }
1.10794 + };
1.10795 + CircularBuffer.prototype.isFull = function () {
1.10796 + return (this.index + 1 & CIRCULAR_BUFFER_MASK) === this.start;
1.10797 + };
1.10798 + CircularBuffer.prototype.isEmpty = function () {
1.10799 + return this.index === this.start;
1.10800 + };
1.10801 + return CircularBuffer;
1.10802 + }();
1.10803 + Shumway.CircularBuffer = CircularBuffer;
1.10804 +}(Shumway || (Shumway = {})));
1.10805 +var assert = Shumway.Debug.assert;
1.10806 +var IndentingWriter = Shumway.IndentingWriter;
1.10807 +var assert = Shumway.Debug.assert;
1.10808 +var $DEBUG;
1.10809 +var release = true;
1.10810 +var c4CoerceNonPrimitiveParameters = false;
1.10811 +var c4CoerceNonPrimitive = false;
1.10812 +var c4AsTypeLate = true;
1.10813 +var error = Shumway.Debug.error;
1.10814 +var assertNotImplemented = Shumway.Debug.assertNotImplemented;
1.10815 +var warning = Shumway.Debug.warning;
1.10816 +var notImplemented = Shumway.Debug.notImplemented;
1.10817 +var somewhatImplemented = Shumway.Debug.somewhatImplemented;
1.10818 +var unexpected = Shumway.Debug.unexpected;
1.10819 +var defineReadOnlyProperty = Shumway.ObjectUtilities.defineReadOnlyProperty;
1.10820 +var createEmptyObject = Shumway.ObjectUtilities.createEmptyObject;
1.10821 +var makeForwardingGetter = Shumway.FunctionUtilities.makeForwardingGetter;
1.10822 +var makeForwardingSetter = Shumway.FunctionUtilities.makeForwardingSetter;
1.10823 +var bindSafely = Shumway.FunctionUtilities.bindSafely;
1.10824 +var cloneObject = Shumway.ObjectUtilities.cloneObject;
1.10825 +var copyProperties = Shumway.ObjectUtilities.copyProperties;
1.10826 +var toSafeString = Shumway.StringUtilities.toSafeString;
1.10827 +var toSafeArrayString = Shumway.StringUtilities.toSafeArrayString;
1.10828 +var getLatestGetterOrSetterPropertyDescriptor = Shumway.ObjectUtilities.getLatestGetterOrSetterPropertyDescriptor;
1.10829 +var defineNonEnumerableGetterOrSetter = Shumway.ObjectUtilities.defineNonEnumerableGetterOrSetter;
1.10830 +var defineNonEnumerableGetter = Shumway.ObjectUtilities.defineNonEnumerableGetter;
1.10831 +var defineNonEnumerableSetter = Shumway.ObjectUtilities.defineNonEnumerableSetter;
1.10832 +var defineNonEnumerableProperty = Shumway.ObjectUtilities.defineNonEnumerableProperty;
1.10833 +var defineNonEnumerableForwardingProperty = Shumway.ObjectUtilities.defineNonEnumerableForwardingProperty;
1.10834 +var defineNewNonEnumerableProperty = Shumway.ObjectUtilities.defineNewNonEnumerableProperty;
1.10835 +var isNumeric = Shumway.isNumeric;
1.10836 +var isNullOrUndefined = Shumway.isNullOrUndefined;
1.10837 +var isPowerOfTwo = Shumway.IntegerUtilities.isPowerOfTwo;
1.10838 +function time(fn, count) {
1.10839 + var start = performance.now();
1.10840 + for (var i = 0; i < count; i++) {
1.10841 + fn();
1.10842 + }
1.10843 + var time = (performance.now() - start) / count;
1.10844 + console.info('Took: ' + time.toFixed(2) + 'ms.');
1.10845 + return time;
1.10846 +}
1.10847 +function clamp(x, min, max) {
1.10848 + if (x < min) {
1.10849 + return min;
1.10850 + } else if (x > max) {
1.10851 + return max;
1.10852 + }
1.10853 + return x;
1.10854 +}
1.10855 +var fromCharCodeArray = Shumway.StringUtilities.fromCharCodeArray;
1.10856 +function hasOwnProperty(object, name) {
1.10857 + return Object.prototype.hasOwnProperty.call(object, name);
1.10858 +}
1.10859 +var toKeyValueArray = Shumway.ObjectUtilities.toKeyValueArray;
1.10860 +var boxValue = Shumway.ObjectUtilities.boxValue;
1.10861 +function isObject(value) {
1.10862 + return typeof value === 'object' || typeof value === 'function';
1.10863 +}
1.10864 +function isString(value) {
1.10865 + return typeof value === 'string';
1.10866 +}
1.10867 +function isFunction(value) {
1.10868 + return typeof value === 'function';
1.10869 +}
1.10870 +function isNumber(value) {
1.10871 + return typeof value === 'number';
1.10872 +}
1.10873 +function toNumber(x) {
1.10874 + return +x;
1.10875 +}
1.10876 +function setBitFlags(flags, flag, value) {
1.10877 + return value ? flags | flag : flags & ~flag;
1.10878 +}
1.10879 +function getBitFlags(flags, flag) {
1.10880 + return !(!(flags & flag));
1.10881 +}
1.10882 +(function () {
1.10883 + function extendBuiltin(proto, prop, f) {
1.10884 + if (!proto[prop]) {
1.10885 + Object.defineProperty(proto, prop, {
1.10886 + value: f,
1.10887 + writable: true,
1.10888 + configurable: true,
1.10889 + enumerable: false
1.10890 + });
1.10891 + }
1.10892 + }
1.10893 + var Sp = String.prototype;
1.10894 + function removeColors(s) {
1.10895 + return s.replace(/\033\[[0-9]*m/g, '');
1.10896 + }
1.10897 + extendBuiltin(Sp, 'padRight', function (c, n) {
1.10898 + var str = this;
1.10899 + var length = removeColors(str).length;
1.10900 + if (!c || length >= n) {
1.10901 + return str;
1.10902 + }
1.10903 + var max = (n - length) / c.length;
1.10904 + for (var i = 0; i < max; i++) {
1.10905 + str += c;
1.10906 + }
1.10907 + return str;
1.10908 + });
1.10909 + extendBuiltin(Sp, 'padLeft', function (c, n) {
1.10910 + var str = this;
1.10911 + var length = str.length;
1.10912 + if (!c || length >= n) {
1.10913 + return str;
1.10914 + }
1.10915 + var max = (n - length) / c.length;
1.10916 + for (var i = 0; i < max; i++) {
1.10917 + str = c + str;
1.10918 + }
1.10919 + return str;
1.10920 + });
1.10921 + extendBuiltin(Sp, 'trim', function () {
1.10922 + return this.replace(/^\s+|\s+$/g, '');
1.10923 + });
1.10924 + extendBuiltin(Sp, 'endsWith', function (str) {
1.10925 + return this.indexOf(str, this.length - str.length) !== -1;
1.10926 + });
1.10927 + var Ap = Array.prototype;
1.10928 + extendBuiltin(Ap, 'popMany', function (count) {
1.10929 + true;
1.10930 + var start = this.length - count;
1.10931 + var res = this.slice(start, this.length);
1.10932 + this.splice(start, count);
1.10933 + return res;
1.10934 + });
1.10935 + extendBuiltin(Ap, 'pushMany', function (array) {
1.10936 + for (var i = 0; i < array.length; i++) {
1.10937 + this.push(array[i]);
1.10938 + }
1.10939 + });
1.10940 + extendBuiltin(Ap, 'clone', function () {
1.10941 + return this.slice(0);
1.10942 + });
1.10943 + extendBuiltin(Ap, 'first', function () {
1.10944 + true;
1.10945 + return this[0];
1.10946 + });
1.10947 + extendBuiltin(Ap, 'last', function () {
1.10948 + true;
1.10949 + return this[this.length - 1];
1.10950 + });
1.10951 + extendBuiltin(Ap, 'peek', function () {
1.10952 + true;
1.10953 + return this[this.length - 1];
1.10954 + });
1.10955 + extendBuiltin(Ap, 'empty', function () {
1.10956 + return this.length === 0;
1.10957 + });
1.10958 + extendBuiltin(Ap, 'pushUnique', function (v) {
1.10959 + for (var i = 0, j = this.length; i < j; i++) {
1.10960 + if (this[i] === v) {
1.10961 + return;
1.10962 + }
1.10963 + }
1.10964 + this.push(v);
1.10965 + });
1.10966 + var uniquesMap;
1.10967 + if (typeof Map !== 'undefined' && (uniquesMap = new Map()).clear) {
1.10968 + extendBuiltin(Ap, 'unique', function () {
1.10969 + var unique = [];
1.10970 + for (var i = 0; i < this.length; i++) {
1.10971 + if (uniquesMap.has(this[i])) {
1.10972 + continue;
1.10973 + }
1.10974 + unique.push(this[i]);
1.10975 + uniquesMap.set(this[i], true);
1.10976 + }
1.10977 + uniquesMap.clear();
1.10978 + return unique;
1.10979 + });
1.10980 + } else {
1.10981 + extendBuiltin(Ap, 'unique', function () {
1.10982 + var unique = [];
1.10983 + for (var i = 0; i < this.length; i++) {
1.10984 + unique.pushUnique(this[i]);
1.10985 + }
1.10986 + return unique;
1.10987 + });
1.10988 + }
1.10989 + extendBuiltin(Ap, 'replace', function (x, y) {
1.10990 + if (x === y) {
1.10991 + return 0;
1.10992 + }
1.10993 + var count = 0;
1.10994 + for (var i = 0; i < this.length; i++) {
1.10995 + if (this[i] === x) {
1.10996 + this[i] = y;
1.10997 + count++;
1.10998 + }
1.10999 + }
1.11000 + return count;
1.11001 + });
1.11002 + extendBuiltin(Ap, 'count', function (x) {
1.11003 + var count = 0;
1.11004 + for (var i = 0; i < this.length; i++) {
1.11005 + if (this[i] === x) {
1.11006 + count++;
1.11007 + }
1.11008 + }
1.11009 + return count;
1.11010 + });
1.11011 + extendBuiltin(Ap, 'notEmpty', function () {
1.11012 + return this.length > 0;
1.11013 + });
1.11014 + extendBuiltin(Ap, 'contains', function (val) {
1.11015 + return this.indexOf(val) >= 0;
1.11016 + });
1.11017 + extendBuiltin(Ap, 'top', function () {
1.11018 + return this.length && this[this.length - 1];
1.11019 + });
1.11020 + extendBuiltin(Ap, 'mapWithIndex', function (fn) {
1.11021 + var arr = [];
1.11022 + for (var i = 0; i < this.length; i++) {
1.11023 + arr.push(fn(this[i], i));
1.11024 + }
1.11025 + return arr;
1.11026 + });
1.11027 +}());
1.11028 +var utf8decode = Shumway.StringUtilities.utf8decode;
1.11029 +var utf8encode = Shumway.StringUtilities.utf8encode;
1.11030 +var escapeString = Shumway.StringUtilities.escapeString;
1.11031 +var bitCount = Shumway.IntegerUtilities.bitCount;
1.11032 +var ones = Shumway.IntegerUtilities.ones;
1.11033 +var leadingZeros = Shumway.IntegerUtilities.leadingZeros;
1.11034 +var trailingZeros = Shumway.IntegerUtilities.trailingZeros;
1.11035 +var getFlags = Shumway.IntegerUtilities.getFlags;
1.11036 +function BitSetFunctor(length) {
1.11037 + var ADDRESS_BITS_PER_WORD = 5;
1.11038 + var BITS_PER_WORD = 1 << ADDRESS_BITS_PER_WORD;
1.11039 + var BIT_INDEX_MASK = BITS_PER_WORD - 1;
1.11040 + var SIZE = length + (BITS_PER_WORD - 1) >> ADDRESS_BITS_PER_WORD << ADDRESS_BITS_PER_WORD;
1.11041 + function BitSet() {
1.11042 + this.count = 0;
1.11043 + this.dirty = 0;
1.11044 + this.size = SIZE;
1.11045 + this.bits = new Uint32Array(SIZE >> ADDRESS_BITS_PER_WORD);
1.11046 + }
1.11047 + function BitSetS() {
1.11048 + this.count = 0;
1.11049 + this.dirty = 0;
1.11050 + this.size = SIZE;
1.11051 + this.bits = 0;
1.11052 + }
1.11053 + var singleword = SIZE >> ADDRESS_BITS_PER_WORD === 1;
1.11054 + var Ctor = singleword ? BitSetS : BitSet;
1.11055 + Ctor.ADDRESS_BITS_PER_WORD = ADDRESS_BITS_PER_WORD;
1.11056 + Ctor.BITS_PER_WORD = BITS_PER_WORD;
1.11057 + Ctor.BIT_INDEX_MASK = BIT_INDEX_MASK;
1.11058 + Ctor.singleword = singleword;
1.11059 + BitSet.prototype = {
1.11060 + recount: function recount() {
1.11061 + if (!this.dirty) {
1.11062 + return;
1.11063 + }
1.11064 + var bits = this.bits;
1.11065 + var c = 0;
1.11066 + for (var i = 0, j = bits.length; i < j; i++) {
1.11067 + var v = bits[i];
1.11068 + v = v - (v >> 1 & 1431655765);
1.11069 + v = (v & 858993459) + (v >> 2 & 858993459);
1.11070 + c += (v + (v >> 4) & 252645135) * 16843009 >> 24;
1.11071 + }
1.11072 + this.count = c;
1.11073 + this.dirty = 0;
1.11074 + },
1.11075 + set: function set(i) {
1.11076 + var n = i >> ADDRESS_BITS_PER_WORD;
1.11077 + var old = this.bits[n];
1.11078 + var b = old | 1 << (i & BIT_INDEX_MASK);
1.11079 + this.bits[n] = b;
1.11080 + this.dirty |= old ^ b;
1.11081 + },
1.11082 + setAll: function setAll() {
1.11083 + var bits = this.bits;
1.11084 + for (var i = 0, j = bits.length; i < j; i++) {
1.11085 + bits[i] = 4294967295;
1.11086 + }
1.11087 + this.count = this.size;
1.11088 + this.dirty = 0;
1.11089 + },
1.11090 + assign: function assign(set) {
1.11091 + this.count = set.count;
1.11092 + this.dirty = set.dirty;
1.11093 + this.size = set.size;
1.11094 + for (var i = 0, j = this.bits.length; i < j; i++) {
1.11095 + this.bits[i] = set.bits[i];
1.11096 + }
1.11097 + },
1.11098 + clear: function clear(i) {
1.11099 + var n = i >> ADDRESS_BITS_PER_WORD;
1.11100 + var old = this.bits[n];
1.11101 + var b = old & ~(1 << (i & BIT_INDEX_MASK));
1.11102 + this.bits[n] = b;
1.11103 + this.dirty |= old ^ b;
1.11104 + },
1.11105 + get: function get(i) {
1.11106 + var word = this.bits[i >> ADDRESS_BITS_PER_WORD];
1.11107 + return (word & 1 << (i & BIT_INDEX_MASK)) !== 0;
1.11108 + },
1.11109 + clearAll: function clearAll() {
1.11110 + var bits = this.bits;
1.11111 + for (var i = 0, j = bits.length; i < j; i++) {
1.11112 + bits[i] = 0;
1.11113 + }
1.11114 + this.count = 0;
1.11115 + this.dirty = 0;
1.11116 + },
1.11117 + _union: function _union(other) {
1.11118 + var dirty = this.dirty;
1.11119 + var bits = this.bits;
1.11120 + var otherBits = other.bits;
1.11121 + for (var i = 0, j = bits.length; i < j; i++) {
1.11122 + var old = bits[i];
1.11123 + var b = old | otherBits[i];
1.11124 + bits[i] = b;
1.11125 + dirty |= old ^ b;
1.11126 + }
1.11127 + this.dirty = dirty;
1.11128 + },
1.11129 + intersect: function intersect(other) {
1.11130 + var dirty = this.dirty;
1.11131 + var bits = this.bits;
1.11132 + var otherBits = other.bits;
1.11133 + for (var i = 0, j = bits.length; i < j; i++) {
1.11134 + var old = bits[i];
1.11135 + var b = old & otherBits[i];
1.11136 + bits[i] = b;
1.11137 + dirty |= old ^ b;
1.11138 + }
1.11139 + this.dirty = dirty;
1.11140 + },
1.11141 + subtract: function subtract(other) {
1.11142 + var dirty = this.dirty;
1.11143 + var bits = this.bits;
1.11144 + var otherBits = other.bits;
1.11145 + for (var i = 0, j = bits.length; i < j; i++) {
1.11146 + var old = bits[i];
1.11147 + var b = old & ~otherBits[i];
1.11148 + bits[i] = b;
1.11149 + dirty |= old ^ b;
1.11150 + }
1.11151 + this.dirty = dirty;
1.11152 + },
1.11153 + negate: function negate() {
1.11154 + var dirty = this.dirty;
1.11155 + var bits = this.bits;
1.11156 + for (var i = 0, j = bits.length; i < j; i++) {
1.11157 + var old = bits[i];
1.11158 + var b = ~old;
1.11159 + bits[i] = b;
1.11160 + dirty |= old ^ b;
1.11161 + }
1.11162 + this.dirty = dirty;
1.11163 + },
1.11164 + forEach: function forEach(fn) {
1.11165 + true;
1.11166 + var bits = this.bits;
1.11167 + for (var i = 0, j = bits.length; i < j; i++) {
1.11168 + var word = bits[i];
1.11169 + if (word) {
1.11170 + for (var k = 0; k < BITS_PER_WORD; k++) {
1.11171 + if (word & 1 << k) {
1.11172 + fn(i * BITS_PER_WORD + k);
1.11173 + }
1.11174 + }
1.11175 + }
1.11176 + }
1.11177 + },
1.11178 + toArray: function toArray() {
1.11179 + var set = [];
1.11180 + var bits = this.bits;
1.11181 + for (var i = 0, j = bits.length; i < j; i++) {
1.11182 + var word = bits[i];
1.11183 + if (word) {
1.11184 + for (var k = 0; k < BITS_PER_WORD; k++) {
1.11185 + if (word & 1 << k) {
1.11186 + set.push(i * BITS_PER_WORD + k);
1.11187 + }
1.11188 + }
1.11189 + }
1.11190 + }
1.11191 + return set;
1.11192 + },
1.11193 + equals: function equals(other) {
1.11194 + if (this.size !== other.size) {
1.11195 + return false;
1.11196 + }
1.11197 + var bits = this.bits;
1.11198 + var otherBits = other.bits;
1.11199 + for (var i = 0, j = bits.length; i < j; i++) {
1.11200 + if (bits[i] !== otherBits[i]) {
1.11201 + return false;
1.11202 + }
1.11203 + }
1.11204 + return true;
1.11205 + },
1.11206 + contains: function contains(other) {
1.11207 + if (this.size !== other.size) {
1.11208 + return false;
1.11209 + }
1.11210 + var bits = this.bits;
1.11211 + var otherBits = other.bits;
1.11212 + for (var i = 0, j = bits.length; i < j; i++) {
1.11213 + if ((bits[i] | otherBits[i]) !== bits[i]) {
1.11214 + return false;
1.11215 + }
1.11216 + }
1.11217 + return true;
1.11218 + },
1.11219 + toBitString: function toBitString(on, off) {
1.11220 + on = on || '1';
1.11221 + off = off || '0';
1.11222 + var str = '';
1.11223 + for (var i = 0; i < length; i++) {
1.11224 + str += this.get(i) ? on : off;
1.11225 + }
1.11226 + return str;
1.11227 + },
1.11228 + length: length,
1.11229 + toString: function toString(names) {
1.11230 + var set = [];
1.11231 + for (var i = 0; i < length; i++) {
1.11232 + if (this.get(i)) {
1.11233 + set.push(names ? names[i] : i);
1.11234 + }
1.11235 + }
1.11236 + return set.join(', ');
1.11237 + },
1.11238 + isEmpty: function isEmpty() {
1.11239 + this.recount();
1.11240 + return this.count === 0;
1.11241 + },
1.11242 + clone: function clone() {
1.11243 + var set = new BitSet();
1.11244 + set._union(this);
1.11245 + return set;
1.11246 + }
1.11247 + };
1.11248 + BitSetS.prototype = {
1.11249 + recount: function recount() {
1.11250 + if (!this.dirty) {
1.11251 + return;
1.11252 + }
1.11253 + var c = 0;
1.11254 + var v = this.bits;
1.11255 + v = v - (v >> 1 & 1431655765);
1.11256 + v = (v & 858993459) + (v >> 2 & 858993459);
1.11257 + c += (v + (v >> 4) & 252645135) * 16843009 >> 24;
1.11258 + this.count = c;
1.11259 + this.dirty = 0;
1.11260 + },
1.11261 + set: function set(i) {
1.11262 + var old = this.bits;
1.11263 + var b = old | 1 << (i & BIT_INDEX_MASK);
1.11264 + this.bits = b;
1.11265 + this.dirty |= old ^ b;
1.11266 + },
1.11267 + setAll: function setAll() {
1.11268 + this.bits = 4294967295;
1.11269 + this.count = this.size;
1.11270 + this.dirty = 0;
1.11271 + },
1.11272 + assign: function assign(set) {
1.11273 + this.count = set.count;
1.11274 + this.dirty = set.dirty;
1.11275 + this.size = set.size;
1.11276 + this.bits = set.bits;
1.11277 + },
1.11278 + clear: function clear(i) {
1.11279 + var old = this.bits;
1.11280 + var b = old & ~(1 << (i & BIT_INDEX_MASK));
1.11281 + this.bits = b;
1.11282 + this.dirty |= old ^ b;
1.11283 + },
1.11284 + get: function get(i) {
1.11285 + return (this.bits & 1 << (i & BIT_INDEX_MASK)) !== 0;
1.11286 + },
1.11287 + clearAll: function clearAll() {
1.11288 + this.bits = 0;
1.11289 + this.count = 0;
1.11290 + this.dirty = 0;
1.11291 + },
1.11292 + _union: function _union(other) {
1.11293 + var old = this.bits;
1.11294 + var b = old | other.bits;
1.11295 + this.bits = b;
1.11296 + this.dirty = old ^ b;
1.11297 + },
1.11298 + intersect: function intersect(other) {
1.11299 + var old = this.bits;
1.11300 + var b = old & other.bits;
1.11301 + this.bits = b;
1.11302 + this.dirty = old ^ b;
1.11303 + },
1.11304 + subtract: function subtract(other) {
1.11305 + var old = this.bits;
1.11306 + var b = old & ~other.bits;
1.11307 + this.bits = b;
1.11308 + this.dirty = old ^ b;
1.11309 + },
1.11310 + negate: function negate() {
1.11311 + var old = this.bits;
1.11312 + var b = ~old;
1.11313 + this.bits = b;
1.11314 + this.dirty = old ^ b;
1.11315 + },
1.11316 + forEach: function forEach(fn) {
1.11317 + true;
1.11318 + var word = this.bits;
1.11319 + if (word) {
1.11320 + for (var k = 0; k < BITS_PER_WORD; k++) {
1.11321 + if (word & 1 << k) {
1.11322 + fn(k);
1.11323 + }
1.11324 + }
1.11325 + }
1.11326 + },
1.11327 + toArray: function toArray() {
1.11328 + var set = [];
1.11329 + var word = this.bits;
1.11330 + if (word) {
1.11331 + for (var k = 0; k < BITS_PER_WORD; k++) {
1.11332 + if (word & 1 << k) {
1.11333 + set.push(k);
1.11334 + }
1.11335 + }
1.11336 + }
1.11337 + return set;
1.11338 + },
1.11339 + equals: function equals(other) {
1.11340 + return this.bits === other.bits;
1.11341 + },
1.11342 + contains: function contains(other) {
1.11343 + var bits = this.bits;
1.11344 + return (bits | other.bits) === bits;
1.11345 + },
1.11346 + isEmpty: function isEmpty() {
1.11347 + this.recount();
1.11348 + return this.count === 0;
1.11349 + },
1.11350 + clone: function clone() {
1.11351 + var set = new BitSetS();
1.11352 + set._union(this);
1.11353 + return set;
1.11354 + },
1.11355 + toBitString: BitSet.prototype.toBitString,
1.11356 + toString: BitSet.prototype.toString,
1.11357 + length: length
1.11358 + };
1.11359 + return Ctor;
1.11360 +}
1.11361 +var Map = function () {
1.11362 + function map() {
1.11363 + this.elements = {};
1.11364 + }
1.11365 + map.prototype.set = function set(k, v) {
1.11366 + this.elements[k] = v;
1.11367 + };
1.11368 + map.prototype.get = function get(k) {
1.11369 + if (this.has(k)) {
1.11370 + return this.elements[k];
1.11371 + }
1.11372 + return undefined;
1.11373 + };
1.11374 + map.prototype.has = function has(k) {
1.11375 + return Object.prototype.hasOwnProperty.call(this.elements, k);
1.11376 + };
1.11377 + map.prototype.remove = function remove(k) {
1.11378 + if (this.has(k)) {
1.11379 + delete this.elements[k];
1.11380 + }
1.11381 + };
1.11382 + return map;
1.11383 + }();
1.11384 +(function checkWeakMap() {
1.11385 + if (typeof this.WeakMap === 'function')
1.11386 + return;
1.11387 + var id = 0;
1.11388 + function WeakMap() {
1.11389 + this.id = '$weakmap' + id++;
1.11390 + }
1.11391 + ;
1.11392 + WeakMap.prototype = {
1.11393 + has: function (obj) {
1.11394 + return obj.hasOwnProperty(this.id);
1.11395 + },
1.11396 + get: function (obj, defaultValue) {
1.11397 + return obj.hasOwnProperty(this.id) ? obj[this.id] : defaultValue;
1.11398 + },
1.11399 + set: function (obj, value) {
1.11400 + Object.defineProperty(obj, this.id, {
1.11401 + value: value,
1.11402 + enumerable: false,
1.11403 + configurable: true
1.11404 + });
1.11405 + }
1.11406 + };
1.11407 + this.WeakMap = WeakMap;
1.11408 +}());
1.11409 +var Callback = function () {
1.11410 + function callback() {
1.11411 + this.queues = {};
1.11412 + }
1.11413 + callback.prototype.register = function register(type, callback) {
1.11414 + var queue = this.queues[type];
1.11415 + if (queue) {
1.11416 + if (queue.indexOf(callback) > -1) {
1.11417 + return;
1.11418 + }
1.11419 + } else {
1.11420 + queue = this.queues[type] = [];
1.11421 + }
1.11422 + queue.push(callback);
1.11423 + };
1.11424 + callback.prototype.unregister = function unregister(type, callback) {
1.11425 + var queue = this.queues[type];
1.11426 + if (!queue) {
1.11427 + return;
1.11428 + }
1.11429 + var i = queue.indexOf(callback);
1.11430 + if (i !== -1) {
1.11431 + queue.splice(i, 1);
1.11432 + }
1.11433 + if (queue.length === 0) {
1.11434 + this.queues[type] = null;
1.11435 + }
1.11436 + };
1.11437 + callback.prototype.notify = function notify(type, args) {
1.11438 + var queue = this.queues[type];
1.11439 + if (!queue) {
1.11440 + return;
1.11441 + }
1.11442 + queue = queue.slice();
1.11443 + var args = sliceArguments(arguments, 0);
1.11444 + for (var i = 0; i < queue.length; i++) {
1.11445 + if (false) {
1.11446 + Counter.count('callback(' + type + ').notify');
1.11447 + }
1.11448 + var callback = queue[i];
1.11449 + callback.apply(null, args);
1.11450 + }
1.11451 + };
1.11452 + callback.prototype.notify1 = function notify1(type, value) {
1.11453 + var queue = this.queues[type];
1.11454 + if (!queue) {
1.11455 + return;
1.11456 + }
1.11457 + queue = queue.slice();
1.11458 + for (var i = 0; i < queue.length; i++) {
1.11459 + if (false) {
1.11460 + Counter.count('callback(' + type + ').notify1');
1.11461 + }
1.11462 + var callback = queue[i];
1.11463 + callback(type, value);
1.11464 + }
1.11465 + };
1.11466 + return callback;
1.11467 + }();
1.11468 +function lazyClass(holder, name, initialize) {
1.11469 + Object.defineProperty(holder, name, {
1.11470 + get: function () {
1.11471 + var start = performance.now();
1.11472 + var value = initialize();
1.11473 + print('Initialized Class: ' + name + ' ' + (performance.now() - start).toFixed(4));
1.11474 + Object.defineProperty(holder, name, {
1.11475 + value: value,
1.11476 + writable: true
1.11477 + });
1.11478 + return value;
1.11479 + },
1.11480 + configurable: true
1.11481 + });
1.11482 +}
1.11483 +var hashBytesTo32BitsAdler = Shumway.HashUtilities.hashBytesTo32BitsAdler;
1.11484 +var hashBytesTo32BitsMD5 = Shumway.HashUtilities.hashBytesTo32BitsMD5;
1.11485 +var variableLengthEncodeInt32 = Shumway.StringUtilities.variableLengthEncodeInt32;
1.11486 +var fromEncoding = Shumway.StringUtilities.fromEncoding;
1.11487 +var variableLengthDecodeIdentifier = Shumway.StringUtilities.variableLengthDecodeInt32;
1.11488 +var toEncoding = Shumway.StringUtilities.toEncoding;
1.11489 +var Shumway;
1.11490 +(function (Shumway) {
1.11491 + (function (Options) {
1.11492 + var Argument = function () {
1.11493 + function Argument(shortName, longName, type, options) {
1.11494 + this.shortName = shortName;
1.11495 + this.longName = longName;
1.11496 + this.type = type;
1.11497 + options = options || {};
1.11498 + this.positional = options.positional;
1.11499 + this.parseFn = options.parse;
1.11500 + this.value = options.defaultValue;
1.11501 + }
1.11502 + Argument.prototype.parse = function (value) {
1.11503 + if (this.type === 'boolean') {
1.11504 + true;
1.11505 + this.value = value;
1.11506 + } else if (this.type === 'number') {
1.11507 + true;
1.11508 + this.value = parseInt(value, 10);
1.11509 + } else {
1.11510 + this.value = value;
1.11511 + }
1.11512 + if (this.parseFn) {
1.11513 + this.parseFn(this.value);
1.11514 + }
1.11515 + };
1.11516 + return Argument;
1.11517 + }();
1.11518 + Options.Argument = Argument;
1.11519 + var ArgumentParser = function () {
1.11520 + function ArgumentParser() {
1.11521 + this.args = [];
1.11522 + }
1.11523 + ArgumentParser.prototype.addArgument = function (shortName, longName, type, options) {
1.11524 + var argument = new Argument(shortName, longName, type, options);
1.11525 + this.args.push(argument);
1.11526 + return argument;
1.11527 + };
1.11528 + ArgumentParser.prototype.addBoundOption = function (option) {
1.11529 + var options = {
1.11530 + parse: function (x) {
1.11531 + option.value = x;
1.11532 + }
1.11533 + };
1.11534 + this.args.push(new Argument(option.shortName, option.longName, option.type, options));
1.11535 + };
1.11536 + ArgumentParser.prototype.addBoundOptionSet = function (optionSet) {
1.11537 + var self = this;
1.11538 + optionSet.options.forEach(function (x) {
1.11539 + if (x instanceof OptionSet) {
1.11540 + self.addBoundOptionSet(x);
1.11541 + } else {
1.11542 + true;
1.11543 + self.addBoundOption(x);
1.11544 + }
1.11545 + });
1.11546 + };
1.11547 + ArgumentParser.prototype.getUsage = function () {
1.11548 + var str = '';
1.11549 + this.args.forEach(function (x) {
1.11550 + if (!x.positional) {
1.11551 + str += '[-' + x.shortName + '|--' + x.longName + (x.type === 'boolean' ? '' : ' ' + x.type[0].toUpperCase()) + ']';
1.11552 + } else {
1.11553 + str += x.longName;
1.11554 + }
1.11555 + str += ' ';
1.11556 + });
1.11557 + return str;
1.11558 + };
1.11559 + ArgumentParser.prototype.parse = function (args) {
1.11560 + var nonPositionalArgumentMap = {};
1.11561 + var positionalArgumentList = [];
1.11562 + this.args.forEach(function (x) {
1.11563 + if (x.positional) {
1.11564 + positionalArgumentList.push(x);
1.11565 + } else {
1.11566 + nonPositionalArgumentMap['-' + x.shortName] = x;
1.11567 + nonPositionalArgumentMap['--' + x.longName] = x;
1.11568 + }
1.11569 + });
1.11570 + var leftoverArguments = [];
1.11571 + while (args.length) {
1.11572 + var argString = args.shift();
1.11573 + var argument = null, value = argString;
1.11574 + if (argString == '--') {
1.11575 + leftoverArguments = leftoverArguments.concat(args);
1.11576 + break;
1.11577 + } else if (argString.slice(0, 1) == '-' || argString.slice(0, 2) == '--') {
1.11578 + argument = nonPositionalArgumentMap[argString];
1.11579 + true;
1.11580 + if (!argument) {
1.11581 + continue;
1.11582 + }
1.11583 + if (argument.type !== 'boolean') {
1.11584 + value = args.shift();
1.11585 + true;
1.11586 + } else {
1.11587 + value = true;
1.11588 + }
1.11589 + } else if (positionalArgumentList.length) {
1.11590 + argument = positionalArgumentList.shift();
1.11591 + } else {
1.11592 + leftoverArguments.push(value);
1.11593 + }
1.11594 + if (argument) {
1.11595 + argument.parse(value);
1.11596 + }
1.11597 + }
1.11598 + true;
1.11599 + return leftoverArguments;
1.11600 + };
1.11601 + return ArgumentParser;
1.11602 + }();
1.11603 + Options.ArgumentParser = ArgumentParser;
1.11604 + var OptionSet = function () {
1.11605 + function OptionSet(name) {
1.11606 + this.name = name;
1.11607 + this.options = [];
1.11608 + }
1.11609 + OptionSet.prototype.register = function (option) {
1.11610 + this.options.push(option);
1.11611 + return option;
1.11612 + };
1.11613 + OptionSet.prototype.trace = function (writer) {
1.11614 + writer.enter(this.name + ' {');
1.11615 + this.options.forEach(function (option) {
1.11616 + option.trace(writer);
1.11617 + });
1.11618 + writer.leave('}');
1.11619 + };
1.11620 + return OptionSet;
1.11621 + }();
1.11622 + Options.OptionSet = OptionSet;
1.11623 + var Option = function () {
1.11624 + function Option(shortName, longName, type, defaultValue, description) {
1.11625 + this.longName = longName;
1.11626 + this.shortName = shortName;
1.11627 + this.type = type;
1.11628 + this.defaultValue = defaultValue;
1.11629 + this.value = defaultValue;
1.11630 + this.description = description;
1.11631 + }
1.11632 + Option.prototype.parse = function (value) {
1.11633 + this.value = value;
1.11634 + };
1.11635 + Option.prototype.trace = function (writer) {
1.11636 + writer.writeLn(('-' + this.shortName + '|--' + this.longName).padRight(' ', 30) + ' = ' + this.type + ' ' + this.value + ' [' + this.defaultValue + ']' + ' (' + this.description + ')');
1.11637 + };
1.11638 + return Option;
1.11639 + }();
1.11640 + Options.Option = Option;
1.11641 + }(Shumway.Options || (Shumway.Options = {})));
1.11642 + var Options = Shumway.Options;
1.11643 +}(Shumway || (Shumway = {})));
1.11644 +if (typeof exports !== 'undefined') {
1.11645 + exports['Shumway'] = Shumway;
1.11646 +}
1.11647 +var ArgumentParser = Shumway.Options.ArgumentParser;
1.11648 +var Option = Shumway.Options.Option;
1.11649 +var OptionSet = Shumway.Options.OptionSet;
1.11650 +var ArgumentParser = Shumway.Options.ArgumentParser;
1.11651 +var Option = Shumway.Options.Option;
1.11652 +var OptionSet = Shumway.Options.OptionSet;
1.11653 +var Shumway;
1.11654 +(function (Shumway) {
1.11655 + (function (Metrics) {
1.11656 + var Timer = function () {
1.11657 + function Timer(parent, name) {
1.11658 + this._parent = parent;
1.11659 + this._timers = Shumway.ObjectUtilities.createMap();
1.11660 + this._name = name;
1.11661 + this._begin = 0;
1.11662 + this._last = 0;
1.11663 + this._total = 0;
1.11664 + this._count = 0;
1.11665 + }
1.11666 + Timer.time = function (name, fn) {
1.11667 + Timer.start(name);
1.11668 + fn();
1.11669 + Timer.stop();
1.11670 + };
1.11671 + Timer.start = function (name) {
1.11672 + Timer._top = Timer._top._timers[name] || (Timer._top._timers[name] = new Timer(Timer._top, name));
1.11673 + Timer._top.start();
1.11674 + var tmp = Timer._flat._timers[name] || (Timer._flat._timers[name] = new Timer(Timer._flat, name));
1.11675 + tmp.start();
1.11676 + Timer._flatStack.push(tmp);
1.11677 + };
1.11678 + Timer.stop = function () {
1.11679 + Timer._top.stop();
1.11680 + Timer._top = Timer._top._parent;
1.11681 + Timer._flatStack.pop().stop();
1.11682 + };
1.11683 + Timer.stopStart = function (name) {
1.11684 + Timer.stop();
1.11685 + Timer.start(name);
1.11686 + };
1.11687 + Timer.prototype.start = function () {
1.11688 + this._begin = Shumway.getTicks();
1.11689 + };
1.11690 + Timer.prototype.stop = function () {
1.11691 + this._last = Shumway.getTicks() - this._begin;
1.11692 + this._total += this._last;
1.11693 + this._count += 1;
1.11694 + };
1.11695 + Timer.prototype.toJSON = function () {
1.11696 + return {
1.11697 + name: this._name,
1.11698 + total: this._total,
1.11699 + timers: this._timers
1.11700 + };
1.11701 + };
1.11702 + Timer.prototype.trace = function (writer) {
1.11703 + writer.enter(this._name + ': ' + this._total.toFixed(2) + ' ms' + ', count: ' + this._count + ', average: ' + (this._total / this._count).toFixed(2) + ' ms');
1.11704 + for (var name in this._timers) {
1.11705 + this._timers[name].trace(writer);
1.11706 + }
1.11707 + writer.outdent();
1.11708 + };
1.11709 + Timer.trace = function (writer) {
1.11710 + Timer._base.trace(writer);
1.11711 + Timer._flat.trace(writer);
1.11712 + };
1.11713 + Timer._base = new Timer(null, 'Total');
1.11714 + Timer._top = Timer._base;
1.11715 + Timer._flat = new Timer(null, 'Flat');
1.11716 + Timer._flatStack = [];
1.11717 + return Timer;
1.11718 + }();
1.11719 + Metrics.Timer = Timer;
1.11720 + var Counter = function () {
1.11721 + function Counter(enabled) {
1.11722 + this._enabled = enabled;
1.11723 + this.clear();
1.11724 + }
1.11725 + Counter.prototype.setEnabled = function (enabled) {
1.11726 + this._enabled = enabled;
1.11727 + };
1.11728 + Counter.prototype.clear = function () {
1.11729 + this._counts = Shumway.ObjectUtilities.createMap();
1.11730 + };
1.11731 + Counter.prototype.toJSON = function () {
1.11732 + return {
1.11733 + counts: this._counts
1.11734 + };
1.11735 + };
1.11736 + Counter.prototype.count = function (name, increment) {
1.11737 + if (typeof increment === 'undefined') {
1.11738 + increment = 1;
1.11739 + }
1.11740 + if (!this._enabled) {
1.11741 + return;
1.11742 + }
1.11743 + if (this._counts[name] === undefined) {
1.11744 + this._counts[name] = 0;
1.11745 + }
1.11746 + this._counts[name] += increment;
1.11747 + return this._counts[name];
1.11748 + };
1.11749 + Counter.prototype.trace = function (writer) {
1.11750 + for (var name in this._counts) {
1.11751 + writer.writeLn(name + ': ' + this._counts[name]);
1.11752 + }
1.11753 + };
1.11754 + Counter.prototype.traceSorted = function (writer) {
1.11755 + var pairs = [];
1.11756 + for (var name in this._counts) {
1.11757 + pairs.push([
1.11758 + name,
1.11759 + this._counts[name]
1.11760 + ]);
1.11761 + }
1.11762 + pairs.sort(function (a, b) {
1.11763 + return b[1] - a[1];
1.11764 + });
1.11765 + pairs.forEach(function (pair) {
1.11766 + writer.writeLn(pair[0] + ': ' + pair[1]);
1.11767 + });
1.11768 + };
1.11769 + return Counter;
1.11770 + }();
1.11771 + Metrics.Counter = Counter;
1.11772 + var Average = function () {
1.11773 + function Average(max) {
1.11774 + this._samples = new Float64Array(max);
1.11775 + this._count = 0;
1.11776 + this._index = 0;
1.11777 + }
1.11778 + Average.prototype.push = function (sample) {
1.11779 + if (this._count < this._samples.length) {
1.11780 + this._count++;
1.11781 + }
1.11782 + this._index++;
1.11783 + this._samples[this._index % this._samples.length] = sample;
1.11784 + };
1.11785 + Average.prototype.average = function () {
1.11786 + var sum = 0;
1.11787 + for (var i = 0; i < this._count; i++) {
1.11788 + sum += this._samples[i];
1.11789 + }
1.11790 + return sum / this._count;
1.11791 + };
1.11792 + return Average;
1.11793 + }();
1.11794 + Metrics.Average = Average;
1.11795 + }(Shumway.Metrics || (Shumway.Metrics = {})));
1.11796 + var Metrics = Shumway.Metrics;
1.11797 +}(Shumway || (Shumway = {})));
1.11798 +var Timer = Shumway.Metrics.Timer;
1.11799 +var Counter = new Shumway.Metrics.Counter(true);
1.11800 +var Timer = Shumway.Metrics.Timer;
1.11801 +var Counter = new Shumway.Metrics.Counter(true);
1.11802 +var FrameCounter = new Shumway.Metrics.Counter(true);
1.11803 +var systemOptions = new OptionSet('System Options');
1.11804 +var disassemble = systemOptions.register(new Option('d', 'disassemble', 'boolean', false, 'disassemble'));
1.11805 +var traceLevel = systemOptions.register(new Option('t', 'traceLevel', 'number', 0, 'trace level'));
1.11806 +window.print = function (s) {
1.11807 + console.log(s);
1.11808 +};
1.11809 +var CONSTANT_Undefined = 0;
1.11810 +var CONSTANT_Utf8 = 1;
1.11811 +var CONSTANT_Float = 2;
1.11812 +var CONSTANT_Int = 3;
1.11813 +var CONSTANT_UInt = 4;
1.11814 +var CONSTANT_PrivateNs = 5;
1.11815 +var CONSTANT_Double = 6;
1.11816 +var CONSTANT_QName = 7;
1.11817 +var CONSTANT_Namespace = 8;
1.11818 +var CONSTANT_Multiname = 9;
1.11819 +var CONSTANT_False = 10;
1.11820 +var CONSTANT_True = 11;
1.11821 +var CONSTANT_Null = 12;
1.11822 +var CONSTANT_QNameA = 13;
1.11823 +var CONSTANT_MultinameA = 14;
1.11824 +var CONSTANT_RTQName = 15;
1.11825 +var CONSTANT_RTQNameA = 16;
1.11826 +var CONSTANT_RTQNameL = 17;
1.11827 +var CONSTANT_RTQNameLA = 18;
1.11828 +var CONSTANT_NameL = 19;
1.11829 +var CONSTANT_NameLA = 20;
1.11830 +var CONSTANT_NamespaceSet = 21;
1.11831 +var CONSTANT_PackageNamespace = 22;
1.11832 +var CONSTANT_PackageInternalNs = 23;
1.11833 +var CONSTANT_ProtectedNamespace = 24;
1.11834 +var CONSTANT_ExplicitNamespace = 25;
1.11835 +var CONSTANT_StaticProtectedNs = 26;
1.11836 +var CONSTANT_MultinameL = 27;
1.11837 +var CONSTANT_MultinameLA = 28;
1.11838 +var CONSTANT_TypeName = 29;
1.11839 +var CONSTANT_ClassSealed = 1;
1.11840 +var CONSTANT_ClassFinal = 2;
1.11841 +var CONSTANT_ClassInterface = 4;
1.11842 +var CONSTANT_ClassProtectedNs = 8;
1.11843 +var TRAIT_Slot = 0;
1.11844 +var TRAIT_Method = 1;
1.11845 +var TRAIT_Getter = 2;
1.11846 +var TRAIT_Setter = 3;
1.11847 +var TRAIT_Class = 4;
1.11848 +var TRAIT_Function = 5;
1.11849 +var TRAIT_Const = 6;
1.11850 +var ATTR_Final = 1;
1.11851 +var ATTR_Override = 2;
1.11852 +var ATTR_Metadata = 4;
1.11853 +var SLOT_var = 0;
1.11854 +var SLOT_method = 1;
1.11855 +var SLOT_getter = 2;
1.11856 +var SLOT_setter = 3;
1.11857 +var SLOT_class = 4;
1.11858 +var SLOT_function = 6;
1.11859 +var METHOD_Arguments = 1;
1.11860 +var METHOD_Activation = 2;
1.11861 +var METHOD_Needrest = 4;
1.11862 +var METHOD_HasOptional = 8;
1.11863 +var METHOD_IgnoreRest = 16;
1.11864 +var METHOD_Native = 32;
1.11865 +var METHOD_Setsdxns = 64;
1.11866 +var METHOD_HasParamNames = 128;
1.11867 +var OP_bkpt = 1;
1.11868 +var OP_nop = 2;
1.11869 +var OP_throw = 3;
1.11870 +var OP_getsuper = 4;
1.11871 +var OP_setsuper = 5;
1.11872 +var OP_dxns = 6;
1.11873 +var OP_dxnslate = 7;
1.11874 +var OP_kill = 8;
1.11875 +var OP_label = 9;
1.11876 +var OP_lf32x4 = 10;
1.11877 +var OP_sf32x4 = 11;
1.11878 +var OP_ifnlt = 12;
1.11879 +var OP_ifnle = 13;
1.11880 +var OP_ifngt = 14;
1.11881 +var OP_ifnge = 15;
1.11882 +var OP_jump = 16;
1.11883 +var OP_iftrue = 17;
1.11884 +var OP_iffalse = 18;
1.11885 +var OP_ifeq = 19;
1.11886 +var OP_ifne = 20;
1.11887 +var OP_iflt = 21;
1.11888 +var OP_ifle = 22;
1.11889 +var OP_ifgt = 23;
1.11890 +var OP_ifge = 24;
1.11891 +var OP_ifstricteq = 25;
1.11892 +var OP_ifstrictne = 26;
1.11893 +var OP_lookupswitch = 27;
1.11894 +var OP_pushwith = 28;
1.11895 +var OP_popscope = 29;
1.11896 +var OP_nextname = 30;
1.11897 +var OP_hasnext = 31;
1.11898 +var OP_pushnull = 32;
1.11899 +var OP_pushundefined = 33;
1.11900 +var OP_pushfloat = 34;
1.11901 +var OP_nextvalue = 35;
1.11902 +var OP_pushbyte = 36;
1.11903 +var OP_pushshort = 37;
1.11904 +var OP_pushtrue = 38;
1.11905 +var OP_pushfalse = 39;
1.11906 +var OP_pushnan = 40;
1.11907 +var OP_pop = 41;
1.11908 +var OP_dup = 42;
1.11909 +var OP_swap = 43;
1.11910 +var OP_pushstring = 44;
1.11911 +var OP_pushint = 45;
1.11912 +var OP_pushuint = 46;
1.11913 +var OP_pushdouble = 47;
1.11914 +var OP_pushscope = 48;
1.11915 +var OP_pushnamespace = 49;
1.11916 +var OP_hasnext2 = 50;
1.11917 +var OP_li8 = 53;
1.11918 +var OP_li16 = 54;
1.11919 +var OP_li32 = 55;
1.11920 +var OP_lf32 = 56;
1.11921 +var OP_lf64 = 57;
1.11922 +var OP_si8 = 58;
1.11923 +var OP_si16 = 59;
1.11924 +var OP_si32 = 60;
1.11925 +var OP_sf32 = 61;
1.11926 +var OP_sf64 = 62;
1.11927 +var OP_newfunction = 64;
1.11928 +var OP_call = 65;
1.11929 +var OP_construct = 66;
1.11930 +var OP_callmethod = 67;
1.11931 +var OP_callstatic = 68;
1.11932 +var OP_callsuper = 69;
1.11933 +var OP_callproperty = 70;
1.11934 +var OP_returnvoid = 71;
1.11935 +var OP_returnvalue = 72;
1.11936 +var OP_constructsuper = 73;
1.11937 +var OP_constructprop = 74;
1.11938 +var OP_callsuperid = 75;
1.11939 +var OP_callproplex = 76;
1.11940 +var OP_callinterface = 77;
1.11941 +var OP_callsupervoid = 78;
1.11942 +var OP_callpropvoid = 79;
1.11943 +var OP_sxi1 = 80;
1.11944 +var OP_sxi8 = 81;
1.11945 +var OP_sxi16 = 82;
1.11946 +var OP_applytype = 83;
1.11947 +var OP_pushfloat4 = 84;
1.11948 +var OP_newobject = 85;
1.11949 +var OP_newarray = 86;
1.11950 +var OP_newactivation = 87;
1.11951 +var OP_newclass = 88;
1.11952 +var OP_getdescendants = 89;
1.11953 +var OP_newcatch = 90;
1.11954 +var OP_findpropstrict = 93;
1.11955 +var OP_findproperty = 94;
1.11956 +var OP_finddef = 95;
1.11957 +var OP_getlex = 96;
1.11958 +var OP_setproperty = 97;
1.11959 +var OP_getlocal = 98;
1.11960 +var OP_setlocal = 99;
1.11961 +var OP_getglobalscope = 100;
1.11962 +var OP_getscopeobject = 101;
1.11963 +var OP_getproperty = 102;
1.11964 +var OP_getouterscope = 103;
1.11965 +var OP_initproperty = 104;
1.11966 +var OP_setpropertylate = 105;
1.11967 +var OP_deleteproperty = 106;
1.11968 +var OP_deletepropertylate = 107;
1.11969 +var OP_getslot = 108;
1.11970 +var OP_setslot = 109;
1.11971 +var OP_getglobalslot = 110;
1.11972 +var OP_setglobalslot = 111;
1.11973 +var OP_convert_s = 112;
1.11974 +var OP_esc_xelem = 113;
1.11975 +var OP_esc_xattr = 114;
1.11976 +var OP_convert_i = 115;
1.11977 +var OP_convert_u = 116;
1.11978 +var OP_convert_d = 117;
1.11979 +var OP_convert_b = 118;
1.11980 +var OP_convert_o = 119;
1.11981 +var OP_checkfilter = 120;
1.11982 +var OP_convert_f = 121;
1.11983 +var OP_unplus = 122;
1.11984 +var OP_convert_f4 = 123;
1.11985 +var OP_coerce = 128;
1.11986 +var OP_coerce_b = 129;
1.11987 +var OP_coerce_a = 130;
1.11988 +var OP_coerce_i = 131;
1.11989 +var OP_coerce_d = 132;
1.11990 +var OP_coerce_s = 133;
1.11991 +var OP_astype = 134;
1.11992 +var OP_astypelate = 135;
1.11993 +var OP_coerce_u = 136;
1.11994 +var OP_coerce_o = 137;
1.11995 +var OP_negate = 144;
1.11996 +var OP_increment = 145;
1.11997 +var OP_inclocal = 146;
1.11998 +var OP_decrement = 147;
1.11999 +var OP_declocal = 148;
1.12000 +var OP_typeof = 149;
1.12001 +var OP_not = 150;
1.12002 +var OP_bitnot = 151;
1.12003 +var OP_add = 160;
1.12004 +var OP_subtract = 161;
1.12005 +var OP_multiply = 162;
1.12006 +var OP_divide = 163;
1.12007 +var OP_modulo = 164;
1.12008 +var OP_lshift = 165;
1.12009 +var OP_rshift = 166;
1.12010 +var OP_urshift = 167;
1.12011 +var OP_bitand = 168;
1.12012 +var OP_bitor = 169;
1.12013 +var OP_bitxor = 170;
1.12014 +var OP_equals = 171;
1.12015 +var OP_strictequals = 172;
1.12016 +var OP_lessthan = 173;
1.12017 +var OP_lessequals = 174;
1.12018 +var OP_greaterthan = 175;
1.12019 +var OP_greaterequals = 176;
1.12020 +var OP_instanceof = 177;
1.12021 +var OP_istype = 178;
1.12022 +var OP_istypelate = 179;
1.12023 +var OP_in = 180;
1.12024 +var OP_increment_i = 192;
1.12025 +var OP_decrement_i = 193;
1.12026 +var OP_inclocal_i = 194;
1.12027 +var OP_declocal_i = 195;
1.12028 +var OP_negate_i = 196;
1.12029 +var OP_add_i = 197;
1.12030 +var OP_subtract_i = 198;
1.12031 +var OP_multiply_i = 199;
1.12032 +var OP_getlocal0 = 208;
1.12033 +var OP_getlocal1 = 209;
1.12034 +var OP_getlocal2 = 210;
1.12035 +var OP_getlocal3 = 211;
1.12036 +var OP_setlocal0 = 212;
1.12037 +var OP_setlocal1 = 213;
1.12038 +var OP_setlocal2 = 214;
1.12039 +var OP_setlocal3 = 215;
1.12040 +var OP_invalid = 237;
1.12041 +var OP_debug = 239;
1.12042 +var OP_debugline = 240;
1.12043 +var OP_debugfile = 241;
1.12044 +var OP_bkptline = 242;
1.12045 +var OP_timestamp = 243;
1.12046 +var INT_MIN_VALUE = -2147483648;
1.12047 +var INT_MAX_VALUE = 2147483647;
1.12048 +var UINT_MIN_VALUE = 0;
1.12049 +var UINT_MAX_VALUE = 4294967295;
1.12050 +var SORT_CASEINSENSITIVE = 1;
1.12051 +var SORT_DESCENDING = 2;
1.12052 +var SORT_UNIQUESORT = 4;
1.12053 +var SORT_RETURNINDEXEDARRAY = 8;
1.12054 +var SORT_NUMERIC = 16;
1.12055 +var Shumway;
1.12056 +(function (Shumway) {
1.12057 + (function (AVM2) {
1.12058 + AVM2.Errors = {
1.12059 + CallOfNonFunctionError: {
1.12060 + code: 1006,
1.12061 + message: '%1 is not a function.'
1.12062 + },
1.12063 + ConvertNullToObjectError: {
1.12064 + code: 1009,
1.12065 + message: 'Cannot access a property or method of a null object reference.'
1.12066 + },
1.12067 + ConvertUndefinedToObjectError: {
1.12068 + code: 1010,
1.12069 + message: 'A term is undefined and has no properties.'
1.12070 + },
1.12071 + ClassNotFoundError: {
1.12072 + code: 1014,
1.12073 + message: 'Class %1 could not be found.'
1.12074 + },
1.12075 + CheckTypeFailedError: {
1.12076 + code: 1034,
1.12077 + message: 'Type Coercion failed: cannot convert %1 to %2.'
1.12078 + },
1.12079 + WrongArgumentCountError: {
1.12080 + code: 1063,
1.12081 + message: 'Argument count mismatch on %1. Expected %2, got %3.'
1.12082 + },
1.12083 + XMLMarkupMustBeWellFormed: {
1.12084 + code: 1088,
1.12085 + message: 'The markup in the document following the root element must be well-formed.'
1.12086 + },
1.12087 + OutOfRangeError: {
1.12088 + code: 1125,
1.12089 + message: 'The index %1 is out of range %2.'
1.12090 + },
1.12091 + VectorFixedError: {
1.12092 + code: 1126,
1.12093 + message: 'Cannot change the length of a fixed Vector.'
1.12094 + },
1.12095 + InvalidParamError: {
1.12096 + code: 2004,
1.12097 + message: 'One of the parameters is invalid.'
1.12098 + },
1.12099 + ParamRangeError: {
1.12100 + code: 2006,
1.12101 + message: 'The supplied index is out of bounds.'
1.12102 + },
1.12103 + NullPointerError: {
1.12104 + code: 2007,
1.12105 + message: 'Parameter %1 must be non-null.'
1.12106 + },
1.12107 + InvalidEnumError: {
1.12108 + code: 2008,
1.12109 + message: 'Parameter %1 must be one of the accepted values.'
1.12110 + },
1.12111 + ArgumentError: {
1.12112 + code: 2015,
1.12113 + message: 'Invalid BitmapData.'
1.12114 + },
1.12115 + CompressedDataError: {
1.12116 + code: 2058,
1.12117 + message: 'There was an error decompressing the data.'
1.12118 + },
1.12119 + SocketConnectError: {
1.12120 + code: 2011,
1.12121 + message: 'Socket connection failed to %1:%2.'
1.12122 + },
1.12123 + CantAddSelfError: {
1.12124 + code: 2024,
1.12125 + message: 'An object cannot be added as a child of itself.'
1.12126 + },
1.12127 + NotAChildError: {
1.12128 + code: 2025,
1.12129 + message: 'The supplied DisplayObject must be a child of the caller.'
1.12130 + },
1.12131 + ExternalInterfaceNotAvailableError: {
1.12132 + code: 2067,
1.12133 + message: 'The ExternalInterface is not available in this container. ExternalInterface requires Internet Explorer ActiveX, Firefox, Mozilla 1.7.5 and greater, or other browsers that support NPRuntime.'
1.12134 + }
1.12135 + };
1.12136 + function getErrorMessage(index) {
1.12137 + if (!Shumway.AVM2.Runtime.debuggerMode.value) {
1.12138 + return 'Error #' + index;
1.12139 + }
1.12140 + for (var k in AVM2.Errors) {
1.12141 + if (AVM2.Errors[k].code == index) {
1.12142 + return 'Error #' + index + ': ' + AVM2.Errors[k].message;
1.12143 + }
1.12144 + }
1.12145 + return 'Error #' + index + ': (unknown)';
1.12146 + }
1.12147 + AVM2.getErrorMessage = getErrorMessage;
1.12148 + function formatErrorMessage(error) {
1.12149 + var args = [];
1.12150 + for (var _i = 0; _i < arguments.length - 1; _i++) {
1.12151 + args[_i] = arguments[_i + 1];
1.12152 + }
1.12153 + var message = error.message;
1.12154 + Array.prototype.slice.call(arguments, 1).forEach(function (x, i) {
1.12155 + message = message.replace('%' + (i + 1), x);
1.12156 + });
1.12157 + return 'Error #' + error.code + ': ' + message;
1.12158 + }
1.12159 + AVM2.formatErrorMessage = formatErrorMessage;
1.12160 + function translateErrorMessage(error) {
1.12161 + if (error.type) {
1.12162 + switch (error.type) {
1.12163 + case 'undefined_method':
1.12164 + return formatErrorMessage(AVM2.Errors.CallOfNonFunctionError, 'value');
1.12165 + default:
1.12166 + throw Shumway.Debug.notImplemented(error.type);
1.12167 + }
1.12168 + } else {
1.12169 + if (error.message.indexOf('is not a function') >= 0) {
1.12170 + return formatErrorMessage(AVM2.Errors.CallOfNonFunctionError, 'value');
1.12171 + }
1.12172 + return error.message;
1.12173 + }
1.12174 + }
1.12175 + AVM2.translateErrorMessage = translateErrorMessage;
1.12176 + }(Shumway.AVM2 || (Shumway.AVM2 = {})));
1.12177 + var AVM2 = Shumway.AVM2;
1.12178 +}(Shumway || (Shumway = {})));
1.12179 +var Errors = Shumway.AVM2.Errors;
1.12180 +var getErrorMessage = Shumway.AVM2.getErrorMessage;
1.12181 +var formatErrorMessage = Shumway.AVM2.formatErrorMessage;
1.12182 +var translateErrorMessage = Shumway.AVM2.translateErrorMessage;
1.12183 +var Errors = Shumway.AVM2.Errors;
1.12184 +var getErrorMessage = Shumway.AVM2.getErrorMessage;
1.12185 +var formatErrorMessage = Shumway.AVM2.formatErrorMessage;
1.12186 +var translateErrorMessage = Shumway.AVM2.translateErrorMessage;
1.12187 +var Shumway;
1.12188 +(function (Shumway) {
1.12189 + (function (AVM2) {
1.12190 + AVM2.opcodeTable = [
1.12191 + null,
1.12192 + {
1.12193 + name: 'bkpt',
1.12194 + canThrow: false,
1.12195 + operands: []
1.12196 + },
1.12197 + {
1.12198 + name: 'nop',
1.12199 + canThrow: false,
1.12200 + operands: []
1.12201 + },
1.12202 + {
1.12203 + name: 'throw',
1.12204 + canThrow: true,
1.12205 + operands: []
1.12206 + },
1.12207 + {
1.12208 + name: 'getsuper',
1.12209 + canThrow: true,
1.12210 + operands: [
1.12211 + {
1.12212 + name: 'index',
1.12213 + size: 'u30',
1.12214 + type: ''
1.12215 + }
1.12216 + ]
1.12217 + },
1.12218 + {
1.12219 + name: 'setsuper',
1.12220 + canThrow: true,
1.12221 + operands: [
1.12222 + {
1.12223 + name: 'index',
1.12224 + size: 'u30',
1.12225 + type: ''
1.12226 + }
1.12227 + ]
1.12228 + },
1.12229 + {
1.12230 + name: 'dxns',
1.12231 + canThrow: true,
1.12232 + operands: [
1.12233 + {
1.12234 + name: 'index',
1.12235 + size: 'u30',
1.12236 + type: ''
1.12237 + }
1.12238 + ]
1.12239 + },
1.12240 + {
1.12241 + name: 'dxnslate',
1.12242 + canThrow: true,
1.12243 + operands: []
1.12244 + },
1.12245 + {
1.12246 + name: 'kill',
1.12247 + canThrow: false,
1.12248 + operands: [
1.12249 + {
1.12250 + name: 'index',
1.12251 + size: 'u30',
1.12252 + type: ''
1.12253 + }
1.12254 + ]
1.12255 + },
1.12256 + {
1.12257 + name: 'label',
1.12258 + canThrow: false,
1.12259 + operands: []
1.12260 + },
1.12261 + {
1.12262 + name: 'lf32x4',
1.12263 + canThrow: true,
1.12264 + operands: []
1.12265 + },
1.12266 + {
1.12267 + name: 'sf32x4',
1.12268 + canThrow: true,
1.12269 + operands: []
1.12270 + },
1.12271 + {
1.12272 + name: 'ifnlt',
1.12273 + canThrow: true,
1.12274 + operands: [
1.12275 + {
1.12276 + name: 'offset',
1.12277 + size: 's24',
1.12278 + type: ''
1.12279 + }
1.12280 + ]
1.12281 + },
1.12282 + {
1.12283 + name: 'ifnle',
1.12284 + canThrow: true,
1.12285 + operands: [
1.12286 + {
1.12287 + name: 'offset',
1.12288 + size: 's24',
1.12289 + type: ''
1.12290 + }
1.12291 + ]
1.12292 + },
1.12293 + {
1.12294 + name: 'ifngt',
1.12295 + canThrow: true,
1.12296 + operands: [
1.12297 + {
1.12298 + name: 'offset',
1.12299 + size: 's24',
1.12300 + type: ''
1.12301 + }
1.12302 + ]
1.12303 + },
1.12304 + {
1.12305 + name: 'ifnge',
1.12306 + canThrow: true,
1.12307 + operands: [
1.12308 + {
1.12309 + name: 'offset',
1.12310 + size: 's24',
1.12311 + type: ''
1.12312 + }
1.12313 + ]
1.12314 + },
1.12315 + {
1.12316 + name: 'jump',
1.12317 + canThrow: false,
1.12318 + operands: [
1.12319 + {
1.12320 + name: 'offset',
1.12321 + size: 's24',
1.12322 + type: ''
1.12323 + }
1.12324 + ]
1.12325 + },
1.12326 + {
1.12327 + name: 'iftrue',
1.12328 + canThrow: false,
1.12329 + operands: [
1.12330 + {
1.12331 + name: 'offset',
1.12332 + size: 's24',
1.12333 + type: ''
1.12334 + }
1.12335 + ]
1.12336 + },
1.12337 + {
1.12338 + name: 'iffalse',
1.12339 + canThrow: false,
1.12340 + operands: [
1.12341 + {
1.12342 + name: 'offset',
1.12343 + size: 's24',
1.12344 + type: ''
1.12345 + }
1.12346 + ]
1.12347 + },
1.12348 + {
1.12349 + name: 'ifeq',
1.12350 + canThrow: true,
1.12351 + operands: [
1.12352 + {
1.12353 + name: 'offset',
1.12354 + size: 's24',
1.12355 + type: ''
1.12356 + }
1.12357 + ]
1.12358 + },
1.12359 + {
1.12360 + name: 'ifne',
1.12361 + canThrow: true,
1.12362 + operands: [
1.12363 + {
1.12364 + name: 'offset',
1.12365 + size: 's24',
1.12366 + type: ''
1.12367 + }
1.12368 + ]
1.12369 + },
1.12370 + {
1.12371 + name: 'iflt',
1.12372 + canThrow: true,
1.12373 + operands: [
1.12374 + {
1.12375 + name: 'offset',
1.12376 + size: 's24',
1.12377 + type: ''
1.12378 + }
1.12379 + ]
1.12380 + },
1.12381 + {
1.12382 + name: 'ifle',
1.12383 + canThrow: true,
1.12384 + operands: [
1.12385 + {
1.12386 + name: 'offset',
1.12387 + size: 's24',
1.12388 + type: ''
1.12389 + }
1.12390 + ]
1.12391 + },
1.12392 + {
1.12393 + name: 'ifgt',
1.12394 + canThrow: true,
1.12395 + operands: [
1.12396 + {
1.12397 + name: 'offset',
1.12398 + size: 's24',
1.12399 + type: ''
1.12400 + }
1.12401 + ]
1.12402 + },
1.12403 + {
1.12404 + name: 'ifge',
1.12405 + canThrow: true,
1.12406 + operands: [
1.12407 + {
1.12408 + name: 'offset',
1.12409 + size: 's24',
1.12410 + type: ''
1.12411 + }
1.12412 + ]
1.12413 + },
1.12414 + {
1.12415 + name: 'ifstricteq',
1.12416 + canThrow: false,
1.12417 + operands: [
1.12418 + {
1.12419 + name: 'offset',
1.12420 + size: 's24',
1.12421 + type: ''
1.12422 + }
1.12423 + ]
1.12424 + },
1.12425 + {
1.12426 + name: 'ifstrictne',
1.12427 + canThrow: false,
1.12428 + operands: [
1.12429 + {
1.12430 + name: 'offset',
1.12431 + size: 's24',
1.12432 + type: ''
1.12433 + }
1.12434 + ]
1.12435 + },
1.12436 + {
1.12437 + name: 'lookupswitch',
1.12438 + canThrow: false,
1.12439 + operands: null
1.12440 + },
1.12441 + {
1.12442 + name: 'pushwith',
1.12443 + canThrow: false,
1.12444 + operands: []
1.12445 + },
1.12446 + {
1.12447 + name: 'popscope',
1.12448 + canThrow: false,
1.12449 + operands: []
1.12450 + },
1.12451 + {
1.12452 + name: 'nextname',
1.12453 + canThrow: true,
1.12454 + operands: []
1.12455 + },
1.12456 + {
1.12457 + name: 'hasnext',
1.12458 + canThrow: true,
1.12459 + operands: []
1.12460 + },
1.12461 + {
1.12462 + name: 'pushnull',
1.12463 + canThrow: false,
1.12464 + operands: []
1.12465 + },
1.12466 + {
1.12467 + name: 'pushundefined',
1.12468 + canThrow: false,
1.12469 + operands: []
1.12470 + },
1.12471 + null,
1.12472 + {
1.12473 + name: 'nextvalue',
1.12474 + canThrow: true,
1.12475 + operands: []
1.12476 + },
1.12477 + {
1.12478 + name: 'pushbyte',
1.12479 + canThrow: false,
1.12480 + operands: [
1.12481 + {
1.12482 + name: 'value',
1.12483 + size: 's08',
1.12484 + type: ''
1.12485 + }
1.12486 + ]
1.12487 + },
1.12488 + {
1.12489 + name: 'pushshort',
1.12490 + canThrow: false,
1.12491 + operands: [
1.12492 + {
1.12493 + name: 'value',
1.12494 + size: 's16',
1.12495 + type: ''
1.12496 + }
1.12497 + ]
1.12498 + },
1.12499 + {
1.12500 + name: 'pushtrue',
1.12501 + canThrow: false,
1.12502 + operands: []
1.12503 + },
1.12504 + {
1.12505 + name: 'pushfalse',
1.12506 + canThrow: false,
1.12507 + operands: []
1.12508 + },
1.12509 + {
1.12510 + name: 'pushnan',
1.12511 + canThrow: false,
1.12512 + operands: []
1.12513 + },
1.12514 + {
1.12515 + name: 'pop',
1.12516 + canThrow: false,
1.12517 + operands: []
1.12518 + },
1.12519 + {
1.12520 + name: 'dup',
1.12521 + canThrow: false,
1.12522 + operands: []
1.12523 + },
1.12524 + {
1.12525 + name: 'swap',
1.12526 + canThrow: false,
1.12527 + operands: []
1.12528 + },
1.12529 + {
1.12530 + name: 'pushstring',
1.12531 + canThrow: false,
1.12532 + operands: [
1.12533 + {
1.12534 + name: 'index',
1.12535 + size: 'u30',
1.12536 + type: 'S'
1.12537 + }
1.12538 + ]
1.12539 + },
1.12540 + {
1.12541 + name: 'pushint',
1.12542 + canThrow: false,
1.12543 + operands: [
1.12544 + {
1.12545 + name: 'index',
1.12546 + size: 'u30',
1.12547 + type: 'I'
1.12548 + }
1.12549 + ]
1.12550 + },
1.12551 + {
1.12552 + name: 'pushuint',
1.12553 + canThrow: false,
1.12554 + operands: [
1.12555 + {
1.12556 + name: 'index',
1.12557 + size: 'u30',
1.12558 + type: 'U'
1.12559 + }
1.12560 + ]
1.12561 + },
1.12562 + {
1.12563 + name: 'pushdouble',
1.12564 + canThrow: false,
1.12565 + operands: [
1.12566 + {
1.12567 + name: 'index',
1.12568 + size: 'u30',
1.12569 + type: 'D'
1.12570 + }
1.12571 + ]
1.12572 + },
1.12573 + {
1.12574 + name: 'pushscope',
1.12575 + canThrow: false,
1.12576 + operands: []
1.12577 + },
1.12578 + {
1.12579 + name: 'pushnamespace',
1.12580 + canThrow: false,
1.12581 + operands: [
1.12582 + {
1.12583 + name: 'index',
1.12584 + size: 'u30',
1.12585 + type: 'N'
1.12586 + }
1.12587 + ]
1.12588 + },
1.12589 + {
1.12590 + name: 'hasnext2',
1.12591 + canThrow: true,
1.12592 + operands: [
1.12593 + {
1.12594 + name: 'object',
1.12595 + size: 'u30',
1.12596 + type: ''
1.12597 + },
1.12598 + {
1.12599 + name: 'index',
1.12600 + size: 'u30',
1.12601 + type: ''
1.12602 + }
1.12603 + ]
1.12604 + },
1.12605 + {
1.12606 + name: 'lix8',
1.12607 + canThrow: true,
1.12608 + operands: null
1.12609 + },
1.12610 + {
1.12611 + name: 'lix16',
1.12612 + canThrow: true,
1.12613 + operands: null
1.12614 + },
1.12615 + {
1.12616 + name: 'li8',
1.12617 + canThrow: true,
1.12618 + operands: []
1.12619 + },
1.12620 + {
1.12621 + name: 'li16',
1.12622 + canThrow: true,
1.12623 + operands: []
1.12624 + },
1.12625 + {
1.12626 + name: 'li32',
1.12627 + canThrow: true,
1.12628 + operands: []
1.12629 + },
1.12630 + {
1.12631 + name: 'lf32',
1.12632 + canThrow: true,
1.12633 + operands: []
1.12634 + },
1.12635 + {
1.12636 + name: 'lf64',
1.12637 + canThrow: true,
1.12638 + operands: []
1.12639 + },
1.12640 + {
1.12641 + name: 'si8',
1.12642 + canThrow: true,
1.12643 + operands: []
1.12644 + },
1.12645 + {
1.12646 + name: 'si16',
1.12647 + canThrow: true,
1.12648 + operands: []
1.12649 + },
1.12650 + {
1.12651 + name: 'si32',
1.12652 + canThrow: true,
1.12653 + operands: []
1.12654 + },
1.12655 + {
1.12656 + name: 'sf32',
1.12657 + canThrow: true,
1.12658 + operands: []
1.12659 + },
1.12660 + {
1.12661 + name: 'sf64',
1.12662 + canThrow: true,
1.12663 + operands: []
1.12664 + },
1.12665 + null,
1.12666 + {
1.12667 + name: 'newfunction',
1.12668 + canThrow: true,
1.12669 + operands: [
1.12670 + {
1.12671 + name: 'index',
1.12672 + size: 'u30',
1.12673 + type: 'MI'
1.12674 + }
1.12675 + ]
1.12676 + },
1.12677 + {
1.12678 + name: 'call',
1.12679 + canThrow: true,
1.12680 + operands: [
1.12681 + {
1.12682 + name: 'argCount',
1.12683 + size: 'u30',
1.12684 + type: ''
1.12685 + }
1.12686 + ]
1.12687 + },
1.12688 + {
1.12689 + name: 'construct',
1.12690 + canThrow: true,
1.12691 + operands: [
1.12692 + {
1.12693 + name: 'argCount',
1.12694 + size: 'u30',
1.12695 + type: ''
1.12696 + }
1.12697 + ]
1.12698 + },
1.12699 + {
1.12700 + name: 'callmethod',
1.12701 + canThrow: true,
1.12702 + operands: [
1.12703 + {
1.12704 + name: 'index',
1.12705 + size: 'u30',
1.12706 + type: ''
1.12707 + },
1.12708 + {
1.12709 + name: 'argCount',
1.12710 + size: 'u30',
1.12711 + type: ''
1.12712 + }
1.12713 + ]
1.12714 + },
1.12715 + {
1.12716 + name: 'callstatic',
1.12717 + canThrow: true,
1.12718 + operands: [
1.12719 + {
1.12720 + name: 'index',
1.12721 + size: 'u30',
1.12722 + type: 'MI'
1.12723 + },
1.12724 + {
1.12725 + name: 'argCount',
1.12726 + size: 'u30',
1.12727 + type: ''
1.12728 + }
1.12729 + ]
1.12730 + },
1.12731 + {
1.12732 + name: 'callsuper',
1.12733 + canThrow: true,
1.12734 + operands: [
1.12735 + {
1.12736 + name: 'index',
1.12737 + size: 'u30',
1.12738 + type: 'M'
1.12739 + },
1.12740 + {
1.12741 + name: 'argCount',
1.12742 + size: 'u30',
1.12743 + type: ''
1.12744 + }
1.12745 + ]
1.12746 + },
1.12747 + {
1.12748 + name: 'callproperty',
1.12749 + canThrow: true,
1.12750 + operands: [
1.12751 + {
1.12752 + name: 'index',
1.12753 + size: 'u30',
1.12754 + type: 'M'
1.12755 + },
1.12756 + {
1.12757 + name: 'argCount',
1.12758 + size: 'u30',
1.12759 + type: ''
1.12760 + }
1.12761 + ]
1.12762 + },
1.12763 + {
1.12764 + name: 'returnvoid',
1.12765 + canThrow: false,
1.12766 + operands: []
1.12767 + },
1.12768 + {
1.12769 + name: 'returnvalue',
1.12770 + canThrow: true,
1.12771 + operands: []
1.12772 + },
1.12773 + {
1.12774 + name: 'constructsuper',
1.12775 + canThrow: true,
1.12776 + operands: [
1.12777 + {
1.12778 + name: 'argCount',
1.12779 + size: 'u30',
1.12780 + type: ''
1.12781 + }
1.12782 + ]
1.12783 + },
1.12784 + {
1.12785 + name: 'constructprop',
1.12786 + canThrow: true,
1.12787 + operands: [
1.12788 + {
1.12789 + name: 'index',
1.12790 + size: 'u30',
1.12791 + type: 'M'
1.12792 + },
1.12793 + {
1.12794 + name: 'argCount',
1.12795 + size: 'u30',
1.12796 + type: ''
1.12797 + }
1.12798 + ]
1.12799 + },
1.12800 + {
1.12801 + name: 'callsuperid',
1.12802 + canThrow: true,
1.12803 + operands: null
1.12804 + },
1.12805 + {
1.12806 + name: 'callproplex',
1.12807 + canThrow: true,
1.12808 + operands: [
1.12809 + {
1.12810 + name: 'index',
1.12811 + size: 'u30',
1.12812 + type: 'M'
1.12813 + },
1.12814 + {
1.12815 + name: 'argCount',
1.12816 + size: 'u30',
1.12817 + type: ''
1.12818 + }
1.12819 + ]
1.12820 + },
1.12821 + {
1.12822 + name: 'callinterface',
1.12823 + canThrow: true,
1.12824 + operands: null
1.12825 + },
1.12826 + {
1.12827 + name: 'callsupervoid',
1.12828 + canThrow: true,
1.12829 + operands: [
1.12830 + {
1.12831 + name: 'index',
1.12832 + size: 'u30',
1.12833 + type: 'M'
1.12834 + },
1.12835 + {
1.12836 + name: 'argCount',
1.12837 + size: 'u30',
1.12838 + type: ''
1.12839 + }
1.12840 + ]
1.12841 + },
1.12842 + {
1.12843 + name: 'callpropvoid',
1.12844 + canThrow: true,
1.12845 + operands: [
1.12846 + {
1.12847 + name: 'index',
1.12848 + size: 'u30',
1.12849 + type: 'M'
1.12850 + },
1.12851 + {
1.12852 + name: 'argCount',
1.12853 + size: 'u30',
1.12854 + type: ''
1.12855 + }
1.12856 + ]
1.12857 + },
1.12858 + {
1.12859 + name: 'sxi1',
1.12860 + canThrow: false,
1.12861 + operands: []
1.12862 + },
1.12863 + {
1.12864 + name: 'sxi8',
1.12865 + canThrow: false,
1.12866 + operands: []
1.12867 + },
1.12868 + {
1.12869 + name: 'sxi16',
1.12870 + canThrow: false,
1.12871 + operands: []
1.12872 + },
1.12873 + {
1.12874 + name: 'applytype',
1.12875 + canThrow: true,
1.12876 + operands: [
1.12877 + {
1.12878 + name: 'argCount',
1.12879 + size: 'u30',
1.12880 + type: ''
1.12881 + }
1.12882 + ]
1.12883 + },
1.12884 + {
1.12885 + name: 'pushfloat4',
1.12886 + canThrow: false,
1.12887 + operands: null
1.12888 + },
1.12889 + {
1.12890 + name: 'newobject',
1.12891 + canThrow: true,
1.12892 + operands: [
1.12893 + {
1.12894 + name: 'argCount',
1.12895 + size: 'u30',
1.12896 + type: ''
1.12897 + }
1.12898 + ]
1.12899 + },
1.12900 + {
1.12901 + name: 'newarray',
1.12902 + canThrow: true,
1.12903 + operands: [
1.12904 + {
1.12905 + name: 'argCount',
1.12906 + size: 'u30',
1.12907 + type: ''
1.12908 + }
1.12909 + ]
1.12910 + },
1.12911 + {
1.12912 + name: 'newactivation',
1.12913 + canThrow: true,
1.12914 + operands: []
1.12915 + },
1.12916 + {
1.12917 + name: 'newclass',
1.12918 + canThrow: true,
1.12919 + operands: [
1.12920 + {
1.12921 + name: 'index',
1.12922 + size: 'u30',
1.12923 + type: 'CI'
1.12924 + }
1.12925 + ]
1.12926 + },
1.12927 + {
1.12928 + name: 'getdescendants',
1.12929 + canThrow: true,
1.12930 + operands: [
1.12931 + {
1.12932 + name: 'index',
1.12933 + size: 'u30',
1.12934 + type: 'M'
1.12935 + }
1.12936 + ]
1.12937 + },
1.12938 + {
1.12939 + name: 'newcatch',
1.12940 + canThrow: true,
1.12941 + operands: [
1.12942 + {
1.12943 + name: 'index',
1.12944 + size: 'u30',
1.12945 + type: 'EI'
1.12946 + }
1.12947 + ]
1.12948 + },
1.12949 + {
1.12950 + name: 'findpropglobalstrict',
1.12951 + canThrow: true,
1.12952 + operands: null
1.12953 + },
1.12954 + {
1.12955 + name: 'findpropglobal',
1.12956 + canThrow: true,
1.12957 + operands: null
1.12958 + },
1.12959 + {
1.12960 + name: 'findpropstrict',
1.12961 + canThrow: true,
1.12962 + operands: [
1.12963 + {
1.12964 + name: 'index',
1.12965 + size: 'u30',
1.12966 + type: 'M'
1.12967 + }
1.12968 + ]
1.12969 + },
1.12970 + {
1.12971 + name: 'findproperty',
1.12972 + canThrow: true,
1.12973 + operands: [
1.12974 + {
1.12975 + name: 'index',
1.12976 + size: 'u30',
1.12977 + type: 'M'
1.12978 + }
1.12979 + ]
1.12980 + },
1.12981 + {
1.12982 + name: 'finddef',
1.12983 + canThrow: true,
1.12984 + operands: null
1.12985 + },
1.12986 + {
1.12987 + name: 'getlex',
1.12988 + canThrow: true,
1.12989 + operands: [
1.12990 + {
1.12991 + name: 'index',
1.12992 + size: 'u30',
1.12993 + type: 'M'
1.12994 + }
1.12995 + ]
1.12996 + },
1.12997 + {
1.12998 + name: 'setproperty',
1.12999 + canThrow: true,
1.13000 + operands: [
1.13001 + {
1.13002 + name: 'index',
1.13003 + size: 'u30',
1.13004 + type: 'M'
1.13005 + }
1.13006 + ]
1.13007 + },
1.13008 + {
1.13009 + name: 'getlocal',
1.13010 + canThrow: false,
1.13011 + operands: [
1.13012 + {
1.13013 + name: 'index',
1.13014 + size: 'u30',
1.13015 + type: ''
1.13016 + }
1.13017 + ]
1.13018 + },
1.13019 + {
1.13020 + name: 'setlocal',
1.13021 + canThrow: false,
1.13022 + operands: [
1.13023 + {
1.13024 + name: 'index',
1.13025 + size: 'u30',
1.13026 + type: ''
1.13027 + }
1.13028 + ]
1.13029 + },
1.13030 + {
1.13031 + name: 'getglobalscope',
1.13032 + canThrow: false,
1.13033 + operands: []
1.13034 + },
1.13035 + {
1.13036 + name: 'getscopeobject',
1.13037 + canThrow: false,
1.13038 + operands: [
1.13039 + {
1.13040 + name: 'index',
1.13041 + size: 'u30',
1.13042 + type: ''
1.13043 + }
1.13044 + ]
1.13045 + },
1.13046 + {
1.13047 + name: 'getproperty',
1.13048 + canThrow: true,
1.13049 + operands: [
1.13050 + {
1.13051 + name: 'index',
1.13052 + size: 'u30',
1.13053 + type: 'M'
1.13054 + }
1.13055 + ]
1.13056 + },
1.13057 + {
1.13058 + name: 'getouterscope',
1.13059 + canThrow: false,
1.13060 + operands: null
1.13061 + },
1.13062 + {
1.13063 + name: 'initproperty',
1.13064 + canThrow: true,
1.13065 + operands: [
1.13066 + {
1.13067 + name: 'index',
1.13068 + size: 'u30',
1.13069 + type: 'M'
1.13070 + }
1.13071 + ]
1.13072 + },
1.13073 + null,
1.13074 + {
1.13075 + name: 'deleteproperty',
1.13076 + canThrow: true,
1.13077 + operands: [
1.13078 + {
1.13079 + name: 'index',
1.13080 + size: 'u30',
1.13081 + type: 'M'
1.13082 + }
1.13083 + ]
1.13084 + },
1.13085 + null,
1.13086 + {
1.13087 + name: 'getslot',
1.13088 + canThrow: true,
1.13089 + operands: [
1.13090 + {
1.13091 + name: 'index',
1.13092 + size: 'u30',
1.13093 + type: ''
1.13094 + }
1.13095 + ]
1.13096 + },
1.13097 + {
1.13098 + name: 'setslot',
1.13099 + canThrow: true,
1.13100 + operands: [
1.13101 + {
1.13102 + name: 'index',
1.13103 + size: 'u30',
1.13104 + type: ''
1.13105 + }
1.13106 + ]
1.13107 + },
1.13108 + {
1.13109 + name: 'getglobalslot',
1.13110 + canThrow: false,
1.13111 + operands: [
1.13112 + {
1.13113 + name: 'index',
1.13114 + size: 'u30',
1.13115 + type: ''
1.13116 + }
1.13117 + ]
1.13118 + },
1.13119 + {
1.13120 + name: 'setglobalslot',
1.13121 + canThrow: false,
1.13122 + operands: [
1.13123 + {
1.13124 + name: 'index',
1.13125 + size: 'u30',
1.13126 + type: ''
1.13127 + }
1.13128 + ]
1.13129 + },
1.13130 + {
1.13131 + name: 'convert_s',
1.13132 + canThrow: true,
1.13133 + operands: []
1.13134 + },
1.13135 + {
1.13136 + name: 'esc_xelem',
1.13137 + canThrow: true,
1.13138 + operands: []
1.13139 + },
1.13140 + {
1.13141 + name: 'esc_xattr',
1.13142 + canThrow: true,
1.13143 + operands: []
1.13144 + },
1.13145 + {
1.13146 + name: 'convert_i',
1.13147 + canThrow: true,
1.13148 + operands: []
1.13149 + },
1.13150 + {
1.13151 + name: 'convert_u',
1.13152 + canThrow: true,
1.13153 + operands: []
1.13154 + },
1.13155 + {
1.13156 + name: 'convert_d',
1.13157 + canThrow: true,
1.13158 + operands: []
1.13159 + },
1.13160 + {
1.13161 + name: 'convert_b',
1.13162 + canThrow: true,
1.13163 + operands: []
1.13164 + },
1.13165 + {
1.13166 + name: 'convert_o',
1.13167 + canThrow: true,
1.13168 + operands: []
1.13169 + },
1.13170 + {
1.13171 + name: 'checkfilter',
1.13172 + canThrow: true,
1.13173 + operands: []
1.13174 + },
1.13175 + {
1.13176 + name: 'convert_f',
1.13177 + canThrow: true,
1.13178 + operands: []
1.13179 + },
1.13180 + {
1.13181 + name: 'unplus',
1.13182 + canThrow: true,
1.13183 + operands: []
1.13184 + },
1.13185 + {
1.13186 + name: 'convert_f4',
1.13187 + canThrow: true,
1.13188 + operands: []
1.13189 + },
1.13190 + null,
1.13191 + null,
1.13192 + null,
1.13193 + null,
1.13194 + {
1.13195 + name: 'coerce',
1.13196 + canThrow: true,
1.13197 + operands: [
1.13198 + {
1.13199 + name: 'index',
1.13200 + size: 'u30',
1.13201 + type: 'M'
1.13202 + }
1.13203 + ]
1.13204 + },
1.13205 + {
1.13206 + name: 'coerce_b',
1.13207 + canThrow: true,
1.13208 + operands: []
1.13209 + },
1.13210 + {
1.13211 + name: 'coerce_a',
1.13212 + canThrow: true,
1.13213 + operands: []
1.13214 + },
1.13215 + {
1.13216 + name: 'coerce_i',
1.13217 + canThrow: true,
1.13218 + operands: []
1.13219 + },
1.13220 + {
1.13221 + name: 'coerce_d',
1.13222 + canThrow: true,
1.13223 + operands: []
1.13224 + },
1.13225 + {
1.13226 + name: 'coerce_s',
1.13227 + canThrow: true,
1.13228 + operands: []
1.13229 + },
1.13230 + {
1.13231 + name: 'astype',
1.13232 + canThrow: true,
1.13233 + operands: [
1.13234 + {
1.13235 + name: 'index',
1.13236 + size: 'u30',
1.13237 + type: 'M'
1.13238 + }
1.13239 + ]
1.13240 + },
1.13241 + {
1.13242 + name: 'astypelate',
1.13243 + canThrow: true,
1.13244 + operands: []
1.13245 + },
1.13246 + {
1.13247 + name: 'coerce_u',
1.13248 + canThrow: true,
1.13249 + operands: []
1.13250 + },
1.13251 + {
1.13252 + name: 'coerce_o',
1.13253 + canThrow: true,
1.13254 + operands: []
1.13255 + },
1.13256 + null,
1.13257 + null,
1.13258 + null,
1.13259 + null,
1.13260 + null,
1.13261 + null,
1.13262 + {
1.13263 + name: 'negate',
1.13264 + canThrow: true,
1.13265 + operands: []
1.13266 + },
1.13267 + {
1.13268 + name: 'increment',
1.13269 + canThrow: true,
1.13270 + operands: []
1.13271 + },
1.13272 + {
1.13273 + name: 'inclocal',
1.13274 + canThrow: true,
1.13275 + operands: [
1.13276 + {
1.13277 + name: 'index',
1.13278 + size: 'u30',
1.13279 + type: ''
1.13280 + }
1.13281 + ]
1.13282 + },
1.13283 + {
1.13284 + name: 'decrement',
1.13285 + canThrow: true,
1.13286 + operands: []
1.13287 + },
1.13288 + {
1.13289 + name: 'declocal',
1.13290 + canThrow: true,
1.13291 + operands: [
1.13292 + {
1.13293 + name: 'index',
1.13294 + size: 'u30',
1.13295 + type: ''
1.13296 + }
1.13297 + ]
1.13298 + },
1.13299 + {
1.13300 + name: 'typeof',
1.13301 + canThrow: false,
1.13302 + operands: []
1.13303 + },
1.13304 + {
1.13305 + name: 'not',
1.13306 + canThrow: false,
1.13307 + operands: []
1.13308 + },
1.13309 + {
1.13310 + name: 'bitnot',
1.13311 + canThrow: true,
1.13312 + operands: []
1.13313 + },
1.13314 + null,
1.13315 + null,
1.13316 + null,
1.13317 + null,
1.13318 + null,
1.13319 + null,
1.13320 + null,
1.13321 + null,
1.13322 + {
1.13323 + name: 'add',
1.13324 + canThrow: true,
1.13325 + operands: []
1.13326 + },
1.13327 + {
1.13328 + name: 'subtract',
1.13329 + canThrow: true,
1.13330 + operands: []
1.13331 + },
1.13332 + {
1.13333 + name: 'multiply',
1.13334 + canThrow: true,
1.13335 + operands: []
1.13336 + },
1.13337 + {
1.13338 + name: 'divide',
1.13339 + canThrow: true,
1.13340 + operands: []
1.13341 + },
1.13342 + {
1.13343 + name: 'modulo',
1.13344 + canThrow: true,
1.13345 + operands: []
1.13346 + },
1.13347 + {
1.13348 + name: 'lshift',
1.13349 + canThrow: true,
1.13350 + operands: []
1.13351 + },
1.13352 + {
1.13353 + name: 'rshift',
1.13354 + canThrow: true,
1.13355 + operands: []
1.13356 + },
1.13357 + {
1.13358 + name: 'urshift',
1.13359 + canThrow: true,
1.13360 + operands: []
1.13361 + },
1.13362 + {
1.13363 + name: 'bitand',
1.13364 + canThrow: true,
1.13365 + operands: []
1.13366 + },
1.13367 + {
1.13368 + name: 'bitor',
1.13369 + canThrow: true,
1.13370 + operands: []
1.13371 + },
1.13372 + {
1.13373 + name: 'bitxor',
1.13374 + canThrow: true,
1.13375 + operands: []
1.13376 + },
1.13377 + {
1.13378 + name: 'equals',
1.13379 + canThrow: true,
1.13380 + operands: []
1.13381 + },
1.13382 + {
1.13383 + name: 'strictequals',
1.13384 + canThrow: true,
1.13385 + operands: []
1.13386 + },
1.13387 + {
1.13388 + name: 'lessthan',
1.13389 + canThrow: true,
1.13390 + operands: []
1.13391 + },
1.13392 + {
1.13393 + name: 'lessequals',
1.13394 + canThrow: true,
1.13395 + operands: []
1.13396 + },
1.13397 + {
1.13398 + name: 'greaterthan',
1.13399 + canThrow: true,
1.13400 + operands: []
1.13401 + },
1.13402 + {
1.13403 + name: 'greaterequals',
1.13404 + canThrow: true,
1.13405 + operands: []
1.13406 + },
1.13407 + {
1.13408 + name: 'instanceof',
1.13409 + canThrow: true,
1.13410 + operands: []
1.13411 + },
1.13412 + {
1.13413 + name: 'istype',
1.13414 + canThrow: true,
1.13415 + operands: [
1.13416 + {
1.13417 + name: 'index',
1.13418 + size: 'u30',
1.13419 + type: 'M'
1.13420 + }
1.13421 + ]
1.13422 + },
1.13423 + {
1.13424 + name: 'istypelate',
1.13425 + canThrow: true,
1.13426 + operands: []
1.13427 + },
1.13428 + {
1.13429 + name: 'in',
1.13430 + canThrow: true,
1.13431 + operands: []
1.13432 + },
1.13433 + null,
1.13434 + null,
1.13435 + null,
1.13436 + null,
1.13437 + null,
1.13438 + null,
1.13439 + null,
1.13440 + null,
1.13441 + null,
1.13442 + null,
1.13443 + null,
1.13444 + {
1.13445 + name: 'increment_i',
1.13446 + canThrow: true,
1.13447 + operands: []
1.13448 + },
1.13449 + {
1.13450 + name: 'decrement_i',
1.13451 + canThrow: true,
1.13452 + operands: []
1.13453 + },
1.13454 + {
1.13455 + name: 'inclocal_i',
1.13456 + canThrow: true,
1.13457 + operands: [
1.13458 + {
1.13459 + name: 'index',
1.13460 + size: 'u30',
1.13461 + type: ''
1.13462 + }
1.13463 + ]
1.13464 + },
1.13465 + {
1.13466 + name: 'declocal_i',
1.13467 + canThrow: true,
1.13468 + operands: [
1.13469 + {
1.13470 + name: 'index',
1.13471 + size: 'u30',
1.13472 + type: ''
1.13473 + }
1.13474 + ]
1.13475 + },
1.13476 + {
1.13477 + name: 'negate_i',
1.13478 + canThrow: true,
1.13479 + operands: []
1.13480 + },
1.13481 + {
1.13482 + name: 'add_i',
1.13483 + canThrow: true,
1.13484 + operands: []
1.13485 + },
1.13486 + {
1.13487 + name: 'subtract_i',
1.13488 + canThrow: true,
1.13489 + operands: []
1.13490 + },
1.13491 + {
1.13492 + name: 'multiply_i',
1.13493 + canThrow: true,
1.13494 + operands: []
1.13495 + },
1.13496 + null,
1.13497 + null,
1.13498 + null,
1.13499 + null,
1.13500 + null,
1.13501 + null,
1.13502 + null,
1.13503 + null,
1.13504 + {
1.13505 + name: 'getlocal0',
1.13506 + canThrow: false,
1.13507 + operands: []
1.13508 + },
1.13509 + {
1.13510 + name: 'getlocal1',
1.13511 + canThrow: false,
1.13512 + operands: []
1.13513 + },
1.13514 + {
1.13515 + name: 'getlocal2',
1.13516 + canThrow: false,
1.13517 + operands: []
1.13518 + },
1.13519 + {
1.13520 + name: 'getlocal3',
1.13521 + canThrow: false,
1.13522 + operands: []
1.13523 + },
1.13524 + {
1.13525 + name: 'setlocal0',
1.13526 + canThrow: false,
1.13527 + operands: []
1.13528 + },
1.13529 + {
1.13530 + name: 'setlocal1',
1.13531 + canThrow: false,
1.13532 + operands: []
1.13533 + },
1.13534 + {
1.13535 + name: 'setlocal2',
1.13536 + canThrow: false,
1.13537 + operands: []
1.13538 + },
1.13539 + {
1.13540 + name: 'setlocal3',
1.13541 + canThrow: false,
1.13542 + operands: []
1.13543 + },
1.13544 + null,
1.13545 + null,
1.13546 + null,
1.13547 + null,
1.13548 + null,
1.13549 + null,
1.13550 + null,
1.13551 + null,
1.13552 + null,
1.13553 + null,
1.13554 + null,
1.13555 + null,
1.13556 + null,
1.13557 + null,
1.13558 + null,
1.13559 + null,
1.13560 + null,
1.13561 + null,
1.13562 + null,
1.13563 + null,
1.13564 + null,
1.13565 + {
1.13566 + name: 'invalid',
1.13567 + canThrow: false,
1.13568 + operands: []
1.13569 + },
1.13570 + null,
1.13571 + {
1.13572 + name: 'debug',
1.13573 + canThrow: true,
1.13574 + operands: [
1.13575 + {
1.13576 + name: 'debugType',
1.13577 + size: 'u08',
1.13578 + type: ''
1.13579 + },
1.13580 + {
1.13581 + name: 'index',
1.13582 + size: 'u30',
1.13583 + type: 'S'
1.13584 + },
1.13585 + {
1.13586 + name: 'reg',
1.13587 + size: 'u08',
1.13588 + type: ''
1.13589 + },
1.13590 + {
1.13591 + name: 'extra',
1.13592 + size: 'u30',
1.13593 + type: ''
1.13594 + }
1.13595 + ]
1.13596 + },
1.13597 + {
1.13598 + name: 'debugline',
1.13599 + canThrow: true,
1.13600 + operands: [
1.13601 + {
1.13602 + name: 'lineNumber',
1.13603 + size: 'u30',
1.13604 + type: ''
1.13605 + }
1.13606 + ]
1.13607 + },
1.13608 + {
1.13609 + name: 'debugfile',
1.13610 + canThrow: true,
1.13611 + operands: [
1.13612 + {
1.13613 + name: 'index',
1.13614 + size: 'u30',
1.13615 + type: 'S'
1.13616 + }
1.13617 + ]
1.13618 + },
1.13619 + null,
1.13620 + null,
1.13621 + null,
1.13622 + null,
1.13623 + null,
1.13624 + null,
1.13625 + null,
1.13626 + null,
1.13627 + null,
1.13628 + null,
1.13629 + null,
1.13630 + null,
1.13631 + null,
1.13632 + null
1.13633 + ];
1.13634 + function opcodeName(op) {
1.13635 + return AVM2.opcodeTable[op].name;
1.13636 + }
1.13637 + AVM2.opcodeName = opcodeName;
1.13638 + }(Shumway.AVM2 || (Shumway.AVM2 = {})));
1.13639 + var AVM2 = Shumway.AVM2;
1.13640 +}(Shumway || (Shumway = {})));
1.13641 +var opcodeTable = Shumway.AVM2.opcodeTable;
1.13642 +var opcodeName = Shumway.AVM2.opcodeName;
1.13643 +var opcodeTable = Shumway.AVM2.opcodeTable;
1.13644 +var opcodeName = Shumway.AVM2.opcodeName;
1.13645 +var __extends = this.__extends || function (d, b) {
1.13646 + for (var p in b)
1.13647 + if (b.hasOwnProperty(p))
1.13648 + d[p] = b[p];
1.13649 + function __() {
1.13650 + this.constructor = d;
1.13651 + }
1.13652 + __.prototype = b.prototype;
1.13653 + d.prototype = new __();
1.13654 + };
1.13655 +var Shumway;
1.13656 +(function (Shumway) {
1.13657 + (function (AVM2) {
1.13658 + (function (ABC) {
1.13659 + var Timer = Shumway.Metrics.Timer;
1.13660 + var isString = Shumway.isString;
1.13661 + var isNumber = Shumway.isNumber;
1.13662 + var isNumeric = Shumway.isNumeric;
1.13663 + var isObject = Shumway.isObject;
1.13664 + var textDecoder = null;
1.13665 + if (typeof TextDecoder !== 'undefined') {
1.13666 + textDecoder = new TextDecoder();
1.13667 + }
1.13668 + var AbcStream = function () {
1.13669 + function AbcStream(bytes) {
1.13670 + this._bytes = bytes;
1.13671 + this._view = new DataView(bytes.buffer, bytes.byteOffset);
1.13672 + this._position = 0;
1.13673 + }
1.13674 + AbcStream._getResultBuffer = function (length) {
1.13675 + if (!AbcStream._resultBuffer || AbcStream._resultBuffer.length < length) {
1.13676 + AbcStream._resultBuffer = new Int32Array(length * 2);
1.13677 + }
1.13678 + return AbcStream._resultBuffer;
1.13679 + };
1.13680 + Object.defineProperty(AbcStream.prototype, 'position', {
1.13681 + get: function () {
1.13682 + return this._position;
1.13683 + },
1.13684 + enumerable: true,
1.13685 + configurable: true
1.13686 + });
1.13687 + AbcStream.prototype.remaining = function () {
1.13688 + return this._bytes.length - this._position;
1.13689 + };
1.13690 + AbcStream.prototype.seek = function (position) {
1.13691 + this._position = position;
1.13692 + };
1.13693 + AbcStream.prototype.readU8 = function () {
1.13694 + return this._bytes[this._position++];
1.13695 + };
1.13696 + AbcStream.prototype.readU8s = function (count) {
1.13697 + var b = new Uint8Array(count);
1.13698 + b.set(this._bytes.subarray(this._position, this._position + count), 0);
1.13699 + this._position += count;
1.13700 + return b;
1.13701 + };
1.13702 + AbcStream.prototype.readS8 = function () {
1.13703 + return this._bytes[this._position++] << 24 >> 24;
1.13704 + };
1.13705 + AbcStream.prototype.readU32 = function () {
1.13706 + return this.readS32() >>> 0;
1.13707 + };
1.13708 + AbcStream.prototype.readU30 = function () {
1.13709 + var result = this.readU32();
1.13710 + if (result & 3221225472) {
1.13711 + return result;
1.13712 + }
1.13713 + return result;
1.13714 + };
1.13715 + AbcStream.prototype.readU30Unsafe = function () {
1.13716 + return this.readU32();
1.13717 + };
1.13718 + AbcStream.prototype.readS16 = function () {
1.13719 + return this.readU30Unsafe() << 16 >> 16;
1.13720 + };
1.13721 + AbcStream.prototype.readS32 = function () {
1.13722 + var result = this.readU8();
1.13723 + if (result & 128) {
1.13724 + result = result & 127 | this.readU8() << 7;
1.13725 + if (result & 16384) {
1.13726 + result = result & 16383 | this.readU8() << 14;
1.13727 + if (result & 2097152) {
1.13728 + result = result & 2097151 | this.readU8() << 21;
1.13729 + if (result & 268435456) {
1.13730 + result = result & 268435455 | this.readU8() << 28;
1.13731 + result = result & 4294967295;
1.13732 + }
1.13733 + }
1.13734 + }
1.13735 + }
1.13736 + return result;
1.13737 + };
1.13738 + AbcStream.prototype.readWord = function () {
1.13739 + var result = this._view.getUint32(this._position, true);
1.13740 + this._position += 4;
1.13741 + return result;
1.13742 + };
1.13743 + AbcStream.prototype.readS24 = function () {
1.13744 + var u = this.readU8() | this.readU8() << 8 | this.readU8() << 16;
1.13745 + return u << 8 >> 8;
1.13746 + };
1.13747 + AbcStream.prototype.readDouble = function () {
1.13748 + var result = this._view.getFloat64(this._position, true);
1.13749 + this._position += 8;
1.13750 + return result;
1.13751 + };
1.13752 + AbcStream.prototype.readUTFString = function (length) {
1.13753 + if (textDecoder) {
1.13754 + var position = this._position;
1.13755 + this._position += length;
1.13756 + return textDecoder.decode(this._bytes.subarray(position, position + length));
1.13757 + }
1.13758 + var pos = this._position;
1.13759 + var end = pos + length;
1.13760 + var bytes = this._bytes;
1.13761 + var i = 0;
1.13762 + var result = AbcStream._getResultBuffer(length * 2);
1.13763 + while (pos < end) {
1.13764 + var c = bytes[pos++];
1.13765 + if (c <= 127) {
1.13766 + result[i++] = c;
1.13767 + } else if (c >= 192) {
1.13768 + var code = 0;
1.13769 + if (c < 224) {
1.13770 + code = (c & 31) << 6 | bytes[pos++] & 63;
1.13771 + } else if (c < 240) {
1.13772 + code = (c & 15) << 12 | (bytes[pos++] & 63) << 6 | bytes[pos++] & 63;
1.13773 + } else {
1.13774 + code = ((c & 7) << 18 | (bytes[pos++] & 63) << 12 | (bytes[pos++] & 63) << 6 | bytes[pos++] & 63) - 65536;
1.13775 + result[i++] = ((code & 1047552) >>> 10) + 55296;
1.13776 + code = (code & 1023) + 56320;
1.13777 + }
1.13778 + result[i++] = code;
1.13779 + }
1.13780 + }
1.13781 + this._position = pos;
1.13782 + return Shumway.StringUtilities.fromCharCodeArray(result.subarray(0, i));
1.13783 + };
1.13784 + AbcStream._resultBuffer = new Int32Array(256);
1.13785 + return AbcStream;
1.13786 + }();
1.13787 + ABC.AbcStream = AbcStream;
1.13788 + var Parameter = function () {
1.13789 + function Parameter(name, type, value) {
1.13790 + this.name = name;
1.13791 + this.type = type;
1.13792 + this.value = value;
1.13793 + }
1.13794 + return Parameter;
1.13795 + }();
1.13796 + ABC.Parameter = Parameter;
1.13797 + var Trait = function () {
1.13798 + function Trait(abc, stream, holder) {
1.13799 + var constantPool = abc.constantPool;
1.13800 + var methods = abc.methods;
1.13801 + var classes = abc.classes;
1.13802 + var metadata = abc.metadata;
1.13803 + this.holder = holder;
1.13804 + this.name = constantPool.multinames[stream.readU30()];
1.13805 + var tag = stream.readU8();
1.13806 + this.kind = tag & 15;
1.13807 + this.attributes = tag >> 4 & 15;
1.13808 + true;
1.13809 + switch (this.kind) {
1.13810 + case 0:
1.13811 + case 6:
1.13812 + this.slotId = stream.readU30();
1.13813 + this.typeName = constantPool.multinames[stream.readU30()];
1.13814 + var valueIndex = stream.readU30();
1.13815 + this.value = undefined;
1.13816 + if (valueIndex !== 0) {
1.13817 + this.hasDefaultValue = true;
1.13818 + this.value = constantPool.getValue(stream.readU8(), valueIndex);
1.13819 + }
1.13820 + break;
1.13821 + case 1:
1.13822 + case 3:
1.13823 + case 2:
1.13824 + this.dispId = stream.readU30();
1.13825 + this.methodInfo = methods[stream.readU30()];
1.13826 + this.methodInfo.name = this.name;
1.13827 + AbcFile.attachHolder(this.methodInfo, this.holder);
1.13828 + this.methodInfo.abc = abc;
1.13829 + break;
1.13830 + case 4:
1.13831 + this.slotId = stream.readU30();
1.13832 + true;
1.13833 + this.classInfo = classes[stream.readU30()];
1.13834 + break;
1.13835 + case 5:
1.13836 + true;
1.13837 + break;
1.13838 + }
1.13839 + if (this.attributes & 4) {
1.13840 + var traitMetadata;
1.13841 + for (var i = 0, j = stream.readU30(); i < j; i++) {
1.13842 + var md = metadata[stream.readU30()];
1.13843 + if (md.name === '__go_to_definition_help' || md.name === '__go_to_ctor_definition_help') {
1.13844 + continue;
1.13845 + }
1.13846 + if (!traitMetadata) {
1.13847 + traitMetadata = {};
1.13848 + }
1.13849 + traitMetadata[md.name] = md;
1.13850 + }
1.13851 + if (traitMetadata) {
1.13852 + if (this.isClass()) {
1.13853 + this.classInfo.metadata = traitMetadata;
1.13854 + }
1.13855 + this.metadata = traitMetadata;
1.13856 + }
1.13857 + }
1.13858 + }
1.13859 + Trait.prototype.isSlot = function () {
1.13860 + return this.kind === 0;
1.13861 + };
1.13862 + Trait.prototype.isConst = function () {
1.13863 + return this.kind === 6;
1.13864 + };
1.13865 + Trait.prototype.isMethod = function () {
1.13866 + return this.kind === 1;
1.13867 + };
1.13868 + Trait.prototype.isClass = function () {
1.13869 + return this.kind === 4;
1.13870 + };
1.13871 + Trait.prototype.isGetter = function () {
1.13872 + return this.kind === 2;
1.13873 + };
1.13874 + Trait.prototype.isSetter = function () {
1.13875 + return this.kind === 3;
1.13876 + };
1.13877 + Trait.prototype.isProtected = function () {
1.13878 + true;
1.13879 + return this.name.namespaces[0].isProtected();
1.13880 + };
1.13881 + Trait.prototype.kindName = function () {
1.13882 + switch (this.kind) {
1.13883 + case 0:
1.13884 + return 'Slot';
1.13885 + case 6:
1.13886 + return 'Const';
1.13887 + case 1:
1.13888 + return 'Method';
1.13889 + case 3:
1.13890 + return 'Setter';
1.13891 + case 2:
1.13892 + return 'Getter';
1.13893 + case 4:
1.13894 + return 'Class';
1.13895 + case 5:
1.13896 + return 'Function';
1.13897 + }
1.13898 + Shumway.Debug.unexpected();
1.13899 + };
1.13900 + Trait.prototype.isOverride = function () {
1.13901 + return this.attributes & 2;
1.13902 + };
1.13903 + Trait.prototype.isFinal = function () {
1.13904 + return this.attributes & 1;
1.13905 + };
1.13906 + Trait.prototype.toString = function () {
1.13907 + var str = Shumway.IntegerUtilities.getFlags(this.attributes, 'final|override|metadata'.split('|'));
1.13908 + if (str) {
1.13909 + str += ' ';
1.13910 + }
1.13911 + str += Multiname.getQualifiedName(this.name);
1.13912 + switch (this.kind) {
1.13913 + case 0:
1.13914 + case 6:
1.13915 + return str + ', typeName: ' + this.typeName + ', slotId: ' + this.slotId + ', value: ' + this.value;
1.13916 + case 1:
1.13917 + case 3:
1.13918 + case 2:
1.13919 + return str + ', ' + this.kindName() + ': ' + this.methodInfo.name;
1.13920 + case 4:
1.13921 + return str + ', slotId: ' + this.slotId + ', class: ' + this.classInfo;
1.13922 + case 5:
1.13923 + break;
1.13924 + }
1.13925 + };
1.13926 + Trait.parseTraits = function (abc, stream, holder) {
1.13927 + var count = stream.readU30();
1.13928 + var traits = [];
1.13929 + for (var i = 0; i < count; i++) {
1.13930 + traits.push(new Trait(abc, stream, holder));
1.13931 + }
1.13932 + return traits;
1.13933 + };
1.13934 + return Trait;
1.13935 + }();
1.13936 + ABC.Trait = Trait;
1.13937 + var Info = function () {
1.13938 + function Info(abc, index) {
1.13939 + this.abc = abc;
1.13940 + this.index = index;
1.13941 + }
1.13942 + return Info;
1.13943 + }();
1.13944 + ABC.Info = Info;
1.13945 + var MethodInfo = function (_super) {
1.13946 + __extends(MethodInfo, _super);
1.13947 + function MethodInfo(abc, index, stream) {
1.13948 + _super.call(this, abc, index);
1.13949 + var constantPool = abc.constantPool;
1.13950 + var parameterCount = stream.readU30();
1.13951 + this.returnType = constantPool.multinames[stream.readU30()];
1.13952 + this.parameters = [];
1.13953 + for (var i = 0; i < parameterCount; i++) {
1.13954 + this.parameters.push(new Parameter(undefined, constantPool.multinames[stream.readU30()], undefined));
1.13955 + }
1.13956 + this.debugName = constantPool.strings[stream.readU30()];
1.13957 + this.flags = stream.readU8();
1.13958 + var optionalCount = 0;
1.13959 + if (this.flags & 8) {
1.13960 + optionalCount = stream.readU30();
1.13961 + true;
1.13962 + for (var i = parameterCount - optionalCount; i < parameterCount; i++) {
1.13963 + var valueIndex = stream.readU30();
1.13964 + this.parameters[i].value = constantPool.getValue(stream.readU8(), valueIndex);
1.13965 + }
1.13966 + }
1.13967 + if (this.flags & 128) {
1.13968 + for (var i = 0; i < parameterCount; i++) {
1.13969 + if (false) {
1.13970 + this.parameters[i].name = constantPool.strings[stream.readU30()];
1.13971 + } else {
1.13972 + stream.readU30();
1.13973 + this.parameters[i].name = MethodInfo._getParameterName(i);
1.13974 + }
1.13975 + }
1.13976 + } else {
1.13977 + for (var i = 0; i < parameterCount; i++) {
1.13978 + this.parameters[i].name = MethodInfo._getParameterName(i);
1.13979 + }
1.13980 + }
1.13981 + }
1.13982 + MethodInfo._getParameterName = function (i) {
1.13983 + true;
1.13984 + return String.fromCharCode('A'.charCodeAt(0) + i);
1.13985 + };
1.13986 + MethodInfo.prototype.toString = function () {
1.13987 + var flags = Shumway.IntegerUtilities.getFlags(this.flags, 'NEED_ARGUMENTS|NEED_ACTIVATION|NEED_REST|HAS_OPTIONAL|||SET_DXN|HAS_PARAM_NAMES'.split('|'));
1.13988 + return (flags ? flags + ' ' : '') + this.name;
1.13989 + };
1.13990 + MethodInfo.prototype.hasOptional = function () {
1.13991 + return !(!(this.flags & 8));
1.13992 + };
1.13993 + MethodInfo.prototype.needsActivation = function () {
1.13994 + return !(!(this.flags & 2));
1.13995 + };
1.13996 + MethodInfo.prototype.needsRest = function () {
1.13997 + return !(!(this.flags & 4));
1.13998 + };
1.13999 + MethodInfo.prototype.needsArguments = function () {
1.14000 + return !(!(this.flags & 1));
1.14001 + };
1.14002 + MethodInfo.prototype.isNative = function () {
1.14003 + return !(!(this.flags & 32));
1.14004 + };
1.14005 + MethodInfo.prototype.isClassMember = function () {
1.14006 + return this.holder instanceof ClassInfo;
1.14007 + };
1.14008 + MethodInfo.prototype.isInstanceMember = function () {
1.14009 + return this.holder instanceof InstanceInfo;
1.14010 + };
1.14011 + MethodInfo.prototype.isScriptMember = function () {
1.14012 + return this.holder instanceof ScriptInfo;
1.14013 + };
1.14014 + MethodInfo.parseException = function (abc, stream) {
1.14015 + var multinames = abc.constantPool.multinames;
1.14016 + var ex = {
1.14017 + start: stream.readU30(),
1.14018 + end: stream.readU30(),
1.14019 + target: stream.readU30(),
1.14020 + typeName: multinames[stream.readU30()],
1.14021 + varName: multinames[stream.readU30()]
1.14022 + };
1.14023 + true;
1.14024 + true;
1.14025 + return ex;
1.14026 + };
1.14027 + MethodInfo.parseBody = function (abc, stream) {
1.14028 + var constantPool = abc.constantPool;
1.14029 + var methods = abc.methods;
1.14030 + var index = stream.readU30();
1.14031 + var mi = methods[index];
1.14032 + mi.index = index;
1.14033 + mi.hasBody = true;
1.14034 + mi.hash = abc.hash + 196608 + index;
1.14035 + true;
1.14036 + mi.maxStack = stream.readU30();
1.14037 + mi.localCount = stream.readU30();
1.14038 + mi.initScopeDepth = stream.readU30();
1.14039 + mi.maxScopeDepth = stream.readU30();
1.14040 + mi.code = stream.readU8s(stream.readU30());
1.14041 + var exceptions = [];
1.14042 + var exceptionCount = stream.readU30();
1.14043 + for (var i = 0; i < exceptionCount; ++i) {
1.14044 + exceptions.push(MethodInfo.parseException(abc, stream));
1.14045 + }
1.14046 + mi.exceptions = exceptions;
1.14047 + mi.traits = Trait.parseTraits(abc, stream, mi);
1.14048 + };
1.14049 + MethodInfo.prototype.hasExceptions = function () {
1.14050 + return this.exceptions.length > 0;
1.14051 + };
1.14052 + return MethodInfo;
1.14053 + }(Info);
1.14054 + ABC.MethodInfo = MethodInfo;
1.14055 + var InstanceInfo = function (_super) {
1.14056 + __extends(InstanceInfo, _super);
1.14057 + function InstanceInfo(abc, index, stream) {
1.14058 + _super.call(this, abc, index);
1.14059 + this.runtimeId = InstanceInfo.nextID++;
1.14060 + var constantPool = abc.constantPool;
1.14061 + var methods = abc.methods;
1.14062 + this.name = constantPool.multinames[stream.readU30()];
1.14063 + true;
1.14064 + this.superName = constantPool.multinames[stream.readU30()];
1.14065 + this.flags = stream.readU8();
1.14066 + this.protectedNs = undefined;
1.14067 + if (this.flags & 8) {
1.14068 + this.protectedNs = constantPool.namespaces[stream.readU30()];
1.14069 + }
1.14070 + var interfaceCount = stream.readU30();
1.14071 + this.interfaces = [];
1.14072 + for (var i = 0; i < interfaceCount; i++) {
1.14073 + this.interfaces[i] = constantPool.multinames[stream.readU30()];
1.14074 + }
1.14075 + this.init = methods[stream.readU30()];
1.14076 + this.init.isInstanceInitializer = true;
1.14077 + this.init.name = this.name;
1.14078 + AbcFile.attachHolder(this.init, this);
1.14079 + this.traits = Trait.parseTraits(abc, stream, this);
1.14080 + }
1.14081 + InstanceInfo.prototype.toString = function () {
1.14082 + var flags = Shumway.IntegerUtilities.getFlags(this.flags & 8, 'sealed|final|interface|protected'.split('|'));
1.14083 + var str = (flags ? flags + ' ' : '') + this.name;
1.14084 + if (this.superName) {
1.14085 + str += ' extends ' + this.superName;
1.14086 + }
1.14087 + return str;
1.14088 + };
1.14089 + InstanceInfo.prototype.isFinal = function () {
1.14090 + return !(!(this.flags & 2));
1.14091 + };
1.14092 + InstanceInfo.prototype.isSealed = function () {
1.14093 + return !(!(this.flags & 1));
1.14094 + };
1.14095 + InstanceInfo.prototype.isInterface = function () {
1.14096 + return !(!(this.flags & 4));
1.14097 + };
1.14098 + InstanceInfo.nextID = 1;
1.14099 + return InstanceInfo;
1.14100 + }(Info);
1.14101 + ABC.InstanceInfo = InstanceInfo;
1.14102 + var ClassInfo = function (_super) {
1.14103 + __extends(ClassInfo, _super);
1.14104 + function ClassInfo(abc, index, stream) {
1.14105 + _super.call(this, abc, index);
1.14106 + this.runtimeId = ClassInfo.nextID++;
1.14107 + this.abc = abc;
1.14108 + this.hash = abc.hash + 65536 + index;
1.14109 + this.index = index;
1.14110 + this.init = abc.methods[stream.readU30()];
1.14111 + this.init.isClassInitializer = true;
1.14112 + AbcFile.attachHolder(this.init, this);
1.14113 + this.traits = Trait.parseTraits(abc, stream, this);
1.14114 + this.instanceInfo = abc.instances[index];
1.14115 + this.instanceInfo.classInfo = this;
1.14116 + this.defaultValue = ClassInfo._getDefaultValue(this.instanceInfo.name);
1.14117 + }
1.14118 + ClassInfo._getDefaultValue = function (qn) {
1.14119 + if (Multiname.getQualifiedName(qn) === Multiname.Int || Multiname.getQualifiedName(qn) === Multiname.Uint) {
1.14120 + return 0;
1.14121 + } else if (Multiname.getQualifiedName(qn) === Multiname.Number) {
1.14122 + return NaN;
1.14123 + } else if (Multiname.getQualifiedName(qn) === Multiname.Boolean) {
1.14124 + return false;
1.14125 + } else {
1.14126 + return null;
1.14127 + }
1.14128 + };
1.14129 + ClassInfo.prototype.toString = function () {
1.14130 + return this.instanceInfo.name.toString();
1.14131 + };
1.14132 + ClassInfo.nextID = 1;
1.14133 + return ClassInfo;
1.14134 + }(Info);
1.14135 + ABC.ClassInfo = ClassInfo;
1.14136 + var ScriptInfo = function (_super) {
1.14137 + __extends(ScriptInfo, _super);
1.14138 + function ScriptInfo(abc, index, stream) {
1.14139 + _super.call(this, abc, index);
1.14140 + this.runtimeId = ClassInfo.nextID++;
1.14141 + this.hash = abc.hash + 131072 + index;
1.14142 + this.name = abc.name + '$script' + index;
1.14143 + this.init = abc.methods[stream.readU30()];
1.14144 + this.init.isScriptInitializer = true;
1.14145 + AbcFile.attachHolder(this.init, this);
1.14146 + this.traits = Trait.parseTraits(abc, stream, this);
1.14147 + }
1.14148 + Object.defineProperty(ScriptInfo.prototype, 'entryPoint', {
1.14149 + get: function () {
1.14150 + return this.init;
1.14151 + },
1.14152 + enumerable: true,
1.14153 + configurable: true
1.14154 + });
1.14155 + ScriptInfo.prototype.toString = function () {
1.14156 + return this.name;
1.14157 + };
1.14158 + ScriptInfo.nextID = 1;
1.14159 + return ScriptInfo;
1.14160 + }(Info);
1.14161 + ABC.ScriptInfo = ScriptInfo;
1.14162 + var AbcFile = function () {
1.14163 + function AbcFile(bytes, name, hash) {
1.14164 + if (typeof hash === 'undefined') {
1.14165 + hash = 0;
1.14166 + }
1.14167 + Timer.start('Parse ABC');
1.14168 + this.name = name;
1.14169 + this.env = {};
1.14170 + var computedHash;
1.14171 + if (!hash || !true) {
1.14172 + Timer.start('Adler');
1.14173 + computedHash = Shumway.HashUtilities.hashBytesTo32BitsAdler(bytes, 0, bytes.length);
1.14174 + Timer.stop();
1.14175 + }
1.14176 + if (hash) {
1.14177 + this.hash = hash;
1.14178 + true;
1.14179 + } else {
1.14180 + this.hash = computedHash;
1.14181 + }
1.14182 + var n, i;
1.14183 + var stream = new AbcStream(bytes);
1.14184 + AbcFile._checkMagic(stream);
1.14185 + Timer.start('Parse constantPool');
1.14186 + this.constantPool = new ConstantPool(stream, this);
1.14187 + Timer.stop();
1.14188 + Timer.start('Parse Method Infos');
1.14189 + this.methods = [];
1.14190 + n = stream.readU30();
1.14191 + for (i = 0; i < n; ++i) {
1.14192 + this.methods.push(new MethodInfo(this, i, stream));
1.14193 + }
1.14194 + Timer.stop();
1.14195 + Timer.start('Parse MetaData Infos');
1.14196 + this.metadata = [];
1.14197 + n = stream.readU30();
1.14198 + for (i = 0; i < n; ++i) {
1.14199 + this.metadata.push(new MetaDataInfo(this, stream));
1.14200 + }
1.14201 + Timer.stop();
1.14202 + Timer.start('Parse Instance Infos');
1.14203 + this.instances = [];
1.14204 + n = stream.readU30();
1.14205 + for (i = 0; i < n; ++i) {
1.14206 + this.instances.push(new InstanceInfo(this, i, stream));
1.14207 + }
1.14208 + Timer.stop();
1.14209 + Timer.start('Parse Class Infos');
1.14210 + this.classes = [];
1.14211 + for (i = 0; i < n; ++i) {
1.14212 + this.classes.push(new ClassInfo(this, i, stream));
1.14213 + }
1.14214 + Timer.stop();
1.14215 + Timer.start('Parse Script Infos');
1.14216 + this.scripts = [];
1.14217 + n = stream.readU30();
1.14218 + for (i = 0; i < n; ++i) {
1.14219 + this.scripts.push(new ScriptInfo(this, i, stream));
1.14220 + }
1.14221 + Timer.stop();
1.14222 + Timer.start('Parse Method Body Info');
1.14223 + n = stream.readU30();
1.14224 + for (i = 0; i < n; ++i) {
1.14225 + MethodInfo.parseBody(this, stream);
1.14226 + }
1.14227 + Timer.stop();
1.14228 + Timer.stop();
1.14229 + }
1.14230 + AbcFile._checkMagic = function (stream) {
1.14231 + var magic = stream.readWord();
1.14232 + var flashPlayerBrannan = 46 << 16 | 15;
1.14233 + if (magic < flashPlayerBrannan) {
1.14234 + throw new Error('Invalid ABC File (magic = ' + Number(magic).toString(16) + ')');
1.14235 + }
1.14236 + };
1.14237 + Object.defineProperty(AbcFile.prototype, 'lastScript', {
1.14238 + get: function () {
1.14239 + true;
1.14240 + return this.scripts[this.scripts.length - 1];
1.14241 + },
1.14242 + enumerable: true,
1.14243 + configurable: true
1.14244 + });
1.14245 + AbcFile.attachHolder = function (mi, holder) {
1.14246 + true;
1.14247 + mi.holder = holder;
1.14248 + };
1.14249 + AbcFile.prototype.toString = function () {
1.14250 + return this.name;
1.14251 + };
1.14252 + return AbcFile;
1.14253 + }();
1.14254 + ABC.AbcFile = AbcFile;
1.14255 + var Namespace = function () {
1.14256 + function Namespace(kind, uri, prefix, uniqueURIHash) {
1.14257 + if (typeof uri === 'undefined') {
1.14258 + uri = '';
1.14259 + }
1.14260 + if (uri === undefined) {
1.14261 + uri = '';
1.14262 + }
1.14263 + if (prefix !== undefined) {
1.14264 + this.prefix = prefix;
1.14265 + }
1.14266 + this.kind = kind;
1.14267 + this.uri = uri;
1.14268 + this._buildNamespace(uniqueURIHash);
1.14269 + }
1.14270 + Namespace.prototype._buildNamespace = function (uniqueURIHash) {
1.14271 + if (this.kind === 22) {
1.14272 + this.kind = 8;
1.14273 + }
1.14274 + if (this.isPublic() && this.uri) {
1.14275 + var n = this.uri.length - 1;
1.14276 + var mark = this.uri.charCodeAt(n);
1.14277 + if (mark > Namespace._MIN_API_MARK) {
1.14278 + this.uri = this.uri.substring(0, n - 1);
1.14279 + }
1.14280 + } else if (this.isUnique()) {
1.14281 + this.uri = 'private ' + uniqueURIHash;
1.14282 + }
1.14283 + this.qualifiedName = Namespace._qualifyNamespace(this.kind, this.uri, this.prefix ? this.prefix : '');
1.14284 + };
1.14285 + Namespace._hashNamespace = function (kind, uri, prefix) {
1.14286 + var data = new Int32Array(1 + uri.length + prefix.length);
1.14287 + var j = 0;
1.14288 + data[j++] = kind;
1.14289 + var index = Namespace._knownURIs.indexOf(uri);
1.14290 + if (index >= 0) {
1.14291 + return kind << 2 | index;
1.14292 + } else {
1.14293 + for (var i = 0; i < uri.length; i++) {
1.14294 + data[j++] = uri.charCodeAt(i);
1.14295 + }
1.14296 + }
1.14297 + for (var i = 0; i < prefix.length; i++) {
1.14298 + data[j++] = prefix.charCodeAt(i);
1.14299 + }
1.14300 + return Shumway.HashUtilities.hashBytesTo32BitsMD5(data, 0, j);
1.14301 + };
1.14302 + Namespace._qualifyNamespace = function (kind, uri, prefix) {
1.14303 + var key = kind + uri;
1.14304 + var mangledNamespace = Namespace._mangledNamespaceCache[key];
1.14305 + if (mangledNamespace) {
1.14306 + return mangledNamespace;
1.14307 + }
1.14308 + mangledNamespace = Shumway.StringUtilities.variableLengthEncodeInt32(Namespace._hashNamespace(kind, uri, prefix));
1.14309 + Namespace._mangledNamespaceMap[mangledNamespace] = {
1.14310 + kind: kind,
1.14311 + uri: uri,
1.14312 + prefix: prefix
1.14313 + };
1.14314 + Namespace._mangledNamespaceCache[key] = mangledNamespace;
1.14315 + return mangledNamespace;
1.14316 + };
1.14317 + Namespace.fromQualifiedName = function (qn) {
1.14318 + var length = Shumway.StringUtilities.fromEncoding(qn[0]);
1.14319 + var mangledNamespace = qn.substring(0, length + 1);
1.14320 + var ns = Namespace._mangledNamespaceMap[mangledNamespace];
1.14321 + return new Namespace(ns.kind, ns.uri, ns.prefix);
1.14322 + };
1.14323 + Namespace.kindFromString = function (str) {
1.14324 + for (var kind in Namespace._kinds) {
1.14325 + if (Namespace._kinds[kind] === str) {
1.14326 + return kind;
1.14327 + }
1.14328 + }
1.14329 + return true;
1.14330 + };
1.14331 + Namespace.createNamespace = function (uri, prefix) {
1.14332 + return new Namespace(8, uri, prefix);
1.14333 + };
1.14334 + Namespace.parse = function (constantPool, stream, hash) {
1.14335 + var kind = stream.readU8();
1.14336 + var uri = constantPool.strings[stream.readU30()];
1.14337 + return new Namespace(kind, uri, undefined, hash);
1.14338 + };
1.14339 + Namespace.prototype.isPublic = function () {
1.14340 + return this.kind === 8 || this.kind === 22;
1.14341 + };
1.14342 + Namespace.prototype.isProtected = function () {
1.14343 + return this.kind === 24;
1.14344 + };
1.14345 + Namespace.prototype.isUnique = function () {
1.14346 + return this.kind === 5 && !this.uri;
1.14347 + };
1.14348 + Namespace.prototype.isDynamic = function () {
1.14349 + return this.isPublic() && !this.uri;
1.14350 + };
1.14351 + Namespace.prototype.getURI = function () {
1.14352 + return this.uri;
1.14353 + };
1.14354 + Namespace.prototype.toString = function () {
1.14355 + return Namespace._kinds[this.kind] + (this.uri ? ' ' + this.uri : '');
1.14356 + };
1.14357 + Namespace.prototype.clone = function () {
1.14358 + var ns = Object.create(Namespace.prototype);
1.14359 + ns.kind = this.kind;
1.14360 + ns.uri = this.uri;
1.14361 + ns.prefix = this.prefix;
1.14362 + ns.qualifiedName = this.qualifiedName;
1.14363 + return ns;
1.14364 + };
1.14365 + Namespace.prototype.isEqualTo = function (other) {
1.14366 + return this.qualifiedName === other.qualifiedName;
1.14367 + };
1.14368 + Namespace.prototype.inNamespaceSet = function (set) {
1.14369 + for (var i = 0; i < set.length; i++) {
1.14370 + if (set[i].qualifiedName === this.qualifiedName) {
1.14371 + return true;
1.14372 + }
1.14373 + }
1.14374 + return false;
1.14375 + };
1.14376 + Namespace.prototype.getAccessModifier = function () {
1.14377 + return Namespace._kinds[this.kind];
1.14378 + };
1.14379 + Namespace.prototype.getQualifiedName = function () {
1.14380 + return this.qualifiedName;
1.14381 + };
1.14382 + Namespace.fromSimpleName = function (simpleName) {
1.14383 + if (simpleName in Namespace._simpleNameCache) {
1.14384 + return Namespace._simpleNameCache[simpleName];
1.14385 + }
1.14386 + var namespaceNames;
1.14387 + if (simpleName.indexOf('[') === 0) {
1.14388 + true;
1.14389 + namespaceNames = simpleName.substring(1, simpleName.length - 1).split(',');
1.14390 + } else {
1.14391 + namespaceNames = [
1.14392 + simpleName
1.14393 + ];
1.14394 + }
1.14395 + return Namespace._simpleNameCache[simpleName] = namespaceNames.map(function (name) {
1.14396 + name = name.trim();
1.14397 + var kindName, uri;
1.14398 + if (name.indexOf(' ') > 0) {
1.14399 + kindName = name.substring(0, name.indexOf(' ')).trim();
1.14400 + uri = name.substring(name.indexOf(' ') + 1).trim();
1.14401 + } else {
1.14402 + var kinds = Namespace._kinds;
1.14403 + if (name === kinds[8] || name === kinds[23] || name === kinds[5] || name === kinds[24] || name === kinds[25] || name === kinds[26]) {
1.14404 + kindName = name;
1.14405 + uri = '';
1.14406 + } else {
1.14407 + kindName = Namespace._publicPrefix;
1.14408 + uri = name;
1.14409 + }
1.14410 + }
1.14411 + return new Namespace(Namespace.kindFromString(kindName), uri);
1.14412 + });
1.14413 + };
1.14414 + Namespace._publicPrefix = 'public';
1.14415 + Namespace._kinds = function () {
1.14416 + var map = Shumway.ObjectUtilities.createMap();
1.14417 + map[8] = Namespace._publicPrefix;
1.14418 + map[23] = 'packageInternal';
1.14419 + map[5] = 'private';
1.14420 + map[24] = 'protected';
1.14421 + map[25] = 'explicit';
1.14422 + map[26] = 'staticProtected';
1.14423 + return map;
1.14424 + }();
1.14425 + Namespace._MIN_API_MARK = 58004;
1.14426 + Namespace._MAX_API_MARK = 63743;
1.14427 + Namespace._knownURIs = [
1.14428 + ''
1.14429 + ];
1.14430 + Namespace._mangledNamespaceCache = Shumway.ObjectUtilities.createMap();
1.14431 + Namespace._mangledNamespaceMap = Shumway.ObjectUtilities.createMap();
1.14432 + Namespace.PUBLIC = new Namespace(8);
1.14433 + Namespace.PROTECTED = new Namespace(24);
1.14434 + Namespace.PROXY = new Namespace(8, 'http://www.adobe.com/2006/actionscript/flash/proxy');
1.14435 + Namespace._simpleNameCache = Shumway.ObjectUtilities.createMap();
1.14436 + return Namespace;
1.14437 + }();
1.14438 + ABC.Namespace = Namespace;
1.14439 + var Multiname = function () {
1.14440 + function Multiname(namespaces, name, flags) {
1.14441 + if (typeof flags === 'undefined') {
1.14442 + flags = 0;
1.14443 + }
1.14444 + if (name !== undefined) {
1.14445 + true;
1.14446 + }
1.14447 + this.runtimeId = Multiname._nextID++;
1.14448 + this.namespaces = namespaces;
1.14449 + this.name = name;
1.14450 + this.flags = flags;
1.14451 + }
1.14452 + Multiname.parse = function (constantPool, stream, multinames, patchFactoryTypes) {
1.14453 + var index = 0;
1.14454 + var kind = stream.readU8();
1.14455 + var name, namespaces = [], flags = 0;
1.14456 + switch (kind) {
1.14457 + case 7:
1.14458 + case 13:
1.14459 + index = stream.readU30();
1.14460 + if (index) {
1.14461 + namespaces = [
1.14462 + constantPool.namespaces[index]
1.14463 + ];
1.14464 + } else {
1.14465 + flags &= ~Multiname.RUNTIME_NAME;
1.14466 + }
1.14467 + index = stream.readU30();
1.14468 + if (index) {
1.14469 + name = constantPool.strings[index];
1.14470 + }
1.14471 + break;
1.14472 + case 15:
1.14473 + case 16:
1.14474 + index = stream.readU30();
1.14475 + if (index) {
1.14476 + name = constantPool.strings[index];
1.14477 + } else {
1.14478 + flags &= ~Multiname.RUNTIME_NAME;
1.14479 + }
1.14480 + flags |= Multiname.RUNTIME_NAMESPACE;
1.14481 + break;
1.14482 + case 17:
1.14483 + case 18:
1.14484 + flags |= Multiname.RUNTIME_NAMESPACE;
1.14485 + flags |= Multiname.RUNTIME_NAME;
1.14486 + break;
1.14487 + case 9:
1.14488 + case 14:
1.14489 + index = stream.readU30();
1.14490 + if (index) {
1.14491 + name = constantPool.strings[index];
1.14492 + } else {
1.14493 + flags &= ~Multiname.RUNTIME_NAME;
1.14494 + }
1.14495 + index = stream.readU30();
1.14496 + true;
1.14497 + namespaces = constantPool.namespaceSets[index];
1.14498 + break;
1.14499 + case 27:
1.14500 + case 28:
1.14501 + flags |= Multiname.RUNTIME_NAME;
1.14502 + index = stream.readU30();
1.14503 + true;
1.14504 + namespaces = constantPool.namespaceSets[index];
1.14505 + break;
1.14506 + case 29:
1.14507 + var factoryTypeIndex = stream.readU32();
1.14508 + if (multinames[factoryTypeIndex]) {
1.14509 + namespaces = multinames[factoryTypeIndex].namespaces;
1.14510 + name = multinames[factoryTypeIndex].name;
1.14511 + }
1.14512 + var typeParameterCount = stream.readU32();
1.14513 + true;
1.14514 + var typeParameterIndex = stream.readU32();
1.14515 + true;
1.14516 + var mn = new Multiname(namespaces, name, flags);
1.14517 + mn.typeParameter = multinames[typeParameterIndex];
1.14518 + if (!multinames[factoryTypeIndex]) {
1.14519 + patchFactoryTypes.push({
1.14520 + multiname: mn,
1.14521 + index: factoryTypeIndex
1.14522 + });
1.14523 + }
1.14524 + return mn;
1.14525 + default:
1.14526 + Shumway.Debug.unexpected();
1.14527 + break;
1.14528 + }
1.14529 + switch (kind) {
1.14530 + case 13:
1.14531 + case 16:
1.14532 + case 18:
1.14533 + case 14:
1.14534 + case 28:
1.14535 + flags |= Multiname.ATTRIBUTE;
1.14536 + break;
1.14537 + }
1.14538 + return new Multiname(namespaces, name, flags);
1.14539 + };
1.14540 + Multiname.isMultiname = function (mn) {
1.14541 + return typeof mn === 'number' || typeof mn === 'string' || mn instanceof Multiname || mn instanceof Number;
1.14542 + };
1.14543 + Multiname.needsResolution = function (mn) {
1.14544 + return mn instanceof Multiname && mn.namespaces.length > 1;
1.14545 + };
1.14546 + Multiname.isQName = function (mn) {
1.14547 + if (mn instanceof Multiname) {
1.14548 + return mn.namespaces && mn.namespaces.length === 1;
1.14549 + }
1.14550 + return true;
1.14551 + };
1.14552 + Multiname.isRuntimeName = function (mn) {
1.14553 + return mn instanceof Multiname && mn.isRuntimeName();
1.14554 + };
1.14555 + Multiname.isRuntimeNamespace = function (mn) {
1.14556 + return mn instanceof Multiname && mn.isRuntimeNamespace();
1.14557 + };
1.14558 + Multiname.isRuntime = function (mn) {
1.14559 + return mn instanceof Multiname && mn.isRuntimeName() || mn.isRuntimeNamespace();
1.14560 + };
1.14561 + Multiname.getQualifiedName = function (mn) {
1.14562 + true;
1.14563 + if (mn instanceof Multiname) {
1.14564 + if (mn.qualifiedName !== undefined) {
1.14565 + return mn.qualifiedName;
1.14566 + }
1.14567 + var name = String(mn.name);
1.14568 + if (isNumeric(name) && mn.namespaces[0].isPublic()) {
1.14569 + return mn.qualifiedName = name;
1.14570 + }
1.14571 + mn = mn.qualifiedName = Multiname.qualifyName(mn.namespaces[0], name);
1.14572 + }
1.14573 + return mn;
1.14574 + };
1.14575 + Multiname.qualifyName = function (namespace, name) {
1.14576 + return '$' + namespace.qualifiedName + name;
1.14577 + };
1.14578 + Multiname.stripPublicQualifier = function (qn) {
1.14579 + var publicQualifier = '$' + Namespace.PUBLIC.qualifiedName;
1.14580 + var index = qn.indexOf(publicQualifier);
1.14581 + if (index !== 0) {
1.14582 + return undefined;
1.14583 + }
1.14584 + return qn.substring(publicQualifier.length);
1.14585 + };
1.14586 + Multiname.fromQualifiedName = function (qn) {
1.14587 + if (qn instanceof Multiname) {
1.14588 + return qn;
1.14589 + }
1.14590 + if (isNumeric(qn)) {
1.14591 + return new Multiname([
1.14592 + Namespace.PUBLIC
1.14593 + ], qn);
1.14594 + }
1.14595 + if (qn[0] !== '$') {
1.14596 + return;
1.14597 + }
1.14598 + var ns = Namespace.fromQualifiedName(qn.substring(1));
1.14599 + return new Multiname([
1.14600 + ns
1.14601 + ], qn.substring(1 + ns.qualifiedName.length));
1.14602 + };
1.14603 + Multiname.getNameFromPublicQualifiedName = function (qn) {
1.14604 + var mn = Multiname.fromQualifiedName(qn);
1.14605 + true;
1.14606 + return mn.name;
1.14607 + };
1.14608 + Multiname.getFullQualifiedName = function (mn) {
1.14609 + var qn = Multiname.getQualifiedName(mn);
1.14610 + if (mn instanceof Multiname && mn.typeParameter) {
1.14611 + qn += '$' + Multiname.getFullQualifiedName(mn.typeParameter);
1.14612 + }
1.14613 + return qn;
1.14614 + };
1.14615 + Multiname.getPublicQualifiedName = function (name) {
1.14616 + if (isNumeric(name)) {
1.14617 + return Shumway.toNumber(name);
1.14618 + } else if (name !== null && isObject(name)) {
1.14619 + return name;
1.14620 + }
1.14621 + return Multiname.qualifyName(Namespace.PUBLIC, name);
1.14622 + };
1.14623 + Multiname.isPublicQualifiedName = function (qn) {
1.14624 + return typeof qn === 'number' || isNumeric(qn) || qn.indexOf(Namespace.PUBLIC.qualifiedName) === 1;
1.14625 + };
1.14626 + Multiname.getAccessModifier = function (mn) {
1.14627 + true;
1.14628 + if (typeof mn === 'number' || typeof mn === 'string' || mn instanceof Number) {
1.14629 + return 'public';
1.14630 + }
1.14631 + true;
1.14632 + return mn.namespaces[0].getAccessModifier();
1.14633 + };
1.14634 + Multiname.isNumeric = function (mn) {
1.14635 + if (typeof mn === 'number') {
1.14636 + return true;
1.14637 + } else if (typeof mn === 'string') {
1.14638 + return isNumeric(mn);
1.14639 + }
1.14640 + return !isNaN(parseInt(Multiname.getName(mn), 10));
1.14641 + };
1.14642 + Multiname.getName = function (mn) {
1.14643 + true;
1.14644 + true;
1.14645 + return mn.getName();
1.14646 + };
1.14647 + Multiname.isAnyName = function (mn) {
1.14648 + return typeof mn === 'object' && !mn.isRuntimeName() && !mn.name;
1.14649 + };
1.14650 + Multiname.fromSimpleName = function (simpleName) {
1.14651 + true;
1.14652 + if (simpleName in Multiname._simpleNameCache) {
1.14653 + return Multiname._simpleNameCache[simpleName];
1.14654 + }
1.14655 + var nameIndex, namespaceIndex, name, namespace;
1.14656 + nameIndex = simpleName.lastIndexOf('.');
1.14657 + if (nameIndex <= 0) {
1.14658 + nameIndex = simpleName.lastIndexOf(' ');
1.14659 + }
1.14660 + if (nameIndex > 0 && nameIndex < simpleName.length - 1) {
1.14661 + name = simpleName.substring(nameIndex + 1).trim();
1.14662 + namespace = simpleName.substring(0, nameIndex).trim();
1.14663 + } else {
1.14664 + name = simpleName;
1.14665 + namespace = '';
1.14666 + }
1.14667 + return Multiname._simpleNameCache[simpleName] = new Multiname(Namespace.fromSimpleName(namespace), name);
1.14668 + };
1.14669 + Multiname.prototype.getQName = function (index) {
1.14670 + true;
1.14671 + if (!this._qualifiedNameCache) {
1.14672 + this._qualifiedNameCache = Shumway.ObjectUtilities.createArrayMap();
1.14673 + }
1.14674 + var name = this._qualifiedNameCache[index];
1.14675 + if (!name) {
1.14676 + name = this._qualifiedNameCache[index] = new Multiname([
1.14677 + this.namespaces[index]
1.14678 + ], this.name, this.flags);
1.14679 + }
1.14680 + return name;
1.14681 + };
1.14682 + Multiname.prototype.hasQName = function (qn) {
1.14683 + true;
1.14684 + if (this.name !== qn.name) {
1.14685 + return false;
1.14686 + }
1.14687 + for (var i = 0; i < this.namespaces.length; i++) {
1.14688 + if (this.namespaces[i].isEqualTo(qn.namespaces[0])) {
1.14689 + return true;
1.14690 + }
1.14691 + }
1.14692 + return false;
1.14693 + };
1.14694 + Multiname.prototype.isAttribute = function () {
1.14695 + return this.flags & Multiname.ATTRIBUTE;
1.14696 + };
1.14697 + Multiname.prototype.isAnyName = function () {
1.14698 + return Multiname.isAnyName(this);
1.14699 + };
1.14700 + Multiname.prototype.isAnyNamespace = function () {
1.14701 + return !this.isRuntimeNamespace() && (this.namespaces.length === 0 || this.isAnyName() && this.namespaces.length !== 1);
1.14702 + };
1.14703 + Multiname.prototype.isRuntimeName = function () {
1.14704 + return !(!(this.flags & Multiname.RUNTIME_NAME));
1.14705 + };
1.14706 + Multiname.prototype.isRuntimeNamespace = function () {
1.14707 + return !(!(this.flags & Multiname.RUNTIME_NAMESPACE));
1.14708 + };
1.14709 + Multiname.prototype.isRuntime = function () {
1.14710 + return !(!(this.flags & (Multiname.RUNTIME_NAME | Multiname.RUNTIME_NAMESPACE)));
1.14711 + };
1.14712 + Multiname.prototype.isQName = function () {
1.14713 + return this.namespaces.length === 1 && !this.isAnyName();
1.14714 + };
1.14715 + Multiname.prototype.hasTypeParameter = function () {
1.14716 + return !(!this.typeParameter);
1.14717 + };
1.14718 + Multiname.prototype.getName = function () {
1.14719 + return this.name;
1.14720 + };
1.14721 + Multiname.prototype.getOriginalName = function () {
1.14722 + true;
1.14723 + var name = this.namespaces[0].uri;
1.14724 + if (name) {
1.14725 + name += '.';
1.14726 + }
1.14727 + return name + this.name;
1.14728 + };
1.14729 + Multiname.prototype.getNamespace = function () {
1.14730 + true;
1.14731 + true;
1.14732 + return this.namespaces[0];
1.14733 + };
1.14734 + Multiname.prototype.nameToString = function () {
1.14735 + if (this.isAnyName()) {
1.14736 + return '*';
1.14737 + } else {
1.14738 + var name = this.getName();
1.14739 + return this.isRuntimeName() ? '[]' : name;
1.14740 + }
1.14741 + };
1.14742 + Multiname.prototype.hasObjectName = function () {
1.14743 + return typeof this.name === 'object';
1.14744 + };
1.14745 + Multiname.prototype.toString = function () {
1.14746 + var str = this.isAttribute() ? '@' : '';
1.14747 + if (this.isAnyNamespace()) {
1.14748 + str += '*::' + this.nameToString();
1.14749 + } else if (this.isRuntimeNamespace()) {
1.14750 + str += '[]::' + this.nameToString();
1.14751 + } else if (this.namespaces.length === 1 && this.isQName()) {
1.14752 + str += this.namespaces[0].toString() + '::';
1.14753 + str += this.nameToString();
1.14754 + } else {
1.14755 + str += '{';
1.14756 + for (var i = 0, count = this.namespaces.length; i < count; i++) {
1.14757 + str += this.namespaces[i].toString();
1.14758 + if (i + 1 < count) {
1.14759 + str += ',';
1.14760 + }
1.14761 + }
1.14762 + str += '}::' + this.nameToString();
1.14763 + }
1.14764 + if (this.hasTypeParameter()) {
1.14765 + str += '<' + this.typeParameter.toString() + '>';
1.14766 + }
1.14767 + return str;
1.14768 + };
1.14769 + Multiname.ATTRIBUTE = 1;
1.14770 + Multiname.RUNTIME_NAMESPACE = 2;
1.14771 + Multiname.RUNTIME_NAME = 4;
1.14772 + Multiname._nextID = 0;
1.14773 + Multiname._simpleNameCache = Shumway.ObjectUtilities.createMap();
1.14774 + Multiname.Int = Multiname.getPublicQualifiedName('int');
1.14775 + Multiname.Uint = Multiname.getPublicQualifiedName('uint');
1.14776 + Multiname.Class = Multiname.getPublicQualifiedName('Class');
1.14777 + Multiname.Array = Multiname.getPublicQualifiedName('Array');
1.14778 + Multiname.Object = Multiname.getPublicQualifiedName('Object');
1.14779 + Multiname.String = Multiname.getPublicQualifiedName('String');
1.14780 + Multiname.Number = Multiname.getPublicQualifiedName('Number');
1.14781 + Multiname.Boolean = Multiname.getPublicQualifiedName('Boolean');
1.14782 + Multiname.Function = Multiname.getPublicQualifiedName('Function');
1.14783 + Multiname.XML = Multiname.getPublicQualifiedName('XML');
1.14784 + Multiname.XMLList = Multiname.getPublicQualifiedName('XMLList');
1.14785 + Multiname.TEMPORARY = new Multiname([], '');
1.14786 + return Multiname;
1.14787 + }();
1.14788 + ABC.Multiname = Multiname;
1.14789 + var MetaDataInfo = function () {
1.14790 + function MetaDataInfo(abc, stream) {
1.14791 + var strings = abc.constantPool.strings;
1.14792 + var name = this.name = strings[stream.readU30()];
1.14793 + var itemCount = stream.readU30();
1.14794 + var keys = [];
1.14795 + var items = [];
1.14796 + for (var i = 0; i < itemCount; i++) {
1.14797 + keys[i] = strings[stream.readU30()];
1.14798 + }
1.14799 + for (var i = 0; i < itemCount; i++) {
1.14800 + var key = keys[i];
1.14801 + items[i] = {
1.14802 + key: key,
1.14803 + value: strings[stream.readU30()]
1.14804 + };
1.14805 + if (key && name === 'native') {
1.14806 + true;
1.14807 + this[key] = items[i].value;
1.14808 + }
1.14809 + }
1.14810 + this.value = items;
1.14811 + }
1.14812 + MetaDataInfo.prototype.toString = function () {
1.14813 + return '[' + this.name + ']';
1.14814 + };
1.14815 + return MetaDataInfo;
1.14816 + }();
1.14817 + ABC.MetaDataInfo = MetaDataInfo;
1.14818 + (function (CONSTANT) {
1.14819 + CONSTANT[CONSTANT['Undefined'] = 0] = 'Undefined';
1.14820 + CONSTANT[CONSTANT['Utf8'] = 1] = 'Utf8';
1.14821 + CONSTANT[CONSTANT['Float'] = 2] = 'Float';
1.14822 + CONSTANT[CONSTANT['Int'] = 3] = 'Int';
1.14823 + CONSTANT[CONSTANT['UInt'] = 4] = 'UInt';
1.14824 + CONSTANT[CONSTANT['PrivateNs'] = 5] = 'PrivateNs';
1.14825 + CONSTANT[CONSTANT['Double'] = 6] = 'Double';
1.14826 + CONSTANT[CONSTANT['QName'] = 7] = 'QName';
1.14827 + CONSTANT[CONSTANT['Namespace'] = 8] = 'Namespace';
1.14828 + CONSTANT[CONSTANT['Multiname'] = 9] = 'Multiname';
1.14829 + CONSTANT[CONSTANT['False'] = 10] = 'False';
1.14830 + CONSTANT[CONSTANT['True'] = 11] = 'True';
1.14831 + CONSTANT[CONSTANT['Null'] = 12] = 'Null';
1.14832 + CONSTANT[CONSTANT['QNameA'] = 13] = 'QNameA';
1.14833 + CONSTANT[CONSTANT['MultinameA'] = 14] = 'MultinameA';
1.14834 + CONSTANT[CONSTANT['RTQName'] = 15] = 'RTQName';
1.14835 + CONSTANT[CONSTANT['RTQNameA'] = 16] = 'RTQNameA';
1.14836 + CONSTANT[CONSTANT['RTQNameL'] = 17] = 'RTQNameL';
1.14837 + CONSTANT[CONSTANT['RTQNameLA'] = 18] = 'RTQNameLA';
1.14838 + CONSTANT[CONSTANT['NameL'] = 19] = 'NameL';
1.14839 + CONSTANT[CONSTANT['NameLA'] = 20] = 'NameLA';
1.14840 + CONSTANT[CONSTANT['NamespaceSet'] = 21] = 'NamespaceSet';
1.14841 + CONSTANT[CONSTANT['PackageNamespace'] = 22] = 'PackageNamespace';
1.14842 + CONSTANT[CONSTANT['PackageInternalNs'] = 23] = 'PackageInternalNs';
1.14843 + CONSTANT[CONSTANT['ProtectedNamespace'] = 24] = 'ProtectedNamespace';
1.14844 + CONSTANT[CONSTANT['ExplicitNamespace'] = 25] = 'ExplicitNamespace';
1.14845 + CONSTANT[CONSTANT['StaticProtectedNs'] = 26] = 'StaticProtectedNs';
1.14846 + CONSTANT[CONSTANT['MultinameL'] = 27] = 'MultinameL';
1.14847 + CONSTANT[CONSTANT['MultinameLA'] = 28] = 'MultinameLA';
1.14848 + CONSTANT[CONSTANT['TypeName'] = 29] = 'TypeName';
1.14849 + CONSTANT[CONSTANT['ClassSealed'] = 1] = 'ClassSealed';
1.14850 + CONSTANT[CONSTANT['ClassFinal'] = 2] = 'ClassFinal';
1.14851 + CONSTANT[CONSTANT['ClassInterface'] = 4] = 'ClassInterface';
1.14852 + CONSTANT[CONSTANT['ClassProtectedNs'] = 8] = 'ClassProtectedNs';
1.14853 + }(ABC.CONSTANT || (ABC.CONSTANT = {})));
1.14854 + var CONSTANT = ABC.CONSTANT;
1.14855 + (function (METHOD) {
1.14856 + METHOD[METHOD['Arguments'] = 1] = 'Arguments';
1.14857 + METHOD[METHOD['Activation'] = 2] = 'Activation';
1.14858 + METHOD[METHOD['Needrest'] = 4] = 'Needrest';
1.14859 + METHOD[METHOD['HasOptional'] = 8] = 'HasOptional';
1.14860 + METHOD[METHOD['IgnoreRest'] = 16] = 'IgnoreRest';
1.14861 + METHOD[METHOD['Native'] = 32] = 'Native';
1.14862 + METHOD[METHOD['Setsdxns'] = 64] = 'Setsdxns';
1.14863 + METHOD[METHOD['HasParamNames'] = 128] = 'HasParamNames';
1.14864 + }(ABC.METHOD || (ABC.METHOD = {})));
1.14865 + var METHOD = ABC.METHOD;
1.14866 + (function (TRAIT) {
1.14867 + TRAIT[TRAIT['Slot'] = 0] = 'Slot';
1.14868 + TRAIT[TRAIT['Method'] = 1] = 'Method';
1.14869 + TRAIT[TRAIT['Getter'] = 2] = 'Getter';
1.14870 + TRAIT[TRAIT['Setter'] = 3] = 'Setter';
1.14871 + TRAIT[TRAIT['Class'] = 4] = 'Class';
1.14872 + TRAIT[TRAIT['Function'] = 5] = 'Function';
1.14873 + TRAIT[TRAIT['Const'] = 6] = 'Const';
1.14874 + }(ABC.TRAIT || (ABC.TRAIT = {})));
1.14875 + var TRAIT = ABC.TRAIT;
1.14876 + (function (ATTR) {
1.14877 + ATTR[ATTR['Final'] = 1] = 'Final';
1.14878 + ATTR[ATTR['Override'] = 2] = 'Override';
1.14879 + ATTR[ATTR['Metadata'] = 4] = 'Metadata';
1.14880 + }(ABC.ATTR || (ABC.ATTR = {})));
1.14881 + var ATTR = ABC.ATTR;
1.14882 + (function (SORT) {
1.14883 + SORT[SORT['CASEINSENSITIVE'] = 1] = 'CASEINSENSITIVE';
1.14884 + SORT[SORT['DESCENDING'] = 2] = 'DESCENDING';
1.14885 + SORT[SORT['UNIQUESORT'] = 4] = 'UNIQUESORT';
1.14886 + SORT[SORT['RETURNINDEXEDARRAY'] = 8] = 'RETURNINDEXEDARRAY';
1.14887 + SORT[SORT['NUMERIC'] = 16] = 'NUMERIC';
1.14888 + }(ABC.SORT || (ABC.SORT = {})));
1.14889 + var SORT = ABC.SORT;
1.14890 + (function (OP) {
1.14891 + OP[OP['bkpt'] = 1] = 'bkpt';
1.14892 + OP[OP['nop'] = 2] = 'nop';
1.14893 + OP[OP['throw'] = 3] = 'throw';
1.14894 + OP[OP['getsuper'] = 4] = 'getsuper';
1.14895 + OP[OP['setsuper'] = 5] = 'setsuper';
1.14896 + OP[OP['dxns'] = 6] = 'dxns';
1.14897 + OP[OP['dxnslate'] = 7] = 'dxnslate';
1.14898 + OP[OP['kill'] = 8] = 'kill';
1.14899 + OP[OP['label'] = 9] = 'label';
1.14900 + OP[OP['lf32x4'] = 10] = 'lf32x4';
1.14901 + OP[OP['sf32x4'] = 11] = 'sf32x4';
1.14902 + OP[OP['ifnlt'] = 12] = 'ifnlt';
1.14903 + OP[OP['ifnle'] = 13] = 'ifnle';
1.14904 + OP[OP['ifngt'] = 14] = 'ifngt';
1.14905 + OP[OP['ifnge'] = 15] = 'ifnge';
1.14906 + OP[OP['jump'] = 16] = 'jump';
1.14907 + OP[OP['iftrue'] = 17] = 'iftrue';
1.14908 + OP[OP['iffalse'] = 18] = 'iffalse';
1.14909 + OP[OP['ifeq'] = 19] = 'ifeq';
1.14910 + OP[OP['ifne'] = 20] = 'ifne';
1.14911 + OP[OP['iflt'] = 21] = 'iflt';
1.14912 + OP[OP['ifle'] = 22] = 'ifle';
1.14913 + OP[OP['ifgt'] = 23] = 'ifgt';
1.14914 + OP[OP['ifge'] = 24] = 'ifge';
1.14915 + OP[OP['ifstricteq'] = 25] = 'ifstricteq';
1.14916 + OP[OP['ifstrictne'] = 26] = 'ifstrictne';
1.14917 + OP[OP['lookupswitch'] = 27] = 'lookupswitch';
1.14918 + OP[OP['pushwith'] = 28] = 'pushwith';
1.14919 + OP[OP['popscope'] = 29] = 'popscope';
1.14920 + OP[OP['nextname'] = 30] = 'nextname';
1.14921 + OP[OP['hasnext'] = 31] = 'hasnext';
1.14922 + OP[OP['pushnull'] = 32] = 'pushnull';
1.14923 + OP[OP['c'] = 33] = 'c';
1.14924 + OP[OP['pushundefined'] = 33] = 'pushundefined';
1.14925 + OP[OP['pushfloat'] = 34] = 'pushfloat';
1.14926 + OP[OP['nextvalue'] = 35] = 'nextvalue';
1.14927 + OP[OP['pushbyte'] = 36] = 'pushbyte';
1.14928 + OP[OP['pushshort'] = 37] = 'pushshort';
1.14929 + OP[OP['pushtrue'] = 38] = 'pushtrue';
1.14930 + OP[OP['pushfalse'] = 39] = 'pushfalse';
1.14931 + OP[OP['pushnan'] = 40] = 'pushnan';
1.14932 + OP[OP['pop'] = 41] = 'pop';
1.14933 + OP[OP['dup'] = 42] = 'dup';
1.14934 + OP[OP['swap'] = 43] = 'swap';
1.14935 + OP[OP['pushstring'] = 44] = 'pushstring';
1.14936 + OP[OP['pushint'] = 45] = 'pushint';
1.14937 + OP[OP['pushuint'] = 46] = 'pushuint';
1.14938 + OP[OP['pushdouble'] = 47] = 'pushdouble';
1.14939 + OP[OP['pushscope'] = 48] = 'pushscope';
1.14940 + OP[OP['pushnamespace'] = 49] = 'pushnamespace';
1.14941 + OP[OP['hasnext2'] = 50] = 'hasnext2';
1.14942 + OP[OP['li8'] = 53] = 'li8';
1.14943 + OP[OP['li16'] = 54] = 'li16';
1.14944 + OP[OP['li32'] = 55] = 'li32';
1.14945 + OP[OP['lf32'] = 56] = 'lf32';
1.14946 + OP[OP['lf64'] = 57] = 'lf64';
1.14947 + OP[OP['si8'] = 58] = 'si8';
1.14948 + OP[OP['si16'] = 59] = 'si16';
1.14949 + OP[OP['si32'] = 60] = 'si32';
1.14950 + OP[OP['sf32'] = 61] = 'sf32';
1.14951 + OP[OP['sf64'] = 62] = 'sf64';
1.14952 + OP[OP['newfunction'] = 64] = 'newfunction';
1.14953 + OP[OP['call'] = 65] = 'call';
1.14954 + OP[OP['construct'] = 66] = 'construct';
1.14955 + OP[OP['callmethod'] = 67] = 'callmethod';
1.14956 + OP[OP['callstatic'] = 68] = 'callstatic';
1.14957 + OP[OP['callsuper'] = 69] = 'callsuper';
1.14958 + OP[OP['callproperty'] = 70] = 'callproperty';
1.14959 + OP[OP['returnvoid'] = 71] = 'returnvoid';
1.14960 + OP[OP['returnvalue'] = 72] = 'returnvalue';
1.14961 + OP[OP['constructsuper'] = 73] = 'constructsuper';
1.14962 + OP[OP['constructprop'] = 74] = 'constructprop';
1.14963 + OP[OP['callsuperid'] = 75] = 'callsuperid';
1.14964 + OP[OP['callproplex'] = 76] = 'callproplex';
1.14965 + OP[OP['callinterface'] = 77] = 'callinterface';
1.14966 + OP[OP['callsupervoid'] = 78] = 'callsupervoid';
1.14967 + OP[OP['callpropvoid'] = 79] = 'callpropvoid';
1.14968 + OP[OP['sxi1'] = 80] = 'sxi1';
1.14969 + OP[OP['sxi8'] = 81] = 'sxi8';
1.14970 + OP[OP['sxi16'] = 82] = 'sxi16';
1.14971 + OP[OP['applytype'] = 83] = 'applytype';
1.14972 + OP[OP['pushfloat4'] = 84] = 'pushfloat4';
1.14973 + OP[OP['newobject'] = 85] = 'newobject';
1.14974 + OP[OP['newarray'] = 86] = 'newarray';
1.14975 + OP[OP['newactivation'] = 87] = 'newactivation';
1.14976 + OP[OP['newclass'] = 88] = 'newclass';
1.14977 + OP[OP['getdescendants'] = 89] = 'getdescendants';
1.14978 + OP[OP['newcatch'] = 90] = 'newcatch';
1.14979 + OP[OP['findpropstrict'] = 93] = 'findpropstrict';
1.14980 + OP[OP['findproperty'] = 94] = 'findproperty';
1.14981 + OP[OP['finddef'] = 95] = 'finddef';
1.14982 + OP[OP['getlex'] = 96] = 'getlex';
1.14983 + OP[OP['setproperty'] = 97] = 'setproperty';
1.14984 + OP[OP['getlocal'] = 98] = 'getlocal';
1.14985 + OP[OP['setlocal'] = 99] = 'setlocal';
1.14986 + OP[OP['getglobalscope'] = 100] = 'getglobalscope';
1.14987 + OP[OP['getscopeobject'] = 101] = 'getscopeobject';
1.14988 + OP[OP['getproperty'] = 102] = 'getproperty';
1.14989 + OP[OP['getouterscope'] = 103] = 'getouterscope';
1.14990 + OP[OP['initproperty'] = 104] = 'initproperty';
1.14991 + OP[OP['setpropertylate'] = 105] = 'setpropertylate';
1.14992 + OP[OP['deleteproperty'] = 106] = 'deleteproperty';
1.14993 + OP[OP['deletepropertylate'] = 107] = 'deletepropertylate';
1.14994 + OP[OP['getslot'] = 108] = 'getslot';
1.14995 + OP[OP['setslot'] = 109] = 'setslot';
1.14996 + OP[OP['getglobalslot'] = 110] = 'getglobalslot';
1.14997 + OP[OP['setglobalslot'] = 111] = 'setglobalslot';
1.14998 + OP[OP['convert_s'] = 112] = 'convert_s';
1.14999 + OP[OP['esc_xelem'] = 113] = 'esc_xelem';
1.15000 + OP[OP['esc_xattr'] = 114] = 'esc_xattr';
1.15001 + OP[OP['convert_i'] = 115] = 'convert_i';
1.15002 + OP[OP['convert_u'] = 116] = 'convert_u';
1.15003 + OP[OP['convert_d'] = 117] = 'convert_d';
1.15004 + OP[OP['convert_b'] = 118] = 'convert_b';
1.15005 + OP[OP['convert_o'] = 119] = 'convert_o';
1.15006 + OP[OP['checkfilter'] = 120] = 'checkfilter';
1.15007 + OP[OP['convert_f'] = 121] = 'convert_f';
1.15008 + OP[OP['unplus'] = 122] = 'unplus';
1.15009 + OP[OP['convert_f4'] = 123] = 'convert_f4';
1.15010 + OP[OP['coerce'] = 128] = 'coerce';
1.15011 + OP[OP['coerce_b'] = 129] = 'coerce_b';
1.15012 + OP[OP['coerce_a'] = 130] = 'coerce_a';
1.15013 + OP[OP['coerce_i'] = 131] = 'coerce_i';
1.15014 + OP[OP['coerce_d'] = 132] = 'coerce_d';
1.15015 + OP[OP['coerce_s'] = 133] = 'coerce_s';
1.15016 + OP[OP['astype'] = 134] = 'astype';
1.15017 + OP[OP['astypelate'] = 135] = 'astypelate';
1.15018 + OP[OP['coerce_u'] = 136] = 'coerce_u';
1.15019 + OP[OP['coerce_o'] = 137] = 'coerce_o';
1.15020 + OP[OP['negate'] = 144] = 'negate';
1.15021 + OP[OP['increment'] = 145] = 'increment';
1.15022 + OP[OP['inclocal'] = 146] = 'inclocal';
1.15023 + OP[OP['decrement'] = 147] = 'decrement';
1.15024 + OP[OP['declocal'] = 148] = 'declocal';
1.15025 + OP[OP['typeof'] = 149] = 'typeof';
1.15026 + OP[OP['not'] = 150] = 'not';
1.15027 + OP[OP['bitnot'] = 151] = 'bitnot';
1.15028 + OP[OP['add'] = 160] = 'add';
1.15029 + OP[OP['subtract'] = 161] = 'subtract';
1.15030 + OP[OP['multiply'] = 162] = 'multiply';
1.15031 + OP[OP['divide'] = 163] = 'divide';
1.15032 + OP[OP['modulo'] = 164] = 'modulo';
1.15033 + OP[OP['lshift'] = 165] = 'lshift';
1.15034 + OP[OP['rshift'] = 166] = 'rshift';
1.15035 + OP[OP['urshift'] = 167] = 'urshift';
1.15036 + OP[OP['bitand'] = 168] = 'bitand';
1.15037 + OP[OP['bitor'] = 169] = 'bitor';
1.15038 + OP[OP['bitxor'] = 170] = 'bitxor';
1.15039 + OP[OP['equals'] = 171] = 'equals';
1.15040 + OP[OP['strictequals'] = 172] = 'strictequals';
1.15041 + OP[OP['lessthan'] = 173] = 'lessthan';
1.15042 + OP[OP['lessequals'] = 174] = 'lessequals';
1.15043 + OP[OP['greaterthan'] = 175] = 'greaterthan';
1.15044 + OP[OP['greaterequals'] = 176] = 'greaterequals';
1.15045 + OP[OP['instanceof'] = 177] = 'instanceof';
1.15046 + OP[OP['istype'] = 178] = 'istype';
1.15047 + OP[OP['istypelate'] = 179] = 'istypelate';
1.15048 + OP[OP['in'] = 180] = 'in';
1.15049 + OP[OP['increment_i'] = 192] = 'increment_i';
1.15050 + OP[OP['decrement_i'] = 193] = 'decrement_i';
1.15051 + OP[OP['inclocal_i'] = 194] = 'inclocal_i';
1.15052 + OP[OP['declocal_i'] = 195] = 'declocal_i';
1.15053 + OP[OP['negate_i'] = 196] = 'negate_i';
1.15054 + OP[OP['add_i'] = 197] = 'add_i';
1.15055 + OP[OP['subtract_i'] = 198] = 'subtract_i';
1.15056 + OP[OP['multiply_i'] = 199] = 'multiply_i';
1.15057 + OP[OP['getlocal0'] = 208] = 'getlocal0';
1.15058 + OP[OP['getlocal1'] = 209] = 'getlocal1';
1.15059 + OP[OP['getlocal2'] = 210] = 'getlocal2';
1.15060 + OP[OP['getlocal3'] = 211] = 'getlocal3';
1.15061 + OP[OP['setlocal0'] = 212] = 'setlocal0';
1.15062 + OP[OP['setlocal1'] = 213] = 'setlocal1';
1.15063 + OP[OP['setlocal2'] = 214] = 'setlocal2';
1.15064 + OP[OP['setlocal3'] = 215] = 'setlocal3';
1.15065 + OP[OP['invalid'] = 237] = 'invalid';
1.15066 + OP[OP['debug'] = 239] = 'debug';
1.15067 + OP[OP['debugline'] = 240] = 'debugline';
1.15068 + OP[OP['debugfile'] = 241] = 'debugfile';
1.15069 + OP[OP['bkptline'] = 242] = 'bkptline';
1.15070 + OP[OP['timestamp'] = 243] = 'timestamp';
1.15071 + }(ABC.OP || (ABC.OP = {})));
1.15072 + var OP = ABC.OP;
1.15073 + var ConstantPool = function () {
1.15074 + function ConstantPool(stream, abc) {
1.15075 + var n;
1.15076 + var ints = [
1.15077 + 0
1.15078 + ];
1.15079 + n = stream.readU30();
1.15080 + for (var i = 1; i < n; ++i) {
1.15081 + ints.push(stream.readS32());
1.15082 + }
1.15083 + var uints = [
1.15084 + 0
1.15085 + ];
1.15086 + n = stream.readU30();
1.15087 + for (var i = 1; i < n; ++i) {
1.15088 + uints.push(stream.readU32());
1.15089 + }
1.15090 + var doubles = [
1.15091 + NaN
1.15092 + ];
1.15093 + n = stream.readU30();
1.15094 + for (var i = 1; i < n; ++i) {
1.15095 + doubles.push(stream.readDouble());
1.15096 + }
1.15097 + Timer.start('Parse Strings');
1.15098 + var strings = [
1.15099 + ''
1.15100 + ];
1.15101 + n = stream.readU30();
1.15102 + for (var i = 1; i < n; ++i) {
1.15103 + strings.push(stream.readUTFString(stream.readU30()));
1.15104 + }
1.15105 + this.positionAfterUTFStrings = stream.position;
1.15106 + Timer.stop();
1.15107 + this.ints = ints;
1.15108 + this.uints = uints;
1.15109 + this.doubles = doubles;
1.15110 + this.strings = strings;
1.15111 + Timer.start('Parse Namespaces');
1.15112 + var namespaces = [
1.15113 + undefined
1.15114 + ];
1.15115 + n = stream.readU30();
1.15116 + for (var i = 1; i < n; ++i) {
1.15117 + namespaces.push(Namespace.parse(this, stream, abc.hash + i));
1.15118 + }
1.15119 + Timer.stop();
1.15120 + Timer.start('Parse Namespace Sets');
1.15121 + var namespaceSets = [
1.15122 + undefined
1.15123 + ];
1.15124 + n = stream.readU30();
1.15125 + for (var i = 1; i < n; ++i) {
1.15126 + var count = stream.readU30();
1.15127 + var set = [];
1.15128 + set.runtimeId = ConstantPool._nextNamespaceSetID++;
1.15129 + for (var j = 0; j < count; ++j) {
1.15130 + set.push(namespaces[stream.readU30()]);
1.15131 + }
1.15132 + namespaceSets.push(set);
1.15133 + }
1.15134 + Timer.stop();
1.15135 + this.namespaces = namespaces;
1.15136 + this.namespaceSets = namespaceSets;
1.15137 + Timer.start('Parse Multinames');
1.15138 + var multinames = [
1.15139 + undefined
1.15140 + ];
1.15141 + var patchFactoryTypes = [];
1.15142 + n = stream.readU30();
1.15143 + for (var i = 1; i < n; ++i) {
1.15144 + multinames.push(Multiname.parse(this, stream, multinames, patchFactoryTypes));
1.15145 + }
1.15146 + Timer.stop();
1.15147 + this.multinames = multinames;
1.15148 + }
1.15149 + ConstantPool.prototype.getValue = function (kind, index) {
1.15150 + switch (kind) {
1.15151 + case 3:
1.15152 + return this.ints[index];
1.15153 + case 4:
1.15154 + return this.uints[index];
1.15155 + case 6:
1.15156 + return this.doubles[index];
1.15157 + case 1:
1.15158 + return this.strings[index];
1.15159 + case 11:
1.15160 + return true;
1.15161 + case 10:
1.15162 + return false;
1.15163 + case 12:
1.15164 + return null;
1.15165 + case 0:
1.15166 + return undefined;
1.15167 + case 8:
1.15168 + case 23:
1.15169 + return this.namespaces[index];
1.15170 + case 7:
1.15171 + case 14:
1.15172 + case 15:
1.15173 + case 16:
1.15174 + case 17:
1.15175 + case 18:
1.15176 + case 19:
1.15177 + case 20:
1.15178 + return this.multinames[index];
1.15179 + case 2:
1.15180 + Shumway.Debug.warning('TODO: CONSTANT.Float may be deprecated?');
1.15181 + break;
1.15182 + default:
1.15183 + true;
1.15184 + }
1.15185 + };
1.15186 + ConstantPool._nextNamespaceSetID = 1;
1.15187 + return ConstantPool;
1.15188 + }();
1.15189 + ABC.ConstantPool = ConstantPool;
1.15190 + }(AVM2.ABC || (AVM2.ABC = {})));
1.15191 + var ABC = AVM2.ABC;
1.15192 + }(Shumway.AVM2 || (Shumway.AVM2 = {})));
1.15193 + var AVM2 = Shumway.AVM2;
1.15194 +}(Shumway || (Shumway = {})));
1.15195 +var AbcFile = Shumway.AVM2.ABC.AbcFile;
1.15196 +var AbcStream = Shumway.AVM2.ABC.AbcStream;
1.15197 +var ConstantPool = Shumway.AVM2.ABC.ConstantPool;
1.15198 +var ClassInfo = Shumway.AVM2.ABC.ClassInfo;
1.15199 +var MetaDataInfo = Shumway.AVM2.ABC.MetaDataInfo;
1.15200 +var InstanceInfo = Shumway.AVM2.ABC.InstanceInfo;
1.15201 +var ScriptInfo = Shumway.AVM2.ABC.ScriptInfo;
1.15202 +var Trait = Shumway.AVM2.ABC.Trait;
1.15203 +var MethodInfo = Shumway.AVM2.ABC.MethodInfo;
1.15204 +var Multiname = Shumway.AVM2.ABC.Multiname;
1.15205 +var ASNamespace = Shumway.AVM2.ABC.Namespace;
1.15206 +var AbcFile = Shumway.AVM2.ABC.AbcFile;
1.15207 +var AbcStream = Shumway.AVM2.ABC.AbcStream;
1.15208 +var ConstantPool = Shumway.AVM2.ABC.ConstantPool;
1.15209 +var ClassInfo = Shumway.AVM2.ABC.ClassInfo;
1.15210 +var MetaDataInfo = Shumway.AVM2.ABC.MetaDataInfo;
1.15211 +var InstanceInfo = Shumway.AVM2.ABC.InstanceInfo;
1.15212 +var ScriptInfo = Shumway.AVM2.ABC.ScriptInfo;
1.15213 +var Trait = Shumway.AVM2.ABC.Trait;
1.15214 +var MethodInfo = Shumway.AVM2.ABC.MethodInfo;
1.15215 +var Multiname = Shumway.AVM2.ABC.Multiname;
1.15216 +var ASNamespace = Shumway.AVM2.ABC.Namespace;
1.15217 +var Bytecode = function () {
1.15218 + function Bytecode(code) {
1.15219 + var op = code.readU8();
1.15220 + this.op = op;
1.15221 + this.originalPosition = code.position;
1.15222 + var opdesc = Shumway.AVM2.opcodeTable[op];
1.15223 + if (!opdesc) {
1.15224 + unexpected('Unknown Op ' + op);
1.15225 + }
1.15226 + this.canThrow = opdesc.canThrow;
1.15227 + var i, n;
1.15228 + switch (op) {
1.15229 + case OP_lookupswitch:
1.15230 + var defaultOffset = code.readS24();
1.15231 + this.offsets = [];
1.15232 + var n = code.readU30() + 1;
1.15233 + for (i = 0; i < n; i++) {
1.15234 + this.offsets.push(code.readS24());
1.15235 + }
1.15236 + this.offsets.push(defaultOffset);
1.15237 + break;
1.15238 + default:
1.15239 + for (i = 0, n = opdesc.operands.length; i < n; i++) {
1.15240 + var operand = opdesc.operands[i];
1.15241 + switch (operand.size) {
1.15242 + case 'u08':
1.15243 + this[operand.name] = code.readU8();
1.15244 + break;
1.15245 + case 's08':
1.15246 + this[operand.name] = code.readS8();
1.15247 + break;
1.15248 + case 's16':
1.15249 + this[operand.name] = code.readS16();
1.15250 + break;
1.15251 + case 's24':
1.15252 + this[operand.name] = code.readS24();
1.15253 + break;
1.15254 + case 'u30':
1.15255 + this[operand.name] = code.readU30();
1.15256 + break;
1.15257 + case 'u32':
1.15258 + this[operand.name] = code.readU32();
1.15259 + break;
1.15260 + default:
1.15261 + unexpected();
1.15262 + }
1.15263 + }
1.15264 + }
1.15265 + }
1.15266 + Bytecode.prototype = {
1.15267 + makeBlockHead: function makeBlockHead(id) {
1.15268 + if (this.succs) {
1.15269 + return id;
1.15270 + }
1.15271 + this.bid = id;
1.15272 + this.succs = [];
1.15273 + this.preds = [];
1.15274 + this.dominatees = [];
1.15275 + return id + 1;
1.15276 + },
1.15277 + trace: function trace(writer) {
1.15278 + if (!this.succs) {
1.15279 + return;
1.15280 + }
1.15281 + writer.writeLn('#' + this.bid);
1.15282 + },
1.15283 + toString: function toString(abc) {
1.15284 + var opDescription = Shumway.AVM2.opcodeTable[this.op];
1.15285 + var str = opDescription.name.padRight(' ', 20);
1.15286 + var i, j;
1.15287 + if (this.op === OP_lookupswitch) {
1.15288 + str += 'targets:';
1.15289 + for (i = 0, j = this.targets.length; i < j; i++) {
1.15290 + str += (i > 0 ? ',' : '') + this.targets[i].position;
1.15291 + }
1.15292 + } else {
1.15293 + for (i = 0, j = opDescription.operands.length; i < j; i++) {
1.15294 + var operand = opDescription.operands[i];
1.15295 + if (operand.name === 'offset') {
1.15296 + str += 'target:' + this.target.position;
1.15297 + } else {
1.15298 + str += operand.name + ': ';
1.15299 + var value = this[operand.name];
1.15300 + if (abc) {
1.15301 + switch (operand.type) {
1.15302 + case '':
1.15303 + str += value;
1.15304 + break;
1.15305 + case 'I':
1.15306 + str += abc.constantPool.ints[value];
1.15307 + break;
1.15308 + case 'U':
1.15309 + str += abc.constantPool.uints[value];
1.15310 + break;
1.15311 + case 'D':
1.15312 + str += abc.constantPool.doubles[value];
1.15313 + break;
1.15314 + case 'S':
1.15315 + str += abc.constantPool.strings[value];
1.15316 + break;
1.15317 + case 'N':
1.15318 + str += abc.constantPool.namespaces[value];
1.15319 + break;
1.15320 + case 'CI':
1.15321 + str += abc.classes[value];
1.15322 + break;
1.15323 + case 'M':
1.15324 + str += abc.constantPool.multinames[value];
1.15325 + break;
1.15326 + default:
1.15327 + str += '?';
1.15328 + break;
1.15329 + }
1.15330 + } else {
1.15331 + str += value;
1.15332 + }
1.15333 + }
1.15334 + if (i < j - 1) {
1.15335 + str += ', ';
1.15336 + }
1.15337 + }
1.15338 + }
1.15339 + return str;
1.15340 + }
1.15341 + };
1.15342 + return Bytecode;
1.15343 + }();
1.15344 +var Analysis = function () {
1.15345 + function blockSetClass(length, blockById) {
1.15346 + var BlockSet = BitSetFunctor(length);
1.15347 + var ADDRESS_BITS_PER_WORD = BlockSet.ADDRESS_BITS_PER_WORD;
1.15348 + var BITS_PER_WORD = BlockSet.BITS_PER_WORD;
1.15349 + var BIT_INDEX_MASK = BlockSet.BIT_INDEX_MASK;
1.15350 + BlockSet.singleton = function singleton(b) {
1.15351 + var bs = new BlockSet();
1.15352 + bs.set(b.bid);
1.15353 + bs.count = 1;
1.15354 + bs.dirty = 0;
1.15355 + return bs;
1.15356 + };
1.15357 + BlockSet.fromBlocks = function fromArray(other) {
1.15358 + var bs = new BlockSet();
1.15359 + bs.setBlocks(other);
1.15360 + return bs;
1.15361 + };
1.15362 + var Bsp = BlockSet.prototype;
1.15363 + if (BlockSet.singleword) {
1.15364 + Bsp.forEachBlock = function forEach(fn) {
1.15365 + true;
1.15366 + var byId = blockById;
1.15367 + var word = this.bits;
1.15368 + if (word) {
1.15369 + for (var k = 0; k < BITS_PER_WORD; k++) {
1.15370 + if (word & 1 << k) {
1.15371 + fn(byId[k]);
1.15372 + }
1.15373 + }
1.15374 + }
1.15375 + };
1.15376 + Bsp.choose = function choose() {
1.15377 + var byId = blockById;
1.15378 + var word = this.bits;
1.15379 + if (word) {
1.15380 + for (var k = 0; k < BITS_PER_WORD; k++) {
1.15381 + if (word & 1 << k) {
1.15382 + return byId[k];
1.15383 + }
1.15384 + }
1.15385 + }
1.15386 + };
1.15387 + Bsp.members = function members() {
1.15388 + var byId = blockById;
1.15389 + var set = [];
1.15390 + var word = this.bits;
1.15391 + if (word) {
1.15392 + for (var k = 0; k < BITS_PER_WORD; k++) {
1.15393 + if (word & 1 << k) {
1.15394 + set.push(byId[k]);
1.15395 + }
1.15396 + }
1.15397 + }
1.15398 + return set;
1.15399 + };
1.15400 + Bsp.setBlocks = function setBlocks(bs) {
1.15401 + var bits = this.bits;
1.15402 + for (var i = 0, j = bs.length; i < j; i++) {
1.15403 + var id = bs[i].bid;
1.15404 + bits |= 1 << (id & BIT_INDEX_MASK);
1.15405 + }
1.15406 + this.bits = bits;
1.15407 + };
1.15408 + } else {
1.15409 + Bsp.forEachBlock = function forEach(fn) {
1.15410 + true;
1.15411 + var byId = blockById;
1.15412 + var bits = this.bits;
1.15413 + for (var i = 0, j = bits.length; i < j; i++) {
1.15414 + var word = bits[i];
1.15415 + if (word) {
1.15416 + for (var k = 0; k < BITS_PER_WORD; k++) {
1.15417 + if (word & 1 << k) {
1.15418 + fn(byId[i * BITS_PER_WORD + k]);
1.15419 + }
1.15420 + }
1.15421 + }
1.15422 + }
1.15423 + };
1.15424 + Bsp.choose = function choose() {
1.15425 + var byId = blockById;
1.15426 + var bits = this.bits;
1.15427 + for (var i = 0, j = bits.length; i < j; i++) {
1.15428 + var word = bits[i];
1.15429 + if (word) {
1.15430 + for (var k = 0; k < BITS_PER_WORD; k++) {
1.15431 + if (word & 1 << k) {
1.15432 + return byId[i * BITS_PER_WORD + k];
1.15433 + }
1.15434 + }
1.15435 + }
1.15436 + }
1.15437 + };
1.15438 + Bsp.members = function members() {
1.15439 + var byId = blockById;
1.15440 + var set = [];
1.15441 + var bits = this.bits;
1.15442 + for (var i = 0, j = bits.length; i < j; i++) {
1.15443 + var word = bits[i];
1.15444 + if (word) {
1.15445 + for (var k = 0; k < BITS_PER_WORD; k++) {
1.15446 + if (word & 1 << k) {
1.15447 + set.push(byId[i * BITS_PER_WORD + k]);
1.15448 + }
1.15449 + }
1.15450 + }
1.15451 + }
1.15452 + return set;
1.15453 + };
1.15454 + Bsp.setBlocks = function setBlocks(bs) {
1.15455 + var bits = this.bits;
1.15456 + for (var i = 0, j = bs.length; i < j; i++) {
1.15457 + var id = bs[i].bid;
1.15458 + bits[id >> ADDRESS_BITS_PER_WORD] |= 1 << (id & BIT_INDEX_MASK);
1.15459 + }
1.15460 + };
1.15461 + }
1.15462 + return BlockSet;
1.15463 + }
1.15464 + function Analysis(method) {
1.15465 + Counter.count('Analysis');
1.15466 + this.method = method;
1.15467 + if (this.method.code) {
1.15468 + Timer.start('Normalize');
1.15469 + this.normalizeBytecode();
1.15470 + Timer.stop();
1.15471 + }
1.15472 + }
1.15473 + Analysis.prototype = {
1.15474 + normalizeBytecode: function normalizeBytecode() {
1.15475 + function getInvalidTarget(cache, offset) {
1.15476 + if (cache && cache[offset]) {
1.15477 + return cache[offset];
1.15478 + }
1.15479 + var code = Object.create(Bytecode.prototype);
1.15480 + code.op = OP_invalid;
1.15481 + code.position = offset;
1.15482 + cache && (cache[offset] = code);
1.15483 + return code;
1.15484 + }
1.15485 + var method = this.method;
1.15486 + function accessLocal(index) {
1.15487 + if (index-- === 0)
1.15488 + return;
1.15489 + if (index < method.parameters.length) {
1.15490 + method.parameters[index].isUsed = true;
1.15491 + }
1.15492 + }
1.15493 + var bytecodesOffset = [];
1.15494 + var bytecodes = [];
1.15495 + var codeStream = new AbcStream(this.method.code);
1.15496 + var code;
1.15497 + while (codeStream.remaining() > 0) {
1.15498 + var pos = codeStream.position;
1.15499 + code = new Bytecode(codeStream);
1.15500 + switch (code.op) {
1.15501 + case OP_nop:
1.15502 + case OP_label:
1.15503 + bytecodesOffset[pos] = bytecodes.length;
1.15504 + continue;
1.15505 + case OP_lookupswitch:
1.15506 + this.method.hasLookupSwitches = true;
1.15507 + code.targets = [];
1.15508 + var offsets = code.offsets;
1.15509 + for (var i = 0, j = offsets.length; i < j; i++) {
1.15510 + offsets[i] += pos;
1.15511 + }
1.15512 + break;
1.15513 + case OP_jump:
1.15514 + case OP_iflt:
1.15515 + case OP_ifnlt:
1.15516 + case OP_ifle:
1.15517 + case OP_ifnle:
1.15518 + case OP_ifgt:
1.15519 + case OP_ifngt:
1.15520 + case OP_ifge:
1.15521 + case OP_ifnge:
1.15522 + case OP_ifeq:
1.15523 + case OP_ifne:
1.15524 + case OP_ifstricteq:
1.15525 + case OP_ifstrictne:
1.15526 + case OP_iftrue:
1.15527 + case OP_iffalse:
1.15528 + code.offset += codeStream.position;
1.15529 + break;
1.15530 + case OP_getlocal0:
1.15531 + case OP_getlocal1:
1.15532 + case OP_getlocal2:
1.15533 + case OP_getlocal3:
1.15534 + accessLocal(code.op - OP_getlocal0);
1.15535 + break;
1.15536 + case OP_getlocal:
1.15537 + accessLocal(code.index);
1.15538 + break;
1.15539 + default:
1.15540 + break;
1.15541 + }
1.15542 + code.position = bytecodes.length;
1.15543 + bytecodesOffset[pos] = bytecodes.length;
1.15544 + bytecodes.push(code);
1.15545 + }
1.15546 + var invalidJumps = {};
1.15547 + var newOffset;
1.15548 + for (var pc = 0, end = bytecodes.length; pc < end; pc++) {
1.15549 + code = bytecodes[pc];
1.15550 + switch (code.op) {
1.15551 + case OP_lookupswitch:
1.15552 + var offsets = code.offsets;
1.15553 + for (var i = 0, j = offsets.length; i < j; i++) {
1.15554 + newOffset = bytecodesOffset[offsets[i]];
1.15555 + code.targets.push(bytecodes[newOffset] || getInvalidTarget(invalidJumps, offsets[i]));
1.15556 + offsets[i] = newOffset;
1.15557 + }
1.15558 + break;
1.15559 + case OP_jump:
1.15560 + case OP_iflt:
1.15561 + case OP_ifnlt:
1.15562 + case OP_ifle:
1.15563 + case OP_ifnle:
1.15564 + case OP_ifgt:
1.15565 + case OP_ifngt:
1.15566 + case OP_ifge:
1.15567 + case OP_ifnge:
1.15568 + case OP_ifeq:
1.15569 + case OP_ifne:
1.15570 + case OP_ifstricteq:
1.15571 + case OP_ifstrictne:
1.15572 + case OP_iftrue:
1.15573 + case OP_iffalse:
1.15574 + newOffset = bytecodesOffset[code.offset];
1.15575 + code.target = bytecodes[newOffset] || getInvalidTarget(invalidJumps, code.offset);
1.15576 + code.offset = newOffset;
1.15577 + break;
1.15578 + default:
1.15579 + }
1.15580 + }
1.15581 + this.bytecodes = bytecodes;
1.15582 + var exceptions = this.method.exceptions;
1.15583 + for (var i = 0, j = exceptions.length; i < j; i++) {
1.15584 + var ex = exceptions[i];
1.15585 + ex.start = bytecodesOffset[ex.start];
1.15586 + ex.end = bytecodesOffset[ex.end];
1.15587 + ex.offset = bytecodesOffset[ex.target];
1.15588 + ex.target = bytecodes[ex.offset];
1.15589 + ex.target.exception = ex;
1.15590 + }
1.15591 + },
1.15592 + detectBasicBlocks: function detectBasicBlocks() {
1.15593 + var bytecodes = this.bytecodes;
1.15594 + var exceptions = this.method.exceptions;
1.15595 + var hasExceptions = exceptions.length > 0;
1.15596 + var blockById = {};
1.15597 + var code;
1.15598 + var pc, end;
1.15599 + var id = 0;
1.15600 + function tryTargets(block) {
1.15601 + var targets = [];
1.15602 + for (var i = 0, j = exceptions.length; i < j; i++) {
1.15603 + var ex = exceptions[i];
1.15604 + if (block.position >= ex.start && block.end.position <= ex.end) {
1.15605 + targets.push(ex.target);
1.15606 + }
1.15607 + }
1.15608 + return targets;
1.15609 + }
1.15610 + id = bytecodes[0].makeBlockHead(id);
1.15611 + for (pc = 0, end = bytecodes.length - 1; pc < end; pc++) {
1.15612 + code = bytecodes[pc];
1.15613 + switch (code.op) {
1.15614 + case OP_returnvoid:
1.15615 + case OP_returnvalue:
1.15616 + case OP_throw:
1.15617 + id = bytecodes[pc + 1].makeBlockHead(id);
1.15618 + break;
1.15619 + case OP_lookupswitch:
1.15620 + var targets = code.targets;
1.15621 + for (var i = 0, j = targets.length; i < j; i++) {
1.15622 + id = targets[i].makeBlockHead(id);
1.15623 + }
1.15624 + id = bytecodes[pc + 1].makeBlockHead(id);
1.15625 + break;
1.15626 + case OP_jump:
1.15627 + case OP_iflt:
1.15628 + case OP_ifnlt:
1.15629 + case OP_ifle:
1.15630 + case OP_ifnle:
1.15631 + case OP_ifgt:
1.15632 + case OP_ifngt:
1.15633 + case OP_ifge:
1.15634 + case OP_ifnge:
1.15635 + case OP_ifeq:
1.15636 + case OP_ifne:
1.15637 + case OP_ifstricteq:
1.15638 + case OP_ifstrictne:
1.15639 + case OP_iftrue:
1.15640 + case OP_iffalse:
1.15641 + id = code.target.makeBlockHead(id);
1.15642 + id = bytecodes[pc + 1].makeBlockHead(id);
1.15643 + break;
1.15644 + default:
1.15645 + }
1.15646 + }
1.15647 + code = bytecodes[end];
1.15648 + switch (code.op) {
1.15649 + case OP_returnvoid:
1.15650 + case OP_returnvalue:
1.15651 + case OP_throw:
1.15652 + break;
1.15653 + case OP_lookupswitch:
1.15654 + var targets = code.targets;
1.15655 + for (var i = 0, j = targets.length; i < j; i++) {
1.15656 + id = targets[i].makeBlockHead(id);
1.15657 + }
1.15658 + break;
1.15659 + case OP_jump:
1.15660 + id = code.target.makeBlockHead(id);
1.15661 + break;
1.15662 + case OP_iflt:
1.15663 + case OP_ifnlt:
1.15664 + case OP_ifle:
1.15665 + case OP_ifnle:
1.15666 + case OP_ifgt:
1.15667 + case OP_ifngt:
1.15668 + case OP_ifge:
1.15669 + case OP_ifnge:
1.15670 + case OP_ifeq:
1.15671 + case OP_ifne:
1.15672 + case OP_ifstricteq:
1.15673 + case OP_ifstrictne:
1.15674 + case OP_iftrue:
1.15675 + case OP_iffalse:
1.15676 + id = code.target.makeBlockHead(id);
1.15677 + bytecodes[pc + 1] = getInvalidTarget(null, pc + 1);
1.15678 + id = bytecodes[pc + 1].makeBlockHead(id);
1.15679 + break;
1.15680 + default:
1.15681 + }
1.15682 + if (hasExceptions) {
1.15683 + for (var i = 0, j = exceptions.length; i < j; i++) {
1.15684 + var ex = exceptions[i];
1.15685 + var tryStart = bytecodes[ex.start];
1.15686 + var afterTry = bytecodes[ex.end + 1];
1.15687 + id = tryStart.makeBlockHead(id);
1.15688 + if (afterTry) {
1.15689 + id = afterTry.makeBlockHead(id);
1.15690 + }
1.15691 + id = ex.target.makeBlockHead(id);
1.15692 + }
1.15693 + }
1.15694 + var currentBlock = bytecodes[0];
1.15695 + for (pc = 1, end = bytecodes.length; pc < end; pc++) {
1.15696 + if (!bytecodes[pc].succs) {
1.15697 + continue;
1.15698 + }
1.15699 + true;
1.15700 + blockById[currentBlock.bid] = currentBlock;
1.15701 + code = bytecodes[pc - 1];
1.15702 + currentBlock.end = code;
1.15703 + var nextBlock = bytecodes[pc];
1.15704 + switch (code.op) {
1.15705 + case OP_returnvoid:
1.15706 + case OP_returnvalue:
1.15707 + case OP_throw:
1.15708 + break;
1.15709 + case OP_lookupswitch:
1.15710 + for (var i = 0, j = code.targets.length; i < j; i++) {
1.15711 + currentBlock.succs.push(code.targets[i]);
1.15712 + }
1.15713 + break;
1.15714 + case OP_jump:
1.15715 + currentBlock.succs.push(code.target);
1.15716 + break;
1.15717 + case OP_iflt:
1.15718 + case OP_ifnlt:
1.15719 + case OP_ifle:
1.15720 + case OP_ifnle:
1.15721 + case OP_ifgt:
1.15722 + case OP_ifngt:
1.15723 + case OP_ifge:
1.15724 + case OP_ifnge:
1.15725 + case OP_ifeq:
1.15726 + case OP_ifne:
1.15727 + case OP_ifstricteq:
1.15728 + case OP_ifstrictne:
1.15729 + case OP_iftrue:
1.15730 + case OP_iffalse:
1.15731 + currentBlock.succs.push(code.target);
1.15732 + if (code.target !== nextBlock) {
1.15733 + currentBlock.succs.push(nextBlock);
1.15734 + }
1.15735 + break;
1.15736 + default:
1.15737 + currentBlock.succs.push(nextBlock);
1.15738 + }
1.15739 + if (hasExceptions) {
1.15740 + var targets = tryTargets(currentBlock);
1.15741 + currentBlock.hasCatches = targets.length > 0;
1.15742 + currentBlock.succs.push.apply(currentBlock.succs, targets);
1.15743 + }
1.15744 + currentBlock = nextBlock;
1.15745 + }
1.15746 + blockById[currentBlock.bid] = currentBlock;
1.15747 + code = bytecodes[end - 1];
1.15748 + switch (code.op) {
1.15749 + case OP_lookupswitch:
1.15750 + for (var i = 0, j = code.targets.length; i < j; i++) {
1.15751 + currentBlock.succs.push(code.targets[i]);
1.15752 + }
1.15753 + break;
1.15754 + case OP_jump:
1.15755 + currentBlock.succs.push(code.target);
1.15756 + break;
1.15757 + default:
1.15758 + }
1.15759 + currentBlock.end = code;
1.15760 + this.BlockSet = blockSetClass(id, blockById);
1.15761 + },
1.15762 + normalizeReachableBlocks: function normalizeReachableBlocks() {
1.15763 + var root = this.bytecodes[0];
1.15764 + true;
1.15765 + var ONCE = 1;
1.15766 + var BUNCH_OF_TIMES = 2;
1.15767 + var BlockSet = this.BlockSet;
1.15768 + var blocks = [];
1.15769 + var visited = {};
1.15770 + var ancestors = {};
1.15771 + var worklist = [
1.15772 + root
1.15773 + ];
1.15774 + var node;
1.15775 + ancestors[root.bid] = true;
1.15776 + while (node = worklist.top()) {
1.15777 + if (visited[node.bid]) {
1.15778 + if (visited[node.bid] === ONCE) {
1.15779 + visited[node.bid] = BUNCH_OF_TIMES;
1.15780 + blocks.push(node);
1.15781 + var succs = node.succs;
1.15782 + for (var i = 0, j = succs.length; i < j; i++) {
1.15783 + succs[i].preds.push(node);
1.15784 + }
1.15785 + }
1.15786 + ancestors[node.bid] = false;
1.15787 + worklist.pop();
1.15788 + continue;
1.15789 + }
1.15790 + visited[node.bid] = ONCE;
1.15791 + ancestors[node.bid] = true;
1.15792 + var succs = node.succs;
1.15793 + for (var i = 0, j = succs.length; i < j; i++) {
1.15794 + var s = succs[i];
1.15795 + if (ancestors[s.bid]) {
1.15796 + if (!node.spbacks) {
1.15797 + node.spbacks = new BlockSet();
1.15798 + }
1.15799 + node.spbacks.set(s.bid);
1.15800 + }
1.15801 + !visited[s.bid] && worklist.push(s);
1.15802 + }
1.15803 + }
1.15804 + this.blocks = blocks.reverse();
1.15805 + },
1.15806 + computeDominance: function computeDominance() {
1.15807 + function intersectDominators(doms, b1, b2) {
1.15808 + var finger1 = b1;
1.15809 + var finger2 = b2;
1.15810 + while (finger1 !== finger2) {
1.15811 + while (finger1 > finger2) {
1.15812 + finger1 = doms[finger1];
1.15813 + }
1.15814 + while (finger2 > finger1) {
1.15815 + finger2 = doms[finger2];
1.15816 + }
1.15817 + }
1.15818 + return finger1;
1.15819 + }
1.15820 + var blocks = this.blocks;
1.15821 + var n = blocks.length;
1.15822 + var doms = new Array(n);
1.15823 + doms[0] = 0;
1.15824 + var rpo = {};
1.15825 + for (var b = 0; b < n; b++) {
1.15826 + rpo[blocks[b].bid] = b;
1.15827 + }
1.15828 + var changed = true;
1.15829 + while (changed) {
1.15830 + changed = false;
1.15831 + for (var b = 1; b < n; b++) {
1.15832 + var preds = blocks[b].preds;
1.15833 + var j = preds.length;
1.15834 + var newIdom = rpo[preds[0].bid];
1.15835 + if (!(newIdom in doms)) {
1.15836 + for (var i = 1; i < j; i++) {
1.15837 + newIdom = rpo[preds[i].bid];
1.15838 + if (newIdom in doms) {
1.15839 + break;
1.15840 + }
1.15841 + }
1.15842 + }
1.15843 + true;
1.15844 + for (var i = 0; i < j; i++) {
1.15845 + var p = rpo[preds[i].bid];
1.15846 + if (p === newIdom) {
1.15847 + continue;
1.15848 + }
1.15849 + if (p in doms) {
1.15850 + newIdom = intersectDominators(doms, p, newIdom);
1.15851 + }
1.15852 + }
1.15853 + if (doms[b] !== newIdom) {
1.15854 + doms[b] = newIdom;
1.15855 + changed = true;
1.15856 + }
1.15857 + }
1.15858 + }
1.15859 + blocks[0].dominator = blocks[0];
1.15860 + var block;
1.15861 + for (var b = 1; b < n; b++) {
1.15862 + block = blocks[b];
1.15863 + var idom = blocks[doms[b]];
1.15864 + block.dominator = idom;
1.15865 + idom.dominatees.push(block);
1.15866 + block.npreds = block.preds.length;
1.15867 + }
1.15868 + var worklist = [
1.15869 + blocks[0]
1.15870 + ];
1.15871 + blocks[0].level || (blocks[0].level = 0);
1.15872 + while (block = worklist.shift()) {
1.15873 + var dominatees = block.dominatees;
1.15874 + for (var i = 0, j = dominatees.length; i < j; i++) {
1.15875 + dominatees[i].level = block.level + 1;
1.15876 + }
1.15877 + worklist.push.apply(worklist, dominatees);
1.15878 + }
1.15879 + },
1.15880 + analyzeControlFlow: function analyzeControlFlow() {
1.15881 + true;
1.15882 + this.detectBasicBlocks();
1.15883 + this.normalizeReachableBlocks();
1.15884 + this.computeDominance();
1.15885 + this.analyzedControlFlow = true;
1.15886 + return true;
1.15887 + },
1.15888 + markLoops: function markLoops() {
1.15889 + if (!this.analyzedControlFlow && !this.analyzeControlFlow()) {
1.15890 + return false;
1.15891 + }
1.15892 + var BlockSet = this.BlockSet;
1.15893 + function findSCCs(root) {
1.15894 + var preorderId = 1;
1.15895 + var preorder = {};
1.15896 + var assigned = {};
1.15897 + var unconnectedNodes = [];
1.15898 + var pendingNodes = [];
1.15899 + var sccs = [];
1.15900 + var level = root.level + 1;
1.15901 + var worklist = [
1.15902 + root
1.15903 + ];
1.15904 + var node;
1.15905 + var u, s;
1.15906 + while (node = worklist.top()) {
1.15907 + if (preorder[node.bid]) {
1.15908 + if (pendingNodes.peek() === node) {
1.15909 + pendingNodes.pop();
1.15910 + var scc = [];
1.15911 + do {
1.15912 + u = unconnectedNodes.pop();
1.15913 + assigned[u.bid] = true;
1.15914 + scc.push(u);
1.15915 + } while (u !== node);
1.15916 + if (scc.length > 1 || u.spbacks && u.spbacks.get(u.bid)) {
1.15917 + sccs.push(scc);
1.15918 + }
1.15919 + }
1.15920 + worklist.pop();
1.15921 + continue;
1.15922 + }
1.15923 + preorder[node.bid] = preorderId++;
1.15924 + unconnectedNodes.push(node);
1.15925 + pendingNodes.push(node);
1.15926 + var succs = node.succs;
1.15927 + for (var i = 0, j = succs.length; i < j; i++) {
1.15928 + s = succs[i];
1.15929 + if (s.level < level) {
1.15930 + continue;
1.15931 + }
1.15932 + var sid = s.bid;
1.15933 + if (!preorder[sid]) {
1.15934 + worklist.push(s);
1.15935 + } else if (!assigned[sid]) {
1.15936 + while (preorder[pendingNodes.peek().bid] > preorder[sid]) {
1.15937 + pendingNodes.pop();
1.15938 + }
1.15939 + }
1.15940 + }
1.15941 + }
1.15942 + return sccs;
1.15943 + }
1.15944 + function findLoopHeads(blocks) {
1.15945 + var heads = new BlockSet();
1.15946 + for (var i = 0, j = blocks.length; i < j; i++) {
1.15947 + var block = blocks[i];
1.15948 + var spbacks = block.spbacks;
1.15949 + if (!spbacks) {
1.15950 + continue;
1.15951 + }
1.15952 + var succs = block.succs;
1.15953 + for (var k = 0, l = succs.length; k < l; k++) {
1.15954 + var s = succs[k];
1.15955 + if (spbacks.get(s.bid)) {
1.15956 + heads.set(s.dominator.bid);
1.15957 + }
1.15958 + }
1.15959 + }
1.15960 + return heads.members();
1.15961 + }
1.15962 + function LoopInfo(scc, loopId) {
1.15963 + var body = new BlockSet();
1.15964 + body.setBlocks(scc);
1.15965 + body.recount();
1.15966 + this.id = loopId;
1.15967 + this.body = body;
1.15968 + this.exit = new BlockSet();
1.15969 + this.save = {};
1.15970 + this.head = new BlockSet();
1.15971 + this.npreds = 0;
1.15972 + }
1.15973 + var heads = findLoopHeads(this.blocks);
1.15974 + if (heads.length <= 0) {
1.15975 + this.markedLoops = true;
1.15976 + return true;
1.15977 + }
1.15978 + var worklist = heads.sort(function (a, b) {
1.15979 + return a.level - b.level;
1.15980 + });
1.15981 + var loopId = 0;
1.15982 + for (var n = worklist.length - 1; n >= 0; n--) {
1.15983 + var top = worklist[n];
1.15984 + var sccs = findSCCs(top);
1.15985 + if (sccs.length === 0) {
1.15986 + continue;
1.15987 + }
1.15988 + for (var i = 0, j = sccs.length; i < j; i++) {
1.15989 + var scc = sccs[i];
1.15990 + var loop = new LoopInfo(scc, loopId++);
1.15991 + for (var k = 0, l = scc.length; k < l; k++) {
1.15992 + var h = scc[k];
1.15993 + if (h.level === top.level + 1 && !h.loop) {
1.15994 + h.loop = loop;
1.15995 + loop.head.set(h.bid);
1.15996 + var preds = h.preds;
1.15997 + for (var pi = 0, pj = preds.length; pi < pj; pi++) {
1.15998 + loop.body.get(preds[pi].bid) && h.npreds--;
1.15999 + }
1.16000 + loop.npreds += h.npreds;
1.16001 + }
1.16002 + }
1.16003 + for (var k = 0, l = scc.length; k < l; k++) {
1.16004 + var h = scc[k];
1.16005 + if (h.level === top.level + 1) {
1.16006 + h.npreds = loop.npreds;
1.16007 + }
1.16008 + }
1.16009 + loop.head.recount();
1.16010 + }
1.16011 + }
1.16012 + this.markedLoops = true;
1.16013 + return true;
1.16014 + }
1.16015 + };
1.16016 + return Analysis;
1.16017 + }();
1.16018 +(function (exports) {
1.16019 + var lang = exports.lang = {
1.16020 + Node: {},
1.16021 + Program: {
1.16022 + extends: 'Node',
1.16023 + fields: [
1.16024 + '@body'
1.16025 + ]
1.16026 + },
1.16027 + Statement: {
1.16028 + extends: 'Node'
1.16029 + },
1.16030 + EmptyStatement: {
1.16031 + extends: 'Statement'
1.16032 + },
1.16033 + BlockStatement: {
1.16034 + extends: 'Statement',
1.16035 + fields: [
1.16036 + '@body'
1.16037 + ]
1.16038 + },
1.16039 + ExpressionStatement: {
1.16040 + extends: 'Statement',
1.16041 + fields: [
1.16042 + '@expression'
1.16043 + ]
1.16044 + },
1.16045 + IfStatement: {
1.16046 + extends: 'Statement',
1.16047 + fields: [
1.16048 + '@test',
1.16049 + '@consequent',
1.16050 + '@alternate'
1.16051 + ]
1.16052 + },
1.16053 + LabeledStatement: {
1.16054 + extends: 'Statement',
1.16055 + fields: [
1.16056 + '@label',
1.16057 + '@body'
1.16058 + ]
1.16059 + },
1.16060 + BreakStatement: {
1.16061 + extends: 'Statement',
1.16062 + fields: [
1.16063 + '@label'
1.16064 + ]
1.16065 + },
1.16066 + ContinueStatement: {
1.16067 + extends: 'Statement',
1.16068 + fields: [
1.16069 + '@label'
1.16070 + ]
1.16071 + },
1.16072 + WithStatement: {
1.16073 + extends: 'Statement',
1.16074 + fields: [
1.16075 + '@object',
1.16076 + '@body'
1.16077 + ]
1.16078 + },
1.16079 + SwitchStatement: {
1.16080 + extends: 'Statement',
1.16081 + fields: [
1.16082 + '@discriminant',
1.16083 + '@cases',
1.16084 + 'lexical'
1.16085 + ]
1.16086 + },
1.16087 + ReturnStatement: {
1.16088 + extends: 'Statement',
1.16089 + fields: [
1.16090 + '@argument'
1.16091 + ]
1.16092 + },
1.16093 + ThrowStatement: {
1.16094 + extends: 'Statement',
1.16095 + fields: [
1.16096 + '@argument'
1.16097 + ]
1.16098 + },
1.16099 + TryStatement: {
1.16100 + extends: 'Statement',
1.16101 + fields: [
1.16102 + '@block',
1.16103 + '@handlers',
1.16104 + '@finalizer'
1.16105 + ]
1.16106 + },
1.16107 + WhileStatement: {
1.16108 + extends: 'Statement',
1.16109 + fields: [
1.16110 + '@test',
1.16111 + '@body'
1.16112 + ]
1.16113 + },
1.16114 + DoWhileStatement: {
1.16115 + extends: 'Statement',
1.16116 + fields: [
1.16117 + '@body',
1.16118 + '@test'
1.16119 + ]
1.16120 + },
1.16121 + ForStatement: {
1.16122 + extends: 'Statement',
1.16123 + fields: [
1.16124 + '@init',
1.16125 + '@test',
1.16126 + '@update',
1.16127 + '@body'
1.16128 + ]
1.16129 + },
1.16130 + ForInStatement: {
1.16131 + extends: 'Statement',
1.16132 + fields: [
1.16133 + '@left',
1.16134 + '@right',
1.16135 + '@body',
1.16136 + 'each'
1.16137 + ]
1.16138 + },
1.16139 + LetStatement: {
1.16140 + extends: 'Statement',
1.16141 + fields: [
1.16142 + '@head',
1.16143 + '@body'
1.16144 + ]
1.16145 + },
1.16146 + DebuggerStatement: {
1.16147 + extends: 'Statement'
1.16148 + },
1.16149 + Declaration: {
1.16150 + extends: 'Statement'
1.16151 + },
1.16152 + FunctionDeclaration: {
1.16153 + extends: 'Declaration',
1.16154 + fields: [
1.16155 + '@id',
1.16156 + '@params',
1.16157 + '@body',
1.16158 + '@decltype',
1.16159 + 'generator',
1.16160 + 'expression',
1.16161 + '@modifiers'
1.16162 + ]
1.16163 + },
1.16164 + VariableDeclaration: {
1.16165 + extends: 'Declaration',
1.16166 + fields: [
1.16167 + 'kind',
1.16168 + '@declarations'
1.16169 + ]
1.16170 + },
1.16171 + VariableDeclarator: {
1.16172 + extends: 'Node',
1.16173 + fields: [
1.16174 + '@id',
1.16175 + '@init',
1.16176 + '@decltype',
1.16177 + '@arguments'
1.16178 + ]
1.16179 + },
1.16180 + Expression: {
1.16181 + extends: 'Pattern'
1.16182 + },
1.16183 + ThisExpression: {
1.16184 + extends: 'Expression'
1.16185 + },
1.16186 + ArrayExpression: {
1.16187 + extends: 'Expression',
1.16188 + fields: [
1.16189 + '@elements'
1.16190 + ]
1.16191 + },
1.16192 + ObjectExpression: {
1.16193 + extends: 'Expression',
1.16194 + fields: [
1.16195 + '@properties'
1.16196 + ]
1.16197 + },
1.16198 + Property: {
1.16199 + extends: 'Node',
1.16200 + fields: [
1.16201 + '@key',
1.16202 + '@value',
1.16203 + 'kind'
1.16204 + ]
1.16205 + },
1.16206 + FunctionExpression: {
1.16207 + extends: 'Expression',
1.16208 + fields: [
1.16209 + '@id',
1.16210 + '@params',
1.16211 + '@body',
1.16212 + '@decltype',
1.16213 + 'generator',
1.16214 + 'expression'
1.16215 + ]
1.16216 + },
1.16217 + SequenceExpression: {
1.16218 + extends: 'Expression',
1.16219 + fields: [
1.16220 + '@expressions'
1.16221 + ]
1.16222 + },
1.16223 + UnaryExpression: {
1.16224 + extends: 'Expression',
1.16225 + fields: [
1.16226 + 'operator',
1.16227 + '@argument',
1.16228 + 'prefix'
1.16229 + ]
1.16230 + },
1.16231 + BinaryExpression: {
1.16232 + extends: 'Expression',
1.16233 + fields: [
1.16234 + 'operator',
1.16235 + '@left',
1.16236 + '@right'
1.16237 + ]
1.16238 + },
1.16239 + AssignmentExpression: {
1.16240 + extends: 'Expression',
1.16241 + fields: [
1.16242 + '@left',
1.16243 + 'operator',
1.16244 + '@right'
1.16245 + ]
1.16246 + },
1.16247 + UpdateExpression: {
1.16248 + extends: 'Expression',
1.16249 + fields: [
1.16250 + 'operator',
1.16251 + '@argument',
1.16252 + 'prefix'
1.16253 + ]
1.16254 + },
1.16255 + LogicalExpression: {
1.16256 + extends: 'Expression',
1.16257 + fields: [
1.16258 + 'operator',
1.16259 + '@left',
1.16260 + '@right'
1.16261 + ]
1.16262 + },
1.16263 + ConditionalExpression: {
1.16264 + extends: 'Expression',
1.16265 + fields: [
1.16266 + '@test',
1.16267 + '@consequent',
1.16268 + '@alternate'
1.16269 + ]
1.16270 + },
1.16271 + NewExpression: {
1.16272 + extends: 'Expression',
1.16273 + fields: [
1.16274 + '@callee',
1.16275 + '@arguments'
1.16276 + ]
1.16277 + },
1.16278 + CallExpression: {
1.16279 + extends: 'Expression',
1.16280 + fields: [
1.16281 + '@callee',
1.16282 + '@arguments'
1.16283 + ]
1.16284 + },
1.16285 + MemberExpression: {
1.16286 + extends: 'Expression',
1.16287 + fields: [
1.16288 + '@object',
1.16289 + '@property',
1.16290 + 'computed',
1.16291 + 'kind'
1.16292 + ]
1.16293 + },
1.16294 + YieldExpression: {
1.16295 + extends: 'Expression',
1.16296 + fields: [
1.16297 + '@argument'
1.16298 + ]
1.16299 + },
1.16300 + ComprehensionExpression: {
1.16301 + extends: 'Expression',
1.16302 + fields: [
1.16303 + '@blocks',
1.16304 + '@filter'
1.16305 + ]
1.16306 + },
1.16307 + GeneratorExpression: {
1.16308 + extends: 'Expression',
1.16309 + fields: [
1.16310 + '@blocks',
1.16311 + '@filter'
1.16312 + ]
1.16313 + },
1.16314 + LetExpression: {
1.16315 + extends: 'Expression',
1.16316 + fields: [
1.16317 + '@head',
1.16318 + '@body'
1.16319 + ]
1.16320 + },
1.16321 + Pattern: {
1.16322 + extends: 'Node'
1.16323 + },
1.16324 + ObjectPattern: {
1.16325 + extends: 'Pattern',
1.16326 + fields: [
1.16327 + '@properties'
1.16328 + ]
1.16329 + },
1.16330 + ArrayPattern: {
1.16331 + extends: 'Pattern',
1.16332 + fields: [
1.16333 + '@elements'
1.16334 + ]
1.16335 + },
1.16336 + SwitchCase: {
1.16337 + extends: 'Node',
1.16338 + fields: [
1.16339 + '@test',
1.16340 + '@consequent'
1.16341 + ]
1.16342 + },
1.16343 + CatchClause: {
1.16344 + extends: 'Node',
1.16345 + fields: [
1.16346 + '@param',
1.16347 + '@guard',
1.16348 + '@body'
1.16349 + ]
1.16350 + },
1.16351 + Identifier: {
1.16352 + extends: 'Expression',
1.16353 + fields: [
1.16354 + 'name',
1.16355 + 'kind'
1.16356 + ]
1.16357 + },
1.16358 + Literal: {
1.16359 + extends: 'Expression',
1.16360 + fields: [
1.16361 + 'value'
1.16362 + ]
1.16363 + },
1.16364 + Type: {
1.16365 + extends: 'Node'
1.16366 + },
1.16367 + PointerType: {
1.16368 + extends: 'Type',
1.16369 + fields: [
1.16370 + '@base'
1.16371 + ]
1.16372 + },
1.16373 + ArrayType: {
1.16374 + extends: 'PointerType',
1.16375 + fields: [
1.16376 + 'length'
1.16377 + ]
1.16378 + },
1.16379 + StructType: {
1.16380 + extends: 'Type',
1.16381 + fields: [
1.16382 + '@id',
1.16383 + '@members',
1.16384 + 'isUnion'
1.16385 + ]
1.16386 + },
1.16387 + MemberDeclarator: {
1.16388 + extends: 'Node',
1.16389 + fields: [
1.16390 + 'modifiers',
1.16391 + '@declarator'
1.16392 + ]
1.16393 + },
1.16394 + ArrowType: {
1.16395 + extends: 'Type',
1.16396 + fields: [
1.16397 + '@params',
1.16398 + '@return'
1.16399 + ]
1.16400 + },
1.16401 + TypeIdentifier: {
1.16402 + extends: 'Type',
1.16403 + fields: [
1.16404 + 'name'
1.16405 + ]
1.16406 + },
1.16407 + TypeAliasDirective: {
1.16408 + extends: 'Node',
1.16409 + fields: [
1.16410 + '@original',
1.16411 + '@alias'
1.16412 + ]
1.16413 + },
1.16414 + CastExpression: {
1.16415 + extends: 'Expression',
1.16416 + fields: [
1.16417 + '@as',
1.16418 + '@argument'
1.16419 + ]
1.16420 + }
1.16421 + };
1.16422 + function allFields(spec) {
1.16423 + var fields = [
1.16424 + 'leadingComments',
1.16425 + 'loc'
1.16426 + ];
1.16427 + while (spec) {
1.16428 + if (spec.fields) {
1.16429 + fields = spec.fields.concat(fields);
1.16430 + }
1.16431 + spec = spec.extends ? lang[spec.extends] : null;
1.16432 + }
1.16433 + return fields;
1.16434 + }
1.16435 + ;
1.16436 + exports.allFields = allFields;
1.16437 + function prefixUnderscore(s) {
1.16438 + return '_' + s;
1.16439 + }
1.16440 + function ensureConstructor(name, spec) {
1.16441 + if (!exports[name]) {
1.16442 + var fields = allFields(spec);
1.16443 + var children = [];
1.16444 + var body = [
1.16445 + 'this.type = "' + name + '";'
1.16446 + ];
1.16447 + for (var i = 0, j = fields.length; i < j; i++) {
1.16448 + var fname = fields[i];
1.16449 + if (fname.charAt(0) === '@') {
1.16450 + fields[i] = fname = fname.substr(1);
1.16451 + children.push(fname);
1.16452 + }
1.16453 + body.push('this.' + fname + ' = _' + fname + ';');
1.16454 + }
1.16455 + var node = new Function(fields.map(prefixUnderscore), body.join('\n'));
1.16456 + if (spec.extends) {
1.16457 + var pnode = ensureConstructor(spec.extends, lang[spec.extends]);
1.16458 + node.prototype = Object.create(pnode.prototype);
1.16459 + }
1.16460 + Object.defineProperty(node.prototype, '_children', {
1.16461 + value: children,
1.16462 + writable: true,
1.16463 + configurable: true,
1.16464 + enumerable: false
1.16465 + });
1.16466 + exports[name] = node;
1.16467 + }
1.16468 + return exports[name];
1.16469 + }
1.16470 + for (var name in lang) {
1.16471 + ensureConstructor(name, lang[name]);
1.16472 + }
1.16473 + exports.makePass = function makePass(name, prop) {
1.16474 + return function (o) {
1.16475 + var trans, arr;
1.16476 + var child, children = this._children;
1.16477 + for (var i = 0, j = children.length; i < j; i++) {
1.16478 + if (!(child = this[children[i]])) {
1.16479 + continue;
1.16480 + }
1.16481 + if (child instanceof Array) {
1.16482 + arr = this[children[i]] = [];
1.16483 + for (var k = 0, l = child.length; k < l; k++) {
1.16484 + if (!child[k]) {
1.16485 + arr.push(child[k]);
1.16486 + } else if (typeof child[k][name] === 'function') {
1.16487 + trans = child[k][name](o);
1.16488 + if (trans !== null) {
1.16489 + arr.push(trans);
1.16490 + }
1.16491 + }
1.16492 + }
1.16493 + } else if (typeof child[name] === 'function') {
1.16494 + trans = child[name](o);
1.16495 + if (trans === null) {
1.16496 + this[children[i]] = undefined;
1.16497 + } else {
1.16498 + this[children[i]] = trans;
1.16499 + }
1.16500 + }
1.16501 + }
1.16502 + if (typeof this[prop] === 'function') {
1.16503 + if (o.logger && typeof this.loc !== 'undefined') {
1.16504 + o.logger.push(this);
1.16505 + trans = this[prop](o);
1.16506 + o.logger.pop();
1.16507 + } else {
1.16508 + trans = this[prop](o);
1.16509 + }
1.16510 + if (trans === null) {
1.16511 + return null;
1.16512 + }
1.16513 + return trans ? trans : this;
1.16514 + }
1.16515 + return this;
1.16516 + };
1.16517 + };
1.16518 + exports.makePass = function makePass(name, prop, backward) {
1.16519 + return function (o) {
1.16520 + var trans, arr;
1.16521 + var child, children = this._children;
1.16522 + var i, k;
1.16523 + for (var x = 0, j = children.length; x < j; x++) {
1.16524 + i = backward ? children.length - 1 - x : x;
1.16525 + if (!(child = this[children[i]])) {
1.16526 + continue;
1.16527 + }
1.16528 + if (child instanceof Array) {
1.16529 + arr = this[children[i]] = [];
1.16530 + var y;
1.16531 + for (var y = 0, l = child.length; y < l; y++) {
1.16532 + k = backward ? child.length - 1 - y : y;
1.16533 + if (!child[k]) {
1.16534 + if (backward) {
1.16535 + arr.unshift(child[k]);
1.16536 + } else {
1.16537 + arr.push(child[k]);
1.16538 + }
1.16539 + } else if (typeof child[k][name] === 'function') {
1.16540 + trans = child[k][name](o);
1.16541 + if (trans !== null) {
1.16542 + if (backward) {
1.16543 + arr.unshift(trans);
1.16544 + } else {
1.16545 + arr.push(trans);
1.16546 + }
1.16547 + }
1.16548 + }
1.16549 + }
1.16550 + } else if (typeof child[name] === 'function') {
1.16551 + trans = child[name](o);
1.16552 + if (trans === null) {
1.16553 + this[children[i]] = undefined;
1.16554 + } else {
1.16555 + this[children[i]] = trans;
1.16556 + }
1.16557 + }
1.16558 + }
1.16559 + if (typeof this[prop] === 'function') {
1.16560 + if (o.logger && typeof this.loc !== 'undefined') {
1.16561 + o.logger.push(this);
1.16562 + trans = this[prop](o);
1.16563 + o.logger.pop();
1.16564 + } else {
1.16565 + trans = this[prop](o);
1.16566 + }
1.16567 + if (trans === null) {
1.16568 + return null;
1.16569 + }
1.16570 + return trans ? trans : this;
1.16571 + }
1.16572 + return this;
1.16573 + };
1.16574 + };
1.16575 + exports.lift = function lift(raw) {
1.16576 + if (!raw) {
1.16577 + return raw;
1.16578 + }
1.16579 + if (raw instanceof Array) {
1.16580 + return raw.map(function (r) {
1.16581 + return r ? lift(r) : r;
1.16582 + });
1.16583 + }
1.16584 + var type = raw.type;
1.16585 + var Node = exports[type];
1.16586 + if (!Node) {
1.16587 + throw new Error('unknown node type `' + type + '\'');
1.16588 + }
1.16589 + var node = new Node();
1.16590 + node.loc = raw.loc;
1.16591 + var fields = allFields(lang[type]);
1.16592 + for (var i = 0, j = fields.length; i < j; i++) {
1.16593 + var field;
1.16594 + if (fields[i].charAt(0) === '@') {
1.16595 + field = fields[i].substr(1);
1.16596 + if (raw[field]) {
1.16597 + node[field] = lift(raw[field]);
1.16598 + }
1.16599 + } else {
1.16600 + field = fields[i];
1.16601 + node[field] = raw[field];
1.16602 + }
1.16603 + }
1.16604 + return node;
1.16605 + };
1.16606 + exports.flatten = function flatten(node) {
1.16607 + if (!node) {
1.16608 + return node;
1.16609 + }
1.16610 + if (node instanceof Array) {
1.16611 + return node.map(function (n) {
1.16612 + return flatten(n);
1.16613 + });
1.16614 + }
1.16615 + var type = node.type;
1.16616 + var raw = {
1.16617 + type: type
1.16618 + };
1.16619 + var fields = allFields(lang[type]);
1.16620 + for (var i = 0, j = fields.length; i < j; i++) {
1.16621 + var field;
1.16622 + if (fields[i].charAt(0) === '@') {
1.16623 + field = fields[i].substr(1);
1.16624 + if (node[field]) {
1.16625 + raw[field] = flatten(node[field]);
1.16626 + } else {
1.16627 + raw[field] = null;
1.16628 + }
1.16629 + } else {
1.16630 + field = fields[i];
1.16631 + raw[field] = node[field];
1.16632 + }
1.16633 + }
1.16634 + return raw;
1.16635 + };
1.16636 +}(typeof exports === 'undefined' ? estransform = {} : exports));
1.16637 +(function (exports) {
1.16638 + var Syntax, Precedence, BinaryPrecedence, Regex, VisitorKeys, VisitorOption, isArray, base, indent, json, renumber, hexadecimal, quotes, escapeless, newline, space, parentheses, semicolons, extra, parse;
1.16639 + Syntax = {
1.16640 + AssignmentExpression: 'AssignmentExpression',
1.16641 + ArrayExpression: 'ArrayExpression',
1.16642 + BlockStatement: 'BlockStatement',
1.16643 + BinaryExpression: 'BinaryExpression',
1.16644 + BreakStatement: 'BreakStatement',
1.16645 + CallExpression: 'CallExpression',
1.16646 + CatchClause: 'CatchClause',
1.16647 + ConditionalExpression: 'ConditionalExpression',
1.16648 + ContinueStatement: 'ContinueStatement',
1.16649 + DoWhileStatement: 'DoWhileStatement',
1.16650 + DebuggerStatement: 'DebuggerStatement',
1.16651 + EmptyStatement: 'EmptyStatement',
1.16652 + ExpressionStatement: 'ExpressionStatement',
1.16653 + ForStatement: 'ForStatement',
1.16654 + ForInStatement: 'ForInStatement',
1.16655 + FunctionDeclaration: 'FunctionDeclaration',
1.16656 + FunctionExpression: 'FunctionExpression',
1.16657 + Identifier: 'Identifier',
1.16658 + IfStatement: 'IfStatement',
1.16659 + Literal: 'Literal',
1.16660 + LabeledStatement: 'LabeledStatement',
1.16661 + LogicalExpression: 'LogicalExpression',
1.16662 + MemberExpression: 'MemberExpression',
1.16663 + NewExpression: 'NewExpression',
1.16664 + ObjectExpression: 'ObjectExpression',
1.16665 + Program: 'Program',
1.16666 + Property: 'Property',
1.16667 + ReturnStatement: 'ReturnStatement',
1.16668 + SequenceExpression: 'SequenceExpression',
1.16669 + SwitchStatement: 'SwitchStatement',
1.16670 + SwitchCase: 'SwitchCase',
1.16671 + ThisExpression: 'ThisExpression',
1.16672 + ThrowStatement: 'ThrowStatement',
1.16673 + TryStatement: 'TryStatement',
1.16674 + UnaryExpression: 'UnaryExpression',
1.16675 + UpdateExpression: 'UpdateExpression',
1.16676 + VariableDeclaration: 'VariableDeclaration',
1.16677 + VariableDeclarator: 'VariableDeclarator',
1.16678 + WhileStatement: 'WhileStatement',
1.16679 + WithStatement: 'WithStatement'
1.16680 + };
1.16681 + Precedence = {
1.16682 + Sequence: 0,
1.16683 + Assignment: 1,
1.16684 + Conditional: 2,
1.16685 + LogicalOR: 3,
1.16686 + LogicalAND: 4,
1.16687 + BitwiseOR: 5,
1.16688 + BitwiseXOR: 6,
1.16689 + BitwiseAND: 7,
1.16690 + Equality: 8,
1.16691 + Relational: 9,
1.16692 + BitwiseSHIFT: 10,
1.16693 + Additive: 11,
1.16694 + Multiplicative: 12,
1.16695 + Unary: 13,
1.16696 + Postfix: 14,
1.16697 + Call: 15,
1.16698 + New: 16,
1.16699 + Member: 17,
1.16700 + Primary: 18
1.16701 + };
1.16702 + BinaryPrecedence = {
1.16703 + '||': Precedence.LogicalOR,
1.16704 + '&&': Precedence.LogicalAND,
1.16705 + '|': Precedence.BitwiseOR,
1.16706 + '^': Precedence.BitwiseXOR,
1.16707 + '&': Precedence.BitwiseAND,
1.16708 + '==': Precedence.Equality,
1.16709 + '!=': Precedence.Equality,
1.16710 + '===': Precedence.Equality,
1.16711 + '!==': Precedence.Equality,
1.16712 + '<': Precedence.Relational,
1.16713 + '>': Precedence.Relational,
1.16714 + '<=': Precedence.Relational,
1.16715 + '>=': Precedence.Relational,
1.16716 + 'in': Precedence.Relational,
1.16717 + 'instanceof': Precedence.Relational,
1.16718 + '<<': Precedence.BitwiseSHIFT,
1.16719 + '>>': Precedence.BitwiseSHIFT,
1.16720 + '>>>': Precedence.BitwiseSHIFT,
1.16721 + '+': Precedence.Additive,
1.16722 + '-': Precedence.Additive,
1.16723 + '*': Precedence.Multiplicative,
1.16724 + '%': Precedence.Multiplicative,
1.16725 + '/': Precedence.Multiplicative
1.16726 + };
1.16727 + Regex = {
1.16728 + NonAsciiIdentifierPart: new RegExp('[\xaa\xb5\xba\xc0-\xd6\xd8-\xf6\xf8-\u02c1\u02c6-\u02d1\u02e0-\u02e4\u02ec\u02ee\u0300-\u0374\u0376\u0377\u037a-\u037d\u0386\u0388-\u038a\u038c\u038e-\u03a1\u03a3-\u03f5\u03f7-\u0481\u0483-\u0487\u048a-\u0527\u0531-\u0556\u0559\u0561-\u0587\u0591-\u05bd\u05bf\u05c1\u05c2\u05c4\u05c5\u05c7\u05d0-\u05ea\u05f0-\u05f2\u0610-\u061a\u0620-\u0669\u066e-\u06d3\u06d5-\u06dc\u06df-\u06e8\u06ea-\u06fc\u06ff\u0710-\u074a\u074d-\u07b1\u07c0-\u07f5\u07fa\u0800-\u082d\u0840-\u085b\u08a0\u08a2-\u08ac\u08e4-\u08fe\u0900-\u0963\u0966-\u096f\u0971-\u0977\u0979-\u097f\u0981-\u0983\u0985-\u098c\u098f\u0990\u0993-\u09a8\u09aa-\u09b0\u09b2\u09b6-\u09b9\u09bc-\u09c4\u09c7\u09c8\u09cb-\u09ce\u09d7\u09dc\u09dd\u09df-\u09e3\u09e6-\u09f1\u0a01-\u0a03\u0a05-\u0a0a\u0a0f\u0a10\u0a13-\u0a28\u0a2a-\u0a30\u0a32\u0a33\u0a35\u0a36\u0a38\u0a39\u0a3c\u0a3e-\u0a42\u0a47\u0a48\u0a4b-\u0a4d\u0a51\u0a59-\u0a5c\u0a5e\u0a66-\u0a75\u0a81-\u0a83\u0a85-\u0a8d\u0a8f-\u0a91\u0a93-\u0aa8\u0aaa-\u0ab0\u0ab2\u0ab3\u0ab5-\u0ab9\u0abc-\u0ac5\u0ac7-\u0ac9\u0acb-\u0acd\u0ad0\u0ae0-\u0ae3\u0ae6-\u0aef\u0b01-\u0b03\u0b05-\u0b0c\u0b0f\u0b10\u0b13-\u0b28\u0b2a-\u0b30\u0b32\u0b33\u0b35-\u0b39\u0b3c-\u0b44\u0b47\u0b48\u0b4b-\u0b4d\u0b56\u0b57\u0b5c\u0b5d\u0b5f-\u0b63\u0b66-\u0b6f\u0b71\u0b82\u0b83\u0b85-\u0b8a\u0b8e-\u0b90\u0b92-\u0b95\u0b99\u0b9a\u0b9c\u0b9e\u0b9f\u0ba3\u0ba4\u0ba8-\u0baa\u0bae-\u0bb9\u0bbe-\u0bc2\u0bc6-\u0bc8\u0bca-\u0bcd\u0bd0\u0bd7\u0be6-\u0bef\u0c01-\u0c03\u0c05-\u0c0c\u0c0e-\u0c10\u0c12-\u0c28\u0c2a-\u0c33\u0c35-\u0c39\u0c3d-\u0c44\u0c46-\u0c48\u0c4a-\u0c4d\u0c55\u0c56\u0c58\u0c59\u0c60-\u0c63\u0c66-\u0c6f\u0c82\u0c83\u0c85-\u0c8c\u0c8e-\u0c90\u0c92-\u0ca8\u0caa-\u0cb3\u0cb5-\u0cb9\u0cbc-\u0cc4\u0cc6-\u0cc8\u0cca-\u0ccd\u0cd5\u0cd6\u0cde\u0ce0-\u0ce3\u0ce6-\u0cef\u0cf1\u0cf2\u0d02\u0d03\u0d05-\u0d0c\u0d0e-\u0d10\u0d12-\u0d3a\u0d3d-\u0d44\u0d46-\u0d48\u0d4a-\u0d4e\u0d57\u0d60-\u0d63\u0d66-\u0d6f\u0d7a-\u0d7f\u0d82\u0d83\u0d85-\u0d96\u0d9a-\u0db1\u0db3-\u0dbb\u0dbd\u0dc0-\u0dc6\u0dca\u0dcf-\u0dd4\u0dd6\u0dd8-\u0ddf\u0df2\u0df3\u0e01-\u0e3a\u0e40-\u0e4e\u0e50-\u0e59\u0e81\u0e82\u0e84\u0e87\u0e88\u0e8a\u0e8d\u0e94-\u0e97\u0e99-\u0e9f\u0ea1-\u0ea3\u0ea5\u0ea7\u0eaa\u0eab\u0ead-\u0eb9\u0ebb-\u0ebd\u0ec0-\u0ec4\u0ec6\u0ec8-\u0ecd\u0ed0-\u0ed9\u0edc-\u0edf\u0f00\u0f18\u0f19\u0f20-\u0f29\u0f35\u0f37\u0f39\u0f3e-\u0f47\u0f49-\u0f6c\u0f71-\u0f84\u0f86-\u0f97\u0f99-\u0fbc\u0fc6\u1000-\u1049\u1050-\u109d\u10a0-\u10c5\u10c7\u10cd\u10d0-\u10fa\u10fc-\u1248\u124a-\u124d\u1250-\u1256\u1258\u125a-\u125d\u1260-\u1288\u128a-\u128d\u1290-\u12b0\u12b2-\u12b5\u12b8-\u12be\u12c0\u12c2-\u12c5\u12c8-\u12d6\u12d8-\u1310\u1312-\u1315\u1318-\u135a\u135d-\u135f\u1380-\u138f\u13a0-\u13f4\u1401-\u166c\u166f-\u167f\u1681-\u169a\u16a0-\u16ea\u16ee-\u16f0\u1700-\u170c\u170e-\u1714\u1720-\u1734\u1740-\u1753\u1760-\u176c\u176e-\u1770\u1772\u1773\u1780-\u17d3\u17d7\u17dc\u17dd\u17e0-\u17e9\u180b-\u180d\u1810-\u1819\u1820-\u1877\u1880-\u18aa\u18b0-\u18f5\u1900-\u191c\u1920-\u192b\u1930-\u193b\u1946-\u196d\u1970-\u1974\u1980-\u19ab\u19b0-\u19c9\u19d0-\u19d9\u1a00-\u1a1b\u1a20-\u1a5e\u1a60-\u1a7c\u1a7f-\u1a89\u1a90-\u1a99\u1aa7\u1b00-\u1b4b\u1b50-\u1b59\u1b6b-\u1b73\u1b80-\u1bf3\u1c00-\u1c37\u1c40-\u1c49\u1c4d-\u1c7d\u1cd0-\u1cd2\u1cd4-\u1cf6\u1d00-\u1de6\u1dfc-\u1f15\u1f18-\u1f1d\u1f20-\u1f45\u1f48-\u1f4d\u1f50-\u1f57\u1f59\u1f5b\u1f5d\u1f5f-\u1f7d\u1f80-\u1fb4\u1fb6-\u1fbc\u1fbe\u1fc2-\u1fc4\u1fc6-\u1fcc\u1fd0-\u1fd3\u1fd6-\u1fdb\u1fe0-\u1fec\u1ff2-\u1ff4\u1ff6-\u1ffc\u200c\u200d\u203f\u2040\u2054\u2071\u207f\u2090-\u209c\u20d0-\u20dc\u20e1\u20e5-\u20f0\u2102\u2107\u210a-\u2113\u2115\u2119-\u211d\u2124\u2126\u2128\u212a-\u212d\u212f-\u2139\u213c-\u213f\u2145-\u2149\u214e\u2160-\u2188\u2c00-\u2c2e\u2c30-\u2c5e\u2c60-\u2ce4\u2ceb-\u2cf3\u2d00-\u2d25\u2d27\u2d2d\u2d30-\u2d67\u2d6f\u2d7f-\u2d96\u2da0-\u2da6\u2da8-\u2dae\u2db0-\u2db6\u2db8-\u2dbe\u2dc0-\u2dc6\u2dc8-\u2dce\u2dd0-\u2dd6\u2dd8-\u2dde\u2de0-\u2dff\u2e2f\u3005-\u3007\u3021-\u302f\u3031-\u3035\u3038-\u303c\u3041-\u3096\u3099\u309a\u309d-\u309f\u30a1-\u30fa\u30fc-\u30ff\u3105-\u312d\u3131-\u318e\u31a0-\u31ba\u31f0-\u31ff\u3400-\u4db5\u4e00-\u9fcc\ua000-\ua48c\ua4d0-\ua4fd\ua500-\ua60c\ua610-\ua62b\ua640-\ua66f\ua674-\ua67d\ua67f-\ua697\ua69f-\ua6f1\ua717-\ua71f\ua722-\ua788\ua78b-\ua78e\ua790-\ua793\ua7a0-\ua7aa\ua7f8-\ua827\ua840-\ua873\ua880-\ua8c4\ua8d0-\ua8d9\ua8e0-\ua8f7\ua8fb\ua900-\ua92d\ua930-\ua953\ua960-\ua97c\ua980-\ua9c0\ua9cf-\ua9d9\uaa00-\uaa36\uaa40-\uaa4d\uaa50-\uaa59\uaa60-\uaa76\uaa7a\uaa7b\uaa80-\uaac2\uaadb-\uaadd\uaae0-\uaaef\uaaf2-\uaaf6\uab01-\uab06\uab09-\uab0e\uab11-\uab16\uab20-\uab26\uab28-\uab2e\uabc0-\uabea\uabec\uabed\uabf0-\uabf9\uac00-\ud7a3\ud7b0-\ud7c6\ud7cb-\ud7fb\uf900-\ufa6d\ufa70-\ufad9\ufb00-\ufb06\ufb13-\ufb17\ufb1d-\ufb28\ufb2a-\ufb36\ufb38-\ufb3c\ufb3e\ufb40\ufb41\ufb43\ufb44\ufb46-\ufbb1\ufbd3-\ufd3d\ufd50-\ufd8f\ufd92-\ufdc7\ufdf0-\ufdfb\ufe00-\ufe0f\ufe20-\ufe26\ufe33\ufe34\ufe4d-\ufe4f\ufe70-\ufe74\ufe76-\ufefc\uff10-\uff19\uff21-\uff3a\uff3f\uff41-\uff5a\uff66-\uffbe\uffc2-\uffc7\uffca-\uffcf\uffd2-\uffd7\uffda-\uffdc]')
1.16729 + };
1.16730 + function getDefaultOptions() {
1.16731 + return {
1.16732 + indent: null,
1.16733 + base: null,
1.16734 + parse: null,
1.16735 + comment: false,
1.16736 + format: {
1.16737 + indent: {
1.16738 + style: ' ',
1.16739 + base: 0,
1.16740 + adjustMultilineComment: false
1.16741 + },
1.16742 + json: false,
1.16743 + renumber: false,
1.16744 + hexadecimal: false,
1.16745 + quotes: 'single',
1.16746 + escapeless: false,
1.16747 + compact: false,
1.16748 + parentheses: true,
1.16749 + semicolons: true
1.16750 + }
1.16751 + };
1.16752 + }
1.16753 + function stringToArray(str) {
1.16754 + var length = str.length, result = [], i;
1.16755 + for (i = 0; i < length; i += 1) {
1.16756 + result[i] = str.charAt(i);
1.16757 + }
1.16758 + return result;
1.16759 + }
1.16760 + function stringRepeat(str, num) {
1.16761 + var result = '';
1.16762 + for (num |= 0; num > 0; num >>>= 1, str += str) {
1.16763 + if (num & 1) {
1.16764 + result += str;
1.16765 + }
1.16766 + }
1.16767 + return result;
1.16768 + }
1.16769 + isArray = Array.isArray;
1.16770 + if (!isArray) {
1.16771 + isArray = function isArray(array) {
1.16772 + return Object.prototype.toString.call(array) === '[object Array]';
1.16773 + };
1.16774 + }
1.16775 + function endsWithLineTerminator(str) {
1.16776 + var len, ch;
1.16777 + len = str.length;
1.16778 + ch = str.charAt(len - 1);
1.16779 + return ch === '\r' || ch === '\n';
1.16780 + }
1.16781 + function shallowCopy(obj) {
1.16782 + var ret = {}, key;
1.16783 + for (key in obj) {
1.16784 + if (obj.hasOwnProperty(key)) {
1.16785 + ret[key] = obj[key];
1.16786 + }
1.16787 + }
1.16788 + return ret;
1.16789 + }
1.16790 + function deepCopy(obj) {
1.16791 + var ret = {}, key, val;
1.16792 + for (key in obj) {
1.16793 + if (obj.hasOwnProperty(key)) {
1.16794 + val = obj[key];
1.16795 + if (typeof val === 'object' && val !== null) {
1.16796 + ret[key] = deepCopy(val);
1.16797 + } else {
1.16798 + ret[key] = val;
1.16799 + }
1.16800 + }
1.16801 + }
1.16802 + return ret;
1.16803 + }
1.16804 + function updateDeeply(target, override) {
1.16805 + var key, val;
1.16806 + function isHashObject(target) {
1.16807 + return typeof target === 'object' && target instanceof Object && !(target instanceof RegExp);
1.16808 + }
1.16809 + for (key in override) {
1.16810 + if (override.hasOwnProperty(key)) {
1.16811 + val = override[key];
1.16812 + if (isHashObject(val)) {
1.16813 + if (isHashObject(target[key])) {
1.16814 + updateDeeply(target[key], val);
1.16815 + } else {
1.16816 + target[key] = updateDeeply({}, val);
1.16817 + }
1.16818 + } else {
1.16819 + target[key] = val;
1.16820 + }
1.16821 + }
1.16822 + }
1.16823 + return target;
1.16824 + }
1.16825 + function generateNumber(value) {
1.16826 + var result, point, temp, exponent, pos;
1.16827 + if (value !== value) {
1.16828 + throw new Error('Numeric literal whose value is NaN');
1.16829 + }
1.16830 + if (1 / value < 0) {
1.16831 + throw new Error('Numeric literal whose value is negative');
1.16832 + }
1.16833 + if (value === 1 / 0) {
1.16834 + return json ? 'null' : renumber ? '1e400' : '1e+400';
1.16835 + }
1.16836 + result = '' + value;
1.16837 + if (!renumber || result.length < 3) {
1.16838 + return result;
1.16839 + }
1.16840 + point = result.indexOf('.');
1.16841 + if (!json && result.charAt(0) === '0' && point === 1) {
1.16842 + point = 0;
1.16843 + result = result.slice(1);
1.16844 + }
1.16845 + temp = result;
1.16846 + result = result.replace('e+', 'e');
1.16847 + exponent = 0;
1.16848 + if ((pos = temp.indexOf('e')) > 0) {
1.16849 + exponent = +temp.slice(pos + 1);
1.16850 + temp = temp.slice(0, pos);
1.16851 + }
1.16852 + if (point >= 0) {
1.16853 + exponent -= temp.length - point - 1;
1.16854 + temp = +(temp.slice(0, point) + temp.slice(point + 1)) + '';
1.16855 + }
1.16856 + pos = 0;
1.16857 + while (temp.charAt(temp.length + pos - 1) === '0') {
1.16858 + pos -= 1;
1.16859 + }
1.16860 + if (pos !== 0) {
1.16861 + exponent -= pos;
1.16862 + temp = temp.slice(0, pos);
1.16863 + }
1.16864 + if (exponent !== 0) {
1.16865 + temp += 'e' + exponent;
1.16866 + }
1.16867 + if ((temp.length < result.length || hexadecimal && value > 1000000000000 && Math.floor(value) === value && (temp = '0x' + value.toString(16)).length < result.length) && +temp === value) {
1.16868 + result = temp;
1.16869 + }
1.16870 + return result;
1.16871 + }
1.16872 + function escapeAllowedCharacter(ch, next) {
1.16873 + var code = ch.charCodeAt(0), hex = code.toString(16), result = '\\';
1.16874 + switch (ch) {
1.16875 + case '\b':
1.16876 + result += 'b';
1.16877 + break;
1.16878 + case '\f':
1.16879 + result += 'f';
1.16880 + break;
1.16881 + case '\t':
1.16882 + result += 't';
1.16883 + break;
1.16884 + default:
1.16885 + if (json || code > 255) {
1.16886 + result += 'u' + '0000'.slice(hex.length) + hex;
1.16887 + } else if (ch === '\0' && '0123456789'.indexOf(next) < 0) {
1.16888 + result += '0';
1.16889 + } else if (ch === '\v') {
1.16890 + result += 'v';
1.16891 + } else {
1.16892 + result += 'x' + '00'.slice(hex.length) + hex;
1.16893 + }
1.16894 + break;
1.16895 + }
1.16896 + return result;
1.16897 + }
1.16898 + function escapeDisallowedCharacter(ch) {
1.16899 + var result = '\\';
1.16900 + switch (ch) {
1.16901 + case '\\':
1.16902 + result += '\\';
1.16903 + break;
1.16904 + case '\n':
1.16905 + result += 'n';
1.16906 + break;
1.16907 + case '\r':
1.16908 + result += 'r';
1.16909 + break;
1.16910 + case '\u2028':
1.16911 + result += 'u2028';
1.16912 + break;
1.16913 + case '\u2029':
1.16914 + result += 'u2029';
1.16915 + break;
1.16916 + default:
1.16917 + throw new Error('Incorrectly classified character');
1.16918 + }
1.16919 + return result;
1.16920 + }
1.16921 + function escapeString(str) {
1.16922 + var result = '', i, len, ch, next, singleQuotes = 0, doubleQuotes = 0, single;
1.16923 + if (typeof str[0] === 'undefined') {
1.16924 + str = stringToArray(str);
1.16925 + }
1.16926 + for (i = 0, len = str.length; i < len; i += 1) {
1.16927 + ch = str[i];
1.16928 + if (ch === '\'') {
1.16929 + singleQuotes += 1;
1.16930 + } else if (ch === '"') {
1.16931 + doubleQuotes += 1;
1.16932 + } else if (ch === '/' && json) {
1.16933 + result += '\\';
1.16934 + } else if ('\\\n\r\u2028\u2029'.indexOf(ch) >= 0) {
1.16935 + result += escapeDisallowedCharacter(ch);
1.16936 + continue;
1.16937 + } else if (json && ch < ' ' || !(json || escapeless || ch >= ' ' && ch <= '~')) {
1.16938 + result += escapeAllowedCharacter(ch, str[i + 1]);
1.16939 + continue;
1.16940 + }
1.16941 + result += ch;
1.16942 + }
1.16943 + single = !(quotes === 'double' || quotes === 'auto' && doubleQuotes < singleQuotes);
1.16944 + str = result;
1.16945 + result = single ? '\'' : '"';
1.16946 + if (typeof str[0] === 'undefined') {
1.16947 + str = stringToArray(str);
1.16948 + }
1.16949 + for (i = 0, len = str.length; i < len; i += 1) {
1.16950 + ch = str[i];
1.16951 + if (ch === '\'' && single || ch === '"' && !single) {
1.16952 + result += '\\';
1.16953 + }
1.16954 + result += ch;
1.16955 + }
1.16956 + return result + (single ? '\'' : '"');
1.16957 + }
1.16958 + function isWhiteSpace(ch) {
1.16959 + return '\t\v\f \xa0'.indexOf(ch) >= 0 || ch.charCodeAt(0) >= 5760 && '\u1680\u180e\u2000\u2001\u2002\u2003\u2004\u2005\u2006\u2007\u2008\u2009\u200a\u202f\u205f\u3000\ufeff'.indexOf(ch) >= 0;
1.16960 + }
1.16961 + function isLineTerminator(ch) {
1.16962 + return '\n\r\u2028\u2029'.indexOf(ch) >= 0;
1.16963 + }
1.16964 + function isIdentifierPart(ch) {
1.16965 + return ch === '$' || ch === '_' || ch === '\\' || ch >= 'a' && ch <= 'z' || ch >= 'A' && ch <= 'Z' || ch >= '0' && ch <= '9' || ch.charCodeAt(0) >= 128 && Regex.NonAsciiIdentifierPart.test(ch);
1.16966 + }
1.16967 + function join(left, right) {
1.16968 + var leftChar = left.charAt(left.length - 1), rightChar = right.charAt(0);
1.16969 + if ((leftChar === '+' || leftChar === '-') && leftChar === rightChar || isIdentifierPart(leftChar) && isIdentifierPart(rightChar)) {
1.16970 + return left + ' ' + right;
1.16971 + } else if (isWhiteSpace(leftChar) || isLineTerminator(leftChar) || isWhiteSpace(rightChar) || isLineTerminator(rightChar)) {
1.16972 + return left + right;
1.16973 + }
1.16974 + return left + space + right;
1.16975 + }
1.16976 + function addIndent(stmt) {
1.16977 + return base + stmt;
1.16978 + }
1.16979 + function calculateSpaces(str) {
1.16980 + var i;
1.16981 + for (i = str.length - 1; i >= 0; i -= 1) {
1.16982 + if (isLineTerminator(str.charAt(i))) {
1.16983 + break;
1.16984 + }
1.16985 + }
1.16986 + return str.length - 1 - i;
1.16987 + }
1.16988 + function adjustMultilineComment(value, specialBase) {
1.16989 + var array, i, len, line, j, ch, spaces, previousBase;
1.16990 + array = value.split(/\r\n|[\r\n]/);
1.16991 + spaces = Number.MAX_VALUE;
1.16992 + for (i = 1, len = array.length; i < len; i += 1) {
1.16993 + line = array[i];
1.16994 + j = 0;
1.16995 + while (j < line.length && isWhiteSpace(line[j])) {
1.16996 + j += 1;
1.16997 + }
1.16998 + if (spaces > j) {
1.16999 + spaces = j;
1.17000 + }
1.17001 + }
1.17002 + if (typeof specialBase !== 'undefined') {
1.17003 + previousBase = base;
1.17004 + if (array[1][spaces] === '*') {
1.17005 + specialBase += ' ';
1.17006 + }
1.17007 + base = specialBase;
1.17008 + } else {
1.17009 + if (spaces % 2 === 1) {
1.17010 + spaces -= 1;
1.17011 + }
1.17012 + previousBase = base;
1.17013 + }
1.17014 + for (i = 1, len = array.length; i < len; i += 1) {
1.17015 + array[i] = addIndent(array[i].slice(spaces));
1.17016 + }
1.17017 + base = previousBase;
1.17018 + return array.join('\n');
1.17019 + }
1.17020 + function generateComment(comment, specialBase) {
1.17021 + if (comment.type === 'Line') {
1.17022 + if (endsWithLineTerminator(comment.value)) {
1.17023 + return '//' + comment.value;
1.17024 + } else {
1.17025 + return '//' + comment.value + '\n';
1.17026 + }
1.17027 + }
1.17028 + if (extra.format.indent.adjustMultilineComment && /[\n\r]/.test(comment.value)) {
1.17029 + return adjustMultilineComment('/*' + comment.value + '*/', specialBase);
1.17030 + }
1.17031 + return '/*' + comment.value + '*/';
1.17032 + }
1.17033 + function addCommentsToStatement(stmt, result) {
1.17034 + var i, len, comment, save, node, tailingToStatement, specialBase, fragment;
1.17035 + if (stmt.leadingComments) {
1.17036 + save = result;
1.17037 + comment = stmt.leadingComments[0];
1.17038 + result = generateComment(comment);
1.17039 + if (!endsWithLineTerminator(result)) {
1.17040 + result += '\n';
1.17041 + }
1.17042 + for (i = 1, len = stmt.leadingComments.length; i < len; i += 1) {
1.17043 + comment = stmt.leadingComments[i];
1.17044 + fragment = generateComment(comment);
1.17045 + if (!endsWithLineTerminator(fragment)) {
1.17046 + fragment += '\n';
1.17047 + }
1.17048 + result += addIndent(fragment);
1.17049 + }
1.17050 + result += addIndent(save);
1.17051 + }
1.17052 + if (stmt.trailingComments) {
1.17053 + tailingToStatement = !endsWithLineTerminator(result);
1.17054 + specialBase = stringRepeat(' ', calculateSpaces(base + result + indent));
1.17055 + for (i = 0, len = stmt.trailingComments.length; i < len; i += 1) {
1.17056 + comment = stmt.trailingComments[i];
1.17057 + if (tailingToStatement) {
1.17058 + if (i === 0) {
1.17059 + result += indent;
1.17060 + } else {
1.17061 + result += specialBase;
1.17062 + }
1.17063 + result += generateComment(comment, specialBase);
1.17064 + } else {
1.17065 + result += addIndent(generateComment(comment));
1.17066 + }
1.17067 + if (i !== len - 1 && !endsWithLineTerminator(result)) {
1.17068 + result += '\n';
1.17069 + }
1.17070 + }
1.17071 + }
1.17072 + return result;
1.17073 + }
1.17074 + function parenthesize(text, current, should) {
1.17075 + if (current < should) {
1.17076 + return '(' + text + ')';
1.17077 + }
1.17078 + return text;
1.17079 + }
1.17080 + function maybeBlock(stmt, semicolonOptional) {
1.17081 + var previousBase, result, noLeadingComment;
1.17082 + noLeadingComment = !extra.comment || !stmt.leadingComments;
1.17083 + if (stmt.type === Syntax.BlockStatement && noLeadingComment) {
1.17084 + return space + generateStatement(stmt);
1.17085 + }
1.17086 + if (stmt.type === Syntax.EmptyStatement && noLeadingComment) {
1.17087 + return ';';
1.17088 + }
1.17089 + previousBase = base;
1.17090 + base += indent;
1.17091 + result = newline + addIndent(generateStatement(stmt, {
1.17092 + semicolonOptional: semicolonOptional
1.17093 + }));
1.17094 + base = previousBase;
1.17095 + return result;
1.17096 + }
1.17097 + function maybeBlockSuffix(stmt, result) {
1.17098 + if (stmt.type === Syntax.BlockStatement && (!extra.comment || !stmt.leadingComments) && !endsWithLineTerminator(result)) {
1.17099 + return space;
1.17100 + }
1.17101 + if (endsWithLineTerminator(result)) {
1.17102 + return addIndent('');
1.17103 + }
1.17104 + return (newline === '' ? ' ' : newline) + addIndent('');
1.17105 + }
1.17106 + function generateFunctionBody(node) {
1.17107 + var result, i, len;
1.17108 + result = '(';
1.17109 + for (i = 0, len = node.params.length; i < len; i += 1) {
1.17110 + result += node.params[i].name;
1.17111 + if (i + 1 < len) {
1.17112 + result += ',' + space;
1.17113 + }
1.17114 + }
1.17115 + return result + ')' + maybeBlock(node.body);
1.17116 + }
1.17117 + function generateExpression(expr, option) {
1.17118 + var result, precedence, currentPrecedence, previousBase, i, len, raw, fragment, allowIn, allowCall, allowUnparenthesizedNew;
1.17119 + precedence = option.precedence;
1.17120 + allowIn = option.allowIn;
1.17121 + allowCall = option.allowCall;
1.17122 + switch (expr.type) {
1.17123 + case Syntax.SequenceExpression:
1.17124 + result = '';
1.17125 + allowIn |= Precedence.Sequence < precedence;
1.17126 + for (i = 0, len = expr.expressions.length; i < len; i += 1) {
1.17127 + result += generateExpression(expr.expressions[i], {
1.17128 + precedence: Precedence.Assignment,
1.17129 + allowIn: allowIn,
1.17130 + allowCall: true
1.17131 + });
1.17132 + if (i + 1 < len) {
1.17133 + result += ',' + space;
1.17134 + }
1.17135 + }
1.17136 + result = parenthesize(result, Precedence.Sequence, precedence);
1.17137 + break;
1.17138 + case Syntax.AssignmentExpression:
1.17139 + allowIn |= Precedence.Assignment < precedence;
1.17140 + result = parenthesize(generateExpression(expr.left, {
1.17141 + precedence: Precedence.Call,
1.17142 + allowIn: allowIn,
1.17143 + allowCall: true
1.17144 + }) + space + expr.operator + space + generateExpression(expr.right, {
1.17145 + precedence: Precedence.Assignment,
1.17146 + allowIn: allowIn,
1.17147 + allowCall: true
1.17148 + }), Precedence.Assignment, precedence);
1.17149 + break;
1.17150 + case Syntax.ConditionalExpression:
1.17151 + allowIn |= Precedence.Conditional < precedence;
1.17152 + result = parenthesize(generateExpression(expr.test, {
1.17153 + precedence: Precedence.LogicalOR,
1.17154 + allowIn: allowIn,
1.17155 + allowCall: true
1.17156 + }) + space + '?' + space + generateExpression(expr.consequent, {
1.17157 + precedence: Precedence.Assignment,
1.17158 + allowIn: allowIn,
1.17159 + allowCall: true
1.17160 + }) + space + ':' + space + generateExpression(expr.alternate, {
1.17161 + precedence: Precedence.Assignment,
1.17162 + allowIn: allowIn,
1.17163 + allowCall: true
1.17164 + }), Precedence.Conditional, precedence);
1.17165 + break;
1.17166 + case Syntax.LogicalExpression:
1.17167 + case Syntax.BinaryExpression:
1.17168 + currentPrecedence = BinaryPrecedence[expr.operator];
1.17169 + allowIn |= currentPrecedence < precedence;
1.17170 + result = join(generateExpression(expr.left, {
1.17171 + precedence: currentPrecedence,
1.17172 + allowIn: allowIn,
1.17173 + allowCall: true
1.17174 + }), expr.operator);
1.17175 + fragment = generateExpression(expr.right, {
1.17176 + precedence: currentPrecedence + 1,
1.17177 + allowIn: allowIn,
1.17178 + allowCall: true
1.17179 + });
1.17180 + if (expr.operator === '/' && result.charAt(result.length - 1) === '/') {
1.17181 + result += ' ' + fragment;
1.17182 + } else {
1.17183 + result = join(result, fragment);
1.17184 + }
1.17185 + if (expr.operator === 'in' && !allowIn) {
1.17186 + result = '(' + result + ')';
1.17187 + } else {
1.17188 + result = parenthesize(result, currentPrecedence, precedence);
1.17189 + }
1.17190 + break;
1.17191 + case Syntax.CallExpression:
1.17192 + result = generateExpression(expr.callee, {
1.17193 + precedence: Precedence.Call,
1.17194 + allowIn: true,
1.17195 + allowCall: true,
1.17196 + allowUnparenthesizedNew: false
1.17197 + });
1.17198 + result += '(';
1.17199 + for (i = 0, len = expr['arguments'].length; i < len; i += 1) {
1.17200 + result += generateExpression(expr['arguments'][i], {
1.17201 + precedence: Precedence.Assignment,
1.17202 + allowIn: true,
1.17203 + allowCall: true
1.17204 + });
1.17205 + if (i + 1 < len) {
1.17206 + result += ',' + space;
1.17207 + }
1.17208 + }
1.17209 + result += ')';
1.17210 + if (!allowCall) {
1.17211 + result = '(' + result + ')';
1.17212 + } else {
1.17213 + result = parenthesize(result, Precedence.Call, precedence);
1.17214 + }
1.17215 + break;
1.17216 + case Syntax.NewExpression:
1.17217 + len = expr['arguments'].length;
1.17218 + allowUnparenthesizedNew = option.allowUnparenthesizedNew === undefined || option.allowUnparenthesizedNew;
1.17219 + result = join('new', generateExpression(expr.callee, {
1.17220 + precedence: Precedence.New,
1.17221 + allowIn: true,
1.17222 + allowCall: false,
1.17223 + allowUnparenthesizedNew: allowUnparenthesizedNew && !parentheses && len === 0
1.17224 + }));
1.17225 + if (!allowUnparenthesizedNew || parentheses || len > 0) {
1.17226 + result += '(';
1.17227 + for (i = 0; i < len; i += 1) {
1.17228 + result += generateExpression(expr['arguments'][i], {
1.17229 + precedence: Precedence.Assignment,
1.17230 + allowIn: true,
1.17231 + allowCall: true
1.17232 + });
1.17233 + if (i + 1 < len) {
1.17234 + result += ',' + space;
1.17235 + }
1.17236 + }
1.17237 + result += ')';
1.17238 + }
1.17239 + result = parenthesize(result, Precedence.New, precedence);
1.17240 + break;
1.17241 + case Syntax.MemberExpression:
1.17242 + result = generateExpression(expr.object, {
1.17243 + precedence: Precedence.Call,
1.17244 + allowIn: true,
1.17245 + allowCall: allowCall,
1.17246 + allowUnparenthesizedNew: false
1.17247 + });
1.17248 + if (expr.computed) {
1.17249 + result += '[' + generateExpression(expr.property, {
1.17250 + precedence: Precedence.Sequence,
1.17251 + allowIn: true,
1.17252 + allowCall: allowCall
1.17253 + }) + ']';
1.17254 + } else {
1.17255 + if (expr.object.type === Syntax.Literal && typeof expr.object.value === 'number') {
1.17256 + if (result.indexOf('.') < 0) {
1.17257 + if (!/[eExX]/.test(result) && !(result.length >= 2 && result[0] === '0')) {
1.17258 + result += '.';
1.17259 + }
1.17260 + }
1.17261 + }
1.17262 + result += '.' + expr.property.name;
1.17263 + }
1.17264 + result = parenthesize(result, Precedence.Member, precedence);
1.17265 + break;
1.17266 + case Syntax.UnaryExpression:
1.17267 + fragment = generateExpression(expr.argument, {
1.17268 + precedence: Precedence.Unary + (expr.argument.type === Syntax.UnaryExpression && expr.operator.length < 3 && expr.argument.operator === expr.operator ? 1 : 0),
1.17269 + allowIn: true,
1.17270 + allowCall: true
1.17271 + });
1.17272 + if (space === '') {
1.17273 + result = join(expr.operator, fragment);
1.17274 + } else {
1.17275 + result = expr.operator;
1.17276 + if (result.length > 2) {
1.17277 + result += ' ';
1.17278 + }
1.17279 + result += fragment;
1.17280 + }
1.17281 + result = parenthesize(result, Precedence.Unary, precedence);
1.17282 + break;
1.17283 + case Syntax.UpdateExpression:
1.17284 + if (expr.prefix) {
1.17285 + result = parenthesize(expr.operator + generateExpression(expr.argument, {
1.17286 + precedence: Precedence.Unary,
1.17287 + allowIn: true,
1.17288 + allowCall: true
1.17289 + }), Precedence.Unary, precedence);
1.17290 + } else {
1.17291 + result = parenthesize(generateExpression(expr.argument, {
1.17292 + precedence: Precedence.Postfix,
1.17293 + allowIn: true,
1.17294 + allowCall: true
1.17295 + }) + expr.operator, Precedence.Postfix, precedence);
1.17296 + }
1.17297 + break;
1.17298 + case Syntax.FunctionExpression:
1.17299 + result = 'function';
1.17300 + if (expr.id) {
1.17301 + result += ' ' + expr.id.name;
1.17302 + } else {
1.17303 + result += space;
1.17304 + }
1.17305 + result += generateFunctionBody(expr);
1.17306 + break;
1.17307 + case Syntax.ArrayExpression:
1.17308 + if (!expr.elements.length) {
1.17309 + result = '[]';
1.17310 + break;
1.17311 + }
1.17312 + result = '[' + newline;
1.17313 + previousBase = base;
1.17314 + base += indent;
1.17315 + for (i = 0, len = expr.elements.length; i < len; i += 1) {
1.17316 + if (!expr.elements[i]) {
1.17317 + result += addIndent('');
1.17318 + if (i + 1 === len) {
1.17319 + result += ',';
1.17320 + }
1.17321 + } else {
1.17322 + result += addIndent(generateExpression(expr.elements[i], {
1.17323 + precedence: Precedence.Assignment,
1.17324 + allowIn: true,
1.17325 + allowCall: true
1.17326 + }));
1.17327 + }
1.17328 + if (i + 1 < len) {
1.17329 + result += ',' + newline;
1.17330 + }
1.17331 + }
1.17332 + base = previousBase;
1.17333 + if (!endsWithLineTerminator(result)) {
1.17334 + result += newline;
1.17335 + }
1.17336 + result += addIndent(']');
1.17337 + break;
1.17338 + case Syntax.Property:
1.17339 + if (expr.kind === 'get' || expr.kind === 'set') {
1.17340 + result = expr.kind + ' ' + generateExpression(expr.key, {
1.17341 + precedence: Precedence.Sequence,
1.17342 + allowIn: true,
1.17343 + allowCall: true
1.17344 + }) + generateFunctionBody(expr.value);
1.17345 + } else {
1.17346 + result = generateExpression(expr.key, {
1.17347 + precedence: Precedence.Sequence,
1.17348 + allowIn: true,
1.17349 + allowCall: true
1.17350 + }) + ':' + space + generateExpression(expr.value, {
1.17351 + precedence: Precedence.Assignment,
1.17352 + allowIn: true,
1.17353 + allowCall: true
1.17354 + });
1.17355 + }
1.17356 + break;
1.17357 + case Syntax.ObjectExpression:
1.17358 + if (!expr.properties.length) {
1.17359 + result = '{}';
1.17360 + break;
1.17361 + }
1.17362 + result = '{' + newline;
1.17363 + previousBase = base;
1.17364 + base += indent;
1.17365 + for (i = 0, len = expr.properties.length; i < len; i += 1) {
1.17366 + result += addIndent(generateExpression(expr.properties[i], {
1.17367 + precedence: Precedence.Sequence,
1.17368 + allowIn: true,
1.17369 + allowCall: true
1.17370 + }));
1.17371 + if (i + 1 < len) {
1.17372 + result += ',' + newline;
1.17373 + }
1.17374 + }
1.17375 + base = previousBase;
1.17376 + if (!endsWithLineTerminator(result)) {
1.17377 + result += newline;
1.17378 + }
1.17379 + result += addIndent('}');
1.17380 + break;
1.17381 + case Syntax.ThisExpression:
1.17382 + result = 'this';
1.17383 + break;
1.17384 + case Syntax.Identifier:
1.17385 + result = expr.name;
1.17386 + break;
1.17387 + case Syntax.Literal:
1.17388 + if (expr.hasOwnProperty('raw') && parse) {
1.17389 + try {
1.17390 + raw = parse(expr.raw).body[0].expression;
1.17391 + if (raw.type === Syntax.Literal) {
1.17392 + if (raw.value === expr.value) {
1.17393 + result = expr.raw;
1.17394 + break;
1.17395 + }
1.17396 + }
1.17397 + } catch (e) {
1.17398 + }
1.17399 + }
1.17400 + if (expr.value === null) {
1.17401 + result = 'null';
1.17402 + break;
1.17403 + }
1.17404 + if (typeof expr.value === 'string') {
1.17405 + result = escapeString(expr.value);
1.17406 + break;
1.17407 + }
1.17408 + if (typeof expr.value === 'number') {
1.17409 + result = generateNumber(expr.value);
1.17410 + break;
1.17411 + }
1.17412 + result = expr.value.toString();
1.17413 + break;
1.17414 + default:
1.17415 + break;
1.17416 + }
1.17417 + if (result === undefined) {
1.17418 + throw new Error('Unknown expression type: ' + expr.type);
1.17419 + }
1.17420 + return result;
1.17421 + }
1.17422 + function generateStatement(stmt, option) {
1.17423 + var i, len, result, previousBase, node, allowIn, fragment, semicolon;
1.17424 + allowIn = true;
1.17425 + semicolon = ';';
1.17426 + if (option) {
1.17427 + allowIn = option.allowIn === undefined || option.allowIn;
1.17428 + if (!semicolons && option.semicolonOptional === true) {
1.17429 + semicolon = '';
1.17430 + }
1.17431 + }
1.17432 + switch (stmt.type) {
1.17433 + case Syntax.BlockStatement:
1.17434 + result = '{' + newline;
1.17435 + previousBase = base;
1.17436 + base += indent;
1.17437 + for (i = 0, len = stmt.body.length; i < len; i += 1) {
1.17438 + fragment = addIndent(generateStatement(stmt.body[i], {
1.17439 + semicolonOptional: i === len - 1
1.17440 + }));
1.17441 + result += fragment;
1.17442 + if (!endsWithLineTerminator(fragment)) {
1.17443 + result += newline;
1.17444 + }
1.17445 + }
1.17446 + base = previousBase;
1.17447 + result += addIndent('}');
1.17448 + break;
1.17449 + case Syntax.BreakStatement:
1.17450 + if (stmt.label) {
1.17451 + result = 'break ' + stmt.label.name + semicolon;
1.17452 + } else {
1.17453 + result = 'break' + semicolon;
1.17454 + }
1.17455 + break;
1.17456 + case Syntax.ContinueStatement:
1.17457 + if (stmt.label) {
1.17458 + result = 'continue ' + stmt.label.name + semicolon;
1.17459 + } else {
1.17460 + result = 'continue' + semicolon;
1.17461 + }
1.17462 + break;
1.17463 + case Syntax.DoWhileStatement:
1.17464 + result = join('do', maybeBlock(stmt.body));
1.17465 + result += maybeBlockSuffix(stmt.body, result);
1.17466 + result += 'while' + space + '(' + generateExpression(stmt.test, {
1.17467 + precedence: Precedence.Sequence,
1.17468 + allowIn: true,
1.17469 + allowCall: true
1.17470 + }) + ')' + semicolon;
1.17471 + break;
1.17472 + case Syntax.CatchClause:
1.17473 + previousBase = base;
1.17474 + base += indent;
1.17475 + result = 'catch' + space + '(' + generateExpression(stmt.param, {
1.17476 + precedence: Precedence.Sequence,
1.17477 + allowIn: true,
1.17478 + allowCall: true
1.17479 + }) + ')';
1.17480 + base = previousBase;
1.17481 + result += maybeBlock(stmt.body);
1.17482 + break;
1.17483 + case Syntax.DebuggerStatement:
1.17484 + result = 'debugger' + semicolon;
1.17485 + break;
1.17486 + case Syntax.EmptyStatement:
1.17487 + result = ';';
1.17488 + break;
1.17489 + case Syntax.ExpressionStatement:
1.17490 + result = generateExpression(stmt.expression, {
1.17491 + precedence: Precedence.Sequence,
1.17492 + allowIn: true,
1.17493 + allowCall: true
1.17494 + });
1.17495 + if (result.charAt(0) === '{' || result.slice(0, 8) === 'function' && ' ('.indexOf(result.charAt(8)) >= 0) {
1.17496 + result = '(' + result + ')' + semicolon;
1.17497 + } else {
1.17498 + result += semicolon;
1.17499 + }
1.17500 + break;
1.17501 + case Syntax.VariableDeclarator:
1.17502 + if (stmt.init) {
1.17503 + result = stmt.id.name + space + '=' + space + generateExpression(stmt.init, {
1.17504 + precedence: Precedence.Assignment,
1.17505 + allowIn: allowIn,
1.17506 + allowCall: true
1.17507 + });
1.17508 + } else {
1.17509 + result = stmt.id.name;
1.17510 + }
1.17511 + break;
1.17512 + case Syntax.VariableDeclaration:
1.17513 + result = stmt.kind;
1.17514 + if (stmt.declarations.length === 1 && stmt.declarations[0].init && stmt.declarations[0].init.type === Syntax.FunctionExpression) {
1.17515 + result += ' ' + generateStatement(stmt.declarations[0], {
1.17516 + allowIn: allowIn
1.17517 + });
1.17518 + } else {
1.17519 + previousBase = base;
1.17520 + base += indent;
1.17521 + node = stmt.declarations[0];
1.17522 + if (extra.comment && node.leadingComments) {
1.17523 + result += '\n' + addIndent(generateStatement(node, {
1.17524 + allowIn: allowIn
1.17525 + }));
1.17526 + } else {
1.17527 + result += ' ' + generateStatement(node, {
1.17528 + allowIn: allowIn
1.17529 + });
1.17530 + }
1.17531 + for (i = 1, len = stmt.declarations.length; i < len; i += 1) {
1.17532 + node = stmt.declarations[i];
1.17533 + if (extra.comment && node.leadingComments) {
1.17534 + result += ',' + newline + addIndent(generateStatement(node, {
1.17535 + allowIn: allowIn
1.17536 + }));
1.17537 + } else {
1.17538 + result += ',' + space + generateStatement(node, {
1.17539 + allowIn: allowIn
1.17540 + });
1.17541 + }
1.17542 + }
1.17543 + base = previousBase;
1.17544 + }
1.17545 + result += semicolon;
1.17546 + break;
1.17547 + case Syntax.ThrowStatement:
1.17548 + result = join('throw', generateExpression(stmt.argument, {
1.17549 + precedence: Precedence.Sequence,
1.17550 + allowIn: true,
1.17551 + allowCall: true
1.17552 + })) + semicolon;
1.17553 + break;
1.17554 + case Syntax.TryStatement:
1.17555 + result = 'try' + maybeBlock(stmt.block);
1.17556 + result += maybeBlockSuffix(stmt.block, result);
1.17557 + for (i = 0, len = stmt.handlers.length; i < len; i += 1) {
1.17558 + result += generateStatement(stmt.handlers[i]);
1.17559 + if (stmt.finalizer || i + 1 !== len) {
1.17560 + result += maybeBlockSuffix(stmt.handlers[i].body, result);
1.17561 + }
1.17562 + }
1.17563 + if (stmt.finalizer) {
1.17564 + result += 'finally' + maybeBlock(stmt.finalizer);
1.17565 + }
1.17566 + break;
1.17567 + case Syntax.SwitchStatement:
1.17568 + previousBase = base;
1.17569 + base += indent;
1.17570 + result = 'switch' + space + '(' + generateExpression(stmt.discriminant, {
1.17571 + precedence: Precedence.Sequence,
1.17572 + allowIn: true,
1.17573 + allowCall: true
1.17574 + }) + ')' + space + '{' + newline;
1.17575 + base = previousBase;
1.17576 + if (stmt.cases) {
1.17577 + for (i = 0, len = stmt.cases.length; i < len; i += 1) {
1.17578 + fragment = addIndent(generateStatement(stmt.cases[i], {
1.17579 + semicolonOptional: i === len - 1
1.17580 + }));
1.17581 + result += fragment;
1.17582 + if (!endsWithLineTerminator(fragment)) {
1.17583 + result += newline;
1.17584 + }
1.17585 + }
1.17586 + }
1.17587 + result += addIndent('}');
1.17588 + break;
1.17589 + case Syntax.SwitchCase:
1.17590 + previousBase = base;
1.17591 + base += indent;
1.17592 + if (stmt.test) {
1.17593 + result = join('case', generateExpression(stmt.test, {
1.17594 + precedence: Precedence.Sequence,
1.17595 + allowIn: true,
1.17596 + allowCall: true
1.17597 + })) + ':';
1.17598 + } else {
1.17599 + result = 'default:';
1.17600 + }
1.17601 + i = 0;
1.17602 + len = stmt.consequent.length;
1.17603 + if (len && stmt.consequent[0].type === Syntax.BlockStatement) {
1.17604 + fragment = maybeBlock(stmt.consequent[0]);
1.17605 + result += fragment;
1.17606 + i = 1;
1.17607 + }
1.17608 + if (i !== len && !endsWithLineTerminator(result)) {
1.17609 + result += newline;
1.17610 + }
1.17611 + for (; i < len; i += 1) {
1.17612 + fragment = addIndent(generateStatement(stmt.consequent[i], {
1.17613 + semicolonOptional: i === len - 1 && semicolon === ''
1.17614 + }));
1.17615 + result += fragment;
1.17616 + if (i + 1 !== len && !endsWithLineTerminator(fragment)) {
1.17617 + result += newline;
1.17618 + }
1.17619 + }
1.17620 + base = previousBase;
1.17621 + break;
1.17622 + case Syntax.IfStatement:
1.17623 + previousBase = base;
1.17624 + base += indent;
1.17625 + if (stmt.alternate) {
1.17626 + if (stmt.alternate.type === Syntax.IfStatement) {
1.17627 + result = 'if' + space + '(' + generateExpression(stmt.test, {
1.17628 + precedence: Precedence.Sequence,
1.17629 + allowIn: true,
1.17630 + allowCall: true
1.17631 + }) + ')';
1.17632 + base = previousBase;
1.17633 + result += maybeBlock(stmt.consequent);
1.17634 + result += maybeBlockSuffix(stmt.consequent, result);
1.17635 + result += 'else ' + generateStatement(stmt.alternate);
1.17636 + } else {
1.17637 + result = 'if' + space + '(' + generateExpression(stmt.test, {
1.17638 + precedence: Precedence.Sequence,
1.17639 + allowIn: true,
1.17640 + allowCall: true
1.17641 + }) + ')';
1.17642 + base = previousBase;
1.17643 + result += maybeBlock(stmt.consequent);
1.17644 + result += maybeBlockSuffix(stmt.consequent, result);
1.17645 + result += 'else';
1.17646 + result = join(result, maybeBlock(stmt.alternate, semicolon === ''));
1.17647 + }
1.17648 + } else {
1.17649 + result = 'if' + space + '(' + generateExpression(stmt.test, {
1.17650 + precedence: Precedence.Sequence,
1.17651 + allowIn: true,
1.17652 + allowCall: true
1.17653 + }) + ')';
1.17654 + base = previousBase;
1.17655 + result += maybeBlock(stmt.consequent, semicolon === '');
1.17656 + }
1.17657 + break;
1.17658 + case Syntax.ForStatement:
1.17659 + previousBase = base;
1.17660 + base += indent;
1.17661 + result = 'for' + space + '(';
1.17662 + if (stmt.init) {
1.17663 + if (stmt.init.type === Syntax.VariableDeclaration) {
1.17664 + result += generateStatement(stmt.init, {
1.17665 + allowIn: false
1.17666 + });
1.17667 + } else {
1.17668 + result += generateExpression(stmt.init, {
1.17669 + precedence: Precedence.Sequence,
1.17670 + allowIn: false,
1.17671 + allowCall: true
1.17672 + }) + ';';
1.17673 + }
1.17674 + } else {
1.17675 + result += ';';
1.17676 + }
1.17677 + if (stmt.test) {
1.17678 + result += space + generateExpression(stmt.test, {
1.17679 + precedence: Precedence.Sequence,
1.17680 + allowIn: true,
1.17681 + allowCall: true
1.17682 + }) + ';';
1.17683 + } else {
1.17684 + result += ';';
1.17685 + }
1.17686 + if (stmt.update) {
1.17687 + result += space + generateExpression(stmt.update, {
1.17688 + precedence: Precedence.Sequence,
1.17689 + allowIn: true,
1.17690 + allowCall: true
1.17691 + }) + ')';
1.17692 + } else {
1.17693 + result += ')';
1.17694 + }
1.17695 + base = previousBase;
1.17696 + result += maybeBlock(stmt.body, semicolon === '');
1.17697 + break;
1.17698 + case Syntax.ForInStatement:
1.17699 + result = 'for' + space + '(';
1.17700 + if (stmt.left.type === Syntax.VariableDeclaration) {
1.17701 + previousBase = base;
1.17702 + base += indent + indent;
1.17703 + result += stmt.left.kind + ' ' + generateStatement(stmt.left.declarations[0], {
1.17704 + allowIn: false
1.17705 + });
1.17706 + base = previousBase;
1.17707 + } else {
1.17708 + previousBase = base;
1.17709 + base += indent;
1.17710 + result += generateExpression(stmt.left, {
1.17711 + precedence: Precedence.Call,
1.17712 + allowIn: true,
1.17713 + allowCall: true
1.17714 + });
1.17715 + base = previousBase;
1.17716 + }
1.17717 + previousBase = base;
1.17718 + base += indent;
1.17719 + result = join(result, 'in');
1.17720 + result = join(result, generateExpression(stmt.right, {
1.17721 + precedence: Precedence.Sequence,
1.17722 + allowIn: true,
1.17723 + allowCall: true
1.17724 + })) + ')';
1.17725 + base = previousBase;
1.17726 + result += maybeBlock(stmt.body, semicolon === '');
1.17727 + break;
1.17728 + case Syntax.LabeledStatement:
1.17729 + result = stmt.label.name + ':' + maybeBlock(stmt.body, semicolon === '');
1.17730 + break;
1.17731 + case Syntax.Program:
1.17732 + result = '';
1.17733 + for (i = 0, len = stmt.body.length; i < len; i += 1) {
1.17734 + fragment = addIndent(generateStatement(stmt.body[i], {
1.17735 + semicolonOptional: i === len - 1
1.17736 + }));
1.17737 + result += fragment;
1.17738 + if (i + 1 < len && !endsWithLineTerminator(fragment)) {
1.17739 + result += newline;
1.17740 + }
1.17741 + }
1.17742 + break;
1.17743 + case Syntax.FunctionDeclaration:
1.17744 + result = 'function' + space;
1.17745 + if (stmt.id) {
1.17746 + result += (space === '' ? ' ' : '') + stmt.id.name;
1.17747 + }
1.17748 + result += generateFunctionBody(stmt);
1.17749 + break;
1.17750 + case Syntax.ReturnStatement:
1.17751 + if (stmt.argument) {
1.17752 + result = join('return', generateExpression(stmt.argument, {
1.17753 + precedence: Precedence.Sequence,
1.17754 + allowIn: true,
1.17755 + allowCall: true
1.17756 + })) + semicolon;
1.17757 + } else {
1.17758 + result = 'return' + semicolon;
1.17759 + }
1.17760 + break;
1.17761 + case Syntax.WhileStatement:
1.17762 + previousBase = base;
1.17763 + base += indent;
1.17764 + result = 'while' + space + '(' + generateExpression(stmt.test, {
1.17765 + precedence: Precedence.Sequence,
1.17766 + allowIn: true,
1.17767 + allowCall: true
1.17768 + }) + ')';
1.17769 + base = previousBase;
1.17770 + result += maybeBlock(stmt.body, semicolon === '');
1.17771 + break;
1.17772 + case Syntax.WithStatement:
1.17773 + previousBase = base;
1.17774 + base += indent;
1.17775 + result = 'with' + space + '(' + generateExpression(stmt.object, {
1.17776 + precedence: Precedence.Sequence,
1.17777 + allowIn: true,
1.17778 + allowCall: true
1.17779 + }) + ')';
1.17780 + base = previousBase;
1.17781 + result += maybeBlock(stmt.body, semicolon === '');
1.17782 + break;
1.17783 + default:
1.17784 + break;
1.17785 + }
1.17786 + if (result === undefined) {
1.17787 + throw new Error('Unknown statement type: ' + stmt.type);
1.17788 + }
1.17789 + if (extra.comment) {
1.17790 + return addCommentsToStatement(stmt, result);
1.17791 + }
1.17792 + return result;
1.17793 + }
1.17794 + function generate(node, options) {
1.17795 + var defaultOptions = getDefaultOptions();
1.17796 + if (typeof options !== 'undefined') {
1.17797 + if (typeof options.indent === 'string') {
1.17798 + defaultOptions.format.indent.style = options.indent;
1.17799 + }
1.17800 + if (typeof options.base === 'number') {
1.17801 + defaultOptions.format.indent.base = options.base;
1.17802 + }
1.17803 + options = updateDeeply(defaultOptions, options);
1.17804 + indent = options.format.indent.style;
1.17805 + if (typeof options.base === 'string') {
1.17806 + base = options.base;
1.17807 + } else {
1.17808 + base = stringRepeat(indent, options.format.indent.base);
1.17809 + }
1.17810 + } else {
1.17811 + options = defaultOptions;
1.17812 + indent = options.format.indent.style;
1.17813 + base = stringRepeat(indent, options.format.indent.base);
1.17814 + }
1.17815 + json = options.format.json;
1.17816 + renumber = options.format.renumber;
1.17817 + hexadecimal = json ? false : options.format.hexadecimal;
1.17818 + quotes = json ? 'double' : options.format.quotes;
1.17819 + escapeless = options.format.escapeless;
1.17820 + if (options.format.compact) {
1.17821 + newline = space = indent = base = '';
1.17822 + } else {
1.17823 + newline = '\n';
1.17824 + space = ' ';
1.17825 + }
1.17826 + parentheses = options.format.parentheses;
1.17827 + semicolons = options.format.semicolons;
1.17828 + parse = json ? null : options.parse;
1.17829 + extra = options;
1.17830 + switch (node.type) {
1.17831 + case Syntax.BlockStatement:
1.17832 + case Syntax.BreakStatement:
1.17833 + case Syntax.CatchClause:
1.17834 + case Syntax.ContinueStatement:
1.17835 + case Syntax.DoWhileStatement:
1.17836 + case Syntax.DebuggerStatement:
1.17837 + case Syntax.EmptyStatement:
1.17838 + case Syntax.ExpressionStatement:
1.17839 + case Syntax.ForStatement:
1.17840 + case Syntax.ForInStatement:
1.17841 + case Syntax.FunctionDeclaration:
1.17842 + case Syntax.IfStatement:
1.17843 + case Syntax.LabeledStatement:
1.17844 + case Syntax.Program:
1.17845 + case Syntax.ReturnStatement:
1.17846 + case Syntax.SwitchStatement:
1.17847 + case Syntax.SwitchCase:
1.17848 + case Syntax.ThrowStatement:
1.17849 + case Syntax.TryStatement:
1.17850 + case Syntax.VariableDeclaration:
1.17851 + case Syntax.VariableDeclarator:
1.17852 + case Syntax.WhileStatement:
1.17853 + case Syntax.WithStatement:
1.17854 + return generateStatement(node);
1.17855 + case Syntax.AssignmentExpression:
1.17856 + case Syntax.ArrayExpression:
1.17857 + case Syntax.BinaryExpression:
1.17858 + case Syntax.CallExpression:
1.17859 + case Syntax.ConditionalExpression:
1.17860 + case Syntax.FunctionExpression:
1.17861 + case Syntax.Identifier:
1.17862 + case Syntax.Literal:
1.17863 + case Syntax.LogicalExpression:
1.17864 + case Syntax.MemberExpression:
1.17865 + case Syntax.NewExpression:
1.17866 + case Syntax.ObjectExpression:
1.17867 + case Syntax.Property:
1.17868 + case Syntax.SequenceExpression:
1.17869 + case Syntax.ThisExpression:
1.17870 + case Syntax.UnaryExpression:
1.17871 + case Syntax.UpdateExpression:
1.17872 + return generateExpression(node, {
1.17873 + precedence: Precedence.Sequence,
1.17874 + allowIn: true,
1.17875 + allowCall: true
1.17876 + });
1.17877 + default:
1.17878 + break;
1.17879 + }
1.17880 + throw new Error('Unknown node type: ' + node.type);
1.17881 + }
1.17882 + VisitorKeys = {
1.17883 + AssignmentExpression: [
1.17884 + 'left',
1.17885 + 'right'
1.17886 + ],
1.17887 + ArrayExpression: [
1.17888 + 'elements'
1.17889 + ],
1.17890 + BlockStatement: [
1.17891 + 'body'
1.17892 + ],
1.17893 + BinaryExpression: [
1.17894 + 'left',
1.17895 + 'right'
1.17896 + ],
1.17897 + BreakStatement: [
1.17898 + 'label'
1.17899 + ],
1.17900 + CallExpression: [
1.17901 + 'callee',
1.17902 + 'arguments'
1.17903 + ],
1.17904 + CatchClause: [
1.17905 + 'param',
1.17906 + 'body'
1.17907 + ],
1.17908 + ConditionalExpression: [
1.17909 + 'test',
1.17910 + 'consequent',
1.17911 + 'alternate'
1.17912 + ],
1.17913 + ContinueStatement: [
1.17914 + 'label'
1.17915 + ],
1.17916 + DoWhileStatement: [
1.17917 + 'body',
1.17918 + 'test'
1.17919 + ],
1.17920 + DebuggerStatement: [],
1.17921 + EmptyStatement: [],
1.17922 + ExpressionStatement: [
1.17923 + 'expression'
1.17924 + ],
1.17925 + ForStatement: [
1.17926 + 'init',
1.17927 + 'test',
1.17928 + 'update',
1.17929 + 'body'
1.17930 + ],
1.17931 + ForInStatement: [
1.17932 + 'left',
1.17933 + 'right',
1.17934 + 'body'
1.17935 + ],
1.17936 + FunctionDeclaration: [
1.17937 + 'id',
1.17938 + 'params',
1.17939 + 'body'
1.17940 + ],
1.17941 + FunctionExpression: [
1.17942 + 'id',
1.17943 + 'params',
1.17944 + 'body'
1.17945 + ],
1.17946 + Identifier: [],
1.17947 + IfStatement: [
1.17948 + 'test',
1.17949 + 'consequent',
1.17950 + 'alternate'
1.17951 + ],
1.17952 + Literal: [],
1.17953 + LabeledStatement: [
1.17954 + 'label',
1.17955 + 'body'
1.17956 + ],
1.17957 + LogicalExpression: [
1.17958 + 'left',
1.17959 + 'right'
1.17960 + ],
1.17961 + MemberExpression: [
1.17962 + 'object',
1.17963 + 'property'
1.17964 + ],
1.17965 + NewExpression: [
1.17966 + 'callee',
1.17967 + 'arguments'
1.17968 + ],
1.17969 + ObjectExpression: [
1.17970 + 'properties'
1.17971 + ],
1.17972 + Program: [
1.17973 + 'body'
1.17974 + ],
1.17975 + Property: [
1.17976 + 'key',
1.17977 + 'value'
1.17978 + ],
1.17979 + ReturnStatement: [
1.17980 + 'argument'
1.17981 + ],
1.17982 + SequenceExpression: [
1.17983 + 'expressions'
1.17984 + ],
1.17985 + SwitchStatement: [
1.17986 + 'descriminant',
1.17987 + 'cases'
1.17988 + ],
1.17989 + SwitchCase: [
1.17990 + 'test',
1.17991 + 'consequent'
1.17992 + ],
1.17993 + ThisExpression: [],
1.17994 + ThrowStatement: [
1.17995 + 'argument'
1.17996 + ],
1.17997 + TryStatement: [
1.17998 + 'block',
1.17999 + 'handlers',
1.18000 + 'finalizer'
1.18001 + ],
1.18002 + UnaryExpression: [
1.18003 + 'argument'
1.18004 + ],
1.18005 + UpdateExpression: [
1.18006 + 'argument'
1.18007 + ],
1.18008 + VariableDeclaration: [
1.18009 + 'declarations'
1.18010 + ],
1.18011 + VariableDeclarator: [
1.18012 + 'id',
1.18013 + 'init'
1.18014 + ],
1.18015 + WhileStatement: [
1.18016 + 'test',
1.18017 + 'body'
1.18018 + ],
1.18019 + WithStatement: [
1.18020 + 'object',
1.18021 + 'body'
1.18022 + ],
1.18023 + PointerType: [
1.18024 + 'base'
1.18025 + ],
1.18026 + StructType: [
1.18027 + 'id',
1.18028 + 'fields'
1.18029 + ],
1.18030 + FieldDeclarator: [
1.18031 + 'id',
1.18032 + 'decltype'
1.18033 + ],
1.18034 + ArrowType: [
1.18035 + 'params',
1.18036 + 'return'
1.18037 + ],
1.18038 + TypeIdentifier: [],
1.18039 + TypeAliasDirective: [
1.18040 + 'original',
1.18041 + 'alias'
1.18042 + ],
1.18043 + CastExpression: [
1.18044 + 'as',
1.18045 + 'argument'
1.18046 + ]
1.18047 + };
1.18048 + VisitorOption = {
1.18049 + Break: 1,
1.18050 + Skip: 2
1.18051 + };
1.18052 + function traverse(top, visitor) {
1.18053 + var worklist, leavelist, node, ret, current, current2, candidates, candidate;
1.18054 + worklist = [
1.18055 + top
1.18056 + ];
1.18057 + leavelist = [];
1.18058 + while (worklist.length) {
1.18059 + node = worklist.pop();
1.18060 + if (node) {
1.18061 + if (visitor.enter) {
1.18062 + ret = visitor.enter(node);
1.18063 + } else {
1.18064 + ret = undefined;
1.18065 + }
1.18066 + if (ret === VisitorOption.Break) {
1.18067 + return;
1.18068 + }
1.18069 + worklist.push(null);
1.18070 + leavelist.push(node);
1.18071 + if (ret !== VisitorOption.Skip) {
1.18072 + candidates = VisitorKeys[node.type];
1.18073 + current = candidates.length;
1.18074 + while ((current -= 1) >= 0) {
1.18075 + candidate = node[candidates[current]];
1.18076 + if (candidate) {
1.18077 + if (isArray(candidate)) {
1.18078 + current2 = candidate.length;
1.18079 + while ((current2 -= 1) >= 0) {
1.18080 + if (candidate[current2]) {
1.18081 + worklist.push(candidate[current2]);
1.18082 + }
1.18083 + }
1.18084 + } else {
1.18085 + worklist.push(candidate);
1.18086 + }
1.18087 + }
1.18088 + }
1.18089 + }
1.18090 + } else {
1.18091 + node = leavelist.pop();
1.18092 + if (visitor.leave) {
1.18093 + ret = visitor.leave(node);
1.18094 + } else {
1.18095 + ret = undefined;
1.18096 + }
1.18097 + if (ret === VisitorOption.Break) {
1.18098 + return;
1.18099 + }
1.18100 + }
1.18101 + }
1.18102 + }
1.18103 + function upperBound(array, func) {
1.18104 + var diff, len, i, current;
1.18105 + len = array.length;
1.18106 + i = 0;
1.18107 + while (len) {
1.18108 + diff = len >>> 1;
1.18109 + current = i + diff;
1.18110 + if (func(array[current])) {
1.18111 + len = diff;
1.18112 + } else {
1.18113 + i = current + 1;
1.18114 + len -= diff + 1;
1.18115 + }
1.18116 + }
1.18117 + return i;
1.18118 + }
1.18119 + function lowerBound(array, func) {
1.18120 + var diff, len, i, current;
1.18121 + len = array.length;
1.18122 + i = 0;
1.18123 + while (len) {
1.18124 + diff = len >>> 1;
1.18125 + current = i + diff;
1.18126 + if (func(array[current])) {
1.18127 + i = current + 1;
1.18128 + len -= diff + 1;
1.18129 + } else {
1.18130 + len = diff;
1.18131 + }
1.18132 + }
1.18133 + return i;
1.18134 + }
1.18135 + function extendCommentRange(comment, tokens) {
1.18136 + var target, token;
1.18137 + target = upperBound(tokens, function search(token) {
1.18138 + return token.range[0] > comment.range[0];
1.18139 + });
1.18140 + comment.extendedRange = [
1.18141 + comment.range[0],
1.18142 + comment.range[1]
1.18143 + ];
1.18144 + if (target !== tokens.length) {
1.18145 + comment.extendedRange[1] = tokens[target].range[0];
1.18146 + }
1.18147 + target -= 1;
1.18148 + if (target >= 0) {
1.18149 + if (target < tokens.length) {
1.18150 + comment.extendedRange[0] = tokens[target].range[1];
1.18151 + } else if (token.length) {
1.18152 + comment.extendedRange[1] = tokens[tokens.length - 1].range[0];
1.18153 + }
1.18154 + }
1.18155 + return comment;
1.18156 + }
1.18157 + function attachComments(tree, providedComments, tokens) {
1.18158 + var comments = [], comment, len, i;
1.18159 + if (!tree.range) {
1.18160 + throw new Error('attachComments needs range information');
1.18161 + }
1.18162 + if (!tokens.length) {
1.18163 + if (providedComments.length) {
1.18164 + for (i = 0, len = providedComments.length; i < len; i += 1) {
1.18165 + comment = deepCopy(providedComments[i]);
1.18166 + comment.extendedRange = [
1.18167 + 0,
1.18168 + tree.range[0]
1.18169 + ];
1.18170 + comments.push(comment);
1.18171 + }
1.18172 + tree.leadingComments = comments;
1.18173 + }
1.18174 + return tree;
1.18175 + }
1.18176 + for (i = 0, len = providedComments.length; i < len; i += 1) {
1.18177 + comments.push(extendCommentRange(deepCopy(providedComments[i]), tokens));
1.18178 + }
1.18179 + traverse(tree, {
1.18180 + cursor: 0,
1.18181 + enter: function (node) {
1.18182 + var comment;
1.18183 + while (this.cursor < comments.length) {
1.18184 + comment = comments[this.cursor];
1.18185 + if (comment.extendedRange[1] > node.range[0]) {
1.18186 + break;
1.18187 + }
1.18188 + if (comment.extendedRange[1] === node.range[0]) {
1.18189 + if (!node.leadingComments) {
1.18190 + node.leadingComments = [];
1.18191 + }
1.18192 + node.leadingComments.push(comment);
1.18193 + comments.splice(this.cursor, 1);
1.18194 + } else {
1.18195 + this.cursor += 1;
1.18196 + }
1.18197 + }
1.18198 + if (this.cursor === comments.length) {
1.18199 + return VisitorOption.Break;
1.18200 + }
1.18201 + if (comments[this.cursor].extendedRange[0] > node.range[1]) {
1.18202 + return VisitorOption.Skip;
1.18203 + }
1.18204 + }
1.18205 + });
1.18206 + traverse(tree, {
1.18207 + cursor: 0,
1.18208 + leave: function (node) {
1.18209 + var comment;
1.18210 + while (this.cursor < comments.length) {
1.18211 + comment = comments[this.cursor];
1.18212 + if (node.range[1] < comment.extendedRange[0]) {
1.18213 + break;
1.18214 + }
1.18215 + if (node.range[1] === comment.extendedRange[0]) {
1.18216 + if (!node.trailingComments) {
1.18217 + node.trailingComments = [];
1.18218 + }
1.18219 + node.trailingComments.push(comment);
1.18220 + comments.splice(this.cursor, 1);
1.18221 + } else {
1.18222 + this.cursor += 1;
1.18223 + }
1.18224 + }
1.18225 + if (this.cursor === comments.length) {
1.18226 + return VisitorOption.Break;
1.18227 + }
1.18228 + if (comments[this.cursor].extendedRange[0] > node.range[1]) {
1.18229 + return VisitorOption.Skip;
1.18230 + }
1.18231 + }
1.18232 + });
1.18233 + return tree;
1.18234 + }
1.18235 + exports.version = '0.0.6-dev';
1.18236 + exports.generate = generate;
1.18237 + exports.traverse = traverse;
1.18238 + exports.attachComments = attachComments;
1.18239 +}(typeof exports === 'undefined' ? escodegen = {} : exports));
1.18240 +var verifierOptions = systemOptions.register(new OptionSet('Verifier Options'));
1.18241 +var verifierTraceLevel = verifierOptions.register(new Option('tv', 'tv', 'number', 0, 'Verifier Trace Level'));
1.18242 +var Type = function () {
1.18243 + function type() {
1.18244 + unexpected('Type is Abstract');
1.18245 + }
1.18246 + type.prototype.equals = function (other) {
1.18247 + return this === other;
1.18248 + };
1.18249 + type.prototype.merge = function (other) {
1.18250 + unexpected('Merging ' + this + ' with ' + other);
1.18251 + };
1.18252 + type.cache = {
1.18253 + name: {},
1.18254 + classInfo: [],
1.18255 + instanceInfo: [],
1.18256 + scriptInfo: [],
1.18257 + methodInfo: []
1.18258 + };
1.18259 + type.from = function from(x, domain) {
1.18260 + var traitsTypeCache = null;
1.18261 + if (x instanceof ClassInfo) {
1.18262 + traitsTypeCache = type.cache.classInfo;
1.18263 + } else if (x instanceof InstanceInfo) {
1.18264 + traitsTypeCache = type.cache.instanceInfo;
1.18265 + } else if (x instanceof ScriptInfo) {
1.18266 + traitsTypeCache = type.cache.scriptInfo;
1.18267 + }
1.18268 + if (traitsTypeCache) {
1.18269 + return traitsTypeCache[x.runtimeId] || (traitsTypeCache[x.runtimeId] = new TraitsType(x, domain));
1.18270 + }
1.18271 + if (x instanceof ActivationInfo) {
1.18272 + return new TraitsType(x.methodInfo);
1.18273 + } else if (x instanceof Global) {
1.18274 + return new TraitsType(x.scriptInfo);
1.18275 + } else if (x instanceof Interface) {
1.18276 + return new TraitsType(x.classInfo, domain);
1.18277 + } else if (x instanceof MethodInfo) {
1.18278 + return new MethodType(x);
1.18279 + } else if (domain && x instanceof Class) {
1.18280 + return type.from(x.classInfo, domain);
1.18281 + }
1.18282 + return Type.Any;
1.18283 + };
1.18284 + type.fromSimpleName = function (name, domain) {
1.18285 + return Type.fromName(Multiname.fromSimpleName(name), domain);
1.18286 + };
1.18287 + type.fromName = function fromName(mn, domain) {
1.18288 + if (mn === undefined) {
1.18289 + return Type.Undefined;
1.18290 + } else {
1.18291 + var qn = Multiname.isQName(mn) ? Multiname.getFullQualifiedName(mn) : undefined;
1.18292 + if (qn) {
1.18293 + var ty = type.cache.name[qn];
1.18294 + if (ty) {
1.18295 + return ty;
1.18296 + }
1.18297 + }
1.18298 + if (qn === Multiname.getPublicQualifiedName('void')) {
1.18299 + return Type.Void;
1.18300 + }
1.18301 + true;
1.18302 + ty = domain.findClassInfo(mn);
1.18303 + ty = ty ? type.from(ty, domain) : Type.Any;
1.18304 + if (mn.hasTypeParameter()) {
1.18305 + ty = new ParameterizedType(ty, type.fromName(mn.typeParameter, domain));
1.18306 + }
1.18307 + return type.cache.name[qn] = ty;
1.18308 + }
1.18309 + };
1.18310 + type.prototype.applyType = function (parameter) {
1.18311 + return new ParameterizedType(this, parameter);
1.18312 + };
1.18313 + type.prototype.toString = function () {
1.18314 + return '[type]';
1.18315 + };
1.18316 + type.prototype.isNumeric = function () {
1.18317 + return this === Type.Int || this === Type.Uint || this === Type.Number;
1.18318 + };
1.18319 + type.prototype.isString = function () {
1.18320 + return this === Type.String;
1.18321 + };
1.18322 + type.prototype.isDirectlyReadable = function () {
1.18323 + return this === Type.Array;
1.18324 + };
1.18325 + type.prototype.isIndexedReadable = function () {
1.18326 + return this.isParameterizedType();
1.18327 + };
1.18328 + type.prototype.isDirectlyWriteable = function () {
1.18329 + return this === Type.Array;
1.18330 + };
1.18331 + type.prototype.isIndexedWriteable = function () {
1.18332 + return this.isParameterizedType();
1.18333 + };
1.18334 + type.prototype.isVector = function () {
1.18335 + return this.isParameterizedType();
1.18336 + };
1.18337 + type.prototype.isNotDirectlyIndexable = function () {
1.18338 + return this === Type.Any || this === Type.XML || this === Type.XMLList || this === Type.Dictionary;
1.18339 + };
1.18340 + type.prototype.isParameterizedType = function () {
1.18341 + return this instanceof ParameterizedType;
1.18342 + };
1.18343 + type.prototype.instanceType = function () {
1.18344 + return this;
1.18345 + };
1.18346 + type.prototype.getTrait = function () {
1.18347 + return null;
1.18348 + };
1.18349 + type.prototype.super = function () {
1.18350 + unexpected('Can\'t call super on ' + this);
1.18351 + };
1.18352 + type.prototype.isSubtypeOf = function (other) {
1.18353 + if (this === other || this.equals(other)) {
1.18354 + return true;
1.18355 + }
1.18356 + return this.merge(other) === this;
1.18357 + };
1.18358 + var typesInitialized = false;
1.18359 + type.initializeTypes = function (domain) {
1.18360 + if (typesInitialized) {
1.18361 + return;
1.18362 + }
1.18363 + type.Any = new AtomType('Any');
1.18364 + type.Null = new AtomType('Null');
1.18365 + type.Undefined = new AtomType('Undefined');
1.18366 + type.Void = new AtomType('Void');
1.18367 + type.Int = Type.fromSimpleName('int', domain).instanceType();
1.18368 + type.Uint = Type.fromSimpleName('uint', domain).instanceType();
1.18369 + type.Class = Type.fromSimpleName('Class', domain).instanceType();
1.18370 + type.Array = Type.fromSimpleName('Array', domain).instanceType();
1.18371 + type.Object = Type.fromSimpleName('Object', domain).instanceType();
1.18372 + type.String = Type.fromSimpleName('String', domain).instanceType();
1.18373 + type.Number = Type.fromSimpleName('Number', domain).instanceType();
1.18374 + type.Boolean = Type.fromSimpleName('Boolean', domain).instanceType();
1.18375 + type.Function = Type.fromSimpleName('Function', domain).instanceType();
1.18376 + type.XML = Type.fromSimpleName('XML', domain).instanceType();
1.18377 + type.XMLList = Type.fromSimpleName('XMLList', domain).instanceType();
1.18378 + type.Dictionary = Type.fromSimpleName('flash.utils.Dictionary', domain).instanceType();
1.18379 + typesInitialized = true;
1.18380 + };
1.18381 + return type;
1.18382 + }();
1.18383 +var AtomType = function () {
1.18384 + function atomType(name) {
1.18385 + this.name = name;
1.18386 + }
1.18387 + atomType.prototype = Object.create(Type.prototype);
1.18388 + atomType.prototype.toString = function () {
1.18389 + if (this === Type.Any) {
1.18390 + return '?';
1.18391 + } else if (this === Type.Undefined) {
1.18392 + return '_';
1.18393 + } else if (this === Type.Null) {
1.18394 + return 'X';
1.18395 + } else if (this === Type.Void) {
1.18396 + return 'V';
1.18397 + }
1.18398 + unexpected();
1.18399 + };
1.18400 + atomType.prototype.merge = function merge(other) {
1.18401 + if (other instanceof TraitsType) {
1.18402 + return Type.Any;
1.18403 + }
1.18404 + if (this === other) {
1.18405 + return this;
1.18406 + }
1.18407 + if (this === Type.Any || other === Type.Any) {
1.18408 + return Type.Any;
1.18409 + }
1.18410 + return Type.Any;
1.18411 + };
1.18412 + return atomType;
1.18413 + }();
1.18414 +var MethodType = function () {
1.18415 + function methodType(methodInfo) {
1.18416 + this.methodInfo = methodInfo;
1.18417 + }
1.18418 + methodType.prototype = Object.create(Type.prototype);
1.18419 + methodType.prototype.toString = function () {
1.18420 + return 'MT ' + this.methodInfo;
1.18421 + };
1.18422 + return methodType;
1.18423 + }();
1.18424 +var TraitsType = function () {
1.18425 + function traitsType(object, domain) {
1.18426 + true;
1.18427 + this.object = object;
1.18428 + this.traits = object.traits;
1.18429 + this.domain = domain;
1.18430 + if (this.object instanceof InstanceInfo) {
1.18431 + true;
1.18432 + }
1.18433 + }
1.18434 + traitsType.prototype = Object.create(Type.prototype);
1.18435 + function nameOf(x) {
1.18436 + if (x instanceof ScriptInfo) {
1.18437 + return 'SI';
1.18438 + } else if (x instanceof ClassInfo) {
1.18439 + return 'CI:' + x.instanceInfo.name.name;
1.18440 + } else if (x instanceof InstanceInfo) {
1.18441 + return 'II:' + x.name.name;
1.18442 + } else if (x instanceof MethodInfo) {
1.18443 + return 'MI';
1.18444 + } else if (x instanceof ActivationInfo) {
1.18445 + return 'AC';
1.18446 + }
1.18447 + true;
1.18448 + }
1.18449 + function findTraitBySlotId(traits, slotId) {
1.18450 + for (var i = traits.length - 1; i >= 0; i--) {
1.18451 + if (traits[i].slotId === slotId) {
1.18452 + return traits[i];
1.18453 + }
1.18454 + }
1.18455 + unexpected('Cannot find trait with slotId: ' + slotId + ' in ' + traits);
1.18456 + }
1.18457 + function findTraitByName(traits, mn, isSetter) {
1.18458 + var isGetter = !isSetter;
1.18459 + var trait;
1.18460 + if (!Multiname.isQName(mn)) {
1.18461 + if (mn instanceof MultinameType) {
1.18462 + return;
1.18463 + }
1.18464 + true;
1.18465 + var dy;
1.18466 + for (var i = 0, j = mn.namespaces.length; i < j; i++) {
1.18467 + var qn = mn.getQName(i);
1.18468 + if (mn.namespaces[i].isDynamic()) {
1.18469 + dy = qn;
1.18470 + } else {
1.18471 + if (trait = findTraitByName(traits, qn, isSetter)) {
1.18472 + return trait;
1.18473 + }
1.18474 + }
1.18475 + }
1.18476 + if (dy) {
1.18477 + return findTraitByName(traits, dy, isSetter);
1.18478 + }
1.18479 + } else {
1.18480 + var qn = Multiname.getQualifiedName(mn);
1.18481 + for (var i = 0, j = traits.length; i < j; i++) {
1.18482 + trait = traits[i];
1.18483 + if (Multiname.getQualifiedName(trait.name) === qn) {
1.18484 + if (isSetter && trait.isGetter() || isGetter && trait.isSetter()) {
1.18485 + continue;
1.18486 + }
1.18487 + return trait;
1.18488 + }
1.18489 + }
1.18490 + }
1.18491 + }
1.18492 + traitsType.prototype.getTrait = function (mn, isSetter, followSuperType) {
1.18493 + if (mn instanceof MultinameType) {
1.18494 + return null;
1.18495 + }
1.18496 + if (mn.isAttribute()) {
1.18497 + return null;
1.18498 + }
1.18499 + if (followSuperType && (this.isInstanceInfo() || this.isClassInfo())) {
1.18500 + var that = this;
1.18501 + do {
1.18502 + var trait = that.getTrait(mn, isSetter, false);
1.18503 + if (!trait) {
1.18504 + that = that.super();
1.18505 + }
1.18506 + } while (!trait && that);
1.18507 + return trait;
1.18508 + } else {
1.18509 + return findTraitByName(this.traits, mn, isSetter);
1.18510 + }
1.18511 + };
1.18512 + traitsType.prototype.getTraitAt = function (i) {
1.18513 + if (this.object instanceof ScriptInfo || this.object instanceof MethodInfo) {
1.18514 + return findTraitBySlotId(this.traits, i);
1.18515 + }
1.18516 + };
1.18517 + traitsType.prototype.toString = function () {
1.18518 + switch (this) {
1.18519 + case Type.Int:
1.18520 + return 'I';
1.18521 + case Type.Uint:
1.18522 + return 'U';
1.18523 + case Type.Array:
1.18524 + return 'A';
1.18525 + case Type.Object:
1.18526 + return 'O';
1.18527 + case Type.String:
1.18528 + return 'S';
1.18529 + case Type.Number:
1.18530 + return 'N';
1.18531 + case Type.Boolean:
1.18532 + return 'B';
1.18533 + case Type.Function:
1.18534 + return 'F';
1.18535 + }
1.18536 + return nameOf(this.object);
1.18537 + };
1.18538 + traitsType.prototype.instanceType = function () {
1.18539 + true;
1.18540 + return this.instanceCache || (this.instanceCache = Type.from(this.object.instanceInfo, this.domain));
1.18541 + };
1.18542 + traitsType.prototype.classType = function () {
1.18543 + true;
1.18544 + return this.instanceCache || (this.instanceCache = Type.from(this.object.classInfo, this.domain));
1.18545 + };
1.18546 + traitsType.prototype.super = function () {
1.18547 + if (this.object instanceof ClassInfo) {
1.18548 + return Type.Class;
1.18549 + }
1.18550 + true;
1.18551 + if (this.object.superName) {
1.18552 + var result = Type.fromName(this.object.superName, this.domain).instanceType();
1.18553 + true;
1.18554 + return result;
1.18555 + }
1.18556 + return null;
1.18557 + };
1.18558 + traitsType.prototype.isScriptInfo = function () {
1.18559 + return this.object instanceof ScriptInfo;
1.18560 + };
1.18561 + traitsType.prototype.isClassInfo = function () {
1.18562 + return this.object instanceof ClassInfo;
1.18563 + };
1.18564 + traitsType.prototype.isInstanceInfo = function () {
1.18565 + return this.object instanceof InstanceInfo;
1.18566 + };
1.18567 + traitsType.prototype.isInstanceOrClassInfo = function () {
1.18568 + return this.isInstanceInfo() || this.isClassInfo();
1.18569 + };
1.18570 + traitsType.prototype.equals = function (other) {
1.18571 + return this.traits === other.traits;
1.18572 + };
1.18573 + traitsType.prototype.merge = function (other) {
1.18574 + if (other instanceof TraitsType) {
1.18575 + if (this.equals(other)) {
1.18576 + return this;
1.18577 + }
1.18578 + if (this.isNumeric() && other.isNumeric()) {
1.18579 + return Type.Number;
1.18580 + }
1.18581 + if (this.isInstanceInfo() && other.isInstanceInfo()) {
1.18582 + var path = [];
1.18583 + for (var curr = this; curr; curr = curr.super()) {
1.18584 + path.push(curr);
1.18585 + }
1.18586 + for (var curr = other; curr; curr = curr.super()) {
1.18587 + for (var i = 0; i < path.length; i++) {
1.18588 + if (path[i].equals(curr)) {
1.18589 + return curr;
1.18590 + }
1.18591 + }
1.18592 + }
1.18593 + return Type.Object;
1.18594 + }
1.18595 + }
1.18596 + return Type.Any;
1.18597 + };
1.18598 + return traitsType;
1.18599 + }();
1.18600 +var MultinameType = function () {
1.18601 + function multinameType(namespaces, name, flags) {
1.18602 + this.namespaces = namespaces;
1.18603 + this.name = name;
1.18604 + this.flags = flags;
1.18605 + }
1.18606 + multinameType.prototype = Object.create(Type.prototype);
1.18607 + multinameType.prototype.toString = function () {
1.18608 + return 'MN';
1.18609 + };
1.18610 + return multinameType;
1.18611 + }();
1.18612 +var ParameterizedType = function () {
1.18613 + function parameterizedType(type, parameter) {
1.18614 + this.type = type;
1.18615 + this.parameter = parameter;
1.18616 + }
1.18617 + parameterizedType.prototype = Object.create(Type.prototype);
1.18618 + parameterizedType.prototype.toString = function () {
1.18619 + return this.type + '<' + this.parameter + '>';
1.18620 + };
1.18621 + parameterizedType.prototype.instanceType = function () {
1.18622 + true;
1.18623 + return new ParameterizedType(this.type.instanceType(), this.parameter.instanceType());
1.18624 + };
1.18625 + parameterizedType.prototype.equals = function (other) {
1.18626 + if (other instanceof ParameterizedType) {
1.18627 + return this.type.equals(other.type) && this.parameter.equals(other.parameter);
1.18628 + }
1.18629 + return false;
1.18630 + };
1.18631 + parameterizedType.prototype.merge = function (other) {
1.18632 + if (other instanceof TraitsType) {
1.18633 + if (this.equals(other)) {
1.18634 + return this;
1.18635 + }
1.18636 + }
1.18637 + return Type.Any;
1.18638 + };
1.18639 + return parameterizedType;
1.18640 + }();
1.18641 +var TypeInformation = function () {
1.18642 + function typeInformation() {
1.18643 + }
1.18644 + typeInformation.prototype.toString = function () {
1.18645 + return toKeyValueArray(this).map(function (x) {
1.18646 + return x[0] + ': ' + x[1];
1.18647 + }).join(' | ');
1.18648 + };
1.18649 + return typeInformation;
1.18650 + }();
1.18651 +var Verifier = function () {
1.18652 + function VerifierError(message) {
1.18653 + this.name = 'VerifierError';
1.18654 + this.message = message || '';
1.18655 + }
1.18656 + var State = function () {
1.18657 + var id = 0;
1.18658 + function state() {
1.18659 + this.id = id += 1;
1.18660 + this.stack = [];
1.18661 + this.scope = [];
1.18662 + this.local = [];
1.18663 + }
1.18664 + state.prototype.clone = function clone() {
1.18665 + var s = new State();
1.18666 + s.originalId = this.id;
1.18667 + s.stack = this.stack.slice(0);
1.18668 + s.scope = this.scope.slice(0);
1.18669 + s.local = this.local.slice(0);
1.18670 + return s;
1.18671 + };
1.18672 + state.prototype.trace = function trace(writer) {
1.18673 + writer.writeLn(this.toString());
1.18674 + };
1.18675 + state.prototype.toString = function () {
1.18676 + return '<' + this.id + (this.originalId ? ':' + this.originalId : '') + ', L[' + this.local.join(', ') + ']' + ', S[' + this.stack.join(', ') + ']' + ', $[' + this.scope.join(', ') + ']>';
1.18677 + };
1.18678 + state.prototype.equals = function (other) {
1.18679 + return arrayEquals(this.stack, other.stack) && arrayEquals(this.scope, other.scope) && arrayEquals(this.local, other.local);
1.18680 + };
1.18681 + function arrayEquals(a, b) {
1.18682 + if (a.length != b.length) {
1.18683 + return false;
1.18684 + }
1.18685 + for (var i = a.length - 1; i >= 0; i--) {
1.18686 + if (!a[i].equals(b[i])) {
1.18687 + return false;
1.18688 + }
1.18689 + }
1.18690 + return true;
1.18691 + }
1.18692 + state.prototype.isSubset = function (other) {
1.18693 + return arraySubset(this.stack, other.stack) && arraySubset(this.scope, other.scope) && arraySubset(this.local, other.local);
1.18694 + };
1.18695 + function arraySubset(a, b) {
1.18696 + if (a.length != b.length) {
1.18697 + return false;
1.18698 + }
1.18699 + for (var i = a.length - 1; i >= 0; i--) {
1.18700 + if (a[i] === b[i] || a[i].equals(b[i])) {
1.18701 + continue;
1.18702 + }
1.18703 + if (a[i].merge(b[i]) !== a[i]) {
1.18704 + return false;
1.18705 + }
1.18706 + }
1.18707 + return true;
1.18708 + }
1.18709 + state.prototype.merge = function (other) {
1.18710 + mergeArrays(this.local, other.local);
1.18711 + mergeArrays(this.stack, other.stack);
1.18712 + mergeArrays(this.scope, other.scope);
1.18713 + };
1.18714 + function mergeArrays(a, b) {
1.18715 + true;
1.18716 + for (var i = a.length - 1; i >= 0; i--) {
1.18717 + true;
1.18718 + if (a[i] === b[i]) {
1.18719 + continue;
1.18720 + }
1.18721 + a[i] = a[i].merge(b[i]);
1.18722 + }
1.18723 + }
1.18724 + return state;
1.18725 + }();
1.18726 + var Verification = function () {
1.18727 + function verification(methodInfo, domain, savedScope) {
1.18728 + this.savedScope = savedScope;
1.18729 + this.methodInfo = methodInfo;
1.18730 + this.domain = domain;
1.18731 + this.writer = new IndentingWriter();
1.18732 + this.returnType = Type.Undefined;
1.18733 + }
1.18734 + verification.prototype.verify = function verify() {
1.18735 + var mi = this.methodInfo;
1.18736 + var writer = verifierTraceLevel.value ? this.writer : null;
1.18737 + var blocks = mi.analysis.blocks;
1.18738 + blocks.forEach(function (x) {
1.18739 + x.entryState = x.exitState = null;
1.18740 + });
1.18741 + if (writer) {
1.18742 + this.methodInfo.trace(writer);
1.18743 + }
1.18744 + var entryState = new State();
1.18745 + true;
1.18746 + this.thisType = mi.holder ? Type.from(mi.holder, this.domain) : Type.Any;
1.18747 + entryState.local.push(this.thisType);
1.18748 + for (var i = 0; i < mi.parameters.length; i++) {
1.18749 + entryState.local.push(Type.fromName(mi.parameters[i].type, this.domain).instanceType());
1.18750 + }
1.18751 + var remainingLocals = mi.localCount - mi.parameters.length - 1;
1.18752 + if (mi.needsRest() || mi.needsArguments()) {
1.18753 + entryState.local.push(Type.Array);
1.18754 + remainingLocals -= 1;
1.18755 + }
1.18756 + for (var i = 0; i < remainingLocals; i++) {
1.18757 + entryState.local.push(Type.Undefined);
1.18758 + }
1.18759 + true;
1.18760 + if (writer) {
1.18761 + entryState.trace(writer);
1.18762 + }
1.18763 + for (var bi = 0, len = blocks.length; bi < len; bi++) {
1.18764 + blocks[bi].bdo = bi;
1.18765 + }
1.18766 + var worklist = new Shumway.SortedList(function compare(blockA, blockB) {
1.18767 + return blockA.bdo - blockB.bdo;
1.18768 + });
1.18769 + blocks[0].entryState = entryState;
1.18770 + worklist.push(blocks[0]);
1.18771 + while (!worklist.isEmpty()) {
1.18772 + var block = worklist.pop();
1.18773 + var exitState = block.exitState = block.entryState.clone();
1.18774 + this.verifyBlock(block, exitState);
1.18775 + block.succs.forEach(function (successor) {
1.18776 + if (worklist.contains(successor)) {
1.18777 + if (writer) {
1.18778 + writer.writeLn('Forward Merged Block: ' + successor.bid + ' ' + exitState.toString() + ' with ' + successor.entryState.toString());
1.18779 + }
1.18780 + successor.entryState.merge(exitState);
1.18781 + if (writer) {
1.18782 + writer.writeLn('Merged State: ' + successor.entryState);
1.18783 + }
1.18784 + return;
1.18785 + }
1.18786 + if (successor.entryState) {
1.18787 + if (!successor.entryState.isSubset(exitState)) {
1.18788 + if (writer) {
1.18789 + writer.writeLn('Backward Merged Block: ' + block.bid + ' with ' + successor.bid + ' ' + exitState.toString() + ' with ' + successor.entryState.toString());
1.18790 + }
1.18791 + successor.entryState.merge(exitState);
1.18792 + worklist.push(successor);
1.18793 + if (writer) {
1.18794 + writer.writeLn('Merged State: ' + successor.entryState);
1.18795 + }
1.18796 + }
1.18797 + return;
1.18798 + }
1.18799 + successor.entryState = exitState.clone();
1.18800 + worklist.push(successor);
1.18801 + if (writer) {
1.18802 + writer.writeLn('Added Block: ' + successor.bid + ' to worklist: ' + successor.entryState.toString());
1.18803 + }
1.18804 + });
1.18805 + }
1.18806 + if (writer) {
1.18807 + writer.writeLn('Inferred return type: ' + this.returnType);
1.18808 + }
1.18809 + this.methodInfo.inferredReturnType = this.returnType;
1.18810 + };
1.18811 + verification.prototype.verifyBlock = function verifyBlock(block, state) {
1.18812 + var savedScope = this.savedScope;
1.18813 + var globalScope = savedScope[0];
1.18814 + var local = state.local;
1.18815 + var stack = state.stack;
1.18816 + var scope = state.scope;
1.18817 + var writer = verifierTraceLevel.value ? this.writer : null;
1.18818 + var bytecodes = this.methodInfo.analysis.bytecodes;
1.18819 + var domain = this.domain;
1.18820 + var multinames = this.methodInfo.abc.constantPool.multinames;
1.18821 + var mi = this.methodInfo;
1.18822 + var bc, obj, fn, mn, l, r, val, type, returnType;
1.18823 + if (writer) {
1.18824 + writer.enter('verifyBlock: ' + block.bid + ', range: [' + block.position + ', ' + block.end.position + '], entryState: ' + state.toString() + ' {');
1.18825 + }
1.18826 + function construct(obj) {
1.18827 + if (obj instanceof TraitsType || obj instanceof ParameterizedType) {
1.18828 + if (obj === Type.Function || obj === Type.Class || obj === Type.Object) {
1.18829 + return Type.Object;
1.18830 + }
1.18831 + return obj.instanceType();
1.18832 + } else {
1.18833 + return Type.Any;
1.18834 + }
1.18835 + }
1.18836 + function ti() {
1.18837 + return bc.ti || (bc.ti = new TypeInformation());
1.18838 + }
1.18839 + function push(x) {
1.18840 + true;
1.18841 + ti().type = x;
1.18842 + stack.push(x);
1.18843 + }
1.18844 + function pop() {
1.18845 + return stack.pop();
1.18846 + }
1.18847 + function findProperty(mn, strict) {
1.18848 + if (mn instanceof MultinameType) {
1.18849 + if (mn.name === 'Array') {
1.18850 + debugger;
1.18851 + }
1.18852 + return Type.Any;
1.18853 + }
1.18854 + for (var i = scope.length - 1; i >= -savedScope.length; i--) {
1.18855 + var s = i >= 0 ? scope[i] : savedScope[savedScope.length + i];
1.18856 + if (s instanceof TraitsType) {
1.18857 + var trait = s.getTrait(mn, false, true);
1.18858 + if (trait) {
1.18859 + ti().scopeDepth = scope.length - i - 1;
1.18860 + if (s.isClassInfo() || s.isScriptInfo()) {
1.18861 + ti().object = LazyInitializer.create(s.object);
1.18862 + }
1.18863 + return s;
1.18864 + }
1.18865 + } else {
1.18866 + if (mn.name === 'Array') {
1.18867 + debugger;
1.18868 + }
1.18869 + return Type.Any;
1.18870 + }
1.18871 + }
1.18872 + var resolved = domain.findDefiningScript(mn, false);
1.18873 + if (resolved) {
1.18874 + ti().object = LazyInitializer.create(resolved.script);
1.18875 + return Type.from(resolved.script, domain);
1.18876 + }
1.18877 + if (mn.name === 'Array') {
1.18878 + debugger;
1.18879 + }
1.18880 + return Type.Any;
1.18881 + }
1.18882 + function popMultiname() {
1.18883 + var mn = multinames[bc.index];
1.18884 + if (mn.isRuntime()) {
1.18885 + var namespaces = mn.namespaces;
1.18886 + var name = mn.name;
1.18887 + if (mn.isRuntimeName()) {
1.18888 + name = pop();
1.18889 + }
1.18890 + if (mn.isRuntimeNamespace()) {
1.18891 + namespaces = [
1.18892 + pop()
1.18893 + ];
1.18894 + }
1.18895 + return new MultinameType(namespaces, name, mn.flags);
1.18896 + }
1.18897 + return mn;
1.18898 + }
1.18899 + function accessSlot(obj) {
1.18900 + if (obj instanceof TraitsType) {
1.18901 + var trait = obj.getTraitAt(bc.index);
1.18902 + writer && writer.debugLn('accessSlot() -> ' + trait);
1.18903 + if (trait) {
1.18904 + ti().trait = trait;
1.18905 + if (trait.isSlot()) {
1.18906 + return Type.fromName(trait.typeName, domain).instanceType();
1.18907 + } else if (trait.isClass()) {
1.18908 + return Type.from(trait.classInfo, domain);
1.18909 + }
1.18910 + }
1.18911 + }
1.18912 + return Type.Any;
1.18913 + }
1.18914 + function isNumericMultiname(mn) {
1.18915 + return mn instanceof Multiname && Multiname.isNumeric(mn) || mn instanceof MultinameType && (mn.name instanceof TraitsType && mn.name.isNumeric());
1.18916 + }
1.18917 + function getProperty(obj, mn) {
1.18918 + if (obj instanceof TraitsType || obj instanceof ParameterizedType) {
1.18919 + var trait = obj.getTrait(mn, false, true);
1.18920 + writer && writer.debugLn('getProperty(' + mn + ') -> ' + trait);
1.18921 + if (trait) {
1.18922 + ti().trait = trait;
1.18923 + if (trait.isSlot() || trait.isConst()) {
1.18924 + return Type.fromName(trait.typeName, domain).instanceType();
1.18925 + } else if (trait.isGetter()) {
1.18926 + return Type.fromName(trait.methodInfo.returnType, domain).instanceType();
1.18927 + } else if (trait.isClass()) {
1.18928 + return Type.from(trait.classInfo, domain);
1.18929 + } else if (trait.isMethod()) {
1.18930 + return Type.from(trait.methodInfo, domain);
1.18931 + }
1.18932 + } else if (obj.isDirectlyReadable() && mn instanceof Multiname) {
1.18933 + ti().propertyQName = Multiname.getPublicQualifiedName(mn.name);
1.18934 + }
1.18935 + if (isNumericMultiname(mn)) {
1.18936 + if (obj.isIndexedReadable()) {
1.18937 + ti().isIndexedReadable = true;
1.18938 + if (obj.isVector()) {
1.18939 + return obj.parameter;
1.18940 + }
1.18941 + } else if (obj.isDirectlyReadable()) {
1.18942 + ti().isDirectlyReadable = true;
1.18943 + }
1.18944 + }
1.18945 + }
1.18946 + return Type.Any;
1.18947 + }
1.18948 + function setProperty(obj, mn, value) {
1.18949 + if (obj instanceof TraitsType || obj instanceof ParameterizedType) {
1.18950 + var trait = obj.getTrait(mn, true, true);
1.18951 + writer && writer.debugLn('setProperty(' + mn + ') -> ' + trait);
1.18952 + if (trait) {
1.18953 + ti().trait = trait;
1.18954 + } else if (obj.isDirectlyWriteable() && mn instanceof Multiname) {
1.18955 + ti().propertyQName = Multiname.getPublicQualifiedName(mn.name);
1.18956 + }
1.18957 + if (isNumericMultiname(mn)) {
1.18958 + if (obj.isDirectlyWriteable()) {
1.18959 + ti().isDirectlyWriteable = true;
1.18960 + } else if (obj.isVector()) {
1.18961 + ti().isIndexedWriteable = true;
1.18962 + }
1.18963 + }
1.18964 + }
1.18965 + }
1.18966 + for (var bci = block.position, end = block.end.position; bci <= end; bci++) {
1.18967 + bc = bytecodes[bci];
1.18968 + var op = bc.op;
1.18969 + if (writer && verifierTraceLevel.value > 1) {
1.18970 + writer.writeLn(('stateBefore: ' + state.toString() + ' $$[' + savedScope.join(', ') + ']').padRight(' ', 100) + ' : ' + bci + ', ' + bc.toString(mi.abc));
1.18971 + }
1.18972 + switch (op) {
1.18973 + case 1:
1.18974 + break;
1.18975 + case 3:
1.18976 + pop();
1.18977 + break;
1.18978 + case 4:
1.18979 + mn = popMultiname();
1.18980 + obj = pop();
1.18981 + true;
1.18982 + ti().baseClass = LazyInitializer.create(this.thisType.super().classType().object);
1.18983 + push(getProperty(obj.super(), mn));
1.18984 + break;
1.18985 + case 5:
1.18986 + val = pop();
1.18987 + mn = popMultiname();
1.18988 + obj = pop();
1.18989 + true;
1.18990 + ti().baseClass = LazyInitializer.create(this.thisType.super().classType().object);
1.18991 + setProperty(obj.super(), mn, val);
1.18992 + break;
1.18993 + case 6:
1.18994 + notImplemented(bc);
1.18995 + break;
1.18996 + case 7:
1.18997 + notImplemented(bc);
1.18998 + break;
1.18999 + case 8:
1.19000 + state.local[bc.index] = Type.Undefined;
1.19001 + break;
1.19002 + case 10:
1.19003 + notImplemented(bc);
1.19004 + break;
1.19005 + case 11:
1.19006 + notImplemented(bc);
1.19007 + break;
1.19008 + case 12:
1.19009 + case 24:
1.19010 + case 13:
1.19011 + case 23:
1.19012 + case 14:
1.19013 + case 22:
1.19014 + case 15:
1.19015 + case 21:
1.19016 + case 19:
1.19017 + case 20:
1.19018 + case 25:
1.19019 + case 26:
1.19020 + pop();
1.19021 + pop();
1.19022 + break;
1.19023 + case 16:
1.19024 + break;
1.19025 + case 17:
1.19026 + case 18:
1.19027 + pop();
1.19028 + break;
1.19029 + case 27:
1.19030 + pop(Type.Int);
1.19031 + break;
1.19032 + case 29:
1.19033 + scope.pop();
1.19034 + break;
1.19035 + case 30:
1.19036 + case 35:
1.19037 + pop(Type.Int);
1.19038 + pop();
1.19039 + push(Type.Any);
1.19040 + break;
1.19041 + case 31:
1.19042 + push(Type.Boolean);
1.19043 + break;
1.19044 + case 50:
1.19045 + push(Type.Boolean);
1.19046 + break;
1.19047 + case 32:
1.19048 + push(Type.Null);
1.19049 + break;
1.19050 + case 33:
1.19051 + push(Type.Undefined);
1.19052 + break;
1.19053 + case 34:
1.19054 + notImplemented(bc);
1.19055 + break;
1.19056 + case 36:
1.19057 + push(Type.Int);
1.19058 + break;
1.19059 + case 37:
1.19060 + push(Type.Int);
1.19061 + break;
1.19062 + case 44:
1.19063 + push(Type.String);
1.19064 + break;
1.19065 + case 45:
1.19066 + push(Type.Int);
1.19067 + break;
1.19068 + case 46:
1.19069 + push(Type.Uint);
1.19070 + break;
1.19071 + case 47:
1.19072 + push(Type.Number);
1.19073 + break;
1.19074 + case 38:
1.19075 + push(Type.Boolean);
1.19076 + break;
1.19077 + case 39:
1.19078 + push(Type.Boolean);
1.19079 + break;
1.19080 + case 40:
1.19081 + push(Type.Number);
1.19082 + break;
1.19083 + case 41:
1.19084 + pop();
1.19085 + break;
1.19086 + case 42:
1.19087 + val = pop();
1.19088 + push(val);
1.19089 + push(val);
1.19090 + break;
1.19091 + case 43:
1.19092 + l = pop();
1.19093 + r = pop();
1.19094 + push(l);
1.19095 + push(r);
1.19096 + break;
1.19097 + case 28:
1.19098 + pop();
1.19099 + scope.push(Type.Any);
1.19100 + break;
1.19101 + case 48:
1.19102 + scope.push(pop());
1.19103 + break;
1.19104 + case 49:
1.19105 + notImplemented(bc);
1.19106 + break;
1.19107 + case 53:
1.19108 + case 54:
1.19109 + case 55:
1.19110 + push(Type.Int);
1.19111 + break;
1.19112 + case 56:
1.19113 + case 57:
1.19114 + push(Type.Number);
1.19115 + break;
1.19116 + case 58:
1.19117 + case 59:
1.19118 + case 60:
1.19119 + pop(Type.Int);
1.19120 + break;
1.19121 + case 61:
1.19122 + case 62:
1.19123 + pop(Type.Number);
1.19124 + break;
1.19125 + case 64:
1.19126 + push(Type.Function);
1.19127 + break;
1.19128 + case 65:
1.19129 + stack.popMany(bc.argCount);
1.19130 + obj = pop();
1.19131 + fn = pop();
1.19132 + push(Type.Any);
1.19133 + break;
1.19134 + case 67:
1.19135 + throw new VerifierError('callmethod');
1.19136 + case 68:
1.19137 + notImplemented(bc);
1.19138 + break;
1.19139 + case 69:
1.19140 + case 78:
1.19141 + case 79:
1.19142 + case 70:
1.19143 + case 76:
1.19144 + stack.popMany(bc.argCount);
1.19145 + mn = popMultiname();
1.19146 + obj = pop();
1.19147 + if (op === OP_callsuper || op === OP_callsupervoid) {
1.19148 + obj = this.thisType.super();
1.19149 + ti().baseClass = LazyInitializer.create(this.thisType.super().classType().object);
1.19150 + }
1.19151 + type = getProperty(obj, mn);
1.19152 + if (op === OP_callpropvoid || op === OP_callsupervoid) {
1.19153 + break;
1.19154 + }
1.19155 + if (type instanceof MethodType) {
1.19156 + returnType = Type.fromName(type.methodInfo.returnType, domain).instanceType();
1.19157 + } else if (type instanceof TraitsType && type.isClassInfo()) {
1.19158 + returnType = type.instanceType();
1.19159 + } else {
1.19160 + returnType = Type.Any;
1.19161 + }
1.19162 + push(returnType);
1.19163 + break;
1.19164 + case 71:
1.19165 + this.returnType.merge(Type.Undefined);
1.19166 + break;
1.19167 + case 72:
1.19168 + type = pop();
1.19169 + if (mi.returnType) {
1.19170 + var coerceType = Type.fromName(mi.returnType, this.domain).instanceType();
1.19171 + if (coerceType.isSubtypeOf(type)) {
1.19172 + ti().noCoercionNeeded = true;
1.19173 + }
1.19174 + }
1.19175 + break;
1.19176 + case 73:
1.19177 + stack.popMany(bc.argCount);
1.19178 + stack.pop();
1.19179 + if (this.thisType.isInstanceInfo() && this.thisType.super() === Type.Object) {
1.19180 + ti().noCallSuperNeeded = true;
1.19181 + } else {
1.19182 + ti().baseClass = LazyInitializer.create(this.thisType.super().classType().object);
1.19183 + }
1.19184 + break;
1.19185 + case 66:
1.19186 + stack.popMany(bc.argCount);
1.19187 + push(construct(pop()));
1.19188 + break;
1.19189 + case 74:
1.19190 + stack.popMany(bc.argCount);
1.19191 + mn = popMultiname();
1.19192 + push(construct(getProperty(stack.pop(), mn)));
1.19193 + break;
1.19194 + case 75:
1.19195 + notImplemented(bc);
1.19196 + break;
1.19197 + case 77:
1.19198 + notImplemented(bc);
1.19199 + break;
1.19200 + case 80:
1.19201 + case 81:
1.19202 + case 82:
1.19203 + break;
1.19204 + case 83:
1.19205 + true;
1.19206 + val = pop();
1.19207 + obj = pop();
1.19208 + if (obj === Type.Any) {
1.19209 + push(Type.Any);
1.19210 + } else {
1.19211 + push(obj.applyType(val));
1.19212 + }
1.19213 + break;
1.19214 + case 84:
1.19215 + notImplemented(bc);
1.19216 + break;
1.19217 + case 85:
1.19218 + stack.popMany(bc.argCount * 2);
1.19219 + push(Type.Object);
1.19220 + break;
1.19221 + case 86:
1.19222 + stack.popMany(bc.argCount);
1.19223 + push(Type.Array);
1.19224 + break;
1.19225 + case 87:
1.19226 + push(Type.from(new ActivationInfo(this.methodInfo)));
1.19227 + break;
1.19228 + case 88:
1.19229 + push(Type.Any);
1.19230 + break;
1.19231 + case 89:
1.19232 + popMultiname();
1.19233 + pop();
1.19234 + push(Type.XMLList);
1.19235 + break;
1.19236 + case 90:
1.19237 + push(Type.Any);
1.19238 + break;
1.19239 + case 93:
1.19240 + push(findProperty(popMultiname(), true));
1.19241 + break;
1.19242 + case 94:
1.19243 + push(findProperty(popMultiname(), false));
1.19244 + break;
1.19245 + case 95:
1.19246 + notImplemented(bc);
1.19247 + break;
1.19248 + case 96:
1.19249 + mn = popMultiname();
1.19250 + push(getProperty(findProperty(mn, true), mn));
1.19251 + break;
1.19252 + case 104:
1.19253 + case 97:
1.19254 + val = pop();
1.19255 + mn = popMultiname();
1.19256 + obj = pop();
1.19257 + setProperty(obj, mn, val, bc);
1.19258 + break;
1.19259 + case 98:
1.19260 + push(local[bc.index]);
1.19261 + break;
1.19262 + case 99:
1.19263 + local[bc.index] = pop();
1.19264 + break;
1.19265 + case 100:
1.19266 + push(globalScope);
1.19267 + ti().object = LazyInitializer.create(globalScope.object);
1.19268 + break;
1.19269 + case 101:
1.19270 + push(scope[bc.index]);
1.19271 + break;
1.19272 + case 102:
1.19273 + mn = popMultiname();
1.19274 + obj = pop();
1.19275 + push(getProperty(obj, mn));
1.19276 + break;
1.19277 + case 103:
1.19278 + notImplemented(bc);
1.19279 + break;
1.19280 + case 105:
1.19281 + notImplemented(bc);
1.19282 + break;
1.19283 + case 106:
1.19284 + popMultiname();
1.19285 + pop();
1.19286 + push(Type.Boolean);
1.19287 + break;
1.19288 + case 107:
1.19289 + notImplemented(bc);
1.19290 + break;
1.19291 + case 108:
1.19292 + push(accessSlot(pop()));
1.19293 + break;
1.19294 + case 109:
1.19295 + val = pop();
1.19296 + obj = pop();
1.19297 + accessSlot(obj);
1.19298 + break;
1.19299 + case 110:
1.19300 + notImplemented(bc);
1.19301 + break;
1.19302 + case 111:
1.19303 + notImplemented(bc);
1.19304 + break;
1.19305 + case 112:
1.19306 + pop();
1.19307 + push(Type.String);
1.19308 + break;
1.19309 + case 113:
1.19310 + pop();
1.19311 + push(Type.String);
1.19312 + break;
1.19313 + case 114:
1.19314 + pop();
1.19315 + push(Type.String);
1.19316 + break;
1.19317 + case 131:
1.19318 + case 115:
1.19319 + pop();
1.19320 + push(Type.Int);
1.19321 + break;
1.19322 + case 136:
1.19323 + case 116:
1.19324 + pop();
1.19325 + push(Type.Uint);
1.19326 + break;
1.19327 + case 132:
1.19328 + case 117:
1.19329 + pop();
1.19330 + push(Type.Number);
1.19331 + break;
1.19332 + case 129:
1.19333 + case 118:
1.19334 + pop();
1.19335 + push(Type.Boolean);
1.19336 + break;
1.19337 + case 119:
1.19338 + notImplemented(bc);
1.19339 + break;
1.19340 + case 120:
1.19341 + break;
1.19342 + case 121:
1.19343 + pop();
1.19344 + push(Type.Number);
1.19345 + break;
1.19346 + case 122:
1.19347 + notImplemented(bc);
1.19348 + break;
1.19349 + case 123:
1.19350 + notImplemented(bc);
1.19351 + break;
1.19352 + case 128:
1.19353 + type = pop();
1.19354 + var coerceType = Type.fromName(multinames[bc.index], this.domain).instanceType();
1.19355 + if (coerceType.isSubtypeOf(type)) {
1.19356 + ti().noCoercionNeeded = true;
1.19357 + }
1.19358 + push(coerceType);
1.19359 + break;
1.19360 + case 130:
1.19361 + break;
1.19362 + case 133:
1.19363 + pop();
1.19364 + push(Type.String);
1.19365 + break;
1.19366 + case 134:
1.19367 + notImplemented(bc);
1.19368 + break;
1.19369 + case 135:
1.19370 + type = pop();
1.19371 + pop();
1.19372 + if (type instanceof TraitsType) {
1.19373 + push(type.instanceType());
1.19374 + } else {
1.19375 + push(Type.Any);
1.19376 + }
1.19377 + break;
1.19378 + case 137:
1.19379 + notImplemented(bc);
1.19380 + break;
1.19381 + case 144:
1.19382 + case 145:
1.19383 + case 147:
1.19384 + pop();
1.19385 + push(Type.Number);
1.19386 + break;
1.19387 + case 146:
1.19388 + case 148:
1.19389 + local[bc.index] = Type.Number;
1.19390 + break;
1.19391 + case 149:
1.19392 + pop();
1.19393 + push(Type.String);
1.19394 + break;
1.19395 + case 150:
1.19396 + pop();
1.19397 + push(Type.Boolean);
1.19398 + break;
1.19399 + case 160:
1.19400 + r = pop();
1.19401 + l = pop();
1.19402 + if (l.isNumeric() && r.isNumeric()) {
1.19403 + push(Type.Number);
1.19404 + } else if (l === Type.String || r === Type.String) {
1.19405 + push(Type.String);
1.19406 + } else {
1.19407 + push(Type.Any);
1.19408 + }
1.19409 + break;
1.19410 + case 161:
1.19411 + case 162:
1.19412 + case 163:
1.19413 + case 164:
1.19414 + pop();
1.19415 + pop();
1.19416 + push(Type.Number);
1.19417 + break;
1.19418 + case 168:
1.19419 + case 169:
1.19420 + case 170:
1.19421 + case 165:
1.19422 + case 166:
1.19423 + case 167:
1.19424 + pop();
1.19425 + pop();
1.19426 + push(Type.Int);
1.19427 + break;
1.19428 + case 151:
1.19429 + pop();
1.19430 + push(Type.Int);
1.19431 + break;
1.19432 + case 171:
1.19433 + case 172:
1.19434 + case 173:
1.19435 + case 174:
1.19436 + case 175:
1.19437 + case 176:
1.19438 + case 177:
1.19439 + case 180:
1.19440 + pop();
1.19441 + pop();
1.19442 + push(Type.Boolean);
1.19443 + break;
1.19444 + case 178:
1.19445 + pop();
1.19446 + push(Type.Boolean);
1.19447 + break;
1.19448 + case 179:
1.19449 + pop();
1.19450 + pop();
1.19451 + push(Type.Boolean);
1.19452 + break;
1.19453 + case 194:
1.19454 + case 195:
1.19455 + local[bc.index] = Type.Int;
1.19456 + break;
1.19457 + case 193:
1.19458 + case 192:
1.19459 + case 196:
1.19460 + pop();
1.19461 + push(Type.Int);
1.19462 + break;
1.19463 + case 197:
1.19464 + case 198:
1.19465 + case 199:
1.19466 + pop();
1.19467 + pop();
1.19468 + push(Type.Int);
1.19469 + break;
1.19470 + case 208:
1.19471 + case 209:
1.19472 + case 210:
1.19473 + case 211:
1.19474 + push(local[op - OP_getlocal0]);
1.19475 + break;
1.19476 + case 212:
1.19477 + case 213:
1.19478 + case 214:
1.19479 + case 215:
1.19480 + local[op - OP_setlocal0] = pop();
1.19481 + break;
1.19482 + case 239:
1.19483 + break;
1.19484 + case 240:
1.19485 + break;
1.19486 + case 241:
1.19487 + break;
1.19488 + case 242:
1.19489 + break;
1.19490 + case 243:
1.19491 + break;
1.19492 + default:
1.19493 + console.info('Not Implemented: ' + bc);
1.19494 + }
1.19495 + if (writer) {
1.19496 + if (bc.ti) {
1.19497 + writer.debugLn('> TI: ' + bc.ti);
1.19498 + }
1.19499 + }
1.19500 + }
1.19501 + if (writer) {
1.19502 + writer.leave('}');
1.19503 + writer.writeLn('verifiedBlock: ' + block.bid + ', range: [' + block.position + ', ' + block.end.position + '], exitState: ' + state.toString());
1.19504 + }
1.19505 + };
1.19506 + return verification;
1.19507 + }();
1.19508 + function verifier() {
1.19509 + this.writer = new IndentingWriter();
1.19510 + }
1.19511 + verifier.prototype.verifyMethod = function (methodInfo, scope) {
1.19512 + try {
1.19513 + var domain = methodInfo.abc.applicationDomain;
1.19514 + var scopeObjects = scope.getScopeObjects();
1.19515 + if (!scopeObjects[scopeObjects.length - 1]) {
1.19516 + if (methodInfo.holder instanceof InstanceInfo) {
1.19517 + scopeObjects[scopeObjects.length - 1] = methodInfo.holder.classInfo;
1.19518 + } else if (methodInfo.holder instanceof ClassInfo) {
1.19519 + scopeObjects[scopeObjects.length - 1] = methodInfo.holder;
1.19520 + }
1.19521 + }
1.19522 + var savedScope = scopeObjects.map(function (object) {
1.19523 + if (object instanceof MethodInfo) {
1.19524 + return Type.from(new ActivationInfo(object));
1.19525 + }
1.19526 + return Type.from(object, domain);
1.19527 + });
1.19528 + new Verification(methodInfo, methodInfo.abc.applicationDomain, savedScope).verify();
1.19529 + methodInfo.verified = true;
1.19530 + Counter.count('Verifier: Methods');
1.19531 + } catch (e) {
1.19532 + if (e instanceof VerifierError) {
1.19533 + return;
1.19534 + }
1.19535 + throw e;
1.19536 + }
1.19537 + };
1.19538 + return verifier;
1.19539 + }();
1.19540 +(function (exports) {
1.19541 + var debug = false;
1.19542 + var IRDefinition = {
1.19543 + Control: {
1.19544 + Region: {
1.19545 + predecessors: {
1.19546 + array: true,
1.19547 + expand: 'control'
1.19548 + },
1.19549 + Start: {
1.19550 + _constructorText: 'this.control = this;',
1.19551 + scope: {
1.19552 + dynamic: true
1.19553 + },
1.19554 + domain: {
1.19555 + dynamic: true
1.19556 + }
1.19557 + }
1.19558 + },
1.19559 + End: {
1.19560 + control: {
1.19561 + assert: 'isControlOrNull'
1.19562 + },
1.19563 + Stop: {
1.19564 + store: {
1.19565 + assert: 'isStore'
1.19566 + },
1.19567 + argument: {
1.19568 + assert: ''
1.19569 + }
1.19570 + },
1.19571 + If: {
1.19572 + predicate: {
1.19573 + assert: ''
1.19574 + }
1.19575 + },
1.19576 + Switch: {
1.19577 + determinant: {
1.19578 + assert: ''
1.19579 + }
1.19580 + },
1.19581 + Jump: {}
1.19582 + }
1.19583 + },
1.19584 + Value: {
1.19585 + StoreDependent: {
1.19586 + control: {
1.19587 + assert: 'isControlOrNull',
1.19588 + nullable: true
1.19589 + },
1.19590 + store: {
1.19591 + assert: 'isStoreOrNull',
1.19592 + nullable: true
1.19593 + },
1.19594 + loads: {
1.19595 + dynamic: true,
1.19596 + nullable: true,
1.19597 + array: true
1.19598 + },
1.19599 + Call: {
1.19600 + callee: {
1.19601 + assert: ''
1.19602 + },
1.19603 + object: {
1.19604 + assert: 'isValueOrNull',
1.19605 + nullable: true
1.19606 + },
1.19607 + args: {
1.19608 + assert: 'isArray',
1.19609 + array: true
1.19610 + },
1.19611 + flags: {
1.19612 + internal: true,
1.19613 + assert: 'isNumber'
1.19614 + }
1.19615 + },
1.19616 + CallProperty: {
1.19617 + object: {
1.19618 + assert: ''
1.19619 + },
1.19620 + name: {
1.19621 + assert: ''
1.19622 + },
1.19623 + args: {
1.19624 + assert: 'isArray',
1.19625 + array: true
1.19626 + },
1.19627 + flags: {
1.19628 + internal: true,
1.19629 + assert: 'isNumber'
1.19630 + },
1.19631 + ASCallProperty: {
1.19632 + isLex: {
1.19633 + assert: '',
1.19634 + internal: true
1.19635 + }
1.19636 + },
1.19637 + ASCallSuper: {
1.19638 + scope: {
1.19639 + assert: ''
1.19640 + }
1.19641 + }
1.19642 + },
1.19643 + New: {
1.19644 + callee: {
1.19645 + assert: ''
1.19646 + },
1.19647 + args: {
1.19648 + assert: '',
1.19649 + array: true
1.19650 + },
1.19651 + ASNew: {}
1.19652 + },
1.19653 + GetProperty: {
1.19654 + object: {
1.19655 + assert: ''
1.19656 + },
1.19657 + name: {
1.19658 + assert: ''
1.19659 + },
1.19660 + ASGetProperty: {
1.19661 + flags: {
1.19662 + internal: true,
1.19663 + assert: 'isNumber'
1.19664 + }
1.19665 + },
1.19666 + ASGetDescendants: {},
1.19667 + ASHasProperty: {},
1.19668 + ASGetSlot: {},
1.19669 + ASGetSuper: {
1.19670 + scope: {
1.19671 + assert: ''
1.19672 + }
1.19673 + }
1.19674 + },
1.19675 + SetProperty: {
1.19676 + object: {
1.19677 + assert: ''
1.19678 + },
1.19679 + name: {
1.19680 + assert: ''
1.19681 + },
1.19682 + value: {
1.19683 + assert: ''
1.19684 + },
1.19685 + ASSetProperty: {
1.19686 + flags: {
1.19687 + internal: true
1.19688 + }
1.19689 + },
1.19690 + ASSetSlot: {},
1.19691 + ASSetSuper: {
1.19692 + scope: {
1.19693 + assert: ''
1.19694 + }
1.19695 + }
1.19696 + },
1.19697 + DeleteProperty: {
1.19698 + object: {
1.19699 + assert: ''
1.19700 + },
1.19701 + name: {
1.19702 + assert: ''
1.19703 + },
1.19704 + ASDeleteProperty: {}
1.19705 + },
1.19706 + ASFindProperty: {
1.19707 + scope: {
1.19708 + assert: ''
1.19709 + },
1.19710 + name: {
1.19711 + assert: ''
1.19712 + },
1.19713 + domain: {
1.19714 + assert: ''
1.19715 + },
1.19716 + strict: {
1.19717 + internal: true
1.19718 + }
1.19719 + }
1.19720 + },
1.19721 + Store: {},
1.19722 + Phi: {
1.19723 + control: {
1.19724 + assert: 'isControl',
1.19725 + nullable: true
1.19726 + },
1.19727 + args: {
1.19728 + array: true,
1.19729 + expand: 'value'
1.19730 + }
1.19731 + },
1.19732 + Variable: {
1.19733 + name: {
1.19734 + internal: true
1.19735 + }
1.19736 + },
1.19737 + Copy: {
1.19738 + argument: {}
1.19739 + },
1.19740 + Move: {
1.19741 + to: {},
1.19742 + from: {}
1.19743 + },
1.19744 + Projection: {
1.19745 + argument: {},
1.19746 + type: {
1.19747 + internal: true
1.19748 + },
1.19749 + selector: {
1.19750 + internal: true,
1.19751 + optional: true
1.19752 + }
1.19753 + },
1.19754 + Latch: {
1.19755 + control: {
1.19756 + assert: 'isControlOrNull',
1.19757 + nullable: true
1.19758 + },
1.19759 + condition: {},
1.19760 + left: {},
1.19761 + right: {}
1.19762 + },
1.19763 + Binary: {
1.19764 + operator: {
1.19765 + internal: true
1.19766 + },
1.19767 + left: {},
1.19768 + right: {}
1.19769 + },
1.19770 + Unary: {
1.19771 + operator: {
1.19772 + internal: true
1.19773 + },
1.19774 + argument: {}
1.19775 + },
1.19776 + Constant: {
1.19777 + value: {
1.19778 + internal: true
1.19779 + }
1.19780 + },
1.19781 + GlobalProperty: {
1.19782 + name: {
1.19783 + internal: true
1.19784 + }
1.19785 + },
1.19786 + This: {
1.19787 + control: {
1.19788 + assert: 'isControl'
1.19789 + }
1.19790 + },
1.19791 + Throw: {
1.19792 + control: {
1.19793 + assert: 'isControl'
1.19794 + },
1.19795 + argument: {}
1.19796 + },
1.19797 + Arguments: {
1.19798 + control: {
1.19799 + assert: 'isControl'
1.19800 + }
1.19801 + },
1.19802 + Parameter: {
1.19803 + control: {
1.19804 + assert: 'isControl'
1.19805 + },
1.19806 + index: {
1.19807 + internal: true
1.19808 + },
1.19809 + name: {
1.19810 + internal: true
1.19811 + }
1.19812 + },
1.19813 + NewArray: {
1.19814 + control: {
1.19815 + assert: 'isControl'
1.19816 + },
1.19817 + elements: {
1.19818 + array: true
1.19819 + }
1.19820 + },
1.19821 + NewObject: {
1.19822 + control: {
1.19823 + assert: 'isControl'
1.19824 + },
1.19825 + properties: {
1.19826 + array: true
1.19827 + }
1.19828 + },
1.19829 + KeyValuePair: {
1.19830 + key: {},
1.19831 + value: {}
1.19832 + },
1.19833 + ASScope: {
1.19834 + parent: {},
1.19835 + object: {},
1.19836 + isWith: {
1.19837 + internal: true
1.19838 + }
1.19839 + },
1.19840 + ASGlobal: {
1.19841 + control: {
1.19842 + assert: 'isControlOrNull',
1.19843 + nullable: true
1.19844 + },
1.19845 + scope: {
1.19846 + assert: 'isScope'
1.19847 + }
1.19848 + },
1.19849 + ASNewActivation: {
1.19850 + methodInfo: {
1.19851 + internal: true
1.19852 + }
1.19853 + },
1.19854 + ASMultiname: {
1.19855 + namespaces: {},
1.19856 + name: {},
1.19857 + flags: {
1.19858 + internal: true
1.19859 + }
1.19860 + }
1.19861 + }
1.19862 + };
1.19863 + function IRGenerator(root) {
1.19864 + var str = '';
1.19865 + function out(s) {
1.19866 + str += s + '\n';
1.19867 + }
1.19868 + var writer = new IndentingWriter(false, out);
1.19869 + function makeProperties(node) {
1.19870 + var result = [];
1.19871 + for (var k in node) {
1.19872 + if (isProperty(k)) {
1.19873 + node[k].name = k;
1.19874 + result.push(node[k]);
1.19875 + }
1.19876 + }
1.19877 + return result;
1.19878 + }
1.19879 + function isProperty(v) {
1.19880 + if (v[0] === '_') {
1.19881 + return false;
1.19882 + }
1.19883 + return v[0].toLowerCase() === v[0];
1.19884 + }
1.19885 + function generate(node, path) {
1.19886 + path = path.concat([
1.19887 + node
1.19888 + ]);
1.19889 + writer.enter('var ' + node._name + ' = (function () {');
1.19890 + var constructorName = node._name[0].toLowerCase() + node._name.slice(1) + 'Node';
1.19891 + if (constructorName.substring(0, 2) === 'aS') {
1.19892 + constructorName = 'as' + constructorName.substring(2);
1.19893 + }
1.19894 + var prototypeName = constructorName + '.prototype';
1.19895 + var properties = path.reduce(function (a, v) {
1.19896 + return a.concat(makeProperties(v));
1.19897 + }, []);
1.19898 + var parameters = properties.filter(function (property) {
1.19899 + return !property.dynamic;
1.19900 + });
1.19901 + var optionalParameters = parameters.filter(function (property) {
1.19902 + return property.optional;
1.19903 + });
1.19904 + var parameterString = parameters.map(function (property) {
1.19905 + if (property.expand) {
1.19906 + return property.expand;
1.19907 + }
1.19908 + return property.name;
1.19909 + }).join(', ');
1.19910 + writer.enter('function ' + constructorName + '(' + parameterString + ') {');
1.19911 + if (true) {
1.19912 + properties.forEach(function (property) {
1.19913 + if (property.assert === '') {
1.19914 + writer.writeLn('release || assert (!(' + property.name + ' == undefined), "' + property.name + '");');
1.19915 + } else if (property.assert) {
1.19916 + writer.writeLn('release || assert (' + property.assert + '(' + property.name + '), "' + property.name + '");');
1.19917 + }
1.19918 + });
1.19919 + writer.writeLn('release || assert (arguments.length >= ' + (parameters.length - optionalParameters.length) + ', "' + node._name + ' not enough args.");');
1.19920 + }
1.19921 + if (node._constructorText) {
1.19922 + writer.writeLn(node._constructorText);
1.19923 + }
1.19924 + properties.forEach(function (property) {
1.19925 + if (property.expand) {
1.19926 + writer.writeLn('this.' + property.name + ' = ' + property.expand + ' ? [' + property.expand + '] : [];');
1.19927 + } else if (property.dynamic) {
1.19928 + writer.writeLn('this.' + property.name + ' = undefined;');
1.19929 + } else {
1.19930 + writer.writeLn('this.' + property.name + ' = ' + property.name + ';');
1.19931 + }
1.19932 + });
1.19933 + writer.writeLn('this.id = nextID[nextID.length - 1] += 1;');
1.19934 + writer.leave('}');
1.19935 + if (path.length > 1) {
1.19936 + writer.writeLn(prototypeName + ' = ' + 'extend(' + path[path.length - 2]._name + ', "' + node._name + '");');
1.19937 + }
1.19938 + writer.writeLn(prototypeName + '.nodeName = "' + node._name + '";');
1.19939 + writer.enter(prototypeName + '.visitInputs = function (visitor) {');
1.19940 + properties.forEach(function (property) {
1.19941 + if (property.internal) {
1.19942 + return;
1.19943 + }
1.19944 + var str = '';
1.19945 + if (property.nullable) {
1.19946 + str += 'this.' + property.name + ' && ';
1.19947 + }
1.19948 + if (property.array) {
1.19949 + str += 'visitArrayInputs(this.' + property.name + ', visitor);';
1.19950 + } else {
1.19951 + str += 'visitor(this.' + property.name + ');';
1.19952 + }
1.19953 + writer.writeLn(str);
1.19954 + });
1.19955 + writer.leave('};');
1.19956 + writer.writeLn('return ' + constructorName + ';');
1.19957 + writer.leave('})();');
1.19958 + writer.writeLn('');
1.19959 + for (var name in node) {
1.19960 + if (name[0] === '_' || isProperty(name)) {
1.19961 + continue;
1.19962 + }
1.19963 + var child = node[name];
1.19964 + child._name = name;
1.19965 + generate(child, path);
1.19966 + }
1.19967 + }
1.19968 + IRDefinition._name = 'Node';
1.19969 + generate(IRDefinition, []);
1.19970 + return str;
1.19971 + }
1.19972 + var nextID = [];
1.19973 + var Node = function () {
1.19974 + function nodeNode() {
1.19975 + true;
1.19976 + this.id = nextID[nextID.length - 1] += 1;
1.19977 + }
1.19978 + nodeNode.prototype.nodeName = 'Node';
1.19979 + nodeNode.prototype.visitInputs = function (visitor) {
1.19980 + };
1.19981 + return nodeNode;
1.19982 + }();
1.19983 + var Control = function () {
1.19984 + function controlNode() {
1.19985 + true;
1.19986 + this.id = nextID[nextID.length - 1] += 1;
1.19987 + }
1.19988 + controlNode.prototype = extend(Node, 'Control');
1.19989 + controlNode.prototype.nodeName = 'Control';
1.19990 + controlNode.prototype.visitInputs = function (visitor) {
1.19991 + };
1.19992 + return controlNode;
1.19993 + }();
1.19994 + var Region = function () {
1.19995 + function regionNode(control) {
1.19996 + true;
1.19997 + this.predecessors = control ? [
1.19998 + control
1.19999 + ] : [];
1.20000 + this.id = nextID[nextID.length - 1] += 1;
1.20001 + }
1.20002 + regionNode.prototype = extend(Control, 'Region');
1.20003 + regionNode.prototype.nodeName = 'Region';
1.20004 + regionNode.prototype.visitInputs = function (visitor) {
1.20005 + visitArrayInputs(this.predecessors, visitor);
1.20006 + };
1.20007 + return regionNode;
1.20008 + }();
1.20009 + var Start = function () {
1.20010 + function startNode(control) {
1.20011 + true;
1.20012 + this.control = this;
1.20013 + this.predecessors = control ? [
1.20014 + control
1.20015 + ] : [];
1.20016 + this.scope = undefined;
1.20017 + this.domain = undefined;
1.20018 + this.id = nextID[nextID.length - 1] += 1;
1.20019 + }
1.20020 + startNode.prototype = extend(Region, 'Start');
1.20021 + startNode.prototype.nodeName = 'Start';
1.20022 + startNode.prototype.visitInputs = function (visitor) {
1.20023 + visitArrayInputs(this.predecessors, visitor);
1.20024 + visitor(this.scope);
1.20025 + visitor(this.domain);
1.20026 + };
1.20027 + return startNode;
1.20028 + }();
1.20029 + var End = function () {
1.20030 + function endNode(control) {
1.20031 + true;
1.20032 + true;
1.20033 + this.control = control;
1.20034 + this.id = nextID[nextID.length - 1] += 1;
1.20035 + }
1.20036 + endNode.prototype = extend(Control, 'End');
1.20037 + endNode.prototype.nodeName = 'End';
1.20038 + endNode.prototype.visitInputs = function (visitor) {
1.20039 + visitor(this.control);
1.20040 + };
1.20041 + return endNode;
1.20042 + }();
1.20043 + var Stop = function () {
1.20044 + function stopNode(control, store, argument) {
1.20045 + true;
1.20046 + true;
1.20047 + true;
1.20048 + true;
1.20049 + this.control = control;
1.20050 + this.store = store;
1.20051 + this.argument = argument;
1.20052 + this.id = nextID[nextID.length - 1] += 1;
1.20053 + }
1.20054 + stopNode.prototype = extend(End, 'Stop');
1.20055 + stopNode.prototype.nodeName = 'Stop';
1.20056 + stopNode.prototype.visitInputs = function (visitor) {
1.20057 + visitor(this.control);
1.20058 + visitor(this.store);
1.20059 + visitor(this.argument);
1.20060 + };
1.20061 + return stopNode;
1.20062 + }();
1.20063 + var If = function () {
1.20064 + function ifNode(control, predicate) {
1.20065 + true;
1.20066 + true;
1.20067 + true;
1.20068 + this.control = control;
1.20069 + this.predicate = predicate;
1.20070 + this.id = nextID[nextID.length - 1] += 1;
1.20071 + }
1.20072 + ifNode.prototype = extend(End, 'If');
1.20073 + ifNode.prototype.nodeName = 'If';
1.20074 + ifNode.prototype.visitInputs = function (visitor) {
1.20075 + visitor(this.control);
1.20076 + visitor(this.predicate);
1.20077 + };
1.20078 + return ifNode;
1.20079 + }();
1.20080 + var Switch = function () {
1.20081 + function switchNode(control, determinant) {
1.20082 + true;
1.20083 + true;
1.20084 + true;
1.20085 + this.control = control;
1.20086 + this.determinant = determinant;
1.20087 + this.id = nextID[nextID.length - 1] += 1;
1.20088 + }
1.20089 + switchNode.prototype = extend(End, 'Switch');
1.20090 + switchNode.prototype.nodeName = 'Switch';
1.20091 + switchNode.prototype.visitInputs = function (visitor) {
1.20092 + visitor(this.control);
1.20093 + visitor(this.determinant);
1.20094 + };
1.20095 + return switchNode;
1.20096 + }();
1.20097 + var Jump = function () {
1.20098 + function jumpNode(control) {
1.20099 + true;
1.20100 + true;
1.20101 + this.control = control;
1.20102 + this.id = nextID[nextID.length - 1] += 1;
1.20103 + }
1.20104 + jumpNode.prototype = extend(End, 'Jump');
1.20105 + jumpNode.prototype.nodeName = 'Jump';
1.20106 + jumpNode.prototype.visitInputs = function (visitor) {
1.20107 + visitor(this.control);
1.20108 + };
1.20109 + return jumpNode;
1.20110 + }();
1.20111 + var Value = function () {
1.20112 + function valueNode() {
1.20113 + true;
1.20114 + this.id = nextID[nextID.length - 1] += 1;
1.20115 + }
1.20116 + valueNode.prototype = extend(Node, 'Value');
1.20117 + valueNode.prototype.nodeName = 'Value';
1.20118 + valueNode.prototype.visitInputs = function (visitor) {
1.20119 + };
1.20120 + return valueNode;
1.20121 + }();
1.20122 + var StoreDependent = function () {
1.20123 + function storeDependentNode(control, store) {
1.20124 + true;
1.20125 + true;
1.20126 + true;
1.20127 + this.control = control;
1.20128 + this.store = store;
1.20129 + this.loads = undefined;
1.20130 + this.id = nextID[nextID.length - 1] += 1;
1.20131 + }
1.20132 + storeDependentNode.prototype = extend(Value, 'StoreDependent');
1.20133 + storeDependentNode.prototype.nodeName = 'StoreDependent';
1.20134 + storeDependentNode.prototype.visitInputs = function (visitor) {
1.20135 + this.control && visitor(this.control);
1.20136 + this.store && visitor(this.store);
1.20137 + this.loads && visitArrayInputs(this.loads, visitor);
1.20138 + };
1.20139 + return storeDependentNode;
1.20140 + }();
1.20141 + var Call = function () {
1.20142 + function callNode(control, store, callee, object, args, flags) {
1.20143 + true;
1.20144 + true;
1.20145 + true;
1.20146 + true;
1.20147 + true;
1.20148 + true;
1.20149 + true;
1.20150 + this.control = control;
1.20151 + this.store = store;
1.20152 + this.loads = undefined;
1.20153 + this.callee = callee;
1.20154 + this.object = object;
1.20155 + this.args = args;
1.20156 + this.flags = flags;
1.20157 + this.id = nextID[nextID.length - 1] += 1;
1.20158 + }
1.20159 + callNode.prototype = extend(StoreDependent, 'Call');
1.20160 + callNode.prototype.nodeName = 'Call';
1.20161 + callNode.prototype.visitInputs = function (visitor) {
1.20162 + this.control && visitor(this.control);
1.20163 + this.store && visitor(this.store);
1.20164 + this.loads && visitArrayInputs(this.loads, visitor);
1.20165 + visitor(this.callee);
1.20166 + this.object && visitor(this.object);
1.20167 + visitArrayInputs(this.args, visitor);
1.20168 + };
1.20169 + return callNode;
1.20170 + }();
1.20171 + var CallProperty = function () {
1.20172 + function callPropertyNode(control, store, object, name, args, flags) {
1.20173 + true;
1.20174 + true;
1.20175 + true;
1.20176 + true;
1.20177 + true;
1.20178 + true;
1.20179 + true;
1.20180 + this.control = control;
1.20181 + this.store = store;
1.20182 + this.loads = undefined;
1.20183 + this.object = object;
1.20184 + this.name = name;
1.20185 + this.args = args;
1.20186 + this.flags = flags;
1.20187 + this.id = nextID[nextID.length - 1] += 1;
1.20188 + }
1.20189 + callPropertyNode.prototype = extend(StoreDependent, 'CallProperty');
1.20190 + callPropertyNode.prototype.nodeName = 'CallProperty';
1.20191 + callPropertyNode.prototype.visitInputs = function (visitor) {
1.20192 + this.control && visitor(this.control);
1.20193 + this.store && visitor(this.store);
1.20194 + this.loads && visitArrayInputs(this.loads, visitor);
1.20195 + visitor(this.object);
1.20196 + visitor(this.name);
1.20197 + visitArrayInputs(this.args, visitor);
1.20198 + };
1.20199 + return callPropertyNode;
1.20200 + }();
1.20201 + var ASCallProperty = function () {
1.20202 + function asCallPropertyNode(control, store, object, name, args, flags, isLex) {
1.20203 + true;
1.20204 + true;
1.20205 + true;
1.20206 + true;
1.20207 + true;
1.20208 + true;
1.20209 + true;
1.20210 + true;
1.20211 + this.control = control;
1.20212 + this.store = store;
1.20213 + this.loads = undefined;
1.20214 + this.object = object;
1.20215 + this.name = name;
1.20216 + this.args = args;
1.20217 + this.flags = flags;
1.20218 + this.isLex = isLex;
1.20219 + this.id = nextID[nextID.length - 1] += 1;
1.20220 + }
1.20221 + asCallPropertyNode.prototype = extend(CallProperty, 'ASCallProperty');
1.20222 + asCallPropertyNode.prototype.nodeName = 'ASCallProperty';
1.20223 + asCallPropertyNode.prototype.visitInputs = function (visitor) {
1.20224 + this.control && visitor(this.control);
1.20225 + this.store && visitor(this.store);
1.20226 + this.loads && visitArrayInputs(this.loads, visitor);
1.20227 + visitor(this.object);
1.20228 + visitor(this.name);
1.20229 + visitArrayInputs(this.args, visitor);
1.20230 + };
1.20231 + return asCallPropertyNode;
1.20232 + }();
1.20233 + var ASCallSuper = function () {
1.20234 + function asCallSuperNode(control, store, object, name, args, flags, scope) {
1.20235 + true;
1.20236 + true;
1.20237 + true;
1.20238 + true;
1.20239 + true;
1.20240 + true;
1.20241 + true;
1.20242 + true;
1.20243 + this.control = control;
1.20244 + this.store = store;
1.20245 + this.loads = undefined;
1.20246 + this.object = object;
1.20247 + this.name = name;
1.20248 + this.args = args;
1.20249 + this.flags = flags;
1.20250 + this.scope = scope;
1.20251 + this.id = nextID[nextID.length - 1] += 1;
1.20252 + }
1.20253 + asCallSuperNode.prototype = extend(CallProperty, 'ASCallSuper');
1.20254 + asCallSuperNode.prototype.nodeName = 'ASCallSuper';
1.20255 + asCallSuperNode.prototype.visitInputs = function (visitor) {
1.20256 + this.control && visitor(this.control);
1.20257 + this.store && visitor(this.store);
1.20258 + this.loads && visitArrayInputs(this.loads, visitor);
1.20259 + visitor(this.object);
1.20260 + visitor(this.name);
1.20261 + visitArrayInputs(this.args, visitor);
1.20262 + visitor(this.scope);
1.20263 + };
1.20264 + return asCallSuperNode;
1.20265 + }();
1.20266 + var New = function () {
1.20267 + function newNode(control, store, callee, args) {
1.20268 + true;
1.20269 + true;
1.20270 + true;
1.20271 + true;
1.20272 + true;
1.20273 + this.control = control;
1.20274 + this.store = store;
1.20275 + this.loads = undefined;
1.20276 + this.callee = callee;
1.20277 + this.args = args;
1.20278 + this.id = nextID[nextID.length - 1] += 1;
1.20279 + }
1.20280 + newNode.prototype = extend(StoreDependent, 'New');
1.20281 + newNode.prototype.nodeName = 'New';
1.20282 + newNode.prototype.visitInputs = function (visitor) {
1.20283 + this.control && visitor(this.control);
1.20284 + this.store && visitor(this.store);
1.20285 + this.loads && visitArrayInputs(this.loads, visitor);
1.20286 + visitor(this.callee);
1.20287 + visitArrayInputs(this.args, visitor);
1.20288 + };
1.20289 + return newNode;
1.20290 + }();
1.20291 + var ASNew = function () {
1.20292 + function asNewNode(control, store, callee, args) {
1.20293 + true;
1.20294 + true;
1.20295 + true;
1.20296 + true;
1.20297 + true;
1.20298 + this.control = control;
1.20299 + this.store = store;
1.20300 + this.loads = undefined;
1.20301 + this.callee = callee;
1.20302 + this.args = args;
1.20303 + this.id = nextID[nextID.length - 1] += 1;
1.20304 + }
1.20305 + asNewNode.prototype = extend(New, 'ASNew');
1.20306 + asNewNode.prototype.nodeName = 'ASNew';
1.20307 + asNewNode.prototype.visitInputs = function (visitor) {
1.20308 + this.control && visitor(this.control);
1.20309 + this.store && visitor(this.store);
1.20310 + this.loads && visitArrayInputs(this.loads, visitor);
1.20311 + visitor(this.callee);
1.20312 + visitArrayInputs(this.args, visitor);
1.20313 + };
1.20314 + return asNewNode;
1.20315 + }();
1.20316 + var GetProperty = function () {
1.20317 + function getPropertyNode(control, store, object, name) {
1.20318 + true;
1.20319 + true;
1.20320 + true;
1.20321 + true;
1.20322 + true;
1.20323 + this.control = control;
1.20324 + this.store = store;
1.20325 + this.loads = undefined;
1.20326 + this.object = object;
1.20327 + this.name = name;
1.20328 + this.id = nextID[nextID.length - 1] += 1;
1.20329 + }
1.20330 + getPropertyNode.prototype = extend(StoreDependent, 'GetProperty');
1.20331 + getPropertyNode.prototype.nodeName = 'GetProperty';
1.20332 + getPropertyNode.prototype.visitInputs = function (visitor) {
1.20333 + this.control && visitor(this.control);
1.20334 + this.store && visitor(this.store);
1.20335 + this.loads && visitArrayInputs(this.loads, visitor);
1.20336 + visitor(this.object);
1.20337 + visitor(this.name);
1.20338 + };
1.20339 + return getPropertyNode;
1.20340 + }();
1.20341 + var ASGetProperty = function () {
1.20342 + function asGetPropertyNode(control, store, object, name, flags) {
1.20343 + true;
1.20344 + true;
1.20345 + true;
1.20346 + true;
1.20347 + true;
1.20348 + true;
1.20349 + this.control = control;
1.20350 + this.store = store;
1.20351 + this.loads = undefined;
1.20352 + this.object = object;
1.20353 + this.name = name;
1.20354 + this.flags = flags;
1.20355 + this.id = nextID[nextID.length - 1] += 1;
1.20356 + }
1.20357 + asGetPropertyNode.prototype = extend(GetProperty, 'ASGetProperty');
1.20358 + asGetPropertyNode.prototype.nodeName = 'ASGetProperty';
1.20359 + asGetPropertyNode.prototype.visitInputs = function (visitor) {
1.20360 + this.control && visitor(this.control);
1.20361 + this.store && visitor(this.store);
1.20362 + this.loads && visitArrayInputs(this.loads, visitor);
1.20363 + visitor(this.object);
1.20364 + visitor(this.name);
1.20365 + };
1.20366 + return asGetPropertyNode;
1.20367 + }();
1.20368 + var ASGetDescendants = function () {
1.20369 + function asGetDescendantsNode(control, store, object, name) {
1.20370 + true;
1.20371 + true;
1.20372 + true;
1.20373 + true;
1.20374 + true;
1.20375 + this.control = control;
1.20376 + this.store = store;
1.20377 + this.loads = undefined;
1.20378 + this.object = object;
1.20379 + this.name = name;
1.20380 + this.id = nextID[nextID.length - 1] += 1;
1.20381 + }
1.20382 + asGetDescendantsNode.prototype = extend(GetProperty, 'ASGetDescendants');
1.20383 + asGetDescendantsNode.prototype.nodeName = 'ASGetDescendants';
1.20384 + asGetDescendantsNode.prototype.visitInputs = function (visitor) {
1.20385 + this.control && visitor(this.control);
1.20386 + this.store && visitor(this.store);
1.20387 + this.loads && visitArrayInputs(this.loads, visitor);
1.20388 + visitor(this.object);
1.20389 + visitor(this.name);
1.20390 + };
1.20391 + return asGetDescendantsNode;
1.20392 + }();
1.20393 + var ASHasProperty = function () {
1.20394 + function asHasPropertyNode(control, store, object, name) {
1.20395 + true;
1.20396 + true;
1.20397 + true;
1.20398 + true;
1.20399 + true;
1.20400 + this.control = control;
1.20401 + this.store = store;
1.20402 + this.loads = undefined;
1.20403 + this.object = object;
1.20404 + this.name = name;
1.20405 + this.id = nextID[nextID.length - 1] += 1;
1.20406 + }
1.20407 + asHasPropertyNode.prototype = extend(GetProperty, 'ASHasProperty');
1.20408 + asHasPropertyNode.prototype.nodeName = 'ASHasProperty';
1.20409 + asHasPropertyNode.prototype.visitInputs = function (visitor) {
1.20410 + this.control && visitor(this.control);
1.20411 + this.store && visitor(this.store);
1.20412 + this.loads && visitArrayInputs(this.loads, visitor);
1.20413 + visitor(this.object);
1.20414 + visitor(this.name);
1.20415 + };
1.20416 + return asHasPropertyNode;
1.20417 + }();
1.20418 + var ASGetSlot = function () {
1.20419 + function asGetSlotNode(control, store, object, name) {
1.20420 + true;
1.20421 + true;
1.20422 + true;
1.20423 + true;
1.20424 + true;
1.20425 + this.control = control;
1.20426 + this.store = store;
1.20427 + this.loads = undefined;
1.20428 + this.object = object;
1.20429 + this.name = name;
1.20430 + this.id = nextID[nextID.length - 1] += 1;
1.20431 + }
1.20432 + asGetSlotNode.prototype = extend(GetProperty, 'ASGetSlot');
1.20433 + asGetSlotNode.prototype.nodeName = 'ASGetSlot';
1.20434 + asGetSlotNode.prototype.visitInputs = function (visitor) {
1.20435 + this.control && visitor(this.control);
1.20436 + this.store && visitor(this.store);
1.20437 + this.loads && visitArrayInputs(this.loads, visitor);
1.20438 + visitor(this.object);
1.20439 + visitor(this.name);
1.20440 + };
1.20441 + return asGetSlotNode;
1.20442 + }();
1.20443 + var ASGetSuper = function () {
1.20444 + function asGetSuperNode(control, store, object, name, scope) {
1.20445 + true;
1.20446 + true;
1.20447 + true;
1.20448 + true;
1.20449 + true;
1.20450 + true;
1.20451 + this.control = control;
1.20452 + this.store = store;
1.20453 + this.loads = undefined;
1.20454 + this.object = object;
1.20455 + this.name = name;
1.20456 + this.scope = scope;
1.20457 + this.id = nextID[nextID.length - 1] += 1;
1.20458 + }
1.20459 + asGetSuperNode.prototype = extend(GetProperty, 'ASGetSuper');
1.20460 + asGetSuperNode.prototype.nodeName = 'ASGetSuper';
1.20461 + asGetSuperNode.prototype.visitInputs = function (visitor) {
1.20462 + this.control && visitor(this.control);
1.20463 + this.store && visitor(this.store);
1.20464 + this.loads && visitArrayInputs(this.loads, visitor);
1.20465 + visitor(this.object);
1.20466 + visitor(this.name);
1.20467 + visitor(this.scope);
1.20468 + };
1.20469 + return asGetSuperNode;
1.20470 + }();
1.20471 + var SetProperty = function () {
1.20472 + function setPropertyNode(control, store, object, name, value) {
1.20473 + true;
1.20474 + true;
1.20475 + true;
1.20476 + true;
1.20477 + true;
1.20478 + true;
1.20479 + this.control = control;
1.20480 + this.store = store;
1.20481 + this.loads = undefined;
1.20482 + this.object = object;
1.20483 + this.name = name;
1.20484 + this.value = value;
1.20485 + this.id = nextID[nextID.length - 1] += 1;
1.20486 + }
1.20487 + setPropertyNode.prototype = extend(StoreDependent, 'SetProperty');
1.20488 + setPropertyNode.prototype.nodeName = 'SetProperty';
1.20489 + setPropertyNode.prototype.visitInputs = function (visitor) {
1.20490 + this.control && visitor(this.control);
1.20491 + this.store && visitor(this.store);
1.20492 + this.loads && visitArrayInputs(this.loads, visitor);
1.20493 + visitor(this.object);
1.20494 + visitor(this.name);
1.20495 + visitor(this.value);
1.20496 + };
1.20497 + return setPropertyNode;
1.20498 + }();
1.20499 + var ASSetProperty = function () {
1.20500 + function asSetPropertyNode(control, store, object, name, value, flags) {
1.20501 + true;
1.20502 + true;
1.20503 + true;
1.20504 + true;
1.20505 + true;
1.20506 + true;
1.20507 + this.control = control;
1.20508 + this.store = store;
1.20509 + this.loads = undefined;
1.20510 + this.object = object;
1.20511 + this.name = name;
1.20512 + this.value = value;
1.20513 + this.flags = flags;
1.20514 + this.id = nextID[nextID.length - 1] += 1;
1.20515 + }
1.20516 + asSetPropertyNode.prototype = extend(SetProperty, 'ASSetProperty');
1.20517 + asSetPropertyNode.prototype.nodeName = 'ASSetProperty';
1.20518 + asSetPropertyNode.prototype.visitInputs = function (visitor) {
1.20519 + this.control && visitor(this.control);
1.20520 + this.store && visitor(this.store);
1.20521 + this.loads && visitArrayInputs(this.loads, visitor);
1.20522 + visitor(this.object);
1.20523 + visitor(this.name);
1.20524 + visitor(this.value);
1.20525 + };
1.20526 + return asSetPropertyNode;
1.20527 + }();
1.20528 + var ASSetSlot = function () {
1.20529 + function asSetSlotNode(control, store, object, name, value) {
1.20530 + true;
1.20531 + true;
1.20532 + true;
1.20533 + true;
1.20534 + true;
1.20535 + true;
1.20536 + this.control = control;
1.20537 + this.store = store;
1.20538 + this.loads = undefined;
1.20539 + this.object = object;
1.20540 + this.name = name;
1.20541 + this.value = value;
1.20542 + this.id = nextID[nextID.length - 1] += 1;
1.20543 + }
1.20544 + asSetSlotNode.prototype = extend(SetProperty, 'ASSetSlot');
1.20545 + asSetSlotNode.prototype.nodeName = 'ASSetSlot';
1.20546 + asSetSlotNode.prototype.visitInputs = function (visitor) {
1.20547 + this.control && visitor(this.control);
1.20548 + this.store && visitor(this.store);
1.20549 + this.loads && visitArrayInputs(this.loads, visitor);
1.20550 + visitor(this.object);
1.20551 + visitor(this.name);
1.20552 + visitor(this.value);
1.20553 + };
1.20554 + return asSetSlotNode;
1.20555 + }();
1.20556 + var ASSetSuper = function () {
1.20557 + function asSetSuperNode(control, store, object, name, value, scope) {
1.20558 + true;
1.20559 + true;
1.20560 + true;
1.20561 + true;
1.20562 + true;
1.20563 + true;
1.20564 + true;
1.20565 + this.control = control;
1.20566 + this.store = store;
1.20567 + this.loads = undefined;
1.20568 + this.object = object;
1.20569 + this.name = name;
1.20570 + this.value = value;
1.20571 + this.scope = scope;
1.20572 + this.id = nextID[nextID.length - 1] += 1;
1.20573 + }
1.20574 + asSetSuperNode.prototype = extend(SetProperty, 'ASSetSuper');
1.20575 + asSetSuperNode.prototype.nodeName = 'ASSetSuper';
1.20576 + asSetSuperNode.prototype.visitInputs = function (visitor) {
1.20577 + this.control && visitor(this.control);
1.20578 + this.store && visitor(this.store);
1.20579 + this.loads && visitArrayInputs(this.loads, visitor);
1.20580 + visitor(this.object);
1.20581 + visitor(this.name);
1.20582 + visitor(this.value);
1.20583 + visitor(this.scope);
1.20584 + };
1.20585 + return asSetSuperNode;
1.20586 + }();
1.20587 + var DeleteProperty = function () {
1.20588 + function deletePropertyNode(control, store, object, name) {
1.20589 + true;
1.20590 + true;
1.20591 + true;
1.20592 + true;
1.20593 + true;
1.20594 + this.control = control;
1.20595 + this.store = store;
1.20596 + this.loads = undefined;
1.20597 + this.object = object;
1.20598 + this.name = name;
1.20599 + this.id = nextID[nextID.length - 1] += 1;
1.20600 + }
1.20601 + deletePropertyNode.prototype = extend(StoreDependent, 'DeleteProperty');
1.20602 + deletePropertyNode.prototype.nodeName = 'DeleteProperty';
1.20603 + deletePropertyNode.prototype.visitInputs = function (visitor) {
1.20604 + this.control && visitor(this.control);
1.20605 + this.store && visitor(this.store);
1.20606 + this.loads && visitArrayInputs(this.loads, visitor);
1.20607 + visitor(this.object);
1.20608 + visitor(this.name);
1.20609 + };
1.20610 + return deletePropertyNode;
1.20611 + }();
1.20612 + var ASDeleteProperty = function () {
1.20613 + function asDeletePropertyNode(control, store, object, name) {
1.20614 + true;
1.20615 + true;
1.20616 + true;
1.20617 + true;
1.20618 + true;
1.20619 + this.control = control;
1.20620 + this.store = store;
1.20621 + this.loads = undefined;
1.20622 + this.object = object;
1.20623 + this.name = name;
1.20624 + this.id = nextID[nextID.length - 1] += 1;
1.20625 + }
1.20626 + asDeletePropertyNode.prototype = extend(DeleteProperty, 'ASDeleteProperty');
1.20627 + asDeletePropertyNode.prototype.nodeName = 'ASDeleteProperty';
1.20628 + asDeletePropertyNode.prototype.visitInputs = function (visitor) {
1.20629 + this.control && visitor(this.control);
1.20630 + this.store && visitor(this.store);
1.20631 + this.loads && visitArrayInputs(this.loads, visitor);
1.20632 + visitor(this.object);
1.20633 + visitor(this.name);
1.20634 + };
1.20635 + return asDeletePropertyNode;
1.20636 + }();
1.20637 + var ASFindProperty = function () {
1.20638 + function asFindPropertyNode(control, store, scope, name, domain, strict) {
1.20639 + true;
1.20640 + true;
1.20641 + true;
1.20642 + true;
1.20643 + true;
1.20644 + true;
1.20645 + this.control = control;
1.20646 + this.store = store;
1.20647 + this.loads = undefined;
1.20648 + this.scope = scope;
1.20649 + this.name = name;
1.20650 + this.domain = domain;
1.20651 + this.strict = strict;
1.20652 + this.id = nextID[nextID.length - 1] += 1;
1.20653 + }
1.20654 + asFindPropertyNode.prototype = extend(StoreDependent, 'ASFindProperty');
1.20655 + asFindPropertyNode.prototype.nodeName = 'ASFindProperty';
1.20656 + asFindPropertyNode.prototype.visitInputs = function (visitor) {
1.20657 + this.control && visitor(this.control);
1.20658 + this.store && visitor(this.store);
1.20659 + this.loads && visitArrayInputs(this.loads, visitor);
1.20660 + visitor(this.scope);
1.20661 + visitor(this.name);
1.20662 + visitor(this.domain);
1.20663 + };
1.20664 + return asFindPropertyNode;
1.20665 + }();
1.20666 + var Store = function () {
1.20667 + function storeNode() {
1.20668 + true;
1.20669 + this.id = nextID[nextID.length - 1] += 1;
1.20670 + }
1.20671 + storeNode.prototype = extend(Value, 'Store');
1.20672 + storeNode.prototype.nodeName = 'Store';
1.20673 + storeNode.prototype.visitInputs = function (visitor) {
1.20674 + };
1.20675 + return storeNode;
1.20676 + }();
1.20677 + var Phi = function () {
1.20678 + function phiNode(control, value) {
1.20679 + true;
1.20680 + true;
1.20681 + this.control = control;
1.20682 + this.args = value ? [
1.20683 + value
1.20684 + ] : [];
1.20685 + this.id = nextID[nextID.length - 1] += 1;
1.20686 + }
1.20687 + phiNode.prototype = extend(Value, 'Phi');
1.20688 + phiNode.prototype.nodeName = 'Phi';
1.20689 + phiNode.prototype.visitInputs = function (visitor) {
1.20690 + this.control && visitor(this.control);
1.20691 + visitArrayInputs(this.args, visitor);
1.20692 + };
1.20693 + return phiNode;
1.20694 + }();
1.20695 + var Variable = function () {
1.20696 + function variableNode(name) {
1.20697 + true;
1.20698 + this.name = name;
1.20699 + this.id = nextID[nextID.length - 1] += 1;
1.20700 + }
1.20701 + variableNode.prototype = extend(Value, 'Variable');
1.20702 + variableNode.prototype.nodeName = 'Variable';
1.20703 + variableNode.prototype.visitInputs = function (visitor) {
1.20704 + };
1.20705 + return variableNode;
1.20706 + }();
1.20707 + var Copy = function () {
1.20708 + function copyNode(argument) {
1.20709 + true;
1.20710 + this.argument = argument;
1.20711 + this.id = nextID[nextID.length - 1] += 1;
1.20712 + }
1.20713 + copyNode.prototype = extend(Value, 'Copy');
1.20714 + copyNode.prototype.nodeName = 'Copy';
1.20715 + copyNode.prototype.visitInputs = function (visitor) {
1.20716 + visitor(this.argument);
1.20717 + };
1.20718 + return copyNode;
1.20719 + }();
1.20720 + var Move = function () {
1.20721 + function moveNode(to, from) {
1.20722 + true;
1.20723 + this.to = to;
1.20724 + this.from = from;
1.20725 + this.id = nextID[nextID.length - 1] += 1;
1.20726 + }
1.20727 + moveNode.prototype = extend(Value, 'Move');
1.20728 + moveNode.prototype.nodeName = 'Move';
1.20729 + moveNode.prototype.visitInputs = function (visitor) {
1.20730 + visitor(this.to);
1.20731 + visitor(this.from);
1.20732 + };
1.20733 + return moveNode;
1.20734 + }();
1.20735 + var Projection = function () {
1.20736 + function projectionNode(argument, type, selector) {
1.20737 + true;
1.20738 + this.argument = argument;
1.20739 + this.type = type;
1.20740 + this.selector = selector;
1.20741 + this.id = nextID[nextID.length - 1] += 1;
1.20742 + }
1.20743 + projectionNode.prototype = extend(Value, 'Projection');
1.20744 + projectionNode.prototype.nodeName = 'Projection';
1.20745 + projectionNode.prototype.visitInputs = function (visitor) {
1.20746 + visitor(this.argument);
1.20747 + };
1.20748 + return projectionNode;
1.20749 + }();
1.20750 + var Latch = function () {
1.20751 + function latchNode(control, condition, left, right) {
1.20752 + true;
1.20753 + true;
1.20754 + this.control = control;
1.20755 + this.condition = condition;
1.20756 + this.left = left;
1.20757 + this.right = right;
1.20758 + this.id = nextID[nextID.length - 1] += 1;
1.20759 + }
1.20760 + latchNode.prototype = extend(Value, 'Latch');
1.20761 + latchNode.prototype.nodeName = 'Latch';
1.20762 + latchNode.prototype.visitInputs = function (visitor) {
1.20763 + this.control && visitor(this.control);
1.20764 + visitor(this.condition);
1.20765 + visitor(this.left);
1.20766 + visitor(this.right);
1.20767 + };
1.20768 + return latchNode;
1.20769 + }();
1.20770 + var Binary = function () {
1.20771 + function binaryNode(operator, left, right) {
1.20772 + true;
1.20773 + this.operator = operator;
1.20774 + this.left = left;
1.20775 + this.right = right;
1.20776 + this.id = nextID[nextID.length - 1] += 1;
1.20777 + }
1.20778 + binaryNode.prototype = extend(Value, 'Binary');
1.20779 + binaryNode.prototype.nodeName = 'Binary';
1.20780 + binaryNode.prototype.visitInputs = function (visitor) {
1.20781 + visitor(this.left);
1.20782 + visitor(this.right);
1.20783 + };
1.20784 + return binaryNode;
1.20785 + }();
1.20786 + var Unary = function () {
1.20787 + function unaryNode(operator, argument) {
1.20788 + true;
1.20789 + this.operator = operator;
1.20790 + this.argument = argument;
1.20791 + this.id = nextID[nextID.length - 1] += 1;
1.20792 + }
1.20793 + unaryNode.prototype = extend(Value, 'Unary');
1.20794 + unaryNode.prototype.nodeName = 'Unary';
1.20795 + unaryNode.prototype.visitInputs = function (visitor) {
1.20796 + visitor(this.argument);
1.20797 + };
1.20798 + return unaryNode;
1.20799 + }();
1.20800 + var Constant = function () {
1.20801 + function constantNode(value) {
1.20802 + true;
1.20803 + this.value = value;
1.20804 + this.id = nextID[nextID.length - 1] += 1;
1.20805 + }
1.20806 + constantNode.prototype = extend(Value, 'Constant');
1.20807 + constantNode.prototype.nodeName = 'Constant';
1.20808 + constantNode.prototype.visitInputs = function (visitor) {
1.20809 + };
1.20810 + return constantNode;
1.20811 + }();
1.20812 + var GlobalProperty = function () {
1.20813 + function globalPropertyNode(name) {
1.20814 + true;
1.20815 + this.name = name;
1.20816 + this.id = nextID[nextID.length - 1] += 1;
1.20817 + }
1.20818 + globalPropertyNode.prototype = extend(Value, 'GlobalProperty');
1.20819 + globalPropertyNode.prototype.nodeName = 'GlobalProperty';
1.20820 + globalPropertyNode.prototype.visitInputs = function (visitor) {
1.20821 + };
1.20822 + return globalPropertyNode;
1.20823 + }();
1.20824 + var This = function () {
1.20825 + function thisNode(control) {
1.20826 + true;
1.20827 + true;
1.20828 + this.control = control;
1.20829 + this.id = nextID[nextID.length - 1] += 1;
1.20830 + }
1.20831 + thisNode.prototype = extend(Value, 'This');
1.20832 + thisNode.prototype.nodeName = 'This';
1.20833 + thisNode.prototype.visitInputs = function (visitor) {
1.20834 + visitor(this.control);
1.20835 + };
1.20836 + return thisNode;
1.20837 + }();
1.20838 + var Throw = function () {
1.20839 + function throwNode(control, argument) {
1.20840 + true;
1.20841 + true;
1.20842 + this.control = control;
1.20843 + this.argument = argument;
1.20844 + this.id = nextID[nextID.length - 1] += 1;
1.20845 + }
1.20846 + throwNode.prototype = extend(Value, 'Throw');
1.20847 + throwNode.prototype.nodeName = 'Throw';
1.20848 + throwNode.prototype.visitInputs = function (visitor) {
1.20849 + visitor(this.control);
1.20850 + visitor(this.argument);
1.20851 + };
1.20852 + return throwNode;
1.20853 + }();
1.20854 + var Arguments = function () {
1.20855 + function argumentsNode(control) {
1.20856 + true;
1.20857 + true;
1.20858 + this.control = control;
1.20859 + this.id = nextID[nextID.length - 1] += 1;
1.20860 + }
1.20861 + argumentsNode.prototype = extend(Value, 'Arguments');
1.20862 + argumentsNode.prototype.nodeName = 'Arguments';
1.20863 + argumentsNode.prototype.visitInputs = function (visitor) {
1.20864 + visitor(this.control);
1.20865 + };
1.20866 + return argumentsNode;
1.20867 + }();
1.20868 + var Parameter = function () {
1.20869 + function parameterNode(control, index, name) {
1.20870 + true;
1.20871 + true;
1.20872 + this.control = control;
1.20873 + this.index = index;
1.20874 + this.name = name;
1.20875 + this.id = nextID[nextID.length - 1] += 1;
1.20876 + }
1.20877 + parameterNode.prototype = extend(Value, 'Parameter');
1.20878 + parameterNode.prototype.nodeName = 'Parameter';
1.20879 + parameterNode.prototype.visitInputs = function (visitor) {
1.20880 + visitor(this.control);
1.20881 + };
1.20882 + return parameterNode;
1.20883 + }();
1.20884 + var NewArray = function () {
1.20885 + function newArrayNode(control, elements) {
1.20886 + true;
1.20887 + true;
1.20888 + this.control = control;
1.20889 + this.elements = elements;
1.20890 + this.id = nextID[nextID.length - 1] += 1;
1.20891 + }
1.20892 + newArrayNode.prototype = extend(Value, 'NewArray');
1.20893 + newArrayNode.prototype.nodeName = 'NewArray';
1.20894 + newArrayNode.prototype.visitInputs = function (visitor) {
1.20895 + visitor(this.control);
1.20896 + visitArrayInputs(this.elements, visitor);
1.20897 + };
1.20898 + return newArrayNode;
1.20899 + }();
1.20900 + var NewObject = function () {
1.20901 + function newObjectNode(control, properties) {
1.20902 + true;
1.20903 + true;
1.20904 + this.control = control;
1.20905 + this.properties = properties;
1.20906 + this.id = nextID[nextID.length - 1] += 1;
1.20907 + }
1.20908 + newObjectNode.prototype = extend(Value, 'NewObject');
1.20909 + newObjectNode.prototype.nodeName = 'NewObject';
1.20910 + newObjectNode.prototype.visitInputs = function (visitor) {
1.20911 + visitor(this.control);
1.20912 + visitArrayInputs(this.properties, visitor);
1.20913 + };
1.20914 + return newObjectNode;
1.20915 + }();
1.20916 + var KeyValuePair = function () {
1.20917 + function keyValuePairNode(key, value) {
1.20918 + true;
1.20919 + this.key = key;
1.20920 + this.value = value;
1.20921 + this.id = nextID[nextID.length - 1] += 1;
1.20922 + }
1.20923 + keyValuePairNode.prototype = extend(Value, 'KeyValuePair');
1.20924 + keyValuePairNode.prototype.nodeName = 'KeyValuePair';
1.20925 + keyValuePairNode.prototype.visitInputs = function (visitor) {
1.20926 + visitor(this.key);
1.20927 + visitor(this.value);
1.20928 + };
1.20929 + return keyValuePairNode;
1.20930 + }();
1.20931 + var ASScope = function () {
1.20932 + function asScopeNode(parent, object, isWith) {
1.20933 + true;
1.20934 + this.parent = parent;
1.20935 + this.object = object;
1.20936 + this.isWith = isWith;
1.20937 + this.id = nextID[nextID.length - 1] += 1;
1.20938 + }
1.20939 + asScopeNode.prototype = extend(Value, 'ASScope');
1.20940 + asScopeNode.prototype.nodeName = 'ASScope';
1.20941 + asScopeNode.prototype.visitInputs = function (visitor) {
1.20942 + visitor(this.parent);
1.20943 + visitor(this.object);
1.20944 + };
1.20945 + return asScopeNode;
1.20946 + }();
1.20947 + var ASGlobal = function () {
1.20948 + function asGlobalNode(control, scope) {
1.20949 + true;
1.20950 + true;
1.20951 + true;
1.20952 + this.control = control;
1.20953 + this.scope = scope;
1.20954 + this.id = nextID[nextID.length - 1] += 1;
1.20955 + }
1.20956 + asGlobalNode.prototype = extend(Value, 'ASGlobal');
1.20957 + asGlobalNode.prototype.nodeName = 'ASGlobal';
1.20958 + asGlobalNode.prototype.visitInputs = function (visitor) {
1.20959 + this.control && visitor(this.control);
1.20960 + visitor(this.scope);
1.20961 + };
1.20962 + return asGlobalNode;
1.20963 + }();
1.20964 + var ASNewActivation = function () {
1.20965 + function asNewActivationNode(methodInfo) {
1.20966 + true;
1.20967 + this.methodInfo = methodInfo;
1.20968 + this.id = nextID[nextID.length - 1] += 1;
1.20969 + }
1.20970 + asNewActivationNode.prototype = extend(Value, 'ASNewActivation');
1.20971 + asNewActivationNode.prototype.nodeName = 'ASNewActivation';
1.20972 + asNewActivationNode.prototype.visitInputs = function (visitor) {
1.20973 + };
1.20974 + return asNewActivationNode;
1.20975 + }();
1.20976 + var ASMultiname = function () {
1.20977 + function asMultinameNode(namespaces, name, flags) {
1.20978 + true;
1.20979 + this.namespaces = namespaces;
1.20980 + this.name = name;
1.20981 + this.flags = flags;
1.20982 + this.id = nextID[nextID.length - 1] += 1;
1.20983 + }
1.20984 + asMultinameNode.prototype = extend(Value, 'ASMultiname');
1.20985 + asMultinameNode.prototype.nodeName = 'ASMultiname';
1.20986 + asMultinameNode.prototype.visitInputs = function (visitor) {
1.20987 + visitor(this.namespaces);
1.20988 + visitor(this.name);
1.20989 + };
1.20990 + return asMultinameNode;
1.20991 + }();
1.20992 + function node() {
1.20993 + this.id = nextID[nextID.length - 1] += 1;
1.20994 + }
1.20995 + Node.startNumbering = function () {
1.20996 + nextID.push(0);
1.20997 + };
1.20998 + Node.stopNumbering = function () {
1.20999 + nextID.pop();
1.21000 + };
1.21001 + Node.prototype.toString = function (brief) {
1.21002 + if (brief) {
1.21003 + return nameOf(this);
1.21004 + }
1.21005 + var inputs = [];
1.21006 + this.visitInputs(function (input) {
1.21007 + inputs.push(nameOf(input));
1.21008 + });
1.21009 + var str = nameOf(this) + ' = ' + this.nodeName.toUpperCase();
1.21010 + if (this.toStringDetails) {
1.21011 + str += ' ' + this.toStringDetails();
1.21012 + }
1.21013 + if (inputs.length) {
1.21014 + str += ' ' + inputs.join(', ');
1.21015 + }
1.21016 + return str;
1.21017 + };
1.21018 + Node.prototype.visitInputsNoConstants = function visitInputs(visitor) {
1.21019 + this.visitInputs(function (node) {
1.21020 + if (isConstant(node)) {
1.21021 + return;
1.21022 + }
1.21023 + visitor(node);
1.21024 + });
1.21025 + };
1.21026 + Node.prototype.replaceInput = function (oldInput, newInput) {
1.21027 + var count = 0;
1.21028 + for (var k in this) {
1.21029 + var v = this[k];
1.21030 + if (v instanceof Node) {
1.21031 + if (v === oldInput) {
1.21032 + this[k] = newInput;
1.21033 + count++;
1.21034 + }
1.21035 + }
1.21036 + if (v instanceof Array) {
1.21037 + count += v.replace(oldInput, newInput);
1.21038 + }
1.21039 + }
1.21040 + return count;
1.21041 + };
1.21042 + Projection.Type = {
1.21043 + CASE: 'case',
1.21044 + TRUE: 'true',
1.21045 + FALSE: 'false',
1.21046 + STORE: 'store',
1.21047 + SCOPE: 'scope'
1.21048 + };
1.21049 + Projection.prototype.project = function () {
1.21050 + return this.argument;
1.21051 + };
1.21052 + Phi.prototype.seal = function seal() {
1.21053 + this.sealed = true;
1.21054 + };
1.21055 + Phi.prototype.pushValue = function pushValue(x) {
1.21056 + true;
1.21057 + true;
1.21058 + this.args.push(x);
1.21059 + };
1.21060 + KeyValuePair.prototype.mustFloat = true;
1.21061 + ASMultiname.prototype.mustFloat = true;
1.21062 + ASMultiname.prototype.isAttribute = function () {
1.21063 + return this.flags & 1;
1.21064 + };
1.21065 + var Flags = {
1.21066 + INDEXED: 1,
1.21067 + RESOLVED: 2,
1.21068 + PRISTINE: 4,
1.21069 + IS_METHOD: 8
1.21070 + };
1.21071 + var Operator = function () {
1.21072 + var map = {};
1.21073 + function operator(name, evaluate, binary) {
1.21074 + this.name = name;
1.21075 + this.binary = binary;
1.21076 + this.evaluate = evaluate;
1.21077 + map[name] = this;
1.21078 + }
1.21079 + operator.ADD = new operator('+', function (l, r) {
1.21080 + return l + r;
1.21081 + }, true);
1.21082 + operator.SUB = new operator('-', function (l, r) {
1.21083 + return l - r;
1.21084 + }, true);
1.21085 + operator.MUL = new operator('*', function (l, r) {
1.21086 + return l * r;
1.21087 + }, true);
1.21088 + operator.DIV = new operator('/', function (l, r) {
1.21089 + return l / r;
1.21090 + }, true);
1.21091 + operator.MOD = new operator('%', function (l, r) {
1.21092 + return l % r;
1.21093 + }, true);
1.21094 + operator.AND = new operator('&', function (l, r) {
1.21095 + return l & r;
1.21096 + }, true);
1.21097 + operator.OR = new operator('|', function (l, r) {
1.21098 + return l | r;
1.21099 + }, true);
1.21100 + operator.XOR = new operator('^', function (l, r) {
1.21101 + return l ^ r;
1.21102 + }, true);
1.21103 + operator.LSH = new operator('<<', function (l, r) {
1.21104 + return l << r;
1.21105 + }, true);
1.21106 + operator.RSH = new operator('>>', function (l, r) {
1.21107 + return l >> r;
1.21108 + }, true);
1.21109 + operator.URSH = new operator('>>>', function (l, r) {
1.21110 + return l >>> r;
1.21111 + }, true);
1.21112 + operator.SEQ = new operator('===', function (l, r) {
1.21113 + return l === r;
1.21114 + }, true);
1.21115 + operator.SNE = new operator('!==', function (l, r) {
1.21116 + return l !== r;
1.21117 + }, true);
1.21118 + operator.EQ = new operator('==', function (l, r) {
1.21119 + return l == r;
1.21120 + }, true);
1.21121 + operator.NE = new operator('!=', function (l, r) {
1.21122 + return l != r;
1.21123 + }, true);
1.21124 + operator.LE = new operator('<=', function (l, r) {
1.21125 + return l <= r;
1.21126 + }, true);
1.21127 + operator.GT = new operator('>', function (l, r) {
1.21128 + return l > r;
1.21129 + }, true);
1.21130 + operator.LT = new operator('<', function (l, r) {
1.21131 + return l < r;
1.21132 + }, true);
1.21133 + operator.GE = new operator('>=', function (l, r) {
1.21134 + return l >= r;
1.21135 + }, true);
1.21136 + operator.BITWISE_NOT = new operator('~', function (a) {
1.21137 + return ~a;
1.21138 + }, false);
1.21139 + operator.PLUS = new operator('+', function (a) {
1.21140 + return +a;
1.21141 + }, false);
1.21142 + operator.NEG = new operator('-', function (a) {
1.21143 + return -a;
1.21144 + }, false);
1.21145 + operator.TYPE_OF = new operator('typeof', function (a) {
1.21146 + return typeof a;
1.21147 + }, false);
1.21148 + operator.TRUE = new operator('!!', function (a) {
1.21149 + return !(!a);
1.21150 + }, false);
1.21151 + operator.FALSE = new operator('!', function (a) {
1.21152 + return !a;
1.21153 + }, false);
1.21154 + operator.AS_ADD = new operator('+', function (l, r) {
1.21155 + if (typeof l === 'string' || typeof r === 'string') {
1.21156 + return String(l) + String(r);
1.21157 + }
1.21158 + return l + r;
1.21159 + }, true);
1.21160 + function linkOpposites(a, b) {
1.21161 + a.not = b;
1.21162 + b.not = a;
1.21163 + }
1.21164 + linkOpposites(operator.SEQ, operator.SNE);
1.21165 + linkOpposites(operator.EQ, operator.NE);
1.21166 + linkOpposites(operator.TRUE, operator.FALSE);
1.21167 + operator.fromName = function fromName(name) {
1.21168 + return map[name];
1.21169 + };
1.21170 + operator.prototype.isBinary = function isBinary() {
1.21171 + return this.binary;
1.21172 + };
1.21173 + operator.prototype.toString = function toString() {
1.21174 + return this.name;
1.21175 + };
1.21176 + return operator;
1.21177 + }();
1.21178 + function extend(c, name) {
1.21179 + true;
1.21180 + return Object.create(c.prototype, {
1.21181 + nodeName: {
1.21182 + value: name
1.21183 + }
1.21184 + });
1.21185 + }
1.21186 + function nameOf(o) {
1.21187 + var useColors = false;
1.21188 + var result;
1.21189 + if (o instanceof Constant) {
1.21190 + if (o.value instanceof Multiname) {
1.21191 + return o.value.name;
1.21192 + }
1.21193 + return o.value;
1.21194 + } else if (o instanceof Variable) {
1.21195 + return o.name;
1.21196 + } else if (o instanceof Phi) {
1.21197 + return result = '|' + o.id + '|', useColors ? PURPLE + result + ENDC : result;
1.21198 + } else if (o instanceof Control) {
1.21199 + return result = '{' + o.id + '}', useColors ? RED + result + ENDC : result;
1.21200 + } else if (o instanceof Projection) {
1.21201 + if (o.type === Projection.Type.STORE) {
1.21202 + return result = '[' + o.id + '->' + o.argument.id + ']', useColors ? YELLOW + result + ENDC : result;
1.21203 + }
1.21204 + return result = '(' + o.id + ')', useColors ? GREEN + result + ENDC : result;
1.21205 + } else if (o instanceof Value) {
1.21206 + return result = '(' + o.id + ')', useColors ? GREEN + result + ENDC : result;
1.21207 + } else if (o instanceof Node) {
1.21208 + return o.id;
1.21209 + }
1.21210 + unexpected(o + ' ' + typeof o);
1.21211 + }
1.21212 + function toID(node) {
1.21213 + return node.id;
1.21214 + }
1.21215 + function visitArrayInputs(array, visitor) {
1.21216 + for (var i = 0; i < array.length; i++) {
1.21217 + visitor(array[i]);
1.21218 + }
1.21219 + }
1.21220 + function visitNothing() {
1.21221 + }
1.21222 + function isNotPhi(phi) {
1.21223 + return !isPhi(phi);
1.21224 + }
1.21225 + function isPhi(phi) {
1.21226 + return phi instanceof Phi;
1.21227 + }
1.21228 + function isScope(scope) {
1.21229 + return isPhi(scope) || scope instanceof ASScope || isProjection(scope, Projection.Type.SCOPE);
1.21230 + }
1.21231 + function isMultinameConstant(node) {
1.21232 + return node instanceof Constant && node.value instanceof Multiname;
1.21233 + }
1.21234 + function isMultiname(name) {
1.21235 + return isMultinameConstant(name) || name instanceof ASMultiname;
1.21236 + }
1.21237 + function isStore(store) {
1.21238 + return isPhi(store) || store instanceof Store || isProjection(store, Projection.Type.STORE);
1.21239 + }
1.21240 + function isConstant(constant) {
1.21241 + return constant instanceof Constant;
1.21242 + }
1.21243 + function isBoolean(boolean) {
1.21244 + return boolean === true || boolean === false;
1.21245 + }
1.21246 + function isInteger(integer) {
1.21247 + return integer | 0 === integer;
1.21248 + }
1.21249 + function isArray(array) {
1.21250 + return array instanceof Array;
1.21251 + }
1.21252 + function isControlOrNull(control) {
1.21253 + return isControl(control) || control === null;
1.21254 + }
1.21255 + function isStoreOrNull(store) {
1.21256 + return isStore(store) || store === null;
1.21257 + }
1.21258 + function isControl(control) {
1.21259 + return control instanceof Control;
1.21260 + }
1.21261 + function isValueOrNull(value) {
1.21262 + return isValue(value) || value === null;
1.21263 + }
1.21264 + function isValue(value) {
1.21265 + return value instanceof Value;
1.21266 + }
1.21267 + function isProjection(node, type) {
1.21268 + return node instanceof Projection && (!type || node.type === type);
1.21269 + }
1.21270 + var Null = new Constant(null);
1.21271 + var Undefined = new Constant(undefined);
1.21272 + Undefined.toString = function () {
1.21273 + return '_';
1.21274 + };
1.21275 + var Block = function () {
1.21276 + function block(id, start, end) {
1.21277 + if (start) {
1.21278 + true;
1.21279 + }
1.21280 + this.region = start;
1.21281 + this.id = id;
1.21282 + this.successors = [];
1.21283 + this.predecessors = [];
1.21284 + this.nodes = [
1.21285 + start,
1.21286 + end
1.21287 + ];
1.21288 + }
1.21289 + block.prototype.pushSuccessorAt = function pushSuccessor(successor, index, pushPredecessor) {
1.21290 + true;
1.21291 + true;
1.21292 + this.successors[index] = successor;
1.21293 + if (pushPredecessor) {
1.21294 + successor.pushPredecessor(this);
1.21295 + }
1.21296 + };
1.21297 + block.prototype.pushSuccessor = function pushSuccessor(successor, pushPredecessor) {
1.21298 + true;
1.21299 + this.successors.push(successor);
1.21300 + if (pushPredecessor) {
1.21301 + successor.pushPredecessor(this);
1.21302 + }
1.21303 + };
1.21304 + block.prototype.pushPredecessor = function pushPredecessor(predecessor) {
1.21305 + true;
1.21306 + this.predecessors.push(predecessor);
1.21307 + };
1.21308 + block.prototype.visitNodes = function (fn) {
1.21309 + var nodes = this.nodes;
1.21310 + for (var i = 0, j = nodes.length; i < j; i++) {
1.21311 + fn(nodes[i]);
1.21312 + }
1.21313 + };
1.21314 + block.prototype.visitSuccessors = function (fn) {
1.21315 + var successors = this.successors;
1.21316 + for (var i = 0, j = successors.length; i < j; i++) {
1.21317 + fn(successors[i]);
1.21318 + }
1.21319 + };
1.21320 + block.prototype.visitPredecessors = function (fn) {
1.21321 + var predecessors = this.predecessors;
1.21322 + for (var i = 0, j = predecessors.length; i < j; i++) {
1.21323 + fn(predecessors[i]);
1.21324 + }
1.21325 + };
1.21326 + block.prototype.append = function (node) {
1.21327 + true;
1.21328 + true;
1.21329 + true;
1.21330 + true;
1.21331 + if (node.mustFloat) {
1.21332 + return;
1.21333 + }
1.21334 + this.nodes.splice(this.nodes.length - 1, 0, node);
1.21335 + };
1.21336 + block.prototype.toString = function () {
1.21337 + return 'B' + this.id + (this.name ? ' (' + this.name + ')' : '');
1.21338 + };
1.21339 + block.prototype.trace = function (writer) {
1.21340 + writer.writeLn(this);
1.21341 + };
1.21342 + return block;
1.21343 + }();
1.21344 + var DFG = function () {
1.21345 + function constructor(exit) {
1.21346 + this.exit = exit;
1.21347 + }
1.21348 + constructor.prototype.buildCFG = function () {
1.21349 + return CFG.fromDFG(this);
1.21350 + };
1.21351 + function preOrderDepthFirstSearch(root, visitChildren, pre) {
1.21352 + var visited = [];
1.21353 + var worklist = [
1.21354 + root
1.21355 + ];
1.21356 + var push = worklist.push.bind(worklist);
1.21357 + var node;
1.21358 + while (node = worklist.pop()) {
1.21359 + if (visited[node.id] === 1) {
1.21360 + continue;
1.21361 + }
1.21362 + visited[node.id] = 1;
1.21363 + pre(node);
1.21364 + worklist.push(node);
1.21365 + visitChildren(node, push);
1.21366 + }
1.21367 + }
1.21368 + function postOrderDepthFirstSearch(root, visitChildren, post) {
1.21369 + var ONE_TIME = 1, MANY_TIMES = 2;
1.21370 + var visited = [];
1.21371 + var worklist = [
1.21372 + root
1.21373 + ];
1.21374 + function visitChild(child) {
1.21375 + if (!visited[child.id]) {
1.21376 + worklist.push(child);
1.21377 + }
1.21378 + }
1.21379 + var node;
1.21380 + while (node = worklist.top()) {
1.21381 + if (visited[node.id]) {
1.21382 + if (visited[node.id] === ONE_TIME) {
1.21383 + visited[node.id] = MANY_TIMES;
1.21384 + post(node);
1.21385 + }
1.21386 + worklist.pop();
1.21387 + continue;
1.21388 + }
1.21389 + visited[node.id] = ONE_TIME;
1.21390 + visitChildren(node, visitChild);
1.21391 + }
1.21392 + }
1.21393 + constructor.prototype.forEachInPreOrderDepthFirstSearch = function forEachInPreOrderDepthFirstSearch(visitor) {
1.21394 + var visited = new Array(1024);
1.21395 + var worklist = [
1.21396 + this.exit
1.21397 + ];
1.21398 + function push(node) {
1.21399 + if (isConstant(node)) {
1.21400 + return;
1.21401 + }
1.21402 + true;
1.21403 + worklist.push(node);
1.21404 + }
1.21405 + var node;
1.21406 + while (node = worklist.pop()) {
1.21407 + if (visited[node.id]) {
1.21408 + continue;
1.21409 + }
1.21410 + visited[node.id] = 1;
1.21411 + visitor && visitor(node);
1.21412 + worklist.push(node);
1.21413 + node.visitInputs(push);
1.21414 + }
1.21415 + };
1.21416 + constructor.prototype.forEach = function forEach(visitor, postOrder) {
1.21417 + var search = postOrder ? postOrderDepthFirstSearch : preOrderDepthFirstSearch;
1.21418 + search(this.exit, function (node, v) {
1.21419 + node.visitInputsNoConstants(v);
1.21420 + }, visitor);
1.21421 + };
1.21422 + constructor.prototype.traceMetrics = function (writer) {
1.21423 + var counter = new metrics.Counter(true);
1.21424 + preOrderDepthFirstSearch(this.exit, function (node, visitor) {
1.21425 + node.visitInputsNoConstants(visitor);
1.21426 + }, function (node) {
1.21427 + counter.count(node.nodeName);
1.21428 + });
1.21429 + counter.trace(writer);
1.21430 + };
1.21431 + constructor.prototype.trace = function (writer) {
1.21432 + var nodes = [];
1.21433 + var visited = {};
1.21434 + function colorOf(node) {
1.21435 + if (node instanceof Control) {
1.21436 + return 'yellow';
1.21437 + } else if (node instanceof Phi) {
1.21438 + return 'purple';
1.21439 + } else if (node instanceof Value) {
1.21440 + return 'green';
1.21441 + }
1.21442 + return 'white';
1.21443 + }
1.21444 + var blocks = [];
1.21445 + function followProjection(node) {
1.21446 + return node instanceof Projection ? node.project() : node;
1.21447 + }
1.21448 + function next(node) {
1.21449 + node = followProjection(node);
1.21450 + if (!visited[node.id]) {
1.21451 + visited[node.id] = true;
1.21452 + if (node.block) {
1.21453 + blocks.push(node.block);
1.21454 + }
1.21455 + nodes.push(node);
1.21456 + node.visitInputsNoConstants(next);
1.21457 + }
1.21458 + }
1.21459 + next(this.exit);
1.21460 + writer.writeLn('');
1.21461 + writer.enter('digraph DFG {');
1.21462 + writer.writeLn('graph [bgcolor = gray10];');
1.21463 + writer.writeLn('edge [color = white];');
1.21464 + writer.writeLn('node [shape = box, fontname = Consolas, fontsize = 11, color = white, fontcolor = white];');
1.21465 + writer.writeLn('rankdir = BT;');
1.21466 + function writeNode(node) {
1.21467 + writer.writeLn('N' + node.id + ' [label = "' + node.toString() + '", color = "' + colorOf(node) + '"];');
1.21468 + }
1.21469 + function defineNode(node) {
1.21470 + writer.writeLn('N' + node.id + ';');
1.21471 + }
1.21472 + blocks.forEach(function (block) {
1.21473 + writer.enter('subgraph cluster' + block.nodes[0].id + ' { bgcolor = gray20;');
1.21474 + block.visitNodes(function (node) {
1.21475 + defineNode(followProjection(node));
1.21476 + });
1.21477 + writer.leave('}');
1.21478 + });
1.21479 + nodes.forEach(writeNode);
1.21480 + nodes.forEach(function (node) {
1.21481 + node.visitInputsNoConstants(function (input) {
1.21482 + input = followProjection(input);
1.21483 + writer.writeLn('N' + node.id + ' -> ' + 'N' + input.id + ' [color=' + colorOf(input) + '];');
1.21484 + });
1.21485 + });
1.21486 + writer.leave('}');
1.21487 + writer.writeLn('');
1.21488 + };
1.21489 + return constructor;
1.21490 + }();
1.21491 + var CFG = function () {
1.21492 + function constructor() {
1.21493 + this.nextBlockID = 0;
1.21494 + this.blocks = [];
1.21495 + this.exit;
1.21496 + this.root;
1.21497 + }
1.21498 + constructor.fromDFG = function fromDFG(dfg) {
1.21499 + var cfg = new CFG();
1.21500 + true;
1.21501 + cfg.dfg = dfg;
1.21502 + var visited = [];
1.21503 + function buildEnd(end) {
1.21504 + if (end instanceof Projection) {
1.21505 + end = end.project();
1.21506 + }
1.21507 + true;
1.21508 + if (visited[end.id]) {
1.21509 + return;
1.21510 + }
1.21511 + visited[end.id] = true;
1.21512 + var start = end.control;
1.21513 + if (!(start instanceof Region)) {
1.21514 + start = end.control = new Region(start);
1.21515 + }
1.21516 + var block = start.block = cfg.buildBlock(start, end);
1.21517 + if (start instanceof Start) {
1.21518 + cfg.root = block;
1.21519 + }
1.21520 + for (var i = 0; i < start.predecessors.length; i++) {
1.21521 + var c = start.predecessors[i];
1.21522 + var d;
1.21523 + var trueProjection = false;
1.21524 + if (c instanceof Projection) {
1.21525 + d = c.project();
1.21526 + trueProjection = c.type === Projection.Type.TRUE;
1.21527 + } else {
1.21528 + d = c;
1.21529 + }
1.21530 + if (d instanceof Region) {
1.21531 + d = new Jump(c);
1.21532 + d = new Projection(d, Projection.Type.TRUE);
1.21533 + start.predecessors[i] = d;
1.21534 + d = d.project();
1.21535 + trueProjection = true;
1.21536 + }
1.21537 + buildEnd(d);
1.21538 + var controlBlock = d.control.block;
1.21539 + if (d instanceof Switch) {
1.21540 + true;
1.21541 + controlBlock.pushSuccessorAt(block, c.selector.value, true);
1.21542 + } else if (trueProjection && controlBlock.successors.length > 0) {
1.21543 + controlBlock.pushSuccessor(block, true);
1.21544 + controlBlock.hasFlippedSuccessors = true;
1.21545 + } else {
1.21546 + controlBlock.pushSuccessor(block, true);
1.21547 + }
1.21548 + }
1.21549 + }
1.21550 + buildEnd(dfg.exit);
1.21551 + cfg.splitCriticalEdges();
1.21552 + cfg.exit = dfg.exit.control.block;
1.21553 + cfg.computeDominators(true);
1.21554 + return cfg;
1.21555 + };
1.21556 + constructor.prototype.buildRootAndExit = function buildRootAndExit() {
1.21557 + true;
1.21558 + if (this.blocks[0].predecessors.length > 0) {
1.21559 + this.root = new Block(this.nextBlockID++);
1.21560 + this.blocks.push(this.root);
1.21561 + this.root.pushSuccessor(this.blocks[0], true);
1.21562 + } else {
1.21563 + this.root = this.blocks[0];
1.21564 + }
1.21565 + var exitBlocks = [];
1.21566 + for (var i = 0; i < this.blocks.length; i++) {
1.21567 + var block = this.blocks[i];
1.21568 + if (block.successors.length === 0) {
1.21569 + exitBlocks.push(block);
1.21570 + }
1.21571 + }
1.21572 + if (exitBlocks.length === 0) {
1.21573 + unexpected('Must have an exit block.');
1.21574 + } else if (exitBlocks.length === 1 && exitBlocks[0] !== this.root) {
1.21575 + this.exit = exitBlocks[0];
1.21576 + } else {
1.21577 + this.exit = new Block(this.nextBlockID++);
1.21578 + this.blocks.push(this.exit);
1.21579 + for (var i = 0; i < exitBlocks.length; i++) {
1.21580 + exitBlocks[i].pushSuccessor(this.exit, true);
1.21581 + }
1.21582 + }
1.21583 + true;
1.21584 + true;
1.21585 + };
1.21586 + constructor.prototype.fromString = function (list, rootName) {
1.21587 + var cfg = this;
1.21588 + var names = cfg.blockNames || (cfg.blockNames = {});
1.21589 + var blocks = cfg.blocks;
1.21590 + var sets = list.replace(/\ /g, '').split(',');
1.21591 + sets.forEach(function (set) {
1.21592 + var edgeList = set.split('->');
1.21593 + var last = null;
1.21594 + for (var i = 0; i < edgeList.length; i++) {
1.21595 + var next = edgeList[i];
1.21596 + if (last) {
1.21597 + buildEdge(last, next);
1.21598 + } else {
1.21599 + buildBlock(next);
1.21600 + }
1.21601 + last = next;
1.21602 + }
1.21603 + });
1.21604 + function buildBlock(name) {
1.21605 + var block = names[name];
1.21606 + if (block) {
1.21607 + return block;
1.21608 + }
1.21609 + names[name] = block = new Block(cfg.nextBlockID++);
1.21610 + block.name = name;
1.21611 + blocks.push(block);
1.21612 + return block;
1.21613 + }
1.21614 + function buildEdge(from, to) {
1.21615 + buildBlock(from).pushSuccessor(buildBlock(to), true);
1.21616 + }
1.21617 + true;
1.21618 + this.root = names[rootName];
1.21619 + };
1.21620 + constructor.prototype.buildBlock = function (start, end) {
1.21621 + var block = new Block(this.nextBlockID++, start, end);
1.21622 + this.blocks.push(block);
1.21623 + return block;
1.21624 + };
1.21625 + constructor.prototype.createBlockSet = function () {
1.21626 + if (!this.setConstructor) {
1.21627 + this.setConstructor = BitSetFunctor(this.blocks.length);
1.21628 + }
1.21629 + return new this.setConstructor();
1.21630 + };
1.21631 + constructor.prototype.computeReversePostOrder = function computeReversePostOrder() {
1.21632 + if (this.order) {
1.21633 + return this.order;
1.21634 + }
1.21635 + var order = this.order = [];
1.21636 + this.depthFirstSearch(null, order.push.bind(order));
1.21637 + order.reverse();
1.21638 + for (var i = 0; i < order.length; i++) {
1.21639 + order[i].rpo = i;
1.21640 + }
1.21641 + return order;
1.21642 + };
1.21643 + constructor.prototype.depthFirstSearch = function depthFirstSearch(preFn, postFn) {
1.21644 + var visited = this.createBlockSet();
1.21645 + function visit(node) {
1.21646 + visited.set(node.id);
1.21647 + if (preFn)
1.21648 + preFn(node);
1.21649 + var successors = node.successors;
1.21650 + for (var i = 0, j = successors.length; i < j; i++) {
1.21651 + var s = successors[i];
1.21652 + if (!visited.get(s.id)) {
1.21653 + visit(s);
1.21654 + }
1.21655 + }
1.21656 + if (postFn)
1.21657 + postFn(node);
1.21658 + }
1.21659 + visit(this.root);
1.21660 + };
1.21661 + constructor.prototype.computeDominators = function (apply) {
1.21662 + true;
1.21663 + var dom = new Int32Array(this.blocks.length);
1.21664 + for (var i = 0; i < dom.length; i++) {
1.21665 + dom[i] = -1;
1.21666 + }
1.21667 + var map = this.createBlockSet();
1.21668 + function computeCommonDominator(a, b) {
1.21669 + map.clearAll();
1.21670 + while (a >= 0) {
1.21671 + map.set(a);
1.21672 + a = dom[a];
1.21673 + }
1.21674 + while (b >= 0 && !map.get(b)) {
1.21675 + b = dom[b];
1.21676 + }
1.21677 + return b;
1.21678 + }
1.21679 + function computeDominator(blockID, parentID) {
1.21680 + if (dom[blockID] < 0) {
1.21681 + dom[blockID] = parentID;
1.21682 + } else {
1.21683 + dom[blockID] = computeCommonDominator(dom[blockID], parentID);
1.21684 + }
1.21685 + }
1.21686 + this.depthFirstSearch(function visit(block) {
1.21687 + var s = block.successors;
1.21688 + for (var i = 0, j = s.length; i < j; i++) {
1.21689 + computeDominator(s[i].id, block.id);
1.21690 + }
1.21691 + });
1.21692 + if (apply) {
1.21693 + for (var i = 0, j = this.blocks.length; i < j; i++) {
1.21694 + this.blocks[i].dominator = this.blocks[dom[i]];
1.21695 + }
1.21696 + function computeDominatorDepth(block) {
1.21697 + var dominatorDepth;
1.21698 + if (block.dominatorDepth !== undefined) {
1.21699 + return block.dominatorDepth;
1.21700 + } else if (!block.dominator) {
1.21701 + dominatorDepth = 0;
1.21702 + } else {
1.21703 + dominatorDepth = computeDominatorDepth(block.dominator) + 1;
1.21704 + }
1.21705 + return block.dominatorDepth = dominatorDepth;
1.21706 + }
1.21707 + for (var i = 0, j = this.blocks.length; i < j; i++) {
1.21708 + computeDominatorDepth(this.blocks[i]);
1.21709 + }
1.21710 + }
1.21711 + return dom;
1.21712 + };
1.21713 + constructor.prototype.computeLoops = function computeLoops() {
1.21714 + var active = this.createBlockSet();
1.21715 + var visited = this.createBlockSet();
1.21716 + var nextLoop = 0;
1.21717 + function makeLoopHeader(block) {
1.21718 + if (!block.isLoopHeader) {
1.21719 + block.isLoopHeader = true;
1.21720 + block.loops = 1 << nextLoop;
1.21721 + nextLoop += 1;
1.21722 + }
1.21723 + }
1.21724 + function visit(block) {
1.21725 + if (visited.get(block.id)) {
1.21726 + if (active.get(block.id)) {
1.21727 + makeLoopHeader(block);
1.21728 + }
1.21729 + return block.loops;
1.21730 + }
1.21731 + visited.set(block.id);
1.21732 + active.set(block.id);
1.21733 + var loops = 0;
1.21734 + for (var i = 0, j = block.successors.length; i < j; i++) {
1.21735 + loops |= visit(block.successors[i]);
1.21736 + }
1.21737 + if (block.isLoopHeader) {
1.21738 + loops &= ~block.loops;
1.21739 + }
1.21740 + block.loops = loops;
1.21741 + active.clear(block.id);
1.21742 + return loops;
1.21743 + }
1.21744 + var loop = visit(this.root);
1.21745 + };
1.21746 + function followProjection(node) {
1.21747 + return node instanceof Projection ? node.project() : node;
1.21748 + }
1.21749 + var Uses = function () {
1.21750 + function constructor() {
1.21751 + this.entries = [];
1.21752 + }
1.21753 + constructor.prototype.addUse = function addUse(def, use) {
1.21754 + var entry = this.entries[def.id];
1.21755 + if (!entry) {
1.21756 + entry = this.entries[def.id] = {
1.21757 + def: def,
1.21758 + uses: []
1.21759 + };
1.21760 + }
1.21761 + entry.uses.pushUnique(use);
1.21762 + };
1.21763 + constructor.prototype.trace = function (writer) {
1.21764 + writer.enter('> Uses');
1.21765 + this.entries.forEach(function (entry) {
1.21766 + writer.writeLn(entry.def.id + ' -> [' + entry.uses.map(toID).join(', ') + '] ' + entry.def);
1.21767 + });
1.21768 + writer.leave('<');
1.21769 + };
1.21770 + constructor.prototype.replace = function (def, value) {
1.21771 + var entry = this.entries[def.id];
1.21772 + if (entry.uses.length === 0) {
1.21773 + return false;
1.21774 + }
1.21775 + var count = 0;
1.21776 + entry.uses.forEach(function (use) {
1.21777 + count += use.replaceInput(def, value);
1.21778 + });
1.21779 + true;
1.21780 + entry.uses = [];
1.21781 + return true;
1.21782 + };
1.21783 + function updateUses(def, value) {
1.21784 + debug && writer.writeLn('Update ' + def + ' with ' + value);
1.21785 + var entry = useEntries[def.id];
1.21786 + if (entry.uses.length === 0) {
1.21787 + return false;
1.21788 + }
1.21789 + debug && writer.writeLn('Replacing: ' + def.id + ' in [' + entry.uses.map(toID).join(', ') + '] with ' + value.id);
1.21790 + var count = 0;
1.21791 + entry.uses.forEach(function (use) {
1.21792 + count += use.replaceInput(def, value);
1.21793 + });
1.21794 + true;
1.21795 + entry.uses = [];
1.21796 + return true;
1.21797 + }
1.21798 + return constructor;
1.21799 + }();
1.21800 + constructor.prototype.computeUses = function computeUses() {
1.21801 + Timer.start('computeUses');
1.21802 + var writer = debug && new IndentingWriter();
1.21803 + debug && writer.enter('> Compute Uses');
1.21804 + var dfg = this.dfg;
1.21805 + var uses = new Uses();
1.21806 + dfg.forEachInPreOrderDepthFirstSearch(function (use) {
1.21807 + use.visitInputs(function (def) {
1.21808 + uses.addUse(def, use);
1.21809 + });
1.21810 + });
1.21811 + if (debug) {
1.21812 + writer.enter('> Uses');
1.21813 + uses.entries.forEach(function (entry) {
1.21814 + writer.writeLn(entry.def.id + ' -> [' + entry.uses.map(toID).join(', ') + '] ' + entry.def);
1.21815 + });
1.21816 + writer.leave('<');
1.21817 + writer.leave('<');
1.21818 + }
1.21819 + Timer.stop();
1.21820 + return uses;
1.21821 + };
1.21822 + constructor.prototype.verify = function verify() {
1.21823 + var writer = debug && new IndentingWriter();
1.21824 + debug && writer.enter('> Verify');
1.21825 + var order = this.computeReversePostOrder();
1.21826 + order.forEach(function (block) {
1.21827 + if (block.phis) {
1.21828 + block.phis.forEach(function (phi) {
1.21829 + true;
1.21830 + true;
1.21831 + });
1.21832 + }
1.21833 + });
1.21834 + debug && writer.leave('<');
1.21835 + };
1.21836 + constructor.prototype.optimizePhis = function optimizePhis() {
1.21837 + var writer = debug && new IndentingWriter();
1.21838 + debug && writer.enter('> Optimize Phis');
1.21839 + var phis = [];
1.21840 + var useEntries = this.computeUses().entries;
1.21841 + useEntries.forEach(function (entry) {
1.21842 + if (isPhi(entry.def)) {
1.21843 + phis.push(entry.def);
1.21844 + }
1.21845 + });
1.21846 + debug && writer.writeLn('Trying to optimize ' + phis.length + ' phis.');
1.21847 + function updateUses(def, value) {
1.21848 + debug && writer.writeLn('Update ' + def + ' with ' + value);
1.21849 + var entry = useEntries[def.id];
1.21850 + if (entry.uses.length === 0) {
1.21851 + return false;
1.21852 + }
1.21853 + debug && writer.writeLn('Replacing: ' + def.id + ' in [' + entry.uses.map(toID).join(', ') + '] with ' + value.id);
1.21854 + var count = 0;
1.21855 + var entryUses = entry.uses;
1.21856 + for (var i = 0, j = entryUses.length; i < j; i++) {
1.21857 + count += entryUses[i].replaceInput(def, value);
1.21858 + }
1.21859 + true;
1.21860 + entry.uses = [];
1.21861 + return true;
1.21862 + }
1.21863 + function simplify(phi, args) {
1.21864 + args = args.unique();
1.21865 + if (args.length === 1) {
1.21866 + return args[0];
1.21867 + } else {
1.21868 + if (args.length === 2) {
1.21869 + if (args[0] === phi) {
1.21870 + return args[1];
1.21871 + } else if (args[1] === phi) {
1.21872 + return args[0];
1.21873 + }
1.21874 + return phi;
1.21875 + }
1.21876 + }
1.21877 + return phi;
1.21878 + }
1.21879 + var count = 0;
1.21880 + var iterations = 0;
1.21881 + var changed = true;
1.21882 + while (changed) {
1.21883 + iterations++;
1.21884 + changed = false;
1.21885 + phis.forEach(function (phi) {
1.21886 + var value = simplify(phi, phi.args);
1.21887 + if (value !== phi) {
1.21888 + if (updateUses(phi, value)) {
1.21889 + changed = true;
1.21890 + count++;
1.21891 + }
1.21892 + }
1.21893 + });
1.21894 + }
1.21895 + if (debug) {
1.21896 + writer.writeLn('Simplified ' + count + ' phis, in ' + iterations + ' iterations.');
1.21897 + writer.leave('<');
1.21898 + }
1.21899 + };
1.21900 + constructor.prototype.splitCriticalEdges = function splitCriticalEdges() {
1.21901 + var writer = debug && new IndentingWriter();
1.21902 + var blocks = this.blocks;
1.21903 + var criticalEdges = [];
1.21904 + debug && writer.enter('> Splitting Critical Edges');
1.21905 + for (var i = 0; i < blocks.length; i++) {
1.21906 + var successors = blocks[i].successors;
1.21907 + if (successors.length > 1) {
1.21908 + for (var j = 0; j < successors.length; j++) {
1.21909 + if (successors[j].predecessors.length > 1) {
1.21910 + criticalEdges.push({
1.21911 + from: blocks[i],
1.21912 + to: successors[j]
1.21913 + });
1.21914 + }
1.21915 + }
1.21916 + }
1.21917 + }
1.21918 + var criticalEdgeCount = criticalEdges.length;
1.21919 + if (criticalEdgeCount && debug) {
1.21920 + writer.writeLn('Splitting: ' + criticalEdgeCount);
1.21921 + this.trace(writer);
1.21922 + }
1.21923 + var edge;
1.21924 + while (edge = criticalEdges.pop()) {
1.21925 + var fromIndex = edge.from.successors.indexOf(edge.to);
1.21926 + var toIndex = edge.to.predecessors.indexOf(edge.from);
1.21927 + true;
1.21928 + debug && writer.writeLn('Splitting critical edge: ' + edge.from + ' -> ' + edge.to);
1.21929 + var toBlock = edge.to;
1.21930 + var toRegion = toBlock.region;
1.21931 + var control = toRegion.predecessors[toIndex];
1.21932 + var region = new Region(control);
1.21933 + var jump = new Jump(region);
1.21934 + var block = this.buildBlock(region, jump);
1.21935 + toRegion.predecessors[toIndex] = new Projection(jump, Projection.Type.TRUE);
1.21936 + var fromBlock = edge.from;
1.21937 + fromBlock.successors[fromIndex] = block;
1.21938 + block.pushPredecessor(fromBlock);
1.21939 + block.pushSuccessor(toBlock);
1.21940 + toBlock.predecessors[toIndex] = block;
1.21941 + }
1.21942 + if (criticalEdgeCount && debug) {
1.21943 + this.trace(writer);
1.21944 + }
1.21945 + if (criticalEdgeCount && !true) {
1.21946 + true;
1.21947 + }
1.21948 + debug && writer.leave('<');
1.21949 + return criticalEdgeCount;
1.21950 + };
1.21951 + constructor.prototype.allocateVariables = function allocateVariables() {
1.21952 + var writer = debug && new IndentingWriter();
1.21953 + debug && writer.enter('> Allocating Virtual Registers');
1.21954 + var order = this.computeReversePostOrder();
1.21955 + function allocate(node) {
1.21956 + if (isProjection(node, Projection.Type.STORE)) {
1.21957 + return;
1.21958 + }
1.21959 + if (node instanceof SetProperty) {
1.21960 + return;
1.21961 + }
1.21962 + if (node instanceof Value) {
1.21963 + node.variable = new Variable('v' + node.id);
1.21964 + debug && writer.writeLn('Allocated: ' + node.variable + ' to ' + node);
1.21965 + }
1.21966 + }
1.21967 + order.forEach(function (block) {
1.21968 + block.nodes.forEach(allocate);
1.21969 + if (block.phis) {
1.21970 + block.phis.forEach(allocate);
1.21971 + }
1.21972 + });
1.21973 + var blockMoves = [];
1.21974 + for (var i = 0; i < order.length; i++) {
1.21975 + var block = order[i];
1.21976 + var phis = block.phis;
1.21977 + var predecessors = block.predecessors;
1.21978 + if (phis) {
1.21979 + for (var j = 0; j < phis.length; j++) {
1.21980 + var phi = phis[j];
1.21981 + debug && writer.writeLn('Emitting moves for: ' + phi);
1.21982 + var arguments = phi.args;
1.21983 + true;
1.21984 + for (var k = 0; k < predecessors.length; k++) {
1.21985 + var predecessor = predecessors[k];
1.21986 + var argument = arguments[k];
1.21987 + if (argument.abstract || isProjection(argument, Projection.Type.STORE)) {
1.21988 + continue;
1.21989 + }
1.21990 + var moves = blockMoves[predecessor.id] || (blockMoves[predecessor.id] = []);
1.21991 + argument = argument.variable || argument;
1.21992 + if (phi.variable !== argument) {
1.21993 + moves.push(new Move(phi.variable, argument));
1.21994 + }
1.21995 + }
1.21996 + }
1.21997 + }
1.21998 + }
1.21999 + var blocks = this.blocks;
1.22000 + blockMoves.forEach(function (moves, blockID) {
1.22001 + var block = blocks[blockID];
1.22002 + var temporary = 0;
1.22003 + debug && writer.writeLn(block + ' Moves: ' + moves);
1.22004 + while (moves.length) {
1.22005 + for (var i = 0; i < moves.length; i++) {
1.22006 + var move = moves[i];
1.22007 + for (var j = 0; j < moves.length; j++) {
1.22008 + if (i === j) {
1.22009 + continue;
1.22010 + }
1.22011 + if (moves[j].from === move.to) {
1.22012 + move = null;
1.22013 + break;
1.22014 + }
1.22015 + }
1.22016 + if (move) {
1.22017 + moves.splice(i--, 1);
1.22018 + block.append(move);
1.22019 + }
1.22020 + }
1.22021 + if (moves.length) {
1.22022 + debug && writer.writeLn('Breaking Cycle');
1.22023 + var move = moves[0];
1.22024 + var temp = new Variable('t' + temporary++);
1.22025 + blocks[blockID].append(new Move(temp, move.to));
1.22026 + for (var i = 1; i < moves.length; i++) {
1.22027 + if (moves[i].from === move.to) {
1.22028 + moves[i].from = temp;
1.22029 + }
1.22030 + }
1.22031 + }
1.22032 + }
1.22033 + });
1.22034 + debug && writer.leave('<');
1.22035 + };
1.22036 + constructor.prototype.scheduleEarly = function scheduleEarly() {
1.22037 + var debugScheduler = false;
1.22038 + var writer = debugScheduler && new IndentingWriter();
1.22039 + debugScheduler && writer.enter('> Schedule Early');
1.22040 + var cfg = this;
1.22041 + var dfg = this.dfg;
1.22042 + var scheduled = [];
1.22043 + var roots = [];
1.22044 + dfg.forEachInPreOrderDepthFirstSearch(function (node) {
1.22045 + if (node instanceof Region || node instanceof Jump) {
1.22046 + return;
1.22047 + }
1.22048 + if (node.control) {
1.22049 + roots.push(node);
1.22050 + }
1.22051 + if (isPhi(node)) {
1.22052 + node.args.forEach(function (input) {
1.22053 + if (shouldFloat(input)) {
1.22054 + input.mustNotFloat = true;
1.22055 + }
1.22056 + });
1.22057 + }
1.22058 + }, true);
1.22059 + if (debugScheduler) {
1.22060 + roots.forEach(function (node) {
1.22061 + print('Root: ' + node);
1.22062 + });
1.22063 + }
1.22064 + for (var i = 0; i < roots.length; i++) {
1.22065 + var root = roots[i];
1.22066 + if (root instanceof Phi) {
1.22067 + var block = root.control.block;
1.22068 + (block.phis || (block.phis = [])).push(root);
1.22069 + }
1.22070 + if (root.control) {
1.22071 + schedule(root);
1.22072 + }
1.22073 + }
1.22074 + function isScheduled(node) {
1.22075 + return scheduled[node.id];
1.22076 + }
1.22077 + function shouldFloat(node) {
1.22078 + if (node.mustNotFloat || node.shouldNotFloat) {
1.22079 + return false;
1.22080 + }
1.22081 + if (node.mustFloat || node.shouldFloat) {
1.22082 + return true;
1.22083 + }
1.22084 + if (node instanceof Parameter || node instanceof This || node instanceof Arguments) {
1.22085 + return true;
1.22086 + }
1.22087 + return node instanceof Binary || node instanceof Unary || node instanceof Parameter;
1.22088 + }
1.22089 + function append(node) {
1.22090 + true;
1.22091 + scheduled[node.id] = true;
1.22092 + true;
1.22093 + if (shouldFloat(node)) {
1.22094 + } else {
1.22095 + node.control.block.append(node);
1.22096 + }
1.22097 + }
1.22098 + function scheduleIn(node, region) {
1.22099 + true;
1.22100 + true;
1.22101 + true;
1.22102 + debugScheduler && writer.writeLn('Scheduled: ' + node + ' in ' + region);
1.22103 + node.control = region;
1.22104 + append(node);
1.22105 + }
1.22106 + function schedule(node) {
1.22107 + debugScheduler && writer.enter('> Schedule: ' + node);
1.22108 + var inputs = [];
1.22109 + node.visitInputs(function (input) {
1.22110 + if (isConstant(input)) {
1.22111 + {
1.22112 + return;
1.22113 + }
1.22114 + }
1.22115 + if (isValue(input)) {
1.22116 + inputs.push(followProjection(input));
1.22117 + }
1.22118 + });
1.22119 + debugScheduler && writer.writeLn('Inputs: [' + inputs.map(toID) + '], length: ' + inputs.length);
1.22120 + for (var i = 0; i < inputs.length; i++) {
1.22121 + var input = inputs[i];
1.22122 + if (isNotPhi(input) && !isScheduled(input)) {
1.22123 + schedule(input);
1.22124 + }
1.22125 + }
1.22126 + if (node.control) {
1.22127 + if (node instanceof End || node instanceof Phi || node instanceof Start || isScheduled(node)) {
1.22128 + } else {
1.22129 + append(node);
1.22130 + }
1.22131 + } else {
1.22132 + if (inputs.length) {
1.22133 + var x = inputs[0].control;
1.22134 + for (var i = 1; i < inputs.length; i++) {
1.22135 + var y = inputs[i].control;
1.22136 + if (x.block.dominatorDepth < y.block.dominatorDepth) {
1.22137 + x = y;
1.22138 + }
1.22139 + }
1.22140 + scheduleIn(node, x);
1.22141 + } else {
1.22142 + scheduleIn(node, cfg.root.region);
1.22143 + }
1.22144 + }
1.22145 + debugScheduler && writer.leave('<');
1.22146 + }
1.22147 + debugScheduler && writer.leave('<');
1.22148 + roots.forEach(function (node) {
1.22149 + node = followProjection(node);
1.22150 + if (node === dfg.start || node instanceof Region) {
1.22151 + return;
1.22152 + }
1.22153 + true;
1.22154 + });
1.22155 + };
1.22156 + constructor.prototype.trace = function (writer) {
1.22157 + var visited = [];
1.22158 + var blocks = [];
1.22159 + function next(block) {
1.22160 + if (!visited[block.id]) {
1.22161 + visited[block.id] = true;
1.22162 + blocks.push(block);
1.22163 + block.visitSuccessors(next);
1.22164 + }
1.22165 + }
1.22166 + var root = this.root;
1.22167 + var exit = this.exit;
1.22168 + next(root);
1.22169 + function colorOf(block) {
1.22170 + return 'black';
1.22171 + }
1.22172 + function styleOf(block) {
1.22173 + return 'filled';
1.22174 + }
1.22175 + function shapeOf(block) {
1.22176 + true;
1.22177 + if (block === root) {
1.22178 + return 'house';
1.22179 + } else if (block === exit) {
1.22180 + return 'invhouse';
1.22181 + }
1.22182 + return 'box';
1.22183 + }
1.22184 + writer.writeLn('');
1.22185 + writer.enter('digraph CFG {');
1.22186 + writer.writeLn('graph [bgcolor = gray10];');
1.22187 + writer.writeLn('edge [fontname = Consolas, fontsize = 11, color = white, fontcolor = white];');
1.22188 + writer.writeLn('node [shape = box, fontname = Consolas, fontsize = 11, color = white, fontcolor = white, style = filled];');
1.22189 + writer.writeLn('rankdir = TB;');
1.22190 + blocks.forEach(function (block) {
1.22191 + var loopInfo = '';
1.22192 + var blockInfo = '';
1.22193 + var intervalInfo = '';
1.22194 + if (block.loops !== undefined) {
1.22195 + }
1.22196 + if (block.name !== undefined) {
1.22197 + blockInfo += ' ' + block.name;
1.22198 + }
1.22199 + if (block.rpo !== undefined) {
1.22200 + blockInfo += ' O: ' + block.rpo;
1.22201 + }
1.22202 + writer.writeLn('B' + block.id + ' [label = "B' + block.id + blockInfo + loopInfo + '", fillcolor = "' + colorOf(block) + '", shape=' + shapeOf(block) + ', style=' + styleOf(block) + '];');
1.22203 + });
1.22204 + blocks.forEach(function (block) {
1.22205 + block.visitSuccessors(function (successor) {
1.22206 + writer.writeLn('B' + block.id + ' -> ' + 'B' + successor.id);
1.22207 + });
1.22208 + if (block.dominator) {
1.22209 + writer.writeLn('B' + block.id + ' -> ' + 'B' + block.dominator.id + ' [color = orange];');
1.22210 + }
1.22211 + if (block.follow) {
1.22212 + writer.writeLn('B' + block.id + ' -> ' + 'B' + block.follow.id + ' [color = purple];');
1.22213 + }
1.22214 + });
1.22215 + writer.leave('}');
1.22216 + writer.writeLn('');
1.22217 + };
1.22218 + return constructor;
1.22219 + }();
1.22220 + var PeepholeOptimizer = function () {
1.22221 + function constructor() {
1.22222 + }
1.22223 + function foldUnary(node, truthy) {
1.22224 + true;
1.22225 + if (isConstant(node.argument)) {
1.22226 + return new Constant(node.operator.evaluate(node.argument.value));
1.22227 + }
1.22228 + if (truthy) {
1.22229 + var argument = fold(node.argument, true);
1.22230 + if (node.operator === Operator.TRUE) {
1.22231 + return argument;
1.22232 + }
1.22233 + if (argument instanceof Unary) {
1.22234 + if (node.operator === Operator.FALSE && argument.operator === Operator.FALSE) {
1.22235 + return argument.argument;
1.22236 + }
1.22237 + } else {
1.22238 + return new Unary(node.operator, argument);
1.22239 + }
1.22240 + }
1.22241 + return node;
1.22242 + }
1.22243 + function foldBinary(node, truthy) {
1.22244 + true;
1.22245 + if (isConstant(node.left) && isConstant(node.right)) {
1.22246 + return new Constant(node.operator.evaluate(node.left.value, node.right.value));
1.22247 + }
1.22248 + return node;
1.22249 + }
1.22250 + function fold(node, truthy) {
1.22251 + if (node instanceof Unary) {
1.22252 + return foldUnary(node, truthy);
1.22253 + } else if (node instanceof Binary) {
1.22254 + return foldBinary(node, truthy);
1.22255 + }
1.22256 + return node;
1.22257 + }
1.22258 + constructor.prototype.tryFold = fold;
1.22259 + return constructor;
1.22260 + }();
1.22261 + exports.isConstant = isConstant;
1.22262 + exports.Block = Block;
1.22263 + exports.Node = Node;
1.22264 + exports.Start = Start;
1.22265 + exports.Null = Null;
1.22266 + exports.Undefined = Undefined;
1.22267 + exports.This = This;
1.22268 + exports.Throw = Throw;
1.22269 + exports.Arguments = Arguments;
1.22270 + exports.ASGlobal = ASGlobal;
1.22271 + exports.Projection = Projection;
1.22272 + exports.Region = Region;
1.22273 + exports.Latch = Latch;
1.22274 + exports.Binary = Binary;
1.22275 + exports.Unary = Unary;
1.22276 + exports.Constant = Constant;
1.22277 + exports.ASFindProperty = ASFindProperty;
1.22278 + exports.GlobalProperty = GlobalProperty;
1.22279 + exports.GetProperty = GetProperty;
1.22280 + exports.SetProperty = SetProperty;
1.22281 + exports.CallProperty = CallProperty;
1.22282 + exports.ASCallProperty = ASCallProperty;
1.22283 + exports.ASCallSuper = ASCallSuper;
1.22284 + exports.ASGetProperty = ASGetProperty;
1.22285 + exports.ASGetSuper = ASGetSuper;
1.22286 + exports.ASHasProperty = ASHasProperty;
1.22287 + exports.ASDeleteProperty = ASDeleteProperty;
1.22288 + exports.ASGetDescendants = ASGetDescendants;
1.22289 + exports.ASSetProperty = ASSetProperty;
1.22290 + exports.ASSetSuper = ASSetSuper;
1.22291 + exports.ASGetSlot = ASGetSlot;
1.22292 + exports.ASSetSlot = ASSetSlot;
1.22293 + exports.Call = Call;
1.22294 + exports.ASNew = ASNew;
1.22295 + exports.Phi = Phi;
1.22296 + exports.Stop = Stop;
1.22297 + exports.If = If;
1.22298 + exports.Switch = Switch;
1.22299 + exports.End = End;
1.22300 + exports.Jump = Jump;
1.22301 + exports.ASScope = ASScope;
1.22302 + exports.Operator = Operator;
1.22303 + exports.Variable = Variable;
1.22304 + exports.Move = Move;
1.22305 + exports.Copy = Copy;
1.22306 + exports.Parameter = Parameter;
1.22307 + exports.NewArray = NewArray;
1.22308 + exports.NewObject = NewObject;
1.22309 + exports.ASNewActivation = ASNewActivation;
1.22310 + exports.KeyValuePair = KeyValuePair;
1.22311 + exports.ASMultiname = ASMultiname;
1.22312 + exports.DFG = DFG;
1.22313 + exports.CFG = CFG;
1.22314 + exports.Flags = Flags;
1.22315 + exports.PeepholeOptimizer = PeepholeOptimizer;
1.22316 +}(typeof exports === 'undefined' ? IR = {} : exports));
1.22317 +var c4Options = systemOptions.register(new OptionSet('C4 Options'));
1.22318 +var enableC4 = c4Options.register(new Option('c4', 'c4', 'boolean', false, 'Enable the C4 compiler.'));
1.22319 +var c4TraceLevel = c4Options.register(new Option('tc4', 'tc4', 'number', 0, 'Compiler Trace Level'));
1.22320 +var enableRegisterAllocator = c4Options.register(new Option('ra', 'ra', 'boolean', false, 'Enable register allocator.'));
1.22321 +var getPublicQualifiedName = Multiname.getPublicQualifiedName;
1.22322 +var createName = function createName(namespaces, name) {
1.22323 + if (isNumeric(name) || isObject(name)) {
1.22324 + return name;
1.22325 + }
1.22326 + return new Multiname(namespaces, name);
1.22327 +};
1.22328 +(function (exports) {
1.22329 + var Node = IR.Node;
1.22330 + var Start = IR.Start;
1.22331 + var Null = IR.Null;
1.22332 + var Undefined = IR.Undefined;
1.22333 + var This = IR.This;
1.22334 + var Projection = IR.Projection;
1.22335 + var Region = IR.Region;
1.22336 + var Binary = IR.Binary;
1.22337 + var Unary = IR.Unary;
1.22338 + var Constant = IR.Constant;
1.22339 + var Call = IR.Call;
1.22340 + var Phi = IR.Phi;
1.22341 + var Stop = IR.Stop;
1.22342 + var Operator = IR.Operator;
1.22343 + var Parameter = IR.Parameter;
1.22344 + var NewArray = IR.NewArray;
1.22345 + var NewObject = IR.NewObject;
1.22346 + var KeyValuePair = IR.KeyValuePair;
1.22347 + var isConstant = IR.isConstant;
1.22348 + var DFG = IR.DFG;
1.22349 + var CFG = IR.CFG;
1.22350 + var writer = new IndentingWriter();
1.22351 + var peepholeOptimizer = new IR.PeepholeOptimizer();
1.22352 + var USE_TYPE_OF_DEFAULT_ARGUMENT_CHECKING = false;
1.22353 + var State = function () {
1.22354 + var nextID = 0;
1.22355 + function constructor(index) {
1.22356 + this.id = nextID += 1;
1.22357 + this.index = index;
1.22358 + this.local = [];
1.22359 + this.stack = [];
1.22360 + this.scope = [];
1.22361 + this.store = Undefined;
1.22362 + this.loads = [];
1.22363 + this.saved = Undefined;
1.22364 + }
1.22365 + constructor.prototype.clone = function clone(index) {
1.22366 + var s = new State();
1.22367 + s.index = index !== undefined ? index : this.index;
1.22368 + s.local = this.local.slice(0);
1.22369 + s.stack = this.stack.slice(0);
1.22370 + s.scope = this.scope.slice(0);
1.22371 + s.loads = this.loads.slice(0);
1.22372 + s.saved = this.saved;
1.22373 + s.store = this.store;
1.22374 + return s;
1.22375 + };
1.22376 + constructor.prototype.matches = function matches(other) {
1.22377 + return this.stack.length === other.stack.length && this.scope.length === other.scope.length && this.local.length === other.local.length;
1.22378 + };
1.22379 + constructor.prototype.makeLoopPhis = function makeLoopPhis(control) {
1.22380 + var s = new State();
1.22381 + true;
1.22382 + function makePhi(x) {
1.22383 + var phi = new Phi(control, x);
1.22384 + phi.isLoop = true;
1.22385 + return phi;
1.22386 + }
1.22387 + s.index = this.index;
1.22388 + s.local = this.local.map(makePhi);
1.22389 + s.stack = this.stack.map(makePhi);
1.22390 + s.scope = this.scope.map(makePhi);
1.22391 + s.loads = this.loads.slice(0);
1.22392 + s.saved = this.saved;
1.22393 + s.store = makePhi(this.store);
1.22394 + return s;
1.22395 + };
1.22396 + constructor.prototype.optimize = function optimize() {
1.22397 + function optimize(x) {
1.22398 + if (x instanceof Phi && !x.isLoop) {
1.22399 + var args = x.args.unique();
1.22400 + if (args.length === 1) {
1.22401 + x.seal();
1.22402 + Counter.count('Builder: OptimizedPhi');
1.22403 + return args[0];
1.22404 + }
1.22405 + }
1.22406 + return x;
1.22407 + }
1.22408 + this.local = this.local.map(optimize);
1.22409 + this.stack = this.stack.map(optimize);
1.22410 + this.scope = this.scope.map(optimize);
1.22411 + this.saved = optimize(this.saved);
1.22412 + this.store = optimize(this.store);
1.22413 + };
1.22414 + function mergeValue(control, a, b) {
1.22415 + var phi = a instanceof Phi && a.control === control ? a : new Phi(control, a);
1.22416 + phi.pushValue(b);
1.22417 + return phi;
1.22418 + }
1.22419 + function mergeValues(control, a, b) {
1.22420 + for (var i = 0; i < a.length; i++) {
1.22421 + a[i] = mergeValue(control, a[i], b[i]);
1.22422 + }
1.22423 + }
1.22424 + constructor.prototype.merge = function merge(control, other) {
1.22425 + true;
1.22426 + true;
1.22427 + mergeValues(control, this.local, other.local);
1.22428 + mergeValues(control, this.stack, other.stack);
1.22429 + mergeValues(control, this.scope, other.scope);
1.22430 + this.store = mergeValue(control, this.store, other.store);
1.22431 + this.store.abstract = true;
1.22432 + };
1.22433 + constructor.prototype.trace = function trace(writer) {
1.22434 + writer.writeLn(this.toString());
1.22435 + };
1.22436 + function toBriefString(x) {
1.22437 + if (x instanceof Node) {
1.22438 + return x.toString(true);
1.22439 + }
1.22440 + return x;
1.22441 + }
1.22442 + constructor.prototype.toString = function () {
1.22443 + return '<' + String(this.id + ' @ ' + this.index).padRight(' ', 10) + (' M: ' + toBriefString(this.store)).padRight(' ', 14) + (' X: ' + toBriefString(this.saved)).padRight(' ', 14) + (' $: ' + this.scope.map(toBriefString).join(', ')).padRight(' ', 20) + (' L: ' + this.local.map(toBriefString).join(', ')).padRight(' ', 40) + (' S: ' + this.stack.map(toBriefString).join(', ')).padRight(' ', 60);
1.22444 + };
1.22445 + return constructor;
1.22446 + }();
1.22447 + function isNumericConstant(node) {
1.22448 + return node instanceof Constant && isNumeric(node.value);
1.22449 + }
1.22450 + function isStringConstant(node) {
1.22451 + return node instanceof Constant && isString(node.value);
1.22452 + }
1.22453 + function isMultinameConstant(node) {
1.22454 + return node instanceof Constant && node.value instanceof Multiname;
1.22455 + }
1.22456 + function hasNumericType(node) {
1.22457 + if (isNumericConstant(node)) {
1.22458 + return true;
1.22459 + }
1.22460 + return node.ty && node.ty.isNumeric();
1.22461 + }
1.22462 + function typesAreEqual(a, b) {
1.22463 + if (hasNumericType(a) && hasNumericType(b) || hasStringType(a) && hasStringType(b)) {
1.22464 + return true;
1.22465 + }
1.22466 + return false;
1.22467 + }
1.22468 + function hasStringType(node) {
1.22469 + if (isStringConstant(node)) {
1.22470 + return true;
1.22471 + }
1.22472 + return node.ty && node.ty.isString();
1.22473 + }
1.22474 + function constant(value) {
1.22475 + return new Constant(value);
1.22476 + }
1.22477 + function qualifiedNameConstant(name) {
1.22478 + return constant(Multiname.getQualifiedName(name));
1.22479 + }
1.22480 + function getJSPropertyWithState(state, object, path) {
1.22481 + true;
1.22482 + var names = path.split('.');
1.22483 + var node = object;
1.22484 + for (var i = 0; i < names.length; i++) {
1.22485 + node = new IR.GetProperty(null, state.store, node, constant(names[i]));
1.22486 + node.shouldFloat = true;
1.22487 + state.loads.push(node);
1.22488 + }
1.22489 + return node;
1.22490 + }
1.22491 + function globalProperty(name) {
1.22492 + var node = new IR.GlobalProperty(name);
1.22493 + node.mustFloat = true;
1.22494 + return node;
1.22495 + }
1.22496 + function warn(message) {
1.22497 + }
1.22498 + function unary(operator, argument) {
1.22499 + var node = new Unary(operator, argument);
1.22500 + if (peepholeOptimizer) {
1.22501 + node = peepholeOptimizer.tryFold(node);
1.22502 + }
1.22503 + return node;
1.22504 + }
1.22505 + function binary(operator, left, right) {
1.22506 + var node = new Binary(operator, left, right);
1.22507 + if (left.ty && left.ty !== Type.Any && left.ty === right.ty) {
1.22508 + if (operator === Operator.EQ) {
1.22509 + node.operator = Operator.SEQ;
1.22510 + } else if (operator === Operator.NE) {
1.22511 + node.operator = Operator.SNE;
1.22512 + }
1.22513 + }
1.22514 + if (peepholeOptimizer) {
1.22515 + node = peepholeOptimizer.tryFold(node);
1.22516 + }
1.22517 + return node;
1.22518 + }
1.22519 + function coerceInt(value) {
1.22520 + return binary(Operator.OR, value, constant(0));
1.22521 + }
1.22522 + function coerceUint(value) {
1.22523 + return binary(Operator.URSH, value, constant(0));
1.22524 + }
1.22525 + function coerceNumber(value) {
1.22526 + if (hasNumericType(value)) {
1.22527 + return value;
1.22528 + }
1.22529 + return unary(Operator.PLUS, value);
1.22530 + }
1.22531 + function coerceBoolean(value) {
1.22532 + return unary(Operator.FALSE, unary(Operator.FALSE, value));
1.22533 + }
1.22534 + function shouldNotFloat(node) {
1.22535 + node.shouldNotFloat = true;
1.22536 + return node;
1.22537 + }
1.22538 + function shouldFloat(node) {
1.22539 + true;
1.22540 + node.shouldFloat = true;
1.22541 + return node;
1.22542 + }
1.22543 + function mustFloat(node) {
1.22544 + node.mustFloat = true;
1.22545 + return node;
1.22546 + }
1.22547 + function callPure(callee, object, args) {
1.22548 + return new Call(null, null, callee, object, args, IR.Flags.PRISTINE);
1.22549 + }
1.22550 + function callGlobalProperty(name, value) {
1.22551 + return callPure(globalProperty(name), null, [
1.22552 + value
1.22553 + ]);
1.22554 + }
1.22555 + function convertString(value) {
1.22556 + if (isStringConstant(value)) {
1.22557 + return value;
1.22558 + }
1.22559 + return callPure(globalProperty('String'), null, [
1.22560 + value
1.22561 + ]);
1.22562 + }
1.22563 + function coerceString(value) {
1.22564 + if (isStringConstant(value)) {
1.22565 + return value;
1.22566 + }
1.22567 + return callPure(globalProperty('asCoerceString'), null, [
1.22568 + value
1.22569 + ]);
1.22570 + }
1.22571 + var coerceObject = callGlobalProperty.bind(null, 'asCoerceObject');
1.22572 + var coercers = createEmptyObject();
1.22573 + coercers[Multiname.Int] = coerceInt;
1.22574 + coercers[Multiname.Uint] = coerceUint;
1.22575 + coercers[Multiname.Number] = coerceNumber;
1.22576 + coercers[Multiname.String] = coerceString;
1.22577 + coercers[Multiname.Object] = coerceObject;
1.22578 + coercers[Multiname.Boolean] = coerceBoolean;
1.22579 + function getCoercerForType(multiname) {
1.22580 + true;
1.22581 + return coercers[Multiname.getQualifiedName(multiname)];
1.22582 + }
1.22583 + var callableConstructors = createEmptyObject();
1.22584 + callableConstructors[Multiname.Int] = coerceInt;
1.22585 + callableConstructors[Multiname.Uint] = coerceUint;
1.22586 + callableConstructors[Multiname.Number] = callGlobalProperty.bind(null, 'Number');
1.22587 + callableConstructors[Multiname.String] = callGlobalProperty.bind(null, 'String');
1.22588 + callableConstructors[Multiname.Object] = callGlobalProperty.bind(null, 'Object');
1.22589 + callableConstructors[Multiname.Boolean] = callGlobalProperty.bind(null, 'Boolean');
1.22590 + function getCallableConstructorForType(multiname) {
1.22591 + true;
1.22592 + return callableConstructors[Multiname.getQualifiedName(multiname)];
1.22593 + }
1.22594 + var Builder = function () {
1.22595 + function builder(methodInfo, scope, hasDynamicScope) {
1.22596 + true;
1.22597 + this.abc = methodInfo.abc;
1.22598 + this.scope = scope;
1.22599 + this.methodInfo = methodInfo;
1.22600 + this.hasDynamicScope = hasDynamicScope;
1.22601 + }
1.22602 + builder.prototype.buildStart = function (start) {
1.22603 + var mi = this.methodInfo;
1.22604 + var state = start.entryState = new State(0);
1.22605 + state.local.push(new This(start));
1.22606 + var parameterIndexOffset = this.hasDynamicScope ? 1 : 0;
1.22607 + var parameterCount = mi.parameters.length;
1.22608 + for (var i = 0; i < parameterCount; i++) {
1.22609 + state.local.push(new Parameter(start, parameterIndexOffset + i, mi.parameters[i].name));
1.22610 + }
1.22611 + for (var i = parameterCount; i < mi.localCount; i++) {
1.22612 + state.local.push(Undefined);
1.22613 + }
1.22614 + state.store = new Projection(start, Projection.Type.STORE);
1.22615 + if (this.hasDynamicScope) {
1.22616 + start.scope = new Parameter(start, 0, SAVED_SCOPE_NAME);
1.22617 + } else {
1.22618 + start.scope = new Constant(this.scope);
1.22619 + }
1.22620 + state.saved = new Projection(start, Projection.Type.SCOPE);
1.22621 + start.domain = new Constant(this.domain);
1.22622 + var args = new IR.Arguments(start);
1.22623 + if (mi.needsRest() || mi.needsArguments()) {
1.22624 + var offset = constant(parameterIndexOffset + (mi.needsRest() ? parameterCount : 0));
1.22625 + state.local[parameterCount + 1] = new Call(start, state.store, globalProperty('sliceArguments'), null, [
1.22626 + args,
1.22627 + offset
1.22628 + ], IR.Flags.PRISTINE);
1.22629 + }
1.22630 + var argumentsLength = getJSPropertyWithState(state, args, 'length');
1.22631 + for (var i = 0; i < parameterCount; i++) {
1.22632 + var parameter = mi.parameters[i];
1.22633 + var index = i + 1;
1.22634 + var local = state.local[index];
1.22635 + if (parameter.value !== undefined) {
1.22636 + var condition;
1.22637 + if (USE_TYPE_OF_DEFAULT_ARGUMENT_CHECKING) {
1.22638 + condition = new IR.Binary(Operator.SEQ, new IR.Unary(Operator.TYPE_OF, local), constant('undefined'));
1.22639 + } else {
1.22640 + condition = new IR.Binary(Operator.LT, argumentsLength, constant(parameterIndexOffset + i + 1));
1.22641 + }
1.22642 + local = new IR.Latch(null, condition, constant(parameter.value), local);
1.22643 + }
1.22644 + if (parameter.type && !parameter.type.isAnyName()) {
1.22645 + var coercer = getCoercerForType(parameter.type);
1.22646 + if (coercer) {
1.22647 + local = coercer(local);
1.22648 + } else if (c4CoerceNonPrimitiveParameters) {
1.22649 + local = new Call(start, state.store, globalProperty('asCoerceByMultiname'), null, [
1.22650 + constant(this.abc.applicationDomain),
1.22651 + constant(parameter.type),
1.22652 + local
1.22653 + ], true);
1.22654 + }
1.22655 + }
1.22656 + state.local[index] = local;
1.22657 + }
1.22658 + return start;
1.22659 + };
1.22660 + builder.prototype.buildGraph = function buildGraph(callerRegion, callerState, inlineArguments) {
1.22661 + var analysis = this.methodInfo.analysis;
1.22662 + var blocks = analysis.blocks;
1.22663 + var bytecodes = analysis.bytecodes;
1.22664 + var methodInfo = this.methodInfo;
1.22665 + var ints = this.abc.constantPool.ints;
1.22666 + var uints = this.abc.constantPool.uints;
1.22667 + var doubles = this.abc.constantPool.doubles;
1.22668 + var strings = this.abc.constantPool.strings;
1.22669 + var methods = this.abc.methods;
1.22670 + var classes = this.abc.classes;
1.22671 + var multinames = this.abc.constantPool.multinames;
1.22672 + var domain = new Constant(this.abc.applicationDomain);
1.22673 + var traceBuilder = c4TraceLevel.value > 2;
1.22674 + var stopPoints = [];
1.22675 + for (var i = 0; i < blocks.length; i++) {
1.22676 + blocks[i].blockDominatorOrder = i;
1.22677 + }
1.22678 + var worklist = new Shumway.SortedList(function compare(a, b) {
1.22679 + return a.block.blockDominatorOrder - b.block.blockDominatorOrder;
1.22680 + });
1.22681 + var start = new Start(null);
1.22682 + this.buildStart(start);
1.22683 + var createFunctionCallee = globalProperty('createFunction');
1.22684 + worklist.push({
1.22685 + region: start,
1.22686 + block: blocks[0]
1.22687 + });
1.22688 + var next;
1.22689 + while (next = worklist.pop()) {
1.22690 + buildBlock(next.region, next.block, next.region.entryState.clone()).forEach(function (stop) {
1.22691 + var target = stop.target;
1.22692 + var region = target.region;
1.22693 + if (region) {
1.22694 + traceBuilder && writer.enter('Merging into region: ' + region + ' @ ' + target.position + ', block ' + target.bid + ' {');
1.22695 + traceBuilder && writer.writeLn(' R ' + region.entryState);
1.22696 + traceBuilder && writer.writeLn('+ I ' + stop.state);
1.22697 + region.entryState.merge(region, stop.state);
1.22698 + region.predecessors.push(stop.control);
1.22699 + traceBuilder && writer.writeLn(' = ' + region.entryState);
1.22700 + traceBuilder && writer.leave('}');
1.22701 + } else {
1.22702 + region = target.region = new Region(stop.control);
1.22703 + if (target.loop) {
1.22704 + traceBuilder && writer.writeLn('Adding PHIs to loop region.');
1.22705 + }
1.22706 + region.entryState = target.loop ? stop.state.makeLoopPhis(region) : stop.state.clone(target.position);
1.22707 + traceBuilder && writer.writeLn('Adding new region: ' + region + ' @ ' + target.position + ' to worklist.');
1.22708 + worklist.push({
1.22709 + region: region,
1.22710 + block: target
1.22711 + });
1.22712 + }
1.22713 + });
1.22714 + traceBuilder && writer.enter('Worklist: {');
1.22715 + worklist.forEach(function (item) {
1.22716 + traceBuilder && writer.writeLn(item.region + ' ' + item.block.bdo + ' ' + item.region.entryState);
1.22717 + });
1.22718 + traceBuilder && writer.leave('}');
1.22719 + }
1.22720 + traceBuilder && writer.writeLn('Done');
1.22721 + function buildBlock(region, block, state) {
1.22722 + true;
1.22723 + state.optimize();
1.22724 + var typeState = block.entryState;
1.22725 + if (typeState) {
1.22726 + traceBuilder && writer.writeLn('Type State: ' + typeState);
1.22727 + for (var i = 0; i < typeState.local.length; i++) {
1.22728 + var type = typeState.local[i];
1.22729 + var local = state.local[i];
1.22730 + if (local.ty) {
1.22731 + } else {
1.22732 + local.ty = type;
1.22733 + }
1.22734 + }
1.22735 + }
1.22736 + var local = state.local;
1.22737 + var stack = state.stack;
1.22738 + var scope = state.scope;
1.22739 + function savedScope() {
1.22740 + return state.saved;
1.22741 + }
1.22742 + function topScope(depth) {
1.22743 + if (depth !== undefined) {
1.22744 + if (depth < scope.length) {
1.22745 + return scope[scope.length - 1 - depth];
1.22746 + } else if (depth === scope.length) {
1.22747 + return savedScope();
1.22748 + } else {
1.22749 + var s = savedScope();
1.22750 + var savedScopeDepth = depth - scope.length;
1.22751 + for (var i = 0; i < savedScopeDepth; i++) {
1.22752 + s = getJSProperty(s, 'parent');
1.22753 + }
1.22754 + return s;
1.22755 + }
1.22756 + }
1.22757 + if (scope.length > 0) {
1.22758 + return scope.top();
1.22759 + }
1.22760 + return savedScope();
1.22761 + }
1.22762 + var object, receiver, index, callee, value, multiname, type, args, pristine, left, right, operator;
1.22763 + function push(x) {
1.22764 + true;
1.22765 + if (bc.ti) {
1.22766 + if (x.ty) {
1.22767 + } else {
1.22768 + x.ty = bc.ti.type;
1.22769 + }
1.22770 + }
1.22771 + stack.push(x);
1.22772 + }
1.22773 + function pop() {
1.22774 + return stack.pop();
1.22775 + }
1.22776 + function popMany(count) {
1.22777 + return stack.popMany(count);
1.22778 + }
1.22779 + function pushLocal(index) {
1.22780 + push(local[index]);
1.22781 + }
1.22782 + function popLocal(index) {
1.22783 + local[index] = shouldNotFloat(pop());
1.22784 + }
1.22785 + function buildMultiname(index) {
1.22786 + var multiname = multinames[index];
1.22787 + var namespaces, name, flags = multiname.flags;
1.22788 + if (multiname.isRuntimeName()) {
1.22789 + name = stack.pop();
1.22790 + } else {
1.22791 + name = constant(multiname.name);
1.22792 + }
1.22793 + if (multiname.isRuntimeNamespace()) {
1.22794 + namespaces = shouldFloat(new NewArray(region, [
1.22795 + pop()
1.22796 + ]));
1.22797 + } else {
1.22798 + namespaces = constant(multiname.namespaces);
1.22799 + }
1.22800 + return new IR.ASMultiname(namespaces, name, flags);
1.22801 + }
1.22802 + function simplifyName(name) {
1.22803 + if (isMultinameConstant(name) && Multiname.isQName(name.value)) {
1.22804 + return constant(Multiname.getQualifiedName(name.value));
1.22805 + }
1.22806 + return name;
1.22807 + }
1.22808 + function getGlobalScope(ti) {
1.22809 + if (ti && ti.object) {
1.22810 + return constant(ti.object);
1.22811 + }
1.22812 + return new IR.ASGlobal(null, savedScope());
1.22813 + }
1.22814 + function findProperty(multiname, strict, ti) {
1.22815 + var slowPath = new IR.ASFindProperty(region, state.store, topScope(), multiname, domain, strict);
1.22816 + if (ti) {
1.22817 + if (ti.object) {
1.22818 + if (ti.object instanceof Global && !ti.object.isExecuting()) {
1.22819 + warn('Can\'t optimize findProperty ' + multiname + ', global object is not yet executed or executing.');
1.22820 + return slowPath;
1.22821 + }
1.22822 + return constant(ti.object);
1.22823 + } else if (ti.scopeDepth !== undefined) {
1.22824 + return getScopeObject(topScope(ti.scopeDepth));
1.22825 + }
1.22826 + }
1.22827 + warn('Can\'t optimize findProperty ' + multiname);
1.22828 + return slowPath;
1.22829 + }
1.22830 + function getJSProperty(object, path) {
1.22831 + return getJSPropertyWithState(state, object, path);
1.22832 + }
1.22833 + function coerce(multiname, value) {
1.22834 + if (false && isConstant(value)) {
1.22835 + return constant(asCoerceByMultiname(domain.value, multiname, value.value));
1.22836 + } else {
1.22837 + var coercer = getCoercerForType(multiname);
1.22838 + if (coercer) {
1.22839 + return coercer(value);
1.22840 + }
1.22841 + }
1.22842 + if (c4CoerceNonPrimitive) {
1.22843 + return call(globalProperty('asCoerceByMultiname'), null, [
1.22844 + domain,
1.22845 + constant(multiname),
1.22846 + value
1.22847 + ]);
1.22848 + }
1.22849 + return value;
1.22850 + }
1.22851 + function getScopeObject(scope) {
1.22852 + if (scope instanceof IR.ASScope) {
1.22853 + return scope.object;
1.22854 + }
1.22855 + return getJSProperty(scope, 'object');
1.22856 + }
1.22857 + function store(node) {
1.22858 + state.store = new Projection(node, Projection.Type.STORE);
1.22859 + node.loads = state.loads.slice(0);
1.22860 + state.loads.length = 0;
1.22861 + return node;
1.22862 + }
1.22863 + function load(node) {
1.22864 + state.loads.push(node);
1.22865 + return node;
1.22866 + }
1.22867 + function resolveMultinameGlobally(multiname) {
1.22868 + var namespaces = multiname.namespaces;
1.22869 + var name = multiname.name;
1.22870 + if (!Shumway.AVM2.Runtime.globalMultinameAnalysis.value) {
1.22871 + return;
1.22872 + }
1.22873 + if (!isConstant(namespaces) || !isConstant(name) || multiname.isAttribute()) {
1.22874 + Counter.count('GlobalMultinameResolver: Cannot resolve runtime multiname or attribute.');
1.22875 + return;
1.22876 + }
1.22877 + if (isNumeric(name.value) || !isString(name.value) || !name.value) {
1.22878 + Counter.count('GlobalMultinameResolver: Cannot resolve numeric or any names.');
1.22879 + return false;
1.22880 + }
1.22881 + return GlobalMultinameResolver.resolveMultiname(new Multiname(namespaces.value, name.value, multiname.flags));
1.22882 + }
1.22883 + function callSuper(scope, object, multiname, args, ti) {
1.22884 + if (ti && ti.trait && ti.trait.isMethod() && ti.baseClass) {
1.22885 + var qn = VM_OPEN_METHOD_PREFIX + Multiname.getQualifiedName(ti.trait.name);
1.22886 + var callee = getJSProperty(constant(ti.baseClass), 'traitsPrototype.' + qn);
1.22887 + return call(callee, object, args);
1.22888 + }
1.22889 + return store(new IR.ASCallSuper(region, state.store, object, multiname, args, IR.Flags.PRISTINE, scope));
1.22890 + }
1.22891 + function getSuper(scope, object, multiname, ti) {
1.22892 + if (ti && ti.trait && ti.trait.isGetter() && ti.baseClass) {
1.22893 + var qn = VM_OPEN_GET_METHOD_PREFIX + Multiname.getQualifiedName(ti.trait.name);
1.22894 + var callee = getJSProperty(constant(ti.baseClass), 'traitsPrototype.' + qn);
1.22895 + return call(callee, object, []);
1.22896 + }
1.22897 + return store(new IR.ASGetSuper(region, state.store, object, multiname, scope));
1.22898 + }
1.22899 + function setSuper(scope, object, multiname, value, ti) {
1.22900 + if (ti && ti.trait && ti.trait.isSetter() && ti.baseClass) {
1.22901 + var qn = VM_OPEN_SET_METHOD_PREFIX + Multiname.getQualifiedName(ti.trait.name);
1.22902 + var callee = getJSProperty(constant(ti.baseClass), 'traitsPrototype.' + qn);
1.22903 + return call(callee, object, [
1.22904 + value
1.22905 + ]);
1.22906 + }
1.22907 + return store(new IR.ASSetSuper(region, state.store, object, multiname, value, scope));
1.22908 + }
1.22909 + function constructSuper(scope, object, args, ti) {
1.22910 + if (ti) {
1.22911 + if (ti.noCallSuperNeeded) {
1.22912 + return;
1.22913 + } else if (ti.baseClass) {
1.22914 + var callee = getJSProperty(constant(ti.baseClass), 'instanceConstructorNoInitialize');
1.22915 + call(callee, object, args);
1.22916 + return;
1.22917 + }
1.22918 + }
1.22919 + callee = getJSProperty(scope, 'object.baseClass.instanceConstructorNoInitialize');
1.22920 + call(callee, object, args);
1.22921 + return;
1.22922 + }
1.22923 + function callProperty(object, multiname, args, isLex, ti) {
1.22924 + if (ti && ti.trait) {
1.22925 + if (ti.trait.isMethod()) {
1.22926 + var openQn;
1.22927 + if (ti.trait.holder instanceof InstanceInfo && ti.trait.holder.isInterface()) {
1.22928 + openQn = Multiname.getPublicQualifiedName(Multiname.getName(ti.trait.name));
1.22929 + } else {
1.22930 + openQn = Multiname.getQualifiedName(ti.trait.name);
1.22931 + }
1.22932 + openQn = VM_OPEN_METHOD_PREFIX + openQn;
1.22933 + return store(new IR.CallProperty(region, state.store, object, constant(openQn), args, IR.Flags.PRISTINE));
1.22934 + } else if (ti.trait.isClass()) {
1.22935 + var constructor = getCallableConstructorForType(ti.trait.name);
1.22936 + if (constructor) {
1.22937 + return constructor(args[0]);
1.22938 + }
1.22939 + var qn = Multiname.getQualifiedName(ti.trait.name);
1.22940 + return store(new IR.CallProperty(region, state.store, object, constant(qn), args, 0));
1.22941 + }
1.22942 + } else if (ti && ti.propertyQName) {
1.22943 + return store(new IR.CallProperty(region, state.store, object, constant(ti.propertyQName), args, IR.Flags.PRISTINE));
1.22944 + }
1.22945 + var qn = resolveMultinameGlobally(multiname);
1.22946 + if (qn) {
1.22947 + return store(new IR.ASCallProperty(region, state.store, object, constant(Multiname.getQualifiedName(qn)), args, IR.Flags.PRISTINE | IR.Flags.RESOLVED, isLex));
1.22948 + }
1.22949 + return store(new IR.ASCallProperty(region, state.store, object, multiname, args, IR.Flags.PRISTINE, isLex));
1.22950 + }
1.22951 + function getProperty(object, multiname, ti, getOpenMethod) {
1.22952 + true;
1.22953 + getOpenMethod = !(!getOpenMethod);
1.22954 + if (ti) {
1.22955 + if (ti.trait) {
1.22956 + if (ti.trait.isConst() && ti.trait.hasDefaultValue) {
1.22957 + return constant(ti.trait.value);
1.22958 + }
1.22959 + var get = new IR.GetProperty(region, state.store, object, qualifiedNameConstant(ti.trait.name));
1.22960 + return ti.trait.isGetter() ? store(get) : load(get);
1.22961 + }
1.22962 + if (ti.propertyQName) {
1.22963 + return store(new IR.GetProperty(region, state.store, object, constant(ti.propertyQName)));
1.22964 + } else if (ti.isDirectlyReadable) {
1.22965 + return store(new IR.GetProperty(region, state.store, object, multiname.name));
1.22966 + } else if (ti.isIndexedReadable) {
1.22967 + return store(new IR.ASGetProperty(region, state.store, object, multiname, IR.Flags.INDEXED | (getOpenMethod ? IR.Flagas.IS_METHOD : 0)));
1.22968 + }
1.22969 + }
1.22970 + warn('Can\'t optimize getProperty ' + multiname);
1.22971 + var qn = resolveMultinameGlobally(multiname);
1.22972 + if (qn) {
1.22973 + return store(new IR.ASGetProperty(region, state.store, object, constant(Multiname.getQualifiedName(qn)), IR.Flags.RESOLVED | (getOpenMethod ? IR.Flagas.IS_METHOD : 0)));
1.22974 + }
1.22975 + Counter.count('Compiler: Slow ASGetProperty');
1.22976 + return store(new IR.ASGetProperty(region, state.store, object, multiname, getOpenMethod ? IR.Flagas.IS_METHOD : 0));
1.22977 + }
1.22978 + function setProperty(object, multiname, value, ti) {
1.22979 + true;
1.22980 + if (ti) {
1.22981 + if (ti.trait) {
1.22982 + var coercer = ti.trait.typeName ? getCoercerForType(ti.trait.typeName) : null;
1.22983 + if (coercer) {
1.22984 + value = coercer(value);
1.22985 + }
1.22986 + store(new IR.SetProperty(region, state.store, object, qualifiedNameConstant(ti.trait.name), value));
1.22987 + return;
1.22988 + }
1.22989 + if (ti.propertyQName) {
1.22990 + return store(new IR.SetProperty(region, state.store, object, constant(ti.propertyQName), value));
1.22991 + } else if (ti.isDirectlyWriteable) {
1.22992 + return store(new IR.SetProperty(region, state.store, object, multiname.name, value));
1.22993 + } else if (ti.isIndexedWriteable) {
1.22994 + return store(new IR.ASSetProperty(region, state.store, object, multiname, value, IR.Flags.INDEXED));
1.22995 + }
1.22996 + }
1.22997 + warn('Can\'t optimize setProperty ' + multiname);
1.22998 + var qn = resolveMultinameGlobally(multiname);
1.22999 + if (qn) {
1.23000 + }
1.23001 + return store(new IR.ASSetProperty(region, state.store, object, multiname, value, 0));
1.23002 + }
1.23003 + function getDescendants(object, name, ti) {
1.23004 + name = simplifyName(name);
1.23005 + return new IR.ASGetDescendants(region, state.store, object, name);
1.23006 + }
1.23007 + function getSlot(object, index, ti) {
1.23008 + if (ti) {
1.23009 + var trait = ti.trait;
1.23010 + if (trait) {
1.23011 + if (trait.isConst() && ti.trait.hasDefaultValue) {
1.23012 + return constant(trait.value);
1.23013 + }
1.23014 + var slotQn = Multiname.getQualifiedName(trait.name);
1.23015 + return store(new IR.GetProperty(region, state.store, object, constant(slotQn)));
1.23016 + }
1.23017 + }
1.23018 + warn('Can\'t optimize getSlot ' + index);
1.23019 + return store(new IR.ASGetSlot(null, state.store, object, index));
1.23020 + }
1.23021 + function setSlot(object, index, value, ti) {
1.23022 + if (ti) {
1.23023 + var trait = ti.trait;
1.23024 + if (trait) {
1.23025 + var slotQn = Multiname.getQualifiedName(trait.name);
1.23026 + store(new IR.SetProperty(region, state.store, object, constant(slotQn), value));
1.23027 + return;
1.23028 + }
1.23029 + }
1.23030 + warn('Can\'t optimize setSlot ' + index);
1.23031 + store(new IR.ASSetSlot(region, state.store, object, index, value));
1.23032 + }
1.23033 + function call(callee, object, args) {
1.23034 + return store(new Call(region, state.store, callee, object, args, IR.Flags.PRISTINE));
1.23035 + }
1.23036 + function callCall(callee, object, args, pristine) {
1.23037 + return store(new Call(region, state.store, callee, object, args, pristine ? IR.Flags.PRISTINE : 0));
1.23038 + }
1.23039 + function truthyCondition(operator) {
1.23040 + var right;
1.23041 + if (operator.isBinary()) {
1.23042 + right = pop();
1.23043 + }
1.23044 + var left = pop();
1.23045 + var node;
1.23046 + if (right) {
1.23047 + node = binary(operator, left, right);
1.23048 + } else {
1.23049 + node = unary(operator, left);
1.23050 + }
1.23051 + if (peepholeOptimizer) {
1.23052 + node = peepholeOptimizer.tryFold(node, true);
1.23053 + }
1.23054 + return node;
1.23055 + }
1.23056 + function negatedTruthyCondition(operator) {
1.23057 + var node = unary(Operator.FALSE, truthyCondition(operator));
1.23058 + if (peepholeOptimizer) {
1.23059 + node = peepholeOptimizer.tryFold(node, true);
1.23060 + }
1.23061 + return node;
1.23062 + }
1.23063 + function pushExpression(operator, toInt) {
1.23064 + var left, right;
1.23065 + if (operator.isBinary()) {
1.23066 + right = pop();
1.23067 + left = pop();
1.23068 + if (toInt) {
1.23069 + right = coerceInt(right);
1.23070 + left = coerceInt(left);
1.23071 + }
1.23072 + push(binary(operator, left, right));
1.23073 + } else {
1.23074 + left = pop();
1.23075 + if (toInt) {
1.23076 + left = coerceInt(left);
1.23077 + }
1.23078 + push(unary(operator, left));
1.23079 + }
1.23080 + }
1.23081 + var stops = null;
1.23082 + function buildIfStops(predicate) {
1.23083 + true;
1.23084 + var _if = new IR.If(region, predicate);
1.23085 + stops = [
1.23086 + {
1.23087 + control: new Projection(_if, Projection.Type.FALSE),
1.23088 + target: bytecodes[bc.position + 1],
1.23089 + state: state
1.23090 + },
1.23091 + {
1.23092 + control: new Projection(_if, Projection.Type.TRUE),
1.23093 + target: bc.target,
1.23094 + state: state
1.23095 + }
1.23096 + ];
1.23097 + }
1.23098 + function buildJumpStop() {
1.23099 + true;
1.23100 + stops = [
1.23101 + {
1.23102 + control: region,
1.23103 + target: bc.target,
1.23104 + state: state
1.23105 + }
1.23106 + ];
1.23107 + }
1.23108 + function buildThrowStop() {
1.23109 + true;
1.23110 + stops = [];
1.23111 + }
1.23112 + function buildReturnStop() {
1.23113 + true;
1.23114 + stops = [];
1.23115 + }
1.23116 + function buildSwitchStops(determinant) {
1.23117 + true;
1.23118 + if (bc.targets.length > 2) {
1.23119 + stops = [];
1.23120 + var _switch = new IR.Switch(region, determinant);
1.23121 + for (var i = 0; i < bc.targets.length; i++) {
1.23122 + stops.push({
1.23123 + control: new Projection(_switch, Projection.Type.CASE, constant(i)),
1.23124 + target: bc.targets[i],
1.23125 + state: state
1.23126 + });
1.23127 + }
1.23128 + } else {
1.23129 + true;
1.23130 + var predicate = binary(Operator.SEQ, determinant, constant(0));
1.23131 + var _if = new IR.If(region, predicate);
1.23132 + stops = [
1.23133 + {
1.23134 + control: new Projection(_if, Projection.Type.FALSE),
1.23135 + target: bc.targets[1],
1.23136 + state: state
1.23137 + },
1.23138 + {
1.23139 + control: new Projection(_if, Projection.Type.TRUE),
1.23140 + target: bc.targets[0],
1.23141 + state: state
1.23142 + }
1.23143 + ];
1.23144 + }
1.23145 + }
1.23146 + if (traceBuilder) {
1.23147 + writer.writeLn('Processing Region: ' + region + ', Block: ' + block.bid);
1.23148 + writer.enter(('> state: ' + region.entryState.toString()).padRight(' ', 100));
1.23149 + }
1.23150 + region.processed = true;
1.23151 + var bc;
1.23152 + for (var bci = block.position, end = block.end.position; bci <= end; bci++) {
1.23153 + bc = bytecodes[bci];
1.23154 + var op = bc.op;
1.23155 + state.index = bci;
1.23156 + switch (op) {
1.23157 + case 3:
1.23158 + store(new IR.Throw(region, pop()));
1.23159 + stopPoints.push({
1.23160 + region: region,
1.23161 + store: state.store,
1.23162 + value: Undefined
1.23163 + });
1.23164 + buildThrowStop();
1.23165 + break;
1.23166 + case 98:
1.23167 + pushLocal(bc.index);
1.23168 + break;
1.23169 + case 208:
1.23170 + case 209:
1.23171 + case 210:
1.23172 + case 211:
1.23173 + pushLocal(op - OP_getlocal0);
1.23174 + break;
1.23175 + case 99:
1.23176 + popLocal(bc.index);
1.23177 + break;
1.23178 + case 212:
1.23179 + case 213:
1.23180 + case 214:
1.23181 + case 215:
1.23182 + popLocal(op - OP_setlocal0);
1.23183 + break;
1.23184 + case 28:
1.23185 + scope.push(new IR.ASScope(topScope(), pop(), true));
1.23186 + break;
1.23187 + case 48:
1.23188 + scope.push(new IR.ASScope(topScope(), pop(), false));
1.23189 + break;
1.23190 + case 29:
1.23191 + scope.pop();
1.23192 + break;
1.23193 + case 100:
1.23194 + push(getGlobalScope(bc.ti));
1.23195 + break;
1.23196 + case 101:
1.23197 + push(getScopeObject(state.scope[bc.index]));
1.23198 + break;
1.23199 + case 93:
1.23200 + push(findProperty(buildMultiname(bc.index), true, bc.ti));
1.23201 + break;
1.23202 + case 94:
1.23203 + push(findProperty(buildMultiname(bc.index), false, bc.ti));
1.23204 + break;
1.23205 + case 102:
1.23206 + multiname = buildMultiname(bc.index);
1.23207 + object = pop();
1.23208 + push(getProperty(object, multiname, bc.ti, false));
1.23209 + break;
1.23210 + case 89:
1.23211 + multiname = buildMultiname(bc.index);
1.23212 + object = pop();
1.23213 + push(getDescendants(object, multiname, bc.ti));
1.23214 + break;
1.23215 + case 96:
1.23216 + multiname = buildMultiname(bc.index);
1.23217 + push(getProperty(findProperty(multiname, true, bc.ti), multiname, bc.ti, false));
1.23218 + break;
1.23219 + case 104:
1.23220 + case 97:
1.23221 + value = pop();
1.23222 + multiname = buildMultiname(bc.index);
1.23223 + object = pop();
1.23224 + setProperty(object, multiname, value, bc.ti);
1.23225 + break;
1.23226 + case 106:
1.23227 + multiname = buildMultiname(bc.index);
1.23228 + object = pop();
1.23229 + push(store(new IR.ASDeleteProperty(region, state.store, object, multiname)));
1.23230 + break;
1.23231 + case 108:
1.23232 + object = pop();
1.23233 + push(getSlot(object, constant(bc.index), bc.ti));
1.23234 + break;
1.23235 + case 109:
1.23236 + value = pop();
1.23237 + object = pop();
1.23238 + setSlot(object, constant(bc.index), value, bc.ti);
1.23239 + break;
1.23240 + case 4:
1.23241 + multiname = buildMultiname(bc.index);
1.23242 + object = pop();
1.23243 + push(getSuper(savedScope(), object, multiname, bc.ti));
1.23244 + break;
1.23245 + case 5:
1.23246 + value = pop();
1.23247 + multiname = buildMultiname(bc.index);
1.23248 + object = pop();
1.23249 + setSuper(savedScope(), object, multiname, value, bc.ti);
1.23250 + break;
1.23251 + case 241:
1.23252 + case 240:
1.23253 + break;
1.23254 + case 64:
1.23255 + push(callPure(createFunctionCallee, null, [
1.23256 + constant(methods[bc.index]),
1.23257 + topScope(),
1.23258 + constant(true)
1.23259 + ]));
1.23260 + break;
1.23261 + case 65:
1.23262 + args = popMany(bc.argCount);
1.23263 + object = pop();
1.23264 + callee = pop();
1.23265 + push(callCall(callee, object, args));
1.23266 + break;
1.23267 + case 70:
1.23268 + case 79:
1.23269 + case 76:
1.23270 + args = popMany(bc.argCount);
1.23271 + multiname = buildMultiname(bc.index);
1.23272 + object = pop();
1.23273 + value = callProperty(object, multiname, args, op === OP_callproplex, bc.ti);
1.23274 + if (op !== OP_callpropvoid) {
1.23275 + push(value);
1.23276 + }
1.23277 + break;
1.23278 + case 69:
1.23279 + case 78:
1.23280 + multiname = buildMultiname(bc.index);
1.23281 + args = popMany(bc.argCount);
1.23282 + object = pop();
1.23283 + value = callSuper(savedScope(), object, multiname, args, bc.ti);
1.23284 + if (op !== OP_callsupervoid) {
1.23285 + push(value);
1.23286 + }
1.23287 + break;
1.23288 + case 66:
1.23289 + args = popMany(bc.argCount);
1.23290 + object = pop();
1.23291 + push(store(new IR.ASNew(region, state.store, object, args)));
1.23292 + break;
1.23293 + case 73:
1.23294 + args = popMany(bc.argCount);
1.23295 + object = pop();
1.23296 + constructSuper(savedScope(), object, args, bc.ti);
1.23297 + break;
1.23298 + case 74:
1.23299 + args = popMany(bc.argCount);
1.23300 + multiname = buildMultiname(bc.index);
1.23301 + object = pop();
1.23302 + callee = getProperty(object, multiname, bc.ti, false);
1.23303 + push(store(new IR.ASNew(region, state.store, callee, args)));
1.23304 + break;
1.23305 + case 128:
1.23306 + if (bc.ti && bc.ti.noCoercionNeeded) {
1.23307 + Counter.count('Compiler: NoCoercionNeeded');
1.23308 + break;
1.23309 + } else {
1.23310 + Counter.count('Compiler: CoercionNeeded');
1.23311 + }
1.23312 + value = pop();
1.23313 + push(coerce(multinames[bc.index], value));
1.23314 + break;
1.23315 + case 131:
1.23316 + case 115:
1.23317 + push(coerceInt(pop()));
1.23318 + break;
1.23319 + case 136:
1.23320 + case 116:
1.23321 + push(coerceUint(pop()));
1.23322 + break;
1.23323 + case 132:
1.23324 + case 117:
1.23325 + push(coerceNumber(pop()));
1.23326 + break;
1.23327 + case 129:
1.23328 + case 118:
1.23329 + push(coerceBoolean(pop()));
1.23330 + break;
1.23331 + case 120:
1.23332 + push(call(globalProperty('checkFilter'), null, [
1.23333 + pop()
1.23334 + ]));
1.23335 + break;
1.23336 + case 130:
1.23337 + break;
1.23338 + case 133:
1.23339 + push(coerceString(pop()));
1.23340 + break;
1.23341 + case 112:
1.23342 + push(convertString(pop()));
1.23343 + break;
1.23344 + case 135:
1.23345 + type = pop();
1.23346 + if (c4AsTypeLate) {
1.23347 + value = pop();
1.23348 + push(call(globalProperty('asAsType'), null, [
1.23349 + type,
1.23350 + value
1.23351 + ]));
1.23352 + }
1.23353 + break;
1.23354 + case 72:
1.23355 + case 71:
1.23356 + value = Undefined;
1.23357 + if (op === OP_returnvalue) {
1.23358 + value = pop();
1.23359 + if (methodInfo.returnType) {
1.23360 + if (!(bc.ti && bc.ti.noCoercionNeeded)) {
1.23361 + value = coerce(methodInfo.returnType, value);
1.23362 + }
1.23363 + }
1.23364 + }
1.23365 + stopPoints.push({
1.23366 + region: region,
1.23367 + store: state.store,
1.23368 + value: value
1.23369 + });
1.23370 + buildReturnStop();
1.23371 + break;
1.23372 + case 30:
1.23373 + case 35:
1.23374 + index = pop();
1.23375 + object = pop();
1.23376 + push(new IR.CallProperty(region, state.store, object, constant(op === OP_nextname ? 'asNextName' : 'asNextValue'), [
1.23377 + index
1.23378 + ], IR.Flags.PRISTINE));
1.23379 + break;
1.23380 + case 50:
1.23381 + var temp = call(globalProperty('asHasNext2'), null, [
1.23382 + local[bc.object],
1.23383 + local[bc.index]
1.23384 + ]);
1.23385 + local[bc.object] = getJSProperty(temp, 'object');
1.23386 + push(local[bc.index] = getJSProperty(temp, 'index'));
1.23387 + break;
1.23388 + case 32:
1.23389 + push(Null);
1.23390 + break;
1.23391 + case 33:
1.23392 + push(Undefined);
1.23393 + break;
1.23394 + case 34:
1.23395 + notImplemented();
1.23396 + break;
1.23397 + case 36:
1.23398 + push(constant(bc.value));
1.23399 + break;
1.23400 + case 37:
1.23401 + push(constant(bc.value));
1.23402 + break;
1.23403 + case 44:
1.23404 + push(constant(strings[bc.index]));
1.23405 + break;
1.23406 + case 45:
1.23407 + push(constant(ints[bc.index]));
1.23408 + break;
1.23409 + case 46:
1.23410 + push(constant(uints[bc.index]));
1.23411 + break;
1.23412 + case 47:
1.23413 + push(constant(doubles[bc.index]));
1.23414 + break;
1.23415 + case 38:
1.23416 + push(constant(true));
1.23417 + break;
1.23418 + case 39:
1.23419 + push(constant(false));
1.23420 + break;
1.23421 + case 40:
1.23422 + push(constant(NaN));
1.23423 + break;
1.23424 + case 41:
1.23425 + pop();
1.23426 + break;
1.23427 + case 42:
1.23428 + value = shouldNotFloat(pop());
1.23429 + push(value);
1.23430 + push(value);
1.23431 + break;
1.23432 + case 43:
1.23433 + state.stack.push(pop(), pop());
1.23434 + break;
1.23435 + case 239:
1.23436 + case OP_debugline:
1.23437 + case OP_debugfile:
1.23438 + break;
1.23439 + case 12:
1.23440 + buildIfStops(negatedTruthyCondition(Operator.LT));
1.23441 + break;
1.23442 + case 24:
1.23443 + buildIfStops(truthyCondition(Operator.GE));
1.23444 + break;
1.23445 + case 13:
1.23446 + buildIfStops(negatedTruthyCondition(Operator.LE));
1.23447 + break;
1.23448 + case 23:
1.23449 + buildIfStops(truthyCondition(Operator.GT));
1.23450 + break;
1.23451 + case 14:
1.23452 + buildIfStops(negatedTruthyCondition(Operator.GT));
1.23453 + break;
1.23454 + case 22:
1.23455 + buildIfStops(truthyCondition(Operator.LE));
1.23456 + break;
1.23457 + case 15:
1.23458 + buildIfStops(negatedTruthyCondition(Operator.GE));
1.23459 + break;
1.23460 + case 21:
1.23461 + buildIfStops(truthyCondition(Operator.LT));
1.23462 + break;
1.23463 + case 16:
1.23464 + buildJumpStop();
1.23465 + break;
1.23466 + case 17:
1.23467 + buildIfStops(truthyCondition(Operator.TRUE));
1.23468 + break;
1.23469 + case 18:
1.23470 + buildIfStops(truthyCondition(Operator.FALSE));
1.23471 + break;
1.23472 + case 19:
1.23473 + buildIfStops(truthyCondition(Operator.EQ));
1.23474 + break;
1.23475 + case 20:
1.23476 + buildIfStops(truthyCondition(Operator.NE));
1.23477 + break;
1.23478 + case 25:
1.23479 + buildIfStops(truthyCondition(Operator.SEQ));
1.23480 + break;
1.23481 + case 26:
1.23482 + buildIfStops(truthyCondition(Operator.SNE));
1.23483 + break;
1.23484 + case 27:
1.23485 + buildSwitchStops(pop());
1.23486 + break;
1.23487 + case 150:
1.23488 + pushExpression(Operator.FALSE);
1.23489 + break;
1.23490 + case 151:
1.23491 + pushExpression(Operator.BITWISE_NOT);
1.23492 + break;
1.23493 + case 160:
1.23494 + right = pop();
1.23495 + left = pop();
1.23496 + if (typesAreEqual(left, right)) {
1.23497 + operator = Operator.ADD;
1.23498 + } else if (Shumway.AVM2.Runtime.useAsAdd) {
1.23499 + operator = Operator.AS_ADD;
1.23500 + } else {
1.23501 + operator = Operator.ADD;
1.23502 + }
1.23503 + push(binary(operator, left, right));
1.23504 + break;
1.23505 + case 197:
1.23506 + pushExpression(Operator.ADD, true);
1.23507 + break;
1.23508 + case 161:
1.23509 + pushExpression(Operator.SUB);
1.23510 + break;
1.23511 + case 198:
1.23512 + pushExpression(Operator.SUB, true);
1.23513 + break;
1.23514 + case 162:
1.23515 + pushExpression(Operator.MUL);
1.23516 + break;
1.23517 + case 199:
1.23518 + pushExpression(Operator.MUL, true);
1.23519 + break;
1.23520 + case 163:
1.23521 + pushExpression(Operator.DIV);
1.23522 + break;
1.23523 + case 164:
1.23524 + pushExpression(Operator.MOD);
1.23525 + break;
1.23526 + case 165:
1.23527 + pushExpression(Operator.LSH);
1.23528 + break;
1.23529 + case 166:
1.23530 + pushExpression(Operator.RSH);
1.23531 + break;
1.23532 + case 167:
1.23533 + pushExpression(Operator.URSH);
1.23534 + break;
1.23535 + case 168:
1.23536 + pushExpression(Operator.AND);
1.23537 + break;
1.23538 + case 169:
1.23539 + pushExpression(Operator.OR);
1.23540 + break;
1.23541 + case 170:
1.23542 + pushExpression(Operator.XOR);
1.23543 + break;
1.23544 + case 171:
1.23545 + pushExpression(Operator.EQ);
1.23546 + break;
1.23547 + case 172:
1.23548 + pushExpression(Operator.SEQ);
1.23549 + break;
1.23550 + case 173:
1.23551 + pushExpression(Operator.LT);
1.23552 + break;
1.23553 + case 174:
1.23554 + pushExpression(Operator.LE);
1.23555 + break;
1.23556 + case 175:
1.23557 + pushExpression(Operator.GT);
1.23558 + break;
1.23559 + case 176:
1.23560 + pushExpression(Operator.GE);
1.23561 + break;
1.23562 + case 144:
1.23563 + pushExpression(Operator.NEG);
1.23564 + break;
1.23565 + case 196:
1.23566 + pushExpression(Operator.NEG, true);
1.23567 + break;
1.23568 + case 145:
1.23569 + case 192:
1.23570 + case 147:
1.23571 + case 193:
1.23572 + push(constant(1));
1.23573 + if (op === OP_increment || op === OP_decrement) {
1.23574 + push(coerceNumber(pop()));
1.23575 + } else {
1.23576 + push(coerceInt(pop()));
1.23577 + }
1.23578 + if (op === OP_increment || op === OP_increment_i) {
1.23579 + pushExpression(Operator.ADD);
1.23580 + } else {
1.23581 + pushExpression(Operator.SUB);
1.23582 + }
1.23583 + break;
1.23584 + case 146:
1.23585 + case 194:
1.23586 + case 148:
1.23587 + case 195:
1.23588 + push(constant(1));
1.23589 + if (op === OP_inclocal || op === OP_declocal) {
1.23590 + push(coerceNumber(local[bc.index]));
1.23591 + } else {
1.23592 + push(coerceInt(local[bc.index]));
1.23593 + }
1.23594 + if (op === OP_inclocal || op === OP_inclocal_i) {
1.23595 + pushExpression(Operator.ADD);
1.23596 + } else {
1.23597 + pushExpression(Operator.SUB);
1.23598 + }
1.23599 + popLocal(bc.index);
1.23600 + break;
1.23601 + case 177:
1.23602 + type = pop();
1.23603 + value = pop();
1.23604 + push(call(getJSProperty(type, 'isInstanceOf'), null, [
1.23605 + value
1.23606 + ]));
1.23607 + break;
1.23608 + case 178:
1.23609 + value = pop();
1.23610 + multiname = buildMultiname(bc.index);
1.23611 + type = getProperty(findProperty(multiname, false), multiname);
1.23612 + push(call(globalProperty('asIsType'), null, [
1.23613 + type,
1.23614 + value
1.23615 + ]));
1.23616 + break;
1.23617 + case 179:
1.23618 + type = pop();
1.23619 + value = pop();
1.23620 + push(call(globalProperty('asIsType'), null, [
1.23621 + type,
1.23622 + value
1.23623 + ]));
1.23624 + break;
1.23625 + case 180:
1.23626 + object = pop();
1.23627 + value = pop();
1.23628 + multiname = new IR.ASMultiname(Undefined, value, 0);
1.23629 + push(store(new IR.ASHasProperty(region, state.store, object, multiname)));
1.23630 + break;
1.23631 + case 149:
1.23632 + push(call(globalProperty('asTypeOf'), null, [
1.23633 + pop()
1.23634 + ]));
1.23635 + break;
1.23636 + case 8:
1.23637 + push(Undefined);
1.23638 + popLocal(bc.index);
1.23639 + break;
1.23640 + case 83:
1.23641 + args = popMany(bc.argCount);
1.23642 + type = pop();
1.23643 + callee = globalProperty('applyType');
1.23644 + push(call(callee, null, [
1.23645 + domain,
1.23646 + type,
1.23647 + new NewArray(region, args)
1.23648 + ]));
1.23649 + break;
1.23650 + case 86:
1.23651 + args = popMany(bc.argCount);
1.23652 + push(new NewArray(region, args));
1.23653 + break;
1.23654 + case 85:
1.23655 + var properties = [];
1.23656 + for (var i = 0; i < bc.argCount; i++) {
1.23657 + var value = pop();
1.23658 + var key = pop();
1.23659 + true;
1.23660 + key = constant(Multiname.getPublicQualifiedName(key.value));
1.23661 + properties.push(new KeyValuePair(key, value));
1.23662 + }
1.23663 + push(new NewObject(region, properties));
1.23664 + break;
1.23665 + case 87:
1.23666 + push(new IR.ASNewActivation(constant(methodInfo)));
1.23667 + break;
1.23668 + case 88:
1.23669 + callee = globalProperty('createClass');
1.23670 + push(call(callee, null, [
1.23671 + constant(classes[bc.index]),
1.23672 + pop(),
1.23673 + topScope()
1.23674 + ]));
1.23675 + break;
1.23676 + default:
1.23677 + unexpected('Not Implemented: ' + bc);
1.23678 + }
1.23679 + if (op === OP_debug || op === OP_debugfile || op === OP_debugline) {
1.23680 + continue;
1.23681 + }
1.23682 + if (traceBuilder) {
1.23683 + writer.writeLn(('state: ' + state.toString()).padRight(' ', 100) + ' : ' + bci + ', ' + bc.toString(this.abc));
1.23684 + }
1.23685 + }
1.23686 + if (traceBuilder) {
1.23687 + writer.leave(('< state: ' + state.toString()).padRight(' ', 100));
1.23688 + }
1.23689 + if (!stops) {
1.23690 + stops = [];
1.23691 + if (bc.position + 1 <= bytecodes.length) {
1.23692 + stops.push({
1.23693 + control: region,
1.23694 + target: bytecodes[bc.position + 1],
1.23695 + state: state
1.23696 + });
1.23697 + }
1.23698 + }
1.23699 + return stops;
1.23700 + }
1.23701 + var stop;
1.23702 + if (stopPoints.length > 1) {
1.23703 + var stopRegion = new Region(null);
1.23704 + var stopValuePhi = new Phi(stopRegion, null);
1.23705 + var stopStorePhi = new Phi(stopRegion, null);
1.23706 + stopPoints.forEach(function (stopPoint) {
1.23707 + stopRegion.predecessors.push(stopPoint.region);
1.23708 + stopValuePhi.pushValue(stopPoint.value);
1.23709 + stopStorePhi.pushValue(stopPoint.store);
1.23710 + });
1.23711 + stop = new Stop(stopRegion, stopStorePhi, stopValuePhi);
1.23712 + } else {
1.23713 + stop = new Stop(stopPoints[0].region, stopPoints[0].store, stopPoints[0].value);
1.23714 + }
1.23715 + return new DFG(stop);
1.23716 + };
1.23717 + return builder;
1.23718 + }();
1.23719 + function buildMethod(verifier, methodInfo, scope, hasDynamicScope) {
1.23720 + true;
1.23721 + true;
1.23722 + true;
1.23723 + Counter.count('Compiler: Compiled Methods');
1.23724 + Timer.start('Compiler');
1.23725 + Timer.start('Mark Loops');
1.23726 + methodInfo.analysis.markLoops();
1.23727 + Timer.stop();
1.23728 + if (Shumway.AVM2.Runtime.enableVerifier.value) {
1.23729 + Timer.start('Verify');
1.23730 + verifier.verifyMethod(methodInfo, scope);
1.23731 + Timer.stop();
1.23732 + }
1.23733 + var traceSource = c4TraceLevel.value > 0;
1.23734 + var traceIR = c4TraceLevel.value > 1;
1.23735 + Timer.start('Build IR');
1.23736 + Node.startNumbering();
1.23737 + var dfg = new Builder(methodInfo, scope, hasDynamicScope).buildGraph();
1.23738 + Timer.stop();
1.23739 + traceIR && dfg.trace(writer);
1.23740 + Timer.start('Build CFG');
1.23741 + var cfg = dfg.buildCFG();
1.23742 + Timer.stop();
1.23743 + Timer.start('Optimize Phis');
1.23744 + cfg.optimizePhis();
1.23745 + Timer.stop();
1.23746 + Timer.start('Schedule Nodes');
1.23747 + cfg.scheduleEarly();
1.23748 + Timer.stop();
1.23749 + traceIR && cfg.trace(writer);
1.23750 + Timer.start('Verify IR');
1.23751 + cfg.verify();
1.23752 + Timer.stop();
1.23753 + Timer.start('Allocate Variables');
1.23754 + cfg.allocateVariables();
1.23755 + Timer.stop();
1.23756 + Timer.start('Generate Source');
1.23757 + var result = Backend.generate(cfg, enableRegisterAllocator.value);
1.23758 + Timer.stop();
1.23759 + traceSource && writer.writeLn(result.body);
1.23760 + Node.stopNumbering();
1.23761 + Timer.stop();
1.23762 + return result;
1.23763 + }
1.23764 + exports.buildMethod = buildMethod;
1.23765 +}(typeof exports === 'undefined' ? Builder = {} : exports));
1.23766 +var Compiler = new (function () {
1.23767 + function constructor() {
1.23768 + this.verifier = new Verifier();
1.23769 + }
1.23770 + constructor.prototype.compileMethod = function (methodInfo, scope, hasDynamicScope) {
1.23771 + return Builder.buildMethod(this.verifier, methodInfo, scope, hasDynamicScope);
1.23772 + };
1.23773 + return constructor;
1.23774 + }())();
1.23775 +(function (exports) {
1.23776 + var Control = function () {
1.23777 + var SEQ = 1;
1.23778 + var LOOP = 2;
1.23779 + var IF = 3;
1.23780 + var CASE = 4;
1.23781 + var SWITCH = 5;
1.23782 + var LABEL_CASE = 6;
1.23783 + var LABEL_SWITCH = 7;
1.23784 + var EXIT = 8;
1.23785 + var BREAK = 9;
1.23786 + var CONTINUE = 10;
1.23787 + var TRY = 11;
1.23788 + var CATCH = 12;
1.23789 + function Seq(body) {
1.23790 + this.kind = SEQ;
1.23791 + this.body = body;
1.23792 + }
1.23793 + Seq.prototype = {
1.23794 + trace: function (writer) {
1.23795 + var body = this.body;
1.23796 + for (var i = 0, j = body.length; i < j; i++) {
1.23797 + body[i].trace(writer);
1.23798 + }
1.23799 + },
1.23800 + first: function () {
1.23801 + return this.body[0];
1.23802 + },
1.23803 + slice: function (begin, end) {
1.23804 + return new Seq(this.body.slice(begin, end));
1.23805 + }
1.23806 + };
1.23807 + function Loop(body) {
1.23808 + this.kind = LOOP;
1.23809 + this.body = body;
1.23810 + }
1.23811 + Loop.prototype = {
1.23812 + trace: function (writer) {
1.23813 + writer.enter('loop {');
1.23814 + this.body.trace(writer);
1.23815 + writer.leave('}');
1.23816 + }
1.23817 + };
1.23818 + function If(cond, then, els, nothingThrownLabel) {
1.23819 + this.kind = IF;
1.23820 + this.cond = cond;
1.23821 + this.then = then;
1.23822 + this.else = els;
1.23823 + this.negated = false;
1.23824 + this.nothingThrownLabel = nothingThrownLabel;
1.23825 + }
1.23826 + If.prototype = {
1.23827 + trace: function (writer) {
1.23828 + this.cond.trace(writer);
1.23829 + if (this.nothingThrownLabel) {
1.23830 + writer.enter('if (label is ' + this.nothingThrownLabel + ') {');
1.23831 + }
1.23832 + writer.enter('if' + (this.negated ? ' not' : '') + ' {');
1.23833 + this.then && this.then.trace(writer);
1.23834 + if (this.else) {
1.23835 + writer.outdent();
1.23836 + writer.enter('} else {');
1.23837 + this.else.trace(writer);
1.23838 + }
1.23839 + writer.leave('}');
1.23840 + if (this.nothingThrownLabel) {
1.23841 + writer.leave('}');
1.23842 + }
1.23843 + }
1.23844 + };
1.23845 + function Case(index, body) {
1.23846 + this.kind = CASE;
1.23847 + this.index = index;
1.23848 + this.body = body;
1.23849 + }
1.23850 + Case.prototype = {
1.23851 + trace: function (writer) {
1.23852 + if (this.index >= 0) {
1.23853 + writer.writeLn('case ' + this.index + ':');
1.23854 + } else {
1.23855 + writer.writeLn('default:');
1.23856 + }
1.23857 + writer.indent();
1.23858 + this.body && this.body.trace(writer);
1.23859 + writer.outdent();
1.23860 + }
1.23861 + };
1.23862 + function Switch(determinant, cases, nothingThrownLabel) {
1.23863 + this.kind = SWITCH;
1.23864 + this.determinant = determinant;
1.23865 + this.cases = cases;
1.23866 + this.nothingThrownLabel = nothingThrownLabel;
1.23867 + }
1.23868 + Switch.prototype = {
1.23869 + trace: function (writer) {
1.23870 + if (this.nothingThrownLabel) {
1.23871 + writer.enter('if (label is ' + this.nothingThrownLabel + ') {');
1.23872 + }
1.23873 + this.determinant.trace(writer);
1.23874 + writer.writeLn('switch {');
1.23875 + for (var i = 0, j = this.cases.length; i < j; i++) {
1.23876 + this.cases[i].trace(writer);
1.23877 + }
1.23878 + writer.writeLn('}');
1.23879 + if (this.nothingThrownLabel) {
1.23880 + writer.leave('}');
1.23881 + }
1.23882 + }
1.23883 + };
1.23884 + function LabelCase(labels, body) {
1.23885 + this.kind = LABEL_CASE;
1.23886 + this.labels = labels;
1.23887 + this.body = body;
1.23888 + }
1.23889 + LabelCase.prototype = {
1.23890 + trace: function (writer) {
1.23891 + writer.enter('if (label is ' + this.labels.join(' or ') + ') {');
1.23892 + this.body && this.body.trace(writer);
1.23893 + writer.leave('}');
1.23894 + }
1.23895 + };
1.23896 + function LabelSwitch(cases) {
1.23897 + var labelMap = {};
1.23898 + for (var i = 0, j = cases.length; i < j; i++) {
1.23899 + var c = cases[i];
1.23900 + if (!c.labels) {
1.23901 + print(c.toSource());
1.23902 + }
1.23903 + for (var k = 0, l = c.labels.length; k < l; k++) {
1.23904 + labelMap[c.labels[k]] = c;
1.23905 + }
1.23906 + }
1.23907 + this.kind = LABEL_SWITCH;
1.23908 + this.cases = cases;
1.23909 + this.labelMap = labelMap;
1.23910 + }
1.23911 + LabelSwitch.prototype = {
1.23912 + trace: function (writer) {
1.23913 + for (var i = 0, j = this.cases.length; i < j; i++) {
1.23914 + this.cases[i].trace(writer);
1.23915 + }
1.23916 + }
1.23917 + };
1.23918 + function Exit(label) {
1.23919 + this.kind = EXIT;
1.23920 + this.label = label;
1.23921 + }
1.23922 + Exit.prototype = {
1.23923 + trace: function (writer) {
1.23924 + writer.writeLn('label = ' + this.label);
1.23925 + }
1.23926 + };
1.23927 + function Break(label, head) {
1.23928 + this.kind = BREAK;
1.23929 + this.label = label;
1.23930 + this.head = head;
1.23931 + }
1.23932 + Break.prototype = {
1.23933 + trace: function (writer) {
1.23934 + this.label && writer.writeLn('label = ' + this.label);
1.23935 + writer.writeLn('break');
1.23936 + }
1.23937 + };
1.23938 + function Continue(label, head) {
1.23939 + this.kind = CONTINUE;
1.23940 + this.label = label;
1.23941 + this.head = head;
1.23942 + this.necessary = true;
1.23943 + }
1.23944 + Continue.prototype = {
1.23945 + trace: function (writer) {
1.23946 + this.label && writer.writeLn('label = ' + this.label);
1.23947 + this.necessary && writer.writeLn('continue');
1.23948 + }
1.23949 + };
1.23950 + function Try(body, catches) {
1.23951 + this.kind = TRY;
1.23952 + this.body = body;
1.23953 + this.catches = catches;
1.23954 + }
1.23955 + Try.prototype = {
1.23956 + trace: function (writer) {
1.23957 + writer.enter('try {');
1.23958 + this.body.trace(writer);
1.23959 + writer.writeLn('label = ' + this.nothingThrownLabel);
1.23960 + for (var i = 0, j = this.catches.length; i < j; i++) {
1.23961 + this.catches[i].trace(writer);
1.23962 + }
1.23963 + writer.leave('}');
1.23964 + }
1.23965 + };
1.23966 + function Catch(varName, typeName, body) {
1.23967 + this.kind = CATCH;
1.23968 + this.varName = varName;
1.23969 + this.typeName = typeName;
1.23970 + this.body = body;
1.23971 + }
1.23972 + Catch.prototype = {
1.23973 + trace: function (writer) {
1.23974 + writer.outdent();
1.23975 + writer.enter('} catch (' + (this.varName || 'e') + (this.typeName ? ' : ' + this.typeName : '') + ') {');
1.23976 + this.body.trace(writer);
1.23977 + }
1.23978 + };
1.23979 + return {
1.23980 + SEQ: SEQ,
1.23981 + LOOP: LOOP,
1.23982 + IF: IF,
1.23983 + CASE: CASE,
1.23984 + SWITCH: SWITCH,
1.23985 + LABEL_CASE: LABEL_CASE,
1.23986 + LABEL_SWITCH: LABEL_SWITCH,
1.23987 + EXIT: EXIT,
1.23988 + BREAK: BREAK,
1.23989 + CONTINUE: CONTINUE,
1.23990 + TRY: TRY,
1.23991 + CATCH: CATCH,
1.23992 + Seq: Seq,
1.23993 + Loop: Loop,
1.23994 + If: If,
1.23995 + Case: Case,
1.23996 + Switch: Switch,
1.23997 + LabelCase: LabelCase,
1.23998 + LabelSwitch: LabelSwitch,
1.23999 + Exit: Exit,
1.24000 + Break: Break,
1.24001 + Continue: Continue,
1.24002 + Try: Try,
1.24003 + Catch: Catch
1.24004 + };
1.24005 + }();
1.24006 + var Analysis = function () {
1.24007 + function blockSetClass(length, blockById) {
1.24008 + var BlockSet = BitSetFunctor(length);
1.24009 + var ADDRESS_BITS_PER_WORD = BlockSet.ADDRESS_BITS_PER_WORD;
1.24010 + var BITS_PER_WORD = BlockSet.BITS_PER_WORD;
1.24011 + var BIT_INDEX_MASK = BlockSet.BIT_INDEX_MASK;
1.24012 + BlockSet.singleton = function singleton(b) {
1.24013 + var bs = new BlockSet();
1.24014 + bs.set(b.id);
1.24015 + bs.count = 1;
1.24016 + bs.dirty = 0;
1.24017 + return bs;
1.24018 + };
1.24019 + BlockSet.fromBlocks = function fromArray(other) {
1.24020 + var bs = new BlockSet();
1.24021 + bs.setBlocks(other);
1.24022 + return bs;
1.24023 + };
1.24024 + var Bsp = BlockSet.prototype;
1.24025 + if (BlockSet.singleword) {
1.24026 + Bsp.forEachBlock = function forEach(fn) {
1.24027 + true;
1.24028 + var byId = blockById;
1.24029 + var word = this.bits;
1.24030 + if (word) {
1.24031 + for (var k = 0; k < BITS_PER_WORD; k++) {
1.24032 + if (word & 1 << k) {
1.24033 + fn(byId[k]);
1.24034 + }
1.24035 + }
1.24036 + }
1.24037 + };
1.24038 + Bsp.choose = function choose() {
1.24039 + var byId = blockById;
1.24040 + var word = this.bits;
1.24041 + if (word) {
1.24042 + for (var k = 0; k < BITS_PER_WORD; k++) {
1.24043 + if (word & 1 << k) {
1.24044 + return byId[k];
1.24045 + }
1.24046 + }
1.24047 + }
1.24048 + };
1.24049 + Bsp.members = function members() {
1.24050 + var byId = blockById;
1.24051 + var set = [];
1.24052 + var word = this.bits;
1.24053 + if (word) {
1.24054 + for (var k = 0; k < BITS_PER_WORD; k++) {
1.24055 + if (word & 1 << k) {
1.24056 + set.push(byId[k]);
1.24057 + }
1.24058 + }
1.24059 + }
1.24060 + return set;
1.24061 + };
1.24062 + Bsp.setBlocks = function setBlocks(bs) {
1.24063 + var bits = this.bits;
1.24064 + for (var i = 0, j = bs.length; i < j; i++) {
1.24065 + var id = bs[i].id;
1.24066 + bits |= 1 << (id & BIT_INDEX_MASK);
1.24067 + }
1.24068 + this.bits = bits;
1.24069 + };
1.24070 + } else {
1.24071 + Bsp.forEachBlock = function forEach(fn) {
1.24072 + true;
1.24073 + var byId = blockById;
1.24074 + var bits = this.bits;
1.24075 + for (var i = 0, j = bits.length; i < j; i++) {
1.24076 + var word = bits[i];
1.24077 + if (word) {
1.24078 + for (var k = 0; k < BITS_PER_WORD; k++) {
1.24079 + if (word & 1 << k) {
1.24080 + fn(byId[i * BITS_PER_WORD + k]);
1.24081 + }
1.24082 + }
1.24083 + }
1.24084 + }
1.24085 + };
1.24086 + Bsp.choose = function choose() {
1.24087 + var byId = blockById;
1.24088 + var bits = this.bits;
1.24089 + for (var i = 0, j = bits.length; i < j; i++) {
1.24090 + var word = bits[i];
1.24091 + if (word) {
1.24092 + for (var k = 0; k < BITS_PER_WORD; k++) {
1.24093 + if (word & 1 << k) {
1.24094 + return byId[i * BITS_PER_WORD + k];
1.24095 + }
1.24096 + }
1.24097 + }
1.24098 + }
1.24099 + };
1.24100 + Bsp.members = function members() {
1.24101 + var byId = blockById;
1.24102 + var set = [];
1.24103 + var bits = this.bits;
1.24104 + for (var i = 0, j = bits.length; i < j; i++) {
1.24105 + var word = bits[i];
1.24106 + if (word) {
1.24107 + for (var k = 0; k < BITS_PER_WORD; k++) {
1.24108 + if (word & 1 << k) {
1.24109 + set.push(byId[i * BITS_PER_WORD + k]);
1.24110 + }
1.24111 + }
1.24112 + }
1.24113 + }
1.24114 + return set;
1.24115 + };
1.24116 + Bsp.setBlocks = function setBlocks(bs) {
1.24117 + var bits = this.bits;
1.24118 + for (var i = 0, j = bs.length; i < j; i++) {
1.24119 + var id = bs[i].id;
1.24120 + bits[id >> ADDRESS_BITS_PER_WORD] |= 1 << (id & BIT_INDEX_MASK);
1.24121 + }
1.24122 + };
1.24123 + }
1.24124 + return BlockSet;
1.24125 + }
1.24126 + function Analysis(cfg, options) {
1.24127 + this.options = options || {};
1.24128 + this.BlockSet = blockSetClass(cfg.blocks.length, cfg.blocks);
1.24129 + this.hasExceptions = false;
1.24130 + this.normalizeReachableBlocks(cfg.root);
1.24131 + }
1.24132 + Analysis.prototype = {
1.24133 + normalizeReachableBlocks: function normalizeReachableBlocks(root) {
1.24134 + true;
1.24135 + var ONCE = 1;
1.24136 + var BUNCH_OF_TIMES = 2;
1.24137 + var BlockSet = this.BlockSet;
1.24138 + var blocks = [];
1.24139 + var visited = {};
1.24140 + var ancestors = {};
1.24141 + var worklist = [
1.24142 + root
1.24143 + ];
1.24144 + var node;
1.24145 + ancestors[root.id] = true;
1.24146 + while (node = worklist.top()) {
1.24147 + if (visited[node.id]) {
1.24148 + if (visited[node.id] === ONCE) {
1.24149 + visited[node.id] = BUNCH_OF_TIMES;
1.24150 + blocks.push(node);
1.24151 + }
1.24152 + ancestors[node.id] = false;
1.24153 + worklist.pop();
1.24154 + continue;
1.24155 + }
1.24156 + visited[node.id] = ONCE;
1.24157 + ancestors[node.id] = true;
1.24158 + var successors = node.successors;
1.24159 + for (var i = 0, j = successors.length; i < j; i++) {
1.24160 + var s = successors[i];
1.24161 + if (ancestors[s.id]) {
1.24162 + if (!node.spbacks) {
1.24163 + node.spbacks = new BlockSet();
1.24164 + }
1.24165 + node.spbacks.set(s.id);
1.24166 + }
1.24167 + !visited[s.id] && worklist.push(s);
1.24168 + }
1.24169 + }
1.24170 + this.blocks = blocks.reverse();
1.24171 + },
1.24172 + computeDominance: function computeDominance() {
1.24173 + function intersectDominators(doms, b1, b2) {
1.24174 + var finger1 = b1;
1.24175 + var finger2 = b2;
1.24176 + while (finger1 !== finger2) {
1.24177 + while (finger1 > finger2) {
1.24178 + finger1 = doms[finger1];
1.24179 + }
1.24180 + while (finger2 > finger1) {
1.24181 + finger2 = doms[finger2];
1.24182 + }
1.24183 + }
1.24184 + return finger1;
1.24185 + }
1.24186 + var blocks = this.blocks;
1.24187 + var n = blocks.length;
1.24188 + var doms = new Array(n);
1.24189 + doms[0] = 0;
1.24190 + var rpo = [];
1.24191 + for (var b = 0; b < n; b++) {
1.24192 + rpo[blocks[b].id] = b;
1.24193 + blocks[b].dominatees = [];
1.24194 + }
1.24195 + var changed = true;
1.24196 + while (changed) {
1.24197 + changed = false;
1.24198 + for (var b = 1; b < n; b++) {
1.24199 + var predecessors = blocks[b].predecessors;
1.24200 + var j = predecessors.length;
1.24201 + var newIdom = rpo[predecessors[0].id];
1.24202 + if (!(newIdom in doms)) {
1.24203 + for (var i = 1; i < j; i++) {
1.24204 + newIdom = rpo[predecessors[i].id];
1.24205 + if (newIdom in doms) {
1.24206 + break;
1.24207 + }
1.24208 + }
1.24209 + }
1.24210 + true;
1.24211 + for (var i = 0; i < j; i++) {
1.24212 + var p = rpo[predecessors[i].id];
1.24213 + if (p === newIdom) {
1.24214 + continue;
1.24215 + }
1.24216 + if (p in doms) {
1.24217 + newIdom = intersectDominators(doms, p, newIdom);
1.24218 + }
1.24219 + }
1.24220 + if (doms[b] !== newIdom) {
1.24221 + doms[b] = newIdom;
1.24222 + changed = true;
1.24223 + }
1.24224 + }
1.24225 + }
1.24226 + blocks[0].dominator = blocks[0];
1.24227 + var block;
1.24228 + for (var b = 1; b < n; b++) {
1.24229 + block = blocks[b];
1.24230 + var idom = blocks[doms[b]];
1.24231 + block.dominator = idom;
1.24232 + idom.dominatees.push(block);
1.24233 + block.npredecessors = block.predecessors.length;
1.24234 + }
1.24235 + var worklist = [
1.24236 + blocks[0]
1.24237 + ];
1.24238 + blocks[0].level || (blocks[0].level = 0);
1.24239 + while (block = worklist.shift()) {
1.24240 + var dominatees = block.dominatees;
1.24241 + for (var i = 0, j = dominatees.length; i < j; i++) {
1.24242 + dominatees[i].level = block.level + 1;
1.24243 + }
1.24244 + worklist.push.apply(worklist, dominatees);
1.24245 + }
1.24246 + },
1.24247 + computeFrontiers: function computeFrontiers() {
1.24248 + var BlockSet = this.BlockSet;
1.24249 + var blocks = this.blocks;
1.24250 + for (var b = 0, n = blocks.length; b < n; b++) {
1.24251 + blocks[b].frontier = new BlockSet();
1.24252 + }
1.24253 + for (var b = 1, n = blocks.length; b < n; b++) {
1.24254 + var block = blocks[b];
1.24255 + var predecessors = block.predecessors;
1.24256 + if (predecessors.length >= 2) {
1.24257 + var idom = block.dominator;
1.24258 + for (var i = 0, j = predecessors.length; i < j; i++) {
1.24259 + var runner = predecessors[i];
1.24260 + while (runner !== idom) {
1.24261 + runner.frontier.set(block.id);
1.24262 + runner = runner.dominator;
1.24263 + }
1.24264 + }
1.24265 + }
1.24266 + }
1.24267 + },
1.24268 + analyzeControlFlow: function analyzeControlFlow() {
1.24269 + this.computeDominance();
1.24270 + this.analyzedControlFlow = true;
1.24271 + return true;
1.24272 + },
1.24273 + markLoops: function markLoops() {
1.24274 + if (!this.analyzedControlFlow && !this.analyzeControlFlow()) {
1.24275 + return false;
1.24276 + }
1.24277 + var BlockSet = this.BlockSet;
1.24278 + function findSCCs(root) {
1.24279 + var preorderId = 1;
1.24280 + var preorder = {};
1.24281 + var assigned = {};
1.24282 + var unconnectedNodes = [];
1.24283 + var pendingNodes = [];
1.24284 + var sccs = [];
1.24285 + var level = root.level + 1;
1.24286 + var worklist = [
1.24287 + root
1.24288 + ];
1.24289 + var node;
1.24290 + var u, s;
1.24291 + while (node = worklist.top()) {
1.24292 + if (preorder[node.id]) {
1.24293 + if (pendingNodes.peek() === node) {
1.24294 + pendingNodes.pop();
1.24295 + var scc = [];
1.24296 + do {
1.24297 + u = unconnectedNodes.pop();
1.24298 + assigned[u.id] = true;
1.24299 + scc.push(u);
1.24300 + } while (u !== node);
1.24301 + if (scc.length > 1 || u.spbacks && u.spbacks.get(u.id)) {
1.24302 + sccs.push(scc);
1.24303 + }
1.24304 + }
1.24305 + worklist.pop();
1.24306 + continue;
1.24307 + }
1.24308 + preorder[node.id] = preorderId++;
1.24309 + unconnectedNodes.push(node);
1.24310 + pendingNodes.push(node);
1.24311 + var successors = node.successors;
1.24312 + for (var i = 0, j = successors.length; i < j; i++) {
1.24313 + s = successors[i];
1.24314 + if (s.level < level) {
1.24315 + continue;
1.24316 + }
1.24317 + var sid = s.id;
1.24318 + if (!preorder[sid]) {
1.24319 + worklist.push(s);
1.24320 + } else if (!assigned[sid]) {
1.24321 + while (preorder[pendingNodes.peek().id] > preorder[sid]) {
1.24322 + pendingNodes.pop();
1.24323 + }
1.24324 + }
1.24325 + }
1.24326 + }
1.24327 + return sccs;
1.24328 + }
1.24329 + function findLoopHeads(blocks) {
1.24330 + var heads = new BlockSet();
1.24331 + for (var i = 0, j = blocks.length; i < j; i++) {
1.24332 + var block = blocks[i];
1.24333 + var spbacks = block.spbacks;
1.24334 + if (!spbacks) {
1.24335 + continue;
1.24336 + }
1.24337 + var successors = block.successors;
1.24338 + for (var k = 0, l = successors.length; k < l; k++) {
1.24339 + var s = successors[k];
1.24340 + if (spbacks.get(s.id)) {
1.24341 + heads.set(s.dominator.id);
1.24342 + }
1.24343 + }
1.24344 + }
1.24345 + return heads.members();
1.24346 + }
1.24347 + function LoopInfo(scc, loopId) {
1.24348 + var body = new BlockSet();
1.24349 + body.setBlocks(scc);
1.24350 + body.recount();
1.24351 + this.id = loopId;
1.24352 + this.body = body;
1.24353 + this.exit = new BlockSet();
1.24354 + this.save = {};
1.24355 + this.head = new BlockSet();
1.24356 + this.npredecessors = 0;
1.24357 + }
1.24358 + var heads = findLoopHeads(this.blocks);
1.24359 + if (heads.length <= 0) {
1.24360 + this.markedLoops = true;
1.24361 + return true;
1.24362 + }
1.24363 + var worklist = heads.sort(function (a, b) {
1.24364 + return a.level - b.level;
1.24365 + });
1.24366 + var loopId = 0;
1.24367 + for (var n = worklist.length - 1; n >= 0; n--) {
1.24368 + var top = worklist[n];
1.24369 + var sccs = findSCCs(top);
1.24370 + if (sccs.length === 0) {
1.24371 + continue;
1.24372 + }
1.24373 + for (var i = 0, j = sccs.length; i < j; i++) {
1.24374 + var scc = sccs[i];
1.24375 + var loop = new LoopInfo(scc, loopId++);
1.24376 + for (var k = 0, l = scc.length; k < l; k++) {
1.24377 + var h = scc[k];
1.24378 + if (h.level === top.level + 1 && !h.loop) {
1.24379 + h.loop = loop;
1.24380 + loop.head.set(h.id);
1.24381 + var predecessors = h.predecessors;
1.24382 + for (var pi = 0, pj = predecessors.length; pi < pj; pi++) {
1.24383 + loop.body.get(predecessors[pi].id) && h.npredecessors--;
1.24384 + }
1.24385 + loop.npredecessors += h.npredecessors;
1.24386 + }
1.24387 + }
1.24388 + for (var k = 0, l = scc.length; k < l; k++) {
1.24389 + var h = scc[k];
1.24390 + if (h.level === top.level + 1) {
1.24391 + h.npredecessors = loop.npredecessors;
1.24392 + }
1.24393 + }
1.24394 + loop.head.recount();
1.24395 + }
1.24396 + }
1.24397 + this.markedLoops = true;
1.24398 + return true;
1.24399 + },
1.24400 + induceControlTree: function induceControlTree() {
1.24401 + var hasExceptions = this.hasExceptions;
1.24402 + var BlockSet = this.BlockSet;
1.24403 + function maybe(exit, save) {
1.24404 + exit.recount();
1.24405 + if (exit.count === 0) {
1.24406 + return null;
1.24407 + }
1.24408 + exit.save = save;
1.24409 + return exit;
1.24410 + }
1.24411 + var exceptionId = this.blocks.length;
1.24412 + function induce(head, exit, save, loop, inLoopHead, lookupSwitch, fallthrough) {
1.24413 + var v = [];
1.24414 + while (head) {
1.24415 + if (head.count > 1) {
1.24416 + var exit2 = new BlockSet();
1.24417 + var save2 = {};
1.24418 + var cases = [];
1.24419 + var heads = head.members();
1.24420 + for (var i = 0, j = heads.length; i < j; i++) {
1.24421 + var h = heads[i];
1.24422 + var bid = h.id;
1.24423 + var c;
1.24424 + if (h.loop && head.contains(h.loop.head)) {
1.24425 + var loop2 = h.loop;
1.24426 + if (!loop2.induced) {
1.24427 + var lheads = loop2.head.members();
1.24428 + var lheadsave = 0;
1.24429 + for (k = 0, l = lheads.length; k < l; k++) {
1.24430 + lheadsave += head.save[lheads[k].id];
1.24431 + }
1.24432 + if (h.npredecessors - lheadsave > 0) {
1.24433 + h.npredecessors -= head.save[bid];
1.24434 + h.save = head.save[bid];
1.24435 + c = induce(h, exit2, save2, loop);
1.24436 + cases.push(new Control.LabelCase([
1.24437 + bid
1.24438 + ], c));
1.24439 + } else {
1.24440 + for (k = 0, l = lheads.length; k < l; k++) {
1.24441 + var lh = lheads[k];
1.24442 + lh.npredecessors -= lheadsave;
1.24443 + lh.save = lheadsave;
1.24444 + }
1.24445 + c = induce(h, exit2, save2, loop);
1.24446 + cases.push(new Control.LabelCase(loop2.head.toArray(), c));
1.24447 + loop2.induced = true;
1.24448 + }
1.24449 + }
1.24450 + } else {
1.24451 + h.npredecessors -= head.save[bid];
1.24452 + h.save = head.save[bid];
1.24453 + c = induce(h, exit2, save2, loop);
1.24454 + cases.push(new Control.LabelCase([
1.24455 + bid
1.24456 + ], c));
1.24457 + }
1.24458 + }
1.24459 + var pruned = [];
1.24460 + var k = 0;
1.24461 + var c;
1.24462 + for (var i = 0, j = cases.length; i < j; i++) {
1.24463 + c = cases[i];
1.24464 + var labels = c.labels;
1.24465 + var lk = 0;
1.24466 + for (var ln = 0, nlabels = labels.length; ln < nlabels; ln++) {
1.24467 + var bid = labels[ln];
1.24468 + if (exit2.get(bid) && heads[i].npredecessors - head.save[bid] > 0) {
1.24469 + pruned.push(bid);
1.24470 + } else {
1.24471 + labels[lk++] = bid;
1.24472 + }
1.24473 + }
1.24474 + labels.length = lk;
1.24475 + if (labels.length > 0) {
1.24476 + cases[k++] = c;
1.24477 + }
1.24478 + }
1.24479 + cases.length = k;
1.24480 + if (cases.length === 0) {
1.24481 + for (var i = 0, j = pruned.length; i < j; i++) {
1.24482 + var bid = pruned[i];
1.24483 + save[bid] = (save[bid] || 0) + head.save[bid];
1.24484 + exit.set(bid);
1.24485 + }
1.24486 + break;
1.24487 + }
1.24488 + v.push(new Control.LabelSwitch(cases));
1.24489 + head = maybe(exit2, save2);
1.24490 + continue;
1.24491 + }
1.24492 + var h, bid, c;
1.24493 + if (head.count === 1) {
1.24494 + h = head.choose();
1.24495 + bid = h.id;
1.24496 + h.npredecessors -= head.save[bid];
1.24497 + h.save = head.save[bid];
1.24498 + } else {
1.24499 + h = head;
1.24500 + bid = h.id;
1.24501 + }
1.24502 + if (inLoopHead) {
1.24503 + inLoopHead = false;
1.24504 + } else {
1.24505 + if (loop && !loop.body.get(bid)) {
1.24506 + h.npredecessors += h.save;
1.24507 + loop.exit.set(bid);
1.24508 + loop.save[bid] = (loop.save[bid] || 0) + h.save;
1.24509 + v.push(new Control.Break(bid, loop));
1.24510 + break;
1.24511 + }
1.24512 + if (loop && h.loop === loop) {
1.24513 + h.npredecessors += h.save;
1.24514 + v.push(new Control.Continue(bid, loop));
1.24515 + break;
1.24516 + }
1.24517 + if (h === fallthrough) {
1.24518 + break;
1.24519 + }
1.24520 + if (h.npredecessors > 0) {
1.24521 + h.npredecessors += h.save;
1.24522 + save[bid] = (save[bid] || 0) + h.save;
1.24523 + exit.set(bid);
1.24524 + v.push(lookupSwitch ? new Control.Break(bid, lookupSwitch) : new Control.Exit(bid));
1.24525 + break;
1.24526 + }
1.24527 + if (h.loop) {
1.24528 + var l = h.loop;
1.24529 + var body;
1.24530 + if (l.head.count === 1) {
1.24531 + body = induce(l.head.choose(), null, null, l, true);
1.24532 + } else {
1.24533 + var lcases = [];
1.24534 + var lheads = l.head.members();
1.24535 + for (var i = 0, j = lheads.length; i < j; i++) {
1.24536 + var lh = lheads[i];
1.24537 + var lbid = lh.id;
1.24538 + var c = induce(lh, null, null, l, true);
1.24539 + lcases.push(new Control.LabelCase([
1.24540 + lbid
1.24541 + ], c));
1.24542 + }
1.24543 + body = new Control.LabelSwitch(lcases);
1.24544 + }
1.24545 + v.push(new Control.Loop(body));
1.24546 + head = maybe(l.exit, l.save);
1.24547 + continue;
1.24548 + }
1.24549 + }
1.24550 + var sv;
1.24551 + var successors;
1.24552 + var exit2 = new BlockSet();
1.24553 + var save2 = {};
1.24554 + if (hasExceptions && h.hasCatches) {
1.24555 + var allsuccessors = h.successors;
1.24556 + var catchsuccessors = [];
1.24557 + successors = [];
1.24558 + for (var i = 0, j = allsuccessors.length; i < j; i++) {
1.24559 + var s = allsuccessors[i];
1.24560 + (s.exception ? catchsuccessors : successors).push(s);
1.24561 + }
1.24562 + var catches = [];
1.24563 + for (var i = 0, j = catchsuccessors.length; i < j; i++) {
1.24564 + var t = catchsuccessors[i];
1.24565 + t.npredecessors -= 1;
1.24566 + t.save = 1;
1.24567 + var c = induce(t, exit2, save2, loop);
1.24568 + var ex = t.exception;
1.24569 + catches.push(new Control.Catch(ex.varName, ex.typeName, c));
1.24570 + }
1.24571 + sv = new Control.Try(h, catches);
1.24572 + } else {
1.24573 + successors = h.successors;
1.24574 + sv = h;
1.24575 + }
1.24576 + if (successors.length > 2) {
1.24577 + var cases = [];
1.24578 + var targets = successors;
1.24579 + for (var i = targets.length - 1; i >= 0; i--) {
1.24580 + var t = targets[i];
1.24581 + t.npredecessors -= 1;
1.24582 + t.save = 1;
1.24583 + c = induce(t, exit2, save2, loop, null, h, targets[i + 1]);
1.24584 + cases.unshift(new Control.Case(i, c));
1.24585 + }
1.24586 + cases.top().index = undefined;
1.24587 + if (hasExceptions && h.hasCatches) {
1.24588 + sv.nothingThrownLabel = exceptionId;
1.24589 + sv = new Control.Switch(sv, cases, exceptionId++);
1.24590 + } else {
1.24591 + sv = new Control.Switch(sv, cases);
1.24592 + }
1.24593 + head = maybe(exit2, save2);
1.24594 + } else if (successors.length === 2) {
1.24595 + var branch1 = h.hasFlippedSuccessors ? successors[1] : successors[0];
1.24596 + var branch2 = h.hasFlippedSuccessors ? successors[0] : successors[1];
1.24597 + branch1.npredecessors -= 1;
1.24598 + branch1.save = 1;
1.24599 + var c1 = induce(branch1, exit2, save2, loop);
1.24600 + branch2.npredecessors -= 1;
1.24601 + branch2.save = 1;
1.24602 + var c2 = induce(branch2, exit2, save2, loop);
1.24603 + if (hasExceptions && h.hasCatches) {
1.24604 + sv.nothingThrownLabel = exceptionId;
1.24605 + sv = new Control.If(sv, c1, c2, exceptionId++);
1.24606 + } else {
1.24607 + sv = new Control.If(sv, c1, c2);
1.24608 + }
1.24609 + head = maybe(exit2, save2);
1.24610 + } else {
1.24611 + c = successors[0];
1.24612 + if (c) {
1.24613 + if (hasExceptions && h.hasCatches) {
1.24614 + sv.nothingThrownLabel = c.id;
1.24615 + save2[c.id] = (save2[c.id] || 0) + 1;
1.24616 + exit2.set(c.id);
1.24617 + head = maybe(exit2, save2);
1.24618 + } else {
1.24619 + c.npredecessors -= 1;
1.24620 + c.save = 1;
1.24621 + head = c;
1.24622 + }
1.24623 + } else {
1.24624 + if (hasExceptions && h.hasCatches) {
1.24625 + sv.nothingThrownLabel = -1;
1.24626 + head = maybe(exit2, save2);
1.24627 + } else {
1.24628 + head = c;
1.24629 + }
1.24630 + }
1.24631 + }
1.24632 + v.push(sv);
1.24633 + }
1.24634 + if (v.length > 1) {
1.24635 + return new Control.Seq(v);
1.24636 + }
1.24637 + return v[0];
1.24638 + }
1.24639 + var root = this.blocks[0];
1.24640 + this.controlTree = induce(root, new BlockSet(), {});
1.24641 + },
1.24642 + restructureControlFlow: function restructureControlFlow() {
1.24643 + Timer.start('Restructure Control Flow');
1.24644 + if (!this.markedLoops && !this.markLoops()) {
1.24645 + Timer.stop();
1.24646 + return false;
1.24647 + }
1.24648 + this.induceControlTree();
1.24649 + this.restructuredControlFlow = true;
1.24650 + Timer.stop();
1.24651 + return true;
1.24652 + },
1.24653 + trace: function (writer) {
1.24654 + function bid(node) {
1.24655 + return node.id;
1.24656 + }
1.24657 + function traceBlock(block) {
1.24658 + if (!block.dominator) {
1.24659 + writer.enter('block unreachable {');
1.24660 + } else {
1.24661 + writer.enter('block ' + block.id + (block.successors.length > 0 ? ' -> ' + block.successors.map(bid).join(',') : '') + ' {');
1.24662 + writer.writeLn('npredecessors'.padRight(' ', 10) + block.npredecessors);
1.24663 + writer.writeLn('idom'.padRight(' ', 10) + block.dominator.id);
1.24664 + writer.writeLn('domcs'.padRight(' ', 10) + block.dominatees.map(bid).join(','));
1.24665 + if (block.frontier) {
1.24666 + writer.writeLn('frontier'.padRight(' ', 10) + '{' + block.frontier.toArray().join(',') + '}');
1.24667 + }
1.24668 + writer.writeLn('level'.padRight(' ', 10) + block.level);
1.24669 + }
1.24670 + if (block.loop) {
1.24671 + writer.writeLn('loop'.padRight(' ', 10) + '{' + block.loop.body.toArray().join(',') + '}');
1.24672 + writer.writeLn(' id'.padRight(' ', 10) + block.loop.id);
1.24673 + writer.writeLn(' head'.padRight(' ', 10) + '{' + block.loop.head.toArray().join(',') + '}');
1.24674 + writer.writeLn(' exit'.padRight(' ', 10) + '{' + block.loop.exit.toArray().join(',') + '}');
1.24675 + writer.writeLn(' npredecessors'.padRight(' ', 10) + block.loop.npredecessors);
1.24676 + }
1.24677 + writer.writeLn('');
1.24678 + if (block.position >= 0) {
1.24679 + for (var bci = block.position; bci <= block.end.position; bci++) {
1.24680 + writer.writeLn(('' + bci).padRight(' ', 5) + bytecodes[bci]);
1.24681 + }
1.24682 + } else {
1.24683 + writer.writeLn('abstract');
1.24684 + }
1.24685 + writer.leave('}');
1.24686 + }
1.24687 + var bytecodes = this.bytecodes;
1.24688 + writer.enter('analysis {');
1.24689 + writer.enter('cfg {');
1.24690 + this.blocks.forEach(traceBlock);
1.24691 + writer.leave('}');
1.24692 + if (this.controlTree) {
1.24693 + writer.enter('control-tree {');
1.24694 + this.controlTree.trace(writer);
1.24695 + writer.leave('}');
1.24696 + }
1.24697 + writer.leave('}');
1.24698 + },
1.24699 + traceCFG: makeVizTrace([
1.24700 + {
1.24701 + fn: function (n) {
1.24702 + return n.successors || [];
1.24703 + },
1.24704 + style: ''
1.24705 + }
1.24706 + ], [
1.24707 + {
1.24708 + fn: function (n) {
1.24709 + return n.predecessors || [];
1.24710 + },
1.24711 + style: ''
1.24712 + }
1.24713 + ]),
1.24714 + traceDJ: makeVizTrace([
1.24715 + {
1.24716 + fn: function (n) {
1.24717 + return n.dominatees || [];
1.24718 + },
1.24719 + style: 'style=dashed'
1.24720 + },
1.24721 + {
1.24722 + fn: function (n) {
1.24723 + var crosses = new this.BlockSet();
1.24724 + crosses.setBlocks(n.successors);
1.24725 + crosses.subtract(this.BlockSet.fromBlocks(n.dominatees));
1.24726 + n.spbacks && crosses.subtract(n.spbacks);
1.24727 + return crosses.members();
1.24728 + },
1.24729 + style: ''
1.24730 + },
1.24731 + {
1.24732 + fn: function (n) {
1.24733 + return n.spbacks ? n.spbacks.members() : [];
1.24734 + },
1.24735 + style: 'style=bold'
1.24736 + }
1.24737 + ], [
1.24738 + {
1.24739 + fn: function (n) {
1.24740 + return n.predecessors || [];
1.24741 + },
1.24742 + style: ''
1.24743 + }
1.24744 + ], function (idFn, writer) {
1.24745 + var root = this.bytecodes[0];
1.24746 + var worklist = [
1.24747 + root
1.24748 + ];
1.24749 + var n;
1.24750 + var level = root.level;
1.24751 + var currentLevel = [];
1.24752 + while (n = worklist.shift()) {
1.24753 + if (level != n.level) {
1.24754 + writer.writeLn('{rank=same; ' + currentLevel.map(function (n) {
1.24755 + return 'block_' + idFn(n);
1.24756 + }).join(' ') + '}');
1.24757 + currentLevel.length = 0;
1.24758 + level = n.level;
1.24759 + }
1.24760 + currentLevel.push(n);
1.24761 + worklist.push.apply(worklist, n.dominatees);
1.24762 + }
1.24763 + })
1.24764 + };
1.24765 + function makeVizTrace(successorFns, predecessorFns, postHook) {
1.24766 + return function (writer, name, prefix) {
1.24767 + function idFn(n) {
1.24768 + return prefix + n.id;
1.24769 + }
1.24770 + var analysis = this;
1.24771 + function bindToThis(x) {
1.24772 + x.fn = x.fn.bind(analysis);
1.24773 + }
1.24774 + prefix = prefix || '';
1.24775 + var bytecodes = this.bytecodes;
1.24776 + if (!bytecodes) {
1.24777 + return;
1.24778 + }
1.24779 + successorFns.forEach(bindToThis);
1.24780 + predecessorFns.forEach(bindToThis);
1.24781 + writeGraphViz(writer, name.toString(), bytecodes[0], idFn, function (n) {
1.24782 + return n.successors || [];
1.24783 + }, successorFns, predecessorFns, function (n) {
1.24784 + var str = 'Block: ' + n.id + '\\l';
1.24785 + return str;
1.24786 + }, postHook && postHook.bind(this, idFn));
1.24787 + };
1.24788 + }
1.24789 + return Analysis;
1.24790 + }();
1.24791 + exports.Control = Control;
1.24792 + exports.analyze = function (cfg) {
1.24793 + var analysis = new Analysis(cfg);
1.24794 + analysis.restructureControlFlow();
1.24795 + return analysis.controlTree;
1.24796 + };
1.24797 +}(typeof exports === 'undefined' ? Looper = {} : exports));
1.24798 +(function (exports) {
1.24799 + var TRACE_REGISTER_ALLOCATOR = false;
1.24800 + var T = estransform;
1.24801 + var Node = T.Node;
1.24802 + var Identifier = T.Identifier;
1.24803 + var VariableDeclaration = T.VariableDeclaration;
1.24804 + var VariableDeclarator = T.VariableDeclarator;
1.24805 + var AssignmentExpression = T.AssignmentExpression;
1.24806 + var MemberExpression = T.MemberExpression;
1.24807 + var IfStatement = T.IfStatement;
1.24808 + var WhileStatement = T.WhileStatement;
1.24809 + var FunctionDeclaration = T.FunctionDeclaration;
1.24810 + var writer = new IndentingWriter();
1.24811 + var LinearScan = function () {
1.24812 + function Interval(id, start, end) {
1.24813 + this.id = id;
1.24814 + this.start = start;
1.24815 + this.end = end;
1.24816 + }
1.24817 + Interval.prototype.toString = function () {
1.24818 + return '[' + this.start + ',' + this.end + ']';
1.24819 + };
1.24820 + function linearScan(intervals, maxRegisters) {
1.24821 + this.intervals = intervals.slice(0);
1.24822 + this.maxRegisters = maxRegisters;
1.24823 + }
1.24824 + linearScan.prototype.allocate = function () {
1.24825 + var intervals = this.intervals;
1.24826 + this.intervals.sort(function (a, b) {
1.24827 + return a.start - b.start;
1.24828 + });
1.24829 + var active = new SortedList(function (a, b) {
1.24830 + return a.end - b.end;
1.24831 + });
1.24832 + var maxRegisters = this.maxRegisters;
1.24833 + var freeRegisters = [];
1.24834 + for (var i = maxRegisters - 1; i >= 0; i--) {
1.24835 + freeRegisters.push('R' + i);
1.24836 + }
1.24837 + intervals.forEach(function (i) {
1.24838 + expireOldIntervals(i);
1.24839 + if (active.length === maxRegisters) {
1.24840 + notImplemented('Cannot Spill');
1.24841 + } else {
1.24842 + i.register = freeRegisters.pop();
1.24843 + TRACE_REGISTER_ALLOCATOR && writer.writeLn('Allocate: ' + i + ' ' + i.id + ' -> ' + i.register);
1.24844 + active.push(i);
1.24845 + }
1.24846 + });
1.24847 + function expireOldIntervals(i) {
1.24848 + active.forEach(function (j) {
1.24849 + if (j.end >= i.start) {
1.24850 + return SortedList.RETURN;
1.24851 + }
1.24852 + freeRegisters.push(j.register);
1.24853 + TRACE_REGISTER_ALLOCATOR && writer.writeLn('Release: ' + j + ' -> ' + j.register);
1.24854 + return SortedList.DELETE;
1.24855 + });
1.24856 + }
1.24857 + };
1.24858 + linearScan.Interval = Interval;
1.24859 + return linearScan;
1.24860 + }();
1.24861 + function allocateRegisters(program) {
1.24862 + var scan = T.makePass('scan', 'scanNode');
1.24863 + var label = 0;
1.24864 + Node.prototype.scan = function (o) {
1.24865 + this.position = label++;
1.24866 + return scan.apply(this, o);
1.24867 + };
1.24868 + var variables = [];
1.24869 + var variableIndexMap = {};
1.24870 + var identifiers = [];
1.24871 + FunctionDeclaration.prototype.scan = function () {
1.24872 + this.params.forEach(function (identifier) {
1.24873 + if (!(identifier.name in variableIndexMap)) {
1.24874 + variableIndexMap[identifier.name] = variables.length;
1.24875 + variables.push(identifier.name);
1.24876 + }
1.24877 + });
1.24878 + this.body.scan();
1.24879 + return this;
1.24880 + };
1.24881 + VariableDeclarator.prototype.scan = function () {
1.24882 + this.position = label++;
1.24883 + if (!(this.id.name in variableIndexMap)) {
1.24884 + variableIndexMap[this.id.name] = variables.length;
1.24885 + variables.push(this.id.name);
1.24886 + }
1.24887 + return this;
1.24888 + };
1.24889 + AssignmentExpression.prototype.scan = function (o) {
1.24890 + this.left.scan(o);
1.24891 + this.right.scan(o);
1.24892 + this.position = label++;
1.24893 + return this;
1.24894 + };
1.24895 + WhileStatement.prototype.scan = function (o) {
1.24896 + this.position = label++;
1.24897 + this.test.scan(o);
1.24898 + this.body.scan(o);
1.24899 + this.afterPosition = label++;
1.24900 + return this;
1.24901 + };
1.24902 + program.scan();
1.24903 + TRACE_REGISTER_ALLOCATOR && writer.writeLn('Local Variables: ' + variables);
1.24904 + var Set = BitSetFunctor(variables.length);
1.24905 + var Range = BitSetFunctor(label);
1.24906 + var ranges = [];
1.24907 + for (var i = 0; i < variables.length; i++) {
1.24908 + ranges.push(new Range());
1.24909 + }
1.24910 + function fill(range) {
1.24911 + var start = -1;
1.24912 + for (var i = 0; i < range.length; i++) {
1.24913 + if (range.get(i)) {
1.24914 + start = i;
1.24915 + break;
1.24916 + }
1.24917 + }
1.24918 + for (var i = range.length - 1; i >= 0; i--) {
1.24919 + if (range.get(i)) {
1.24920 + end = i;
1.24921 + break;
1.24922 + }
1.24923 + }
1.24924 + for (var i = start; i < end; i++) {
1.24925 + range.set(i);
1.24926 + }
1.24927 + }
1.24928 + function getRange(range) {
1.24929 + var start = -1, end = -1;
1.24930 + for (var i = 0; i < range.length; i++) {
1.24931 + if (range.get(i)) {
1.24932 + start = i;
1.24933 + break;
1.24934 + }
1.24935 + }
1.24936 + for (var i = range.length - 1; i >= 0; i--) {
1.24937 + if (range.get(i)) {
1.24938 + end = i;
1.24939 + break;
1.24940 + }
1.24941 + }
1.24942 + return [
1.24943 + start,
1.24944 + end
1.24945 + ];
1.24946 + }
1.24947 + function use(set, name, position) {
1.24948 + var index = variableIndexMap[name];
1.24949 + ranges[index].set(position);
1.24950 + set.set(index);
1.24951 + }
1.24952 + function def(set, name, position) {
1.24953 + var index = variableIndexMap[name];
1.24954 + ranges[index].set(position);
1.24955 + set.clear(index);
1.24956 + }
1.24957 + Node.prototype.markLiveness = T.makePass('markLiveness', 'markLivenessNode', true);
1.24958 + Identifier.prototype.markLiveness = function (o) {
1.24959 + var name = this.name;
1.24960 + if (name === 'undefined') {
1.24961 + return this;
1.24962 + }
1.24963 + if (o && o.isProperty) {
1.24964 + return this;
1.24965 + }
1.24966 + if (!(name in variableIndexMap)) {
1.24967 + return this;
1.24968 + }
1.24969 + identifiers.push(this);
1.24970 + var live = o.live;
1.24971 + use(live, name, this.position);
1.24972 + return this;
1.24973 + };
1.24974 + VariableDeclarator.prototype.markLiveness = function (o) {
1.24975 + var live = o.live;
1.24976 + identifiers.push(this.id);
1.24977 + return this;
1.24978 + };
1.24979 + IfStatement.prototype.markLiveness = function (o) {
1.24980 + var a = o.live.clone();
1.24981 + var b = o.live.clone();
1.24982 + this.alternate && this.alternate.markLiveness({
1.24983 + live: a
1.24984 + });
1.24985 + this.consequent && this.consequent.markLiveness({
1.24986 + live: b
1.24987 + });
1.24988 + o.live.assign(a);
1.24989 + o.live._union(b);
1.24990 + this.test.markLiveness(o);
1.24991 + return this;
1.24992 + };
1.24993 + WhileStatement.prototype.markLiveness = function (o) {
1.24994 + var a = o.live.clone();
1.24995 + TRACE_REGISTER_ALLOCATOR && writer.writeLn('END OF LOOP: ' + a);
1.24996 + var afterPosition = this.afterPosition;
1.24997 + do {
1.24998 + var b = a.clone();
1.24999 + this.body.markLiveness({
1.25000 + live: a
1.25001 + });
1.25002 + this.test.markLiveness({
1.25003 + live: a
1.25004 + });
1.25005 + TRACE_REGISTER_ALLOCATOR && writer.writeLn('TOP OF LOOP: ' + a);
1.25006 + var iterate = !b.equals(a);
1.25007 + if (iterate) {
1.25008 + TRACE_REGISTER_ALLOCATOR && writer.writeLn('ITERATE');
1.25009 + a.forEach(function (i) {
1.25010 + ranges[i].set(afterPosition);
1.25011 + });
1.25012 + }
1.25013 + } while (iterate);
1.25014 + o.live.assign(a);
1.25015 + return this;
1.25016 + };
1.25017 + AssignmentExpression.prototype.markLiveness = function (o) {
1.25018 + this.right.markLiveness(o);
1.25019 + if (this.left instanceof Identifier) {
1.25020 + def(o.live, this.left.name, this.position);
1.25021 + identifiers.push(this.left);
1.25022 + } else {
1.25023 + this.left.markLiveness(o);
1.25024 + }
1.25025 + return this;
1.25026 + };
1.25027 + MemberExpression.prototype.markLiveness = function (o) {
1.25028 + if (this.computed || !(this.property instanceof Identifier)) {
1.25029 + this.property.markLiveness(o);
1.25030 + }
1.25031 + this.object.markLiveness(o);
1.25032 + return this;
1.25033 + };
1.25034 + program.markLiveness({
1.25035 + live: new Set()
1.25036 + });
1.25037 + var intervals = [];
1.25038 + for (var i = 0; i < ranges.length; i++) {
1.25039 + var r = getRange(ranges[i]);
1.25040 + intervals.push(new LinearScan.Interval(i, r[0], r[1]));
1.25041 + }
1.25042 + var allocator = new LinearScan(intervals, 1024);
1.25043 + allocator.allocate();
1.25044 + var map = createEmptyObject();
1.25045 + for (var i = 0; i < variables.length; i++) {
1.25046 + map[variables[i]] = intervals[i].register;
1.25047 + }
1.25048 + if (true) {
1.25049 + for (var i = 0; i < identifiers.length; i++) {
1.25050 + if (identifiers[i].patched) {
1.25051 + continue;
1.25052 + }
1.25053 + identifiers[i].name = map[identifiers[i].name];
1.25054 + identifiers[i].patched = true;
1.25055 + }
1.25056 + }
1.25057 + if (TRACE_REGISTER_ALLOCATOR) {
1.25058 + for (var i = 0; i < ranges.length; i++) {
1.25059 + fill(ranges[i]);
1.25060 + writer.writeLn(String(i).padLeft(' ', 3) + ' ' + variables[i].padRight(' ', 5) + ': ' + ranges[i].toBitString('=', ' ') + ' ' + intervals[i].register);
1.25061 + }
1.25062 + }
1.25063 + return program;
1.25064 + }
1.25065 + Transform.transform = function (program) {
1.25066 + allocateRegisters(program);
1.25067 + };
1.25068 +}(typeof exports === 'undefined' ? Transform = {} : exports));
1.25069 +(function (exports) {
1.25070 + var T = estransform;
1.25071 + var Literal = T.Literal;
1.25072 + var Identifier = T.Identifier;
1.25073 + var VariableDeclaration = T.VariableDeclaration;
1.25074 + var VariableDeclarator = T.VariableDeclarator;
1.25075 + var MemberExpression = T.MemberExpression;
1.25076 + var BinaryExpression = T.BinaryExpression;
1.25077 + var CallExpression = T.CallExpression;
1.25078 + var AssignmentExpression = T.AssignmentExpression;
1.25079 + var ExpressionStatement = T.ExpressionStatement;
1.25080 + var ReturnStatement = T.ReturnStatement;
1.25081 + var FunctionDeclaration = T.FunctionDeclaration;
1.25082 + var ConditionalExpression = T.ConditionalExpression;
1.25083 + var ObjectExpression = T.ObjectExpression;
1.25084 + var ArrayExpression = T.ArrayExpression;
1.25085 + var UnaryExpression = T.UnaryExpression;
1.25086 + var NewExpression = T.NewExpression;
1.25087 + var Property = T.Property;
1.25088 + var BlockStatement = T.BlockStatement;
1.25089 + var ThisExpression = T.ThisExpression;
1.25090 + var ThrowStatement = T.ThrowStatement;
1.25091 + var IfStatement = T.IfStatement;
1.25092 + var WhileStatement = T.WhileStatement;
1.25093 + var BreakStatement = T.BreakStatement;
1.25094 + var ContinueStatement = T.ContinueStatement;
1.25095 + var SwitchStatement = T.SwitchStatement;
1.25096 + var SwitchCase = T.SwitchCase;
1.25097 + var Block = IR.Block;
1.25098 + var Operator = IR.Operator;
1.25099 + var Projection = IR.Projection;
1.25100 + var Start = IR.Start;
1.25101 + var Control = Looper.Control;
1.25102 + var Variable = IR.Variable;
1.25103 + Control.Break.prototype.compile = function (cx, state) {
1.25104 + return cx.compileBreak(this, state);
1.25105 + };
1.25106 + Control.Continue.prototype.compile = function (cx, state) {
1.25107 + return cx.compileContinue(this, state);
1.25108 + };
1.25109 + Control.Exit.prototype.compile = function (cx, state) {
1.25110 + return cx.compileExit(this, state);
1.25111 + };
1.25112 + Control.LabelSwitch.prototype.compile = function (cx, state) {
1.25113 + return cx.compileLabelSwitch(this, state);
1.25114 + };
1.25115 + Control.Seq.prototype.compile = function (cx, state) {
1.25116 + return cx.compileSequence(this, state);
1.25117 + };
1.25118 + Block.prototype.compile = function (cx, state) {
1.25119 + return cx.compileBlock(this, state);
1.25120 + };
1.25121 + Control.Loop.prototype.compile = function (cx, state) {
1.25122 + return cx.compileLoop(this, state);
1.25123 + };
1.25124 + Control.Switch.prototype.compile = function (cx, state) {
1.25125 + return cx.compileSwitch(this, state);
1.25126 + };
1.25127 + Control.If.prototype.compile = function (cx, state) {
1.25128 + return cx.compileIf(this, state);
1.25129 + };
1.25130 + Control.Try.prototype.compile = function (cx, state) {
1.25131 + return cx.compileTry(this, state);
1.25132 + };
1.25133 + function constant(value) {
1.25134 + if (typeof value === 'string' || value === null || value === true || value === false) {
1.25135 + return new Literal(value);
1.25136 + } else if (value === undefined) {
1.25137 + return new Identifier('undefined');
1.25138 + } else if (typeof value === 'object' || typeof value === 'function') {
1.25139 + return new Identifier(objectConstantName(value));
1.25140 + } else if (typeof value === 'number' && isNaN(value)) {
1.25141 + return new Identifier('NaN');
1.25142 + } else if (value === Infinity) {
1.25143 + return new Identifier('Infinity');
1.25144 + } else if (value === -Infinity) {
1.25145 + return new UnaryExpression('-', new Identifier('Infinity'));
1.25146 + } else if (typeof value === 'number' && 1 / value < 0) {
1.25147 + return new UnaryExpression('-', new Literal(Math.abs(value)));
1.25148 + } else if (typeof value === 'number') {
1.25149 + return new Literal(value);
1.25150 + } else {
1.25151 + unexpected('Cannot emit constant for value: ', value);
1.25152 + }
1.25153 + }
1.25154 + function id(name) {
1.25155 + true;
1.25156 + return new Identifier(name);
1.25157 + }
1.25158 + function isIdentifierStart(c) {
1.25159 + return c === '$' || c === '_' || c === '\\' || c >= 'a' && c <= 'z' || c >= 'A' && c <= 'Z';
1.25160 + }
1.25161 + function isIdentifierPart(c) {
1.25162 + return c === '$' || c === '_' || c === '\\' || c >= 'a' && c <= 'z' || c >= 'A' && c <= 'Z' || c >= '0' && c <= '9';
1.25163 + }
1.25164 + function isIdentifierName(s) {
1.25165 + if (!isIdentifierStart(s[0])) {
1.25166 + return false;
1.25167 + }
1.25168 + for (var i = 1; i < s.length; i++) {
1.25169 + if (!isIdentifierPart(s[i])) {
1.25170 + return false;
1.25171 + }
1.25172 + }
1.25173 + return true;
1.25174 + }
1.25175 + function property(obj) {
1.25176 + for (var i = 1; i < arguments.length; i++) {
1.25177 + var x = arguments[i];
1.25178 + if (typeof x === 'string') {
1.25179 + if (isIdentifierName(x)) {
1.25180 + obj = new MemberExpression(obj, new Identifier(x), false);
1.25181 + } else {
1.25182 + obj = new MemberExpression(obj, new Literal(x), true);
1.25183 + }
1.25184 + } else if (x instanceof Literal && isIdentifierName(x.value)) {
1.25185 + obj = new MemberExpression(obj, new Identifier(x.value), false);
1.25186 + } else {
1.25187 + obj = new MemberExpression(obj, x, true);
1.25188 + }
1.25189 + }
1.25190 + return obj;
1.25191 + }
1.25192 + function call(callee, args) {
1.25193 + true;
1.25194 + true;
1.25195 + return new CallExpression(callee, args);
1.25196 + }
1.25197 + function callCall(callee, object, args) {
1.25198 + return call(property(callee, 'call'), [
1.25199 + object
1.25200 + ].concat(args));
1.25201 + }
1.25202 + function assignment(left, right) {
1.25203 + true;
1.25204 + return new AssignmentExpression(left, '=', right);
1.25205 + }
1.25206 + function variableDeclaration(declarations) {
1.25207 + return new VariableDeclaration('var', declarations);
1.25208 + }
1.25209 + function negate(node) {
1.25210 + if (node instanceof Constant) {
1.25211 + if (node.value === true || node.value === false) {
1.25212 + return constant(!node.value);
1.25213 + }
1.25214 + } else if (node instanceof Identifier) {
1.25215 + return new UnaryExpression(Operator.FALSE.name, node);
1.25216 + }
1.25217 + true;
1.25218 + var left = node instanceof BinaryExpression ? node.left : node.argument;
1.25219 + var right = node.right;
1.25220 + var operator = Operator.fromName(node.operator);
1.25221 + if (operator === Operator.EQ && right instanceof Literal && right.value === false) {
1.25222 + return left;
1.25223 + }
1.25224 + if (operator === Operator.FALSE) {
1.25225 + return left;
1.25226 + }
1.25227 + if (operator.not) {
1.25228 + if (node instanceof BinaryExpression) {
1.25229 + return new BinaryExpression(operator.not.name, left, right);
1.25230 + } else {
1.25231 + return new UnaryExpression(operator.not.name, left);
1.25232 + }
1.25233 + }
1.25234 + return new UnaryExpression(Operator.FALSE.name, node);
1.25235 + }
1.25236 + function Context() {
1.25237 + this.label = new Variable('$L');
1.25238 + this.variables = [];
1.25239 + this.parameters = [];
1.25240 + }
1.25241 + Context.prototype.useVariable = function (variable) {
1.25242 + true;
1.25243 + return this.variables.pushUnique(variable);
1.25244 + };
1.25245 + Context.prototype.useParameter = function (parameter) {
1.25246 + return this.parameters[parameter.index] = parameter;
1.25247 + };
1.25248 + Context.prototype.compileLabelBody = function compileLabelBody(node) {
1.25249 + var body = [];
1.25250 + if (node.label !== undefined) {
1.25251 + this.useVariable(this.label);
1.25252 + body.push(new ExpressionStatement(assignment(id(this.label.name), new Literal(node.label))));
1.25253 + }
1.25254 + return body;
1.25255 + };
1.25256 + Context.prototype.compileBreak = function compileBreak(node) {
1.25257 + var body = this.compileLabelBody(node);
1.25258 + body.push(new BreakStatement(null));
1.25259 + return new BlockStatement(body);
1.25260 + };
1.25261 + Context.prototype.compileContinue = function compileContinue(node) {
1.25262 + var body = this.compileLabelBody(node);
1.25263 + body.push(new ContinueStatement(null));
1.25264 + return new BlockStatement(body);
1.25265 + };
1.25266 + Context.prototype.compileExit = function compileExit(node) {
1.25267 + return new BlockStatement(this.compileLabelBody(node));
1.25268 + };
1.25269 + Context.prototype.compileIf = function compileIf(node) {
1.25270 + var cr = node.cond.compile(this);
1.25271 + var tr = null, er = null;
1.25272 + if (node.then) {
1.25273 + tr = node.then.compile(this);
1.25274 + }
1.25275 + if (node.else) {
1.25276 + er = node.else.compile(this);
1.25277 + }
1.25278 + var condition = compileValue(cr.end.predicate, this);
1.25279 + condition = node.negated ? negate(condition) : condition;
1.25280 + cr.body.push(new IfStatement(condition, tr || new BlockStatement([]), er || null));
1.25281 + return cr;
1.25282 + };
1.25283 + Context.prototype.compileSwitch = function compileSwitch(node) {
1.25284 + var dr = node.determinant.compile(this);
1.25285 + var cases = [];
1.25286 + node.cases.forEach(function (x) {
1.25287 + var br;
1.25288 + if (x.body) {
1.25289 + br = x.body.compile(this);
1.25290 + }
1.25291 + var test = typeof x.index === 'number' ? new Literal(x.index) : undefined;
1.25292 + cases.push(new SwitchCase(test, br ? [
1.25293 + br
1.25294 + ] : []));
1.25295 + }, this);
1.25296 + var determinant = compileValue(dr.end.determinant, this);
1.25297 + dr.body.push(new SwitchStatement(determinant, cases, false));
1.25298 + return dr;
1.25299 + };
1.25300 + Context.prototype.compileLabelSwitch = function compileLabelSwitch(node) {
1.25301 + var statement = null;
1.25302 + var labelName = id(this.label.name);
1.25303 + function compileLabelTest(labelID) {
1.25304 + true;
1.25305 + return new BinaryExpression('===', labelName, new Literal(labelID));
1.25306 + }
1.25307 + for (var i = node.cases.length - 1; i >= 0; i--) {
1.25308 + var c = node.cases[i];
1.25309 + var labels = c.labels;
1.25310 + var labelTest = compileLabelTest(labels[0]);
1.25311 + for (var j = 1; j < labels.length; j++) {
1.25312 + labelTest = new BinaryExpression('||', labelTest, compileLabelTest(labels[j]));
1.25313 + }
1.25314 + statement = new IfStatement(labelTest, c.body ? c.body.compile(this) : new BlockStatement(), statement);
1.25315 + }
1.25316 + return statement;
1.25317 + };
1.25318 + Context.prototype.compileLoop = function compileLoop(node) {
1.25319 + var br = node.body.compile(this);
1.25320 + return new WhileStatement(constant(true), br);
1.25321 + };
1.25322 + Context.prototype.compileSequence = function compileSequence(node) {
1.25323 + var cx = this;
1.25324 + var body = [];
1.25325 + node.body.forEach(function (x) {
1.25326 + var result = x.compile(cx);
1.25327 + if (result instanceof BlockStatement) {
1.25328 + body = body.concat(result.body);
1.25329 + } else {
1.25330 + body.push(result);
1.25331 + }
1.25332 + });
1.25333 + return new BlockStatement(body);
1.25334 + };
1.25335 + Context.prototype.compileBlock = function compileBlock(block) {
1.25336 + var body = [];
1.25337 + for (var i = 1; i < block.nodes.length - 1; i++) {
1.25338 + var node = block.nodes[i];
1.25339 + var statement;
1.25340 + var to;
1.25341 + var from;
1.25342 + if (node instanceof IR.Throw) {
1.25343 + statement = compileValue(node, this, true);
1.25344 + } else {
1.25345 + if (node instanceof IR.Move) {
1.25346 + to = id(node.to.name);
1.25347 + this.useVariable(node.to);
1.25348 + from = compileValue(node.from, this);
1.25349 + } else {
1.25350 + if (node.variable) {
1.25351 + to = id(node.variable.name);
1.25352 + this.useVariable(node.variable);
1.25353 + } else {
1.25354 + to = null;
1.25355 + }
1.25356 + from = compileValue(node, this, true);
1.25357 + }
1.25358 + if (to) {
1.25359 + statement = new ExpressionStatement(assignment(to, from));
1.25360 + } else {
1.25361 + statement = new ExpressionStatement(from);
1.25362 + }
1.25363 + }
1.25364 + body.push(statement);
1.25365 + }
1.25366 + var end = block.nodes.last();
1.25367 + if (end instanceof IR.Stop) {
1.25368 + body.push(new ReturnStatement(compileValue(end.argument, this)));
1.25369 + }
1.25370 + var result = new BlockStatement(body);
1.25371 + result.end = block.nodes.last();
1.25372 + true;
1.25373 + return result;
1.25374 + };
1.25375 + function compileValue(value, cx, noVariable) {
1.25376 + true;
1.25377 + true;
1.25378 + true;
1.25379 + true;
1.25380 + if (noVariable || !value.variable) {
1.25381 + var node = value.compile(cx);
1.25382 + return node;
1.25383 + }
1.25384 + true;
1.25385 + return id(value.variable.name);
1.25386 + }
1.25387 + function compileMultiname(name, cx) {
1.25388 + return [
1.25389 + compileValue(name.namespaces, cx),
1.25390 + compileValue(name.name, cx),
1.25391 + constant(name.flags)
1.25392 + ];
1.25393 + }
1.25394 + function isArray(array) {
1.25395 + return array instanceof Array;
1.25396 + }
1.25397 + function compileValues(values, cx) {
1.25398 + true;
1.25399 + return values.map(function (value) {
1.25400 + return compileValue(value, cx);
1.25401 + });
1.25402 + }
1.25403 + IR.Parameter.prototype.compile = function (cx) {
1.25404 + cx.useParameter(this);
1.25405 + return id(this.name);
1.25406 + };
1.25407 + IR.Constant.prototype.compile = function (cx) {
1.25408 + return constant(this.value);
1.25409 + };
1.25410 + IR.Variable.prototype.compile = function (cx) {
1.25411 + return id(this.name);
1.25412 + };
1.25413 + IR.Phi.prototype.compile = function (cx) {
1.25414 + true;
1.25415 + return compileValue(this.variable, cx);
1.25416 + };
1.25417 + IR.ASScope.prototype.compile = function (cx) {
1.25418 + var parent = compileValue(this.parent, cx);
1.25419 + var object = compileValue(this.object, cx);
1.25420 + var isWith = new Literal(this.isWith);
1.25421 + return new NewExpression(id('Scope'), [
1.25422 + parent,
1.25423 + object,
1.25424 + isWith
1.25425 + ]);
1.25426 + };
1.25427 + IR.ASFindProperty.prototype.compile = function (cx) {
1.25428 + var scope = compileValue(this.scope, cx);
1.25429 + var name = compileMultiname(this.name, cx);
1.25430 + var domain = compileValue(this.domain, cx);
1.25431 + var strict = new Literal(this.strict);
1.25432 + return call(property(scope, 'findScopeProperty'), name.concat([
1.25433 + domain,
1.25434 + strict
1.25435 + ]));
1.25436 + };
1.25437 + IR.ASGetProperty.prototype.compile = function (cx) {
1.25438 + var object = compileValue(this.object, cx);
1.25439 + if (this.flags & IR.Flags.INDEXED) {
1.25440 + true;
1.25441 + return call(property(object, 'asGetNumericProperty'), [
1.25442 + compileValue(this.name.name, cx)
1.25443 + ]);
1.25444 + } else if (this.flags & IR.Flags.RESOLVED) {
1.25445 + return call(property(object, 'asGetResolvedStringProperty'), [
1.25446 + compileValue(this.name, cx)
1.25447 + ]);
1.25448 + }
1.25449 + var name = compileMultiname(this.name, cx);
1.25450 + var isMethod = new Literal(this.flags & IR.Flags.IS_METHOD);
1.25451 + return call(property(object, 'asGetProperty'), name.concat(isMethod));
1.25452 + };
1.25453 + IR.ASGetSuper.prototype.compile = function (cx) {
1.25454 + var scope = compileValue(this.scope, cx);
1.25455 + var object = compileValue(this.object, cx);
1.25456 + var name = compileMultiname(this.name, cx);
1.25457 + return call(property(object, 'asGetSuper'), [
1.25458 + scope
1.25459 + ].concat(name));
1.25460 + };
1.25461 + IR.Latch.prototype.compile = function (cx) {
1.25462 + return new ConditionalExpression(compileValue(this.condition, cx), compileValue(this.left, cx), compileValue(this.right, cx));
1.25463 + };
1.25464 + IR.Unary.prototype.compile = function (cx) {
1.25465 + return new UnaryExpression(this.operator.name, compileValue(this.argument, cx));
1.25466 + };
1.25467 + IR.Copy.prototype.compile = function (cx) {
1.25468 + return compileValue(this.argument, cx);
1.25469 + };
1.25470 + IR.Binary.prototype.compile = function (cx) {
1.25471 + var left = compileValue(this.left, cx);
1.25472 + var right = compileValue(this.right, cx);
1.25473 + if (this.operator === Operator.AS_ADD) {
1.25474 + return call(id('asAdd'), [
1.25475 + left,
1.25476 + right
1.25477 + ]);
1.25478 + }
1.25479 + return new BinaryExpression(this.operator.name, left, right);
1.25480 + };
1.25481 + IR.CallProperty.prototype.compile = function (cx) {
1.25482 + var object = compileValue(this.object, cx);
1.25483 + var name = compileValue(this.name, cx);
1.25484 + var callee = property(object, name);
1.25485 + var args = this.args.map(function (arg) {
1.25486 + return compileValue(arg, cx);
1.25487 + });
1.25488 + if (this.flags & IR.Flags.PRISTINE) {
1.25489 + return call(callee, args);
1.25490 + } else {
1.25491 + return callCall(callee, object, args);
1.25492 + }
1.25493 + };
1.25494 + IR.ASCallProperty.prototype.compile = function (cx) {
1.25495 + var object = compileValue(this.object, cx);
1.25496 + var args = this.args.map(function (arg) {
1.25497 + return compileValue(arg, cx);
1.25498 + });
1.25499 + if (this.flags & IR.Flags.RESOLVED) {
1.25500 + return call(property(object, 'asCallResolvedStringProperty'), [
1.25501 + compileValue(this.name, cx),
1.25502 + new Literal(this.isLex),
1.25503 + new ArrayExpression(args)
1.25504 + ]);
1.25505 + }
1.25506 + var name = compileMultiname(this.name, cx);
1.25507 + return call(property(object, 'asCallProperty'), name.concat([
1.25508 + new Literal(this.isLex),
1.25509 + new ArrayExpression(args)
1.25510 + ]));
1.25511 + };
1.25512 + IR.ASCallSuper.prototype.compile = function (cx) {
1.25513 + var scope = compileValue(this.scope, cx);
1.25514 + var object = compileValue(this.object, cx);
1.25515 + var args = this.args.map(function (arg) {
1.25516 + return compileValue(arg, cx);
1.25517 + });
1.25518 + var name = compileMultiname(this.name, cx);
1.25519 + return call(property(object, 'asCallSuper'), [
1.25520 + scope
1.25521 + ].concat(name).concat(new ArrayExpression(args)));
1.25522 + };
1.25523 + IR.Call.prototype.compile = function (cx) {
1.25524 + var args = this.args.map(function (arg) {
1.25525 + return compileValue(arg, cx);
1.25526 + });
1.25527 + var callee = compileValue(this.callee, cx);
1.25528 + var object;
1.25529 + if (this.object) {
1.25530 + object = compileValue(this.object, cx);
1.25531 + } else {
1.25532 + object = new Literal(null);
1.25533 + }
1.25534 + if (false && this.pristine && (this.callee instanceof IR.GetProperty && this.callee.object === this.object) || this.object === null) {
1.25535 + return call(callee, args);
1.25536 + } else {
1.25537 + return callCall(callee, object, args);
1.25538 + }
1.25539 + };
1.25540 + IR.ASNew.prototype.compile = function (cx) {
1.25541 + var args = this.args.map(function (arg) {
1.25542 + return compileValue(arg, cx);
1.25543 + });
1.25544 + var callee = compileValue(this.callee, cx);
1.25545 + callee = property(callee, 'instanceConstructor');
1.25546 + return new NewExpression(callee, args);
1.25547 + };
1.25548 + IR.This.prototype.compile = function (cx) {
1.25549 + return new ThisExpression();
1.25550 + };
1.25551 + IR.Throw.prototype.compile = function (cx) {
1.25552 + var argument = compileValue(this.argument, cx);
1.25553 + return new ThrowStatement(argument);
1.25554 + };
1.25555 + IR.Arguments.prototype.compile = function (cx) {
1.25556 + return id('arguments');
1.25557 + };
1.25558 + IR.ASGlobal.prototype.compile = function (cx) {
1.25559 + var scope = compileValue(this.scope, cx);
1.25560 + return property(scope, 'global', 'object');
1.25561 + };
1.25562 + IR.ASSetProperty.prototype.compile = function (cx) {
1.25563 + var object = compileValue(this.object, cx);
1.25564 + var value = compileValue(this.value, cx);
1.25565 + if (this.flags & IR.Flags.INDEXED) {
1.25566 + return call(property(object, 'asSetNumericProperty'), [
1.25567 + compileValue(this.name.name, cx),
1.25568 + value
1.25569 + ]);
1.25570 + }
1.25571 + var name = compileMultiname(this.name, cx);
1.25572 + return call(property(object, 'asSetProperty'), name.concat(value));
1.25573 + };
1.25574 + IR.ASSetSuper.prototype.compile = function (cx) {
1.25575 + var scope = compileValue(this.scope, cx);
1.25576 + var object = compileValue(this.object, cx);
1.25577 + var name = compileMultiname(this.name, cx);
1.25578 + var value = compileValue(this.value, cx);
1.25579 + return call(property(object, 'asSetSuper'), [
1.25580 + scope
1.25581 + ].concat(name).concat([
1.25582 + value
1.25583 + ]));
1.25584 + };
1.25585 + IR.ASDeleteProperty.prototype.compile = function (cx) {
1.25586 + var object = compileValue(this.object, cx);
1.25587 + var name = compileMultiname(this.name, cx);
1.25588 + return call(property(object, 'asDeleteProperty'), name);
1.25589 + };
1.25590 + IR.ASHasProperty.prototype.compile = function (cx) {
1.25591 + var object = compileValue(this.object, cx);
1.25592 + var name = compileMultiname(this.name, cx);
1.25593 + return call(property(object, 'asHasProperty'), name);
1.25594 + };
1.25595 + IR.GlobalProperty.prototype.compile = function (cx) {
1.25596 + return id(this.name);
1.25597 + };
1.25598 + IR.GetProperty.prototype.compile = function (cx) {
1.25599 + var object = compileValue(this.object, cx);
1.25600 + var name = compileValue(this.name, cx);
1.25601 + return property(object, name);
1.25602 + };
1.25603 + IR.SetProperty.prototype.compile = function (cx) {
1.25604 + var object = compileValue(this.object, cx);
1.25605 + var name = compileValue(this.name, cx);
1.25606 + var value = compileValue(this.value, cx);
1.25607 + return assignment(property(object, name), value);
1.25608 + };
1.25609 + IR.ASGetDescendants.prototype.compile = function (cx) {
1.25610 + var object = compileValue(this.object, cx);
1.25611 + var name = compileValue(this.name, cx);
1.25612 + return call(id('getDescendants'), [
1.25613 + object,
1.25614 + name
1.25615 + ]);
1.25616 + };
1.25617 + IR.ASSetSlot.prototype.compile = function (cx) {
1.25618 + var object = compileValue(this.object, cx);
1.25619 + var name = compileValue(this.name, cx);
1.25620 + var value = compileValue(this.value, cx);
1.25621 + return call(id('asSetSlot'), [
1.25622 + object,
1.25623 + name,
1.25624 + value
1.25625 + ]);
1.25626 + };
1.25627 + IR.ASGetSlot.prototype.compile = function (cx) {
1.25628 + var object = compileValue(this.object, cx);
1.25629 + var name = compileValue(this.name, cx);
1.25630 + return call(id('asGetSlot'), [
1.25631 + object,
1.25632 + name
1.25633 + ]);
1.25634 + };
1.25635 + IR.Projection.prototype.compile = function (cx) {
1.25636 + true;
1.25637 + true;
1.25638 + return compileValue(this.argument.scope, cx);
1.25639 + };
1.25640 + IR.NewArray.prototype.compile = function (cx) {
1.25641 + return new ArrayExpression(compileValues(this.elements, cx));
1.25642 + };
1.25643 + IR.NewObject.prototype.compile = function (cx) {
1.25644 + var properties = this.properties.map(function (property) {
1.25645 + var key = compileValue(property.key, cx);
1.25646 + var value = compileValue(property.value, cx);
1.25647 + return new Property(key, value, 'init');
1.25648 + });
1.25649 + return new ObjectExpression(properties);
1.25650 + };
1.25651 + IR.ASNewActivation.prototype.compile = function (cx) {
1.25652 + var methodInfo = compileValue(this.methodInfo, cx);
1.25653 + return call(id('asCreateActivation'), [
1.25654 + methodInfo
1.25655 + ]);
1.25656 + };
1.25657 + IR.ASMultiname.prototype.compile = function (cx) {
1.25658 + var namespaces = compileValue(this.namespaces, cx);
1.25659 + var name = compileValue(this.name, cx);
1.25660 + return call(id('createName'), [
1.25661 + namespaces,
1.25662 + name
1.25663 + ]);
1.25664 + };
1.25665 + function generateSource(node) {
1.25666 + return escodegen.generate(node, {
1.25667 + base: '',
1.25668 + indent: ' ',
1.25669 + comment: true,
1.25670 + format: {
1.25671 + compact: false
1.25672 + }
1.25673 + });
1.25674 + }
1.25675 + function generate(cfg, useRegisterAllocator) {
1.25676 + Timer.start('Looper');
1.25677 + var root = Looper.analyze(cfg);
1.25678 + Timer.stop();
1.25679 + var writer = new IndentingWriter();
1.25680 + var cx = new Context();
1.25681 + Timer.start('Construct AST');
1.25682 + var code = root.compile(cx);
1.25683 + Timer.stop();
1.25684 + var parameters = [];
1.25685 + for (var i = 0; i < cx.parameters.length; i++) {
1.25686 + var name = cx.parameters[i] ? cx.parameters[i].name : '_' + i;
1.25687 + parameters.push(id(name));
1.25688 + }
1.25689 + if (cx.variables.length) {
1.25690 + Counter.count('Backend: Locals', cx.variables.length);
1.25691 + var variables = variableDeclaration(cx.variables.map(function (variable) {
1.25692 + return new VariableDeclarator(id(variable.name));
1.25693 + }));
1.25694 + code.body.unshift(variables);
1.25695 + }
1.25696 + var node = new FunctionDeclaration(id('fn'), parameters, code);
1.25697 + if (useRegisterAllocator) {
1.25698 + if (c4TraceLevel.value > 0) {
1.25699 + writer.writeLn('=== BEFORE ===============================');
1.25700 + writer.writeLn(generateSource(node));
1.25701 + writer.writeLn('=== TRANSFORMING =========================');
1.25702 + }
1.25703 + Transform.transform(node);
1.25704 + if (c4TraceLevel.value > 0) {
1.25705 + writer.writeLn('=== AFTER ================================');
1.25706 + writer.writeLn(generateSource(node));
1.25707 + writer.writeLn('==========================================');
1.25708 + }
1.25709 + var body = generateSource(code);
1.25710 + return {
1.25711 + parameters: parameters.map(function (p) {
1.25712 + return p.name;
1.25713 + }),
1.25714 + body: body
1.25715 + };
1.25716 + }
1.25717 + Timer.start('Serialize AST');
1.25718 + var source = generateSource(code);
1.25719 + Timer.stop();
1.25720 + return {
1.25721 + parameters: parameters.map(function (p) {
1.25722 + return p.name;
1.25723 + }),
1.25724 + body: source
1.25725 + };
1.25726 + }
1.25727 + Backend.generate = generate;
1.25728 +}(typeof exports === 'undefined' ? Backend = {} : exports));
1.25729 +var Shumway;
1.25730 +(function (Shumway) {
1.25731 + (function (AVM2) {
1.25732 + (function (Runtime) {
1.25733 + var Multiname = Shumway.AVM2.ABC.Multiname;
1.25734 + var Namespace = Shumway.AVM2.ABC.Namespace;
1.25735 + var ClassInfo = Shumway.AVM2.ABC.ClassInfo;
1.25736 + var InstanceInfo = Shumway.AVM2.ABC.InstanceInfo;
1.25737 + var Trait = Shumway.AVM2.ABC.Trait;
1.25738 + var IndentingWriter = Shumway.IndentingWriter;
1.25739 + var createMap = Shumway.ObjectUtilities.createMap;
1.25740 + var defineNonEnumerableGetterOrSetter = Shumway.ObjectUtilities.defineNonEnumerableGetterOrSetter;
1.25741 + var defineNonEnumerableProperty = Shumway.ObjectUtilities.defineNonEnumerableProperty;
1.25742 + var defineReadOnlyProperty = Shumway.ObjectUtilities.defineReadOnlyProperty;
1.25743 + var bindSafely = Shumway.FunctionUtilities.bindSafely;
1.25744 + var vmNextTrampolineId = 1;
1.25745 + var vmNextMemoizerId = 1;
1.25746 + function getMethodOverrideKey(methodInfo) {
1.25747 + var key;
1.25748 + if (methodInfo.holder instanceof ClassInfo) {
1.25749 + key = 'static ' + methodInfo.holder.instanceInfo.name.getOriginalName() + '::' + methodInfo.name.getOriginalName();
1.25750 + } else if (methodInfo.holder instanceof InstanceInfo) {
1.25751 + key = methodInfo.holder.name.getOriginalName() + '::' + methodInfo.name.getOriginalName();
1.25752 + } else {
1.25753 + key = methodInfo.name.getOriginalName();
1.25754 + }
1.25755 + return key;
1.25756 + }
1.25757 + Runtime.getMethodOverrideKey = getMethodOverrideKey;
1.25758 + function checkMethodOverrides(methodInfo) {
1.25759 + if (methodInfo.name) {
1.25760 + var key = getMethodOverrideKey(methodInfo);
1.25761 + if (key in Shumway.AVM2.Runtime.VM_METHOD_OVERRIDES) {
1.25762 + Shumway.Debug.warning('Overriding Method: ' + key);
1.25763 + return Shumway.AVM2.Runtime.VM_METHOD_OVERRIDES[key];
1.25764 + }
1.25765 + }
1.25766 + }
1.25767 + Runtime.checkMethodOverrides = checkMethodOverrides;
1.25768 + function makeTrampoline(forward, parameterLength, description) {
1.25769 + true;
1.25770 + return function trampolineContext() {
1.25771 + var target = null;
1.25772 + var trampoline = function execute() {
1.25773 + if (Shumway.AVM2.Runtime.traceExecution.value >= 3) {
1.25774 + log('Trampolining');
1.25775 + }
1.25776 + Counter.count('Executing Trampoline');
1.25777 + Shumway.AVM2.Runtime.traceCallExecution.value > 1 && callWriter.writeLn('Trampoline: ' + description);
1.25778 + if (!target) {
1.25779 + target = forward(trampoline);
1.25780 + true;
1.25781 + }
1.25782 + return target.apply(this, arguments);
1.25783 + };
1.25784 + trampoline.trigger = function trigger() {
1.25785 + Counter.count('Triggering Trampoline');
1.25786 + if (!target) {
1.25787 + target = forward(trampoline);
1.25788 + true;
1.25789 + }
1.25790 + };
1.25791 + trampoline.isTrampoline = true;
1.25792 + trampoline.debugName = 'Trampoline #' + vmNextTrampolineId++;
1.25793 + defineReadOnlyProperty(trampoline, Shumway.AVM2.Runtime.VM_LENGTH, parameterLength);
1.25794 + return trampoline;
1.25795 + }();
1.25796 + }
1.25797 + Runtime.makeTrampoline = makeTrampoline;
1.25798 + function makeMemoizer(qn, target) {
1.25799 + function memoizer() {
1.25800 + Counter.count('Runtime: Memoizing');
1.25801 + if (Shumway.AVM2.Runtime.traceExecution.value >= 3) {
1.25802 + log('Memoizing: ' + qn);
1.25803 + }
1.25804 + Shumway.AVM2.Runtime.traceCallExecution.value > 1 && callWriter.writeLn('Memoizing: ' + qn);
1.25805 + if (Shumway.AVM2.Runtime.isNativePrototype(this)) {
1.25806 + Counter.count('Runtime: Method Closures');
1.25807 + return bindSafely(target.value, this);
1.25808 + }
1.25809 + if (isTrampoline(target.value)) {
1.25810 + target.value.trigger();
1.25811 + }
1.25812 + true;
1.25813 + var mc = null;
1.25814 + if (Shumway.AVM2.Runtime.isClass(this)) {
1.25815 + Counter.count('Runtime: Static Method Closures');
1.25816 + mc = bindSafely(target.value, this);
1.25817 + defineReadOnlyProperty(this, qn, mc);
1.25818 + return mc;
1.25819 + }
1.25820 + if (Object.prototype.hasOwnProperty.call(this, qn)) {
1.25821 + var pd = Object.getOwnPropertyDescriptor(this, qn);
1.25822 + if (pd.get) {
1.25823 + Counter.count('Runtime: Method Closures');
1.25824 + return bindSafely(target.value, this);
1.25825 + }
1.25826 + Counter.count('Runtime: Unpatched Memoizer');
1.25827 + return this[qn];
1.25828 + }
1.25829 + mc = bindSafely(target.value, this);
1.25830 + mc.methodInfo = target.value.methodInfo;
1.25831 + defineReadOnlyProperty(mc, Multiname.getPublicQualifiedName('prototype'), null);
1.25832 + defineReadOnlyProperty(this, qn, mc);
1.25833 + return mc;
1.25834 + }
1.25835 + var m = memoizer;
1.25836 + Counter.count('Runtime: Memoizers');
1.25837 + m.isMemoizer = true;
1.25838 + m.debugName = 'Memoizer #' + vmNextMemoizerId++;
1.25839 + return m;
1.25840 + }
1.25841 + Runtime.makeMemoizer = makeMemoizer;
1.25842 + function isTrampoline(fn) {
1.25843 + true;
1.25844 + return fn.isTrampoline;
1.25845 + }
1.25846 + Runtime.isTrampoline = isTrampoline;
1.25847 + function isMemoizer(fn) {
1.25848 + true;
1.25849 + return fn.isMemoizer;
1.25850 + }
1.25851 + Runtime.isMemoizer = isMemoizer;
1.25852 + }(AVM2.Runtime || (AVM2.Runtime = {})));
1.25853 + var Runtime = AVM2.Runtime;
1.25854 + }(Shumway.AVM2 || (Shumway.AVM2 = {})));
1.25855 + var AVM2 = Shumway.AVM2;
1.25856 +}(Shumway || (Shumway = {})));
1.25857 +var __extends = this.__extends || function (d, b) {
1.25858 + for (var p in b)
1.25859 + if (b.hasOwnProperty(p))
1.25860 + d[p] = b[p];
1.25861 + function __() {
1.25862 + this.constructor = d;
1.25863 + }
1.25864 + __.prototype = b.prototype;
1.25865 + d.prototype = new __();
1.25866 + };
1.25867 +var Shumway;
1.25868 +(function (Shumway) {
1.25869 + (function (AVM2) {
1.25870 + (function (Runtime) {
1.25871 + var Multiname = Shumway.AVM2.ABC.Multiname;
1.25872 + var Namespace = Shumway.AVM2.ABC.Namespace;
1.25873 + var MethodInfo = Shumway.AVM2.ABC.MethodInfo;
1.25874 + var ClassInfo = Shumway.AVM2.ABC.ClassInfo;
1.25875 + var InstanceInfo = Shumway.AVM2.ABC.InstanceInfo;
1.25876 + var ScriptInfo = Shumway.AVM2.ABC.ScriptInfo;
1.25877 + var Trait = Shumway.AVM2.ABC.Trait;
1.25878 + var IndentingWriter = Shumway.IndentingWriter;
1.25879 + var hasOwnProperty = Shumway.ObjectUtilities.hasOwnProperty;
1.25880 + var createMap = Shumway.ObjectUtilities.createMap;
1.25881 + var cloneObject = Shumway.ObjectUtilities.cloneObject;
1.25882 + var copyProperties = Shumway.ObjectUtilities.copyProperties;
1.25883 + var createEmptyObject = Shumway.ObjectUtilities.createEmptyObject;
1.25884 + var bindSafely = Shumway.FunctionUtilities.bindSafely;
1.25885 + var defineNonEnumerableGetterOrSetter = Shumway.ObjectUtilities.defineNonEnumerableGetterOrSetter;
1.25886 + var defineNonEnumerableProperty = Shumway.ObjectUtilities.defineNonEnumerableProperty;
1.25887 + var defineReadOnlyProperty = Shumway.ObjectUtilities.defineReadOnlyProperty;
1.25888 + var defineNonEnumerableGetter = Shumway.ObjectUtilities.defineNonEnumerableGetter;
1.25889 + var makeForwardingGetter = Shumway.FunctionUtilities.makeForwardingGetter;
1.25890 + var makeForwardingSetter = Shumway.FunctionUtilities.makeForwardingSetter;
1.25891 + var Binding = function () {
1.25892 + function Binding(trait) {
1.25893 + this.trait = trait;
1.25894 + }
1.25895 + Binding.getKey = function (qn, trait) {
1.25896 + var key = qn;
1.25897 + if (trait.isGetter()) {
1.25898 + key = Binding.GET_PREFIX + qn;
1.25899 + } else if (trait.isSetter()) {
1.25900 + key = Binding.SET_PREFIX + qn;
1.25901 + }
1.25902 + return key;
1.25903 + };
1.25904 + Binding.prototype.toString = function () {
1.25905 + return String(this.trait);
1.25906 + };
1.25907 + Binding.SET_PREFIX = 'set ';
1.25908 + Binding.GET_PREFIX = 'get ';
1.25909 + Binding.KEY_PREFIX_LENGTH = 4;
1.25910 + return Binding;
1.25911 + }();
1.25912 + Runtime.Binding = Binding;
1.25913 + var SlotInfo = function () {
1.25914 + function SlotInfo(name, isConst, type, trait) {
1.25915 + this.name = name;
1.25916 + this.isConst = isConst;
1.25917 + this.type = type;
1.25918 + this.trait = trait;
1.25919 + }
1.25920 + return SlotInfo;
1.25921 + }();
1.25922 + Runtime.SlotInfo = SlotInfo;
1.25923 + var SlotInfoMap = function () {
1.25924 + function SlotInfoMap() {
1.25925 + this.byID = createMap();
1.25926 + this.byQN = createMap();
1.25927 + }
1.25928 + return SlotInfoMap;
1.25929 + }();
1.25930 + Runtime.SlotInfoMap = SlotInfoMap;
1.25931 + var Bindings = function () {
1.25932 + function Bindings() {
1.25933 + this.map = createMap();
1.25934 + this.slots = [];
1.25935 + this.nextSlotId = 1;
1.25936 + }
1.25937 + Bindings.prototype.assignNextSlot = function (trait) {
1.25938 + true;
1.25939 + true;
1.25940 + if (!trait.slotId) {
1.25941 + trait.slotId = this.nextSlotId++;
1.25942 + } else {
1.25943 + this.nextSlotId = trait.slotId + 1;
1.25944 + }
1.25945 + true;
1.25946 + this.slots[trait.slotId] = trait;
1.25947 + };
1.25948 + Bindings.prototype.trace = function (writer) {
1.25949 + writer.enter('Bindings');
1.25950 + for (var key in this.map) {
1.25951 + var binding = this.map[key];
1.25952 + writer.writeLn(binding.trait.kindName() + ': ' + key + ' -> ' + binding);
1.25953 + }
1.25954 + writer.leaveAndEnter('Slots');
1.25955 + writer.writeArray(this.slots);
1.25956 + writer.outdent();
1.25957 + };
1.25958 + Bindings.prototype.applyTo = function (domain, object) {
1.25959 + true;
1.25960 + true;
1.25961 + true;
1.25962 + defineNonEnumerableProperty(object, Shumway.AVM2.Runtime.VM_SLOTS, new SlotInfoMap());
1.25963 + defineNonEnumerableProperty(object, Shumway.AVM2.Runtime.VM_BINDINGS, []);
1.25964 + defineNonEnumerableProperty(object, Shumway.AVM2.Runtime.VM_OPEN_METHODS, createMap());
1.25965 + defineNonEnumerableProperty(object, 'bindings', this);
1.25966 + defineNonEnumerableProperty(object, 'resolutionMap', []);
1.25967 + traitsWriter && traitsWriter.greenLn('Applying Traits');
1.25968 + for (var key in this.map) {
1.25969 + var binding = this.map[key];
1.25970 + var trait = binding.trait;
1.25971 + var qn = Multiname.getQualifiedName(trait.name);
1.25972 + if (trait.isSlot() || trait.isConst() || trait.isClass()) {
1.25973 + var defaultValue = undefined;
1.25974 + if (trait.isSlot() || trait.isConst()) {
1.25975 + if (trait.hasDefaultValue) {
1.25976 + defaultValue = trait.value;
1.25977 + } else if (trait.typeName) {
1.25978 + defaultValue = domain.findClassInfo(trait.typeName).defaultValue;
1.25979 + }
1.25980 + }
1.25981 + if (key !== qn) {
1.25982 + traitsWriter && traitsWriter.yellowLn('Binding Trait: ' + key + ' -> ' + qn);
1.25983 + defineNonEnumerableGetter(object, key, makeForwardingGetter(qn));
1.25984 + object.asBindings.pushUnique(key);
1.25985 + } else {
1.25986 + traitsWriter && traitsWriter.greenLn('Applying Trait ' + trait.kindName() + ': ' + trait);
1.25987 + defineNonEnumerableProperty(object, qn, defaultValue);
1.25988 + object.asBindings.pushUnique(qn);
1.25989 + var slotInfo = new SlotInfo(qn, trait.isConst(), trait.typeName ? domain.getProperty(trait.typeName, false, false) : null, trait);
1.25990 + object.asSlots.byID[trait.slotId] = slotInfo;
1.25991 + object.asSlots.byQN[qn] = slotInfo;
1.25992 + }
1.25993 + } else if (trait.isMethod() || trait.isGetter() || trait.isSetter()) {
1.25994 + if (trait.isGetter() || trait.isSetter()) {
1.25995 + key = key.substring(Binding.KEY_PREFIX_LENGTH);
1.25996 + }
1.25997 + if (key !== qn) {
1.25998 + traitsWriter && traitsWriter.yellowLn('Binding Trait: ' + key + ' -> ' + qn);
1.25999 + } else {
1.26000 + traitsWriter && traitsWriter.greenLn('Applying Trait ' + trait.kindName() + ': ' + trait);
1.26001 + }
1.26002 + object.asBindings.pushUnique(key);
1.26003 + if (this instanceof ScriptBindings) {
1.26004 + Shumway.AVM2.Runtime.applyNonMemoizedMethodTrait(key, trait, object, binding.scope, binding.natives);
1.26005 + } else {
1.26006 + Shumway.AVM2.Runtime.applyMemoizedMethodTrait(key, trait, object, binding.scope, binding.natives);
1.26007 + }
1.26008 + }
1.26009 + }
1.26010 + };
1.26011 + return Bindings;
1.26012 + }();
1.26013 + Runtime.Bindings = Bindings;
1.26014 + var ActivationBindings = function (_super) {
1.26015 + __extends(ActivationBindings, _super);
1.26016 + function ActivationBindings(methodInfo) {
1.26017 + _super.call(this);
1.26018 + true;
1.26019 + this.methodInfo = methodInfo;
1.26020 + var traits = methodInfo.traits;
1.26021 + for (var i = 0; i < traits.length; i++) {
1.26022 + var trait = traits[i];
1.26023 + true;
1.26024 + var key = Multiname.getQualifiedName(trait.name);
1.26025 + this.map[key] = new Binding(trait);
1.26026 + this.assignNextSlot(trait);
1.26027 + }
1.26028 + }
1.26029 + return ActivationBindings;
1.26030 + }(Bindings);
1.26031 + Runtime.ActivationBindings = ActivationBindings;
1.26032 + var CatchBindings = function (_super) {
1.26033 + __extends(CatchBindings, _super);
1.26034 + function CatchBindings(scope, trait) {
1.26035 + _super.call(this);
1.26036 + var key = Multiname.getQualifiedName(trait.name);
1.26037 + this.map[key] = new Binding(trait);
1.26038 + true;
1.26039 + this.assignNextSlot(trait);
1.26040 + }
1.26041 + return CatchBindings;
1.26042 + }(Bindings);
1.26043 + Runtime.CatchBindings = CatchBindings;
1.26044 + var ScriptBindings = function (_super) {
1.26045 + __extends(ScriptBindings, _super);
1.26046 + function ScriptBindings(scriptInfo, scope) {
1.26047 + _super.call(this);
1.26048 + this.scope = scope;
1.26049 + this.scriptInfo = scriptInfo;
1.26050 + var traits = scriptInfo.traits;
1.26051 + for (var i = 0; i < traits.length; i++) {
1.26052 + var trait = traits[i];
1.26053 + var name = Multiname.getQualifiedName(trait.name);
1.26054 + var key = Binding.getKey(name, trait);
1.26055 + var binding = this.map[key] = new Binding(trait);
1.26056 + if (trait.isSlot() || trait.isConst() || trait.isClass()) {
1.26057 + this.assignNextSlot(trait);
1.26058 + }
1.26059 + if (trait.isClass()) {
1.26060 + if (trait.metadata && trait.metadata.native) {
1.26061 + trait.classInfo.native = trait.metadata.native;
1.26062 + }
1.26063 + }
1.26064 + if (trait.isMethod() || trait.isGetter() || trait.isSetter()) {
1.26065 + binding.scope = this.scope;
1.26066 + }
1.26067 + }
1.26068 + }
1.26069 + return ScriptBindings;
1.26070 + }(Bindings);
1.26071 + Runtime.ScriptBindings = ScriptBindings;
1.26072 + var ClassBindings = function (_super) {
1.26073 + __extends(ClassBindings, _super);
1.26074 + function ClassBindings(classInfo, scope, natives) {
1.26075 + _super.call(this);
1.26076 + this.scope = scope;
1.26077 + this.natives = natives;
1.26078 + this.classInfo = classInfo;
1.26079 + var traits = classInfo.traits;
1.26080 + for (var i = 0; i < traits.length; i++) {
1.26081 + var trait = traits[i];
1.26082 + var name = Multiname.getQualifiedName(trait.name);
1.26083 + var key = Binding.getKey(name, trait);
1.26084 + var binding = this.map[key] = new Binding(trait);
1.26085 + if (trait.isSlot() || trait.isConst()) {
1.26086 + this.assignNextSlot(trait);
1.26087 + }
1.26088 + if (trait.isMethod() || trait.isGetter() || trait.isSetter()) {
1.26089 + binding.scope = this.scope;
1.26090 + binding.natives = this.natives;
1.26091 + }
1.26092 + }
1.26093 + }
1.26094 + return ClassBindings;
1.26095 + }(Bindings);
1.26096 + Runtime.ClassBindings = ClassBindings;
1.26097 + var InstanceBindings = function (_super) {
1.26098 + __extends(InstanceBindings, _super);
1.26099 + function InstanceBindings(parent, instanceInfo, scope, natives) {
1.26100 + _super.call(this);
1.26101 + this.scope = scope;
1.26102 + this.natives = natives;
1.26103 + this.parent = parent;
1.26104 + this.instanceInfo = instanceInfo;
1.26105 + this.implementedInterfaces = parent ? cloneObject(parent.implementedInterfaces) : createEmptyObject();
1.26106 + if (parent) {
1.26107 + this.slots = parent.slots.slice();
1.26108 + this.nextSlotId = parent.nextSlotId;
1.26109 + }
1.26110 + this.extend(parent);
1.26111 + }
1.26112 + InstanceBindings.prototype.extend = function (parent) {
1.26113 + var ii = this.instanceInfo, ib;
1.26114 + var map = this.map;
1.26115 + var name, key, trait, binding, protectedName, protectedKey;
1.26116 + if (parent) {
1.26117 + for (key in parent.map) {
1.26118 + binding = parent.map[key];
1.26119 + trait = binding.trait;
1.26120 + map[key] = binding;
1.26121 + if (trait.isProtected()) {
1.26122 + protectedName = Multiname.getQualifiedName(new Multiname([
1.26123 + ii.protectedNs
1.26124 + ], trait.name.getName()));
1.26125 + protectedKey = Binding.getKey(protectedName, trait);
1.26126 + map[protectedKey] = binding;
1.26127 + }
1.26128 + }
1.26129 + }
1.26130 + function writeOrOverwriteBinding(object, key, binding) {
1.26131 + var trait = binding.trait;
1.26132 + var oldBinding = object[key];
1.26133 + if (oldBinding) {
1.26134 + var oldTrait = oldBinding.trait;
1.26135 + true;
1.26136 + true;
1.26137 + } else {
1.26138 + true;
1.26139 + }
1.26140 + object[key] = binding;
1.26141 + }
1.26142 + function overwriteProtectedBinding(object, key, binding) {
1.26143 + if (key in object) {
1.26144 + object[key] = binding;
1.26145 + }
1.26146 + }
1.26147 + var traits = ii.traits;
1.26148 + for (var i = 0; i < traits.length; i++) {
1.26149 + trait = traits[i];
1.26150 + name = Multiname.getQualifiedName(trait.name);
1.26151 + key = Binding.getKey(name, trait);
1.26152 + binding = new Binding(trait);
1.26153 + writeOrOverwriteBinding(map, key, binding);
1.26154 + if (trait.isProtected()) {
1.26155 + ib = this.parent;
1.26156 + while (ib) {
1.26157 + protectedName = Multiname.getQualifiedName(new Multiname([
1.26158 + ib.instanceInfo.protectedNs
1.26159 + ], trait.name.getName()));
1.26160 + protectedKey = Binding.getKey(protectedName, trait);
1.26161 + overwriteProtectedBinding(map, protectedKey, binding);
1.26162 + ib = ib.parent;
1.26163 + }
1.26164 + }
1.26165 + if (trait.isSlot() || trait.isConst()) {
1.26166 + this.assignNextSlot(trait);
1.26167 + }
1.26168 + if (trait.isMethod() || trait.isGetter() || trait.isSetter()) {
1.26169 + binding.scope = this.scope;
1.26170 + binding.natives = this.natives;
1.26171 + }
1.26172 + }
1.26173 + var domain = ii.abc.applicationDomain;
1.26174 + var interfaces = ii.interfaces;
1.26175 + for (var i = 0; i < interfaces.length; i++) {
1.26176 + var interface = domain.getProperty(interfaces[i], true, true);
1.26177 + true;
1.26178 + copyProperties(this.implementedInterfaces, interface.interfaceBindings.implementedInterfaces);
1.26179 + this.implementedInterfaces[Multiname.getQualifiedName(interface.name)] = interface;
1.26180 + }
1.26181 + for (var interfaceName in this.implementedInterfaces) {
1.26182 + var interface = this.implementedInterfaces[interfaceName];
1.26183 + ib = interface.interfaceBindings;
1.26184 + for (var interfaceKey in ib.map) {
1.26185 + var interfaceBinding = ib.map[interfaceKey];
1.26186 + if (ii.isInterface()) {
1.26187 + map[interfaceKey] = interfaceBinding;
1.26188 + } else {
1.26189 + name = Multiname.getPublicQualifiedName(interfaceBinding.trait.name.getName());
1.26190 + key = Binding.getKey(name, interfaceBinding.trait);
1.26191 + map[interfaceKey] = map[key];
1.26192 + }
1.26193 + }
1.26194 + }
1.26195 + };
1.26196 + InstanceBindings.prototype.toString = function () {
1.26197 + return this.instanceInfo.toString();
1.26198 + };
1.26199 + return InstanceBindings;
1.26200 + }(Bindings);
1.26201 + Runtime.InstanceBindings = InstanceBindings;
1.26202 + var traitsWriter = null;
1.26203 + }(AVM2.Runtime || (AVM2.Runtime = {})));
1.26204 + var Runtime = AVM2.Runtime;
1.26205 + }(Shumway.AVM2 || (Shumway.AVM2 = {})));
1.26206 + var AVM2 = Shumway.AVM2;
1.26207 +}(Shumway || (Shumway = {})));
1.26208 +var Binding = Shumway.AVM2.Runtime.Binding;
1.26209 +var Bindings = Shumway.AVM2.Runtime.Bindings;
1.26210 +var ActivationBindings = Shumway.AVM2.Runtime.ActivationBindings;
1.26211 +var CatchBindings = Shumway.AVM2.Runtime.CatchBindings;
1.26212 +var ScriptBindings = Shumway.AVM2.Runtime.ScriptBindings;
1.26213 +var ClassBindings = Shumway.AVM2.Runtime.ClassBindings;
1.26214 +var InstanceBindings = Shumway.AVM2.Runtime.InstanceBindings;
1.26215 +var Shumway;
1.26216 +(function (Shumway) {
1.26217 + (function (AVM2) {
1.26218 + (function (Runtime) {
1.26219 + var Multiname = Shumway.AVM2.ABC.Multiname;
1.26220 + var Namespace = Shumway.AVM2.ABC.Namespace;
1.26221 + var MethodInfo = Shumway.AVM2.ABC.MethodInfo;
1.26222 + var ClassInfo = Shumway.AVM2.ABC.ClassInfo;
1.26223 + var InstanceInfo = Shumway.AVM2.ABC.InstanceInfo;
1.26224 + var InstanceBindings = Shumway.AVM2.Runtime.InstanceBindings;
1.26225 + var ClassBindings = Shumway.AVM2.Runtime.ClassBindings;
1.26226 + var defineNonEnumerableGetterOrSetter = Shumway.ObjectUtilities.defineNonEnumerableGetterOrSetter;
1.26227 + var defineNonEnumerableProperty = Shumway.ObjectUtilities.defineNonEnumerableProperty;
1.26228 + var defineReadOnlyProperty = Shumway.ObjectUtilities.defineReadOnlyProperty;
1.26229 + var defineNonEnumerableGetter = Shumway.ObjectUtilities.defineNonEnumerableGetter;
1.26230 + var createEmptyObject = Shumway.ObjectUtilities.createEmptyObject;
1.26231 + var toKeyValueArray = Shumway.ObjectUtilities.toKeyValueArray;
1.26232 + var boxValue = Shumway.ObjectUtilities.boxValue;
1.26233 + function makeCacheKey(namespaces, name, flags) {
1.26234 + if (!namespaces) {
1.26235 + return name;
1.26236 + } else if (namespaces.length > 1) {
1.26237 + return namespaces.runtimeId + '$' + name;
1.26238 + } else {
1.26239 + return namespaces[0].qualifiedName + '$' + name;
1.26240 + }
1.26241 + }
1.26242 + var Scope = function () {
1.26243 + function Scope(parent, object, isWith) {
1.26244 + if (typeof isWith === 'undefined') {
1.26245 + isWith = false;
1.26246 + }
1.26247 + this.parent = parent;
1.26248 + this.object = boxValue(object);
1.26249 + true;
1.26250 + this.global = parent ? parent.global : this;
1.26251 + this.isWith = isWith;
1.26252 + this.cache = createEmptyObject();
1.26253 + }
1.26254 + Scope.prototype.findDepth = function (object) {
1.26255 + var current = this;
1.26256 + var depth = 0;
1.26257 + while (current) {
1.26258 + if (current.object === object) {
1.26259 + return depth;
1.26260 + }
1.26261 + depth++;
1.26262 + current = current.parent;
1.26263 + }
1.26264 + return -1;
1.26265 + };
1.26266 + Scope.prototype.getScopeObjects = function () {
1.26267 + var objects = [];
1.26268 + var current = this;
1.26269 + while (current) {
1.26270 + objects.unshift(current.object);
1.26271 + current = current.parent;
1.26272 + }
1.26273 + return objects;
1.26274 + };
1.26275 + Scope.prototype.findScopeProperty = function (namespaces, name, flags, domain, strict, scopeOnly) {
1.26276 + Counter.count('findScopeProperty');
1.26277 + var object;
1.26278 + var key = makeCacheKey(namespaces, name, flags);
1.26279 + if (!scopeOnly && (object = this.cache[key])) {
1.26280 + return object;
1.26281 + }
1.26282 + if (this.object.asHasProperty(namespaces, name, flags, true)) {
1.26283 + return this.isWith ? this.object : this.cache[key] = this.object;
1.26284 + }
1.26285 + if (this.parent) {
1.26286 + return this.cache[key] = this.parent.findScopeProperty(namespaces, name, flags, domain, strict, scopeOnly);
1.26287 + }
1.26288 + if (scopeOnly)
1.26289 + return null;
1.26290 + if (object = domain.findDomainProperty(new Multiname(namespaces, name, flags), strict, true)) {
1.26291 + return object;
1.26292 + }
1.26293 + if (strict) {
1.26294 + Shumway.Debug.unexpected('Cannot find property ' + name);
1.26295 + }
1.26296 + return this.global.object;
1.26297 + };
1.26298 + return Scope;
1.26299 + }();
1.26300 + Runtime.Scope = Scope;
1.26301 + function bindFreeMethodScope(methodInfo, scope) {
1.26302 + var fn = methodInfo.freeMethod;
1.26303 + if (methodInfo.lastBoundMethod && methodInfo.lastBoundMethod.scope === scope) {
1.26304 + return methodInfo.lastBoundMethod.boundMethod;
1.26305 + }
1.26306 + true;
1.26307 + var boundMethod;
1.26308 + var asGlobal = scope.global.object;
1.26309 + if (!methodInfo.hasOptional() && !methodInfo.needsArguments() && !methodInfo.needsRest()) {
1.26310 + switch (methodInfo.parameters.length) {
1.26311 + case 0:
1.26312 + boundMethod = function () {
1.26313 + return fn.call(this === jsGlobal ? asGlobal : this, scope);
1.26314 + };
1.26315 + break;
1.26316 + case 1:
1.26317 + boundMethod = function (x) {
1.26318 + return fn.call(this === jsGlobal ? asGlobal : this, scope, x);
1.26319 + };
1.26320 + break;
1.26321 + case 2:
1.26322 + boundMethod = function (x, y) {
1.26323 + return fn.call(this === jsGlobal ? asGlobal : this, scope, x, y);
1.26324 + };
1.26325 + break;
1.26326 + case 3:
1.26327 + boundMethod = function (x, y, z) {
1.26328 + return fn.call(this === jsGlobal ? asGlobal : this, scope, x, y, z);
1.26329 + };
1.26330 + break;
1.26331 + default:
1.26332 + break;
1.26333 + }
1.26334 + }
1.26335 + if (!boundMethod) {
1.26336 + Counter.count('Bind Scope - Slow Path');
1.26337 + boundMethod = function () {
1.26338 + Array.prototype.unshift.call(arguments, scope);
1.26339 + var global = this === jsGlobal ? scope.global.object : this;
1.26340 + return fn.apply(global, arguments);
1.26341 + };
1.26342 + }
1.26343 + boundMethod.methodInfo = methodInfo;
1.26344 + boundMethod.instanceConstructor = boundMethod;
1.26345 + methodInfo.lastBoundMethod = {
1.26346 + scope: scope,
1.26347 + boundMethod: boundMethod
1.26348 + };
1.26349 + return boundMethod;
1.26350 + }
1.26351 + Runtime.bindFreeMethodScope = bindFreeMethodScope;
1.26352 + }(AVM2.Runtime || (AVM2.Runtime = {})));
1.26353 + var Runtime = AVM2.Runtime;
1.26354 + }(Shumway.AVM2 || (Shumway.AVM2 = {})));
1.26355 + var AVM2 = Shumway.AVM2;
1.26356 +}(Shumway || (Shumway = {})));
1.26357 +var playerglobalLoadedPromise;
1.26358 +var playerglobal;
1.26359 +var Shumway;
1.26360 +(function (Shumway) {
1.26361 + (function (AVM2) {
1.26362 + (function (Runtime) {
1.26363 + var AbcFile = Shumway.AVM2.ABC.AbcFile;
1.26364 + var Multiname = Shumway.AVM2.ABC.Multiname;
1.26365 + var Namespace = Shumway.AVM2.ABC.Namespace;
1.26366 + var MethodInfo = Shumway.AVM2.ABC.MethodInfo;
1.26367 + var ClassInfo = Shumway.AVM2.ABC.ClassInfo;
1.26368 + var InstanceInfo = Shumway.AVM2.ABC.InstanceInfo;
1.26369 + var ScriptInfo = Shumway.AVM2.ABC.ScriptInfo;
1.26370 + var createEmptyObject = Shumway.ObjectUtilities.createEmptyObject;
1.26371 + var IndentingWriter = Shumway.IndentingWriter;
1.26372 + (function (EXECUTION_MODE) {
1.26373 + EXECUTION_MODE[EXECUTION_MODE['INTERPRET'] = 1] = 'INTERPRET';
1.26374 + EXECUTION_MODE[EXECUTION_MODE['COMPILE'] = 2] = 'COMPILE';
1.26375 + }(Runtime.EXECUTION_MODE || (Runtime.EXECUTION_MODE = {})));
1.26376 + var EXECUTION_MODE = Runtime.EXECUTION_MODE;
1.26377 + function createNewCompartment() {
1.26378 + return newGlobal('new-compartment');
1.26379 + }
1.26380 + function executeScript(script) {
1.26381 + var abc = script.abc;
1.26382 + true;
1.26383 + var global = new Shumway.AVM2.Runtime.Global(script);
1.26384 + if (abc.applicationDomain.allowNatives) {
1.26385 + global[Multiname.getPublicQualifiedName('unsafeJSNative')] = getNative;
1.26386 + }
1.26387 + script.executing = true;
1.26388 + var scope = new Shumway.AVM2.Runtime.Scope(null, script.global);
1.26389 + createFunction(script.init, scope).call(script.global, false);
1.26390 + script.executed = true;
1.26391 + }
1.26392 + Runtime.executeScript = executeScript;
1.26393 + function ensureScriptIsExecuted(script, reason) {
1.26394 + if (typeof reason === 'undefined') {
1.26395 + reason = '';
1.26396 + }
1.26397 + if (!script.executed && !script.executing) {
1.26398 + if (Shumway.AVM2.Runtime.traceExecution.value >= 2) {
1.26399 + log('Executing Script For: ' + reason);
1.26400 + }
1.26401 + executeScript(script);
1.26402 + }
1.26403 + }
1.26404 + Runtime.ensureScriptIsExecuted = ensureScriptIsExecuted;
1.26405 + (function (Glue) {
1.26406 + Glue[Glue['PUBLIC_PROPERTIES'] = 1] = 'PUBLIC_PROPERTIES';
1.26407 + Glue[Glue['PUBLIC_METHODS'] = 2] = 'PUBLIC_METHODS';
1.26408 + Glue[Glue['ALL'] = 1 | 2] = 'ALL';
1.26409 + }(Runtime.Glue || (Runtime.Glue = {})));
1.26410 + var Glue = Runtime.Glue;
1.26411 + function grabAbc(abcName) {
1.26412 + var entry = playerglobal.scripts[abcName];
1.26413 + if (!entry) {
1.26414 + return null;
1.26415 + }
1.26416 + var offset = entry.offset;
1.26417 + var length = entry.length;
1.26418 + return new AbcFile(new Uint8Array(playerglobal.abcs, offset, length), abcName);
1.26419 + }
1.26420 + function findDefiningAbc(mn) {
1.26421 + if (!playerglobal) {
1.26422 + return null;
1.26423 + }
1.26424 + for (var i = 0; i < mn.namespaces.length; i++) {
1.26425 + var name = mn.namespaces[i].uri + ':' + mn.name;
1.26426 + var abcName = playerglobal.map[name];
1.26427 + if (abcName) {
1.26428 + break;
1.26429 + }
1.26430 + }
1.26431 + if (abcName) {
1.26432 + return grabAbc(abcName);
1.26433 + }
1.26434 + return null;
1.26435 + }
1.26436 + function promiseFile(path, responseType) {
1.26437 + return new Promise(function (resolve, reject) {
1.26438 + var xhr = new XMLHttpRequest();
1.26439 + xhr.open('GET', path);
1.26440 + xhr.responseType = responseType;
1.26441 + xhr.onload = function () {
1.26442 + if (xhr.response) {
1.26443 + resolve(xhr.response);
1.26444 + } else {
1.26445 + reject('Unable to load ' + path + ': ' + xhr.statusText);
1.26446 + }
1.26447 + };
1.26448 + xhr.send();
1.26449 + });
1.26450 + }
1.26451 + var AVM2 = function () {
1.26452 + function AVM2(sysMode, appMode, loadAVM1) {
1.26453 + this.systemDomain = new ApplicationDomain(this, null, sysMode, true);
1.26454 + this.applicationDomain = new ApplicationDomain(this, this.systemDomain, appMode, false);
1.26455 + this.findDefiningAbc = findDefiningAbc;
1.26456 + this.loadAVM1 = loadAVM1;
1.26457 + this.isAVM1Loaded = false;
1.26458 + this.exception = {
1.26459 + value: undefined
1.26460 + };
1.26461 + this.exceptions = [];
1.26462 + }
1.26463 + AVM2.initialize = function (sysMode, appMode, loadAVM1) {
1.26464 + AVM2.instance = new AVM2(sysMode, appMode, loadAVM1);
1.26465 + };
1.26466 + AVM2.currentAbc = function () {
1.26467 + var caller = arguments.callee;
1.26468 + var maxDepth = 20;
1.26469 + var abc = null;
1.26470 + for (var i = 0; i < maxDepth && caller; i++) {
1.26471 + var mi = caller.methodInfo;
1.26472 + if (mi) {
1.26473 + abc = mi.abc;
1.26474 + break;
1.26475 + }
1.26476 + caller = caller.caller;
1.26477 + }
1.26478 + return abc;
1.26479 + };
1.26480 + AVM2.currentDomain = function () {
1.26481 + var abc = AVM2.currentAbc();
1.26482 + return abc.applicationDomain;
1.26483 + };
1.26484 + AVM2.isPlayerglobalLoaded = function () {
1.26485 + return !(!playerglobal);
1.26486 + };
1.26487 + AVM2.loadPlayerglobal = function (abcsPath, catalogPath) {
1.26488 + if (playerglobalLoadedPromise) {
1.26489 + return Promise.reject('Playerglobal is already loaded');
1.26490 + }
1.26491 + playerglobalLoadedPromise = Promise.all([
1.26492 + promiseFile(abcsPath, 'arraybuffer'),
1.26493 + promiseFile(catalogPath, 'json')
1.26494 + ]).then(function (result) {
1.26495 + playerglobal = {
1.26496 + abcs: result[0],
1.26497 + map: Object.create(null),
1.26498 + scripts: Object.create(null)
1.26499 + };
1.26500 + var catalog = result[1];
1.26501 + for (var i = 0; i < catalog.length; i++) {
1.26502 + var abc = catalog[i];
1.26503 + playerglobal.scripts[abc.name] = abc;
1.26504 + if (typeof abc.defs === 'string') {
1.26505 + playerglobal.map[abc.defs] = abc.name;
1.26506 + } else {
1.26507 + for (var j = 0; j < abc.defs.length; j++) {
1.26508 + var def = abc.defs[j];
1.26509 + playerglobal.map[def] = abc.name;
1.26510 + }
1.26511 + }
1.26512 + }
1.26513 + }, function (e) {
1.26514 + console.error(e);
1.26515 + });
1.26516 + return playerglobalLoadedPromise;
1.26517 + };
1.26518 + AVM2.prototype.notifyConstruct = function (instanceConstructor, args) {
1.26519 + };
1.26520 + AVM2.getStackTrace = function () {
1.26521 + Shumway.Debug.notImplemented('getStackTrace');
1.26522 + };
1.26523 + return AVM2;
1.26524 + }();
1.26525 + Runtime.AVM2 = AVM2;
1.26526 + var ApplicationDomain = function () {
1.26527 + function ApplicationDomain(vm, base, mode, allowNatives) {
1.26528 + true;
1.26529 + true;
1.26530 + this.vm = vm;
1.26531 + this.abcs = [];
1.26532 + this.loadedAbcs = {};
1.26533 + this.loadedClasses = [];
1.26534 + this.classCache = createEmptyObject();
1.26535 + this.scriptCache = createEmptyObject();
1.26536 + this.classInfoCache = createEmptyObject();
1.26537 + this.base = base;
1.26538 + this.allowNatives = allowNatives;
1.26539 + this.mode = mode;
1.26540 + this.onMessage = new Callback();
1.26541 + if (base) {
1.26542 + this.system = base.system;
1.26543 + } else {
1.26544 + this.system = this;
1.26545 + }
1.26546 + }
1.26547 + ApplicationDomain.passthroughCallable = function (f) {
1.26548 + return {
1.26549 + call: function ($this) {
1.26550 + Array.prototype.shift.call(arguments);
1.26551 + return f.apply($this, arguments);
1.26552 + },
1.26553 + apply: function ($this, args) {
1.26554 + return f.apply($this, args);
1.26555 + }
1.26556 + };
1.26557 + };
1.26558 + ApplicationDomain.coerceCallable = function (type) {
1.26559 + return {
1.26560 + call: function ($this, value) {
1.26561 + return Shumway.AVM2.Runtime.asCoerce(type, value);
1.26562 + },
1.26563 + apply: function ($this, args) {
1.26564 + return Shumway.AVM2.Runtime.asCoerce(type, args[0]);
1.26565 + }
1.26566 + };
1.26567 + };
1.26568 + ApplicationDomain.constructingCallable = function (instanceConstructor) {
1.26569 + return {
1.26570 + call: function (self) {
1.26571 + return new (Function.bind.apply(instanceConstructor, arguments))();
1.26572 + },
1.26573 + apply: function (self, args) {
1.26574 + return new (Function.bind.apply(instanceConstructor, [
1.26575 + self
1.26576 + ].concat(args)))();
1.26577 + }
1.26578 + };
1.26579 + };
1.26580 + ApplicationDomain.prototype.getType = function (multiname) {
1.26581 + return this.getProperty(multiname, true, true);
1.26582 + };
1.26583 + ApplicationDomain.prototype.getProperty = function (multiname, strict, execute) {
1.26584 + var resolved = this.findDefiningScript(multiname, execute);
1.26585 + if (resolved) {
1.26586 + if (!resolved.script.executing) {
1.26587 + return undefined;
1.26588 + }
1.26589 + return resolved.script.global[Multiname.getQualifiedName(resolved.trait.name)];
1.26590 + }
1.26591 + if (strict) {
1.26592 + return Shumway.Debug.unexpected('Cannot find property ' + multiname);
1.26593 + }
1.26594 + return undefined;
1.26595 + };
1.26596 + ApplicationDomain.prototype.getClass = function (simpleName) {
1.26597 + var cache = this.classCache;
1.26598 + var c = cache[simpleName];
1.26599 + if (!c) {
1.26600 + c = cache[simpleName] = this.getProperty(Multiname.fromSimpleName(simpleName), true, true);
1.26601 + }
1.26602 + true;
1.26603 + return c;
1.26604 + };
1.26605 + ApplicationDomain.prototype.findClass = function (simpleName) {
1.26606 + if (simpleName in this.classCache) {
1.26607 + return true;
1.26608 + }
1.26609 + return this.findDomainProperty(Multiname.fromSimpleName(simpleName), false, true);
1.26610 + };
1.26611 + ApplicationDomain.prototype.findDomainProperty = function (multiname, strict, execute) {
1.26612 + if (Shumway.AVM2.Runtime.traceDomain.value) {
1.26613 + log('ApplicationDomain.findDomainProperty: ' + multiname);
1.26614 + }
1.26615 + var resolved = this.findDefiningScript(multiname, execute);
1.26616 + if (resolved) {
1.26617 + return resolved.script.global;
1.26618 + }
1.26619 + if (strict) {
1.26620 + return Shumway.Debug.unexpected('Cannot find property ' + multiname);
1.26621 + } else {
1.26622 + return undefined;
1.26623 + }
1.26624 + return undefined;
1.26625 + };
1.26626 + ApplicationDomain.prototype.findClassInfo = function (mn) {
1.26627 + var originalQn;
1.26628 + if (Multiname.isQName(mn)) {
1.26629 + originalQn = Multiname.getQualifiedName(mn);
1.26630 + var ci = this.classInfoCache[originalQn];
1.26631 + if (ci) {
1.26632 + return ci;
1.26633 + }
1.26634 + } else {
1.26635 + var ci = this.classInfoCache[mn.runtimeId];
1.26636 + if (ci) {
1.26637 + return ci;
1.26638 + }
1.26639 + }
1.26640 + if (this.base) {
1.26641 + ci = this.base.findClassInfo(mn);
1.26642 + if (ci) {
1.26643 + return ci;
1.26644 + }
1.26645 + }
1.26646 + var abcs = this.abcs;
1.26647 + for (var i = 0; i < abcs.length; i++) {
1.26648 + var abc = abcs[i];
1.26649 + var scripts = abc.scripts;
1.26650 + for (var j = 0; j < scripts.length; j++) {
1.26651 + var script = scripts[j];
1.26652 + var traits = script.traits;
1.26653 + for (var k = 0; k < traits.length; k++) {
1.26654 + var trait = traits[k];
1.26655 + if (trait.isClass()) {
1.26656 + var traitName = Multiname.getQualifiedName(trait.name);
1.26657 + if (originalQn) {
1.26658 + if (traitName === originalQn) {
1.26659 + return this.classInfoCache[originalQn] = trait.classInfo;
1.26660 + }
1.26661 + } else {
1.26662 + for (var m = 0, n = mn.namespaces.length; m < n; m++) {
1.26663 + var qn = mn.getQName(m);
1.26664 + if (traitName === Multiname.getQualifiedName(qn)) {
1.26665 + return this.classInfoCache[qn] = trait.classInfo;
1.26666 + }
1.26667 + }
1.26668 + }
1.26669 + }
1.26670 + }
1.26671 + }
1.26672 + }
1.26673 + if (!this.base && this.vm.findDefiningAbc) {
1.26674 + var abc = this.vm.findDefiningAbc(mn);
1.26675 + if (abc !== null && !this.loadedAbcs[abc.name]) {
1.26676 + this.loadedAbcs[abc.name] = true;
1.26677 + this.loadAbc(abc);
1.26678 + return this.findClassInfo(mn);
1.26679 + }
1.26680 + }
1.26681 + return undefined;
1.26682 + };
1.26683 + ApplicationDomain.prototype.installNative = function (name, func) {
1.26684 + natives[name] = function () {
1.26685 + return func;
1.26686 + };
1.26687 + };
1.26688 + ApplicationDomain.prototype.findDefiningScript = function (mn, execute) {
1.26689 + var resolved = this.scriptCache[mn.runtimeId];
1.26690 + if (resolved && (resolved.script.executed || !execute)) {
1.26691 + return resolved;
1.26692 + }
1.26693 + if (this.base) {
1.26694 + resolved = this.base.findDefiningScript(mn, execute);
1.26695 + if (resolved) {
1.26696 + return resolved;
1.26697 + }
1.26698 + }
1.26699 + Counter.count('ApplicationDomain: findDefiningScript');
1.26700 + var abcs = this.abcs;
1.26701 + for (var i = 0; i < abcs.length; i++) {
1.26702 + var abc = abcs[i];
1.26703 + var scripts = abc.scripts;
1.26704 + for (var j = 0; j < scripts.length; j++) {
1.26705 + var script = scripts[j];
1.26706 + var traits = script.traits;
1.26707 + if (mn instanceof Multiname) {
1.26708 + for (var k = 0; k < traits.length; k++) {
1.26709 + var trait = traits[k];
1.26710 + if (mn.hasQName(trait.name)) {
1.26711 + if (execute) {
1.26712 + ensureScriptIsExecuted(script, String(trait.name));
1.26713 + }
1.26714 + return this.scriptCache[mn.runtimeId] = {
1.26715 + script: script,
1.26716 + trait: trait
1.26717 + };
1.26718 + }
1.26719 + }
1.26720 + } else {
1.26721 + Shumway.Debug.unexpected();
1.26722 + }
1.26723 + }
1.26724 + }
1.26725 + if (!this.base && this.vm.findDefiningAbc) {
1.26726 + var abc = this.vm.findDefiningAbc(mn);
1.26727 + if (abc !== null && !this.loadedAbcs[abc.name]) {
1.26728 + this.loadedAbcs[abc.name] = true;
1.26729 + this.loadAbc(abc);
1.26730 + return this.findDefiningScript(mn, execute);
1.26731 + }
1.26732 + }
1.26733 + return undefined;
1.26734 + };
1.26735 + ApplicationDomain.prototype.compileAbc = function (abc, writer) {
1.26736 + compileAbc(abc, writer);
1.26737 + };
1.26738 + ApplicationDomain.prototype.executeAbc = function (abc) {
1.26739 + this.loadAbc(abc);
1.26740 + executeScript(abc.lastScript);
1.26741 + };
1.26742 + ApplicationDomain.prototype.loadAbc = function (abc) {
1.26743 + if (Shumway.AVM2.Runtime.traceExecution.value) {
1.26744 + log('Loading: ' + abc.name);
1.26745 + }
1.26746 + abc.applicationDomain = this;
1.26747 + GlobalMultinameResolver.loadAbc(abc);
1.26748 + this.abcs.push(abc);
1.26749 + if (!this.base) {
1.26750 + Type.initializeTypes(this);
1.26751 + }
1.26752 + };
1.26753 + ApplicationDomain.prototype.broadcastMessage = function (type, message, origin) {
1.26754 + if (debug) {
1.26755 + Timer.start('broadcast: ' + type);
1.26756 + }
1.26757 + try {
1.26758 + this.onMessage.notify1(type, {
1.26759 + data: message,
1.26760 + origin: origin,
1.26761 + source: this
1.26762 + });
1.26763 + } catch (e) {
1.26764 + avm2.exceptions.push({
1.26765 + source: type,
1.26766 + message: e.message,
1.26767 + stack: e.stack
1.26768 + });
1.26769 + throw e;
1.26770 + }
1.26771 + if (debug) {
1.26772 + Timer.stop();
1.26773 + }
1.26774 + };
1.26775 + ApplicationDomain.prototype.traceLoadedClasses = function (lastOnly) {
1.26776 + var writer = new IndentingWriter();
1.26777 + lastOnly || writer.enter('Loaded Classes And Interfaces');
1.26778 + var classes = lastOnly ? [
1.26779 + this.loadedClasses.last()
1.26780 + ] : this.loadedClasses;
1.26781 + classes.forEach(function (cls) {
1.26782 + if (cls !== Shumway.AVM2.Runtime.Class) {
1.26783 + cls.trace(writer);
1.26784 + }
1.26785 + });
1.26786 + lastOnly || writer.leave('');
1.26787 + };
1.26788 + return ApplicationDomain;
1.26789 + }();
1.26790 + Runtime.ApplicationDomain = ApplicationDomain;
1.26791 + var SecurityDomain = function () {
1.26792 + function SecurityDomain() {
1.26793 + this.compartment = createNewCompartment();
1.26794 + this.compartment.homePath = homePath;
1.26795 + this.compartment.release = true;
1.26796 + this.compartment.eval(snarf('compartment.js'));
1.26797 + }
1.26798 + SecurityDomain.prototype.initializeShell = function (sysMode, appMode) {
1.26799 + var compartment = this.compartment;
1.26800 + compartment.AVM2.initialize(sysMode, appMode);
1.26801 + compartment.AVM2.instance.systemDomain.executeAbc(compartment.grabAbc(homePath + 'src/avm2/generated/builtin/builtin.abc'));
1.26802 + compartment.AVM2.instance.systemDomain.executeAbc(compartment.grabAbc(homePath + 'src/avm2/generated/shell/shell.abc'));
1.26803 + this.systemDomain = compartment.AVM2.instance.systemDomain;
1.26804 + this.applicationDomain = compartment.AVM2.instance.applicationDomain;
1.26805 + };
1.26806 + return SecurityDomain;
1.26807 + }();
1.26808 + Runtime.SecurityDomain = SecurityDomain;
1.26809 + }(AVM2.Runtime || (AVM2.Runtime = {})));
1.26810 + var Runtime = AVM2.Runtime;
1.26811 + }(Shumway.AVM2 || (Shumway.AVM2 = {})));
1.26812 + var AVM2 = Shumway.AVM2;
1.26813 +}(Shumway || (Shumway = {})));
1.26814 +var Glue = Shumway.AVM2.Runtime.Glue;
1.26815 +var ApplicationDomain = Shumway.AVM2.Runtime.ApplicationDomain;
1.26816 +var AVM2 = Shumway.AVM2.Runtime.AVM2;
1.26817 +var EXECUTION_MODE = Shumway.AVM2.Runtime.EXECUTION_MODE;
1.26818 +var ApplicationDomain = Shumway.AVM2.Runtime.ApplicationDomain;
1.26819 +var AVM2 = Shumway.AVM2.Runtime.AVM2;
1.26820 +var EXECUTION_MODE = Shumway.AVM2.Runtime.EXECUTION_MODE;
1.26821 +var Shumway;
1.26822 +(function (Shumway) {
1.26823 + (function (AVM2) {
1.26824 + (function (Runtime) {
1.26825 + var Multiname = Shumway.AVM2.ABC.Multiname;
1.26826 + var Namespace = Shumway.AVM2.ABC.Namespace;
1.26827 + var ClassInfo = Shumway.AVM2.ABC.ClassInfo;
1.26828 + var InstanceInfo = Shumway.AVM2.ABC.InstanceInfo;
1.26829 + var InstanceBindings = Shumway.AVM2.Runtime.InstanceBindings;
1.26830 + var ClassBindings = Shumway.AVM2.Runtime.ClassBindings;
1.26831 + var defineNonEnumerableGetterOrSetter = Shumway.ObjectUtilities.defineNonEnumerableGetterOrSetter;
1.26832 + var defineNonEnumerableProperty = Shumway.ObjectUtilities.defineNonEnumerableProperty;
1.26833 + var defineReadOnlyProperty = Shumway.ObjectUtilities.defineReadOnlyProperty;
1.26834 + var defineNonEnumerableGetter = Shumway.ObjectUtilities.defineNonEnumerableGetter;
1.26835 + var createEmptyObject = Shumway.ObjectUtilities.createEmptyObject;
1.26836 + var toKeyValueArray = Shumway.ObjectUtilities.toKeyValueArray;
1.26837 + var Interface = function () {
1.26838 + function Interface(classInfo) {
1.26839 + var ii = classInfo.instanceInfo;
1.26840 + true;
1.26841 + this.name = ii.name;
1.26842 + this.classInfo = classInfo;
1.26843 + }
1.26844 + Interface.createInterface = function (classInfo) {
1.26845 + var ii = classInfo.instanceInfo;
1.26846 + true;
1.26847 + if (Shumway.AVM2.Runtime.traceExecution.value) {
1.26848 + var str = 'Creating Interface ' + ii.name;
1.26849 + if (ii.interfaces.length) {
1.26850 + str += ' implements ' + ii.interfaces.map(function (name) {
1.26851 + return name.getName();
1.26852 + }).join(', ');
1.26853 + }
1.26854 + log(str);
1.26855 + }
1.26856 + var cls = new Interface(classInfo);
1.26857 + cls.interfaceBindings = new InstanceBindings(null, ii, null, null);
1.26858 + return cls;
1.26859 + };
1.26860 + Interface.prototype.toString = function () {
1.26861 + return '[interface ' + this.name + ']';
1.26862 + };
1.26863 + Interface.prototype.isInstance = function (value) {
1.26864 + if (value === null || typeof value !== 'object') {
1.26865 + return false;
1.26866 + }
1.26867 + true;
1.26868 + var qualifiedName = Multiname.getQualifiedName(this.name);
1.26869 + return value.class.implementedInterfaces[qualifiedName] !== undefined;
1.26870 + };
1.26871 + Interface.prototype.trace = function (writer) {
1.26872 + writer.enter('interface ' + this.name.getName());
1.26873 + writer.enter('interfaceBindings: ');
1.26874 + this.interfaceBindings.trace(writer);
1.26875 + writer.outdent();
1.26876 + writer.outdent();
1.26877 + writer.leave('}');
1.26878 + };
1.26879 + Interface.prototype.call = function (self, x) {
1.26880 + return x;
1.26881 + };
1.26882 + Interface.prototype.apply = function (self, args) {
1.26883 + return args[0];
1.26884 + };
1.26885 + return Interface;
1.26886 + }();
1.26887 + Runtime.Interface = Interface;
1.26888 + function setDefaultProperties(cls) {
1.26889 + defineNonEnumerableProperty(cls.dynamicPrototype, Multiname.getPublicQualifiedName('constructor'), cls);
1.26890 + defineReadOnlyProperty(cls.traitsPrototype, 'class', cls);
1.26891 + defineReadOnlyProperty(cls.instanceConstructor, 'class', cls);
1.26892 + }
1.26893 + Runtime.setDefaultProperties = setDefaultProperties;
1.26894 + var Class = function () {
1.26895 + function Class(name, instanceConstructor, callable) {
1.26896 + this.debugName = name;
1.26897 + if (instanceConstructor) {
1.26898 + true;
1.26899 + this.instanceConstructor = instanceConstructor;
1.26900 + this.instanceConstructorNoInitialize = instanceConstructor;
1.26901 + this.hasInitialize = 0;
1.26902 + this.instanceConstructor.class = this;
1.26903 + }
1.26904 + if (!callable) {
1.26905 + callable = Shumway.AVM2.Runtime.ApplicationDomain.coerceCallable(this);
1.26906 + } else if (callable === Shumway.AVM2.Runtime.ApplicationDomain.coerceCallable) {
1.26907 + callable = Shumway.AVM2.Runtime.ApplicationDomain.coerceCallable(this);
1.26908 + }
1.26909 + defineNonEnumerableProperty(this, 'call', callable.call);
1.26910 + defineNonEnumerableProperty(this, 'apply', callable.apply);
1.26911 + }
1.26912 + Class.createClass = function (classInfo, baseClass, scope) {
1.26913 + var ci = classInfo;
1.26914 + var ii = ci.instanceInfo;
1.26915 + var domain = ci.abc.applicationDomain;
1.26916 + var className = Multiname.getName(ii.name);
1.26917 + var isNativeClass = ci.native;
1.26918 + if (isNativeClass) {
1.26919 + var buildClass = getNative(ci.native.cls);
1.26920 + if (!buildClass) {
1.26921 + Shumway.Debug.unexpected('No native for ' + ci.native.cls);
1.26922 + }
1.26923 + if (!baseClass) {
1.26924 + scope = new Scope(scope, Class);
1.26925 + }
1.26926 + }
1.26927 + var classScope = new Scope(scope, null);
1.26928 + var instanceConstructor = createFunction(ii.init, classScope, false);
1.26929 + var cls;
1.26930 + if (isNativeClass) {
1.26931 + cls = buildClass(domain, classScope, instanceConstructor, baseClass);
1.26932 + } else {
1.26933 + cls = new Class(className, instanceConstructor);
1.26934 + }
1.26935 + cls.className = className;
1.26936 + cls.classInfo = classInfo;
1.26937 + cls.scope = classScope;
1.26938 + classScope.object = cls;
1.26939 + var classNatives;
1.26940 + var instanceNatives;
1.26941 + if (isNativeClass) {
1.26942 + if (cls.native) {
1.26943 + classNatives = cls.native.static;
1.26944 + instanceNatives = cls.native.instance;
1.26945 + }
1.26946 + } else {
1.26947 + cls.extend(baseClass);
1.26948 + }
1.26949 + cls.classBindings = new ClassBindings(classInfo, classScope, classNatives);
1.26950 + cls.classBindings.applyTo(domain, cls);
1.26951 + defineReadOnlyProperty(cls, Shumway.AVM2.Runtime.VM_IS_CLASS, true);
1.26952 + cls.instanceBindings = new InstanceBindings(baseClass ? baseClass.instanceBindings : null, ii, classScope, instanceNatives);
1.26953 + if (cls.instanceConstructor) {
1.26954 + cls.instanceBindings.applyTo(domain, cls.traitsPrototype);
1.26955 + }
1.26956 + cls.implementedInterfaces = cls.instanceBindings.implementedInterfaces;
1.26957 + return cls;
1.26958 + };
1.26959 + Class.prototype.setSymbol = function (props) {
1.26960 + this.instanceConstructor.prototype.symbol = props;
1.26961 + };
1.26962 + Class.prototype.getSymbol = function () {
1.26963 + return this.instanceConstructor.prototype.symbol;
1.26964 + };
1.26965 + Class.prototype.initializeInstance = function (obj) {
1.26966 + var c = this;
1.26967 + var initializes = [];
1.26968 + while (c) {
1.26969 + if (c.hasInitialize & Class.OWN_INITIALIZE) {
1.26970 + initializes.push(c.instanceConstructor.prototype.initialize);
1.26971 + }
1.26972 + c = c.baseClass;
1.26973 + }
1.26974 + var s;
1.26975 + while (s = initializes.pop()) {
1.26976 + s.call(obj);
1.26977 + }
1.26978 + Counter.count('Initialize Instance ' + obj.class);
1.26979 + };
1.26980 + Class.prototype.createInstance = function (args) {
1.26981 + var o = Object.create(this.instanceConstructor.prototype);
1.26982 + this.instanceConstructor.apply(o, args);
1.26983 + return o;
1.26984 + };
1.26985 + Class.prototype.createAsSymbol = function (props) {
1.26986 + var o = Object.create(this.instanceConstructor.prototype);
1.26987 + if (o.symbol) {
1.26988 + var symbol = Object.create(o.symbol);
1.26989 + for (var prop in props) {
1.26990 + symbol[prop] = props[prop];
1.26991 + }
1.26992 + o.symbol = symbol;
1.26993 + } else {
1.26994 + o.symbol = props;
1.26995 + }
1.26996 + return o;
1.26997 + };
1.26998 + Class.prototype.extendNative = function (baseClass, native) {
1.26999 + this.baseClass = baseClass;
1.27000 + this.dynamicPrototype = Object.getPrototypeOf(native.prototype);
1.27001 + this.instanceConstructor.prototype = this.traitsPrototype = native.prototype;
1.27002 + setDefaultProperties(this);
1.27003 + };
1.27004 + Class.prototype.extendWrapper = function (baseClass, wrapper) {
1.27005 + true;
1.27006 + this.baseClass = baseClass;
1.27007 + this.dynamicPrototype = Object.create(baseClass.dynamicPrototype);
1.27008 + var traitsPrototype = Object.create(this.dynamicPrototype, Shumway.ObjectUtilities.getOwnPropertyDescriptors(wrapper.prototype));
1.27009 + this.instanceConstructor.prototype = this.traitsPrototype = traitsPrototype;
1.27010 + setDefaultProperties(this);
1.27011 + };
1.27012 + Class.prototype.extendBuiltin = function (baseClass) {
1.27013 + true;
1.27014 + this.baseClass = baseClass;
1.27015 + this.dynamicPrototype = this.traitsPrototype = this.instanceConstructor.prototype;
1.27016 + setDefaultProperties(this);
1.27017 + };
1.27018 + Class.prototype.extend = function (baseClass) {
1.27019 + true;
1.27020 + this.baseClass = baseClass;
1.27021 + this.dynamicPrototype = Object.create(baseClass.dynamicPrototype);
1.27022 + if (baseClass.hasInitialize) {
1.27023 + var instanceConstructorNoInitialize = this.instanceConstructor;
1.27024 + var self = this;
1.27025 + this.instanceConstructor = function () {
1.27026 + self.initializeInstance(this);
1.27027 + instanceConstructorNoInitialize.apply(this, arguments);
1.27028 + };
1.27029 + defineReadOnlyProperty(this.instanceConstructor, 'class', instanceConstructorNoInitialize.class);
1.27030 + this.hasInitialize |= Class.SUPER_INITIALIZE;
1.27031 + }
1.27032 + this.instanceConstructor.prototype = this.traitsPrototype = Object.create(this.dynamicPrototype);
1.27033 + setDefaultProperties(this);
1.27034 + };
1.27035 + Class.prototype.setDefaultProperties = function () {
1.27036 + setDefaultProperties(this);
1.27037 + };
1.27038 + Class.prototype.link = function (definition) {
1.27039 + true;
1.27040 + true;
1.27041 + if (definition.initialize) {
1.27042 + if (!this.hasInitialize) {
1.27043 + var instanceConstructorNoInitialize = this.instanceConstructor;
1.27044 + var self = this;
1.27045 + this.instanceConstructor = function () {
1.27046 + self.initializeInstance(this);
1.27047 + instanceConstructorNoInitialize.apply(this, arguments);
1.27048 + };
1.27049 + defineReadOnlyProperty(this.instanceConstructor, 'class', instanceConstructorNoInitialize.class);
1.27050 + this.instanceConstructor.prototype = instanceConstructorNoInitialize.prototype;
1.27051 + }
1.27052 + this.hasInitialize |= Class.OWN_INITIALIZE;
1.27053 + }
1.27054 + var dynamicPrototype = this.dynamicPrototype;
1.27055 + var keys = Object.keys(definition);
1.27056 + for (var i = 0; i < keys.length; i++) {
1.27057 + var propertyName = keys[i];
1.27058 + Object.defineProperty(dynamicPrototype, propertyName, Object.getOwnPropertyDescriptor(definition, propertyName));
1.27059 + }
1.27060 + function glueProperties(obj, properties) {
1.27061 + var keys = Object.keys(properties);
1.27062 + for (var i = 0; i < keys.length; i++) {
1.27063 + var propertyName = keys[i];
1.27064 + var propertyGlue = properties[propertyName];
1.27065 + var propertySimpleName;
1.27066 + var glueOpenMethod = false;
1.27067 + if (propertyGlue.indexOf('open ') >= 0) {
1.27068 + propertySimpleName = propertyGlue.substring(5);
1.27069 + glueOpenMethod = true;
1.27070 + } else {
1.27071 + propertySimpleName = propertyGlue;
1.27072 + }
1.27073 + true;
1.27074 + var qn = Multiname.getQualifiedName(Multiname.fromSimpleName(propertySimpleName));
1.27075 + if (glueOpenMethod) {
1.27076 + qn = Shumway.AVM2.Runtime.VM_OPEN_METHOD_PREFIX + qn;
1.27077 + }
1.27078 + true;
1.27079 + var descriptor = Object.getOwnPropertyDescriptor(obj, qn);
1.27080 + if (descriptor && descriptor.get) {
1.27081 + Object.defineProperty(obj, propertyName, descriptor);
1.27082 + } else {
1.27083 + Object.defineProperty(obj, propertyName, {
1.27084 + get: new Function('', 'return this.' + qn),
1.27085 + set: new Function('v', 'this.' + qn + ' = v')
1.27086 + });
1.27087 + }
1.27088 + }
1.27089 + }
1.27090 + function generatePropertiesFromTraits(traits) {
1.27091 + var properties = createEmptyObject();
1.27092 + traits.forEach(function (trait) {
1.27093 + var ns = trait.name.getNamespace();
1.27094 + if (!ns.isPublic()) {
1.27095 + return;
1.27096 + }
1.27097 + properties[trait.name.getName()] = (trait.isMethod() ? 'open ' : '') + 'public ' + trait.name.getName();
1.27098 + });
1.27099 + return properties;
1.27100 + }
1.27101 + var glue = definition.__glue__;
1.27102 + if (!glue) {
1.27103 + return;
1.27104 + }
1.27105 + if (glue.script) {
1.27106 + if (glue.script.instance) {
1.27107 + if (Shumway.isNumber(glue.script.instance)) {
1.27108 + true;
1.27109 + glueProperties(dynamicPrototype, generatePropertiesFromTraits(this.classInfo.instanceInfo.traits));
1.27110 + } else {
1.27111 + glueProperties(dynamicPrototype, glue.script.instance);
1.27112 + }
1.27113 + }
1.27114 + if (glue.script.static) {
1.27115 + if (Shumway.isNumber(glue.script.static)) {
1.27116 + true;
1.27117 + glueProperties(this, generatePropertiesFromTraits(this.classInfo.traits));
1.27118 + } else {
1.27119 + glueProperties(this, glue.script.static);
1.27120 + }
1.27121 + }
1.27122 + }
1.27123 + };
1.27124 + Class.prototype.linkNatives = function (definition) {
1.27125 + var glue = definition.__glue__;
1.27126 + this.native = glue.native;
1.27127 + };
1.27128 + Class.prototype.verify = function () {
1.27129 + var instanceConstructor = this.instanceConstructor;
1.27130 + var tP = this.traitsPrototype;
1.27131 + var dP = this.dynamicPrototype;
1.27132 + true;
1.27133 + true;
1.27134 + true;
1.27135 + true;
1.27136 + if (tP !== Object.prototype) {
1.27137 + }
1.27138 + true;
1.27139 + };
1.27140 + Class.prototype.coerce = function (value) {
1.27141 + return value;
1.27142 + };
1.27143 + Class.prototype.isInstanceOf = function (value) {
1.27144 + return this.isInstance(value);
1.27145 + };
1.27146 + Class.prototype.isInstance = function (value) {
1.27147 + if (value === null || typeof value !== 'object') {
1.27148 + return false;
1.27149 + }
1.27150 + return this.dynamicPrototype.isPrototypeOf(value);
1.27151 + };
1.27152 + Class.prototype.trace = function (writer) {
1.27153 + var description = this.debugName + (this.baseClass ? ' extends ' + this.baseClass.debugName : '');
1.27154 + writer.enter('class ' + description + ' {');
1.27155 + writer.writeLn('scope: ' + this.scope);
1.27156 + writer.writeLn('baseClass: ' + this.baseClass);
1.27157 + writer.writeLn('classInfo: ' + this.classInfo);
1.27158 + writer.writeLn('dynamicPrototype: ' + this.dynamicPrototype);
1.27159 + writer.writeLn('traitsPrototype: ' + this.traitsPrototype);
1.27160 + writer.writeLn('dynamicPrototype === traitsPrototype: ' + (this.dynamicPrototype === this.traitsPrototype));
1.27161 + writer.writeLn('instanceConstructor: ' + this.instanceConstructor);
1.27162 + writer.writeLn('instanceConstructorNoInitialize: ' + this.instanceConstructorNoInitialize);
1.27163 + writer.writeLn('instanceConstructor === instanceConstructorNoInitialize: ' + (this.instanceConstructor === this.instanceConstructorNoInitialize));
1.27164 + var traitsPrototype = this.traitsPrototype;
1.27165 + writer.enter('traitsPrototype: ');
1.27166 + if (traitsPrototype) {
1.27167 + writer.enter('VM_SLOTS: ');
1.27168 + writer.writeArray(traitsPrototype.asSlots.byID.map(function (slot) {
1.27169 + return slot.trait;
1.27170 + }));
1.27171 + writer.outdent();
1.27172 + writer.enter('VM_BINDINGS: ');
1.27173 + writer.writeArray(traitsPrototype.asBindings.map(function (binding) {
1.27174 + var pd = Object.getOwnPropertyDescriptor(traitsPrototype, binding);
1.27175 + var str = binding;
1.27176 + if (pd.get || pd.set) {
1.27177 + if (pd.get) {
1.27178 + str += ' getter: ' + debugName(pd.get);
1.27179 + }
1.27180 + if (pd.set) {
1.27181 + str += ' setter: ' + debugName(pd.set);
1.27182 + }
1.27183 + } else {
1.27184 + str += ' value: ' + debugName(pd.value);
1.27185 + }
1.27186 + return str;
1.27187 + }));
1.27188 + writer.outdent();
1.27189 + writer.enter('VM_OPEN_METHODS: ');
1.27190 + writer.writeArray(toKeyValueArray(traitsPrototype.asOpenMethods).map(function (pair) {
1.27191 + return pair[0] + ': ' + debugName(pair[1]);
1.27192 + }));
1.27193 + writer.outdent();
1.27194 + }
1.27195 + writer.enter('classBindings: ');
1.27196 + this.classBindings.trace(writer);
1.27197 + writer.outdent();
1.27198 + writer.enter('instanceBindings: ');
1.27199 + this.instanceBindings.trace(writer);
1.27200 + writer.outdent();
1.27201 + writer.outdent();
1.27202 + writer.writeLn('call: ' + this.call);
1.27203 + writer.writeLn('apply: ' + this.apply);
1.27204 + writer.leave('}');
1.27205 + };
1.27206 + Class.prototype.toString = function () {
1.27207 + return '[class ' + this.classInfo.instanceInfo.name.name + ']';
1.27208 + };
1.27209 + Class.OWN_INITIALIZE = 1;
1.27210 + Class.SUPER_INITIALIZE = 2;
1.27211 + return Class;
1.27212 + }();
1.27213 + Runtime.Class = Class;
1.27214 + var callable = Shumway.AVM2.Runtime.ApplicationDomain.coerceCallable(Class);
1.27215 + defineNonEnumerableProperty(Class, 'call', callable.call);
1.27216 + defineNonEnumerableProperty(Class, 'apply', callable.apply);
1.27217 + Class.instanceConstructor = Class;
1.27218 + Class.toString = Class.prototype.toString;
1.27219 + Class.native = {
1.27220 + instance: {
1.27221 + prototype: {
1.27222 + get: function () {
1.27223 + return this.dynamicPrototype;
1.27224 + }
1.27225 + }
1.27226 + }
1.27227 + };
1.27228 + }(AVM2.Runtime || (AVM2.Runtime = {})));
1.27229 + var Runtime = AVM2.Runtime;
1.27230 + }(Shumway.AVM2 || (Shumway.AVM2 = {})));
1.27231 + var AVM2 = Shumway.AVM2;
1.27232 +}(Shumway || (Shumway = {})));
1.27233 +var Interface = Shumway.AVM2.Runtime.Interface;
1.27234 +var Class = Shumway.AVM2.Runtime.Class;
1.27235 +var Binding = Shumway.AVM2.Runtime.Binding;
1.27236 +var Bindings = Shumway.AVM2.Runtime.Bindings;
1.27237 +var ActivationBindings = Shumway.AVM2.Runtime.ActivationBindings;
1.27238 +var CatchBindings = Shumway.AVM2.Runtime.CatchBindings;
1.27239 +var ScriptBindings = Shumway.AVM2.Runtime.ScriptBindings;
1.27240 +var ClassBindings = Shumway.AVM2.Runtime.ClassBindings;
1.27241 +var InstanceBindings = Shumway.AVM2.Runtime.InstanceBindings;
1.27242 +var Interface = Shumway.AVM2.Runtime.Interface;
1.27243 +var Class = Shumway.AVM2.Runtime.Class;
1.27244 +var XRegExp = function (undefined) {
1.27245 + var REGEX_DATA = 'xregexp', self, features = {
1.27246 + astral: false,
1.27247 + natives: false
1.27248 + }, nativ = {
1.27249 + exec: RegExp.prototype.exec,
1.27250 + test: RegExp.prototype.test,
1.27251 + match: String.prototype.match,
1.27252 + replace: String.prototype.replace,
1.27253 + split: String.prototype.split
1.27254 + }, fixed = {}, cache = {}, patternCache = {}, tokens = [], defaultScope = 'default', classScope = 'class', nativeTokens = {
1.27255 + 'default': /\\(?:0(?:[0-3][0-7]{0,2}|[4-7][0-7]?)?|[1-9]\d*|x[\dA-Fa-f]{2}|u[\dA-Fa-f]{4}|c[A-Za-z]|[\s\S])|\(\?[:=!]|[?*+]\?|{\d+(?:,\d*)?}\??|[\s\S]/,
1.27256 + 'class': /\\(?:[0-3][0-7]{0,2}|[4-7][0-7]?|x[\dA-Fa-f]{2}|u[\dA-Fa-f]{4}|c[A-Za-z]|[\s\S])|[\s\S]/
1.27257 + }, replacementToken = /\$(?:{([\w$]+)}|([\d$&`']))/g, correctExecNpcg = nativ.exec.call(/()??/, '')[1] === undefined, hasNativeY = RegExp.prototype.sticky !== undefined, registeredFlags = {
1.27258 + g: true,
1.27259 + i: true,
1.27260 + m: true,
1.27261 + y: hasNativeY
1.27262 + }, toString = {}.toString, add;
1.27263 + function augment(regex, captureNames, addProto) {
1.27264 + var p;
1.27265 + if (addProto) {
1.27266 + if (regex.__proto__) {
1.27267 + regex.__proto__ = self.prototype;
1.27268 + } else {
1.27269 + for (p in self.prototype) {
1.27270 + regex[p] = self.prototype[p];
1.27271 + }
1.27272 + }
1.27273 + }
1.27274 + regex[REGEX_DATA] = {
1.27275 + captureNames: captureNames
1.27276 + };
1.27277 + return regex;
1.27278 + }
1.27279 + function clipDuplicates(str) {
1.27280 + return nativ.replace.call(str, /([\s\S])(?=[\s\S]*\1)/g, '');
1.27281 + }
1.27282 + function copy(regex, options) {
1.27283 + if (!self.isRegExp(regex)) {
1.27284 + throw new TypeError('Type RegExp expected');
1.27285 + }
1.27286 + var flags = nativ.exec.call(/\/([a-z]*)$/i, String(regex))[1];
1.27287 + options = options || {};
1.27288 + if (options.add) {
1.27289 + flags = clipDuplicates(flags + options.add);
1.27290 + }
1.27291 + if (options.remove) {
1.27292 + flags = nativ.replace.call(flags, new RegExp('[' + options.remove + ']+', 'g'), '');
1.27293 + }
1.27294 + regex = augment(new RegExp(regex.source, flags), hasNamedCapture(regex) ? regex[REGEX_DATA].captureNames.slice(0) : null, options.addProto);
1.27295 + return regex;
1.27296 + }
1.27297 + function getBaseProps() {
1.27298 + return {
1.27299 + captureNames: null
1.27300 + };
1.27301 + }
1.27302 + function hasNamedCapture(regex) {
1.27303 + return !(!(regex[REGEX_DATA] && regex[REGEX_DATA].captureNames));
1.27304 + }
1.27305 + function indexOf(array, value) {
1.27306 + if (Array.prototype.indexOf) {
1.27307 + return array.indexOf(value);
1.27308 + }
1.27309 + var len = array.length, i;
1.27310 + for (i = 0; i < len; ++i) {
1.27311 + if (array[i] === value) {
1.27312 + return i;
1.27313 + }
1.27314 + }
1.27315 + return -1;
1.27316 + }
1.27317 + function isType(value, type) {
1.27318 + return toString.call(value) === '[object ' + type + ']';
1.27319 + }
1.27320 + function isQuantifierNext(pattern, pos, flags) {
1.27321 + return nativ.test.call(flags.indexOf('x') > -1 ? /^(?:\s+|#.*|\(\?#[^)]*\))*(?:[?*+]|{\d+(?:,\d*)?})/ : /^(?:\(\?#[^)]*\))*(?:[?*+]|{\d+(?:,\d*)?})/, pattern.slice(pos));
1.27322 + }
1.27323 + function prepareFlags(pattern, flags) {
1.27324 + var i;
1.27325 + if (clipDuplicates(flags) !== flags) {
1.27326 + throw new SyntaxError('Invalid duplicate regex flag ' + flags);
1.27327 + }
1.27328 + pattern = nativ.replace.call(pattern, /^\(\?([\w$]+)\)/, function ($0, $1) {
1.27329 + if (nativ.test.call(/[gy]/, $1)) {
1.27330 + throw new SyntaxError('Cannot use flag g or y in mode modifier ' + $0);
1.27331 + }
1.27332 + flags = clipDuplicates(flags + $1);
1.27333 + return '';
1.27334 + });
1.27335 + for (i = 0; i < flags.length; ++i) {
1.27336 + if (!registeredFlags[flags.charAt(i)]) {
1.27337 + throw new SyntaxError('Unknown regex flag ' + flags.charAt(i));
1.27338 + }
1.27339 + }
1.27340 + return {
1.27341 + pattern: pattern,
1.27342 + flags: flags
1.27343 + };
1.27344 + }
1.27345 + function prepareOptions(value) {
1.27346 + value = value || {};
1.27347 + if (isType(value, 'String')) {
1.27348 + value = self.forEach(value, /[^\s,]+/, function (match) {
1.27349 + this[match] = true;
1.27350 + }, {});
1.27351 + }
1.27352 + return value;
1.27353 + }
1.27354 + function registerFlag(flag) {
1.27355 + if (!/^[\w$]$/.test(flag)) {
1.27356 + throw new Error('Flag must be a single character A-Za-z0-9_$');
1.27357 + }
1.27358 + registeredFlags[flag] = true;
1.27359 + }
1.27360 + function runTokens(pattern, flags, pos, scope, context) {
1.27361 + var i = tokens.length, result = null, match, t;
1.27362 + while (i--) {
1.27363 + t = tokens[i];
1.27364 + if ((t.scope === scope || t.scope === 'all') && (!t.flag || flags.indexOf(t.flag) > -1)) {
1.27365 + match = self.exec(pattern, t.regex, pos, 'sticky');
1.27366 + if (match) {
1.27367 + result = {
1.27368 + matchLength: match[0].length,
1.27369 + output: t.handler.call(context, match, scope, flags),
1.27370 + reparse: t.reparse
1.27371 + };
1.27372 + break;
1.27373 + }
1.27374 + }
1.27375 + }
1.27376 + return result;
1.27377 + }
1.27378 + function setAstral(on) {
1.27379 + self.cache.flush('patterns');
1.27380 + features.astral = on;
1.27381 + }
1.27382 + function setNatives(on) {
1.27383 + RegExp.prototype.exec = (on ? fixed : nativ).exec;
1.27384 + RegExp.prototype.test = (on ? fixed : nativ).test;
1.27385 + String.prototype.match = (on ? fixed : nativ).match;
1.27386 + String.prototype.replace = (on ? fixed : nativ).replace;
1.27387 + String.prototype.split = (on ? fixed : nativ).split;
1.27388 + features.natives = on;
1.27389 + }
1.27390 + function toObject(value) {
1.27391 + if (value == null) {
1.27392 + throw new TypeError('Cannot convert null or undefined to object');
1.27393 + }
1.27394 + return value;
1.27395 + }
1.27396 + self = function (pattern, flags) {
1.27397 + var context = {
1.27398 + hasNamedCapture: false,
1.27399 + captureNames: []
1.27400 + }, scope = defaultScope, output = '', pos = 0, result, token, key;
1.27401 + if (self.isRegExp(pattern)) {
1.27402 + if (flags !== undefined) {
1.27403 + throw new TypeError('Cannot supply flags when copying a RegExp');
1.27404 + }
1.27405 + return copy(pattern, {
1.27406 + addProto: true
1.27407 + });
1.27408 + }
1.27409 + pattern = pattern === undefined ? '' : String(pattern);
1.27410 + flags = flags === undefined ? '' : String(flags);
1.27411 + key = pattern + '***' + flags;
1.27412 + if (!patternCache[key]) {
1.27413 + result = prepareFlags(pattern, flags);
1.27414 + pattern = result.pattern;
1.27415 + flags = result.flags;
1.27416 + while (pos < pattern.length) {
1.27417 + do {
1.27418 + result = runTokens(pattern, flags, pos, scope, context);
1.27419 + if (result && result.reparse) {
1.27420 + pattern = pattern.slice(0, pos) + result.output + pattern.slice(pos + result.matchLength);
1.27421 + }
1.27422 + } while (result && result.reparse);
1.27423 + if (result) {
1.27424 + output += result.output;
1.27425 + pos += result.matchLength || 1;
1.27426 + } else {
1.27427 + token = self.exec(pattern, nativeTokens[scope], pos, 'sticky')[0];
1.27428 + output += token;
1.27429 + pos += token.length;
1.27430 + if (token === '[' && scope === defaultScope) {
1.27431 + scope = classScope;
1.27432 + } else if (token === ']' && scope === classScope) {
1.27433 + scope = defaultScope;
1.27434 + }
1.27435 + }
1.27436 + }
1.27437 + patternCache[key] = {
1.27438 + pattern: nativ.replace.call(output, /\(\?:\)(?=\(\?:\))|^\(\?:\)|\(\?:\)$/g, ''),
1.27439 + flags: nativ.replace.call(flags, /[^gimy]+/g, ''),
1.27440 + captures: context.hasNamedCapture ? context.captureNames : null
1.27441 + };
1.27442 + }
1.27443 + key = patternCache[key];
1.27444 + return augment(new RegExp(key.pattern, key.flags), key.captures, true);
1.27445 + };
1.27446 + self.prototype = new RegExp();
1.27447 + self.version = '3.0.0-pre';
1.27448 + self.addToken = function (regex, handler, options) {
1.27449 + options = options || {};
1.27450 + var optionalFlags = options.optionalFlags, i;
1.27451 + if (options.flag) {
1.27452 + registerFlag(options.flag);
1.27453 + }
1.27454 + if (optionalFlags) {
1.27455 + optionalFlags = nativ.split.call(optionalFlags, '');
1.27456 + for (i = 0; i < optionalFlags.length; ++i) {
1.27457 + registerFlag(optionalFlags[i]);
1.27458 + }
1.27459 + }
1.27460 + tokens.push({
1.27461 + regex: copy(regex, {
1.27462 + add: 'g' + (hasNativeY ? 'y' : '')
1.27463 + }),
1.27464 + handler: handler,
1.27465 + scope: options.scope || defaultScope,
1.27466 + flag: options.flag,
1.27467 + reparse: options.reparse
1.27468 + });
1.27469 + self.cache.flush('patterns');
1.27470 + };
1.27471 + self.cache = function (pattern, flags) {
1.27472 + var key = pattern + '***' + (flags || '');
1.27473 + return cache[key] || (cache[key] = self(pattern, flags));
1.27474 + };
1.27475 + self.cache.flush = function (cacheName) {
1.27476 + if (cacheName === 'patterns') {
1.27477 + patternCache = {};
1.27478 + } else {
1.27479 + cache = {};
1.27480 + }
1.27481 + };
1.27482 + self.escape = function (str) {
1.27483 + return nativ.replace.call(toObject(str), /[-[\]{}()*+?.,\\^$|#\s]/g, '\\$&');
1.27484 + };
1.27485 + self.exec = function (str, regex, pos, sticky) {
1.27486 + var cacheFlags = 'g', match, r2;
1.27487 + if (hasNativeY && (sticky || regex.sticky && sticky !== false)) {
1.27488 + cacheFlags += 'y';
1.27489 + }
1.27490 + regex[REGEX_DATA] = regex[REGEX_DATA] || getBaseProps();
1.27491 + r2 = regex[REGEX_DATA][cacheFlags] || (regex[REGEX_DATA][cacheFlags] = copy(regex, {
1.27492 + add: cacheFlags,
1.27493 + remove: sticky === false ? 'y' : ''
1.27494 + }));
1.27495 + r2.lastIndex = pos = pos || 0;
1.27496 + match = fixed.exec.call(r2, str);
1.27497 + if (sticky && match && match.index !== pos) {
1.27498 + match = null;
1.27499 + }
1.27500 + if (regex.global) {
1.27501 + regex.lastIndex = match ? r2.lastIndex : 0;
1.27502 + }
1.27503 + return match;
1.27504 + };
1.27505 + self.forEach = function (str, regex, callback, context) {
1.27506 + var pos = 0, i = -1, match;
1.27507 + while (match = self.exec(str, regex, pos)) {
1.27508 + callback.call(context, match, ++i, str, regex);
1.27509 + pos = match.index + (match[0].length || 1);
1.27510 + }
1.27511 + return context;
1.27512 + };
1.27513 + self.globalize = function (regex) {
1.27514 + return copy(regex, {
1.27515 + add: 'g',
1.27516 + addProto: true
1.27517 + });
1.27518 + };
1.27519 + self.install = function (options) {
1.27520 + options = prepareOptions(options);
1.27521 + if (!features.astral && options.astral) {
1.27522 + setAstral(true);
1.27523 + }
1.27524 + if (!features.natives && options.natives) {
1.27525 + setNatives(true);
1.27526 + }
1.27527 + };
1.27528 + self.isInstalled = function (feature) {
1.27529 + return !(!features[feature]);
1.27530 + };
1.27531 + self.isRegExp = function (value) {
1.27532 + return toString.call(value) === '[object RegExp]';
1.27533 + };
1.27534 + self.match = function (str, regex, scope) {
1.27535 + var global = regex.global && scope !== 'one' || scope === 'all', cacheFlags = (global ? 'g' : '') + (regex.sticky ? 'y' : ''), result, r2;
1.27536 + regex[REGEX_DATA] = regex[REGEX_DATA] || getBaseProps();
1.27537 + r2 = regex[REGEX_DATA][cacheFlags || 'noGY'] || (regex[REGEX_DATA][cacheFlags || 'noGY'] = copy(regex, {
1.27538 + add: cacheFlags,
1.27539 + remove: scope === 'one' ? 'g' : ''
1.27540 + }));
1.27541 + result = nativ.match.call(toObject(str), r2);
1.27542 + if (regex.global) {
1.27543 + regex.lastIndex = scope === 'one' && result ? result.index + result[0].length : 0;
1.27544 + }
1.27545 + return global ? result || [] : result && result[0];
1.27546 + };
1.27547 + self.matchChain = function (str, chain) {
1.27548 + return function recurseChain(values, level) {
1.27549 + var item = chain[level].regex ? chain[level] : {
1.27550 + regex: chain[level]
1.27551 + }, matches = [], addMatch = function (match) {
1.27552 + if (item.backref) {
1.27553 + if (!(match.hasOwnProperty(item.backref) || +item.backref < match.length)) {
1.27554 + throw new ReferenceError('Backreference to undefined group: ' + item.backref);
1.27555 + }
1.27556 + matches.push(match[item.backref] || '');
1.27557 + } else {
1.27558 + matches.push(match[0]);
1.27559 + }
1.27560 + }, i;
1.27561 + for (i = 0; i < values.length; ++i) {
1.27562 + self.forEach(values[i], item.regex, addMatch);
1.27563 + }
1.27564 + return level === chain.length - 1 || !matches.length ? matches : recurseChain(matches, level + 1);
1.27565 + }([
1.27566 + str
1.27567 + ], 0);
1.27568 + };
1.27569 + self.replace = function (str, search, replacement, scope) {
1.27570 + var isRegex = self.isRegExp(search), global = search.global && scope !== 'one' || scope === 'all', cacheFlags = (global ? 'g' : '') + (search.sticky ? 'y' : ''), s2 = search, result;
1.27571 + if (isRegex) {
1.27572 + search[REGEX_DATA] = search[REGEX_DATA] || getBaseProps();
1.27573 + s2 = search[REGEX_DATA][cacheFlags || 'noGY'] || (search[REGEX_DATA][cacheFlags || 'noGY'] = copy(search, {
1.27574 + add: cacheFlags,
1.27575 + remove: scope === 'one' ? 'g' : ''
1.27576 + }));
1.27577 + } else if (global) {
1.27578 + s2 = new RegExp(self.escape(String(search)), 'g');
1.27579 + }
1.27580 + result = fixed.replace.call(toObject(str), s2, replacement);
1.27581 + if (isRegex && search.global) {
1.27582 + search.lastIndex = 0;
1.27583 + }
1.27584 + return result;
1.27585 + };
1.27586 + self.replaceEach = function (str, replacements) {
1.27587 + var i, r;
1.27588 + for (i = 0; i < replacements.length; ++i) {
1.27589 + r = replacements[i];
1.27590 + str = self.replace(str, r[0], r[1], r[2]);
1.27591 + }
1.27592 + return str;
1.27593 + };
1.27594 + self.split = function (str, separator, limit) {
1.27595 + return fixed.split.call(toObject(str), separator, limit);
1.27596 + };
1.27597 + self.test = function (str, regex, pos, sticky) {
1.27598 + return !(!self.exec(str, regex, pos, sticky));
1.27599 + };
1.27600 + self.uninstall = function (options) {
1.27601 + options = prepareOptions(options);
1.27602 + if (features.astral && options.astral) {
1.27603 + setAstral(false);
1.27604 + }
1.27605 + if (features.natives && options.natives) {
1.27606 + setNatives(false);
1.27607 + }
1.27608 + };
1.27609 + self.union = function (patterns, flags) {
1.27610 + var parts = /(\()(?!\?)|\\([1-9]\d*)|\\[\s\S]|\[(?:[^\\\]]|\\[\s\S])*]/g, output = [], numCaptures = 0, numPriorCaptures, captureNames, pattern, rewrite = function (match, paren, backref) {
1.27611 + var name = captureNames[numCaptures - numPriorCaptures];
1.27612 + if (paren) {
1.27613 + ++numCaptures;
1.27614 + if (name) {
1.27615 + return '(?<' + name + '>';
1.27616 + }
1.27617 + } else if (backref) {
1.27618 + return '\\' + (+backref + numPriorCaptures);
1.27619 + }
1.27620 + return match;
1.27621 + }, i;
1.27622 + if (!(isType(patterns, 'Array') && patterns.length)) {
1.27623 + throw new TypeError('Must provide a nonempty array of patterns to merge');
1.27624 + }
1.27625 + for (i = 0; i < patterns.length; ++i) {
1.27626 + pattern = patterns[i];
1.27627 + if (self.isRegExp(pattern)) {
1.27628 + numPriorCaptures = numCaptures;
1.27629 + captureNames = pattern[REGEX_DATA] && pattern[REGEX_DATA].captureNames || [];
1.27630 + output.push(nativ.replace.call(self(pattern.source).source, parts, rewrite));
1.27631 + } else {
1.27632 + output.push(self.escape(pattern));
1.27633 + }
1.27634 + }
1.27635 + return self(output.join('|'), flags);
1.27636 + };
1.27637 + fixed.exec = function (str) {
1.27638 + var origLastIndex = this.lastIndex, match = nativ.exec.apply(this, arguments), name, r2, i;
1.27639 + if (match) {
1.27640 + if (!correctExecNpcg && match.length > 1 && indexOf(match, '') > -1) {
1.27641 + r2 = copy(this, {
1.27642 + remove: 'g'
1.27643 + });
1.27644 + nativ.replace.call(String(str).slice(match.index), r2, function () {
1.27645 + var len = arguments.length, i;
1.27646 + for (i = 1; i < len - 2; ++i) {
1.27647 + if (arguments[i] === undefined) {
1.27648 + match[i] = undefined;
1.27649 + }
1.27650 + }
1.27651 + });
1.27652 + }
1.27653 + if (this[REGEX_DATA] && this[REGEX_DATA].captureNames) {
1.27654 + for (i = 1; i < match.length; ++i) {
1.27655 + name = this[REGEX_DATA].captureNames[i - 1];
1.27656 + if (name) {
1.27657 + match[name] = match[i];
1.27658 + }
1.27659 + }
1.27660 + }
1.27661 + if (this.global && !match[0].length && this.lastIndex > match.index) {
1.27662 + this.lastIndex = match.index;
1.27663 + }
1.27664 + }
1.27665 + if (!this.global) {
1.27666 + this.lastIndex = origLastIndex;
1.27667 + }
1.27668 + return match;
1.27669 + };
1.27670 + fixed.test = function (str) {
1.27671 + return !(!fixed.exec.call(this, str));
1.27672 + };
1.27673 + fixed.match = function (regex) {
1.27674 + var result;
1.27675 + if (!self.isRegExp(regex)) {
1.27676 + regex = new RegExp(regex);
1.27677 + } else if (regex.global) {
1.27678 + result = nativ.match.apply(this, arguments);
1.27679 + regex.lastIndex = 0;
1.27680 + return result;
1.27681 + }
1.27682 + return fixed.exec.call(regex, toObject(this));
1.27683 + };
1.27684 + fixed.replace = function (search, replacement) {
1.27685 + var isRegex = self.isRegExp(search), origLastIndex, captureNames, result;
1.27686 + if (isRegex) {
1.27687 + if (search[REGEX_DATA]) {
1.27688 + captureNames = search[REGEX_DATA].captureNames;
1.27689 + }
1.27690 + origLastIndex = search.lastIndex;
1.27691 + } else {
1.27692 + search += '';
1.27693 + }
1.27694 + if (isType(replacement, 'Function')) {
1.27695 + result = nativ.replace.call(String(this), search, function () {
1.27696 + var args = arguments, i;
1.27697 + if (captureNames) {
1.27698 + args[0] = new String(args[0]);
1.27699 + for (i = 0; i < captureNames.length; ++i) {
1.27700 + if (captureNames[i]) {
1.27701 + args[0][captureNames[i]] = args[i + 1];
1.27702 + }
1.27703 + }
1.27704 + }
1.27705 + if (isRegex && search.global) {
1.27706 + search.lastIndex = args[args.length - 2] + args[0].length;
1.27707 + }
1.27708 + return replacement.apply(undefined, args);
1.27709 + });
1.27710 + } else {
1.27711 + result = nativ.replace.call(this == null ? this : String(this), search, function () {
1.27712 + var args = arguments;
1.27713 + return nativ.replace.call(String(replacement), replacementToken, function ($0, $1, $2) {
1.27714 + var n;
1.27715 + if ($1) {
1.27716 + n = +$1;
1.27717 + if (n <= args.length - 3) {
1.27718 + return args[n] || '';
1.27719 + }
1.27720 + n = captureNames ? indexOf(captureNames, $1) : -1;
1.27721 + if (n < 0) {
1.27722 + throw new SyntaxError('Backreference to undefined group ' + $0);
1.27723 + }
1.27724 + return args[n + 1] || '';
1.27725 + }
1.27726 + if ($2 === '$') {
1.27727 + return '$';
1.27728 + }
1.27729 + if ($2 === '&' || +$2 === 0) {
1.27730 + return args[0];
1.27731 + }
1.27732 + if ($2 === '`') {
1.27733 + return args[args.length - 1].slice(0, args[args.length - 2]);
1.27734 + }
1.27735 + if ($2 === '\'') {
1.27736 + return args[args.length - 1].slice(args[args.length - 2] + args[0].length);
1.27737 + }
1.27738 + $2 = +$2;
1.27739 + if (!isNaN($2)) {
1.27740 + if ($2 > args.length - 3) {
1.27741 + throw new SyntaxError('Backreference to undefined group ' + $0);
1.27742 + }
1.27743 + return args[$2] || '';
1.27744 + }
1.27745 + throw new SyntaxError('Invalid token ' + $0);
1.27746 + });
1.27747 + });
1.27748 + }
1.27749 + if (isRegex) {
1.27750 + if (search.global) {
1.27751 + search.lastIndex = 0;
1.27752 + } else {
1.27753 + search.lastIndex = origLastIndex;
1.27754 + }
1.27755 + }
1.27756 + return result;
1.27757 + };
1.27758 + fixed.split = function (separator, limit) {
1.27759 + if (!self.isRegExp(separator)) {
1.27760 + return nativ.split.apply(this, arguments);
1.27761 + }
1.27762 + var str = String(this), output = [], origLastIndex = separator.lastIndex, lastLastIndex = 0, lastLength;
1.27763 + limit = (limit === undefined ? -1 : limit) >>> 0;
1.27764 + self.forEach(str, separator, function (match) {
1.27765 + if (match.index + match[0].length > lastLastIndex) {
1.27766 + output.push(str.slice(lastLastIndex, match.index));
1.27767 + if (match.length > 1 && match.index < str.length) {
1.27768 + Array.prototype.push.apply(output, match.slice(1));
1.27769 + }
1.27770 + lastLength = match[0].length;
1.27771 + lastLastIndex = match.index + lastLength;
1.27772 + }
1.27773 + });
1.27774 + if (lastLastIndex === str.length) {
1.27775 + if (!nativ.test.call(separator, '') || lastLength) {
1.27776 + output.push('');
1.27777 + }
1.27778 + } else {
1.27779 + output.push(str.slice(lastLastIndex));
1.27780 + }
1.27781 + separator.lastIndex = origLastIndex;
1.27782 + return output.length > limit ? output.slice(0, limit) : output;
1.27783 + };
1.27784 + add = self.addToken;
1.27785 + add(/\\([ABCE-RTUVXYZaeg-mopqyz]|c(?![A-Za-z])|u(?![\dA-Fa-f]{4})|x(?![\dA-Fa-f]{2}))/, function (match, scope) {
1.27786 + if (match[1] === 'B' && scope === defaultScope) {
1.27787 + return match[0];
1.27788 + }
1.27789 + throw new SyntaxError('Invalid escape ' + match[0]);
1.27790 + }, {
1.27791 + scope: 'all'
1.27792 + });
1.27793 + add(/\[(\^?)]/, function (match) {
1.27794 + return match[1] ? '[\\s\\S]' : '\\b\\B';
1.27795 + });
1.27796 + add(/\(\?#[^)]*\)/, function (match, scope, flags) {
1.27797 + return isQuantifierNext(match.input, match.index + match[0].length, flags) ? '' : '(?:)';
1.27798 + });
1.27799 + add(/\s+|#.*/, function (match, scope, flags) {
1.27800 + return isQuantifierNext(match.input, match.index + match[0].length, flags) ? '' : '(?:)';
1.27801 + }, {
1.27802 + flag: 'x'
1.27803 + });
1.27804 + add(/\./, function () {
1.27805 + return '[\\s\\S]';
1.27806 + }, {
1.27807 + flag: 's'
1.27808 + });
1.27809 + add(/\\k<([\w$]+)>/, function (match) {
1.27810 + var index = isNaN(match[1]) ? indexOf(this.captureNames, match[1]) + 1 : +match[1], endIndex = match.index + match[0].length;
1.27811 + if (!index || index > this.captureNames.length) {
1.27812 + throw new SyntaxError('Backreference to undefined group ' + match[0]);
1.27813 + }
1.27814 + return '\\' + index + (endIndex === match.input.length || isNaN(match.input.charAt(endIndex)) ? '' : '(?:)');
1.27815 + });
1.27816 + add(/\\(\d+)/, function (match, scope) {
1.27817 + if (!(scope === defaultScope && /^[1-9]/.test(match[1]) && +match[1] <= this.captureNames.length) && match[1] !== '0') {
1.27818 + throw new SyntaxError('Cannot use octal escape or backreference to undefined group ' + match[0]);
1.27819 + }
1.27820 + return match[0];
1.27821 + }, {
1.27822 + scope: 'all'
1.27823 + });
1.27824 + add(/\(\?P?<([\w$]+)>/, function (match) {
1.27825 + if (!isNaN(match[1])) {
1.27826 + throw new SyntaxError('Cannot use integer as capture name ' + match[0]);
1.27827 + }
1.27828 + if (match[1] === 'length' || match[1] === '__proto__') {
1.27829 + throw new SyntaxError('Cannot use reserved word as capture name ' + match[0]);
1.27830 + }
1.27831 + if (indexOf(this.captureNames, match[1]) > -1) {
1.27832 + throw new SyntaxError('Cannot use same name for multiple groups ' + match[0]);
1.27833 + }
1.27834 + this.captureNames.push(match[1]);
1.27835 + this.hasNamedCapture = true;
1.27836 + return '(';
1.27837 + });
1.27838 + add(/\((?!\?)/, function (match, scope, flags) {
1.27839 + if (flags.indexOf('n') > -1) {
1.27840 + return '(?:';
1.27841 + }
1.27842 + this.captureNames.push(null);
1.27843 + return '(';
1.27844 + }, {
1.27845 + optionalFlags: 'n'
1.27846 + });
1.27847 + return self;
1.27848 + }();
1.27849 +var Namespace = Shumway.AVM2.ABC.Namespace;
1.27850 +var Shumway;
1.27851 +(function (Shumway) {
1.27852 + (function (AVM2) {
1.27853 + (function (Runtime) {
1.27854 + var Option = Shumway.Options.Option;
1.27855 + var OptionSet = Shumway.Options.OptionSet;
1.27856 + var runtimeOptions = systemOptions.register(new OptionSet('Runtime Options'));
1.27857 + var traceScope = runtimeOptions.register(new Option('ts', 'traceScope', 'boolean', false, 'trace scope execution'));
1.27858 + Runtime.traceExecution = runtimeOptions.register(new Option('tx', 'traceExecution', 'number', 0, 'trace script execution'));
1.27859 + Runtime.traceCallExecution = runtimeOptions.register(new Option('txc', 'traceCallExecution', 'number', 0, 'trace call execution'));
1.27860 + var functionBreak = runtimeOptions.register(new Option('fb', 'functionBreak', 'number', -1, 'Inserts a debugBreak at function index #.'));
1.27861 + var compileOnly = runtimeOptions.register(new Option('co', 'compileOnly', 'number', -1, 'Compiles only function number.'));
1.27862 + var compileUntil = runtimeOptions.register(new Option('cu', 'compileUntil', 'number', -1, 'Compiles only until a function number.'));
1.27863 + Runtime.debuggerMode = runtimeOptions.register(new Option('dm', 'debuggerMode', 'boolean', false, 'matches avm2 debugger build semantics'));
1.27864 + Runtime.enableVerifier = runtimeOptions.register(new Option('verify', 'verify', 'boolean', false, 'Enable verifier.'));
1.27865 + Runtime.globalMultinameAnalysis = runtimeOptions.register(new Option('ga', 'globalMultinameAnalysis', 'boolean', false, 'Global multiname analysis.'));
1.27866 + var traceInlineCaching = runtimeOptions.register(new Option('tic', 'traceInlineCaching', 'boolean', false, 'Trace inline caching execution.'));
1.27867 + Runtime.codeCaching = runtimeOptions.register(new Option('cc', 'codeCaching', 'boolean', false, 'Enable code caching.'));
1.27868 + var compilerEnableExceptions = runtimeOptions.register(new Option('cex', 'exceptions', 'boolean', false, 'Compile functions with catch blocks.'));
1.27869 + var compilerMaximumMethodSize = runtimeOptions.register(new Option('cmms', 'maximumMethodSize', 'number', 4 * 1024, 'Compiler maximum method size.'));
1.27870 + Runtime.traceClasses = runtimeOptions.register(new Option('tc', 'traceClasses', 'boolean', false, 'trace class creation'));
1.27871 + Runtime.traceDomain = runtimeOptions.register(new Option('td', 'traceDomain', 'boolean', false, 'trace domain property access'));
1.27872 + Runtime.sealConstTraits = false;
1.27873 + Runtime.useAsAdd = true;
1.27874 + var useSurrogates = true;
1.27875 + var callCounter = new Shumway.Metrics.Counter(true);
1.27876 + var Multiname = Shumway.AVM2.ABC.Multiname;
1.27877 + var Namespace = Shumway.AVM2.ABC.Namespace;
1.27878 + var MethodInfo = Shumway.AVM2.ABC.MethodInfo;
1.27879 + var ClassInfo = Shumway.AVM2.ABC.ClassInfo;
1.27880 + var InstanceInfo = Shumway.AVM2.ABC.InstanceInfo;
1.27881 + var ScriptInfo = Shumway.AVM2.ABC.ScriptInfo;
1.27882 + var SORT = Shumway.AVM2.ABC.SORT;
1.27883 + var Trait = Shumway.AVM2.ABC.Trait;
1.27884 + var IndentingWriter = Shumway.IndentingWriter;
1.27885 + var hasOwnProperty = Shumway.ObjectUtilities.hasOwnProperty;
1.27886 + var createMap = Shumway.ObjectUtilities.createMap;
1.27887 + var cloneObject = Shumway.ObjectUtilities.cloneObject;
1.27888 + var copyProperties = Shumway.ObjectUtilities.copyProperties;
1.27889 + var createEmptyObject = Shumway.ObjectUtilities.createEmptyObject;
1.27890 + var boxValue = Shumway.ObjectUtilities.boxValue;
1.27891 + var bindSafely = Shumway.FunctionUtilities.bindSafely;
1.27892 + var defineNonEnumerableGetterOrSetter = Shumway.ObjectUtilities.defineNonEnumerableGetterOrSetter;
1.27893 + var defineNonEnumerableProperty = Shumway.ObjectUtilities.defineNonEnumerableProperty;
1.27894 + var defineReadOnlyProperty = Shumway.ObjectUtilities.defineReadOnlyProperty;
1.27895 + var defineNonEnumerableGetter = Shumway.ObjectUtilities.defineNonEnumerableGetter;
1.27896 + var makeForwardingGetter = Shumway.FunctionUtilities.makeForwardingGetter;
1.27897 + var makeForwardingSetter = Shumway.FunctionUtilities.makeForwardingSetter;
1.27898 + var toSafeString = Shumway.StringUtilities.toSafeString;
1.27899 + var toSafeArrayString = Shumway.StringUtilities.toSafeArrayString;
1.27900 + var TRAIT = Shumway.AVM2.ABC.TRAIT;
1.27901 + Runtime.VM_SLOTS = 'asSlots';
1.27902 + Runtime.VM_LENGTH = 'asLength';
1.27903 + Runtime.VM_BINDINGS = 'asBindings';
1.27904 + Runtime.VM_NATIVE_PROTOTYPE_FLAG = 'asIsNative';
1.27905 + Runtime.VM_OPEN_METHODS = 'asOpenMethods';
1.27906 + Runtime.VM_IS_CLASS = 'asIsClass';
1.27907 + Runtime.VM_IS_PROXY = 'asIsProxy';
1.27908 + Runtime.VM_CALL_PROXY = 'asCallProxy';
1.27909 + Runtime.VM_OPEN_METHOD_PREFIX = 'm';
1.27910 + Runtime.VM_MEMOIZER_PREFIX = 'z';
1.27911 + Runtime.VM_OPEN_SET_METHOD_PREFIX = 's';
1.27912 + Runtime.VM_OPEN_GET_METHOD_PREFIX = 'g';
1.27913 + Runtime.VM_NATIVE_BUILTIN_ORIGINALS = 'asOriginals';
1.27914 + Runtime.VM_METHOD_OVERRIDES = createEmptyObject();
1.27915 + var vmNextInterpreterFunctionId = 1;
1.27916 + var vmNextCompiledFunctionId = 1;
1.27917 + var totalFunctionCount = 0;
1.27918 + var compiledFunctionCount = 0;
1.27919 + var compilationCount = 0;
1.27920 + function isClass(object) {
1.27921 + true;
1.27922 + return Object.hasOwnProperty.call(object, Runtime.VM_IS_CLASS);
1.27923 + }
1.27924 + Runtime.isClass = isClass;
1.27925 + function isNativePrototype(object) {
1.27926 + return Object.prototype.hasOwnProperty.call(object, Runtime.VM_NATIVE_PROTOTYPE_FLAG);
1.27927 + }
1.27928 + Runtime.isNativePrototype = isNativePrototype;
1.27929 + var traitsWriter = null;
1.27930 + var callWriter = null;
1.27931 + function patch(patchTargets, value) {
1.27932 + true;
1.27933 + for (var i = 0; i < patchTargets.length; i++) {
1.27934 + var patchTarget = patchTargets[i];
1.27935 + if (Runtime.traceExecution.value >= 3) {
1.27936 + var str = 'Patching: ';
1.27937 + if (patchTarget.name) {
1.27938 + str += patchTarget.name;
1.27939 + } else if (patchTarget.get) {
1.27940 + str += 'get ' + patchTarget.get;
1.27941 + } else if (patchTarget.set) {
1.27942 + str += 'set ' + patchTarget.set;
1.27943 + }
1.27944 + traitsWriter && traitsWriter.redLn(str);
1.27945 + }
1.27946 + if (patchTarget.get) {
1.27947 + defineNonEnumerableGetterOrSetter(patchTarget.object, patchTarget.get, value, true);
1.27948 + } else if (patchTarget.set) {
1.27949 + defineNonEnumerableGetterOrSetter(patchTarget.object, patchTarget.set, value, false);
1.27950 + } else {
1.27951 + defineNonEnumerableProperty(patchTarget.object, patchTarget.name, value);
1.27952 + }
1.27953 + }
1.27954 + }
1.27955 + Runtime.patch = patch;
1.27956 + function applyNonMemoizedMethodTrait(qn, trait, object, scope, natives) {
1.27957 + true;
1.27958 + if (trait.isMethod()) {
1.27959 + var trampoline = Shumway.AVM2.Runtime.makeTrampoline(function (self) {
1.27960 + var fn = getTraitFunction(trait, scope, natives);
1.27961 + patch(self.patchTargets, fn);
1.27962 + return fn;
1.27963 + }, trait.methodInfo.parameters.length);
1.27964 + trampoline.patchTargets = [
1.27965 + {
1.27966 + object: object,
1.27967 + name: qn
1.27968 + },
1.27969 + {
1.27970 + object: object,
1.27971 + name: Runtime.VM_OPEN_METHOD_PREFIX + qn
1.27972 + }
1.27973 + ];
1.27974 + var closure = bindSafely(trampoline, object);
1.27975 + defineReadOnlyProperty(closure, Runtime.VM_LENGTH, trampoline.asLength);
1.27976 + defineReadOnlyProperty(closure, Multiname.getPublicQualifiedName('prototype'), null);
1.27977 + defineNonEnumerableProperty(object, qn, closure);
1.27978 + defineNonEnumerableProperty(object, Runtime.VM_OPEN_METHOD_PREFIX + qn, closure);
1.27979 + } else if (trait.isGetter() || trait.isSetter()) {
1.27980 + var trampoline = Shumway.AVM2.Runtime.makeTrampoline(function (self) {
1.27981 + var fn = getTraitFunction(trait, scope, natives);
1.27982 + patch(self.patchTargets, fn);
1.27983 + return fn;
1.27984 + }, trait.isSetter() ? 1 : 0);
1.27985 + if (trait.isGetter()) {
1.27986 + trampoline.patchTargets = [
1.27987 + {
1.27988 + object: object,
1.27989 + get: qn
1.27990 + }
1.27991 + ];
1.27992 + } else {
1.27993 + trampoline.patchTargets = [
1.27994 + {
1.27995 + object: object,
1.27996 + set: qn
1.27997 + }
1.27998 + ];
1.27999 + }
1.28000 + defineNonEnumerableGetterOrSetter(object, qn, trampoline, trait.isGetter());
1.28001 + } else {
1.28002 + Shumway.Debug.unexpected(trait);
1.28003 + }
1.28004 + }
1.28005 + Runtime.applyNonMemoizedMethodTrait = applyNonMemoizedMethodTrait;
1.28006 + function applyMemoizedMethodTrait(qn, trait, object, scope, natives) {
1.28007 + true;
1.28008 + if (trait.isMethod()) {
1.28009 + var memoizerTarget = {
1.28010 + value: null
1.28011 + };
1.28012 + var trampoline = Shumway.AVM2.Runtime.makeTrampoline(function (self) {
1.28013 + var fn = getTraitFunction(trait, scope, natives);
1.28014 + patch(self.patchTargets, fn);
1.28015 + return fn;
1.28016 + }, trait.methodInfo.parameters.length, String(trait.name));
1.28017 + memoizerTarget.value = trampoline;
1.28018 + var openMethods = object.asOpenMethods;
1.28019 + openMethods[qn] = trampoline;
1.28020 + defineNonEnumerableProperty(object, Runtime.VM_OPEN_METHOD_PREFIX + qn, trampoline);
1.28021 + defineNonEnumerableGetter(object, qn, Shumway.AVM2.Runtime.makeMemoizer(qn, memoizerTarget));
1.28022 + trampoline.patchTargets = [
1.28023 + {
1.28024 + object: memoizerTarget,
1.28025 + name: 'value'
1.28026 + },
1.28027 + {
1.28028 + object: openMethods,
1.28029 + name: qn
1.28030 + },
1.28031 + {
1.28032 + object: object,
1.28033 + name: Runtime.VM_OPEN_METHOD_PREFIX + qn
1.28034 + }
1.28035 + ];
1.28036 + } else if (trait.isGetter() || trait.isSetter()) {
1.28037 + var trampoline = Shumway.AVM2.Runtime.makeTrampoline(function (self) {
1.28038 + var fn = getTraitFunction(trait, scope, natives);
1.28039 + patch(self.patchTargets, fn);
1.28040 + return fn;
1.28041 + }, 0, String(trait.name));
1.28042 + if (trait.isGetter()) {
1.28043 + defineNonEnumerableProperty(object, Runtime.VM_OPEN_GET_METHOD_PREFIX + qn, trampoline);
1.28044 + trampoline.patchTargets = [
1.28045 + {
1.28046 + object: object,
1.28047 + get: qn
1.28048 + },
1.28049 + {
1.28050 + object: object,
1.28051 + name: Runtime.VM_OPEN_GET_METHOD_PREFIX + qn
1.28052 + }
1.28053 + ];
1.28054 + } else {
1.28055 + defineNonEnumerableProperty(object, Runtime.VM_OPEN_SET_METHOD_PREFIX + qn, trampoline);
1.28056 + trampoline.patchTargets = [
1.28057 + {
1.28058 + object: object,
1.28059 + set: qn
1.28060 + },
1.28061 + {
1.28062 + object: object,
1.28063 + name: Runtime.VM_OPEN_SET_METHOD_PREFIX + qn
1.28064 + }
1.28065 + ];
1.28066 + }
1.28067 + defineNonEnumerableGetterOrSetter(object, qn, trampoline, trait.isGetter());
1.28068 + }
1.28069 + }
1.28070 + Runtime.applyMemoizedMethodTrait = applyMemoizedMethodTrait;
1.28071 + function getNamespaceResolutionMap(namespaces) {
1.28072 + var self = this;
1.28073 + var map = self.resolutionMap[namespaces.runtimeId];
1.28074 + if (map)
1.28075 + return map;
1.28076 + map = self.resolutionMap[namespaces.runtimeId] = Shumway.ObjectUtilities.createMap();
1.28077 + var bindings = self.bindings;
1.28078 + for (var key in bindings.map) {
1.28079 + var multiname = key;
1.28080 + var trait = bindings.map[key].trait;
1.28081 + if (trait.isGetter() || trait.isSetter()) {
1.28082 + multiname = multiname.substring(Shumway.AVM2.Runtime.Binding.KEY_PREFIX_LENGTH);
1.28083 + }
1.28084 + multiname = Multiname.fromQualifiedName(multiname);
1.28085 + if (multiname.getNamespace().inNamespaceSet(namespaces)) {
1.28086 + map[multiname.getName()] = Multiname.getQualifiedName(trait.name);
1.28087 + }
1.28088 + }
1.28089 + return map;
1.28090 + }
1.28091 + Runtime.getNamespaceResolutionMap = getNamespaceResolutionMap;
1.28092 + function resolveMultinameProperty(namespaces, name, flags) {
1.28093 + var self = this;
1.28094 + if (typeof name === 'object') {
1.28095 + name = String(name);
1.28096 + }
1.28097 + if (Shumway.isNumeric(name)) {
1.28098 + return Shumway.toNumber(name);
1.28099 + }
1.28100 + if (!namespaces) {
1.28101 + return Multiname.getPublicQualifiedName(name);
1.28102 + }
1.28103 + if (namespaces.length > 1) {
1.28104 + var resolved = self.getNamespaceResolutionMap(namespaces)[name];
1.28105 + if (resolved)
1.28106 + return resolved;
1.28107 + return Multiname.getPublicQualifiedName(name);
1.28108 + } else {
1.28109 + return Multiname.qualifyName(namespaces[0], name);
1.28110 + }
1.28111 + }
1.28112 + Runtime.resolveMultinameProperty = resolveMultinameProperty;
1.28113 + function asGetPublicProperty(name) {
1.28114 + var self = this;
1.28115 + return self.asGetProperty(undefined, name, 0);
1.28116 + }
1.28117 + Runtime.asGetPublicProperty = asGetPublicProperty;
1.28118 + function asGetProperty(namespaces, name, flags) {
1.28119 + var self = this;
1.28120 + var resolved = self.resolveMultinameProperty(namespaces, name, flags);
1.28121 + if (self.asGetNumericProperty && Multiname.isNumeric(resolved)) {
1.28122 + return self.asGetNumericProperty(resolved);
1.28123 + }
1.28124 + return self[resolved];
1.28125 + }
1.28126 + Runtime.asGetProperty = asGetProperty;
1.28127 + function asGetPropertyLikelyNumeric(namespaces, name, flags) {
1.28128 + var self = this;
1.28129 + if (typeof name === 'number') {
1.28130 + return self.asGetNumericProperty(name);
1.28131 + }
1.28132 + return asGetProperty.call(self, namespaces, name, flags);
1.28133 + }
1.28134 + Runtime.asGetPropertyLikelyNumeric = asGetPropertyLikelyNumeric;
1.28135 + function asGetResolvedStringProperty(resolved) {
1.28136 + true;
1.28137 + return this[resolved];
1.28138 + }
1.28139 + Runtime.asGetResolvedStringProperty = asGetResolvedStringProperty;
1.28140 + function asCallResolvedStringProperty(resolved, isLex, args) {
1.28141 + var self = this;
1.28142 + var receiver = isLex ? null : this;
1.28143 + var openMethods = self.asOpenMethods;
1.28144 + var method;
1.28145 + if (receiver && openMethods && openMethods[resolved]) {
1.28146 + method = openMethods[resolved];
1.28147 + } else {
1.28148 + method = self[resolved];
1.28149 + }
1.28150 + return method.apply(receiver, args);
1.28151 + }
1.28152 + Runtime.asCallResolvedStringProperty = asCallResolvedStringProperty;
1.28153 + function asGetResolvedStringPropertyFallback(resolved) {
1.28154 + var self = this;
1.28155 + var name = Multiname.getNameFromPublicQualifiedName(resolved);
1.28156 + return self.asGetProperty([
1.28157 + Namespace.PUBLIC
1.28158 + ], name, 0);
1.28159 + }
1.28160 + Runtime.asGetResolvedStringPropertyFallback = asGetResolvedStringPropertyFallback;
1.28161 + function asSetPublicProperty(name, value) {
1.28162 + var self = this;
1.28163 + return self.asSetProperty(undefined, name, 0, value);
1.28164 + }
1.28165 + Runtime.asSetPublicProperty = asSetPublicProperty;
1.28166 + function asSetProperty(namespaces, name, flags, value) {
1.28167 + var self = this;
1.28168 + if (typeof name === 'object') {
1.28169 + name = String(name);
1.28170 + }
1.28171 + var resolved = self.resolveMultinameProperty(namespaces, name, flags);
1.28172 + if (self.asSetNumericProperty && Multiname.isNumeric(resolved)) {
1.28173 + return self.asSetNumericProperty(resolved, value);
1.28174 + }
1.28175 + var slotInfo = self.asSlots.byQN[resolved];
1.28176 + if (slotInfo) {
1.28177 + if (slotInfo.isConst) {
1.28178 + }
1.28179 + var type = slotInfo.type;
1.28180 + if (type && type.coerce) {
1.28181 + value = type.coerce(value);
1.28182 + }
1.28183 + }
1.28184 + self[resolved] = value;
1.28185 + }
1.28186 + Runtime.asSetProperty = asSetProperty;
1.28187 + function asSetPropertyLikelyNumeric(namespaces, name, flags, value) {
1.28188 + var self = this;
1.28189 + if (typeof name === 'number') {
1.28190 + self.asSetNumericProperty(name, value);
1.28191 + return;
1.28192 + }
1.28193 + return asSetProperty.call(self, namespaces, name, flags, value);
1.28194 + }
1.28195 + Runtime.asSetPropertyLikelyNumeric = asSetPropertyLikelyNumeric;
1.28196 + function asDefinePublicProperty(name, descriptor) {
1.28197 + var self = this;
1.28198 + return self.asDefineProperty(undefined, name, 0, descriptor);
1.28199 + }
1.28200 + Runtime.asDefinePublicProperty = asDefinePublicProperty;
1.28201 + function asDefineProperty(namespaces, name, flags, descriptor) {
1.28202 + var self = this;
1.28203 + if (typeof name === 'object') {
1.28204 + name = String(name);
1.28205 + }
1.28206 + var resolved = self.resolveMultinameProperty(namespaces, name, flags);
1.28207 + Object.defineProperty(self, resolved, descriptor);
1.28208 + }
1.28209 + Runtime.asDefineProperty = asDefineProperty;
1.28210 + function asCallPublicProperty(name, args) {
1.28211 + var self = this;
1.28212 + return self.asCallProperty(undefined, name, 0, false, args);
1.28213 + }
1.28214 + Runtime.asCallPublicProperty = asCallPublicProperty;
1.28215 + function asCallProperty(namespaces, name, flags, isLex, args) {
1.28216 + var self = this;
1.28217 + if (Runtime.traceCallExecution.value) {
1.28218 + var receiverClassName = self.class ? self.class.className + ' ' : '';
1.28219 + callWriter.enter('call ' + receiverClassName + name + '(' + toSafeArrayString(args) + ') #' + callCounter.count(name));
1.28220 + }
1.28221 + var receiver = isLex ? null : self;
1.28222 + var result;
1.28223 + if (isProxyObject(self)) {
1.28224 + result = self[Runtime.VM_CALL_PROXY](new Multiname(namespaces, name, flags), receiver, args);
1.28225 + } else {
1.28226 + var method;
1.28227 + var resolved = self.resolveMultinameProperty(namespaces, name, flags);
1.28228 + if (self.asGetNumericProperty && Multiname.isNumeric(resolved)) {
1.28229 + method = self.asGetNumericProperty(resolved);
1.28230 + } else {
1.28231 + var openMethods = self.asOpenMethods;
1.28232 + if (receiver && openMethods && openMethods[resolved]) {
1.28233 + method = openMethods[resolved];
1.28234 + } else {
1.28235 + method = self[resolved];
1.28236 + }
1.28237 + }
1.28238 + result = method.apply(receiver, args);
1.28239 + }
1.28240 + Runtime.traceCallExecution.value > 0 && callWriter.leave('return ' + toSafeString(result));
1.28241 + return result;
1.28242 + }
1.28243 + Runtime.asCallProperty = asCallProperty;
1.28244 + function asCallSuper(scope, namespaces, name, flags, args) {
1.28245 + var self = this;
1.28246 + if (Runtime.traceCallExecution.value) {
1.28247 + var receiverClassName = self.class ? self.class.className + ' ' : '';
1.28248 + callWriter.enter('call super ' + receiverClassName + name + '(' + toSafeArrayString(args) + ') #' + callCounter.count(name));
1.28249 + }
1.28250 + var baseClass = scope.object.baseClass;
1.28251 + var resolved = baseClass.traitsPrototype.resolveMultinameProperty(namespaces, name, flags);
1.28252 + var openMethods = baseClass.traitsPrototype.asOpenMethods;
1.28253 + var method = openMethods[resolved];
1.28254 + var result = method.apply(this, args);
1.28255 + Runtime.traceCallExecution.value > 0 && callWriter.leave('return ' + toSafeString(result));
1.28256 + return result;
1.28257 + }
1.28258 + Runtime.asCallSuper = asCallSuper;
1.28259 + function asSetSuper(scope, namespaces, name, flags, value) {
1.28260 + var self = this;
1.28261 + if (Runtime.traceCallExecution.value) {
1.28262 + var receiverClassName = self.class ? self.class.className + ' ' : '';
1.28263 + callWriter.enter('set super ' + receiverClassName + name + '(' + toSafeString(value) + ') #' + callCounter.count(name));
1.28264 + }
1.28265 + var baseClass = scope.object.baseClass;
1.28266 + var resolved = baseClass.traitsPrototype.resolveMultinameProperty(namespaces, name, flags);
1.28267 + if (self.asSlots.byQN[resolved]) {
1.28268 + this.asSetProperty(namespaces, name, flags, value);
1.28269 + } else {
1.28270 + baseClass.traitsPrototype[Runtime.VM_OPEN_SET_METHOD_PREFIX + resolved].call(this, value);
1.28271 + }
1.28272 + Runtime.traceCallExecution.value > 0 && callWriter.leave('');
1.28273 + }
1.28274 + Runtime.asSetSuper = asSetSuper;
1.28275 + function asGetSuper(scope, namespaces, name, flags) {
1.28276 + var self = this;
1.28277 + if (Runtime.traceCallExecution.value) {
1.28278 + var receiver = self.class ? self.class.className + ' ' : '';
1.28279 + callWriter.enter('get super ' + receiver + name + ' #' + callCounter.count(name));
1.28280 + }
1.28281 + var baseClass = scope.object.baseClass;
1.28282 + var resolved = baseClass.traitsPrototype.resolveMultinameProperty(namespaces, name, flags);
1.28283 + var result;
1.28284 + if (self.asSlots.byQN[resolved]) {
1.28285 + result = this.asGetProperty(namespaces, name, flags);
1.28286 + } else {
1.28287 + result = baseClass.traitsPrototype[Runtime.VM_OPEN_GET_METHOD_PREFIX + resolved].call(this);
1.28288 + }
1.28289 + Runtime.traceCallExecution.value > 0 && callWriter.leave('return ' + toSafeString(result));
1.28290 + return result;
1.28291 + }
1.28292 + Runtime.asGetSuper = asGetSuper;
1.28293 + function construct(cls, args) {
1.28294 + if (cls.classInfo) {
1.28295 + var qn = Multiname.getQualifiedName(cls.classInfo.instanceInfo.name);
1.28296 + if (qn === Multiname.String) {
1.28297 + return String.apply(null, args);
1.28298 + }
1.28299 + if (qn === Multiname.Boolean) {
1.28300 + return Boolean.apply(null, args);
1.28301 + }
1.28302 + if (qn === Multiname.Number) {
1.28303 + return Number.apply(null, args);
1.28304 + }
1.28305 + }
1.28306 + var c = cls.instanceConstructor;
1.28307 + var a = args;
1.28308 + switch (args.length) {
1.28309 + case 0:
1.28310 + return new c();
1.28311 + case 1:
1.28312 + return new c(a[0]);
1.28313 + case 2:
1.28314 + return new c(a[0], a[1]);
1.28315 + case 3:
1.28316 + return new c(a[0], a[1], a[2]);
1.28317 + case 4:
1.28318 + return new c(a[0], a[1], a[2], a[3]);
1.28319 + case 5:
1.28320 + return new c(a[0], a[1], a[2], a[3], a[4]);
1.28321 + case 6:
1.28322 + return new c(a[0], a[1], a[2], a[3], a[4], a[5]);
1.28323 + case 7:
1.28324 + return new c(a[0], a[1], a[2], a[3], a[4], a[5], a[6]);
1.28325 + case 8:
1.28326 + return new c(a[0], a[1], a[2], a[3], a[4], a[5], a[6], a[7]);
1.28327 + case 9:
1.28328 + return new c(a[0], a[1], a[2], a[3], a[4], a[5], a[6], a[7], a[8]);
1.28329 + case 10:
1.28330 + return new c(a[0], a[1], a[2], a[3], a[4], a[5], a[6], a[7], a[8], a[9]);
1.28331 + }
1.28332 + var applyArguments = [];
1.28333 + for (var i = 0; i < args.length; i++) {
1.28334 + applyArguments[i + 1] = args[i];
1.28335 + }
1.28336 + return new (Function.bind.apply(c, applyArguments))();
1.28337 + }
1.28338 + Runtime.construct = construct;
1.28339 + function asConstructProperty(namespaces, name, flags, args) {
1.28340 + var self = this;
1.28341 + var constructor = self.asGetProperty(namespaces, name, flags);
1.28342 + if (Runtime.traceCallExecution.value) {
1.28343 + callWriter.enter('construct ' + name + '(' + toSafeArrayString(args) + ') #' + callCounter.count(name));
1.28344 + }
1.28345 + var result = construct(constructor, args);
1.28346 + Runtime.traceCallExecution.value > 0 && callWriter.leave('return ' + toSafeString(result));
1.28347 + return result;
1.28348 + }
1.28349 + Runtime.asConstructProperty = asConstructProperty;
1.28350 + function nonProxyingHasProperty(object, name) {
1.28351 + return name in object;
1.28352 + }
1.28353 + Runtime.nonProxyingHasProperty = nonProxyingHasProperty;
1.28354 + function asHasProperty(namespaces, name, flags, nonProxy) {
1.28355 + var self = this;
1.28356 + if (self.hasProperty) {
1.28357 + return self.hasProperty(namespaces, name, flags);
1.28358 + }
1.28359 + if (nonProxy) {
1.28360 + return nonProxyingHasProperty(self, self.resolveMultinameProperty(namespaces, name, flags));
1.28361 + } else {
1.28362 + return self.resolveMultinameProperty(namespaces, name, flags) in this;
1.28363 + }
1.28364 + }
1.28365 + Runtime.asHasProperty = asHasProperty;
1.28366 + function asDeleteProperty(namespaces, name, flags) {
1.28367 + var self = this;
1.28368 + if (self.asHasTraitProperty(namespaces, name, flags)) {
1.28369 + return false;
1.28370 + }
1.28371 + var resolved = self.resolveMultinameProperty(namespaces, name, flags);
1.28372 + return delete self[resolved];
1.28373 + }
1.28374 + Runtime.asDeleteProperty = asDeleteProperty;
1.28375 + function asHasTraitProperty(namespaces, name, flags) {
1.28376 + var self = this;
1.28377 + var resolved = self.resolveMultinameProperty(namespaces, name, flags);
1.28378 + return self.asBindings.indexOf(resolved) >= 0;
1.28379 + }
1.28380 + Runtime.asHasTraitProperty = asHasTraitProperty;
1.28381 + function asGetNumericProperty(i) {
1.28382 + return this[i];
1.28383 + }
1.28384 + Runtime.asGetNumericProperty = asGetNumericProperty;
1.28385 + function asSetNumericProperty(i, v) {
1.28386 + this[i] = v;
1.28387 + }
1.28388 + Runtime.asSetNumericProperty = asSetNumericProperty;
1.28389 + function asGetDescendants(namespaces, name, flags) {
1.28390 + Shumway.Debug.notImplemented('asGetDescendants');
1.28391 + }
1.28392 + Runtime.asGetDescendants = asGetDescendants;
1.28393 + function asNextNameIndex(index) {
1.28394 + var self = this;
1.28395 + if (index === 0) {
1.28396 + defineNonEnumerableProperty(self, 'asEnumerableKeys', self.asGetEnumerableKeys());
1.28397 + }
1.28398 + var asEnumerableKeys = self.asEnumerableKeys;
1.28399 + while (index < asEnumerableKeys.length) {
1.28400 + if (self.asHasProperty(undefined, asEnumerableKeys[index], 0)) {
1.28401 + return index + 1;
1.28402 + }
1.28403 + index++;
1.28404 + }
1.28405 + return 0;
1.28406 + }
1.28407 + Runtime.asNextNameIndex = asNextNameIndex;
1.28408 + function asNextName(index) {
1.28409 + var self = this;
1.28410 + var asEnumerableKeys = self.asEnumerableKeys;
1.28411 + true;
1.28412 + return asEnumerableKeys[index - 1];
1.28413 + }
1.28414 + Runtime.asNextName = asNextName;
1.28415 + function asNextValue(index) {
1.28416 + return this.asGetPublicProperty(this.asNextName(index));
1.28417 + }
1.28418 + Runtime.asNextValue = asNextValue;
1.28419 + function asGetEnumerableKeys() {
1.28420 + var self = this;
1.28421 + var boxedValue = self.valueOf();
1.28422 + if (typeof boxedValue === 'string' || typeof boxedValue === 'number') {
1.28423 + return [];
1.28424 + }
1.28425 + var keys = Object.keys(this);
1.28426 + var result = [];
1.28427 + for (var i = 0; i < keys.length; i++) {
1.28428 + var key = keys[i];
1.28429 + if (Shumway.isNumeric(key)) {
1.28430 + result.push(key);
1.28431 + } else {
1.28432 + var name = Multiname.stripPublicQualifier(key);
1.28433 + if (name !== undefined) {
1.28434 + result.push(name);
1.28435 + }
1.28436 + }
1.28437 + }
1.28438 + return result;
1.28439 + }
1.28440 + Runtime.asGetEnumerableKeys = asGetEnumerableKeys;
1.28441 + function asTypeOf(x) {
1.28442 + if (x) {
1.28443 + if (x.constructor === String) {
1.28444 + return 'string';
1.28445 + } else if (x.constructor === Number) {
1.28446 + return 'number';
1.28447 + } else if (x.constructor === Boolean) {
1.28448 + return 'boolean';
1.28449 + } else if (x instanceof XML || x instanceof XMLList) {
1.28450 + return 'xml';
1.28451 + }
1.28452 + }
1.28453 + return typeof x;
1.28454 + }
1.28455 + Runtime.asTypeOf = asTypeOf;
1.28456 + function publicizeProperties(object) {
1.28457 + var keys = Object.keys(object);
1.28458 + for (var i = 0; i < keys.length; i++) {
1.28459 + var k = keys[i];
1.28460 + if (!Multiname.isPublicQualifiedName(k)) {
1.28461 + var v = object[k];
1.28462 + object[Multiname.getPublicQualifiedName(k)] = v;
1.28463 + delete object[k];
1.28464 + }
1.28465 + }
1.28466 + }
1.28467 + Runtime.publicizeProperties = publicizeProperties;
1.28468 + function asGetSlot(object, index) {
1.28469 + return object[object.asSlots.byID[index].name];
1.28470 + }
1.28471 + Runtime.asGetSlot = asGetSlot;
1.28472 + function asSetSlot(object, index, value) {
1.28473 + var slotInfo = object.asSlots.byID[index];
1.28474 + if (slotInfo.const) {
1.28475 + return;
1.28476 + }
1.28477 + var name = slotInfo.name;
1.28478 + var type = slotInfo.type;
1.28479 + if (type && type.coerce) {
1.28480 + object[name] = type.coerce(value);
1.28481 + } else {
1.28482 + object[name] = value;
1.28483 + }
1.28484 + }
1.28485 + Runtime.asSetSlot = asSetSlot;
1.28486 + function throwError(name, error) {
1.28487 + if (true) {
1.28488 + var message = Shumway.AVM2.formatErrorMessage.apply(null, Array.prototype.slice.call(arguments, 1));
1.28489 + throwErrorFromVM(Shumway.AVM2.Runtime.AVM2.currentDomain(), name, message, error.code);
1.28490 + } else {
1.28491 + throwErrorFromVM(Shumway.AVM2.Runtime.AVM2.currentDomain(), name, Shumway.AVM2.getErrorMessage(error.code), error.code);
1.28492 + }
1.28493 + }
1.28494 + Runtime.throwError = throwError;
1.28495 + function throwErrorFromVM(domain, errorClass, message, id) {
1.28496 + var error = new (domain.getClass(errorClass)).instanceConstructor(message, id);
1.28497 + throw error;
1.28498 + }
1.28499 + Runtime.throwErrorFromVM = throwErrorFromVM;
1.28500 + function translateError(domain, error) {
1.28501 + if (error instanceof Error) {
1.28502 + var type = domain.getClass(error.name);
1.28503 + if (type) {
1.28504 + return new type.instanceConstructor(Shumway.AVM2.translateErrorMessage(error));
1.28505 + }
1.28506 + Shumway.Debug.unexpected('Can\'t translate error: ' + error);
1.28507 + }
1.28508 + return error;
1.28509 + }
1.28510 + Runtime.translateError = translateError;
1.28511 + function asIsInstanceOf(type, value) {
1.28512 + return type.isInstanceOf(value);
1.28513 + }
1.28514 + Runtime.asIsInstanceOf = asIsInstanceOf;
1.28515 + function asIsType(type, value) {
1.28516 + return type.isInstance(value);
1.28517 + }
1.28518 + Runtime.asIsType = asIsType;
1.28519 + function asAsType(type, value) {
1.28520 + return asIsType(type, value) ? value : null;
1.28521 + }
1.28522 + Runtime.asAsType = asAsType;
1.28523 + function asCoerceByMultiname(domain, multiname, value) {
1.28524 + true;
1.28525 + switch (Multiname.getQualifiedName(multiname)) {
1.28526 + case Multiname.Int:
1.28527 + return asCoerceInt(value);
1.28528 + case Multiname.Uint:
1.28529 + return asCoerceUint(value);
1.28530 + case Multiname.String:
1.28531 + return asCoerceString(value);
1.28532 + case Multiname.Number:
1.28533 + return asCoerceNumber(value);
1.28534 + case Multiname.Boolean:
1.28535 + return asCoerceBoolean(value);
1.28536 + case Multiname.Object:
1.28537 + return asCoerceObject(value);
1.28538 + }
1.28539 + return asCoerce(domain.getType(multiname), value);
1.28540 + }
1.28541 + Runtime.asCoerceByMultiname = asCoerceByMultiname;
1.28542 + function asCoerce(type, value) {
1.28543 + if (type.coerce) {
1.28544 + return type.coerce(value);
1.28545 + }
1.28546 + if (Shumway.isNullOrUndefined(value)) {
1.28547 + return null;
1.28548 + }
1.28549 + if (type.isInstance(value)) {
1.28550 + return value;
1.28551 + } else {
1.28552 + true;
1.28553 + }
1.28554 + }
1.28555 + Runtime.asCoerce = asCoerce;
1.28556 + function asCoerceString(x) {
1.28557 + if (typeof x === 'string') {
1.28558 + return x;
1.28559 + } else if (x == undefined) {
1.28560 + return null;
1.28561 + }
1.28562 + return x + '';
1.28563 + }
1.28564 + Runtime.asCoerceString = asCoerceString;
1.28565 + function asCoerceInt(x) {
1.28566 + return x | 0;
1.28567 + }
1.28568 + Runtime.asCoerceInt = asCoerceInt;
1.28569 + function asCoerceUint(x) {
1.28570 + return x >>> 0;
1.28571 + }
1.28572 + Runtime.asCoerceUint = asCoerceUint;
1.28573 + function asCoerceNumber(x) {
1.28574 + return +x;
1.28575 + }
1.28576 + Runtime.asCoerceNumber = asCoerceNumber;
1.28577 + function asCoerceBoolean(x) {
1.28578 + return !(!x);
1.28579 + }
1.28580 + Runtime.asCoerceBoolean = asCoerceBoolean;
1.28581 + function asCoerceObject(x) {
1.28582 + if (x == undefined) {
1.28583 + return null;
1.28584 + }
1.28585 + if (typeof x === 'string' || typeof x === 'number') {
1.28586 + return x;
1.28587 + }
1.28588 + return Object(x);
1.28589 + }
1.28590 + Runtime.asCoerceObject = asCoerceObject;
1.28591 + function asDefaultCompareFunction(a, b) {
1.28592 + return String(a).localeCompare(String(b));
1.28593 + }
1.28594 + Runtime.asDefaultCompareFunction = asDefaultCompareFunction;
1.28595 + function asCompare(a, b, options, compareFunction) {
1.28596 + true;
1.28597 + true;
1.28598 + var result = 0;
1.28599 + if (!compareFunction) {
1.28600 + compareFunction = asDefaultCompareFunction;
1.28601 + }
1.28602 + if (options & 1) {
1.28603 + a = String(a).toLowerCase();
1.28604 + b = String(b).toLowerCase();
1.28605 + }
1.28606 + if (options & 16) {
1.28607 + a = Shumway.toNumber(a);
1.28608 + b = Shumway.toNumber(b);
1.28609 + result = a < b ? -1 : a > b ? 1 : 0;
1.28610 + } else {
1.28611 + result = compareFunction(a, b);
1.28612 + }
1.28613 + if (options & 2) {
1.28614 + result *= -1;
1.28615 + }
1.28616 + return result;
1.28617 + }
1.28618 + Runtime.asCompare = asCompare;
1.28619 + function asAdd(l, r) {
1.28620 + if (typeof l === 'string' || typeof r === 'string') {
1.28621 + return String(l) + String(r);
1.28622 + }
1.28623 + return l + r;
1.28624 + }
1.28625 + Runtime.asAdd = asAdd;
1.28626 + function asHasNext2(object, index) {
1.28627 + if (Shumway.isNullOrUndefined(object)) {
1.28628 + return {
1.28629 + index: 0,
1.28630 + object: null
1.28631 + };
1.28632 + }
1.28633 + object = boxValue(object);
1.28634 + var nextIndex = object.asNextNameIndex(index);
1.28635 + if (nextIndex > 0) {
1.28636 + return {
1.28637 + index: nextIndex,
1.28638 + object: object
1.28639 + };
1.28640 + }
1.28641 + while (true) {
1.28642 + var object = Object.getPrototypeOf(object);
1.28643 + if (!object) {
1.28644 + return {
1.28645 + index: 0,
1.28646 + object: null
1.28647 + };
1.28648 + }
1.28649 + nextIndex = object.asNextNameIndex(0);
1.28650 + if (nextIndex > 0) {
1.28651 + return {
1.28652 + index: nextIndex,
1.28653 + object: object
1.28654 + };
1.28655 + }
1.28656 + }
1.28657 + return {
1.28658 + index: 0,
1.28659 + object: null
1.28660 + };
1.28661 + }
1.28662 + Runtime.asHasNext2 = asHasNext2;
1.28663 + function getDescendants(object, mn) {
1.28664 + if (!isXMLType(object)) {
1.28665 + throw 'Not XML object in getDescendants';
1.28666 + }
1.28667 + return object.descendants(mn);
1.28668 + }
1.28669 + Runtime.getDescendants = getDescendants;
1.28670 + function checkFilter(value) {
1.28671 + if (!value.class || !isXMLType(value)) {
1.28672 + throw 'TypeError operand of childFilter not of XML type';
1.28673 + }
1.28674 + return value;
1.28675 + }
1.28676 + Runtime.checkFilter = checkFilter;
1.28677 + function initializeGlobalObject(global) {
1.28678 + var VM_NATIVE_BUILTIN_SURROGATES = [
1.28679 + {
1.28680 + name: 'Object',
1.28681 + methods: [
1.28682 + 'toString',
1.28683 + 'valueOf'
1.28684 + ]
1.28685 + },
1.28686 + {
1.28687 + name: 'Function',
1.28688 + methods: [
1.28689 + 'toString',
1.28690 + 'valueOf'
1.28691 + ]
1.28692 + }
1.28693 + ];
1.28694 + var originals = global[Runtime.VM_NATIVE_BUILTIN_ORIGINALS] = createEmptyObject();
1.28695 + VM_NATIVE_BUILTIN_SURROGATES.forEach(function (surrogate) {
1.28696 + var object = global[surrogate.name];
1.28697 + originals[surrogate.name] = createEmptyObject();
1.28698 + surrogate.methods.forEach(function (originalFunctionName) {
1.28699 + var originalFunction;
1.28700 + if (object.prototype.hasOwnProperty(originalFunctionName)) {
1.28701 + originalFunction = object.prototype[originalFunctionName];
1.28702 + } else {
1.28703 + originalFunction = originals['Object'][originalFunctionName];
1.28704 + }
1.28705 + originals[surrogate.name][originalFunctionName] = originalFunction;
1.28706 + var overrideFunctionName = Multiname.getPublicQualifiedName(originalFunctionName);
1.28707 + if (useSurrogates) {
1.28708 + global[surrogate.name].prototype[originalFunctionName] = function surrogate() {
1.28709 + if (this[overrideFunctionName]) {
1.28710 + return this[overrideFunctionName]();
1.28711 + }
1.28712 + return originalFunction.call(this);
1.28713 + };
1.28714 + }
1.28715 + });
1.28716 + });
1.28717 + [
1.28718 + 'Object',
1.28719 + 'Number',
1.28720 + 'Boolean',
1.28721 + 'String',
1.28722 + 'Array',
1.28723 + 'Date',
1.28724 + 'RegExp'
1.28725 + ].forEach(function (name) {
1.28726 + defineReadOnlyProperty(global[name].prototype, Runtime.VM_NATIVE_PROTOTYPE_FLAG, true);
1.28727 + });
1.28728 + defineNonEnumerableProperty(global.Object.prototype, 'getNamespaceResolutionMap', getNamespaceResolutionMap);
1.28729 + defineNonEnumerableProperty(global.Object.prototype, 'resolveMultinameProperty', resolveMultinameProperty);
1.28730 + defineNonEnumerableProperty(global.Object.prototype, 'asGetProperty', asGetProperty);
1.28731 + defineNonEnumerableProperty(global.Object.prototype, 'asGetPublicProperty', asGetPublicProperty);
1.28732 + defineNonEnumerableProperty(global.Object.prototype, 'asGetResolvedStringProperty', asGetResolvedStringProperty);
1.28733 + defineNonEnumerableProperty(global.Object.prototype, 'asSetProperty', asSetProperty);
1.28734 + defineNonEnumerableProperty(global.Object.prototype, 'asSetPublicProperty', asSetPublicProperty);
1.28735 + defineNonEnumerableProperty(global.Object.prototype, 'asDefineProperty', asDefineProperty);
1.28736 + defineNonEnumerableProperty(global.Object.prototype, 'asDefinePublicProperty', asDefinePublicProperty);
1.28737 + defineNonEnumerableProperty(global.Object.prototype, 'asCallProperty', asCallProperty);
1.28738 + defineNonEnumerableProperty(global.Object.prototype, 'asCallSuper', asCallSuper);
1.28739 + defineNonEnumerableProperty(global.Object.prototype, 'asGetSuper', asGetSuper);
1.28740 + defineNonEnumerableProperty(global.Object.prototype, 'asSetSuper', asSetSuper);
1.28741 + defineNonEnumerableProperty(global.Object.prototype, 'asCallPublicProperty', asCallPublicProperty);
1.28742 + defineNonEnumerableProperty(global.Object.prototype, 'asCallResolvedStringProperty', asCallResolvedStringProperty);
1.28743 + defineNonEnumerableProperty(global.Object.prototype, 'asConstructProperty', asConstructProperty);
1.28744 + defineNonEnumerableProperty(global.Object.prototype, 'asHasProperty', asHasProperty);
1.28745 + defineNonEnumerableProperty(global.Object.prototype, 'asHasTraitProperty', asHasTraitProperty);
1.28746 + defineNonEnumerableProperty(global.Object.prototype, 'asDeleteProperty', asDeleteProperty);
1.28747 + defineNonEnumerableProperty(global.Object.prototype, 'asNextName', asNextName);
1.28748 + defineNonEnumerableProperty(global.Object.prototype, 'asNextValue', asNextValue);
1.28749 + defineNonEnumerableProperty(global.Object.prototype, 'asNextNameIndex', asNextNameIndex);
1.28750 + defineNonEnumerableProperty(global.Object.prototype, 'asGetEnumerableKeys', asGetEnumerableKeys);
1.28751 + [
1.28752 + 'Array',
1.28753 + 'Int8Array',
1.28754 + 'Uint8Array',
1.28755 + 'Uint8ClampedArray',
1.28756 + 'Int16Array',
1.28757 + 'Uint16Array',
1.28758 + 'Int32Array',
1.28759 + 'Uint32Array',
1.28760 + 'Float32Array',
1.28761 + 'Float64Array'
1.28762 + ].forEach(function (name) {
1.28763 + if (!(name in global)) {
1.28764 + log(name + ' was not found in globals');
1.28765 + return;
1.28766 + }
1.28767 + defineNonEnumerableProperty(global[name].prototype, 'asGetNumericProperty', asGetNumericProperty);
1.28768 + defineNonEnumerableProperty(global[name].prototype, 'asSetNumericProperty', asSetNumericProperty);
1.28769 + defineNonEnumerableProperty(global[name].prototype, 'asGetProperty', asGetPropertyLikelyNumeric);
1.28770 + defineNonEnumerableProperty(global[name].prototype, 'asSetProperty', asSetPropertyLikelyNumeric);
1.28771 + });
1.28772 + global.Array.prototype.asGetProperty = function (namespaces, name, flags) {
1.28773 + if (typeof name === 'number') {
1.28774 + return this[name];
1.28775 + }
1.28776 + return asGetProperty.call(this, namespaces, name, flags);
1.28777 + };
1.28778 + global.Array.prototype.asSetProperty = function (namespaces, name, flags, value) {
1.28779 + if (typeof name === 'number') {
1.28780 + this[name] = value;
1.28781 + return;
1.28782 + }
1.28783 + return asSetProperty.call(this, namespaces, name, flags, value);
1.28784 + };
1.28785 + }
1.28786 + Runtime.initializeGlobalObject = initializeGlobalObject;
1.28787 + function nameInTraits(object, qn) {
1.28788 + if (object.hasOwnProperty(Runtime.VM_BINDINGS) && object.hasOwnProperty(qn)) {
1.28789 + return true;
1.28790 + }
1.28791 + var proto = Object.getPrototypeOf(object);
1.28792 + return proto.hasOwnProperty(Runtime.VM_BINDINGS) && proto.hasOwnProperty(qn);
1.28793 + }
1.28794 + Runtime.nameInTraits = nameInTraits;
1.28795 + function CatchScopeObject(domain, trait) {
1.28796 + if (trait) {
1.28797 + new Shumway.AVM2.Runtime.CatchBindings(new Shumway.AVM2.Runtime.Scope(null, this), trait).applyTo(domain, this);
1.28798 + }
1.28799 + }
1.28800 + Runtime.CatchScopeObject = CatchScopeObject;
1.28801 + var Global = function () {
1.28802 + function Global(script) {
1.28803 + this.scriptInfo = script;
1.28804 + script.global = this;
1.28805 + this.scriptBindings = new Shumway.AVM2.Runtime.ScriptBindings(script, new Shumway.AVM2.Runtime.Scope(null, this, false));
1.28806 + this.scriptBindings.applyTo(script.abc.applicationDomain, this);
1.28807 + script.loaded = true;
1.28808 + }
1.28809 + Global.prototype.toString = function () {
1.28810 + return '[object global]';
1.28811 + };
1.28812 + Global.prototype.isExecuted = function () {
1.28813 + return this.scriptInfo.executed;
1.28814 + };
1.28815 + Global.prototype.isExecuting = function () {
1.28816 + return this.scriptInfo.executing;
1.28817 + };
1.28818 + Global.prototype.ensureExecuted = function () {
1.28819 + Shumway.AVM2.Runtime.ensureScriptIsExecuted(this.scriptInfo);
1.28820 + };
1.28821 + return Global;
1.28822 + }();
1.28823 + Runtime.Global = Global;
1.28824 + defineNonEnumerableProperty(Global.prototype, Multiname.getPublicQualifiedName('toString'), function () {
1.28825 + return this.toString();
1.28826 + });
1.28827 + var LazyInitializer = function () {
1.28828 + function LazyInitializer(target) {
1.28829 + this.target = target;
1.28830 + }
1.28831 + LazyInitializer.create = function (target) {
1.28832 + if (target.asLazyInitializer) {
1.28833 + return target.asLazyInitializer;
1.28834 + }
1.28835 + return target.asLazyInitializer = new LazyInitializer(target);
1.28836 + };
1.28837 + LazyInitializer.prototype.getName = function () {
1.28838 + if (this.name) {
1.28839 + return this.name;
1.28840 + }
1.28841 + var target = this.target, initialize;
1.28842 + if (this.target instanceof ScriptInfo) {
1.28843 + var scriptInfo = target;
1.28844 + this.name = '$' + Shumway.StringUtilities.variableLengthEncodeInt32(scriptInfo.hash);
1.28845 + initialize = function () {
1.28846 + Shumway.AVM2.Runtime.ensureScriptIsExecuted(target, 'Lazy Initializer');
1.28847 + return scriptInfo.global;
1.28848 + };
1.28849 + } else if (this.target instanceof ClassInfo) {
1.28850 + var classInfo = target;
1.28851 + this.name = '$' + Shumway.StringUtilities.variableLengthEncodeInt32(classInfo.hash);
1.28852 + initialize = function () {
1.28853 + if (classInfo.classObject) {
1.28854 + return classInfo.classObject;
1.28855 + }
1.28856 + return classInfo.abc.applicationDomain.getProperty(classInfo.instanceInfo.name);
1.28857 + };
1.28858 + } else {
1.28859 + Shumway.Debug.notImplemented(String(target));
1.28860 + }
1.28861 + var name = this.name;
1.28862 + Object.defineProperty(LazyInitializer._holder, name, {
1.28863 + get: function () {
1.28864 + var value = initialize();
1.28865 + Object.defineProperty(LazyInitializer._holder, name, {
1.28866 + value: value,
1.28867 + writable: true
1.28868 + });
1.28869 + return value;
1.28870 + },
1.28871 + configurable: true
1.28872 + });
1.28873 + return name;
1.28874 + };
1.28875 + LazyInitializer._holder = jsGlobal;
1.28876 + return LazyInitializer;
1.28877 + }();
1.28878 + Runtime.LazyInitializer = LazyInitializer;
1.28879 + function forEachPublicProperty(object, fn, self) {
1.28880 + if (!object.asBindings) {
1.28881 + for (var key in object) {
1.28882 + fn.call(self, key, object[key]);
1.28883 + }
1.28884 + return;
1.28885 + }
1.28886 + for (var key in object) {
1.28887 + if (Shumway.isNumeric(key)) {
1.28888 + fn.call(self, key, object[key]);
1.28889 + } else if (Multiname.isPublicQualifiedName(key) && object.asBindings.indexOf(key) < 0) {
1.28890 + var name = Multiname.stripPublicQualifier(key);
1.28891 + fn.call(self, name, object[key]);
1.28892 + }
1.28893 + }
1.28894 + }
1.28895 + Runtime.forEachPublicProperty = forEachPublicProperty;
1.28896 + function wrapJSObject(object) {
1.28897 + var wrapper = Object.create(object);
1.28898 + for (var i in object) {
1.28899 + Object.defineProperty(wrapper, Multiname.getPublicQualifiedName(i), function (object, i) {
1.28900 + return {
1.28901 + get: function () {
1.28902 + return object[i];
1.28903 + },
1.28904 + set: function (value) {
1.28905 + object[i] = value;
1.28906 + },
1.28907 + enumerable: true
1.28908 + };
1.28909 + }(object, i));
1.28910 + }
1.28911 + return wrapper;
1.28912 + }
1.28913 + Runtime.wrapJSObject = wrapJSObject;
1.28914 + function asCreateActivation(methodInfo) {
1.28915 + return Object.create(methodInfo.activationPrototype);
1.28916 + }
1.28917 + Runtime.asCreateActivation = asCreateActivation;
1.28918 + var GlobalMultinameResolver = function () {
1.28919 + function GlobalMultinameResolver() {
1.28920 + }
1.28921 + GlobalMultinameResolver.updateTraits = function (traits) {
1.28922 + for (var i = 0; i < traits.length; i++) {
1.28923 + var trait = traits[i];
1.28924 + var name = trait.name.name;
1.28925 + var namespace = trait.name.getNamespace();
1.28926 + if (!namespace.isDynamic()) {
1.28927 + GlobalMultinameResolver.hasNonDynamicNamespaces[name] = true;
1.28928 + if (GlobalMultinameResolver.wasResolved[name]) {
1.28929 + Shumway.Debug.notImplemented('We have to the undo the optimization, ' + name + ' can now bind to ' + namespace);
1.28930 + }
1.28931 + }
1.28932 + }
1.28933 + };
1.28934 + GlobalMultinameResolver.loadAbc = function (abc) {
1.28935 + if (!Runtime.globalMultinameAnalysis.value) {
1.28936 + return;
1.28937 + }
1.28938 + var scripts = abc.scripts;
1.28939 + var classes = abc.classes;
1.28940 + var methods = abc.methods;
1.28941 + for (var i = 0; i < scripts.length; i++) {
1.28942 + GlobalMultinameResolver.updateTraits(scripts[i].traits);
1.28943 + }
1.28944 + for (var i = 0; i < classes.length; i++) {
1.28945 + GlobalMultinameResolver.updateTraits(classes[i].traits);
1.28946 + GlobalMultinameResolver.updateTraits(classes[i].instanceInfo.traits);
1.28947 + }
1.28948 + for (var i = 0; i < methods.length; i++) {
1.28949 + if (methods[i].traits) {
1.28950 + GlobalMultinameResolver.updateTraits(methods[i].traits);
1.28951 + }
1.28952 + }
1.28953 + };
1.28954 + GlobalMultinameResolver.resolveMultiname = function (multiname) {
1.28955 + var name = multiname.name;
1.28956 + if (GlobalMultinameResolver.hasNonDynamicNamespaces[name]) {
1.28957 + return;
1.28958 + }
1.28959 + GlobalMultinameResolver.wasResolved[name] = true;
1.28960 + return new Multiname([
1.28961 + Namespace.PUBLIC
1.28962 + ], multiname.name);
1.28963 + };
1.28964 + GlobalMultinameResolver.hasNonDynamicNamespaces = createEmptyObject();
1.28965 + GlobalMultinameResolver.wasResolved = createEmptyObject();
1.28966 + return GlobalMultinameResolver;
1.28967 + }();
1.28968 + Runtime.GlobalMultinameResolver = GlobalMultinameResolver;
1.28969 + var ActivationInfo = function () {
1.28970 + function ActivationInfo(methodInfo) {
1.28971 + this.methodInfo = methodInfo;
1.28972 + }
1.28973 + return ActivationInfo;
1.28974 + }();
1.28975 + Runtime.ActivationInfo = ActivationInfo;
1.28976 + function sliceArguments(args, offset) {
1.28977 + if (typeof offset === 'undefined') {
1.28978 + offset = 0;
1.28979 + }
1.28980 + return Array.prototype.slice.call(args, offset);
1.28981 + }
1.28982 + Runtime.sliceArguments = sliceArguments;
1.28983 + function canCompile(mi) {
1.28984 + if (!mi.hasBody) {
1.28985 + return false;
1.28986 + }
1.28987 + if (mi.hasExceptions() && !compilerEnableExceptions.value) {
1.28988 + return false;
1.28989 + } else if (mi.code.length > compilerMaximumMethodSize.value) {
1.28990 + return false;
1.28991 + }
1.28992 + return true;
1.28993 + }
1.28994 + Runtime.canCompile = canCompile;
1.28995 + function shouldCompile(mi) {
1.28996 + if (!canCompile(mi)) {
1.28997 + return false;
1.28998 + }
1.28999 + if (mi.isClassInitializer || mi.isScriptInitializer) {
1.29000 + return false;
1.29001 + }
1.29002 + return true;
1.29003 + }
1.29004 + Runtime.shouldCompile = shouldCompile;
1.29005 + function forceCompile(mi) {
1.29006 + if (mi.hasExceptions()) {
1.29007 + return false;
1.29008 + }
1.29009 + var holder = mi.holder;
1.29010 + if (holder instanceof ClassInfo) {
1.29011 + holder = holder.instanceInfo;
1.29012 + }
1.29013 + if (holder instanceof InstanceInfo) {
1.29014 + var packageName = holder.name.namespaces[0].uri;
1.29015 + switch (packageName) {
1.29016 + case 'flash.geom':
1.29017 + case 'flash.events':
1.29018 + return true;
1.29019 + default:
1.29020 + break;
1.29021 + }
1.29022 + var className = holder.name.getOriginalName();
1.29023 + switch (className) {
1.29024 + case 'com.google.youtube.model.VideoData':
1.29025 + return true;
1.29026 + }
1.29027 + }
1.29028 + return false;
1.29029 + }
1.29030 + Runtime.forceCompile = forceCompile;
1.29031 + Runtime.CODE_CACHE = createEmptyObject();
1.29032 + function searchCodeCache(methodInfo) {
1.29033 + if (!Runtime.codeCaching.value) {
1.29034 + return;
1.29035 + }
1.29036 + var cacheInfo = Runtime.CODE_CACHE[methodInfo.abc.hash];
1.29037 + if (!cacheInfo) {
1.29038 + warn('Cannot Find Code Cache For ABC, name: ' + methodInfo.abc.name + ', hash: ' + methodInfo.abc.hash);
1.29039 + Counter.count('Code Cache ABC Miss');
1.29040 + return;
1.29041 + }
1.29042 + if (!cacheInfo.isInitialized) {
1.29043 + methodInfo.abc.scripts.forEach(function (scriptInfo) {
1.29044 + LazyInitializer.create(scriptInfo).getName();
1.29045 + });
1.29046 + methodInfo.abc.classes.forEach(function (classInfo) {
1.29047 + LazyInitializer.create(classInfo).getName();
1.29048 + });
1.29049 + cacheInfo.isInitialized = true;
1.29050 + }
1.29051 + var method = cacheInfo.methods[methodInfo.index];
1.29052 + if (!method) {
1.29053 + if (methodInfo.isInstanceInitializer || methodInfo.isClassInitializer) {
1.29054 + Counter.count('Code Cache Query On Initializer');
1.29055 + } else {
1.29056 + Counter.count('Code Cache MISS ON OTHER');
1.29057 + warn('Shouldn\'t MISS: ' + methodInfo + ' ' + methodInfo.debugName);
1.29058 + }
1.29059 + Counter.count('Code Cache Miss');
1.29060 + return;
1.29061 + }
1.29062 + log('Linking CC: ' + methodInfo);
1.29063 + Counter.count('Code Cache Hit');
1.29064 + return method;
1.29065 + }
1.29066 + Runtime.searchCodeCache = searchCodeCache;
1.29067 + function createInterpretedFunction(methodInfo, scope, hasDynamicScope) {
1.29068 + var mi = methodInfo;
1.29069 + var hasDefaults = false;
1.29070 + var defaults = mi.parameters.map(function (p) {
1.29071 + if (p.value !== undefined) {
1.29072 + hasDefaults = true;
1.29073 + }
1.29074 + return p.value;
1.29075 + });
1.29076 + var fn;
1.29077 + if (hasDynamicScope) {
1.29078 + fn = function (scope) {
1.29079 + var global = this === jsGlobal ? scope.global.object : this;
1.29080 + var args = sliceArguments(arguments, 1);
1.29081 + if (hasDefaults && args.length < defaults.length) {
1.29082 + args = args.concat(defaults.slice(args.length - defaults.length));
1.29083 + }
1.29084 + return Shumway.AVM2.Interpreter.interpretMethod(global, methodInfo, scope, args);
1.29085 + };
1.29086 + } else {
1.29087 + fn = function () {
1.29088 + var global = this === jsGlobal ? scope.global.object : this;
1.29089 + var args = sliceArguments(arguments);
1.29090 + if (hasDefaults && args.length < defaults.length) {
1.29091 + args = args.concat(defaults.slice(arguments.length - defaults.length));
1.29092 + }
1.29093 + return Shumway.AVM2.Interpreter.interpretMethod(global, methodInfo, scope, args);
1.29094 + };
1.29095 + }
1.29096 + fn.instanceConstructor = fn;
1.29097 + fn.debugName = 'Interpreter Function #' + vmNextInterpreterFunctionId++;
1.29098 + return fn;
1.29099 + }
1.29100 + Runtime.createInterpretedFunction = createInterpretedFunction;
1.29101 + function debugName(value) {
1.29102 + if (Shumway.isFunction(value)) {
1.29103 + return value.debugName;
1.29104 + }
1.29105 + return value;
1.29106 + }
1.29107 + Runtime.debugName = debugName;
1.29108 + function createCompiledFunction(methodInfo, scope, hasDynamicScope, breakpoint, deferCompilation) {
1.29109 + var mi = methodInfo;
1.29110 + var cached = searchCodeCache(mi);
1.29111 + if (!cached) {
1.29112 + var result = Compiler.compileMethod(mi, scope, hasDynamicScope);
1.29113 + var parameters = result.parameters;
1.29114 + var body = result.body;
1.29115 + }
1.29116 + var fnName = mi.name ? Multiname.getQualifiedName(mi.name) : 'fn' + compiledFunctionCount;
1.29117 + if (mi.holder) {
1.29118 + var fnNamePrefix = '';
1.29119 + if (mi.holder instanceof ClassInfo) {
1.29120 + fnNamePrefix = 'static$' + mi.holder.instanceInfo.name.getName();
1.29121 + } else if (mi.holder instanceof InstanceInfo) {
1.29122 + fnNamePrefix = mi.holder.name.getName();
1.29123 + } else if (mi.holder instanceof ScriptInfo) {
1.29124 + fnNamePrefix = 'script';
1.29125 + }
1.29126 + fnName = fnNamePrefix + '$' + fnName;
1.29127 + }
1.29128 + fnName = Shumway.StringUtilities.escapeString(fnName);
1.29129 + if (mi.verified) {
1.29130 + fnName += '$V';
1.29131 + }
1.29132 + if (compiledFunctionCount == functionBreak.value || breakpoint) {
1.29133 + body = '{ debugger; \n' + body + '}';
1.29134 + }
1.29135 + if (!cached) {
1.29136 + var fnSource = 'function ' + fnName + ' (' + parameters.join(', ') + ') ' + body;
1.29137 + }
1.29138 + if (traceLevel.value > 1) {
1.29139 + mi.trace(new IndentingWriter(), mi.abc);
1.29140 + }
1.29141 + mi.debugTrace = function () {
1.29142 + mi.trace(new IndentingWriter(), mi.abc);
1.29143 + };
1.29144 + if (traceLevel.value > 0) {
1.29145 + log(fnSource);
1.29146 + }
1.29147 + var fn = cached || new Function('return ' + fnSource)();
1.29148 + fn.debugName = 'Compiled Function #' + vmNextCompiledFunctionId++;
1.29149 + return fn;
1.29150 + }
1.29151 + Runtime.createCompiledFunction = createCompiledFunction;
1.29152 + function createFunction(mi, scope, hasDynamicScope, breakpoint) {
1.29153 + if (typeof breakpoint === 'undefined') {
1.29154 + breakpoint = false;
1.29155 + }
1.29156 + true;
1.29157 + if (mi.freeMethod) {
1.29158 + if (hasDynamicScope) {
1.29159 + return Shumway.AVM2.Runtime.bindFreeMethodScope(mi, scope);
1.29160 + }
1.29161 + return mi.freeMethod;
1.29162 + }
1.29163 + var fn;
1.29164 + if (fn = Shumway.AVM2.Runtime.checkMethodOverrides(mi)) {
1.29165 + true;
1.29166 + return fn;
1.29167 + }
1.29168 + ensureFunctionIsInitialized(mi);
1.29169 + totalFunctionCount++;
1.29170 + var useInterpreter = false;
1.29171 + if ((mi.abc.applicationDomain.mode === 1 || !shouldCompile(mi)) && !forceCompile(mi)) {
1.29172 + useInterpreter = true;
1.29173 + }
1.29174 + if (compileOnly.value >= 0) {
1.29175 + if (Number(compileOnly.value) !== totalFunctionCount) {
1.29176 + log('Compile Only Skipping ' + totalFunctionCount);
1.29177 + useInterpreter = true;
1.29178 + }
1.29179 + }
1.29180 + if (compileUntil.value >= 0) {
1.29181 + if (totalFunctionCount > 1000) {
1.29182 + log(Shumway.Debug.backtrace());
1.29183 + log(Shumway.AVM2.Runtime.AVM2.getStackTrace());
1.29184 + }
1.29185 + if (totalFunctionCount > compileUntil.value) {
1.29186 + log('Compile Until Skipping ' + totalFunctionCount);
1.29187 + useInterpreter = true;
1.29188 + }
1.29189 + }
1.29190 + if (useInterpreter) {
1.29191 + mi.freeMethod = createInterpretedFunction(mi, scope, hasDynamicScope);
1.29192 + } else {
1.29193 + compiledFunctionCount++;
1.29194 + if (compileOnly.value >= 0 || compileUntil.value >= 0) {
1.29195 + log('Compiling ' + totalFunctionCount);
1.29196 + }
1.29197 + mi.freeMethod = createCompiledFunction(mi, scope, hasDynamicScope, breakpoint, mi.isInstanceInitializer);
1.29198 + }
1.29199 + mi.freeMethod.methodInfo = mi;
1.29200 + if (hasDynamicScope) {
1.29201 + return Shumway.AVM2.Runtime.bindFreeMethodScope(mi, scope);
1.29202 + }
1.29203 + return mi.freeMethod;
1.29204 + }
1.29205 + Runtime.createFunction = createFunction;
1.29206 + function ensureFunctionIsInitialized(methodInfo) {
1.29207 + var mi = methodInfo;
1.29208 + if (!mi.analysis) {
1.29209 + mi.analysis = new Analysis(mi);
1.29210 + if (mi.needsActivation()) {
1.29211 + mi.activationPrototype = new ActivationInfo(mi);
1.29212 + new Shumway.AVM2.Runtime.ActivationBindings(mi).applyTo(mi.abc.applicationDomain, mi.activationPrototype);
1.29213 + }
1.29214 + var exceptions = mi.exceptions;
1.29215 + for (var i = 0, j = exceptions.length; i < j; i++) {
1.29216 + var handler = exceptions[i];
1.29217 + if (handler.varName) {
1.29218 + var varTrait = Object.create(Trait.prototype);
1.29219 + varTrait.kind = 0;
1.29220 + varTrait.name = handler.varName;
1.29221 + varTrait.typeName = handler.typeName;
1.29222 + varTrait.holder = mi;
1.29223 + handler.scopeObject = new CatchScopeObject(mi.abc.applicationDomain, varTrait);
1.29224 + } else {
1.29225 + handler.scopeObject = new CatchScopeObject(undefined, undefined);
1.29226 + }
1.29227 + }
1.29228 + }
1.29229 + }
1.29230 + Runtime.ensureFunctionIsInitialized = ensureFunctionIsInitialized;
1.29231 + function getTraitFunction(trait, scope, natives) {
1.29232 + true;
1.29233 + true;
1.29234 + var mi = trait.methodInfo;
1.29235 + var fn;
1.29236 + if (mi.isNative()) {
1.29237 + var md = trait.metadata;
1.29238 + if (md && md.native) {
1.29239 + var nativeName = md.native.value[0].value;
1.29240 + var makeNativeFunction = getNative(nativeName);
1.29241 + fn = makeNativeFunction && makeNativeFunction(null, scope);
1.29242 + } else if (md && md.unsafeJSNative) {
1.29243 + fn = getNative(md.unsafeJSNative.value[0].value);
1.29244 + } else if (natives) {
1.29245 + var k = Multiname.getName(mi.name);
1.29246 + if (trait.isGetter()) {
1.29247 + fn = natives[k] ? natives[k].get : undefined;
1.29248 + } else if (trait.isSetter()) {
1.29249 + fn = natives[k] ? natives[k].set : undefined;
1.29250 + } else {
1.29251 + fn = natives[k];
1.29252 + }
1.29253 + }
1.29254 + if (!fn) {
1.29255 + Shumway.Debug.warning('No native method for: ' + trait.kindName() + ' ' + mi.holder.name + '::' + Multiname.getQualifiedName(mi.name));
1.29256 + return function (mi) {
1.29257 + return function () {
1.29258 + Shumway.Debug.warning('Calling undefined native method: ' + trait.kindName() + ' ' + mi.holder.name + '::' + Multiname.getQualifiedName(mi.name));
1.29259 + };
1.29260 + }(mi);
1.29261 + }
1.29262 + } else {
1.29263 + if (Runtime.traceExecution.value >= 2) {
1.29264 + log('Creating Function For Trait: ' + trait.holder + ' ' + trait);
1.29265 + }
1.29266 + fn = createFunction(mi, scope, false, false);
1.29267 + true;
1.29268 + }
1.29269 + if (Runtime.traceExecution.value >= 3) {
1.29270 + log('Made Function: ' + Multiname.getQualifiedName(mi.name));
1.29271 + }
1.29272 + return fn;
1.29273 + }
1.29274 + Runtime.getTraitFunction = getTraitFunction;
1.29275 + function createClass(classInfo, baseClass, scope) {
1.29276 + true;
1.29277 + var ci = classInfo;
1.29278 + var ii = ci.instanceInfo;
1.29279 + var domain = ci.abc.applicationDomain;
1.29280 + var className = Multiname.getName(ii.name);
1.29281 + if (Runtime.traceExecution.value) {
1.29282 + log('Creating ' + (ii.isInterface() ? 'Interface' : 'Class') + ': ' + className + (ci.native ? ' replaced with native ' + ci.native.cls : ''));
1.29283 + }
1.29284 + var cls;
1.29285 + if (ii.isInterface()) {
1.29286 + cls = Shumway.AVM2.Runtime.Interface.createInterface(classInfo);
1.29287 + } else {
1.29288 + cls = Shumway.AVM2.Runtime.Class.createClass(classInfo, baseClass, scope);
1.29289 + }
1.29290 + if (Runtime.traceClasses.value) {
1.29291 + domain.loadedClasses.push(cls);
1.29292 + domain.traceLoadedClasses(true);
1.29293 + }
1.29294 + if (ii.isInterface()) {
1.29295 + return cls;
1.29296 + }
1.29297 + domain.onMessage.notify1('classCreated', cls);
1.29298 + if (cls.instanceConstructor && cls !== Shumway.AVM2.Runtime.Class) {
1.29299 + cls.verify();
1.29300 + }
1.29301 + if (baseClass && (Multiname.getQualifiedName(baseClass.classInfo.instanceInfo.name.name) === 'Proxy' || baseClass.isProxy)) {
1.29302 + installProxyClassWrapper(cls);
1.29303 + cls.isProxy = true;
1.29304 + }
1.29305 + classInfo.classObject = cls;
1.29306 + createFunction(classInfo.init, scope, false, false).call(cls);
1.29307 + if (Runtime.sealConstTraits) {
1.29308 + this.sealConstantTraits(cls, ci.traits);
1.29309 + }
1.29310 + return cls;
1.29311 + }
1.29312 + Runtime.createClass = createClass;
1.29313 + function sealConstantTraits(object, traits) {
1.29314 + for (var i = 0, j = traits.length; i < j; i++) {
1.29315 + var trait = traits[i];
1.29316 + if (trait.isConst()) {
1.29317 + var qn = Multiname.getQualifiedName(trait.name);
1.29318 + var value = object[qn];
1.29319 + (function (qn, value) {
1.29320 + Object.defineProperty(object, qn, {
1.29321 + configurable: false,
1.29322 + enumerable: false,
1.29323 + get: function () {
1.29324 + return value;
1.29325 + },
1.29326 + set: function () {
1.29327 + throwErrorFromVM(Shumway.AVM2.Runtime.AVM2.currentDomain(), 'ReferenceError', 'Illegal write to read-only property ' + qn + '.', 0);
1.29328 + }
1.29329 + });
1.29330 + }(qn, value));
1.29331 + }
1.29332 + }
1.29333 + }
1.29334 + Runtime.sealConstantTraits = sealConstantTraits;
1.29335 + function applyType(domain, factory, types) {
1.29336 + var factoryClassName = factory.classInfo.instanceInfo.name.name;
1.29337 + if (factoryClassName === 'Vector') {
1.29338 + true;
1.29339 + var type = types[0];
1.29340 + var typeClassName;
1.29341 + if (!Shumway.isNullOrUndefined(type)) {
1.29342 + typeClassName = type.classInfo.instanceInfo.name.name.toLowerCase();
1.29343 + switch (typeClassName) {
1.29344 + case 'int':
1.29345 + case 'uint':
1.29346 + case 'double':
1.29347 + case 'object':
1.29348 + return domain.getClass('packageInternal __AS3__.vec.Vector$' + typeClassName);
1.29349 + }
1.29350 + }
1.29351 + return domain.getClass('packageInternal __AS3__.vec.Vector$object').applyType(type);
1.29352 + } else {
1.29353 + return Shumway.Debug.notImplemented(factoryClassName);
1.29354 + }
1.29355 + }
1.29356 + Runtime.applyType = applyType;
1.29357 + }(AVM2.Runtime || (AVM2.Runtime = {})));
1.29358 + var Runtime = AVM2.Runtime;
1.29359 + }(Shumway.AVM2 || (Shumway.AVM2 = {})));
1.29360 + var AVM2 = Shumway.AVM2;
1.29361 +}(Shumway || (Shumway = {})));
1.29362 +var CC = Shumway.AVM2.Runtime.CODE_CACHE;
1.29363 +var VM_LENGTH = Shumway.AVM2.Runtime.VM_LENGTH;
1.29364 +var VM_IS_PROXY = Shumway.AVM2.Runtime.VM_IS_PROXY;
1.29365 +var VM_CALL_PROXY = Shumway.AVM2.Runtime.VM_CALL_PROXY;
1.29366 +var VM_NATIVE_BUILTIN_ORIGINALS = Shumway.AVM2.Runtime.VM_NATIVE_BUILTIN_ORIGINALS;
1.29367 +var VM_OPEN_METHOD_PREFIX = 'm';
1.29368 +var VM_OPEN_SET_METHOD_PREFIX = 's';
1.29369 +var VM_OPEN_GET_METHOD_PREFIX = 'g';
1.29370 +var SAVED_SCOPE_NAME = '$SS';
1.29371 +var originalStringReplace = String.prototype.replace;
1.29372 +XRegExp.install({
1.29373 + natives: true
1.29374 +});
1.29375 +var callWriter = new IndentingWriter(false, function (str) {
1.29376 + print(str);
1.29377 + });
1.29378 +var objectIDs = 0;
1.29379 +var OBJECT_NAME = 'Object Name';
1.29380 +function objectConstantName(object) {
1.29381 + true;
1.29382 + if (object.hasOwnProperty(OBJECT_NAME)) {
1.29383 + return object[OBJECT_NAME];
1.29384 + }
1.29385 + if (object instanceof LazyInitializer) {
1.29386 + return object.getName();
1.29387 + }
1.29388 + var name, id = objectIDs++;
1.29389 + if (object instanceof Global) {
1.29390 + name = '$G' + id;
1.29391 + } else if (object instanceof Multiname) {
1.29392 + name = '$M' + id;
1.29393 + } else if (isClass(object)) {
1.29394 + name = '$C' + id;
1.29395 + } else {
1.29396 + name = '$O' + id;
1.29397 + }
1.29398 + Object.defineProperty(object, OBJECT_NAME, {
1.29399 + value: name,
1.29400 + writable: false,
1.29401 + enumerable: false
1.29402 + });
1.29403 + jsGlobal[name] = object;
1.29404 + return name;
1.29405 +}
1.29406 +var isClass = Shumway.AVM2.Runtime.isClass;
1.29407 +var isTrampoline = Shumway.AVM2.Runtime.isTrampoline;
1.29408 +var isMemoizer = Shumway.AVM2.Runtime.isMemoizer;
1.29409 +var LazyInitializer = Shumway.AVM2.Runtime.LazyInitializer;
1.29410 +var getNamespaceResolutionMap = Shumway.AVM2.Runtime.getNamespaceResolutionMap;
1.29411 +var resolveMultinameProperty = Shumway.AVM2.Runtime.resolveMultinameProperty;
1.29412 +var asGetPublicProperty = Shumway.AVM2.Runtime.asGetPublicProperty;
1.29413 +var asGetProperty = Shumway.AVM2.Runtime.asGetProperty;
1.29414 +var asGetPropertyLikelyNumeric = Shumway.AVM2.Runtime.asGetPropertyLikelyNumeric;
1.29415 +var asGetResolvedStringProperty = Shumway.AVM2.Runtime.asGetResolvedStringProperty;
1.29416 +var asCallResolvedStringProperty = Shumway.AVM2.Runtime.asCallResolvedStringProperty;
1.29417 +var asGetResolvedStringPropertyFallback = Shumway.AVM2.Runtime.asGetResolvedStringPropertyFallback;
1.29418 +var asSetPublicProperty = Shumway.AVM2.Runtime.asSetPublicProperty;
1.29419 +var asSetProperty = Shumway.AVM2.Runtime.asSetProperty;
1.29420 +var asSetPropertyLikelyNumeric = Shumway.AVM2.Runtime.asSetPropertyLikelyNumeric;
1.29421 +var asDefinePublicProperty = Shumway.AVM2.Runtime.asDefinePublicProperty;
1.29422 +var asDefineProperty = Shumway.AVM2.Runtime.asDefineProperty;
1.29423 +var asCallPublicProperty = Shumway.AVM2.Runtime.asCallPublicProperty;
1.29424 +var asCallProperty = Shumway.AVM2.Runtime.asCallProperty;
1.29425 +var asCallSuper = Shumway.AVM2.Runtime.asCallSuper;
1.29426 +var asSetSuper = Shumway.AVM2.Runtime.asSetSuper;
1.29427 +var asGetSuper = Shumway.AVM2.Runtime.asGetSuper;
1.29428 +var construct = Shumway.AVM2.Runtime.construct;
1.29429 +var asConstructProperty = Shumway.AVM2.Runtime.asConstructProperty;
1.29430 +var asHasProperty = Shumway.AVM2.Runtime.asHasProperty;
1.29431 +var asDeleteProperty = Shumway.AVM2.Runtime.asDeleteProperty;
1.29432 +var asGetNumericProperty = Shumway.AVM2.Runtime.asGetNumericProperty;
1.29433 +var asSetNumericProperty = Shumway.AVM2.Runtime.asSetNumericProperty;
1.29434 +var asGetDescendants = Shumway.AVM2.Runtime.asGetDescendants;
1.29435 +var asNextNameIndex = Shumway.AVM2.Runtime.asNextNameIndex;
1.29436 +var asNextName = Shumway.AVM2.Runtime.asNextName;
1.29437 +var asNextValue = Shumway.AVM2.Runtime.asNextValue;
1.29438 +var asGetEnumerableKeys = Shumway.AVM2.Runtime.asGetEnumerableKeys;
1.29439 +var initializeGlobalObject = Shumway.AVM2.Runtime.initializeGlobalObject;
1.29440 +initializeGlobalObject(jsGlobal);
1.29441 +var asTypeOf = Shumway.AVM2.Runtime.asTypeOf;
1.29442 +var publicizeProperties = Shumway.AVM2.Runtime.publicizeProperties;
1.29443 +var asGetSlot = Shumway.AVM2.Runtime.asGetSlot;
1.29444 +var asSetSlot = Shumway.AVM2.Runtime.asSetSlot;
1.29445 +var asHasNext2 = Shumway.AVM2.Runtime.asHasNext2;
1.29446 +var getDescendants = Shumway.AVM2.Runtime.getDescendants;
1.29447 +var checkFilter = Shumway.AVM2.Runtime.checkFilter;
1.29448 +var ActivationInfo = Shumway.AVM2.Runtime.ActivationInfo;
1.29449 +var ScopeStack = Shumway.AVM2.Runtime.ScopeStack;
1.29450 +var Scope = Shumway.AVM2.Runtime.Scope;
1.29451 +var bindFreeMethodScope = Shumway.AVM2.Runtime.bindFreeMethodScope;
1.29452 +var nameInTraits = Shumway.AVM2.Runtime.nameInTraits;
1.29453 +function resolveMultiname(object, mn, traitsOnly) {
1.29454 + return object.resolveMultinameProperty(mn.namespaces, mn.name, mn.flags);
1.29455 +}
1.29456 +var sliceArguments = Shumway.AVM2.Runtime.sliceArguments;
1.29457 +var nonProxyingHasProperty = Shumway.AVM2.Runtime.nonProxyingHasProperty;
1.29458 +var forEachPublicProperty = Shumway.AVM2.Runtime.forEachPublicProperty;
1.29459 +var wrapJSObject = Shumway.AVM2.Runtime.wrapJSObject;
1.29460 +var asCreateActivation = Shumway.AVM2.Runtime.asCreateActivation;
1.29461 +var CatchScopeObject = Shumway.AVM2.Runtime.CatchScopeObject;
1.29462 +var Global = Shumway.AVM2.Runtime.Global;
1.29463 +var canCompile = Shumway.AVM2.Runtime.canCompile;
1.29464 +var shouldCompile = Shumway.AVM2.Runtime.shouldCompile;
1.29465 +var forceCompile = Shumway.AVM2.Runtime.forceCompile;
1.29466 +var createInterpretedFunction = Shumway.AVM2.Runtime.createInterpretedFunction;
1.29467 +var debugName = Shumway.AVM2.Runtime.debugName;
1.29468 +var createCompiledFunction = Shumway.AVM2.Runtime.createCompiledFunction;
1.29469 +var getMethodOverrideKey = Shumway.AVM2.Runtime.getMethodOverrideKey;
1.29470 +var checkMethodOverrides = Shumway.AVM2.Runtime.checkMethodOverrides;
1.29471 +var makeTrampoline = Shumway.AVM2.Runtime.makeTrampoline;
1.29472 +var makeMemoizer = Shumway.AVM2.Runtime.makeMemoizer;
1.29473 +var createFunction = Shumway.AVM2.Runtime.createFunction;
1.29474 +var ensureFunctionIsInitialized = Shumway.AVM2.Runtime.ensureFunctionIsInitialized;
1.29475 +var getTraitFunction = Shumway.AVM2.Runtime.getTraitFunction;
1.29476 +var createClass = Shumway.AVM2.Runtime.createClass;
1.29477 +var sealConstantTraits = Shumway.AVM2.Runtime.sealConstantTraits;
1.29478 +var applyType = Shumway.AVM2.Runtime.applyType;
1.29479 +var throwError = Shumway.AVM2.Runtime.throwError;
1.29480 +var throwErrorFromVM = Shumway.AVM2.Runtime.throwErrorFromVM;
1.29481 +var translateError = Shumway.AVM2.Runtime.translateError;
1.29482 +var asIsInstanceOf = Shumway.AVM2.Runtime.asIsInstanceOf;
1.29483 +var asIsType = Shumway.AVM2.Runtime.asIsType;
1.29484 +var asAsType = Shumway.AVM2.Runtime.asAsType;
1.29485 +var asCoerceByMultiname = Shumway.AVM2.Runtime.asCoerceByMultiname;
1.29486 +var asCoerce = Shumway.AVM2.Runtime.asCoerce;
1.29487 +var asCoerceString = Shumway.AVM2.Runtime.asCoerceString;
1.29488 +var asCoerceInt = Shumway.AVM2.Runtime.asCoerceInt;
1.29489 +var asCoerceUint = Shumway.AVM2.Runtime.asCoerceUint;
1.29490 +var asCoerceNumber = Shumway.AVM2.Runtime.asCoerceNumber;
1.29491 +var asCoerceBoolean = Shumway.AVM2.Runtime.asCoerceBoolean;
1.29492 +var asCoerceObject = Shumway.AVM2.Runtime.asCoerceObject;
1.29493 +var asDefaultCompareFunction = Shumway.AVM2.Runtime.asDefaultCompareFunction;
1.29494 +var asCompare = Shumway.AVM2.Runtime.asCompare;
1.29495 +var asAdd = Shumway.AVM2.Runtime.asAdd;
1.29496 +var GlobalMultinameResolver = Shumway.AVM2.Runtime.GlobalMultinameResolver;
1.29497 +var Shumway;
1.29498 +(function (Shumway) {
1.29499 + (function (AVM2) {
1.29500 + (function (Runtime) {
1.29501 + Shumway.AVM2.Runtime.VM_METHOD_OVERRIDES['static mochi.as3.MochiServices::connect'] = function () {
1.29502 + return;
1.29503 + };
1.29504 + Shumway.AVM2.Runtime.VM_METHOD_OVERRIDES['static MochiBot::track'] = function () {
1.29505 + return;
1.29506 + };
1.29507 + Shumway.AVM2.Runtime.VM_METHOD_OVERRIDES['com.midasplayer.debug.DebugLog::trace'] = function (msg) {
1.29508 + log(msg);
1.29509 + };
1.29510 + Shumway.AVM2.Runtime.VM_METHOD_OVERRIDES['com.midasplayer.engine.comm.DebugGameComm::getGameData'] = function () {
1.29511 + return '<gamedata randomseed="554884453" version="1">\n<musicOn>true</musicOn>\n<soundOn>true</soundOn>\n<isShortGame>false</isShortGame>\n<booster_1>0</booster_1>\n<booster_2>0</booster_2>\n<booster_3>0</booster_3>\n<booster_4>0</booster_4>\n<booster_5>0</booster_5>\n<bestScore>0</bestScore>\n<bestChain>0</bestChain>\n<bestLevel>0</bestLevel>\n<bestCrushed>0</bestCrushed>\n<bestMixed>0</bestMixed>\n<text id="outro.crushed">Candy crushed</text>\n<text id="outro.bestever">best ever</text>\n<text id="outro.trophy.two">scored {0} in one game</text>\n<text id="outro.combo_color_color">All Clear Created</text>\n<text id="outro.trophy.one">crushed {0} candy in one game</text>\n<text id="outro.score">Score</text>\n<text id="outro.opengame">Please register to play the full game</text>\n<text id="outro.chain">Longest chain</text>\n<text id="outro.time">Game ends in {0} seconds</text>\n<text id="outro.combo_color_line">Super Stripes Created</text>\n<text id="game.nomoves">No more moves!</text>\n<text id="outro.combo_wrapper_line">Mega-Candy Created</text>\n<text id="intro.time">Game starts in {0} seconds</text>\n<text id="outro.now">now</text>\n<text id="outro.level">Level reached</text>\n<text id="outro.title">Game Over</text>\n<text id="intro.info1">Match 3 Candy of the same colour to crush them. Matching 4 or 5 in different formations generates special sweets that are extra tasty.</text>\n<text id="intro.info2">You can also combine the special sweets for additional effects by switching them with each other. Try these combinations for a taste you will not forget: </text>\n<text id="outro.combo_color_wrapper">Double Colour Bombs Created</text>\n<text id="outro.trophy.three">made {0} combined candy in one game</text>\n<text id="intro.title">Play like this:</text>\n</gamedata>';
1.29512 + };
1.29513 + Shumway.AVM2.Runtime.VM_METHOD_OVERRIDES['com.antkarlov.Preloader::com.antkarlov:Preloader.isUrl'] = function () {
1.29514 + return true;
1.29515 + };
1.29516 + Shumway.AVM2.Runtime.VM_METHOD_OVERRIDES['static com.demonsters.debugger.MonsterDebugger::initialize'] = function () {
1.29517 + };
1.29518 + Shumway.AVM2.Runtime.VM_METHOD_OVERRIDES['com.spilgames.api.core.tracking.TrackConfig::getTrackers'] = function () {
1.29519 + return [];
1.29520 + };
1.29521 + Shumway.AVM2.Runtime.VM_METHOD_OVERRIDES['com.spilgames.api.components.TextFields.AutoFitTextFieldEx::com.spilgames.api.components.TextFields:AutoFitTextFieldEx.updateProperties'] = Shumway.AVM2.Runtime.VM_METHOD_OVERRIDES['com.spilgames.api.components.TextFields.AutoFitTextFieldEx::com.spilgames.api.components.TextFields:AutoFitTextFieldEx.updateTextSize'] = function () {
1.29522 + };
1.29523 + }(AVM2.Runtime || (AVM2.Runtime = {})));
1.29524 + var Runtime = AVM2.Runtime;
1.29525 + }(Shumway.AVM2 || (Shumway.AVM2 = {})));
1.29526 + var AVM2 = Shumway.AVM2;
1.29527 +}(Shumway || (Shumway = {})));
1.29528 +var checkArguments = true;
1.29529 +function asCheckVectorSetNumericProperty(i, length, fixed) {
1.29530 + if (i < 0 || i > length || i === length && fixed || !isNumeric(i)) {
1.29531 + throwError('RangeError', Errors.OutOfRangeError, i, length);
1.29532 + }
1.29533 +}
1.29534 +function asCheckVectorGetNumericProperty(i, length) {
1.29535 + if (i < 0 || i >= length || !isNumeric(i)) {
1.29536 + throwError('RangeError', Errors.OutOfRangeError, i, length);
1.29537 + }
1.29538 +}
1.29539 +var TypedArrayVector = function () {
1.29540 + var EXTRA_CAPACITY = 4;
1.29541 + var INITIAL_CAPACITY = 10;
1.29542 + var DEFAULT_VALUE = 0;
1.29543 + function vector(length, fixed) {
1.29544 + length = length | 0;
1.29545 + this._fixed = !(!fixed);
1.29546 + this._buffer = new Int32Array(Math.max(INITIAL_CAPACITY, length + EXTRA_CAPACITY));
1.29547 + this._offset = 0;
1.29548 + this._length = length;
1.29549 + }
1.29550 + vector.callable = function (object) {
1.29551 + if (object instanceof vector) {
1.29552 + return object;
1.29553 + }
1.29554 + var length = object.asGetProperty(undefined, 'length');
1.29555 + if (length !== undefined) {
1.29556 + var v = new vector(length, false);
1.29557 + for (var i = 0; i < length; i++) {
1.29558 + v.asSetNumericProperty(i, object.asGetPublicProperty(i));
1.29559 + }
1.29560 + return v;
1.29561 + }
1.29562 + unexpected();
1.29563 + };
1.29564 + vector.prototype.internalToString = function () {
1.29565 + var str = '';
1.29566 + var start = this._offset;
1.29567 + var end = start + this._length;
1.29568 + for (var i = 0; i < this._buffer.length; i++) {
1.29569 + if (i === start) {
1.29570 + str += '[';
1.29571 + }
1.29572 + if (i === end) {
1.29573 + str += ']';
1.29574 + }
1.29575 + str += this._buffer[i];
1.29576 + if (i < this._buffer.length - 1) {
1.29577 + str += ',';
1.29578 + }
1.29579 + }
1.29580 + if (this._offset + this._length === this._buffer.length) {
1.29581 + str += ']';
1.29582 + }
1.29583 + return str + ': offset: ' + this._offset + ', length: ' + this._length + ', capacity: ' + this._buffer.length;
1.29584 + };
1.29585 + vector.prototype.toString = function () {
1.29586 + var str = '';
1.29587 + for (var i = 0; i < this._length; i++) {
1.29588 + str += this._buffer[this._offset + i];
1.29589 + if (i < this._length - 1) {
1.29590 + str += ',';
1.29591 + }
1.29592 + }
1.29593 + return str;
1.29594 + };
1.29595 + vector.prototype._view = function () {
1.29596 + return this._buffer.subarray(this._offset, this._offset + this._length);
1.29597 + };
1.29598 + vector.prototype._ensureCapacity = function (length) {
1.29599 + var minCapacity = this._offset + length;
1.29600 + if (minCapacity < this._buffer.length) {
1.29601 + return;
1.29602 + }
1.29603 + if (length <= this._buffer.length) {
1.29604 + var offset = this._buffer.length - length >> 2;
1.29605 + this._buffer.set(this._view(), offset);
1.29606 + this._offset = offset;
1.29607 + return;
1.29608 + }
1.29609 + var oldCapacity = this._buffer.length;
1.29610 + var newCapacity = oldCapacity * 3 >> 2;
1.29611 + if (newCapacity < minCapacity) {
1.29612 + newCapacity = minCapacity;
1.29613 + }
1.29614 + var buffer = new Int32Array(newCapacity);
1.29615 + buffer.set(this._buffer, 0);
1.29616 + this._buffer = buffer;
1.29617 + };
1.29618 + vector.prototype.concat = function () {
1.29619 + notImplemented('TypedArrayVector.concat');
1.29620 + };
1.29621 + vector.prototype.every = function (callback, thisObject) {
1.29622 + for (var i = 0; i < this._length; i++) {
1.29623 + if (!callback.call(thisObject, this.asGetNumericProperty(i), i, this)) {
1.29624 + return false;
1.29625 + }
1.29626 + }
1.29627 + return true;
1.29628 + };
1.29629 + vector.prototype.filter = function (callback, thisObject) {
1.29630 + var v = new vector();
1.29631 + for (var i = 0; i < this._length; i++) {
1.29632 + if (callback.call(thisObject, this.asGetNumericProperty(i), i, this)) {
1.29633 + v.push(this.asGetNumericProperty(i));
1.29634 + }
1.29635 + }
1.29636 + return v;
1.29637 + };
1.29638 + vector.prototype.some = function (callback, thisObject) {
1.29639 + if (arguments.length !== 2) {
1.29640 + throwError('ArgumentError', Errors.WrongArgumentCountError);
1.29641 + } else if (!isFunction(callback)) {
1.29642 + throwError('ArgumentError', Errors.CheckTypeFailedError);
1.29643 + }
1.29644 + for (var i = 0; i < this._length; i++) {
1.29645 + if (callback.call(thisObject, this.asGetNumericProperty(i), i, this)) {
1.29646 + return true;
1.29647 + }
1.29648 + }
1.29649 + return false;
1.29650 + };
1.29651 + vector.prototype.forEach = function (callback, thisObject) {
1.29652 + for (var i = 0; i < this._length; i++) {
1.29653 + callback.call(thisObject, this.asGetNumericProperty(i), i, this);
1.29654 + }
1.29655 + };
1.29656 + vector.prototype.join = function (sep) {
1.29657 + notImplemented('TypedArrayVector.join');
1.29658 + };
1.29659 + vector.prototype.indexOf = function (searchElement, fromIndex) {
1.29660 + notImplemented('TypedArrayVector.indexOf');
1.29661 + };
1.29662 + vector.prototype.lastIndexOf = function (searchElement, fromIndex) {
1.29663 + notImplemented('TypedArrayVector.lastIndexOf');
1.29664 + };
1.29665 + vector.prototype.map = function (callback, thisObject) {
1.29666 + if (!isFunction(callback)) {
1.29667 + throwError('ArgumentError', Errors.CheckTypeFailedError);
1.29668 + }
1.29669 + var v = new vector();
1.29670 + for (var i = 0; i < this._length; i++) {
1.29671 + v.push(callback.call(thisObject, this.asGetNumericProperty(i), i, this));
1.29672 + }
1.29673 + return v;
1.29674 + };
1.29675 + vector.prototype.push = function () {
1.29676 + this._checkFixed();
1.29677 + this._ensureCapacity(this._length + arguments.length);
1.29678 + for (var i = 0; i < arguments.length; i++) {
1.29679 + this._buffer[this._offset + this._length++] = arguments[i];
1.29680 + }
1.29681 + };
1.29682 + vector.prototype.pop = function () {
1.29683 + this._checkFixed();
1.29684 + if (this._length === 0) {
1.29685 + return DEFAULT_VALUE;
1.29686 + }
1.29687 + this._length--;
1.29688 + return this._buffer[this._offset + this._length];
1.29689 + };
1.29690 + vector.prototype.reverse = function () {
1.29691 + var l = this._offset;
1.29692 + var r = this._offset + this._length - 1;
1.29693 + var b = this._buffer;
1.29694 + while (l < r) {
1.29695 + var t = b[l];
1.29696 + b[l] = b[r];
1.29697 + b[r] = t;
1.29698 + l++;
1.29699 + r--;
1.29700 + }
1.29701 + };
1.29702 + vector.CASEINSENSITIVE = 1;
1.29703 + vector.DESCENDING = 2;
1.29704 + vector.UNIQUESORT = 4;
1.29705 + vector.RETURNINDEXEDARRAY = 8;
1.29706 + vector.NUMERIC = 16;
1.29707 + function defaultCompareFunction(a, b) {
1.29708 + return String(a).localeCompare(String(b));
1.29709 + }
1.29710 + function compare(a, b, options, compareFunction) {
1.29711 + assertNotImplemented(!(options & vector.CASEINSENSITIVE), 'CASEINSENSITIVE');
1.29712 + assertNotImplemented(!(options & vector.UNIQUESORT), 'UNIQUESORT');
1.29713 + assertNotImplemented(!(options & vector.RETURNINDEXEDARRAY), 'RETURNINDEXEDARRAY');
1.29714 + var result = 0;
1.29715 + if (!compareFunction) {
1.29716 + compareFunction = defaultCompareFunction;
1.29717 + }
1.29718 + if (options & vector.NUMERIC) {
1.29719 + a = toNumber(a);
1.29720 + b = toNumber(b);
1.29721 + result = a < b ? -1 : a > b ? 1 : 0;
1.29722 + } else {
1.29723 + result = compareFunction(a, b);
1.29724 + }
1.29725 + if (options & vector.DESCENDING) {
1.29726 + result *= -1;
1.29727 + }
1.29728 + return result;
1.29729 + }
1.29730 + function _sort(a) {
1.29731 + var stack = [];
1.29732 + var sp = -1;
1.29733 + var l = 0;
1.29734 + var r = a.length - 1;
1.29735 + var i, j, swap, temp;
1.29736 + while (true) {
1.29737 + if (r - l <= 100) {
1.29738 + for (j = l + 1; j <= r; j++) {
1.29739 + swap = a[j];
1.29740 + i = j - 1;
1.29741 + while (i >= l && a[i] > swap) {
1.29742 + a[i + 1] = a[i--];
1.29743 + }
1.29744 + a[i + 1] = swap;
1.29745 + }
1.29746 + if (sp == -1) {
1.29747 + break;
1.29748 + }
1.29749 + r = stack[sp--];
1.29750 + l = stack[sp--];
1.29751 + } else {
1.29752 + var median = l + r >> 1;
1.29753 + i = l + 1;
1.29754 + j = r;
1.29755 + swap = a[median];
1.29756 + a[median] = a[i];
1.29757 + a[i] = swap;
1.29758 + if (a[l] > a[r]) {
1.29759 + swap = a[l];
1.29760 + a[l] = a[r];
1.29761 + a[r] = swap;
1.29762 + }
1.29763 + if (a[i] > a[r]) {
1.29764 + swap = a[i];
1.29765 + a[i] = a[r];
1.29766 + a[r] = swap;
1.29767 + }
1.29768 + if (a[l] > a[i]) {
1.29769 + swap = a[l];
1.29770 + a[l] = a[i];
1.29771 + a[i] = swap;
1.29772 + }
1.29773 + temp = a[i];
1.29774 + while (true) {
1.29775 + do {
1.29776 + i++;
1.29777 + } while (a[i] < temp);
1.29778 + do {
1.29779 + j--;
1.29780 + } while (a[j] > temp);
1.29781 + if (j < i) {
1.29782 + break;
1.29783 + }
1.29784 + swap = a[i];
1.29785 + a[i] = a[j];
1.29786 + a[j] = swap;
1.29787 + }
1.29788 + a[l + 1] = a[j];
1.29789 + a[j] = temp;
1.29790 + if (r - i + 1 >= j - l) {
1.29791 + stack[++sp] = i;
1.29792 + stack[++sp] = r;
1.29793 + r = j - 1;
1.29794 + } else {
1.29795 + stack[++sp] = l;
1.29796 + stack[++sp] = j - 1;
1.29797 + l = i;
1.29798 + }
1.29799 + }
1.29800 + }
1.29801 + return a;
1.29802 + }
1.29803 + vector.prototype._sortNumeric = function (descending) {
1.29804 + _sort(this._view());
1.29805 + if (descending) {
1.29806 + this.reverse();
1.29807 + }
1.29808 + };
1.29809 + vector.prototype.sort = function () {
1.29810 + if (arguments.length === 0) {
1.29811 + return Array.prototype.sort.call(this._view());
1.29812 + }
1.29813 + var compareFunction, options = 0;
1.29814 + if (arguments[0] instanceof Function) {
1.29815 + compareFunction = arguments[0];
1.29816 + } else if (isNumber(arguments[0])) {
1.29817 + options = arguments[0];
1.29818 + }
1.29819 + if (isNumber(arguments[1])) {
1.29820 + options = arguments[1];
1.29821 + }
1.29822 + if (options & TypedArrayVector.NUMERIC) {
1.29823 + return this._sortNumeric(options & vector.DESCENDING);
1.29824 + }
1.29825 + Array.prototype.sort.call(this._view(), function (a, b) {
1.29826 + return compare(a, b, options, compareFunction);
1.29827 + });
1.29828 + };
1.29829 + vector.prototype.asGetNumericProperty = function (i) {
1.29830 + checkArguments && asCheckVectorGetNumericProperty(i, this._length);
1.29831 + return this._buffer[this._offset + i];
1.29832 + };
1.29833 + vector.prototype.asSetNumericProperty = function (i, v) {
1.29834 + checkArguments && asCheckVectorSetNumericProperty(i, this._length, this._fixed);
1.29835 + if (i === this._length) {
1.29836 + this._ensureCapacity(this._length + 1);
1.29837 + this._length++;
1.29838 + }
1.29839 + this._buffer[this._offset + i] = v;
1.29840 + };
1.29841 + vector.prototype.shift = function () {
1.29842 + this._checkFixed();
1.29843 + if (this._length === 0) {
1.29844 + return 0;
1.29845 + }
1.29846 + this._length--;
1.29847 + return this._buffer[this._offset++];
1.29848 + };
1.29849 + vector.prototype._checkFixed = function () {
1.29850 + if (this._fixed) {
1.29851 + throwError('RangeError', Errors.VectorFixedError);
1.29852 + }
1.29853 + };
1.29854 + vector.prototype._slide = function (distance) {
1.29855 + this._buffer.set(this._view(), this._offset + distance);
1.29856 + this._offset += distance;
1.29857 + };
1.29858 + vector.prototype.unshift = function () {
1.29859 + this._checkFixed();
1.29860 + if (!arguments.length) {
1.29861 + return;
1.29862 + }
1.29863 + this._ensureCapacity(this._length + arguments.length);
1.29864 + this._slide(arguments.length);
1.29865 + this._offset -= arguments.length;
1.29866 + this._length += arguments.length;
1.29867 + for (var i = 0; i < arguments.length; i++) {
1.29868 + this._buffer[this._offset + i] = arguments[i];
1.29869 + }
1.29870 + };
1.29871 + vector.prototype.asGetEnumerableKeys = function () {
1.29872 + if (vector.prototype === this) {
1.29873 + return Object.prototype.asGetEnumerableKeys.call(this);
1.29874 + }
1.29875 + var keys = [];
1.29876 + for (var i = 0; i < this._length; i++) {
1.29877 + keys.push(i);
1.29878 + }
1.29879 + return keys;
1.29880 + };
1.29881 + vector.prototype.asHasProperty = function (namespaces, name, flags) {
1.29882 + if (vector.prototype === this || !isNumeric(name)) {
1.29883 + return Object.prototype.asHasProperty.call(this, namespaces, name, flags);
1.29884 + }
1.29885 + var index = toNumber(name);
1.29886 + return index >= 0 && index < this._length;
1.29887 + };
1.29888 + Object.defineProperty(vector.prototype, 'length', {
1.29889 + get: function () {
1.29890 + return this._length;
1.29891 + },
1.29892 + set: function (length) {
1.29893 + length = length >>> 0;
1.29894 + if (length > this._length) {
1.29895 + this._ensureCapacity(length);
1.29896 + for (var i = this._offset + this._length, j = this._offset + length; i < j; i++) {
1.29897 + this._buffer[i] = DEFAULT_VALUE;
1.29898 + }
1.29899 + }
1.29900 + this._length = length;
1.29901 + }
1.29902 + });
1.29903 + vector.prototype._spliceHelper = function (index, insertCount, deleteCount, args, offset) {
1.29904 + insertCount = clamp(insertCount, 0, args.length - offset);
1.29905 + deleteCount = clamp(deleteCount, 0, this._length - index);
1.29906 + this._ensureCapacity(this._length - deleteCount + insertCount);
1.29907 + var right = this._offset + index + deleteCount;
1.29908 + var slice = this._buffer.subarray(right, right + this._length - index - deleteCount);
1.29909 + this._buffer.set(slice, this._offset + index + insertCount);
1.29910 + this._length += insertCount - deleteCount;
1.29911 + for (var i = 0; i < insertCount; i++) {
1.29912 + this._buffer[this._offset + index + i] = args.asGetNumericProperty(offset + i);
1.29913 + }
1.29914 + };
1.29915 + vector.prototype.asGetEnumerableKeys = function () {
1.29916 + if (vector.prototype === this) {
1.29917 + return Object.prototype.asGetEnumerableKeys.call(this);
1.29918 + }
1.29919 + var keys = [];
1.29920 + for (var i = 0; i < this._length; i++) {
1.29921 + keys.push(i);
1.29922 + }
1.29923 + return keys;
1.29924 + };
1.29925 + return vector;
1.29926 + }();
1.29927 +var typedArrayVectorTemplate = 'var EXTRA_CAPACITY=4,INITIAL_CAPACITY=10,DEFAULT_VALUE=0;function vector(a,b){a|=0;this._fixed=!!b;this._buffer=new Int32Array(Math.max(INITIAL_CAPACITY,a+EXTRA_CAPACITY));this._offset=0;this._length=a}vector.callable=function(a){if(a instanceof vector)return a;var b=a.asGetProperty(void 0,"length");if(void 0!==b){for(var c=new vector(b,!1),d=0;d<b;d++)c.asSetNumericProperty(d,a.asGetPublicProperty(d));return c}unexpected()}; vector.prototype.internalToString=function(){for(var a="",b=this._offset,c=b+this._length,d=0;d<this._buffer.length;d++)d===b&&(a+="["),d===c&&(a+="]"),a+=this._buffer[d],d<this._buffer.length-1&&(a+=",");this._offset+this._length===this._buffer.length&&(a+="]");return a+": offset: "+this._offset+", length: "+this._length+", capacity: "+this._buffer.length};vector.prototype.toString=function(){for(var a="",b=0;b<this._length;b++)a+=this._buffer[this._offset+b],b<this._length-1&&(a+=",");return a}; vector.prototype._view=function(){return this._buffer.subarray(this._offset,this._offset+this._length)};vector.prototype._ensureCapacity=function(a){var b=this._offset+a;b<this._buffer.length||(a<=this._buffer.length?(b=this._buffer.length-a>>2,this._buffer.set(this._view(),b),this._offset=b):(a=3*this._buffer.length>>2,a<b&&(a=b),b=new Int32Array(a),b.set(this._buffer,0),this._buffer=b))}; vector.prototype.every=function(a,b){for(var c=0;c<this._length;c++)if(!a.call(b,this.asGetNumericProperty(c),c,this))return!1;return!0};vector.prototype.filter=function(a,b){for(var c=new vector,d=0;d<this._length;d++)a.call(b,this.asGetNumericProperty(d),d,this)&&c.push(this.asGetNumericProperty(d));return c}; vector.prototype.some=function(a,b){2!==arguments.length?throwError("ArgumentError",Errors.WrongArgumentCountError):isFunction(a)||throwError("ArgumentError",Errors.CheckTypeFailedError);for(var c=0;c<this._length;c++)if(a.call(b,this.asGetNumericProperty(c),c,this))return!0;return!1};vector.prototype.forEach=function(a,b){for(var c=0;c<this._length;c++)a.call(b,this.asGetNumericProperty(c),c,this)};vector.prototype.join=function(a){notImplemented("TypedArrayVector.join")}; vector.prototype.indexOf=function(a,b){notImplemented("TypedArrayVector.indexOf")};vector.prototype.lastIndexOf=function(a,b){notImplemented("TypedArrayVector.lastIndexOf")};vector.prototype.map=function(a,b){isFunction(a)||throwError("ArgumentError",Errors.CheckTypeFailedError);for(var c=new vector,d=0;d<this._length;d++)c.push(a.call(b,this.asGetNumericProperty(d),d,this));return c}; vector.prototype.push=function(){this._checkFixed();this._ensureCapacity(this._length+arguments.length);for(var a=0;a<arguments.length;a++)this._buffer[this._offset+this._length++]=arguments[a]};vector.prototype.pop=function(){this._checkFixed();if(0===this._length)return DEFAULT_VALUE;this._length--;return this._buffer[this._offset+this._length]};vector.prototype.reverse=function(){for(var a=this._offset,b=this._offset+this._length-1,c=this._buffer;a<b;){var d=c[a];c[a]=c[b];c[b]=d;a++;b--}}; vector.CASEINSENSITIVE=1;vector.DESCENDING=2;vector.UNIQUESORT=4;vector.RETURNINDEXEDARRAY=8;vector.NUMERIC=16;function defaultCompareFunction(a,b){return String(a).localeCompare(String(b))} function compare(a,b,c,d){assertNotImplemented(!(c&vector.CASEINSENSITIVE),"CASEINSENSITIVE");assertNotImplemented(!(c&vector.UNIQUESORT),"UNIQUESORT");assertNotImplemented(!(c&vector.RETURNINDEXEDARRAY),"RETURNINDEXEDARRAY");var f=0;d||(d=defaultCompareFunction);c&vector.NUMERIC?(a=toNumber(a),b=toNumber(b),f=a<b?-1:a>b?1:0):f=d(a,b);c&vector.DESCENDING&&(f*=-1);return f} function _sort(a){for(var b=[],c=-1,d=0,f=a.length-1,e,g,h,k;;)if(100>=f-d){for(g=d+1;g<=f;g++){h=a[g];for(e=g-1;e>=d&&a[e]>h;)a[e+1]=a[e--];a[e+1]=h}if(-1==c)break;f=b[c--];d=b[c--]}else{k=d+f>>1;e=d+1;g=f;h=a[k];a[k]=a[e];a[e]=h;a[d]>a[f]&&(h=a[d],a[d]=a[f],a[f]=h);a[e]>a[f]&&(h=a[e],a[e]=a[f],a[f]=h);a[d]>a[e]&&(h=a[d],a[d]=a[e],a[e]=h);for(k=a[e];;){do e++;while(a[e]<k);do g--;while(a[g]>k);if(g<e)break;h=a[e];a[e]=a[g];a[g]=h}a[d+1]=a[g];a[g]=k;f-e+1>=g-d?(b[++c]=e,b[++c]=f,f=g-1):(b[++c]=d, b[++c]=g-1,d=e)}return a}vector.prototype._sortNumeric=function(a){_sort(this._view());a&&this.reverse()};vector.prototype.sort=function(){if(0===arguments.length)return Array.prototype.sort.call(this._view());var a,b=0;arguments[0]instanceof Function?a=arguments[0]:isNumber(arguments[0])&&(b=arguments[0]);isNumber(arguments[1])&&(b=arguments[1]);if(b&TypedArrayVector.NUMERIC)return this._sortNumeric(b&vector.DESCENDING);Array.prototype.sort.call(this._view(),function(c,d){return compare(c,d,b,a)})}; vector.prototype.asGetNumericProperty=function(a){checkArguments&&asCheckVectorGetNumericProperty(a,this._length);return this._buffer[this._offset+a]};vector.prototype.asSetNumericProperty=function(a,b){checkArguments&&asCheckVectorSetNumericProperty(a,this._length,this._fixed);a===this._length&&(this._ensureCapacity(this._length+1),this._length++);this._buffer[this._offset+a]=b};vector.prototype.shift=function(){this._checkFixed();if(0===this._length)return 0;this._length--;return this._buffer[this._offset++]}; vector.prototype._checkFixed=function(){this._fixed&&throwError("RangeError",Errors.VectorFixedError)};vector.prototype._slide=function(a){this._buffer.set(this._view(),this._offset+a);this._offset+=a};vector.prototype.unshift=function(){this._checkFixed();if(arguments.length){this._ensureCapacity(this._length+arguments.length);this._slide(arguments.length);this._offset-=arguments.length;this._length+=arguments.length;for(var a=0;a<arguments.length;a++)this._buffer[this._offset+a]=arguments[a]}}; vector.prototype.asGetEnumerableKeys=function(){if(vector.prototype===this)return Object.prototype.asGetEnumerableKeys.call(this);for(var a=[],b=0;b<this._length;b++)a.push(b);return a};vector.prototype.asHasProperty=function(a,b,c){if(vector.prototype===this||!isNumeric(b))return Object.prototype.asHasProperty.call(this,a,b,c);a=toNumber(b);return 0<=a&&a<this._length}; Object.defineProperty(vector.prototype,"length",{get:function(){return this._length},set:function(a){a>>>=0;if(a>this._length){this._ensureCapacity(a);for(var b=this._offset+this._length,c=this._offset+a;b<c;b++)this._buffer[b]=DEFAULT_VALUE}this._length=a}}); vector.prototype._spliceHelper=function(a,b,c,d,f){debugger;b=clamp(b,0,d.length-f);c=clamp(c,0,this._length-a);this._ensureCapacity(this._length-c+b);var e=this._offset+a+c,e=this._buffer.subarray(e,e+this._length-a-c);this._buffer.set(e,this._offset+a+b);this._length+=b-c;for(c=0;c<b;c++)this._buffer[this._offset+a+c]=d.asGetNumericProperty(f+c)}; vector.prototype.asGetEnumerableKeys=function(){if(vector.prototype===this)return Object.prototype.asGetEnumerableKeys.call(this);for(var a=[],b=0;b<this._length;b++)a.push(b);return a};';
1.29928 +var Int32Vector = TypedArrayVector;
1.29929 +var Uint32Vector = new Function(originalStringReplace.call(typedArrayVectorTemplate, /Int32Array/g, 'Uint32Array') + ' return vector;')();
1.29930 +var Float64Vector = new Function(originalStringReplace.call(typedArrayVectorTemplate, /Int32Array/g, 'Float64Array') + ' return vector;')();
1.29931 +Int32Vector.prototype.asGetProperty = function (namespaces, name, flags) {
1.29932 + if (typeof name === 'number') {
1.29933 + return this.asGetNumericProperty(name);
1.29934 + }
1.29935 + return asGetProperty.call(this, namespaces, name, flags);
1.29936 +};
1.29937 +Int32Vector.prototype.asSetProperty = function (namespaces, name, flags, value) {
1.29938 + if (typeof name === 'number') {
1.29939 + this.asSetNumericProperty(name, value);
1.29940 + return;
1.29941 + }
1.29942 + return asSetProperty.call(this, namespaces, name, flags, value);
1.29943 +};
1.29944 +Uint32Vector.prototype.asGetProperty = function (namespaces, name, flags) {
1.29945 + if (typeof name === 'number') {
1.29946 + return this.asGetNumericProperty(name);
1.29947 + }
1.29948 + return asGetProperty.call(this, namespaces, name, flags);
1.29949 +};
1.29950 +Uint32Vector.prototype.asSetProperty = function (namespaces, name, flags, value) {
1.29951 + if (typeof name === 'number') {
1.29952 + this.asSetNumericProperty(name, value);
1.29953 + return;
1.29954 + }
1.29955 + return asSetProperty.call(this, namespaces, name, flags, value);
1.29956 +};
1.29957 +Float64Vector.prototype.asGetProperty = function (namespaces, name, flags) {
1.29958 + if (typeof name === 'number') {
1.29959 + return this.asGetNumericProperty(name);
1.29960 + }
1.29961 + return asGetProperty.call(this, namespaces, name, flags);
1.29962 +};
1.29963 +Float64Vector.prototype.asSetProperty = function (namespaces, name, flags, value) {
1.29964 + if (typeof name === 'number') {
1.29965 + this.asSetNumericProperty(name, value);
1.29966 + return;
1.29967 + }
1.29968 + return asSetProperty.call(this, namespaces, name, flags, value);
1.29969 +};
1.29970 +var GenericVector = function () {
1.29971 + function vector(length, fixed, type) {
1.29972 + length = length | 0;
1.29973 + this._fixed = !(!fixed);
1.29974 + this._buffer = new Array(length);
1.29975 + this._type = type;
1.29976 + this._defaultValue = type ? type.defaultValue : null;
1.29977 + this._fill(0, length, this._defaultValue);
1.29978 + }
1.29979 + vector.applyType = function applyType(type) {
1.29980 + function parameterizedVector(length, fixed) {
1.29981 + vector.call(this, length, fixed, type);
1.29982 + }
1.29983 + parameterizedVector.prototype = Object.create(vector.prototype);
1.29984 + parameterizedVector.callable = vector.callable;
1.29985 + return parameterizedVector;
1.29986 + };
1.29987 + vector.callable = function (object) {
1.29988 + if (object instanceof vector) {
1.29989 + return object;
1.29990 + }
1.29991 + var length = object.asGetProperty(undefined, 'length');
1.29992 + if (length !== undefined) {
1.29993 + var v = new vector(length, false);
1.29994 + for (var i = 0; i < length; i++) {
1.29995 + v.asSetNumericProperty(i, object.asGetPublicProperty(i));
1.29996 + }
1.29997 + return v;
1.29998 + }
1.29999 + unexpected();
1.30000 + };
1.30001 + vector.prototype._fill = function (index, length, value) {
1.30002 + for (var i = 0; i < length; i++) {
1.30003 + this._buffer[index + i] = value;
1.30004 + }
1.30005 + };
1.30006 + vector.prototype.toString = function () {
1.30007 + var str = '';
1.30008 + for (var i = 0; i < this._buffer.length; i++) {
1.30009 + str += this._buffer[i];
1.30010 + if (i < this._buffer.length - 1) {
1.30011 + str += ',';
1.30012 + }
1.30013 + }
1.30014 + return str;
1.30015 + };
1.30016 + vector.prototype.every = function (callback, thisObject) {
1.30017 + for (var i = 0; i < this._buffer.length; i++) {
1.30018 + if (!callback.call(thisObject, this.asGetNumericProperty(i), i, this)) {
1.30019 + return false;
1.30020 + }
1.30021 + }
1.30022 + return true;
1.30023 + };
1.30024 + vector.prototype.filter = function (callback, thisObject) {
1.30025 + var v = new vector();
1.30026 + for (var i = 0; i < this._buffer.length; i++) {
1.30027 + if (callback.call(thisObject, this.asGetNumericProperty(i), i, this)) {
1.30028 + v.push(this.asGetNumericProperty(i));
1.30029 + }
1.30030 + }
1.30031 + return v;
1.30032 + };
1.30033 + vector.prototype.some = function (callback, thisObject) {
1.30034 + if (arguments.length !== 2) {
1.30035 + throwError('ArgumentError', Errors.WrongArgumentCountError);
1.30036 + } else if (!isFunction(callback)) {
1.30037 + throwError('ArgumentError', Errors.CheckTypeFailedError);
1.30038 + }
1.30039 + for (var i = 0; i < this._buffer.length; i++) {
1.30040 + if (callback.call(thisObject, this.asGetNumericProperty(i), i, this)) {
1.30041 + return true;
1.30042 + }
1.30043 + }
1.30044 + return false;
1.30045 + };
1.30046 + vector.prototype.forEach = function (callback, thisObject) {
1.30047 + if (!isFunction(callback)) {
1.30048 + throwError('ArgumentError', Errors.CheckTypeFailedError);
1.30049 + }
1.30050 + for (var i = 0; i < this._buffer.length; i++) {
1.30051 + callback.call(thisObject, this.asGetNumericProperty(i), i, this);
1.30052 + }
1.30053 + };
1.30054 + vector.prototype.map = function (callback, thisObject) {
1.30055 + if (!isFunction(callback)) {
1.30056 + throwError('ArgumentError', Errors.CheckTypeFailedError);
1.30057 + }
1.30058 + var v = new vector();
1.30059 + for (var i = 0; i < this._buffer.length; i++) {
1.30060 + v.push(callback.call(thisObject, this.asGetNumericProperty(i), i, this));
1.30061 + }
1.30062 + return v;
1.30063 + };
1.30064 + vector.prototype.push = function () {
1.30065 + this._checkFixed();
1.30066 + for (var i = 0; i < arguments.length; i++) {
1.30067 + this._buffer.push(this._coerce(arguments[i]));
1.30068 + }
1.30069 + };
1.30070 + vector.prototype.pop = function () {
1.30071 + this._checkFixed();
1.30072 + if (this._buffer.length === 0) {
1.30073 + return undefined;
1.30074 + }
1.30075 + return this._buffer.pop();
1.30076 + };
1.30077 + vector.prototype.reverse = function () {
1.30078 + this._buffer.reverse();
1.30079 + };
1.30080 + vector.CASEINSENSITIVE = 1;
1.30081 + vector.DESCENDING = 2;
1.30082 + vector.UNIQUESORT = 4;
1.30083 + vector.RETURNINDEXEDARRAY = 8;
1.30084 + vector.NUMERIC = 16;
1.30085 + function defaultCompareFunction(a, b) {
1.30086 + return String(a).localeCompare(String(b));
1.30087 + }
1.30088 + function compare(a, b, options, compareFunction) {
1.30089 + assertNotImplemented(!(options & CASEINSENSITIVE), 'CASEINSENSITIVE');
1.30090 + assertNotImplemented(!(options & UNIQUESORT), 'UNIQUESORT');
1.30091 + assertNotImplemented(!(options & RETURNINDEXEDARRAY), 'RETURNINDEXEDARRAY');
1.30092 + var result = 0;
1.30093 + if (!compareFunction) {
1.30094 + compareFunction = defaultCompareFunction;
1.30095 + }
1.30096 + if (options & NUMERIC) {
1.30097 + a = toNumber(a);
1.30098 + b = toNumber(b);
1.30099 + result = a < b ? -1 : a > b ? 1 : 0;
1.30100 + } else {
1.30101 + result = compareFunction(a, b);
1.30102 + }
1.30103 + if (options & DESCENDING) {
1.30104 + result *= -1;
1.30105 + }
1.30106 + return result;
1.30107 + }
1.30108 + vector.prototype.sort = function (comparator) {
1.30109 + return this._buffer.sort(comparator);
1.30110 + };
1.30111 + vector.prototype.asGetNumericProperty = function (i) {
1.30112 + checkArguments && asCheckVectorGetNumericProperty(i, this._buffer.length);
1.30113 + return this._buffer[i];
1.30114 + };
1.30115 + vector.prototype._coerce = function (v) {
1.30116 + if (this._type) {
1.30117 + return this._type.coerce(v);
1.30118 + } else if (v === undefined) {
1.30119 + return null;
1.30120 + }
1.30121 + return v;
1.30122 + };
1.30123 + vector.prototype.asSetNumericProperty = function (i, v) {
1.30124 + checkArguments && asCheckVectorSetNumericProperty(i, this._buffer.length, this._fixed);
1.30125 + this._buffer[i] = this._coerce(v);
1.30126 + };
1.30127 + vector.prototype.shift = function () {
1.30128 + this._checkFixed();
1.30129 + if (this._buffer.length === 0) {
1.30130 + return undefined;
1.30131 + }
1.30132 + return this._buffer.shift();
1.30133 + };
1.30134 + vector.prototype._checkFixed = function () {
1.30135 + if (this._fixed) {
1.30136 + throwError('RangeError', Errors.VectorFixedError);
1.30137 + }
1.30138 + };
1.30139 + vector.prototype.unshift = function () {
1.30140 + if (!arguments.length) {
1.30141 + return;
1.30142 + }
1.30143 + this._checkFixed();
1.30144 + var items = [];
1.30145 + for (var i = 0; i < arguments.length; i++) {
1.30146 + items.push(this._coerce(arguments[i]));
1.30147 + }
1.30148 + this._buffer.unshift.apply(this._buffer, items);
1.30149 + };
1.30150 + Object.defineProperty(vector.prototype, 'length', {
1.30151 + get: function () {
1.30152 + return this._buffer.length;
1.30153 + },
1.30154 + set: function (length) {
1.30155 + length = length >>> 0;
1.30156 + if (length > this._buffer.length) {
1.30157 + for (var i = this._buffer.length; i < length; i++) {
1.30158 + this._buffer[i] = this._defaultValue;
1.30159 + }
1.30160 + } else {
1.30161 + this._buffer.length = length;
1.30162 + }
1.30163 + true;
1.30164 + }
1.30165 + });
1.30166 + vector.prototype._spliceHelper = function (index, insertCount, deleteCount, args, offset) {
1.30167 + insertCount = clamp(insertCount, 0, args.length - offset);
1.30168 + deleteCount = clamp(deleteCount, 0, this._buffer.length - index);
1.30169 + var items = [];
1.30170 + for (var i = 0; i < insertCount; i++) {
1.30171 + items.push(this._coerce(args.asGetNumericProperty(offset + i)));
1.30172 + }
1.30173 + this._buffer.splice.apply(this._buffer, [
1.30174 + index,
1.30175 + deleteCount
1.30176 + ].concat(items));
1.30177 + };
1.30178 + vector.prototype.asGetEnumerableKeys = function () {
1.30179 + if (vector.prototype === this) {
1.30180 + return Object.prototype.asGetEnumerableKeys.call(this);
1.30181 + }
1.30182 + var keys = [];
1.30183 + for (var i = 0; i < this._buffer.length; i++) {
1.30184 + keys.push(i);
1.30185 + }
1.30186 + return keys;
1.30187 + };
1.30188 + vector.prototype.asHasProperty = function (namespaces, name, flags) {
1.30189 + if (vector.prototype === this || !isNumeric(name)) {
1.30190 + return Object.prototype.asHasProperty.call(this, namespaces, name, flags);
1.30191 + }
1.30192 + var index = toNumber(name);
1.30193 + return index >= 0 && index < this._buffer.length;
1.30194 + };
1.30195 + return vector;
1.30196 + }();
1.30197 +GenericVector.prototype.asGetProperty = function (namespaces, name, flags) {
1.30198 + if (typeof name === 'number') {
1.30199 + return this.asGetNumericProperty(name);
1.30200 + }
1.30201 + return asGetProperty.call(this, namespaces, name, flags);
1.30202 +};
1.30203 +GenericVector.prototype.asSetProperty = function (namespaces, name, flags, value) {
1.30204 + if (typeof name === 'number') {
1.30205 + this.asSetNumericProperty(name, value);
1.30206 + return;
1.30207 + }
1.30208 + return asSetProperty.call(this, namespaces, name, flags, value);
1.30209 +};
1.30210 +function arraySort(o, args) {
1.30211 + if (args.length === 0) {
1.30212 + return o.sort();
1.30213 + }
1.30214 + var compareFunction, options = 0;
1.30215 + if (args[0] instanceof Function) {
1.30216 + compareFunction = args[0];
1.30217 + } else if (isNumber(args[0])) {
1.30218 + options = args[0];
1.30219 + }
1.30220 + if (isNumber(args[1])) {
1.30221 + options = args[1];
1.30222 + }
1.30223 + o.sort(function (a, b) {
1.30224 + return asCompare(a, b, options, compareFunction);
1.30225 + });
1.30226 + return o;
1.30227 +}
1.30228 +function ArrayClass(domain, scope, instanceConstructor, baseClass) {
1.30229 + var c = new Class('Array', Array, ApplicationDomain.passthroughCallable(Array));
1.30230 + c.extendBuiltin(baseClass);
1.30231 + var CACHE_NUMERIC_COMPARATORS = true;
1.30232 + var numericComparatorCache = createEmptyObject();
1.30233 + c.native = {
1.30234 + static: {
1.30235 + _pop: function _pop(o) {
1.30236 + return o.pop();
1.30237 + },
1.30238 + _reverse: function _reverse(o) {
1.30239 + return o.reverse();
1.30240 + },
1.30241 + _concat: function _concat(o, args) {
1.30242 + return o.concat.apply(o, args);
1.30243 + },
1.30244 + _shift: function _shift(o) {
1.30245 + return o.shift();
1.30246 + },
1.30247 + _slice: function _slice(o, A, B) {
1.30248 + return o.slice(A, B);
1.30249 + },
1.30250 + _unshift: function _unshift(o, args) {
1.30251 + return o.unshift.apply(o, args);
1.30252 + },
1.30253 + _splice: function _splice(o, args) {
1.30254 + return o.splice.apply(o, args);
1.30255 + },
1.30256 + _sort: function _sort(o, args) {
1.30257 + if (args.length === 0) {
1.30258 + return o.sort();
1.30259 + }
1.30260 + var compareFunction, options = 0;
1.30261 + if (args[0] instanceof Function) {
1.30262 + compareFunction = args[0];
1.30263 + } else if (isNumber(args[0])) {
1.30264 + options = args[0];
1.30265 + }
1.30266 + if (isNumber(args[1])) {
1.30267 + options = args[1];
1.30268 + }
1.30269 + o.sort(function (a, b) {
1.30270 + return asCompare(a, b, options, compareFunction);
1.30271 + });
1.30272 + return o;
1.30273 + },
1.30274 + _sortOn: function _sortOn(o, names, options) {
1.30275 + if (isString(names)) {
1.30276 + names = [
1.30277 + names
1.30278 + ];
1.30279 + }
1.30280 + if (isNumber(options)) {
1.30281 + options = [
1.30282 + options
1.30283 + ];
1.30284 + }
1.30285 + for (var i = names.length - 1; i >= 0; i--) {
1.30286 + var key = Multiname.getPublicQualifiedName(names[i]);
1.30287 + if (CACHE_NUMERIC_COMPARATORS && options[i] & SORT_NUMERIC) {
1.30288 + var str = 'var x = toNumber(a.' + key + '), y = toNumber(b.' + key + ');';
1.30289 + if (options[i] & SORT_DESCENDING) {
1.30290 + str += 'return x < y ? 1 : (x > y ? -1 : 0);';
1.30291 + } else {
1.30292 + str += 'return x < y ? -1 : (x > y ? 1 : 0);';
1.30293 + }
1.30294 + var numericComparator = numericComparatorCache[str];
1.30295 + if (!numericComparator) {
1.30296 + numericComparator = numericComparatorCache[str] = new Function('a', 'b', str);
1.30297 + }
1.30298 + o.sort(numericComparator);
1.30299 + } else {
1.30300 + o.sort(function (a, b) {
1.30301 + return asCompare(a[key], b[key], options[i] | 0);
1.30302 + });
1.30303 + }
1.30304 + }
1.30305 + return o;
1.30306 + },
1.30307 + _indexOf: function _indexOf(o, searchElement, fromIndex) {
1.30308 + return o.indexOf(searchElement, fromIndex);
1.30309 + },
1.30310 + _lastIndexOf: function _lastIndexOf(o, searchElement, fromIndex) {
1.30311 + return o.lastIndexOf(searchElement, fromIndex);
1.30312 + },
1.30313 + _every: function _every(o, callback, thisObject) {
1.30314 + for (var i = 0; i < o.length; i++) {
1.30315 + if (callback.call(thisObject, o[i], i, o) !== true) {
1.30316 + return false;
1.30317 + }
1.30318 + }
1.30319 + return false;
1.30320 + },
1.30321 + _filter: function _filter(o, callback, thisObject) {
1.30322 + var result = [];
1.30323 + for (var i = 0; i < o.length; i++) {
1.30324 + if (callback.call(thisObject, o[i], i, o) === true) {
1.30325 + result.push(o[i]);
1.30326 + }
1.30327 + }
1.30328 + return result;
1.30329 + },
1.30330 + _forEach: function _forEach(o, callback, thisObject) {
1.30331 + return o.forEach(callback, thisObject);
1.30332 + },
1.30333 + _map: function _map(o, callback, thisObject) {
1.30334 + return o.map(callback, thisObject);
1.30335 + },
1.30336 + _some: function _some(o, callback, thisObject) {
1.30337 + return o.some(callback, thisObject);
1.30338 + }
1.30339 + },
1.30340 + instance: {
1.30341 + pop: Array.prototype.pop,
1.30342 + push: Array.prototype.push,
1.30343 + unshift: Array.prototype.unshift,
1.30344 + length: {
1.30345 + get: function length() {
1.30346 + return this.length;
1.30347 + },
1.30348 + set: function length(newLength) {
1.30349 + this.length = newLength;
1.30350 + }
1.30351 + }
1.30352 + }
1.30353 + };
1.30354 + c.coerce = function (value) {
1.30355 + return value;
1.30356 + };
1.30357 + c.isInstanceOf = function (value) {
1.30358 + return true;
1.30359 + };
1.30360 + return c;
1.30361 +}
1.30362 +var XMLClass, XMLListClass, QNameClass, ASXML, XML, ASXMLList, XMLList;
1.30363 +var isXMLType, isXMLName, XMLParser;
1.30364 +(function () {
1.30365 + function XMLEncoder(ancestorNamespaces, indentLevel, prettyPrinting) {
1.30366 + function visit(node, encode) {
1.30367 + if (node.isXML) {
1.30368 + switch (node.kind) {
1.30369 + case 'element':
1.30370 + return encode.element(node);
1.30371 + case 'attribute':
1.30372 + return encode.attribute(node);
1.30373 + case 'text':
1.30374 + return encode.text(node);
1.30375 + case 'cdata':
1.30376 + return encode.cdata(node);
1.30377 + case 'comment':
1.30378 + return encode.comment(node);
1.30379 + case 'processing-instruction':
1.30380 + return encode.pi(node);
1.30381 + }
1.30382 + } else if (node.isXMLList) {
1.30383 + return encode.list(node);
1.30384 + } else {
1.30385 + throw 'Not implemented';
1.30386 + }
1.30387 + }
1.30388 + function encode(node, encoder) {
1.30389 + return visit(node, {
1.30390 + element: function (n) {
1.30391 + var s, a;
1.30392 + var ns = n.name.mn.namespaces[0];
1.30393 + var prefix = ns.prefix ? ns.prefix + ':' : '';
1.30394 + s = '<' + prefix + n.name.localName;
1.30395 + var namespaceDeclarations = [];
1.30396 + if (ns.prefix || ns.uri) {
1.30397 + namespaceDeclarations.push(ns);
1.30398 + }
1.30399 + if (prefix) {
1.30400 + namespaceDeclarations[ns.prefix] = true;
1.30401 + }
1.30402 + var t = n;
1.30403 + while (t) {
1.30404 + for (var i = 0; i < t.inScopeNamespaces.length; i++) {
1.30405 + ns = t.inScopeNamespaces[i];
1.30406 + if (!namespaceDeclarations[ns.prefix]) {
1.30407 + namespaceDeclarations.push(ns);
1.30408 + namespaceDeclarations[ns.prefix] = true;
1.30409 + }
1.30410 + }
1.30411 + t = t.parent;
1.30412 + }
1.30413 + for (var i = 0; i < namespaceDeclarations.length; i++) {
1.30414 + a = namespaceDeclarations[i];
1.30415 + if (a.prefix) {
1.30416 + s += ' xmlns:' + a.prefix + '="' + a.uri + '"';
1.30417 + } else {
1.30418 + s += ' xmlns="' + a.uri + '"';
1.30419 + }
1.30420 + }
1.30421 + for (var i = 0; i < n.attributes.length; i++) {
1.30422 + a = n.attributes[i];
1.30423 + var ns = n.name.uri;
1.30424 + var prefix = n.prefix ? ns.prefix + ':' : '';
1.30425 + var name = prefix + a.name.localName;
1.30426 + s += ' ' + name + '="' + a.value + '"';
1.30427 + }
1.30428 + if (n.children.length) {
1.30429 + s += '>';
1.30430 + for (var i = 0; i < n.children.length; i++) {
1.30431 + s += visit(n.children[i], this);
1.30432 + }
1.30433 + s += '</' + prefix + n.name.mn.name + '>';
1.30434 + } else {
1.30435 + s += '/>';
1.30436 + }
1.30437 + return s;
1.30438 + },
1.30439 + text: function (text) {
1.30440 + return escapeAttributeValue(text.value);
1.30441 + },
1.30442 + attribute: function (n) {
1.30443 + return escapeAttributeValue(n.value);
1.30444 + },
1.30445 + cdata: function (n) {
1.30446 + },
1.30447 + comment: function (n) {
1.30448 + },
1.30449 + pi: function (n) {
1.30450 + },
1.30451 + doctype: function (n) {
1.30452 + },
1.30453 + list: function (n) {
1.30454 + var s = '';
1.30455 + for (var i = 0; i < n.children.length; i++) {
1.30456 + if (i > 0) {
1.30457 + s += '\n';
1.30458 + }
1.30459 + s += toXMLString(n.children[i], []);
1.30460 + }
1.30461 + return s;
1.30462 + }
1.30463 + });
1.30464 + }
1.30465 + this.encode = encode;
1.30466 + }
1.30467 + function escapeAttributeValue(v) {
1.30468 + return v.replace('&', '&').replace('<', '<').replace('>', '>');
1.30469 + }
1.30470 + XMLParser = function XMLParser() {
1.30471 + function parseXml(s, sink) {
1.30472 + var i = 0, scopes = [
1.30473 + {
1.30474 + space: 'default',
1.30475 + xmlns: '',
1.30476 + namespaces: {
1.30477 + 'xmlns': 'http://www.w3.org/2000/xmlns/',
1.30478 + 'xml': 'http://www.w3.org/XML/1998/namespace'
1.30479 + }
1.30480 + }
1.30481 + ];
1.30482 + function trim(s) {
1.30483 + return s.replace(/^\s+/, '').replace(/\s+$/, '');
1.30484 + }
1.30485 + function resolveEntities(s) {
1.30486 + return s.replace(/&([^;]+);/g, function (all, entity) {
1.30487 + if (entity.substring(0, 2) === '#x') {
1.30488 + return String.fromCharCode(parseInt(entity.substring(2), 16));
1.30489 + } else if (entity.substring(0, 1) === '#') {
1.30490 + return String.fromCharCode(parseInt(entity.substring(1), 10));
1.30491 + }
1.30492 + switch (entity) {
1.30493 + case 'lt':
1.30494 + return '<';
1.30495 + case 'gt':
1.30496 + return '>';
1.30497 + case 'amp':
1.30498 + return '&';
1.30499 + }
1.30500 + throw 'Unknown entity: ' + entity;
1.30501 + });
1.30502 + }
1.30503 + function isWhitespacePreserved() {
1.30504 + for (var j = scopes.length - 1; j >= 0; --j) {
1.30505 + if (scopes[j].space === 'preserve') {
1.30506 + return true;
1.30507 + }
1.30508 + }
1.30509 + return false;
1.30510 + }
1.30511 + function lookupDefaultNs() {
1.30512 + for (var j = scopes.length - 1; j >= 0; --j) {
1.30513 + if (scopes[j].hasOwnProperty('xmlns')) {
1.30514 + return scopes[j].xmlns;
1.30515 + }
1.30516 + }
1.30517 + }
1.30518 + function lookupNs(prefix) {
1.30519 + for (var j = scopes.length - 1; j >= 0; --j) {
1.30520 + if (scopes[j].namespaces.hasOwnProperty(prefix)) {
1.30521 + return scopes[j].namespaces[prefix];
1.30522 + }
1.30523 + }
1.30524 + throw 'Unknown namespace: ' + prefix;
1.30525 + }
1.30526 + function getName(name, resolveDefaultNs) {
1.30527 + var j = name.indexOf(':');
1.30528 + if (j >= 0) {
1.30529 + var namespace = lookupNs(name.substring(0, j));
1.30530 + var prefix = name.substring(0, j);
1.30531 + var localName = name.substring(j + 1);
1.30532 + return {
1.30533 + name: namespace + '::' + localName,
1.30534 + localName: localName,
1.30535 + prefix: prefix,
1.30536 + namespace: namespace
1.30537 + };
1.30538 + } else if (resolveDefaultNs) {
1.30539 + return {
1.30540 + name: name,
1.30541 + localName: name,
1.30542 + prefix: '',
1.30543 + namespace: lookupDefaultNs()
1.30544 + };
1.30545 + } else {
1.30546 + return {
1.30547 + name: name,
1.30548 + localName: name,
1.30549 + prefix: '',
1.30550 + namespace: ''
1.30551 + };
1.30552 + }
1.30553 + }
1.30554 + var whitespaceMap = {
1.30555 + '10': true,
1.30556 + '13': true,
1.30557 + '9': true,
1.30558 + '32': true
1.30559 + };
1.30560 + function isWhitespace(s, index) {
1.30561 + return s.charCodeAt(index) in whitespaceMap;
1.30562 + }
1.30563 + function parseContent(s, start) {
1.30564 + var pos = start, name, attributes = [];
1.30565 + function skipWs() {
1.30566 + while (pos < s.length && isWhitespace(s, pos)) {
1.30567 + ++pos;
1.30568 + }
1.30569 + }
1.30570 + while (pos < s.length && !isWhitespace(s, pos) && s.charAt(pos) !== '>' && s.charAt(pos) !== '/') {
1.30571 + ++pos;
1.30572 + }
1.30573 + name = s.substring(start, pos);
1.30574 + skipWs();
1.30575 + while (pos < s.length && s.charAt(pos) !== '>' && s.charAt(pos) !== '/' && s.charAt(pos) !== '?') {
1.30576 + skipWs();
1.30577 + var attrName = '', attrValue = '';
1.30578 + while (pos < s.length && !isWhitespace(s, pos) && s.charAt(pos) !== '=') {
1.30579 + attrName += s.charAt(pos);
1.30580 + ++pos;
1.30581 + }
1.30582 + skipWs();
1.30583 + if (s.charAt(pos) !== '=')
1.30584 + throw '\'=\' expected';
1.30585 + ++pos;
1.30586 + skipWs();
1.30587 + var attrEndChar = s.charAt(pos);
1.30588 + if (attrEndChar !== '"' && attrEndChar !== '\'')
1.30589 + throw 'Quote expected';
1.30590 + var attrEndIndex = s.indexOf(attrEndChar, ++pos);
1.30591 + if (attrEndIndex < 0)
1.30592 + throw new 'Unexpected EOF[6]'();
1.30593 + attrValue = s.substring(pos, attrEndIndex);
1.30594 + attributes.push({
1.30595 + name: attrName,
1.30596 + value: resolveEntities(attrValue)
1.30597 + });
1.30598 + pos = attrEndIndex + 1;
1.30599 + skipWs();
1.30600 + }
1.30601 + return {
1.30602 + name: name,
1.30603 + attributes: attributes,
1.30604 + parsed: pos - start
1.30605 + };
1.30606 + }
1.30607 + while (i < s.length) {
1.30608 + var ch = s.charAt(i);
1.30609 + var j = i;
1.30610 + if (ch === '<') {
1.30611 + ++j;
1.30612 + var ch2 = s.charAt(j), q, name;
1.30613 + switch (ch2) {
1.30614 + case '/':
1.30615 + ++j;
1.30616 + q = s.indexOf('>', j);
1.30617 + if (q < 0) {
1.30618 + throw 'Unexpected EOF[1]';
1.30619 + }
1.30620 + name = getName(s.substring(j, q), true);
1.30621 + sink.endElement(name);
1.30622 + scopes.pop();
1.30623 + j = q + 1;
1.30624 + break;
1.30625 + case '?':
1.30626 + ++j;
1.30627 + var content = parseContent(s, j);
1.30628 + if (s.substring(j + content.parsed, j + content.parsed + 2) != '?>') {
1.30629 + throw 'Unexpected EOF[2]';
1.30630 + }
1.30631 + sink.pi(content.name, content.attributes);
1.30632 + j += content.parsed + 2;
1.30633 + break;
1.30634 + case '!':
1.30635 + if (s.substring(j + 1, j + 3) === '--') {
1.30636 + q = s.indexOf('-->', j + 3);
1.30637 + if (q < 0) {
1.30638 + throw 'Unexpected EOF[3]';
1.30639 + }
1.30640 + sink.comment(s.substring(j + 3, q));
1.30641 + j = q + 3;
1.30642 + } else if (s.substring(j + 1, j + 8) === '[CDATA[') {
1.30643 + q = s.indexOf(']]>', j + 8);
1.30644 + if (q < 0) {
1.30645 + throw 'Unexpected EOF[4]';
1.30646 + }
1.30647 + sink.cdata(s.substring(j + 8, q));
1.30648 + j = q + 3;
1.30649 + } else if (s.substring(j + 1, j + 8) === 'DOCTYPE') {
1.30650 + var q2 = s.indexOf('[', j + 8), complexDoctype = false;
1.30651 + q = s.indexOf('>', j + 8);
1.30652 + if (q < 0) {
1.30653 + throw 'Unexpected EOF[5]';
1.30654 + }
1.30655 + if (q2 > 0 && q > q2) {
1.30656 + q = s.indexOf(']>', j + 8);
1.30657 + if (q < 0) {
1.30658 + throw 'Unexpected EOF[7]';
1.30659 + }
1.30660 + complexDoctype = true;
1.30661 + }
1.30662 + var doctypeContent = s.substring(j + 8, q + (complexDoctype ? 1 : 0));
1.30663 + sink.doctype(doctypeContent);
1.30664 + j = q + (complexDoctype ? 2 : 1);
1.30665 + } else {
1.30666 + throw 'Unknown !tag';
1.30667 + }
1.30668 + break;
1.30669 + default:
1.30670 + var content = parseContent(s, j);
1.30671 + var isClosed = false;
1.30672 + if (s.substring(j + content.parsed, j + content.parsed + 2) === '/>') {
1.30673 + isClosed = true;
1.30674 + } else if (s.substring(j + content.parsed, j + content.parsed + 1) !== '>') {
1.30675 + throw 'Unexpected EOF[2]';
1.30676 + }
1.30677 + var scope = {
1.30678 + namespaces: []
1.30679 + };
1.30680 + var contentAttributes = content.attributes;
1.30681 + for (q = 0; q < contentAttributes.length; ++q) {
1.30682 + var attribute = contentAttributes[q];
1.30683 + var attributeName = attribute.name;
1.30684 + if (attributeName.substring(0, 6) === 'xmlns:') {
1.30685 + var prefix = attributeName.substring(6);
1.30686 + var uri = attribute.value;
1.30687 + scope.namespaces[prefix] = trim(uri);
1.30688 + scope.namespaces.push({
1.30689 + uri: uri,
1.30690 + prefix: prefix
1.30691 + });
1.30692 + delete contentAttributes[q];
1.30693 + } else if (attributeName === 'xmlns') {
1.30694 + var uri = attribute.value;
1.30695 + scope.namespaces['xmlns'] = trim(uri);
1.30696 + scope.namespaces.push({
1.30697 + uri: uri,
1.30698 + prefix: ''
1.30699 + });
1.30700 + delete contentAttributes[q];
1.30701 + } else if (attributeName.substring(0, 4) === 'xml:') {
1.30702 + scope[attributeName.substring(4)] = trim(attribute.value);
1.30703 + } else if (attributeName.substring(0, 3) === 'xml') {
1.30704 + throw 'Invalid xml attribute';
1.30705 + } else {
1.30706 + }
1.30707 + }
1.30708 + scopes.push(scope);
1.30709 + var attributes = [];
1.30710 + for (q = 0; q < contentAttributes.length; ++q) {
1.30711 + attribute = contentAttributes[q];
1.30712 + if (attribute) {
1.30713 + attributes.push({
1.30714 + name: getName(attribute.name, false),
1.30715 + value: attribute.value
1.30716 + });
1.30717 + }
1.30718 + }
1.30719 + sink.beginElement(getName(content.name, true), attributes, scope, isClosed);
1.30720 + j += content.parsed + (isClosed ? 2 : 1);
1.30721 + if (isClosed)
1.30722 + scopes.pop();
1.30723 + break;
1.30724 + }
1.30725 + } else {
1.30726 + do {
1.30727 + if (++j >= s.length)
1.30728 + break;
1.30729 + } while (s.charAt(j) !== '<');
1.30730 + var text = s.substring(i, j);
1.30731 + var isWs = text.replace(/^\s+/, '').length === 0;
1.30732 + if (!isWs || isWhitespacePreserved()) {
1.30733 + sink.text(resolveEntities(text), isWs);
1.30734 + }
1.30735 + }
1.30736 + i = j;
1.30737 + }
1.30738 + }
1.30739 + this.parseFromString = function (s, mimeType) {
1.30740 + var currentElement = new XML('element', '', '', '');
1.30741 + var elementsStack = [];
1.30742 + parseXml(s, {
1.30743 + beginElement: function (name, attrs, scope, isEmpty) {
1.30744 + var parent = currentElement;
1.30745 + elementsStack.push(parent);
1.30746 + currentElement = createNode('element', name.namespace, name.localName, name.prefix);
1.30747 + for (var i = 0; i < attrs.length; ++i) {
1.30748 + var rawAttr = attrs[i];
1.30749 + var attr = createNode('attribute', rawAttr.name.namespace, rawAttr.name.localName, rawAttr.name.prefix);
1.30750 + attr.value = rawAttr.value;
1.30751 + currentElement.attributes.push(attr);
1.30752 + }
1.30753 + var namespaces = scope.namespaces;
1.30754 + for (var i = 0; i < namespaces.length; ++i) {
1.30755 + var rawNs = namespaces[i];
1.30756 + var ns = ASNamespace.createNamespace(rawNs.uri, rawNs.prefix);
1.30757 + currentElement.inScopeNamespaces.push(ns);
1.30758 + }
1.30759 + parent.insert(parent.length(), currentElement);
1.30760 + if (isEmpty) {
1.30761 + currentElement = elementsStack.pop();
1.30762 + }
1.30763 + },
1.30764 + endElement: function (name) {
1.30765 + currentElement = elementsStack.pop();
1.30766 + },
1.30767 + text: function (text, isWhitespace) {
1.30768 + var node = createNode('text', '', '');
1.30769 + node.value = text;
1.30770 + currentElement.insert(currentElement.length(), node);
1.30771 + },
1.30772 + cdata: function (text) {
1.30773 + var node = createNode('text', '', '');
1.30774 + node.value = text;
1.30775 + currentElement.insert(currentElement.length(), node);
1.30776 + },
1.30777 + comment: function (text) {
1.30778 + },
1.30779 + pi: function (name, attrs) {
1.30780 + },
1.30781 + doctype: function (text) {
1.30782 + }
1.30783 + });
1.30784 + return currentElement;
1.30785 + };
1.30786 + function createNode(kind, uri, name, prefix) {
1.30787 + return new XML(kind, uri, name, prefix);
1.30788 + }
1.30789 + };
1.30790 + var xmlParser = new XMLParser();
1.30791 + isXMLType = function isXMLType(val) {
1.30792 + return val.isXML || val.isXMLList;
1.30793 + };
1.30794 + function toString(node) {
1.30795 + if (typeof node === 'object' && node !== null) {
1.30796 + switch (node.kind) {
1.30797 + case 'text':
1.30798 + case 'attribute':
1.30799 + return node.value;
1.30800 + default:
1.30801 + if (node.hasSimpleContent()) {
1.30802 + var str = '';
1.30803 + node.children.forEach(function (v, i) {
1.30804 + str += toString(v);
1.30805 + });
1.30806 + return str;
1.30807 + }
1.30808 + return toXMLString(node);
1.30809 + }
1.30810 + } else {
1.30811 + return String(node);
1.30812 + }
1.30813 + }
1.30814 + function toXMLString(node, ancestorNamespaces, indentLevel) {
1.30815 + return new XMLEncoder(ancestorNamespaces, indentLevel, true).encode(node);
1.30816 + }
1.30817 + function toXML(v) {
1.30818 + if (v === null) {
1.30819 + throw new TypeError(formatErrorMessage(Errors.ConvertNullToObjectError));
1.30820 + } else if (v === undefined) {
1.30821 + throw new TypeError(formatErrorMessage(Errors.ConvertUndefinedToObjectError));
1.30822 + } else if (v.isXML) {
1.30823 + return v;
1.30824 + } else if (v.isXMLList) {
1.30825 + if (v.length() === 1) {
1.30826 + return v.children[0];
1.30827 + }
1.30828 + throw new TypeError(formatErrorMessage(Errors.XMLMarkupMustBeWellFormed));
1.30829 + } else {
1.30830 + var x = xmlParser.parseFromString(String(v));
1.30831 + if (x.length() === 0) {
1.30832 + var x = new XML('text');
1.30833 + return x;
1.30834 + } else if (x.length() === 1) {
1.30835 + x.children[0].parent = null;
1.30836 + return x.children[0];
1.30837 + }
1.30838 + throw 'SyntaxError in ToXML';
1.30839 + }
1.30840 + }
1.30841 + var defaultNamespace = '';
1.30842 + function toXMLList(value) {
1.30843 + if (value === null) {
1.30844 + throw new TypeError(formatErrorMessage(Errors.ConvertNullToObjectError));
1.30845 + } else if (value === undefined) {
1.30846 + throw new TypeError(formatErrorMessage(Errors.ConvertUndefinedToObjectError));
1.30847 + } else if (value instanceof XML) {
1.30848 + var xl = new XMLList(value.parent, value.name);
1.30849 + xl.append(value);
1.30850 + return xl;
1.30851 + } else if (value instanceof XMLList) {
1.30852 + return value;
1.30853 + } else {
1.30854 + var s = '<parent xmlns=\'' + defaultNamespace + '\'>' + String(value) + '</parent>';
1.30855 + var x = new ASXML(s);
1.30856 + var xl = new XMLList();
1.30857 + for (var i = 0; i < x.length(); i++) {
1.30858 + var v = x.children[i];
1.30859 + v.parent = null;
1.30860 + xl.append(v);
1.30861 + }
1.30862 + return xl;
1.30863 + }
1.30864 + }
1.30865 + function toAttributeName(v) {
1.30866 + if (v === undefined || v === null || typeof v === 'boolean' || typeof v === 'number') {
1.30867 + throw 'TypeError: invalid operand to ToAttributeName()';
1.30868 + } else if (isXMLType(v)) {
1.30869 + v = toString(v);
1.30870 + } else if (v instanceof Object && v !== null) {
1.30871 + if (v instanceof QName) {
1.30872 + return new QName(v.uri, v.localName, true);
1.30873 + }
1.30874 + v = toString(v);
1.30875 + }
1.30876 + if (typeof v === 'string') {
1.30877 + var ns = new ASNamespace();
1.30878 + var qn = new QName(ns, v, true);
1.30879 + } else {
1.30880 + }
1.30881 + return qn;
1.30882 + }
1.30883 + function toXMLName(mn) {
1.30884 + return new QName(mn);
1.30885 + }
1.30886 + function getDefaultNamespace(scope) {
1.30887 + while (scope) {
1.30888 + var obj = scope.object;
1.30889 + if (obj.defaultNamepsace !== undefined) {
1.30890 + return obj.defaultNamespace;
1.30891 + }
1.30892 + scope = scope.parent;
1.30893 + }
1.30894 + var ns = ASNamespace.createNamespace('', '');
1.30895 + return ns;
1.30896 + }
1.30897 + isXMLName = function isXMLName(v) {
1.30898 + try {
1.30899 + var qn = new QName(v);
1.30900 + } catch (e) {
1.30901 + return false;
1.30902 + }
1.30903 + return true;
1.30904 + };
1.30905 + function asGetProperty(namespaces, name, flags, isMethod) {
1.30906 + var mn = isNumeric(name) ? toNumber(name) : name instanceof QName ? name.mn : new Multiname(namespaces ? namespaces : [
1.30907 + ASNamespace.PUBLIC
1.30908 + ], name, flags);
1.30909 + return this.getProperty(mn, isMethod);
1.30910 + }
1.30911 + function asSetProperty(namespaces, name, flags, value) {
1.30912 + var mn = isNumeric(name) ? toNumber(name) : name instanceof QName ? name.mn : new Multiname(namespaces ? namespaces : [
1.30913 + ASNamespace.PUBLIC
1.30914 + ], name, flags);
1.30915 + this.setProperty(mn, value);
1.30916 + }
1.30917 + function asHasProperty(namespaces, name, flags) {
1.30918 + var mn = isNumeric(name) ? toNumber(name) : name instanceof QName ? name.mn : new Multiname(namespaces ? namespaces : [
1.30919 + ASNamespace.PUBLIC
1.30920 + ], name, flags);
1.30921 + return this.hasProperty(mn);
1.30922 + }
1.30923 + function asCallProperty(namespaces, name, flags, isLex, args) {
1.30924 + var receiver = isLex ? null : this;
1.30925 + var property = this.asGetProperty(namespaces, name, flags, true);
1.30926 + if (!property) {
1.30927 + return this.toString().asCallProperty(namespaces ? namespaces : [
1.30928 + ASNamespace.PUBLIC
1.30929 + ], name, flags, isLex, args);
1.30930 + }
1.30931 + return property.apply(receiver, args);
1.30932 + }
1.30933 + var ATTR_NAME = 1;
1.30934 + var ELEM_NAME = 2;
1.30935 + var ANY_NAME = 4;
1.30936 + var ANY_NAMESPACE = 8;
1.30937 + function nameKind(mn) {
1.30938 + var flags = 0;
1.30939 + if (mn.isAttribute()) {
1.30940 + flags |= ATTR_NAME;
1.30941 + } else {
1.30942 + flags |= ELEM_NAME;
1.30943 + }
1.30944 + if (mn.isAnyName()) {
1.30945 + flags |= ANY_NAME;
1.30946 + }
1.30947 + if (mn.isAnyNamespace()) {
1.30948 + flags |= ANY_NAMESPACE;
1.30949 + }
1.30950 + return flags;
1.30951 + }
1.30952 + XMLClass = function XMLClass(runtime, scope, instanceConstructor, baseClass) {
1.30953 + var FLAG_IGNORE_COMMENTS = 1;
1.30954 + var FLAG_IGNORE_PROCESSING_INSTRUCTIONS = 2;
1.30955 + var FLAG_IGNORE_WHITESPACE = 4;
1.30956 + var FLAG_PRETTY_PRINTING = 8;
1.30957 + ASXML = function (value) {
1.30958 + if (!(this instanceof ASXML)) {
1.30959 + if (value instanceof ASXML) {
1.30960 + return value;
1.30961 + }
1.30962 + return new ASXML(value);
1.30963 + }
1.30964 + if (value === null || value === undefined) {
1.30965 + value = '';
1.30966 + }
1.30967 + var x = toXML(value);
1.30968 + if (isXMLType(value)) {
1.30969 + x = x.deepCopy();
1.30970 + }
1.30971 + return x;
1.30972 + };
1.30973 + XML = function (kind, uri, name, prefix) {
1.30974 + if (kind === undefined) {
1.30975 + kind = 'text';
1.30976 + }
1.30977 + if (uri === undefined) {
1.30978 + uri = '';
1.30979 + }
1.30980 + if (name === undefined) {
1.30981 + name = '';
1.30982 + }
1.30983 + this.init(kind, uri, name, prefix);
1.30984 + };
1.30985 + var c = new Class('XML', ASXML, ApplicationDomain.passthroughCallable(ASXML));
1.30986 + c.flags = FLAG_IGNORE_COMMENTS | FLAG_IGNORE_PROCESSING_INSTRUCTIONS | FLAG_IGNORE_WHITESPACE | FLAG_PRETTY_PRINTING;
1.30987 + c.prettyIndent = 2;
1.30988 + c.extend(baseClass);
1.30989 + var Xp = XML.prototype = ASXML.prototype;
1.30990 + Xp.init = function init(kind, uri, name, prefix) {
1.30991 + this.name = new QName(new Multiname([
1.30992 + new ASNamespace(prefix, uri)
1.30993 + ], name));
1.30994 + this.kind = kind;
1.30995 + this.parent = null;
1.30996 + this.inScopeNamespaces = [];
1.30997 + switch (kind) {
1.30998 + case 'element':
1.30999 + this.attributes = [];
1.31000 + this.children = [];
1.31001 + break;
1.31002 + case 'attribute':
1.31003 + case 'text':
1.31004 + this.value = '';
1.31005 + break;
1.31006 + default:
1.31007 + break;
1.31008 + }
1.31009 + return this;
1.31010 + };
1.31011 + Xp.length = function () {
1.31012 + if (!this.children) {
1.31013 + return 0;
1.31014 + }
1.31015 + return this.children.length;
1.31016 + };
1.31017 + Xp.canHandleProperties = true;
1.31018 + Xp.deepCopy = function () {
1.31019 + return new ASXML(toXMLString(this));
1.31020 + };
1.31021 + Xp.resolveValue = function resolveValue() {
1.31022 + return this;
1.31023 + };
1.31024 + Xp.hasSimpleContent = function hasSimpleContent() {
1.31025 + if (this.kind === 'comment' || this.kind === 'processing-instruction') {
1.31026 + return false;
1.31027 + }
1.31028 + var result = true;
1.31029 + if (this.children) {
1.31030 + this.children.forEach(function (v) {
1.31031 + if (v.kind === 'element') {
1.31032 + result = false;
1.31033 + }
1.31034 + });
1.31035 + }
1.31036 + return result;
1.31037 + };
1.31038 + Xp.asGetEnumerableKeys = function asGetEnumerableKeys() {
1.31039 + if (Xp === this) {
1.31040 + return Object.prototype.asGetEnumerableKeys.call(this);
1.31041 + }
1.31042 + var keys = [];
1.31043 + this.children.forEach(function (v, i) {
1.31044 + keys.push(v.name);
1.31045 + });
1.31046 + return keys;
1.31047 + };
1.31048 + function setAttribute(node, name, value) {
1.31049 + if (node.nodeType === Node.DOCUMENT_NODE) {
1.31050 + node.childNodes[0].setAttribute(name, value);
1.31051 + } else if (node.nodeType === Node.ELEMENT_NODE) {
1.31052 + node.setAttribute(name, value);
1.31053 + } else {
1.31054 + throw 'error or unhandled case in setAttribute';
1.31055 + }
1.31056 + }
1.31057 + Xp.setProperty = function (p, v) {
1.31058 + var x, i, c, n;
1.31059 + x = this;
1.31060 + if (p === p >>> 0) {
1.31061 + throw 'TypeError in XML.prototype.setProperty(): invalid property name ' + p;
1.31062 + }
1.31063 + if (x.kind === 'text' || x.kind === 'comment' || x.kind === 'processing-instruction' || x.kind === 'attribute') {
1.31064 + return;
1.31065 + }
1.31066 + if (!v || !v.isXML && !v.isXMLList || v.kind === 'text' || v.kind === 'attribute') {
1.31067 + c = toString(v);
1.31068 + } else {
1.31069 + c = v.deepCopy();
1.31070 + }
1.31071 + n = toXMLName(p);
1.31072 + if (n.isAttr) {
1.31073 + if (!this.attributes) {
1.31074 + return;
1.31075 + }
1.31076 + this.attributes.forEach(function (v, i, o) {
1.31077 + if (v.name === n.localName) {
1.31078 + delete o[i];
1.31079 + }
1.31080 + });
1.31081 + var a = new XML('attribute', n.uri, n.localName);
1.31082 + a.value = v;
1.31083 + a.parent = this;
1.31084 + this.attributes.push(a);
1.31085 + return;
1.31086 + }
1.31087 + var isValidName = isXMLName(n);
1.31088 + if (!isValidName && n.localName !== '*') {
1.31089 + return;
1.31090 + }
1.31091 + var i = undefined;
1.31092 + var primitiveAssign = !isXMLType(c) && n.localName !== '*';
1.31093 + for (var k = x.length() - 1; k >= 0; k--) {
1.31094 + if ((n.isAny || x.children[k].kind === 'element' && x.children[k].name.localName === n.localName) && (n.uri === null || x.children[k].kind === 'element' && x.children[k].name.uri === n.uri)) {
1.31095 + if (i !== undefined) {
1.31096 + x.deleteByIndex(String(i));
1.31097 + }
1.31098 + i = k;
1.31099 + }
1.31100 + }
1.31101 + if (i === undefined) {
1.31102 + i = x.length();
1.31103 + if (primitiveAssign) {
1.31104 + if (n.uri === null) {
1.31105 + var name = new QName(getDefaultNamespace(scope), n);
1.31106 + } else {
1.31107 + var name = new QName(n);
1.31108 + }
1.31109 + var y = new XML('element', name.uri, name.localName, name.prefix);
1.31110 + y.parent = x;
1.31111 + var ns = name.getNamespace();
1.31112 + x.replace(String(i), y);
1.31113 + y.addInScopeNamespace(ns);
1.31114 + }
1.31115 + }
1.31116 + if (primitiveAssign) {
1.31117 + x.children[i].children = [];
1.31118 + var s = toString(c);
1.31119 + if (s !== '') {
1.31120 + x.children[i].replace('0', s);
1.31121 + }
1.31122 + } else {
1.31123 + x.replace(String(i), c);
1.31124 + }
1.31125 + return;
1.31126 + };
1.31127 + Xp.asGetProperty = asGetProperty;
1.31128 + Xp.asGetResolvedStringProperty = asGetResolvedStringPropertyFallback;
1.31129 + Xp.asSetProperty = asSetProperty;
1.31130 + Xp.asHasProperty = asHasProperty;
1.31131 + Xp.asCallProperty = asCallProperty;
1.31132 + Xp.getProperty = function (mn, isMethod) {
1.31133 + if (isMethod) {
1.31134 + var resolved = Multiname.isQName(mn) ? mn : this.resolveMultinameProperty(mn.namespaces, mn.name, mn.flags);
1.31135 + return this[Multiname.getQualifiedName(resolved)];
1.31136 + }
1.31137 + if (!Multiname.isQName(mn) && isNumeric(mn)) {
1.31138 + if (Number(0) === 0) {
1.31139 + return this;
1.31140 + }
1.31141 + return null;
1.31142 + }
1.31143 + var x = this;
1.31144 + var name = toXMLName(mn);
1.31145 + var xl = new XMLList(x, name);
1.31146 + var flags = nameKind(name.mn);
1.31147 + var anyName = flags & ANY_NAME;
1.31148 + var anyNamespace = flags & ANY_NAMESPACE;
1.31149 + if (flags & ATTR_NAME) {
1.31150 + if (x.attributes) {
1.31151 + x.attributes.forEach(function (v, i) {
1.31152 + if ((anyName || v.name.localName === name.localName) && (anyNamespace || v.name.uri === name.uri)) {
1.31153 + xl.append(v);
1.31154 + }
1.31155 + });
1.31156 + }
1.31157 + } else {
1.31158 + x.children.forEach(function (v, i) {
1.31159 + if ((anyName || v.kind === 'element' && v.name.localName === name.localName) && (anyNamespace || v.kind === 'element' && v.name.uri === name.uri)) {
1.31160 + xl.append(v);
1.31161 + }
1.31162 + });
1.31163 + }
1.31164 + return xl;
1.31165 + };
1.31166 + Xp.hasProperty = function (mn, isMethod) {
1.31167 + if (isMethod) {
1.31168 + var resolved = Multiname.isQName(mn) ? mn : this.resolveMultinameProperty(mn.namespaces, mn.name, mn.flags);
1.31169 + return !(!this[Multiname.getQualifiedName(resolved)]);
1.31170 + }
1.31171 + if (!Multiname.isQName(mn) && isNumeric(mn)) {
1.31172 + if (Number(0) === 0) {
1.31173 + return true;
1.31174 + }
1.31175 + return false;
1.31176 + }
1.31177 + var name = toXMLName(mn);
1.31178 + var flags = nameKind(name.mn);
1.31179 + var anyName = flags & ANY_NAME;
1.31180 + var anyNamespace = flags & ANY_NAMESPACE;
1.31181 + if (flags & ATTR_NAME) {
1.31182 + return this.attributes.some(function (v, i) {
1.31183 + if ((anyName || v.name.localName === name.localName) && (anyNamespace || v.name.uri === name.uri)) {
1.31184 + return true;
1.31185 + }
1.31186 + });
1.31187 + if (x.attributes) {
1.31188 + x.attributes.forEach(function (v, i) {
1.31189 + if ((anyName || v.name.localName === name.localName) && (anyNamespace || v.name.uri === name.uri)) {
1.31190 + xl.append(v);
1.31191 + }
1.31192 + });
1.31193 + }
1.31194 + } else {
1.31195 + if (this.children.some(function (v, i) {
1.31196 + if ((anyName || v.kind === 'element' && v.name.localName === name.localName) && (anyNamespace || v.kind === 'element' && v.name.uri === name.uri)) {
1.31197 + return true;
1.31198 + }
1.31199 + })) {
1.31200 + return true;
1.31201 + }
1.31202 + var resolved = Multiname.isQName(mn) ? mn : this.resolveMultinameProperty(mn.namespaces, mn.name, mn.flags);
1.31203 + return !(!this[Multiname.getQualifiedName(resolved)]);
1.31204 + }
1.31205 + };
1.31206 + Xp.delete = function (key, isMethod) {
1.31207 + notImplemented('XML.[[Delete]]');
1.31208 + };
1.31209 + Xp.deleteByIndex = function (p) {
1.31210 + var x = this;
1.31211 + var i = p >>> 0;
1.31212 + if (String(i) !== String(p)) {
1.31213 + throw 'TypeError in XML.prototype.deleteByIndex(): invalid index ' + p;
1.31214 + }
1.31215 + if (p < x.length()) {
1.31216 + if (x.children[p]) {
1.31217 + x.children[p].parent = null;
1.31218 + delete x.children[p];
1.31219 + for (q = i + 1; q < x.length(); q++) {
1.31220 + x.children[q - 1] = x.children[q];
1.31221 + }
1.31222 + x.children.length = x.children.length - 1;
1.31223 + }
1.31224 + }
1.31225 + };
1.31226 + Xp.isXML = true;
1.31227 + Xp.insert = function insert(p, v) {
1.31228 + var x, s, i, n;
1.31229 + x = this;
1.31230 + if (x.kind === 'text' || x.kind === 'comment' || x.kind === 'processing-instruction' || x.kind === 'attribute') {
1.31231 + return;
1.31232 + }
1.31233 + i = p >>> 0;
1.31234 + if (String(p) !== String(i)) {
1.31235 + throw 'TypeError in XML.prototype.insert(): invalid property name ' + p;
1.31236 + }
1.31237 + if (x.kind === 'element') {
1.31238 + var a = x;
1.31239 + while (a) {
1.31240 + if (a === v) {
1.31241 + throw 'Error in XML.prototype.insert()';
1.31242 + }
1.31243 + a = a.parent;
1.31244 + }
1.31245 + }
1.31246 + if (x.isXMLList) {
1.31247 + n = x.length();
1.31248 + if (n === 0) {
1.31249 + return;
1.31250 + }
1.31251 + } else {
1.31252 + n = 1;
1.31253 + }
1.31254 + for (var j = x.length() - 1; j >= i; j--) {
1.31255 + x[j + n] = x[j];
1.31256 + }
1.31257 + if (x.isXMLList) {
1.31258 + n = v.length();
1.31259 + for (var j = 0; j < n; j++) {
1.31260 + v.children[j].parent = x;
1.31261 + x[i + j] = v[j];
1.31262 + }
1.31263 + } else {
1.31264 + v.parent = x;
1.31265 + x.children[i] = v;
1.31266 + }
1.31267 + };
1.31268 + Xp.replace = function (p, v) {
1.31269 + var x, s;
1.31270 + x = this;
1.31271 + if (x.kind === 'text' || x.kind === 'comment' || x.kind === 'processing-instruction' || x.kind === 'attribute') {
1.31272 + return;
1.31273 + }
1.31274 + var i = p >>> 0;
1.31275 + if (String(p) !== String(i)) {
1.31276 + throw 'TypeError in XML.prototype.replace(): invalid name ' + p;
1.31277 + }
1.31278 + if (i >= x.length()) {
1.31279 + p = String(x.length());
1.31280 + }
1.31281 + if (v.kind === 'element') {
1.31282 + var a = x;
1.31283 + while (a) {
1.31284 + if (a === v) {
1.31285 + throw 'Error in XML.prototype.replace()';
1.31286 + }
1.31287 + a = a.parent;
1.31288 + }
1.31289 + }
1.31290 + if (v.kind === 'element' || v.kind === 'text' || v.kind === 'comment' || v.kind === 'processing-instruction') {
1.31291 + v.parent = x;
1.31292 + if (x[p]) {
1.31293 + x.children[p].parent = null;
1.31294 + }
1.31295 + x.children[p] = v;
1.31296 + } else if (x.isXMLList) {
1.31297 + x.deleteByIndex(p);
1.31298 + x.insert(p, v);
1.31299 + } else {
1.31300 + s = toString(v);
1.31301 + t = new XML();
1.31302 + t.parent = x;
1.31303 + t.value = s;
1.31304 + if (x[p]) {
1.31305 + x.children[p].parent = null;
1.31306 + }
1.31307 + x.children[p] = t;
1.31308 + }
1.31309 + };
1.31310 + Xp.addInScopeNamespace = function (ns) {
1.31311 + var x, s;
1.31312 + x = this;
1.31313 + if (x.kind === 'text' || x.kind === 'comment' || x.kind === 'processing-instruction' || x.kind === 'attribute') {
1.31314 + return;
1.31315 + }
1.31316 + if (ns.prefix !== undefined) {
1.31317 + if (ns.prefix === '' && x.name.uri === '') {
1.31318 + return;
1.31319 + }
1.31320 + var match = null;
1.31321 + x.inScopeNamespaces.forEach(function (v, i) {
1.31322 + if (v.prefix === ns.prefix) {
1.31323 + match = v;
1.31324 + }
1.31325 + });
1.31326 + if (match !== null && match.uri !== ns.uri) {
1.31327 + x.inScopeNamespaces.forEach(function (v, i) {
1.31328 + if (v.prefix === match.prefix) {
1.31329 + x.inScopeNamespaces[i] = ns;
1.31330 + }
1.31331 + });
1.31332 + }
1.31333 + if (x.name.prefix === ns.prefix) {
1.31334 + x.name.prefix = undefined;
1.31335 + }
1.31336 + x.attributes.forEach(function (v, i) {
1.31337 + if (v.name.prefix === ns.name.prefix) {
1.31338 + v.name.prefix = undefined;
1.31339 + }
1.31340 + });
1.31341 + }
1.31342 + };
1.31343 + Xp.descendants = function (name) {
1.31344 + name = toXMLName(name);
1.31345 + var x = this;
1.31346 + var xl = new XMLList();
1.31347 + if (x.kind !== 'element') {
1.31348 + return xl;
1.31349 + }
1.31350 + if (name.isAttr) {
1.31351 + this.attributes.forEach(function (v, i) {
1.31352 + if (name.isAny || name.localName === v.name.localName) {
1.31353 + xl.append(v);
1.31354 + }
1.31355 + });
1.31356 + } else {
1.31357 + this.children.forEach(function (v, i) {
1.31358 + if (name.isAny || name.localName === v.name.localName) {
1.31359 + xl.append(v);
1.31360 + }
1.31361 + });
1.31362 + }
1.31363 + this.children.forEach(function (v, i) {
1.31364 + xl.append(v.descendants(name));
1.31365 + });
1.31366 + return xl;
1.31367 + };
1.31368 + Xp.comments = function () {
1.31369 + var x = this;
1.31370 + var xl = new XMLList(x, null);
1.31371 + x.children.forEach(function (v, i) {
1.31372 + if (v.kind === 'comment') {
1.31373 + xl.append(v);
1.31374 + }
1.31375 + });
1.31376 + return xl;
1.31377 + };
1.31378 + Xp.text = function () {
1.31379 + var x = this;
1.31380 + var xl = new XMLList(x, null);
1.31381 + x.children.forEach(function (v, i) {
1.31382 + if (v.kind === 'text') {
1.31383 + xl.append(v);
1.31384 + }
1.31385 + });
1.31386 + return xl;
1.31387 + };
1.31388 + c.native = {
1.31389 + static: {
1.31390 + ignoreComments: {
1.31391 + get: function ignoreComments() {
1.31392 + return getBitFlags(c.flags, FLAG_IGNORE_COMMENTS);
1.31393 + },
1.31394 + set: function ignoreComments(newIgnore) {
1.31395 + c.flags = setBitFlags(c.flags, FLAG_IGNORE_COMMENTS, newIgnore);
1.31396 + }
1.31397 + },
1.31398 + ignoreProcessingInstructions: {
1.31399 + get: function ignoreProcessingInstructions() {
1.31400 + return getBitFlags(c.flags, FLAG_IGNORE_PROCESSING_INSTRUCTIONS);
1.31401 + },
1.31402 + set: function ignoreProcessingInstructions(newIgnore) {
1.31403 + c.flags = setBitFlags(c.flags, FLAG_IGNORE_PROCESSING_INSTRUCTIONS, newIgnore);
1.31404 + }
1.31405 + },
1.31406 + ignoreWhitespace: {
1.31407 + get: function ignoreWhitespace() {
1.31408 + return getBitFlags(c.flags, FLAG_IGNORE_WHITESPACE);
1.31409 + },
1.31410 + set: function ignoreWhitespace(newIgnore) {
1.31411 + c.flags = setBitFlags(c.flags, FLAG_IGNORE_WHITESPACE, newIgnore);
1.31412 + }
1.31413 + },
1.31414 + prettyPrinting: {
1.31415 + get: function prettyPrinting() {
1.31416 + return getBitFlags(c.flags, FLAG_PRETTY_PRINTING);
1.31417 + },
1.31418 + set: function prettyPrinting(newPretty) {
1.31419 + c.flags = setBitFlags(c.flags, FLAG_PRETTY_PRINTING, newPretty);
1.31420 + }
1.31421 + },
1.31422 + prettyIndent: {
1.31423 + get: function prettyIndent() {
1.31424 + return c.prettyIndent;
1.31425 + },
1.31426 + set: function prettyIndent(newIndent) {
1.31427 + c.prettyIndent = newIndent;
1.31428 + }
1.31429 + }
1.31430 + },
1.31431 + instance: {
1.31432 + toString: function () {
1.31433 + return toString(this);
1.31434 + },
1.31435 + hasOwnProperty: function hasOwnProperty(P) {
1.31436 + somewhatImplemented('XML.hasOwnProperty');
1.31437 + return this.hasProperty(P);
1.31438 + },
1.31439 + propertyIsEnumerable: function propertyIsEnumerable(P) {
1.31440 + notImplemented('XML.propertyIsEnumerable');
1.31441 + },
1.31442 + addNamespace: function addNamespace(ns) {
1.31443 + notImplemented('XML.addNamespace');
1.31444 + },
1.31445 + appendChild: function appendChild(child) {
1.31446 + var children = this.getProperty('*');
1.31447 + children.setProperty(children.length(), child);
1.31448 + return this;
1.31449 + },
1.31450 + attribute: function attribute(name) {
1.31451 + return this.getProperty(toAttributeName(name));
1.31452 + },
1.31453 + attributes: function attributes() {
1.31454 + return this.getProperty(toAttributeName('*'));
1.31455 + },
1.31456 + child: function child(name) {
1.31457 + return this.getProperty(name);
1.31458 + },
1.31459 + childIndex: function childIndex() {
1.31460 + notImplemented('XML.childIndex');
1.31461 + },
1.31462 + children: function children() {
1.31463 + var list = new XMLList();
1.31464 + Array.prototype.push.apply(list.children, this.children);
1.31465 + return list;
1.31466 + },
1.31467 + comments: function comments() {
1.31468 + return this.comments();
1.31469 + },
1.31470 + contains: function contains(value) {
1.31471 + notImplemented('XML.contains');
1.31472 + },
1.31473 + copy: function copy() {
1.31474 + return this.deepCopy();
1.31475 + },
1.31476 + descendants: function descendants(name) {
1.31477 + if (name === undefined) {
1.31478 + name = '*';
1.31479 + }
1.31480 + return this.descendants(name);
1.31481 + },
1.31482 + elements: function elements(name) {
1.31483 + var x = this;
1.31484 + var any = false;
1.31485 + if (name === undefined) {
1.31486 + name = '*';
1.31487 + any = true;
1.31488 + }
1.31489 + var name = toXMLName(name);
1.31490 + var xl = new XMLList(this.parent, name);
1.31491 + x.children.forEach(function (v, i) {
1.31492 + if (v.kind === 'element' && (any || v.name.localName === name.localName) && (name.uri === null || v.kind === 'element' && v.name.uri === name.uri)) {
1.31493 + xl.append(v);
1.31494 + }
1.31495 + });
1.31496 + return xl;
1.31497 + },
1.31498 + hasComplexContent: function hasComplexContent() {
1.31499 + notImplemented('XML.hasComplexContent');
1.31500 + },
1.31501 + hasSimpleContent: function hasSimpleContent() {
1.31502 + return this.hasSimpleContent();
1.31503 + },
1.31504 + inScopeNamespaces: function inScopeNamespaces() {
1.31505 + notImplemented('XML.inScopeNamespaces');
1.31506 + },
1.31507 + insertChildAfter: function insertChildAfter(child1, child2) {
1.31508 + notImplemented('XML.insertChildAfter');
1.31509 + },
1.31510 + insertChildBefore: function insertChildBefore(child1, child2) {
1.31511 + notImplemented('XML.insertChildBefore');
1.31512 + },
1.31513 + localName: function localName() {
1.31514 + return this.name.localName;
1.31515 + },
1.31516 + name: function name() {
1.31517 + return this.name;
1.31518 + },
1.31519 + _namespace: function _namespace(prefix, argc) {
1.31520 + somewhatImplemented('XML._namespace()');
1.31521 + return this.name.uri;
1.31522 + },
1.31523 + namespaceDeclarations: function namespaceDeclarations() {
1.31524 + return new XMLList();
1.31525 + },
1.31526 + nodeKind: function nodeKind() {
1.31527 + return this.kind;
1.31528 + },
1.31529 + normalize: function normalize() {
1.31530 + notImplemented('XML.normalize');
1.31531 + },
1.31532 + parent: function parent() {
1.31533 + notImplemented('XML.parent');
1.31534 + },
1.31535 + processingInstructions: function processingInstructions(name) {
1.31536 + notImplemented('XML.processingInstructions');
1.31537 + },
1.31538 + prependChild: function prependChild(value) {
1.31539 + notImplemented('XML.prependChild');
1.31540 + },
1.31541 + removeNamespace: function removeNamespace(ns) {
1.31542 + notImplemented('XML.removeNamespace');
1.31543 + },
1.31544 + replace: function replace(propertyName, value) {
1.31545 + var c, x, s, i;
1.31546 + x = this;
1.31547 + if (x.kind === 'text' || x.kind === 'comment' || x.kind === 'processing-instruction' || x.kind === 'attribute') {
1.31548 + return x;
1.31549 + }
1.31550 + if (!isXMLType(value)) {
1.31551 + c = value.toString();
1.31552 + } else {
1.31553 + c = value.deepCopy();
1.31554 + }
1.31555 + var i = propertyName >>> 0;
1.31556 + if (String(propertyName) === String(i)) {
1.31557 + x.replace(propertyName, c);
1.31558 + return x;
1.31559 + }
1.31560 + n = new QName(propertyName);
1.31561 + i = undefined;
1.31562 + for (k = x.length() - 1; k >= 0; k--) {
1.31563 + var v = x.children[k];
1.31564 + if (n.isAny || v.kind === 'element' && v.name.localName === n.localName && (n.uri === null || v.kind === 'element' && v.name.uri === n.uri)) {
1.31565 + if (i !== undefined) {
1.31566 + x.deleteByIndex(String(i));
1.31567 + }
1.31568 + i = k;
1.31569 + }
1.31570 + }
1.31571 + if (i !== undefined) {
1.31572 + x.replace(i.toString(), c);
1.31573 + }
1.31574 + return x;
1.31575 + },
1.31576 + setChildren: function setChildren(value) {
1.31577 + notImplemented('XML.setChildren');
1.31578 + },
1.31579 + setLocalName: function setLocalName(name) {
1.31580 + notImplemented('XML.setLocalName');
1.31581 + },
1.31582 + setName: function setName(name) {
1.31583 + notImplemented('XML.setName');
1.31584 + },
1.31585 + setNamespace: function setNamespace(ns) {
1.31586 + notImplemented('XML.setNamespace');
1.31587 + },
1.31588 + text: function text() {
1.31589 + return this.text();
1.31590 + },
1.31591 + toXMLString: function () {
1.31592 + return toXMLString(this);
1.31593 + },
1.31594 + notification: function notification() {
1.31595 + notImplemented('XML.notification');
1.31596 + },
1.31597 + setNotification: function setNotification(f) {
1.31598 + notImplemented('XML.setNotification');
1.31599 + }
1.31600 + }
1.31601 + };
1.31602 + return c;
1.31603 + };
1.31604 + XMLListClass = function XMLListClass(runtime, scope, instanceConstructor, baseClass) {
1.31605 + ASXMLList = function (value) {
1.31606 + if (!(this instanceof ASXMLList)) {
1.31607 + return callXMLList(value);
1.31608 + }
1.31609 + return constructXMLList(value);
1.31610 + };
1.31611 + function callXMLList(v) {
1.31612 + if (v === null || v === undefined) {
1.31613 + v = '';
1.31614 + }
1.31615 + return toXMLList(v);
1.31616 + }
1.31617 + function constructXMLList(val) {
1.31618 + if (val === null || val === undefined) {
1.31619 + val = '';
1.31620 + }
1.31621 + if (val.isXMLList) {
1.31622 + var xl = new XMLList();
1.31623 + xl.append(val);
1.31624 + return xl;
1.31625 + }
1.31626 + return toXMLList(val);
1.31627 + }
1.31628 + XMLList = function (targetObject, targetProperty) {
1.31629 + this.targetObject = targetObject ? targetObject : null;
1.31630 + this.targetProperty = targetProperty ? targetProperty : null;
1.31631 + this.children = [];
1.31632 + };
1.31633 + var c = new Class('XMLList', ASXMLList, ApplicationDomain.passthroughCallable(ASXMLList));
1.31634 + c.extend(baseClass);
1.31635 + var XLp = XMLList.prototype = ASXMLList.prototype;
1.31636 + XLp.canHandleProperties = true;
1.31637 + XLp.hasSimpleContent = function hasSimpleContent() {
1.31638 + if (this.length() === 0) {
1.31639 + return true;
1.31640 + } else if (this.length() === 1) {
1.31641 + return toXML(this).hasSimpleContent();
1.31642 + }
1.31643 + var result = true;
1.31644 + this.children.forEach(function (v) {
1.31645 + if (v.kind === 'element') {
1.31646 + result = false;
1.31647 + }
1.31648 + });
1.31649 + return result;
1.31650 + };
1.31651 + XLp.asGetProperty = asGetProperty;
1.31652 + XLp.asGetResolvedStringProperty = asGetResolvedStringPropertyFallback;
1.31653 + XLp.asSetProperty = asSetProperty;
1.31654 + XLp.asHasProperty = asHasProperty;
1.31655 + XLp.asCallProperty = asCallProperty;
1.31656 + XLp.setProperty = function (mn, v, isMethod) {
1.31657 + var x, i, r;
1.31658 + x = this;
1.31659 + i = mn >>> 0;
1.31660 + if (String(mn) === String(i)) {
1.31661 + var targetObject = this.targetObject;
1.31662 + var targetProperty = this.targetProperty;
1.31663 + if (targetObject !== null) {
1.31664 + r = targetObject.resolveValue();
1.31665 + if (r === null) {
1.31666 + return;
1.31667 + }
1.31668 + } else {
1.31669 + r = null;
1.31670 + }
1.31671 + if (i >= x.length()) {
1.31672 + if (r && r.isXMLList) {
1.31673 + if (r.length !== 1) {
1.31674 + return;
1.31675 + } else {
1.31676 + r = r.children[0];
1.31677 + }
1.31678 + }
1.31679 + if (r && r.kind !== 'element') {
1.31680 + return;
1.31681 + }
1.31682 + var y = new XML();
1.31683 + y.parent = r;
1.31684 + y.name = x.targetProperty;
1.31685 + if (targetProperty === null || targetProperty.localName === '*') {
1.31686 + y.name = null;
1.31687 + y.kind = 'text';
1.31688 + } else if (targetProperty.isAttr) {
1.31689 + var attributeExists = r.getProperty(y.name);
1.31690 + if (attributeExists.length() > 0) {
1.31691 + return;
1.31692 + }
1.31693 + r.kind = 'attribute';
1.31694 + } else {
1.31695 + y.kind = 'element';
1.31696 + }
1.31697 + i = x.length();
1.31698 + if (y.kind !== 'attribute') {
1.31699 + if (r !== null) {
1.31700 + if (i > 0) {
1.31701 + var j = 0;
1.31702 + while (j < r.length() - 1 && r.children[j] !== x.children[i - 1]) {
1.31703 + j++;
1.31704 + }
1.31705 + } else {
1.31706 + var j = r.length() - 1;
1.31707 + }
1.31708 + r.insert(String(j + 1), y);
1.31709 + }
1.31710 + if (v.isXML) {
1.31711 + y.name = v.name;
1.31712 + } else if (v.isXMLList) {
1.31713 + y.name = v.targetProperty;
1.31714 + }
1.31715 + }
1.31716 + x.append(y);
1.31717 + }
1.31718 + if (!v.isXML && !v.isXMLList || v.kind === 'text' || v.kind === 'attribute') {
1.31719 + v = toString(v);
1.31720 + }
1.31721 + if (x.children[i].kind === 'attribute') {
1.31722 + var z = toAttributeName(x.children[i].name);
1.31723 + x.children[i].parent.setProperty(z, v);
1.31724 + var attr = x.children[i].parent.getProperty(z);
1.31725 + x.children[i] = attr.children[0];
1.31726 + } else if (v.isXMLList) {
1.31727 + var c = v.deepCopy();
1.31728 + var parent = x.children[i].parent;
1.31729 + if (parent !== null) {
1.31730 + var q;
1.31731 + parent.children.some(function (v, p) {
1.31732 + if (v == x.children[i]) {
1.31733 + q = p;
1.31734 + return true;
1.31735 + }
1.31736 + });
1.31737 + parent.replace(q, c);
1.31738 + c.children.forEach(function (v, j) {
1.31739 + c.children[j] = parent.children[q >>> 0 + j];
1.31740 + });
1.31741 + }
1.31742 + if (c.length() === 0) {
1.31743 + for (var j = x + 1; j < x.length() - 1; j++) {
1.31744 + x.children[String(j - 1)] = x.children[j];
1.31745 + }
1.31746 + } else {
1.31747 + for (var j = x.length() - 1; j >= i + 1; j--) {
1.31748 + x.children[String(j + c.length() - 1)] = x.children[j];
1.31749 + }
1.31750 + }
1.31751 + for (var j = 0; j < c.length(); j++) {
1.31752 + x.children[i + j] = c.children[j];
1.31753 + }
1.31754 + } else if (v.isXML || (k = x.children[i].kind) === 'text' || k === 'comment' || k === 'processing-instruction') {
1.31755 + var parent = x.children[i].parent;
1.31756 + if (parent !== null) {
1.31757 + var q;
1.31758 + parent.children.some(function (v, p) {
1.31759 + if (v == x.children[i]) {
1.31760 + q = p;
1.31761 + return true;
1.31762 + }
1.31763 + });
1.31764 + parent.replace(q, v);
1.31765 + var v = parent.children[q];
1.31766 + }
1.31767 + if (typeof v === 'string') {
1.31768 + var t = new XML('text');
1.31769 + t.parent = x;
1.31770 + t.value = v;
1.31771 + x.children[i] = t;
1.31772 + } else {
1.31773 + x.children[i] = v;
1.31774 + }
1.31775 + } else {
1.31776 + x.children[i].setProperty('*', v);
1.31777 + }
1.31778 + } else if (x.length() <= 1) {
1.31779 + if (x.length() === 0) {
1.31780 + r = x.resolveValue();
1.31781 + if (r === null || r.length() !== 1) {
1.31782 + return;
1.31783 + }
1.31784 + x.append(r);
1.31785 + }
1.31786 + x.children[0].setProperty(mn, v);
1.31787 + }
1.31788 + };
1.31789 + XLp.getProperty = function (mn, isMethod) {
1.31790 + if (isMethod) {
1.31791 + var resolved = Multiname.isQName(mn) ? mn : this.resolveMultinameProperty(mn.namespaces, mn.name, mn.flags);
1.31792 + return this[Multiname.getQualifiedName(resolved)];
1.31793 + }
1.31794 + var x = this;
1.31795 + var i = mn >>> 0;
1.31796 + if (String(mn) === String(i)) {
1.31797 + return x.children[mn];
1.31798 + }
1.31799 + var name = toXMLName(mn);
1.31800 + var xl = new XMLList(this, name);
1.31801 + x.children.forEach(function (v, i) {
1.31802 + var xl2;
1.31803 + if (v.kind === 'element') {
1.31804 + xl2 = v.getProperty(mn);
1.31805 + if (xl2.length() > 0) {
1.31806 + xl.append(xl2);
1.31807 + }
1.31808 + }
1.31809 + });
1.31810 + return xl;
1.31811 + };
1.31812 + XLp.hasProperty = function (mn, isMethod) {
1.31813 + if (isMethod) {
1.31814 + var resolved = Multiname.isQName(mn) ? mn : this.resolveMultinameProperty(mn.namespaces, mn.name, mn.flags);
1.31815 + return !(!this[Multiname.getQualifiedName(resolved)]);
1.31816 + }
1.31817 + var x = this;
1.31818 + var i = mn >>> 0;
1.31819 + if (String(mn) === String(i)) {
1.31820 + return !(!x.children[mn]);
1.31821 + }
1.31822 + var name = toXMLName(mn);
1.31823 + return this.children.some(function (v, i) {
1.31824 + var xl2 = v.getProperty(mn);
1.31825 + if (xl2.length() > 0) {
1.31826 + return true;
1.31827 + }
1.31828 + });
1.31829 + };
1.31830 + XLp.delete = function (key, isMethod) {
1.31831 + };
1.31832 + XLp.append = function (val) {
1.31833 + if (val.isXMLList) {
1.31834 + this.targetObject = val.targetObject;
1.31835 + this.targetProperty = val.targetProperty;
1.31836 + if (val.length() === 0) {
1.31837 + return;
1.31838 + }
1.31839 + for (var i = 0; i < val.length(); i++) {
1.31840 + this.children.push(val.children[i]);
1.31841 + }
1.31842 + } else if (val.isXML) {
1.31843 + this.children.push(val);
1.31844 + }
1.31845 + };
1.31846 + XLp.length = function () {
1.31847 + return this.children.length;
1.31848 + };
1.31849 + XLp.resolve = function () {
1.31850 + var base = this.targetObject.resolveValue();
1.31851 + if (base === null) {
1.31852 + return null;
1.31853 + }
1.31854 + var target = this.targetObject.getProperty(this.targetProperty);
1.31855 + if (base.length === 0) {
1.31856 + notImplemented('XMLList.resolve');
1.31857 + base.setProperty(this.targetProperty, '');
1.31858 + target = base.getProperty(this.targetProperty);
1.31859 + return target;
1.31860 + }
1.31861 + };
1.31862 + XLp.deepCopy = function () {
1.31863 + var xl = new XMLList();
1.31864 + this.children.forEach(function (v, i) {
1.31865 + xl.children[i] = v.deepCopy();
1.31866 + });
1.31867 + return xl;
1.31868 + };
1.31869 + XLp.descendants = function (name) {
1.31870 + var xl = new XMLList(null);
1.31871 + this.children.forEach(function (v, i) {
1.31872 + if (v.kind === 'element') {
1.31873 + xl.append(v.descendants(name));
1.31874 + }
1.31875 + });
1.31876 + return xl;
1.31877 + };
1.31878 + XLp.resolveValue = function resolveValue() {
1.31879 + if (this.length() > 0) {
1.31880 + return this;
1.31881 + }
1.31882 + var x = this;
1.31883 + var name = x.name;
1.31884 + var targetObject = x.targetObject;
1.31885 + var targetProperty = x.targetProperty;
1.31886 + if (targetObject === null || targetProperty === null || name.isAttr || name.isAny) {
1.31887 + return null;
1.31888 + }
1.31889 + var base = targetObject.resolveValue();
1.31890 + if (base === null) {
1.31891 + return null;
1.31892 + }
1.31893 + var target = base.getProperty(targetProperty);
1.31894 + if (target.length() === 0) {
1.31895 + if (base.isXMLList && base.length() > 1) {
1.31896 + return null;
1.31897 + }
1.31898 + base.setProperty(targetProperty, '');
1.31899 + target = base.getProperty(targetProperty);
1.31900 + }
1.31901 + return target;
1.31902 + };
1.31903 + XLp.asGetEnumerableKeys = function asGetEnumerableKeys() {
1.31904 + if (XLp === this) {
1.31905 + return Object.prototype.asGetEnumerableKeys.call(this);
1.31906 + }
1.31907 + var keys = [];
1.31908 + this.children.forEach(function (v, i) {
1.31909 + keys.push(i);
1.31910 + });
1.31911 + return keys;
1.31912 + };
1.31913 + c.native = {
1.31914 + instance: {
1.31915 + init: function () {
1.31916 + }
1.31917 + }
1.31918 + };
1.31919 + XLp.isXMLList = true;
1.31920 + c.native = {
1.31921 + static: {},
1.31922 + instance: {
1.31923 + toString: function () {
1.31924 + return toString(this);
1.31925 + },
1.31926 + hasOwnProperty: function hasOwnProperty(P) {
1.31927 + somewhatImplemented('XMLList.hasOwnProperty');
1.31928 + return this.hasProperty(P);
1.31929 + },
1.31930 + propertyIsEnumerable: function propertyIsEnumerable(P) {
1.31931 + notImplemented('XMLList.propertyIsEnumerable');
1.31932 + },
1.31933 + attribute: function attribute(name) {
1.31934 + return this.getProperty(toAttributeName(name));
1.31935 + },
1.31936 + attributes: function attributes() {
1.31937 + return this.getProperty(toAttributeName('*'));
1.31938 + },
1.31939 + child: function child(propertyName) {
1.31940 + notImplemented('XMLList.child');
1.31941 + },
1.31942 + children: function children() {
1.31943 + var list = new XMLList();
1.31944 + for (var i = 0; i < this.children.length; i++) {
1.31945 + var child = this.children[i];
1.31946 + Array.prototype.push.apply(list.children, child.children);
1.31947 + }
1.31948 + return list;
1.31949 + },
1.31950 + comments: function comments() {
1.31951 + var x = this;
1.31952 + var xl = new XMLList(x, null);
1.31953 + x.children.forEach(function (v, i) {
1.31954 + if (v.kind === 'element') {
1.31955 + xl.append(v.comments());
1.31956 + }
1.31957 + });
1.31958 + return xl;
1.31959 + },
1.31960 + contains: function contains(value) {
1.31961 + for (var i = 0; i < this.children.length; i++) {
1.31962 + if (this.children[i] === value) {
1.31963 + return true;
1.31964 + }
1.31965 + }
1.31966 + return false;
1.31967 + },
1.31968 + copy: function copy() {
1.31969 + return this.deepCopy();
1.31970 + },
1.31971 + descendants: function descendants(name) {
1.31972 + return this.descendants(name === undefined ? '*' : name);
1.31973 + },
1.31974 + elements: function elements(name) {
1.31975 + var x = this;
1.31976 + var any = false;
1.31977 + if (name === undefined) {
1.31978 + name = '*';
1.31979 + any = true;
1.31980 + }
1.31981 + var name = toXMLName(name);
1.31982 + var xl = new XMLList(x, name);
1.31983 + x.children.forEach(function (v, i) {
1.31984 + if (v.kind === 'element') {
1.31985 + xl.append(v.comments());
1.31986 + }
1.31987 + });
1.31988 + return xl;
1.31989 + },
1.31990 + hasComplexContent: function hasComplexContent() {
1.31991 + notImplemented('XMLList.hasComplexContent');
1.31992 + },
1.31993 + hasSimpleContent: function hasSimpleContent() {
1.31994 + return this.hasSimpleContent();
1.31995 + },
1.31996 + length: function length() {
1.31997 + return this.children.length;
1.31998 + },
1.31999 + name: function name() {
1.32000 + return toXML(this).name;
1.32001 + },
1.32002 + normalize: function normalize() {
1.32003 + notImplemented('XMLList.normalize');
1.32004 + },
1.32005 + parent: function parent() {
1.32006 + notImplemented('XMLList.parent');
1.32007 + },
1.32008 + processingInstructions: function processingInstructions(name) {
1.32009 + notImplemented('XMLList.processingInstructions');
1.32010 + },
1.32011 + text: function text() {
1.32012 + var x = this;
1.32013 + var xl = new XMLList(x, null);
1.32014 + x.children.forEach(function (v, i) {
1.32015 + if (v.kind === 'text' || v.kind === 'element') {
1.32016 + xl.append(v.text());
1.32017 + }
1.32018 + });
1.32019 + return xl;
1.32020 + },
1.32021 + toXMLString: function () {
1.32022 + return toXMLString(this);
1.32023 + },
1.32024 + addNamespace: function addNamespace(ns) {
1.32025 + notImplemented('XMLList.addNamespace');
1.32026 + },
1.32027 + appendChild: function appendChild(child) {
1.32028 + toXML(this).appendChild(child);
1.32029 + return this;
1.32030 + },
1.32031 + childIndex: function childIndex() {
1.32032 + notImplemented('XMLList.childIndex');
1.32033 + },
1.32034 + inScopeNamespaces: function inScopeNamespaces() {
1.32035 + notImplemented('XMLList.inScopeNamespaces');
1.32036 + },
1.32037 + insertChildAfter: function insertChildAfter(child1, child2) {
1.32038 + notImplemented('XMLList.insertChildAfter');
1.32039 + },
1.32040 + insertChildBefore: function insertChildBefore(child1, child2) {
1.32041 + notImplemented('XMLList.insertChildBefore');
1.32042 + },
1.32043 + nodeKind: function nodeKind() {
1.32044 + return toXML(this).kind;
1.32045 + },
1.32046 + _namespace: function _namespace(prefix, argc) {
1.32047 + notImplemented('XMLList._namespace');
1.32048 + },
1.32049 + localName: function localName() {
1.32050 + notImplemented('XMLList.localName');
1.32051 + },
1.32052 + namespaceDeclarations: function namespaceDeclarations() {
1.32053 + somewhatImplemented('XMLList.prototype.namespaceDeclarations()');
1.32054 + return new XMLList();
1.32055 + },
1.32056 + prependChild: function prependChild(value) {
1.32057 + notImplemented('XMLList.prependChild');
1.32058 + },
1.32059 + removeNamespace: function removeNamespace(ns) {
1.32060 + notImplemented('XMLList.removeNamespace');
1.32061 + },
1.32062 + replace: function replace(propertyName, value) {
1.32063 + toXML(this).replace(propertyName, value);
1.32064 + return this;
1.32065 + },
1.32066 + setChildren: function setChildren(value) {
1.32067 + notImplemented('XMLList.setChildren');
1.32068 + },
1.32069 + setLocalName: function setLocalName(name) {
1.32070 + notImplemented('XMLList.setLocalName');
1.32071 + },
1.32072 + setName: function setName(name) {
1.32073 + notImplemented('XMLList.setName');
1.32074 + },
1.32075 + setNamespace: function setNamespace(ns) {
1.32076 + notImplemented('XMLList.setNamespace');
1.32077 + }
1.32078 + }
1.32079 + };
1.32080 + return c;
1.32081 + };
1.32082 + QNameClass = function QNameClass(runtime, scope, instanceConstructor, baseClass) {
1.32083 + QName = function QName(ns, name, isAttr) {
1.32084 + if (!(this instanceof QName)) {
1.32085 + if (name === undefined && ns instanceof QName) {
1.32086 + return ns;
1.32087 + } else {
1.32088 + return new QName(ns, name);
1.32089 + }
1.32090 + }
1.32091 + if (name === undefined) {
1.32092 + name = ns;
1.32093 + ns = undefined;
1.32094 + }
1.32095 + if (typeof ns === 'string' || ns instanceof QName) {
1.32096 + ns = new ASNamespace(ns);
1.32097 + }
1.32098 + var mn;
1.32099 + if (name instanceof QName) {
1.32100 + if (ns === undefined) {
1.32101 + mn = name.mn;
1.32102 + } else {
1.32103 + mn = new Multiname([
1.32104 + ns
1.32105 + ], name.mn.getName());
1.32106 + }
1.32107 + } else if (name instanceof Multiname) {
1.32108 + if (ns === undefined) {
1.32109 + if (name.isQName() || name.isAnyName() || name.isAnyNamespace()) {
1.32110 + mn = name;
1.32111 + } else {
1.32112 + mn = new Multiname([
1.32113 + getDefaultNamespace(scope)
1.32114 + ], name.getName(), name.flags);
1.32115 + }
1.32116 + } else {
1.32117 + mn = new Multiname([
1.32118 + ns
1.32119 + ], name.getName(), name.flags);
1.32120 + }
1.32121 + } else if (name === '*') {
1.32122 + mn = new Multiname([], null, isAttr ? Multiname.ATTRIBUTE : 0);
1.32123 + } else if (name === '@*') {
1.32124 + mn = new Multiname([], null, Multiname.ATTRIBUTE);
1.32125 + } else {
1.32126 + ns = ns === undefined ? getDefaultNamespace(scope) : ns;
1.32127 + if (name === undefined) {
1.32128 + mn = new Multiname([
1.32129 + ns
1.32130 + ], '');
1.32131 + } else {
1.32132 + mn = new Multiname([
1.32133 + ns
1.32134 + ], toString(name), isAttr ? Multiname.ATTRIBUTE : 0);
1.32135 + }
1.32136 + }
1.32137 + this.mn = mn;
1.32138 + this.isAny = mn.isAnyName();
1.32139 + this.isAnyNamespace = mn.isAnyNamespace();
1.32140 + this.isAttr = mn.isAttribute();
1.32141 + };
1.32142 + var c = new Class('QName', QName, ApplicationDomain.passthroughCallable(QName));
1.32143 + c.extend(baseClass);
1.32144 + QNp = QName.prototype;
1.32145 + defineNonEnumerableGetter(QNp, 'localName', function () {
1.32146 + if (!this._localName) {
1.32147 + this._localName = this.isAny ? '*' : this.mn.getName();
1.32148 + }
1.32149 + return this._localName;
1.32150 + });
1.32151 + defineNonEnumerableGetter(QNp, 'uri', function () {
1.32152 + if (!this._uri) {
1.32153 + var ns = this.mn.namespaces[0];
1.32154 + this._uri = ns && ns.uri ? ns.uri : this.isAny || this.isAnyNamespace ? null : '';
1.32155 + }
1.32156 + return this._uri;
1.32157 + });
1.32158 + defineNonEnumerableGetter(QNp, 'prefix', function () {
1.32159 + return this.mn.namespaces[0].prefix;
1.32160 + });
1.32161 + defineNonEnumerableSetter(QNp, 'prefix', function (prefix) {
1.32162 + this.mn.namespaces[0].prefix = prefix;
1.32163 + });
1.32164 + QNp.getNamespace = function (isns) {
1.32165 + if (this.uri === null) {
1.32166 + throw 'TypeError in QName.prototype.getNamespace()';
1.32167 + }
1.32168 + if (!isns) {
1.32169 + isns = [];
1.32170 + }
1.32171 + var ns;
1.32172 + for (var i = 0; i < isns.length; i++) {
1.32173 + if (this.uri === isns[i].uri) {
1.32174 + ns = isns[i];
1.32175 + }
1.32176 + }
1.32177 + if (!ns) {
1.32178 + ns = ASNamespace.createNamespace(this.uri);
1.32179 + }
1.32180 + return ns;
1.32181 + };
1.32182 + c.native = {
1.32183 + static: {},
1.32184 + instance: {
1.32185 + localName: {
1.32186 + get: function localName() {
1.32187 + return this.localName;
1.32188 + }
1.32189 + },
1.32190 + uri: {
1.32191 + get: function uri() {
1.32192 + return this.uri;
1.32193 + }
1.32194 + }
1.32195 + }
1.32196 + };
1.32197 + return c;
1.32198 + };
1.32199 +}());
1.32200 +var AMFUtils = function AMFUtilsClosure() {
1.32201 + var AMF0_NUMBER_MARKER = 0;
1.32202 + var AMF0_BOOLEAN_MARKER = 1;
1.32203 + var AMF0_STRING_MARKER = 2;
1.32204 + var AMF0_OBJECT_MARKER = 3;
1.32205 + var AMF0_NULL_MARKER = 5;
1.32206 + var AMF0_UNDEFINED_MARKER = 6;
1.32207 + var AMF0_REFERENCE_MARKER = 7;
1.32208 + var AMF0_ECMA_ARRAY_MARKER = 8;
1.32209 + var AMF0_OBJECT_END_MARKER = 9;
1.32210 + var AMF0_STRICT_ARRAY_MARKER = 10;
1.32211 + var AMF0_DATE_MARKER = 11;
1.32212 + var AMF0_LONG_STRING_MARKER = 12;
1.32213 + var AMF0_XML_MARKER = 15;
1.32214 + var AMF0_TYPED_OBJECT_MARKER = 16;
1.32215 + var AMF0_AVMPLUS_MARKER = 17;
1.32216 + function writeString(ba, s) {
1.32217 + if (s.length > 65535) {
1.32218 + throw 'AMF short string exceeded';
1.32219 + }
1.32220 + if (!s.length) {
1.32221 + ba.writeByte(0);
1.32222 + ba.writeByte(0);
1.32223 + return;
1.32224 + }
1.32225 + var bytes = utf8decode(s);
1.32226 + ba.writeByte(bytes.length >> 8 & 255);
1.32227 + ba.writeByte(bytes.length & 255);
1.32228 + for (var i = 0; i < bytes.length; i++) {
1.32229 + ba.writeByte(bytes[i]);
1.32230 + }
1.32231 + }
1.32232 + function readString(ba) {
1.32233 + var byteLength = ba.readByte() << 8 | ba.readByte();
1.32234 + if (!byteLength) {
1.32235 + return '';
1.32236 + }
1.32237 + var buffer = new Uint8Array(byteLength);
1.32238 + for (var i = 0; i < byteLength; i++) {
1.32239 + buffer[i] = ba.readByte();
1.32240 + }
1.32241 + return utf8encode(buffer);
1.32242 + }
1.32243 + function writeDouble(ba, value) {
1.32244 + var buffer = new ArrayBuffer(8);
1.32245 + var view = new DataView(buffer);
1.32246 + view.setFloat64(0, value, false);
1.32247 + for (var i = 0; i < buffer.byteLength; i++) {
1.32248 + ba.writeByte(view.getUint8(i));
1.32249 + }
1.32250 + }
1.32251 + function readDouble(ba) {
1.32252 + var buffer = new ArrayBuffer(8);
1.32253 + var view = new DataView(buffer);
1.32254 + for (var i = 0; i < buffer.byteLength; i++) {
1.32255 + view.setUint8(i, ba.readByte());
1.32256 + }
1.32257 + return view.getFloat64(0, false);
1.32258 + }
1.32259 + function setAvmProperty(obj, propertyName, value) {
1.32260 + obj.asSetPublicProperty(propertyName, value);
1.32261 + }
1.32262 + var amf0 = {
1.32263 + write: function (ba, obj) {
1.32264 + switch (typeof obj) {
1.32265 + case 'boolean':
1.32266 + ba.writeByte(AMF0_BOOLEAN_MARKER);
1.32267 + ba.writeByte(obj ? 1 : 0);
1.32268 + break;
1.32269 + case 'number':
1.32270 + ba.writeByte(AMF0_NUMBER_MARKER);
1.32271 + writeDouble(ba, obj);
1.32272 + break;
1.32273 + case 'undefined':
1.32274 + ba.writeByte(AMF0_UNDEFINED_MARKER);
1.32275 + break;
1.32276 + case 'string':
1.32277 + ba.writeByte(AMF0_STRING_MARKER);
1.32278 + writeString(ba, obj);
1.32279 + break;
1.32280 + case 'object':
1.32281 + if (obj === null) {
1.32282 + ba.writeByte(AMF0_NULL_MARKER);
1.32283 + } else if (Array.isArray(obj)) {
1.32284 + ba.writeByte(AMF0_ECMA_ARRAY_MARKER);
1.32285 + ba.writeByte(obj.length >>> 24 & 255);
1.32286 + ba.writeByte(obj.length >> 16 & 255);
1.32287 + ba.writeByte(obj.length >> 8 & 255);
1.32288 + ba.writeByte(obj.length & 255);
1.32289 + forEachPublicProperty(obj, function (key, value) {
1.32290 + writeString(ba, key);
1.32291 + this.write(ba, value);
1.32292 + }, this);
1.32293 + ba.writeByte(0);
1.32294 + ba.writeByte(0);
1.32295 + ba.writeByte(AMF0_OBJECT_END_MARKER);
1.32296 + } else {
1.32297 + ba.writeByte(AMF0_OBJECT_MARKER);
1.32298 + forEachPublicProperty(obj, function (key, value) {
1.32299 + writeString(ba, key);
1.32300 + this.write(ba, value);
1.32301 + }, this);
1.32302 + ba.writeByte(0);
1.32303 + ba.writeByte(0);
1.32304 + ba.writeByte(AMF0_OBJECT_END_MARKER);
1.32305 + }
1.32306 + return;
1.32307 + }
1.32308 + },
1.32309 + read: function (ba) {
1.32310 + var marker = ba.readByte();
1.32311 + switch (marker) {
1.32312 + case AMF0_NUMBER_MARKER:
1.32313 + return readDouble(ba);
1.32314 + case AMF0_BOOLEAN_MARKER:
1.32315 + return !(!ba.readByte());
1.32316 + case AMF0_STRING_MARKER:
1.32317 + return readString(ba);
1.32318 + case AMF0_OBJECT_MARKER:
1.32319 + var obj = {};
1.32320 + while (true) {
1.32321 + var key = readString(ba);
1.32322 + if (!key.length)
1.32323 + break;
1.32324 + setAvmProperty(obj, key, this.read(ba));
1.32325 + }
1.32326 + if (ba.readByte() !== AMF0_OBJECT_END_MARKER) {
1.32327 + throw 'AMF0 End marker is not found';
1.32328 + }
1.32329 + return obj;
1.32330 + case AMF0_NULL_MARKER:
1.32331 + return null;
1.32332 + case AMF0_UNDEFINED_MARKER:
1.32333 + return undefined;
1.32334 + case AMF0_ECMA_ARRAY_MARKER:
1.32335 + var obj = [];
1.32336 + obj.length = ba.readByte() << 24 | ba.readByte() << 16 | ba.readByte() << 8 | ba.readByte();
1.32337 + while (true) {
1.32338 + var key = readString(ba);
1.32339 + if (!key.length)
1.32340 + break;
1.32341 + setAvmProperty(obj, key, this.read(ba));
1.32342 + }
1.32343 + if (ba.readByte() !== AMF0_OBJECT_END_MARKER) {
1.32344 + throw 'AMF0 End marker is not found';
1.32345 + }
1.32346 + return obj;
1.32347 + case AMF0_STRICT_ARRAY_MARKER:
1.32348 + var obj = [];
1.32349 + obj.length = ba.readByte() << 24 | ba.readByte() << 16 | ba.readByte() << 8 | ba.readByte();
1.32350 + for (var i = 0; i < obj.length; i++) {
1.32351 + obj[i] = this.read(ba);
1.32352 + }
1.32353 + return obj;
1.32354 + case AMF0_AVMPLUS_MARKER:
1.32355 + return readAmf3Data(ba, {});
1.32356 + default:
1.32357 + throw 'AMF0 Unknown marker ' + marker;
1.32358 + }
1.32359 + }
1.32360 + };
1.32361 + var AMF3_UNDEFINED_MARKER = 0;
1.32362 + var AMF3_NULL_MARKER = 1;
1.32363 + var AMF3_FALSE_MARKER = 2;
1.32364 + var AMF3_TRUE_MARKER = 3;
1.32365 + var AMF3_INTEGER_MARKER = 4;
1.32366 + var AMF3_DOUBLE_MARKER = 5;
1.32367 + var AMF3_STRING_MARKER = 6;
1.32368 + var AMF3_XML_DOC_MARKER = 7;
1.32369 + var AMF3_DATE_MARKER = 8;
1.32370 + var AMF3_ARRAY_MARKER = 9;
1.32371 + var AMF3_OBJECT_MARKER = 10;
1.32372 + var AMF3_XML_MARKER = 11;
1.32373 + var AMF3_BYTEARRAY_MARKER = 12;
1.32374 + var AMF3_VECTOR_INT_MARKER = 13;
1.32375 + var AMF3_VECTOR_UINT_MARKER = 14;
1.32376 + var AMF3_VECTOR_DOUBLE_MARKER = 15;
1.32377 + var AMF3_VECTOR_OBJECT_MARKER = 16;
1.32378 + var AMF3_DICTIONARY_MARKER = 17;
1.32379 + function readU29(ba) {
1.32380 + var b1 = ba.readByte();
1.32381 + if ((b1 & 128) === 0) {
1.32382 + return b1;
1.32383 + }
1.32384 + var b2 = ba.readByte();
1.32385 + if ((b2 & 128) === 0) {
1.32386 + return (b1 & 127) << 7 | b2;
1.32387 + }
1.32388 + var b3 = ba.readByte();
1.32389 + if ((b3 & 128) === 0) {
1.32390 + return (b1 & 127) << 14 | (b2 & 127) << 7 | b3;
1.32391 + }
1.32392 + var b4 = ba.readByte();
1.32393 + return (b1 & 127) << 22 | (b2 & 127) << 15 | (b3 & 127) << 8 | b4;
1.32394 + }
1.32395 + function writeU29(ba, value) {
1.32396 + if ((value & 4294967168) === 0) {
1.32397 + ba.writeByte(value & 127);
1.32398 + } else if ((value & 4294950912) === 0) {
1.32399 + ba.writeByte(128 | value >> 7 & 127);
1.32400 + ba.writeByte(value & 127);
1.32401 + } else if ((value & 4292870144) === 0) {
1.32402 + ba.writeByte(128 | value >> 14 & 127);
1.32403 + ba.writeByte(128 | value >> 7 & 127);
1.32404 + ba.writeByte(value & 127);
1.32405 + } else if ((value & 3221225472) === 0) {
1.32406 + ba.writeByte(128 | value >> 22 & 127);
1.32407 + ba.writeByte(128 | value >> 15 & 127);
1.32408 + ba.writeByte(128 | value >> 8 & 127);
1.32409 + ba.writeByte(value & 255);
1.32410 + } else {
1.32411 + throw 'AMF3 U29 range';
1.32412 + }
1.32413 + }
1.32414 + function readUTF8vr(ba, caches) {
1.32415 + var u29s = readU29(ba);
1.32416 + if (u29s === 1) {
1.32417 + return '';
1.32418 + }
1.32419 + var stringsCache = caches.stringsCache || (caches.stringsCache = []);
1.32420 + if ((u29s & 1) === 0) {
1.32421 + return stringsCache[u29s >> 1];
1.32422 + }
1.32423 + var byteLength = u29s >> 1;
1.32424 + var buffer = new Uint8Array(byteLength);
1.32425 + for (var i = 0; i < byteLength; i++) {
1.32426 + buffer[i] = ba.readByte();
1.32427 + }
1.32428 + var value = utf8encode(buffer);
1.32429 + stringsCache.push(value);
1.32430 + return value;
1.32431 + }
1.32432 + function writeUTF8vr(ba, value, caches) {
1.32433 + if (value === '') {
1.32434 + ba.writeByte(1);
1.32435 + return;
1.32436 + }
1.32437 + var stringsCache = caches.stringsCache || (caches.stringsCache = []);
1.32438 + var index = stringsCache.indexOf(value);
1.32439 + if (index >= 0) {
1.32440 + writeU29(ba, index << 1);
1.32441 + return;
1.32442 + }
1.32443 + stringsCache.push(value);
1.32444 + var bytes = utf8decode(value);
1.32445 + writeU29(ba, 1 | bytes.length << 1);
1.32446 + for (var i = 0; i < bytes.length; i++) {
1.32447 + ba.writeByte(bytes[i]);
1.32448 + }
1.32449 + }
1.32450 + function readAmf3Data(ba, caches) {
1.32451 + var marker = ba.readByte();
1.32452 + switch (marker) {
1.32453 + case AMF3_NULL_MARKER:
1.32454 + return null;
1.32455 + case AMF3_UNDEFINED_MARKER:
1.32456 + return undefined;
1.32457 + case AMF3_FALSE_MARKER:
1.32458 + return false;
1.32459 + case AMF3_TRUE_MARKER:
1.32460 + return true;
1.32461 + case AMF3_INTEGER_MARKER:
1.32462 + return readU29(ba);
1.32463 + case AMF3_DOUBLE_MARKER:
1.32464 + return readDouble(ba);
1.32465 + case AMF3_STRING_MARKER:
1.32466 + return readUTF8vr(ba, caches);
1.32467 + case AMF3_DATE_MARKER:
1.32468 + return new Date(readDouble(ba));
1.32469 + case AMF3_OBJECT_MARKER:
1.32470 + var u29o = readU29(ba);
1.32471 + if ((u29o & 1) === 0) {
1.32472 + return caches.objectsCache[u29o >> 1];
1.32473 + }
1.32474 + if ((u29o & 4) !== 0) {
1.32475 + throw 'AMF3 Traits-Ext is not supported';
1.32476 + }
1.32477 + var traits, objectClass;
1.32478 + if ((u29o & 2) === 0) {
1.32479 + traits = caches.traitsCache[u29o >> 2];
1.32480 + objectClass = traits.class;
1.32481 + } else {
1.32482 + traits = {};
1.32483 + var aliasName = readUTF8vr(ba, caches);
1.32484 + traits.className = aliasName;
1.32485 + objectClass = aliasName && aliasesCache.names[aliasName];
1.32486 + traits.class = objectClass;
1.32487 + traits.isDynamic = (u29o & 8) !== 0;
1.32488 + traits.members = [];
1.32489 + var slots = objectClass && objectClass.instanceBindings.slots;
1.32490 + for (var i = 0, j = u29o >> 4; i < j; i++) {
1.32491 + var traitName = readUTF8vr(ba, caches);
1.32492 + var slot = null;
1.32493 + for (var j = 1; slots && j < slots.length; j++) {
1.32494 + if (slots[j].name.name === traitName) {
1.32495 + slot = slots[j];
1.32496 + break;
1.32497 + }
1.32498 + }
1.32499 + traits.members.push(slot ? Multiname.getQualifiedName(slot.name) : Multiname.getPublicQualifiedName(traitName));
1.32500 + }
1.32501 + (caches.traitsCache || (caches.traitsCache = [])).push(traits);
1.32502 + }
1.32503 + var obj = objectClass ? objectClass.createInstance() : {};
1.32504 + (caches.objectsCache || (caches.objectsCache = [])).push(obj);
1.32505 + for (var i = 0; i < traits.members.length; i++) {
1.32506 + var value = readAmf3Data(ba, caches);
1.32507 + obj[traits.members[i]] = value;
1.32508 + }
1.32509 + if (traits.isDynamic) {
1.32510 + while (true) {
1.32511 + var key = readUTF8vr(ba, caches);
1.32512 + if (!key.length)
1.32513 + break;
1.32514 + var value = readAmf3Data(ba, caches);
1.32515 + setAvmProperty(obj, key, value);
1.32516 + }
1.32517 + }
1.32518 + return obj;
1.32519 + case AMF3_ARRAY_MARKER:
1.32520 + var u29o = readU29(ba);
1.32521 + if ((u29o & 1) === 0) {
1.32522 + return caches.objectsCache[u29o >> 1];
1.32523 + }
1.32524 + var obj = [];
1.32525 + (caches.objectsCache || (caches.objectsCache = [])).push(obj);
1.32526 + var densePortionLength = u29o >> 1;
1.32527 + while (true) {
1.32528 + var key = readUTF8vr(ba, caches);
1.32529 + if (!key.length)
1.32530 + break;
1.32531 + var value = readAmf3Data(ba, caches);
1.32532 + setAvmProperty(obj, key, value);
1.32533 + }
1.32534 + for (var i = 0; i < densePortionLength; i++) {
1.32535 + var value = readAmf3Data(ba, caches);
1.32536 + setAvmProperty(obj, i, value);
1.32537 + }
1.32538 + return obj;
1.32539 + default:
1.32540 + throw 'AMF3 Unknown marker ' + marker;
1.32541 + }
1.32542 + }
1.32543 + function writeCachedReference(ba, obj, caches) {
1.32544 + var objectsCache = caches.objectsCache || (caches.objectsCache = []);
1.32545 + var index = objectsCache.indexOf(obj);
1.32546 + if (index < 0) {
1.32547 + objectsCache.push(obj);
1.32548 + return false;
1.32549 + }
1.32550 + writeU29(ba, index << 1);
1.32551 + return true;
1.32552 + }
1.32553 + function writeAmf3Data(ba, obj, caches) {
1.32554 + switch (typeof obj) {
1.32555 + case 'boolean':
1.32556 + ba.writeByte(obj ? AMF3_TRUE_MARKER : AMF3_FALSE_MARKER);
1.32557 + break;
1.32558 + case 'number':
1.32559 + if (obj === (obj | 0)) {
1.32560 + ba.writeByte(AMF3_INTEGER_MARKER);
1.32561 + writeU29(ba, obj);
1.32562 + } else {
1.32563 + ba.writeByte(AMF3_DOUBLE_MARKER);
1.32564 + writeDouble(ba, obj);
1.32565 + }
1.32566 + break;
1.32567 + case 'undefined':
1.32568 + ba.writeByte(AMF3_UNDEFINED_MARKER);
1.32569 + break;
1.32570 + case 'string':
1.32571 + ba.writeByte(AMF3_STRING_MARKER);
1.32572 + writeUTF8vr(ba, obj, caches);
1.32573 + break;
1.32574 + case 'object':
1.32575 + if (obj === null) {
1.32576 + ba.writeByte(AMF3_NULL_MARKER);
1.32577 + } else if (Array.isArray(obj)) {
1.32578 + ba.writeByte(AMF3_ARRAY_MARKER);
1.32579 + if (writeCachedReference(ba, obj, caches))
1.32580 + break;
1.32581 + var densePortionLength = 0;
1.32582 + while (densePortionLength in obj) {
1.32583 + ++densePortionLength;
1.32584 + }
1.32585 + writeU29(ba, densePortionLength << 1 | 1);
1.32586 + forEachPublicProperty(obj, function (i, value) {
1.32587 + if (isNumeric(i) && i >= 0 && i < densePortionLength) {
1.32588 + return;
1.32589 + }
1.32590 + writeUTF8vr(ba, i, caches);
1.32591 + writeAmf3Data(ba, value, caches);
1.32592 + });
1.32593 + writeUTF8vr(ba, '', caches);
1.32594 + for (var j = 0; j < densePortionLength; j++) {
1.32595 + writeAmf3Data(ba, obj[j], caches);
1.32596 + }
1.32597 + } else if (obj instanceof Date) {
1.32598 + ba.writeByte(AMF3_DATE_MARKER);
1.32599 + if (writeCachedReference(ba, obj, caches))
1.32600 + break;
1.32601 + writeU29(ba, 1);
1.32602 + writeDouble(ba, obj.valueOf());
1.32603 + } else {
1.32604 + ba.writeByte(AMF3_OBJECT_MARKER);
1.32605 + if (writeCachedReference(ba, obj, caches))
1.32606 + break;
1.32607 + var isDynamic = true;
1.32608 + var objectClass = obj.class;
1.32609 + if (objectClass) {
1.32610 + isDynamic = !objectClass.classInfo.instanceInfo.isSealed();
1.32611 + var aliasName = aliasesCache.classes.get(objectClass) || '';
1.32612 + var traits, traitsCount;
1.32613 + var traitsCache = caches.traitsCache || (caches.traitsCache = []);
1.32614 + var traitsInfos = caches.traitsInfos || (caches.traitsInfos = []);
1.32615 + var traitsRef = traitsCache.indexOf(objectClass);
1.32616 + if (traitsRef < 0) {
1.32617 + var slots = objectClass.instanceBindings.slots;
1.32618 + traits = [];
1.32619 + var traitsNames = [];
1.32620 + for (var i = 1; i < slots.length; i++) {
1.32621 + var slot = slots[i];
1.32622 + if (!slot.name.getNamespace().isPublic()) {
1.32623 + continue;
1.32624 + }
1.32625 + traits.push(Multiname.getQualifiedName(slot.name));
1.32626 + traitsNames.push(slot.name.name);
1.32627 + }
1.32628 + traitsCache.push(objectClass);
1.32629 + traitsInfos.push(traits);
1.32630 + traitsCount = traitsNames.length;
1.32631 + writeU29(ba, (isDynamic ? 11 : 3) + (traitsCount << 4));
1.32632 + writeUTF8vr(ba, aliasName, caches);
1.32633 + for (var i = 0; i < traitsCount; i++) {
1.32634 + writeUTF8vr(ba, traitsNames[i], caches);
1.32635 + }
1.32636 + } else {
1.32637 + traits = traitsInfos[traitsRef];
1.32638 + traitsCount = traits.length;
1.32639 + writeU29(ba, 1 + (traitsRef << 2));
1.32640 + }
1.32641 + for (var i = 0; i < traitsCount; i++) {
1.32642 + writeAmf3Data(ba, obj[traits[i]], caches);
1.32643 + }
1.32644 + } else {
1.32645 + writeU29(ba, 11);
1.32646 + writeUTF8vr(ba, '', caches);
1.32647 + }
1.32648 + if (isDynamic) {
1.32649 + forEachPublicProperty(obj, function (i, value) {
1.32650 + writeUTF8vr(ba, i, caches);
1.32651 + writeAmf3Data(ba, value, caches);
1.32652 + });
1.32653 + writeUTF8vr(ba, '', caches);
1.32654 + }
1.32655 + }
1.32656 + return;
1.32657 + }
1.32658 + }
1.32659 + var aliasesCache = {
1.32660 + classes: new WeakMap(),
1.32661 + names: Object.create(null)
1.32662 + };
1.32663 + var amf3 = {
1.32664 + write: function (ba, obj) {
1.32665 + writeAmf3Data(ba, obj, {});
1.32666 + },
1.32667 + read: function (ba) {
1.32668 + return readAmf3Data(ba, {});
1.32669 + }
1.32670 + };
1.32671 + return {
1.32672 + encodings: [
1.32673 + amf0,
1.32674 + null,
1.32675 + null,
1.32676 + amf3
1.32677 + ],
1.32678 + aliasesCache: aliasesCache
1.32679 + };
1.32680 + }();
1.32681 +function ProxyClass(runtime, scope, instanceConstructor, baseClass) {
1.32682 + function ProxyConstructor() {
1.32683 + somewhatImplemented('Proxy');
1.32684 + }
1.32685 + var c = new Class('Proxy', ProxyConstructor, ApplicationDomain.coerceCallable(ProxyConstructor));
1.32686 + c.extendBuiltin(baseClass);
1.32687 + return c;
1.32688 +}
1.32689 +var proxyTrapQns = {
1.32690 + 'getProperty': null,
1.32691 + 'setProperty': null,
1.32692 + 'hasProperty': null,
1.32693 + 'callProperty': null
1.32694 + };
1.32695 +for (var name in proxyTrapQns) {
1.32696 + proxyTrapQns[name] = VM_OPEN_METHOD_PREFIX + Multiname.getQualifiedName(new Multiname([
1.32697 + ASNamespace.PROXY
1.32698 + ], name));
1.32699 +}
1.32700 +function isProxyObject(obj) {
1.32701 + return obj[VM_IS_PROXY];
1.32702 +}
1.32703 +function nameFromQualifiedName(qn) {
1.32704 + if (isNumeric(qn)) {
1.32705 + return qn;
1.32706 + }
1.32707 + var mn = Multiname.fromQualifiedName(qn);
1.32708 + if (mn === undefined) {
1.32709 + return undefined;
1.32710 + }
1.32711 + return mn.name;
1.32712 +}
1.32713 +function hasNonProxyingCaller() {
1.32714 + var caller = arguments.callee;
1.32715 + var maxDepth = 5;
1.32716 + var domain;
1.32717 + for (var i = 0; i < maxDepth && caller; i++) {
1.32718 + if (caller === nonProxyingHasProperty) {
1.32719 + return true;
1.32720 + }
1.32721 + caller = caller.caller;
1.32722 + }
1.32723 + return false;
1.32724 +}
1.32725 +function installProxyClassWrapper(cls) {
1.32726 + var TRACE_PROXY = false;
1.32727 + if (TRACE_PROXY) {
1.32728 + print('proxy wrapping, class: ' + cls);
1.32729 + }
1.32730 + var instanceConstructor = cls.instanceConstructor;
1.32731 + function construct() {
1.32732 + if (TRACE_PROXY) {
1.32733 + print('proxy create, class: ' + cls);
1.32734 + }
1.32735 + var target = Object.create(instanceConstructor.prototype);
1.32736 + var proxy = Proxy.create({
1.32737 + get: function (o, qn) {
1.32738 + if (qn === VM_IS_PROXY) {
1.32739 + TRACE_PROXY && print('proxy check');
1.32740 + return true;
1.32741 + }
1.32742 + if (qn === VM_CALL_PROXY) {
1.32743 + TRACE_PROXY && print('proxy get caller');
1.32744 + return function apply(mn, receiver, args) {
1.32745 + receiver = receiver ? target : null;
1.32746 + if (TRACE_PROXY) {
1.32747 + print('proxy call, class: ' + target.class + ', mn: ' + mn + 'hasNonProxyingCallerr: ' + hasNonProxyingCaller());
1.32748 + }
1.32749 + var resolved = Multiname.isQName(mn) ? mn : target.resolveMultinameProperty(mn.namespaces, mn.name, mn.flags);
1.32750 + var qn = resolved ? Multiname.getQualifiedName(resolved) : Multiname.getPublicQualifiedName(mn.name);
1.32751 + if (!nameInTraits(target, qn)) {
1.32752 + return target[proxyTrapQns.callProperty](mn.name, args);
1.32753 + }
1.32754 + if (TRACE_PROXY) {
1.32755 + TRACE_PROXY && print('> proxy pass through ' + resolved);
1.32756 + }
1.32757 + if (target.asOpenMethods && target.asOpenMethods[qn]) {
1.32758 + return target.asOpenMethods[qn].apply(o, args);
1.32759 + }
1.32760 + return undefined;
1.32761 + };
1.32762 + }
1.32763 + if (TRACE_PROXY) {
1.32764 + print('proxy get, class: ' + target.class + ', qn: ' + qn + 'hasNonProxyingCallerr: ' + hasNonProxyingCaller());
1.32765 + }
1.32766 + if (!hasNonProxyingCaller()) {
1.32767 + var name = nameFromQualifiedName(qn);
1.32768 + if (name !== undefined && !nameInTraits(target, qn)) {
1.32769 + return target[proxyTrapQns.getProperty](name);
1.32770 + }
1.32771 + }
1.32772 + if (target.asOpenMethods && target.asOpenMethods[qn]) {
1.32773 + return bindSafely(target.asOpenMethods[qn], o);
1.32774 + }
1.32775 + TRACE_PROXY && print('> proxy pass through ' + qn);
1.32776 + return target[qn];
1.32777 + },
1.32778 + set: function (o, qn, value) {
1.32779 + if (TRACE_PROXY) {
1.32780 + print('proxy set, class: ' + target.class + ', qn: ' + qn + 'hasNonProxyingCallerr: ' + hasNonProxyingCaller());
1.32781 + }
1.32782 + if (!hasNonProxyingCaller()) {
1.32783 + var name = nameFromQualifiedName(qn);
1.32784 + if (name !== undefined && !nameInTraits(target, qn)) {
1.32785 + target[proxyTrapQns.setProperty](name, value);
1.32786 + return;
1.32787 + }
1.32788 + }
1.32789 + TRACE_PROXY && print('> proxy pass through ' + qn);
1.32790 + target[qn] = value;
1.32791 + },
1.32792 + has: function (qn) {
1.32793 + if (TRACE_PROXY) {
1.32794 + print('proxy has, class: ' + target.class + ', qn: ' + qn + 'hasNonProxyingCallerr: ' + hasNonProxyingCaller());
1.32795 + }
1.32796 + if (!hasNonProxyingCaller()) {
1.32797 + var name = nameFromQualifiedName(qn);
1.32798 + if (name !== undefined && !nameInTraits(target, qn)) {
1.32799 + return target[proxyTrapQns.hasProperty](name);
1.32800 + }
1.32801 + }
1.32802 + return qn in target;
1.32803 + },
1.32804 + hasOwn: function (qn) {
1.32805 + if (TRACE_PROXY) {
1.32806 + print('proxy hasOwn, class: ' + target.class + ', qn: ' + qn + 'hasNonProxyingCallerr: ' + hasNonProxyingCaller());
1.32807 + }
1.32808 + if (!hasNonProxyingCaller()) {
1.32809 + var name = nameFromQualifiedName(qn);
1.32810 + if (name !== undefined && !nameInTraits(target, qn)) {
1.32811 + return target[proxyTrapQns.hasProperty](name);
1.32812 + }
1.32813 + }
1.32814 + TRACE_PROXY && print('> proxy pass through ' + qn);
1.32815 + return !(!Object.getOwnPropertyDescriptor(target, qn));
1.32816 + },
1.32817 + enumerate: function () {
1.32818 + notImplemented('enumerate');
1.32819 + },
1.32820 + keys: function () {
1.32821 + notImplemented('keys');
1.32822 + }
1.32823 + }, instanceConstructor.prototype);
1.32824 + instanceConstructor.apply(proxy, sliceArguments(arguments, 0));
1.32825 + return proxy;
1.32826 + }
1.32827 + cls.instanceConstructor = construct;
1.32828 +}
1.32829 +function DictionaryClass(domain, scope, instanceConstructor, baseClass) {
1.32830 + function ASDictionary(weakKeys) {
1.32831 + this.weakKeys = weakKeys;
1.32832 + this.map = new WeakMap();
1.32833 + if (!weakKeys) {
1.32834 + this.keys = [];
1.32835 + }
1.32836 + this.primitiveMap = createEmptyObject();
1.32837 + }
1.32838 + var c = new Class('Dictionary', ASDictionary, ApplicationDomain.passthroughCallable(ASDictionary));
1.32839 + c.extendNative(baseClass, ASDictionary);
1.32840 + function makePrimitiveKey(key) {
1.32841 + if (typeof key === 'string' || typeof key === 'number') {
1.32842 + return key;
1.32843 + }
1.32844 + return undefined;
1.32845 + }
1.32846 + var prototype = ASDictionary.prototype;
1.32847 + defineNonEnumerableProperty(prototype, 'asGetProperty', function asGetProperty(namespaces, name, flags, isMethod) {
1.32848 + var key = makePrimitiveKey(name);
1.32849 + if (key !== undefined) {
1.32850 + return this.primitiveMap[key];
1.32851 + }
1.32852 + return this.map.get(Object(name));
1.32853 + });
1.32854 + defineNonEnumerableProperty(prototype, 'asGetResolvedStringProperty', asGetResolvedStringPropertyFallback);
1.32855 + defineNonEnumerableProperty(prototype, 'asSetProperty', function asSetProperty(namespaces, name, flags, value) {
1.32856 + var key = makePrimitiveKey(name);
1.32857 + if (key !== undefined) {
1.32858 + this.primitiveMap[key] = value;
1.32859 + return;
1.32860 + }
1.32861 + this.map.set(Object(name), value);
1.32862 + if (!this.weakKeys && this.keys.indexOf(name) < 0) {
1.32863 + this.keys.push(name);
1.32864 + }
1.32865 + });
1.32866 + defineNonEnumerableProperty(prototype, 'asCallProperty', function asCallProperty(namespaces, name, flags, isLex, args) {
1.32867 + notImplemented('asCallProperty');
1.32868 + });
1.32869 + defineNonEnumerableProperty(prototype, 'asHasProperty', function asHasProperty(namespaces, name, flags, nonProxy) {
1.32870 + var key = makePrimitiveKey(name);
1.32871 + if (key !== undefined) {
1.32872 + return key in this.primitiveMap;
1.32873 + }
1.32874 + return this.map.has(Object(name));
1.32875 + });
1.32876 + defineNonEnumerableProperty(prototype, 'asDeleteProperty', function asDeleteProperty(namespaces, name, flags) {
1.32877 + var key = makePrimitiveKey(name);
1.32878 + if (key !== undefined) {
1.32879 + delete this.primitiveMap[key];
1.32880 + }
1.32881 + this.map.delete(Object(name));
1.32882 + var i;
1.32883 + if (!this.weakKeys && (i = this.keys.indexOf(name)) >= 0) {
1.32884 + this.keys.splice(i, 1);
1.32885 + }
1.32886 + return true;
1.32887 + });
1.32888 + defineNonEnumerableProperty(prototype, 'asGetEnumerableKeys', function () {
1.32889 + if (prototype === this) {
1.32890 + return Object.prototype.asGetEnumerableKeys.call(this);
1.32891 + }
1.32892 + var primitiveMapKeys = [];
1.32893 + for (var k in this.primitiveMap) {
1.32894 + primitiveMapKeys.push(k);
1.32895 + }
1.32896 + if (this.weakKeys) {
1.32897 + return primitiveMapKeys;
1.32898 + }
1.32899 + return primitiveMapKeys.concat(this.keys);
1.32900 + });
1.32901 + c.native = {
1.32902 + instance: {
1.32903 + init: function () {
1.32904 + }
1.32905 + }
1.32906 + };
1.32907 + return c;
1.32908 +}
1.32909 +function debugBreak(message) {
1.32910 + debugger;
1.32911 + print('\x1b[91mdebugBreak: ' + message + '\x1b[0m');
1.32912 +}
1.32913 +var NativeASNamespace;
1.32914 +var natives = function () {
1.32915 + var C = ApplicationDomain.passthroughCallable;
1.32916 + var CC = ApplicationDomain.constructingCallable;
1.32917 + function ObjectClass(applicationDomain, scope, instanceConstructor, baseClass) {
1.32918 + var c = new Class('Object', Object, C(Object));
1.32919 + c.native = {
1.32920 + instance: {
1.32921 + isPrototypeOf: Object.prototype.isPrototypeOf,
1.32922 + hasOwnProperty: function (name) {
1.32923 + if (name === undefined) {
1.32924 + return false;
1.32925 + }
1.32926 + name = Multiname.getPublicQualifiedName(name);
1.32927 + if (Object.prototype.hasOwnProperty.call(this, name)) {
1.32928 + return true;
1.32929 + }
1.32930 + return Object.getPrototypeOf(this).hasOwnProperty(name);
1.32931 + },
1.32932 + propertyIsEnumerable: function (name) {
1.32933 + if (name === undefined) {
1.32934 + return false;
1.32935 + }
1.32936 + name = Multiname.getPublicQualifiedName(name);
1.32937 + return Object.prototype.propertyIsEnumerable.call(this, name);
1.32938 + }
1.32939 + },
1.32940 + static: {
1.32941 + _setPropertyIsEnumerable: function _setPropertyIsEnumerable(obj, name, isEnum) {
1.32942 + name = Multiname.getPublicQualifiedName(name);
1.32943 + var descriptor = Object.getOwnPropertyDescriptor(obj, name);
1.32944 + descriptor.enumerable = false;
1.32945 + Object.defineProperty(obj, name, descriptor);
1.32946 + }
1.32947 + }
1.32948 + };
1.32949 + c.dynamicPrototype = c.traitsPrototype = Object.prototype;
1.32950 + c.setDefaultProperties();
1.32951 + c.defaultValue = null;
1.32952 + c.coerce = function (value) {
1.32953 + return asCoerceObject(value);
1.32954 + };
1.32955 + c.isInstanceOf = function (value) {
1.32956 + if (value === null) {
1.32957 + return false;
1.32958 + }
1.32959 + return true;
1.32960 + };
1.32961 + c.isInstance = function (value) {
1.32962 + if (value === null || value === undefined) {
1.32963 + return false;
1.32964 + }
1.32965 + return true;
1.32966 + };
1.32967 + return c;
1.32968 + }
1.32969 + function ClassClass(runtime, scope, instanceConstructor, baseClass) {
1.32970 + var c = Class;
1.32971 + c.debugName = 'Class';
1.32972 + c.prototype.extendBuiltin.call(c, baseClass);
1.32973 + c.coerce = function (value) {
1.32974 + return value;
1.32975 + };
1.32976 + c.isInstanceOf = function (value) {
1.32977 + return true;
1.32978 + };
1.32979 + c.isInstance = function (value) {
1.32980 + return value instanceof c.instanceConstructor;
1.32981 + };
1.32982 + return c;
1.32983 + }
1.32984 + function BooleanClass(runtime, scope, instanceConstructor, baseClass) {
1.32985 + var c = new Class('Boolean', Boolean, C(Boolean));
1.32986 + c.extendBuiltin(baseClass);
1.32987 + c.native = {
1.32988 + instance: {
1.32989 + toString: Boolean.prototype.toString,
1.32990 + valueOf: Boolean.prototype.valueOf
1.32991 + }
1.32992 + };
1.32993 + c.coerce = Boolean;
1.32994 + c.isInstanceOf = function (value) {
1.32995 + return typeof value === 'boolean' || value instanceof Boolean;
1.32996 + };
1.32997 + c.isInstance = function (value) {
1.32998 + if (typeof value === 'boolean' || value instanceof Boolean) {
1.32999 + return true;
1.33000 + }
1.33001 + return false;
1.33002 + };
1.33003 + return c;
1.33004 + }
1.33005 + function FunctionClass(runtime, scope, instanceConstructor, baseClass) {
1.33006 + var c = new Class('Function', Function, C(Function));
1.33007 + c.extendBuiltin(baseClass);
1.33008 + c.native = {
1.33009 + instance: {
1.33010 + prototype: {
1.33011 + get: function () {
1.33012 + return this.prototype;
1.33013 + },
1.33014 + set: function (p) {
1.33015 + this.prototype = p;
1.33016 + }
1.33017 + },
1.33018 + length: {
1.33019 + get: function () {
1.33020 + if (this.hasOwnProperty(VM_LENGTH)) {
1.33021 + return this.asLength;
1.33022 + }
1.33023 + return this.length;
1.33024 + }
1.33025 + },
1.33026 + call: Function.prototype.call,
1.33027 + apply: Function.prototype.apply
1.33028 + }
1.33029 + };
1.33030 + c.coerce = function (value) {
1.33031 + return value;
1.33032 + };
1.33033 + c.isInstanceOf = function (value) {
1.33034 + return typeof value === 'function';
1.33035 + };
1.33036 + c.isInstance = function (value) {
1.33037 + return typeof value === 'function';
1.33038 + };
1.33039 + return c;
1.33040 + }
1.33041 + function MethodClosure($this, fn) {
1.33042 + var bound = bindSafely(fn, $this);
1.33043 + defineNonEnumerableProperty(this, 'call', bound.call.bind(bound));
1.33044 + defineNonEnumerableProperty(this, 'apply', bound.apply.bind(bound));
1.33045 + }
1.33046 + MethodClosure.prototype = {
1.33047 + toString: function () {
1.33048 + return 'function Function() {}';
1.33049 + }
1.33050 + };
1.33051 + function MethodClosureClass(runtime, scope, instanceConstructor, baseClass) {
1.33052 + var c = new Class('MethodClosure', MethodClosure);
1.33053 + c.extendBuiltin(baseClass);
1.33054 + return c;
1.33055 + }
1.33056 + function StringClass(runtime, scope, instanceConstructor, baseClass) {
1.33057 + var c = new Class('String', String, C(String));
1.33058 + c.extendBuiltin(baseClass);
1.33059 + var Sp = String.prototype;
1.33060 + c.native = {
1.33061 + instance: {
1.33062 + length: {
1.33063 + get: function () {
1.33064 + return this.length;
1.33065 + }
1.33066 + },
1.33067 + indexOf: Sp.indexOf,
1.33068 + lastIndexOf: Sp.lastIndexOf,
1.33069 + charAt: Sp.charAt,
1.33070 + charCodeAt: Sp.charCodeAt,
1.33071 + concat: Sp.concat,
1.33072 + localeCompare: Sp.localeCompare,
1.33073 + match: function (re) {
1.33074 + if (re === void 0 || re === null) {
1.33075 + return null;
1.33076 + } else {
1.33077 + if (re instanceof RegExp && re.global) {
1.33078 + var matches = [], m;
1.33079 + while (m = re.exec(this)) {
1.33080 + matches.push(m[0]);
1.33081 + }
1.33082 + return matches;
1.33083 + }
1.33084 + if (!(re instanceof RegExp) && !(typeof re === 'string')) {
1.33085 + re = String(re);
1.33086 + }
1.33087 + return this.match(re);
1.33088 + }
1.33089 + },
1.33090 + replace: Sp.replace,
1.33091 + search: function (re) {
1.33092 + if (re === void 0) {
1.33093 + return -1;
1.33094 + } else {
1.33095 + return this.search(re);
1.33096 + }
1.33097 + },
1.33098 + slice: Sp.slice,
1.33099 + split: Sp.split,
1.33100 + substr: Sp.substr,
1.33101 + substring: Sp.substring,
1.33102 + toLowerCase: Sp.toLowerCase,
1.33103 + toLocaleLowerCase: Sp.toLocaleLowerCase,
1.33104 + toUpperCase: function () {
1.33105 + var str = Sp.toUpperCase.apply(this);
1.33106 + var str = str.replace(/\u039C/g, String.fromCharCode(181));
1.33107 + return str;
1.33108 + },
1.33109 + toLocaleUpperCase: function () {
1.33110 + var str = Sp.toLocaleUpperCase.apply(this);
1.33111 + var str = str.replace(/\u039C/g, String.fromCharCode(181));
1.33112 + return str;
1.33113 + },
1.33114 + toString: Sp.toString,
1.33115 + valueOf: Sp.valueOf
1.33116 + },
1.33117 + static: String
1.33118 + };
1.33119 + c.isInstance = function (value) {
1.33120 + return value !== null && value !== undefined && typeof value.valueOf() === 'string';
1.33121 + };
1.33122 + c.coerce = function (value) {
1.33123 + if (value === null || value === undefined) {
1.33124 + return null;
1.33125 + }
1.33126 + return String(value);
1.33127 + };
1.33128 + c.isInstanceOf = function (value) {
1.33129 + return Object(value) instanceof String;
1.33130 + };
1.33131 + c.isInstance = function (value) {
1.33132 + return Object(value) instanceof String;
1.33133 + };
1.33134 + return c;
1.33135 + }
1.33136 + function VectorClass(domain, scope, instanceConstructor, baseClass) {
1.33137 + return createVectorClass(undefined, baseClass);
1.33138 + }
1.33139 + function ObjectVectorClass(domain, scope, instanceConstructor, baseClass) {
1.33140 + return createVectorClass(domain.getClass('Object'), baseClass);
1.33141 + }
1.33142 + function IntVectorClass(domain, scope, instanceConstructor, baseClass) {
1.33143 + return createVectorClass(domain.getClass('int'), baseClass);
1.33144 + }
1.33145 + function UIntVectorClass(domain, scope, instanceConstructor, baseClass) {
1.33146 + return createVectorClass(domain.getClass('uint'), baseClass);
1.33147 + }
1.33148 + function DoubleVectorClass(domain, scope, instanceConstructor, baseClass) {
1.33149 + return createVectorClass(domain.getClass('Number'), baseClass);
1.33150 + }
1.33151 + function createVectorClass(type, baseClass) {
1.33152 + var V;
1.33153 + if (type) {
1.33154 + var className = 'Vector$' + type.classInfo.instanceInfo.name.name;
1.33155 + switch (className) {
1.33156 + case 'Vector$int':
1.33157 + V = Int32Vector;
1.33158 + break;
1.33159 + case 'Vector$uint':
1.33160 + V = Uint32Vector;
1.33161 + break;
1.33162 + case 'Vector$Number':
1.33163 + V = Float64Vector;
1.33164 + break;
1.33165 + case 'Vector$Object':
1.33166 + V = GenericVector;
1.33167 + break;
1.33168 + default:
1.33169 + unexpected();
1.33170 + break;
1.33171 + }
1.33172 + } else {
1.33173 + V = GenericVector.applyType(null);
1.33174 + }
1.33175 + var Vp = V.prototype;
1.33176 + var cls = new Class(className, V, C(V.callable));
1.33177 + if (V === GenericVector) {
1.33178 + cls.applyType = function (type) {
1.33179 + return cls;
1.33180 + };
1.33181 + }
1.33182 + cls.extendWrapper(baseClass, V);
1.33183 + cls.native = {
1.33184 + instance: {
1.33185 + fixed: {
1.33186 + get: function () {
1.33187 + return this._fixed;
1.33188 + },
1.33189 + set: function (v) {
1.33190 + this._fixed = v;
1.33191 + }
1.33192 + },
1.33193 + length: {
1.33194 + get: function () {
1.33195 + return this.length;
1.33196 + },
1.33197 + set: function setLength(length) {
1.33198 + this.length = length;
1.33199 + }
1.33200 + },
1.33201 + push: Vp.push,
1.33202 + pop: Vp.pop,
1.33203 + shift: Vp.shift,
1.33204 + unshift: Vp.unshift,
1.33205 + _reverse: Vp.reverse,
1.33206 + _filter: Vp.filter,
1.33207 + _map: Vp.map,
1.33208 + newThisType: function newThisType() {
1.33209 + return new cls.instanceConstructor();
1.33210 + },
1.33211 + _spliceHelper: function _spliceHelper(insertPoint, insertCount, deleteCount, args, offset) {
1.33212 + return this._spliceHelper(insertPoint, insertCount, deleteCount, args, offset);
1.33213 + }
1.33214 + },
1.33215 + static: {
1.33216 + _some: function (o, callback, thisObject) {
1.33217 + return o.some(callback, thisObject);
1.33218 + },
1.33219 + _every: function (o, callback, thisObject) {
1.33220 + return o.every(callback, thisObject);
1.33221 + },
1.33222 + _forEach: function (o, callback, thisObject) {
1.33223 + return o.forEach(callback, thisObject);
1.33224 + },
1.33225 + _sort: arraySort
1.33226 + }
1.33227 + };
1.33228 + cls.vectorType = type;
1.33229 + cls.coerce = function (value) {
1.33230 + return value;
1.33231 + };
1.33232 + cls.isInstanceOf = function (value) {
1.33233 + return true;
1.33234 + };
1.33235 + cls.isInstance = function (value) {
1.33236 + if (value === null || typeof value !== 'object') {
1.33237 + return false;
1.33238 + }
1.33239 + if (!this.instanceConstructor.vectorType && value.class.vectorType) {
1.33240 + return true;
1.33241 + }
1.33242 + return this.instanceConstructor.prototype.isPrototypeOf(value);
1.33243 + };
1.33244 + return cls;
1.33245 + }
1.33246 + function NumberClass(runtime, scope, instanceConstructor, baseClass) {
1.33247 + var c = new Class('Number', Number, C(Number));
1.33248 + c.extendBuiltin(baseClass);
1.33249 + c.native = {
1.33250 + instance: Number.prototype
1.33251 + };
1.33252 + c.defaultValue = Number(0);
1.33253 + c.isInstance = function (value) {
1.33254 + return value !== null && value !== undefined && typeof value.valueOf() === 'number';
1.33255 + };
1.33256 + c.coerce = Number;
1.33257 + c.isInstanceOf = function (value) {
1.33258 + return Object(value) instanceof Number;
1.33259 + };
1.33260 + c.isInstance = function (value) {
1.33261 + return Object(value) instanceof Number;
1.33262 + };
1.33263 + return c;
1.33264 + }
1.33265 + function Int(x) {
1.33266 + return x | 0;
1.33267 + }
1.33268 + function boxedInt(x) {
1.33269 + return Object(x | 0);
1.33270 + }
1.33271 + function intClass(runtime, scope, instanceConstructor, baseClass) {
1.33272 + var c = new Class('int', boxedInt, C(Int));
1.33273 + c.extendBuiltin(baseClass);
1.33274 + c.defaultValue = 0;
1.33275 + c.coerce = Int;
1.33276 + c.isInstanceOf = function (value) {
1.33277 + return false;
1.33278 + };
1.33279 + c.isInstance = function (value) {
1.33280 + if (value instanceof Number) {
1.33281 + value = value.valueOf();
1.33282 + }
1.33283 + return (value | 0) === value;
1.33284 + };
1.33285 + return c;
1.33286 + }
1.33287 + function Uint(x) {
1.33288 + return x >>> 0;
1.33289 + }
1.33290 + function boxedUint(x) {
1.33291 + return Object(x >>> 0);
1.33292 + }
1.33293 + function uintClass(runtime, scope, instanceConstructor, baseClass) {
1.33294 + var c = new Class('uint', boxedUint, C(Uint));
1.33295 + c.extend(baseClass);
1.33296 + c.defaultValue = 0;
1.33297 + c.isInstanceOf = function (value) {
1.33298 + return false;
1.33299 + };
1.33300 + c.isInstance = function (value) {
1.33301 + if (value instanceof Number) {
1.33302 + value = value.valueOf();
1.33303 + }
1.33304 + return value >>> 0 === value;
1.33305 + };
1.33306 + c.coerce = Uint;
1.33307 + return c;
1.33308 + }
1.33309 + function MathClass(runtime, scope, instanceConstructor, baseClass) {
1.33310 + var c = new Class('Math');
1.33311 + c.native = {
1.33312 + static: Math
1.33313 + };
1.33314 + return c;
1.33315 + }
1.33316 + function DateClass(runtime, scope, instanceConstructor, baseClass) {
1.33317 + var c = new Class('Date', Date, C(Date));
1.33318 + c.extendBuiltin(baseClass);
1.33319 + c.native = {
1.33320 + instance: Date.prototype,
1.33321 + static: Date
1.33322 + };
1.33323 + return c;
1.33324 + }
1.33325 + function makeErrorClass(name) {
1.33326 + var ErrorDefinition = {
1.33327 + __glue__: {
1.33328 + script: {
1.33329 + instance: {
1.33330 + message: 'public message',
1.33331 + name: 'public name'
1.33332 + }
1.33333 + },
1.33334 + native: {
1.33335 + instance: {
1.33336 + getStackTrace: function () {
1.33337 + somewhatImplemented('Error.getStackTrace()');
1.33338 + return AVM2.getStackTrace();
1.33339 + }
1.33340 + },
1.33341 + static: {
1.33342 + getErrorMessage: getErrorMessage
1.33343 + }
1.33344 + }
1.33345 + }
1.33346 + };
1.33347 + return function (runtime, scope, instanceConstructor, baseClass) {
1.33348 + var c = new Class(name, instanceConstructor);
1.33349 + c.extend(baseClass);
1.33350 + if (name === 'Error') {
1.33351 + c.link(ErrorDefinition);
1.33352 + c.linkNatives(ErrorDefinition);
1.33353 + }
1.33354 + return c;
1.33355 + };
1.33356 + }
1.33357 + function RegExpClass(runtime, scope, instanceConstructor, baseClass) {
1.33358 + var c = new Class('RegExp', XRegExp, C(XRegExp));
1.33359 + c.extendBuiltin(baseClass);
1.33360 + RegExpClass.exec = function exec() {
1.33361 + var result = this.exec.apply(this, arguments);
1.33362 + if (!result) {
1.33363 + return result;
1.33364 + }
1.33365 + var keys = Object.keys(result);
1.33366 + for (var i = 0; i < keys.length; i++) {
1.33367 + var k = keys[i];
1.33368 + if (!isNumeric(k)) {
1.33369 + if (result[k] === undefined) {
1.33370 + result[k] = '';
1.33371 + }
1.33372 + }
1.33373 + }
1.33374 + publicizeProperties(result);
1.33375 + return result;
1.33376 + };
1.33377 + RegExpClass.test = function test() {
1.33378 + return this.exec.apply(this, arguments) !== null;
1.33379 + };
1.33380 + c.native = {
1.33381 + instance: {
1.33382 + global: {
1.33383 + get: function () {
1.33384 + return this.global;
1.33385 + }
1.33386 + },
1.33387 + source: {
1.33388 + get: function () {
1.33389 + return this.source;
1.33390 + }
1.33391 + },
1.33392 + ignoreCase: {
1.33393 + get: function () {
1.33394 + return this.ignoreCase;
1.33395 + }
1.33396 + },
1.33397 + multiline: {
1.33398 + get: function () {
1.33399 + return this.multiline;
1.33400 + }
1.33401 + },
1.33402 + lastIndex: {
1.33403 + get: function () {
1.33404 + return this.lastIndex;
1.33405 + },
1.33406 + set: function (i) {
1.33407 + this.lastIndex = i;
1.33408 + }
1.33409 + },
1.33410 + dotall: {
1.33411 + get: function () {
1.33412 + return this.dotall;
1.33413 + }
1.33414 + },
1.33415 + extended: {
1.33416 + get: function () {
1.33417 + return this.extended;
1.33418 + }
1.33419 + },
1.33420 + exec: RegExpClass.exec,
1.33421 + test: RegExpClass.test
1.33422 + }
1.33423 + };
1.33424 + return c;
1.33425 + }
1.33426 + function NamespaceClass(runtime, scope, instanceConstructor, baseClass) {
1.33427 + NativeASNamespace = function NativeASNamespace(prefixValue, uriValue) {
1.33428 + if (uriValue === undefined) {
1.33429 + uriValue = prefixValue;
1.33430 + prefixValue = undefined;
1.33431 + }
1.33432 + var prefix, uri;
1.33433 + if (prefixValue === undefined) {
1.33434 + if (uriValue === undefined) {
1.33435 + prefix = '';
1.33436 + uri = '';
1.33437 + } else if (typeof uriValue === 'object') {
1.33438 + prefix = uriValue.prefix;
1.33439 + if (uriValue instanceof ASNamespace) {
1.33440 + uri = uriValue.uri;
1.33441 + } else if (uriValue instanceof QName) {
1.33442 + uri = uriValue.uri;
1.33443 + }
1.33444 + } else {
1.33445 + uri = uriValue + '';
1.33446 + if (uri === '') {
1.33447 + prefix = '';
1.33448 + } else {
1.33449 + prefix = undefined;
1.33450 + }
1.33451 + }
1.33452 + } else {
1.33453 + if (typeof uriValue === 'object' && uriValue instanceof QName && uriValue.uri !== null) {
1.33454 + uri = uriValue.uri;
1.33455 + } else {
1.33456 + uri = uriValue + '';
1.33457 + }
1.33458 + if (uri === '') {
1.33459 + if (prefixValue === undefined || prefixValue + '' === '') {
1.33460 + prefix = '';
1.33461 + } else {
1.33462 + throw 'type error';
1.33463 + }
1.33464 + } else if (prefixValue === undefined || prefixValue === '') {
1.33465 + prefix = undefined;
1.33466 + } else if (false && !isXMLName(prefixValue)) {
1.33467 + prefix = undefined;
1.33468 + } else {
1.33469 + prefix = prefixValue + '';
1.33470 + }
1.33471 + }
1.33472 + return ASNamespace.createNamespace(uri, prefix);
1.33473 + };
1.33474 + var c = new Class('Namespace', NativeASNamespace, C(NativeASNamespace));
1.33475 + c.extendNative(baseClass, ASNamespace);
1.33476 + var Np = ASNamespace.prototype;
1.33477 + c.native = {
1.33478 + instance: {
1.33479 + prefix: {
1.33480 + get: Np.getPrefix
1.33481 + },
1.33482 + uri: {
1.33483 + get: Np.getURI
1.33484 + }
1.33485 + }
1.33486 + };
1.33487 + return c;
1.33488 + }
1.33489 + function JSONClass(runtime, scope, instanceConstructor, baseClass) {
1.33490 + function transformJSValueToAS(value) {
1.33491 + if (typeof value !== 'object') {
1.33492 + return value;
1.33493 + }
1.33494 + var keys = Object.keys(value);
1.33495 + var result = value instanceof Array ? [] : {};
1.33496 + for (var i = 0; i < keys.length; i++) {
1.33497 + result.asSetPublicProperty(keys[i], transformJSValueToAS(value[keys[i]]));
1.33498 + }
1.33499 + return result;
1.33500 + }
1.33501 + function transformASValueToJS(value) {
1.33502 + if (typeof value !== 'object') {
1.33503 + return value;
1.33504 + }
1.33505 + var keys = Object.keys(value);
1.33506 + var result = value instanceof Array ? [] : {};
1.33507 + for (var i = 0; i < keys.length; i++) {
1.33508 + var key = keys[i];
1.33509 + var jsKey = key;
1.33510 + if (!isNumeric(key)) {
1.33511 + jsKey = Multiname.getNameFromPublicQualifiedName(key);
1.33512 + }
1.33513 + result[jsKey] = transformASValueToJS(value[key]);
1.33514 + }
1.33515 + return result;
1.33516 + }
1.33517 + function ASJSON() {
1.33518 + }
1.33519 + var c = new Class('JSON', ASJSON, C(ASJSON));
1.33520 + c.extend(baseClass);
1.33521 + c.native = {
1.33522 + static: {
1.33523 + parseCore: function parseCore(text) {
1.33524 + return transformJSValueToAS(JSON.parse(text));
1.33525 + },
1.33526 + stringifySpecializedToString: function stringifySpecializedToString(value, replacerArray, replacerFunction, gap) {
1.33527 + return JSON.stringify(transformASValueToJS(value), replacerFunction, gap);
1.33528 + }
1.33529 + }
1.33530 + };
1.33531 + return c;
1.33532 + }
1.33533 + function CapabilitiesClass(runtime, scope, instanceConstructor, baseClass) {
1.33534 + function Capabilities() {
1.33535 + }
1.33536 + var c = new Class('Capabilities', Capabilities, C(Capabilities));
1.33537 + c.extend(baseClass);
1.33538 + c.native = {
1.33539 + static: {
1.33540 + playerType: {
1.33541 + get: function () {
1.33542 + return 'AVMPlus';
1.33543 + }
1.33544 + }
1.33545 + }
1.33546 + };
1.33547 + return c;
1.33548 + }
1.33549 + function FileClass(runtime, scope, instanceConstructor, baseClass) {
1.33550 + function File() {
1.33551 + }
1.33552 + var c = new Class('File', File, C(File));
1.33553 + c.extend(baseClass);
1.33554 + c.native = {
1.33555 + static: {
1.33556 + exists: function (filename) {
1.33557 + notImplemented('File.exists');
1.33558 + return false;
1.33559 + },
1.33560 + read: function (filename) {
1.33561 + return snarf(filename);
1.33562 + },
1.33563 + write: function (filename, data) {
1.33564 + notImplemented('File.write');
1.33565 + return true;
1.33566 + },
1.33567 + readByteArray: function (filename) {
1.33568 + var ByteArrayClass = AVM2.currentDomain().getClass('flash.utils.ByteArray');
1.33569 + var data = ByteArrayClass.createInstance();
1.33570 + data.writeRawBytes(snarf(filename, 'binary'));
1.33571 + return data;
1.33572 + },
1.33573 + writeByteArray: function (filename, bytes) {
1.33574 + write('bin/' + filename, bytes.getBytes());
1.33575 + return true;
1.33576 + }
1.33577 + }
1.33578 + };
1.33579 + return c;
1.33580 + }
1.33581 + function ShumwayClass(runtime, scope, instanceConstructor, baseClass) {
1.33582 + function Shumway() {
1.33583 + }
1.33584 + var c = new Class('Shumway', Shumway, C(Shumway));
1.33585 + c.extend(baseClass);
1.33586 + c.native = {
1.33587 + static: {
1.33588 + info: function (x) {
1.33589 + console.info(x);
1.33590 + },
1.33591 + json: function (x) {
1.33592 + return JSON.stringify(x);
1.33593 + },
1.33594 + eval: function (x) {
1.33595 + return eval(x);
1.33596 + },
1.33597 + debugger: function (x) {
1.33598 + debugger;
1.33599 + }
1.33600 + }
1.33601 + };
1.33602 + return c;
1.33603 + }
1.33604 + function constant(x) {
1.33605 + return function () {
1.33606 + return x;
1.33607 + };
1.33608 + }
1.33609 + function ByteArrayClass(runtime, scope, instanceConstructor, baseClass) {
1.33610 + var BA = function () {
1.33611 + ByteArray.call(this);
1.33612 + };
1.33613 + var BAp = BA.prototype = Object.create(ByteArray.prototype);
1.33614 + var c = new Class('ByteArray', BA, C(BA));
1.33615 + c.extendBuiltin(baseClass);
1.33616 + BAp.asGetNumericProperty = function (i) {
1.33617 + if (i >= this.length) {
1.33618 + return undefined;
1.33619 + }
1.33620 + return this.uint8v[i];
1.33621 + };
1.33622 + BAp.asSetNumericProperty = function (i, v) {
1.33623 + var len = i + 1;
1.33624 + this.ensureCapacity(len);
1.33625 + this.uint8v[i] = v;
1.33626 + if (len > this.length) {
1.33627 + this.length = len;
1.33628 + }
1.33629 + };
1.33630 + BAp.readUTF = function readUTF() {
1.33631 + return this.readUTFBytes(this.readShort());
1.33632 + };
1.33633 + BAp.readUTFBytes = function readUTFBytes(length) {
1.33634 + var pos = this.position;
1.33635 + if (pos + length > this.length) {
1.33636 + throwEOFError();
1.33637 + }
1.33638 + this.position += length;
1.33639 + return utf8encode(new Int8Array(this.a, pos, length));
1.33640 + };
1.33641 + BAp.writeUTF = function writeUTF(str) {
1.33642 + var bytes = utf8decode(str);
1.33643 + this.writeShort(bytes.length);
1.33644 + this.writeRawBytes(bytes);
1.33645 + };
1.33646 + BAp.writeUTFBytes = function writeUTFBytes(str) {
1.33647 + var bytes = utf8decode(str);
1.33648 + this.writeRawBytes(bytes);
1.33649 + };
1.33650 + BAp.toString = function toString() {
1.33651 + return utf8encode(new Int8Array(this.a, 0, this.length));
1.33652 + };
1.33653 + c.native = {
1.33654 + instance: {
1.33655 + length: {
1.33656 + get: function () {
1.33657 + return this.length;
1.33658 + },
1.33659 + set: function setLength(length) {
1.33660 + var cap = this.a.byteLength;
1.33661 + if (length > cap) {
1.33662 + this.ensureCapacity(length);
1.33663 + }
1.33664 + this.length = length;
1.33665 + this.position = clamp(this.position, 0, this.length);
1.33666 + }
1.33667 + },
1.33668 + bytesAvailable: {
1.33669 + get: function () {
1.33670 + return this.length - this.position;
1.33671 + }
1.33672 + },
1.33673 + position: {
1.33674 + get: function () {
1.33675 + return this.position;
1.33676 + },
1.33677 + set: function (p) {
1.33678 + this.position = p;
1.33679 + }
1.33680 + },
1.33681 + endian: {
1.33682 + get: function () {
1.33683 + return this.le ? 'littleEndian' : 'bigEndian';
1.33684 + },
1.33685 + set: function (e) {
1.33686 + this.le = e === 'littleEndian';
1.33687 + }
1.33688 + },
1.33689 + objectEncoding: {
1.33690 + get: function () {
1.33691 + return this.objectEncoding;
1.33692 + },
1.33693 + set: function (v) {
1.33694 + this.objectEncoding = v;
1.33695 + }
1.33696 + },
1.33697 + writeBytes: BAp.writeBytes,
1.33698 + writeBoolean: BAp.writeBoolean,
1.33699 + writeByte: BAp.writeByte,
1.33700 + writeShort: BAp.writeShort,
1.33701 + writeInt: BAp.writeInt,
1.33702 + writeUnsignedInt: BAp.writeUnsignedInt,
1.33703 + writeFloat: BAp.writeFloat,
1.33704 + writeDouble: BAp.writeDouble,
1.33705 + writeMultiByte: BAp.writeMultiByte,
1.33706 + writeObject: function writeObject(v) {
1.33707 + return AMFUtils.encodings[this.objectEncoding].write(this, v);
1.33708 + },
1.33709 + writeUTF: BAp.writeUTF,
1.33710 + writeUTFBytes: BAp.writeUTFBytes,
1.33711 + readBoolean: BAp.readBoolean,
1.33712 + readByte: BAp.readByte,
1.33713 + readBytes: BAp.readBytes,
1.33714 + readUnsignedByte: BAp.readUnsignedByte,
1.33715 + readShort: BAp.readShort,
1.33716 + readUnsignedShort: BAp.readUnsignedShort,
1.33717 + readInt: BAp.readInt,
1.33718 + readUnsignedInt: BAp.readUnsignedInt,
1.33719 + readFloat: BAp.readFloat,
1.33720 + readDouble: BAp.readDouble,
1.33721 + readMultiByte: BAp.readMultiByte,
1.33722 + readObject: function readObject() {
1.33723 + return AMFUtils.encodings[this.objectEncoding].read(this);
1.33724 + },
1.33725 + readUTF: BAp.readUTF,
1.33726 + readUTFBytes: BAp.readUTFBytes,
1.33727 + toString: BAp.toString,
1.33728 + clear: BAp.clear,
1.33729 + _compress: BAp.compress,
1.33730 + _uncompress: BAp.uncompress
1.33731 + },
1.33732 + static: {
1.33733 + defaultObjectEncoding: {
1.33734 + get: function () {
1.33735 + return ByteArray.DEFAULT_OBJECT_ENCODING;
1.33736 + },
1.33737 + set: function (e) {
1.33738 + ByteArray.DEFAULT_OBJECT_ENCODING = e;
1.33739 + }
1.33740 + }
1.33741 + }
1.33742 + };
1.33743 + return c;
1.33744 + }
1.33745 + function DomainClass(runtime, scope, instanceConstructor, baseClass) {
1.33746 + var c = new Class('File', instanceConstructor, C(instanceConstructor));
1.33747 + c.extend(baseClass);
1.33748 + c.native = {
1.33749 + instance: {
1.33750 + init: function (base) {
1.33751 + this.base = base;
1.33752 + this.nativeObject = new ApplicationDomain(AVM2.instance, base ? base.nativeObject : null);
1.33753 + },
1.33754 + loadBytes: function (byteArray, swfVersion) {
1.33755 + this.nativeObject.executeAbc(new AbcFile(byteArray.readRawBytes()));
1.33756 + },
1.33757 + getClass: function (className) {
1.33758 + return this.nativeObject.getClass(className);
1.33759 + }
1.33760 + },
1.33761 + static: {
1.33762 + currentDomain: {
1.33763 + get: function () {
1.33764 + var domain = Object.create(instanceConstructor.prototype);
1.33765 + domain.nativeObject = AVM2.currentDomain();
1.33766 + return domain;
1.33767 + }
1.33768 + }
1.33769 + }
1.33770 + };
1.33771 + return c;
1.33772 + }
1.33773 + function SystemClass(runtime, scope, instanceConstructor, baseClass) {
1.33774 + var c = new Class('System', instanceConstructor, C(instanceConstructor));
1.33775 + c.extend(baseClass);
1.33776 + c.native = {
1.33777 + static: {
1.33778 + swfVersion: {
1.33779 + get: function () {
1.33780 + return 19;
1.33781 + }
1.33782 + },
1.33783 + apiVersion: {
1.33784 + get: function () {
1.33785 + return 26;
1.33786 + }
1.33787 + },
1.33788 + getArgv: function () {
1.33789 + return [];
1.33790 + },
1.33791 + getRunmode: function () {
1.33792 + return 'mixed';
1.33793 + }
1.33794 + }
1.33795 + };
1.33796 + return c;
1.33797 + }
1.33798 + function bugzilla(n) {
1.33799 + switch (n) {
1.33800 + case 574600:
1.33801 + return true;
1.33802 + }
1.33803 + return false;
1.33804 + }
1.33805 + return {
1.33806 + print: constant(print),
1.33807 + notImplemented: constant(notImplemented),
1.33808 + debugBreak: constant(debugBreak),
1.33809 + bugzilla: constant(bugzilla),
1.33810 + decodeURI: constant(decodeURI),
1.33811 + decodeURIComponent: constant(decodeURIComponent),
1.33812 + encodeURI: constant(encodeURI),
1.33813 + encodeURIComponent: constant(encodeURIComponent),
1.33814 + isNaN: constant(isNaN),
1.33815 + isFinite: constant(isFinite),
1.33816 + parseInt: constant(parseInt),
1.33817 + parseFloat: constant(parseFloat),
1.33818 + escape: constant(escape),
1.33819 + unescape: constant(unescape),
1.33820 + isXMLName: constant(typeof isXMLName !== 'undefined' ? isXMLName : function () {
1.33821 + notImplemented('Chrome doesn\'t support isXMLName.');
1.33822 + }),
1.33823 + Function: Function,
1.33824 + String: String,
1.33825 + Array: Array,
1.33826 + Number: Number,
1.33827 + Boolean: Boolean,
1.33828 + Math: Math,
1.33829 + Date: Date,
1.33830 + RegExp: RegExp,
1.33831 + Object: Object,
1.33832 + ObjectClass: ObjectClass,
1.33833 + Class: ClassClass,
1.33834 + NamespaceClass: NamespaceClass,
1.33835 + FunctionClass: FunctionClass,
1.33836 + MethodClosureClass: MethodClosureClass,
1.33837 + BooleanClass: BooleanClass,
1.33838 + StringClass: StringClass,
1.33839 + NumberClass: NumberClass,
1.33840 + intClass: intClass,
1.33841 + uintClass: uintClass,
1.33842 + ArrayClass: ArrayClass,
1.33843 + VectorClass: VectorClass,
1.33844 + ObjectVectorClass: ObjectVectorClass,
1.33845 + IntVectorClass: IntVectorClass,
1.33846 + UIntVectorClass: UIntVectorClass,
1.33847 + DoubleVectorClass: DoubleVectorClass,
1.33848 + ByteArrayClass: ByteArrayClass,
1.33849 + ProxyClass: ProxyClass,
1.33850 + ErrorClass: makeErrorClass('Error'),
1.33851 + DefinitionErrorClass: makeErrorClass('DefinitionError'),
1.33852 + EvalErrorClass: makeErrorClass('EvalError'),
1.33853 + RangeErrorClass: makeErrorClass('RangeError'),
1.33854 + ReferenceErrorClass: makeErrorClass('ReferenceError'),
1.33855 + SecurityErrorClass: makeErrorClass('SecurityError'),
1.33856 + SyntaxErrorClass: makeErrorClass('SyntaxError'),
1.33857 + TypeErrorClass: makeErrorClass('TypeError'),
1.33858 + URIErrorClass: makeErrorClass('URIError'),
1.33859 + VerifyErrorClass: makeErrorClass('VerifyError'),
1.33860 + UninitializedErrorClass: makeErrorClass('UninitializedError'),
1.33861 + ArgumentErrorClass: makeErrorClass('ArgumentError'),
1.33862 + DateClass: DateClass,
1.33863 + MathClass: MathClass,
1.33864 + RegExpClass: RegExpClass,
1.33865 + DictionaryClass: DictionaryClass,
1.33866 + XMLClass: XMLClass,
1.33867 + XMLListClass: XMLListClass,
1.33868 + QNameClass: QNameClass,
1.33869 + JSONClass: JSONClass,
1.33870 + ShumwayClass: ShumwayClass,
1.33871 + CapabilitiesClass: CapabilitiesClass,
1.33872 + FileClass: FileClass,
1.33873 + DomainClass: DomainClass,
1.33874 + SystemClass: SystemClass,
1.33875 + getQualifiedClassName: constant(function (value) {
1.33876 + if (value === null) {
1.33877 + return 'null';
1.33878 + } else if (value === undefined) {
1.33879 + return 'void';
1.33880 + }
1.33881 + switch (typeof value) {
1.33882 + case 'number':
1.33883 + if ((value | 0) === value) {
1.33884 + return 'int';
1.33885 + }
1.33886 + return 'Number';
1.33887 + case 'string':
1.33888 + return 'String';
1.33889 + case 'boolean':
1.33890 + return 'Boolean';
1.33891 + case 'object':
1.33892 + if (value instanceof Date) {
1.33893 + return 'Date';
1.33894 + }
1.33895 + var cls;
1.33896 + if (value instanceof Class) {
1.33897 + cls = value;
1.33898 + } else if (value.class) {
1.33899 + cls = value.class;
1.33900 + } else if (value.classInfo) {
1.33901 + cls = value;
1.33902 + }
1.33903 + if (cls) {
1.33904 + var name = cls.classInfo.instanceInfo.name;
1.33905 + var uri = name.namespaces[0].uri;
1.33906 + if (uri) {
1.33907 + return uri + '::' + name.name;
1.33908 + }
1.33909 + return name.name;
1.33910 + }
1.33911 + break;
1.33912 + }
1.33913 + return notImplemented(value + ' (' + typeof value + ')');
1.33914 + }),
1.33915 + getQualifiedSuperclassName: constant(function (value) {
1.33916 + switch (typeof value) {
1.33917 + case 'number':
1.33918 + case 'string':
1.33919 + case 'boolean':
1.33920 + return 'Object';
1.33921 + case 'function':
1.33922 + return 'Function';
1.33923 + case 'object':
1.33924 + if (value instanceof Date) {
1.33925 + return 'Object';
1.33926 + }
1.33927 + var cls;
1.33928 + if (value.class) {
1.33929 + cls = value.class;
1.33930 + } else if (value.classInfo) {
1.33931 + cls = value;
1.33932 + }
1.33933 + if (cls && cls.baseClass) {
1.33934 + var name = cls.baseClass.classInfo.instanceInfo.name;
1.33935 + var uri = name.namespaces[0].uri;
1.33936 + if (uri) {
1.33937 + return uri + '::' + name.name;
1.33938 + }
1.33939 + return name.name;
1.33940 + }
1.33941 + return 'Object';
1.33942 + }
1.33943 + return notImplemented(value + ' (superOf ' + typeof value + ')');
1.33944 + }),
1.33945 + getDefinitionByName: constant(function (name) {
1.33946 + var simpleName = String(name).replace('::', '.');
1.33947 + return AVM2.currentDomain().getClass(simpleName);
1.33948 + }),
1.33949 + describeTypeJSON: constant(describeTypeJSON),
1.33950 + original: jsGlobal[VM_NATIVE_BUILTIN_ORIGINALS]
1.33951 + };
1.33952 + function describeTypeJSON(o, flags) {
1.33953 + var Flags = {
1.33954 + HIDE_NSURI_METHODS: 1,
1.33955 + INCLUDE_BASES: 2,
1.33956 + INCLUDE_INTERFACES: 4,
1.33957 + INCLUDE_VARIABLES: 8,
1.33958 + INCLUDE_ACCESSORS: 16,
1.33959 + INCLUDE_METHODS: 32,
1.33960 + INCLUDE_METADATA: 64,
1.33961 + INCLUDE_CONSTRUCTOR: 128,
1.33962 + INCLUDE_TRAITS: 256,
1.33963 + USE_ITRAITS: 512,
1.33964 + HIDE_OBJECT: 1024
1.33965 + };
1.33966 + var declaredByKey = publicName('declaredBy');
1.33967 + var metadataKey = publicName('metadata');
1.33968 + var accessKey = publicName('access');
1.33969 + var uriKey = publicName('uri');
1.33970 + var nameKey = publicName('name');
1.33971 + var typeKey = publicName('type');
1.33972 + var returnTypeKey = publicName('returnType');
1.33973 + var valueKey = publicName('value');
1.33974 + var keyKey = publicName('key');
1.33975 + var parametersKey = publicName('parameters');
1.33976 + var optionalKey = publicName('optional');
1.33977 + var cls = o.classInfo ? o : Object.getPrototypeOf(o).class;
1.33978 + true;
1.33979 + var info = cls.classInfo;
1.33980 + var description = {};
1.33981 + description[nameKey] = unmangledQualifiedName(info.instanceInfo.name);
1.33982 + description[publicName('isDynamic')] = cls === o ? true : !(info.instanceInfo.flags & CONSTANT_ClassSealed);
1.33983 + description[publicName('isStatic')] = cls === o;
1.33984 + description[publicName('isFinal')] = cls === o ? true : !(info.instanceInfo.flags & CONSTANT_ClassFinal);
1.33985 + if (flags & Flags.INCLUDE_TRAITS) {
1.33986 + description[publicName('traits')] = addTraits(cls, flags);
1.33987 + }
1.33988 + var metadata = null;
1.33989 + if (info.metadata) {
1.33990 + metadata = Object.keys(info.metadata).map(function (key) {
1.33991 + return describeMetadata(info.metadata[key]);
1.33992 + });
1.33993 + }
1.33994 + description[metadataKey] = metadata;
1.33995 + return description;
1.33996 + function publicName(str) {
1.33997 + return Multiname.getPublicQualifiedName(str);
1.33998 + }
1.33999 + function unmangledQualifiedName(mn) {
1.34000 + var name = mn.name;
1.34001 + var namespace = mn.namespaces[0];
1.34002 + if (namespace && namespace.uri) {
1.34003 + return namespace.uri + '::' + name;
1.34004 + }
1.34005 + return name;
1.34006 + }
1.34007 + function describeMetadata(metadata) {
1.34008 + var result = {};
1.34009 + result[nameKey] = metadata.name;
1.34010 + result[valueKey] = metadata.value.map(function (value) {
1.34011 + var val = {};
1.34012 + val[keyKey] = value.key;
1.34013 + val[valueKey] = value.value;
1.34014 + return value;
1.34015 + });
1.34016 + return result;
1.34017 + }
1.34018 + function addTraits(cls, flags) {
1.34019 + var includedMembers = [
1.34020 + flags & Flags.INCLUDE_VARIABLES,
1.34021 + flags & Flags.INCLUDE_METHODS,
1.34022 + flags & Flags.INCLUDE_ACCESSORS,
1.34023 + flags & Flags.INCLUDE_ACCESSORS
1.34024 + ];
1.34025 + var includeBases = flags & Flags.INCLUDE_BASES;
1.34026 + var includeMetadata = flags & Flags.INCLUDE_METADATA;
1.34027 + var obj = {};
1.34028 + var basesVal = obj[publicName('bases')] = includeBases ? [] : null;
1.34029 + if (flags & Flags.INCLUDE_INTERFACES) {
1.34030 + var interfacesVal = obj[publicName('interfaces')] = [];
1.34031 + if (flags & Flags.USE_ITRAITS) {
1.34032 + for (var key in cls.implementedInterfaces) {
1.34033 + var ifaceName = cls.implementedInterfaces[key].name;
1.34034 + interfacesVal.push(unmangledQualifiedName(ifaceName));
1.34035 + }
1.34036 + }
1.34037 + } else {
1.34038 + obj[publicName('interfaces')] = null;
1.34039 + }
1.34040 + var variablesVal = obj[publicName('variables')] = flags & Flags.INCLUDE_VARIABLES ? [] : null;
1.34041 + var accessorsVal = obj[publicName('accessors')] = flags & Flags.INCLUDE_ACCESSORS ? [] : null;
1.34042 + var methodsVal = obj[publicName('methods')] = flags & Flags.INCLUDE_METHODS ? [] : null;
1.34043 + var encounteredAccessors = {};
1.34044 + var addBase = false;
1.34045 + while (cls) {
1.34046 + var className = unmangledQualifiedName(cls.classInfo.instanceInfo.name);
1.34047 + if (includeBases && addBase) {
1.34048 + basesVal.push(className);
1.34049 + } else {
1.34050 + addBase = true;
1.34051 + }
1.34052 + if (flags & Flags.USE_ITRAITS) {
1.34053 + describeTraits(cls.classInfo.instanceInfo.traits);
1.34054 + } else {
1.34055 + describeTraits(cls.classInfo.traits);
1.34056 + }
1.34057 + cls = cls.baseClass;
1.34058 + }
1.34059 + function describeTraits(traits) {
1.34060 + true;
1.34061 + for (var i = 0; traits && i < traits.length; i++) {
1.34062 + var t = traits[i];
1.34063 + if (!includedMembers[t.kind] || !t.name.getNamespace().isPublic() && !t.name.uri) {
1.34064 + continue;
1.34065 + }
1.34066 + var name = unmangledQualifiedName(t.name);
1.34067 + if (encounteredAccessors[name]) {
1.34068 + var val = encounteredAccessors[name];
1.34069 + val[accessKey] = 'readwrite';
1.34070 + if (t.kind === TRAIT_Getter) {
1.34071 + val[typeKey] = unmangledQualifiedName(t.methodInfo.returnType);
1.34072 + }
1.34073 + continue;
1.34074 + }
1.34075 + var val = {};
1.34076 + if (includeMetadata && t.metadata) {
1.34077 + var metadataVal = val[metadataKey] = [];
1.34078 + for (var key in t.metadata) {
1.34079 + metadataVal.push(describeMetadata(t.metadata[key]));
1.34080 + }
1.34081 + } else {
1.34082 + val[metadataKey] = null;
1.34083 + }
1.34084 + val[declaredByKey] = className;
1.34085 + val[uriKey] = t.name.uri === undefined ? null : t.name.uri;
1.34086 + val[nameKey] = name;
1.34087 + if (!t.typeName && !(t.methodInfo && t.methodInfo.returnType)) {
1.34088 + continue;
1.34089 + }
1.34090 + val[t.kind === TRAIT_Method ? returnTypeKey : typeKey] = unmangledQualifiedName(t.kind === TRAIT_Slot ? t.typeName : t.methodInfo.returnType);
1.34091 + switch (t.kind) {
1.34092 + case TRAIT_Slot:
1.34093 + val[accessKey] = 'readwrite';
1.34094 + variablesVal.push(val);
1.34095 + break;
1.34096 + case TRAIT_Method:
1.34097 + var parametersVal = val[parametersKey] = [];
1.34098 + var parameters = t.methodInfo.parameters;
1.34099 + for (var j = 0; j < parameters.length; j++) {
1.34100 + var param = parameters[j];
1.34101 + var paramVal = {};
1.34102 + paramVal[typeKey] = param.type ? unmangledQualifiedName(param.type) : '*';
1.34103 + paramVal[optionalKey] = 'value' in param;
1.34104 + parametersVal.push(paramVal);
1.34105 + }
1.34106 + methodsVal.push(val);
1.34107 + break;
1.34108 + case TRAIT_Getter:
1.34109 + case TRAIT_Setter:
1.34110 + val[accessKey] = t.kind === TRAIT_Getter ? 'read' : 'write';
1.34111 + accessorsVal.push(val);
1.34112 + encounteredAccessors[name] = val;
1.34113 + break;
1.34114 + default:
1.34115 + break;
1.34116 + }
1.34117 + }
1.34118 + }
1.34119 + return obj;
1.34120 + }
1.34121 + }
1.34122 + }();
1.34123 +function getNative(path) {
1.34124 + var chain = path.split('.');
1.34125 + var v = natives;
1.34126 + for (var i = 0, j = chain.length; i < j; i++) {
1.34127 + v = v && v[chain[i]];
1.34128 + }
1.34129 + true;
1.34130 + return v;
1.34131 +}
1.34132 +var disassemblerOptions = systemOptions.register(new OptionSet('Disassembler Options'));
1.34133 +var filter = disassemblerOptions.register(new Option('f', 'filter', 'string', 'SpciMsmNtu', '[S]ource, constant[p]ool, [c]lasses, [i]nstances, [M]etadata, [s]cripts, [m]ethods, multi[N]ames, S[t]atistics, [u]tf'));
1.34134 +function traceArray(writer, name, array, abc) {
1.34135 + if (array.length === 0) {
1.34136 + return;
1.34137 + }
1.34138 + writer.enter(name + ' {');
1.34139 + array.forEach(function (a, idx) {
1.34140 + a.trace(writer, abc);
1.34141 + });
1.34142 + writer.leave('}');
1.34143 +}
1.34144 +AbcFile.prototype.trace = function trace(writer) {
1.34145 + if (filter.value.indexOf('p') >= 0) {
1.34146 + this.constantPool.trace(writer);
1.34147 + }
1.34148 + if (filter.value.indexOf('N') >= 0) {
1.34149 + this.constantPool.traceMultinamesOnly(writer);
1.34150 + }
1.34151 + if (filter.value.indexOf('c') >= 0) {
1.34152 + traceArray(writer, 'classes', this.classes);
1.34153 + }
1.34154 + if (filter.value.indexOf('i') >= 0) {
1.34155 + traceArray(writer, 'instances', this.instances);
1.34156 + }
1.34157 + if (filter.value.indexOf('M') >= 0) {
1.34158 + traceArray(writer, 'metadata', this.metadata);
1.34159 + }
1.34160 + if (filter.value.indexOf('s') >= 0) {
1.34161 + traceArray(writer, 'scripts', this.scripts);
1.34162 + }
1.34163 + if (filter.value.indexOf('m') >= 0) {
1.34164 + traceArray(writer, 'methods', this.methods, this);
1.34165 + }
1.34166 + if (filter.value.indexOf('S') >= 0) {
1.34167 + traceSource(writer, this);
1.34168 + }
1.34169 + if (filter.value.indexOf('t') >= 0) {
1.34170 + traceStatistics(writer, this);
1.34171 + }
1.34172 + if (filter.value.indexOf('u') >= 0) {
1.34173 + print(JSON.stringify({
1.34174 + strings: this.constantPool.strings,
1.34175 + positionAfterUTFStrings: this.constantPool.positionAfterUTFStrings
1.34176 + }, null, 2));
1.34177 + }
1.34178 +};
1.34179 +ConstantPool.prototype.trace = function (writer) {
1.34180 + writer.enter('constantPool {');
1.34181 + for (var key in this) {
1.34182 + if (key === 'namespaces') {
1.34183 + writer.enter('namespaces {');
1.34184 + this.namespaces.forEach(function (ns, i) {
1.34185 + writer.writeLn(('' + i).padRight(' ', 3) + (ns ? ns.toString() : '*'));
1.34186 + });
1.34187 + writer.leave('}');
1.34188 + } else if (this[key] instanceof Array) {
1.34189 + writer.enter(key + ' ' + this[key].length + ' {');
1.34190 + writer.writeArray(this[key]);
1.34191 + writer.leave('}');
1.34192 + }
1.34193 + }
1.34194 + writer.leave('}');
1.34195 +};
1.34196 +ConstantPool.prototype.traceMultinamesOnly = function (writer) {
1.34197 + writer.writeArray(this.multinames, null, true);
1.34198 +};
1.34199 +ClassInfo.prototype.trace = function (writer) {
1.34200 + writer.enter('class ' + this + ' {');
1.34201 + traceArray(writer, 'traits', this.traits);
1.34202 + writer.leave('}');
1.34203 +};
1.34204 +MetaDataInfo.prototype.trace = function (writer) {
1.34205 + writer.enter(this + ' {');
1.34206 + this.value.forEach(function (item) {
1.34207 + writer.writeLn((item.key ? item.key + ': ' : '') + '"' + item.value + '"');
1.34208 + });
1.34209 + writer.leave('}');
1.34210 +};
1.34211 +InstanceInfo.prototype.trace = function (writer) {
1.34212 + writer.enter('instance ' + this + ' {');
1.34213 + traceArray(writer, 'traits', this.traits);
1.34214 + writer.leave('}');
1.34215 +};
1.34216 +ScriptInfo.prototype.trace = function (writer) {
1.34217 + writer.enter('script ' + this + ' {');
1.34218 + traceArray(writer, 'traits', this.traits);
1.34219 + writer.leave('}');
1.34220 +};
1.34221 +Trait.prototype.trace = function (writer) {
1.34222 + if (this.metadata) {
1.34223 + for (var key in this.metadata) {
1.34224 + if (this.metadata.hasOwnProperty(key)) {
1.34225 + this.metadata[key].trace(writer);
1.34226 + }
1.34227 + }
1.34228 + }
1.34229 + writer.writeLn(this);
1.34230 +};
1.34231 +function traceAbc(writer, abc) {
1.34232 + abc.trace(writer);
1.34233 +}
1.34234 +function traceOperand(operand, abc, code) {
1.34235 + var value = 0;
1.34236 + switch (operand.size) {
1.34237 + case 's08':
1.34238 + value = code.readS8();
1.34239 + break;
1.34240 + case 'u08':
1.34241 + value = code.readU8();
1.34242 + break;
1.34243 + case 's16':
1.34244 + value = code.readS16();
1.34245 + break;
1.34246 + case 's24':
1.34247 + value = code.readS24();
1.34248 + break;
1.34249 + case 'u30':
1.34250 + value = code.readU30();
1.34251 + break;
1.34252 + case 'u32':
1.34253 + value = code.readU32();
1.34254 + break;
1.34255 + default:
1.34256 + true;
1.34257 + break;
1.34258 + }
1.34259 + var description = '';
1.34260 + switch (operand.type) {
1.34261 + case '':
1.34262 + break;
1.34263 + case 'I':
1.34264 + description = abc.constantPool.ints[value];
1.34265 + break;
1.34266 + case 'U':
1.34267 + description = abc.constantPool.uints[value];
1.34268 + break;
1.34269 + case 'D':
1.34270 + description = abc.constantPool.doubles[value];
1.34271 + break;
1.34272 + case 'S':
1.34273 + description = abc.constantPool.strings[value];
1.34274 + break;
1.34275 + case 'N':
1.34276 + description = abc.constantPool.namespaces[value];
1.34277 + break;
1.34278 + case 'CI':
1.34279 + description = abc.classes[value];
1.34280 + break;
1.34281 + case 'M':
1.34282 + return abc.constantPool.multinames[value];
1.34283 + default:
1.34284 + description = '?';
1.34285 + break;
1.34286 + }
1.34287 + return operand.name + ':' + value + (description === '' ? '' : ' (' + description + ')');
1.34288 +}
1.34289 +function traceOperands(opcode, abc, code, rewind) {
1.34290 + rewind = rewind || false;
1.34291 + var old = code.position;
1.34292 + var str = '';
1.34293 + if (opcode.operands === null) {
1.34294 + str = 'null';
1.34295 + } else {
1.34296 + opcode.operands.forEach(function (op, i) {
1.34297 + str += traceOperand(op, abc, code);
1.34298 + if (i < opcode.operands.length - 1) {
1.34299 + str += ', ';
1.34300 + }
1.34301 + });
1.34302 + }
1.34303 + if (rewind) {
1.34304 + code.seek(old);
1.34305 + }
1.34306 + return str;
1.34307 +}
1.34308 +MethodInfo.prototype.trace = function trace(writer) {
1.34309 + var abc = this.abc;
1.34310 + writer.enter('method' + (this.name ? ' ' + this.name : '') + ' {');
1.34311 + writer.writeLn('flags: ' + getFlags(this.flags, 'NEED_ARGUMENTS|NEED_ACTIVATION|NEED_REST|HAS_OPTIONAL||NATIVE|SET_DXN|HAS_PARAM_NAMES'.split('|')));
1.34312 + writer.writeLn('parameters: ' + this.parameters.map(function (x) {
1.34313 + return (x.type ? Multiname.getQualifiedName(x.type) + '::' : '') + x.name;
1.34314 + }));
1.34315 + if (!this.code) {
1.34316 + writer.leave('}');
1.34317 + return;
1.34318 + }
1.34319 + var code = new AbcStream(this.code);
1.34320 + traceArray(writer, 'traits', this.traits);
1.34321 + writer.enter('code {');
1.34322 + while (code.remaining() > 0) {
1.34323 + var bc = code.readU8();
1.34324 + var opcode = opcodeTable[bc];
1.34325 + var str, defaultOffset, offset, count;
1.34326 + str = ('' + code.position).padRight(' ', 6);
1.34327 + switch (bc) {
1.34328 + case OP_lookupswitch:
1.34329 + str += opcode.name + ': defaultOffset: ' + code.readS24();
1.34330 + var caseCount = code.readU30();
1.34331 + str += ', caseCount: ' + caseCount;
1.34332 + for (var i = 0; i < caseCount + 1; i++) {
1.34333 + str += ' offset: ' + code.readS24();
1.34334 + }
1.34335 + writer.writeLn(str);
1.34336 + break;
1.34337 + default:
1.34338 + if (opcode) {
1.34339 + str += opcode.name.padRight(' ', 20);
1.34340 + if (!opcode.operands) {
1.34341 + true;
1.34342 + } else {
1.34343 + if (opcode.operands.length > 0) {
1.34344 + str += traceOperands(opcode, abc, code);
1.34345 + }
1.34346 + writer.writeLn(str);
1.34347 + }
1.34348 + } else {
1.34349 + true;
1.34350 + }
1.34351 + break;
1.34352 + }
1.34353 + }
1.34354 + writer.leave('}');
1.34355 + writer.leave('}');
1.34356 +};
1.34357 +var SourceTracer = function () {
1.34358 + function literal(value) {
1.34359 + if (value === undefined) {
1.34360 + return 'undefined';
1.34361 + } else if (value === null) {
1.34362 + return 'null';
1.34363 + } else if (typeof value === 'string') {
1.34364 + return '"' + value + '"';
1.34365 + } else {
1.34366 + return String(value);
1.34367 + }
1.34368 + }
1.34369 + function getSignature(mi, excludeTypesAndDefaultValues) {
1.34370 + return mi.parameters.map(function (x) {
1.34371 + var str = x.name;
1.34372 + if (!excludeTypesAndDefaultValues) {
1.34373 + if (x.type) {
1.34374 + str += ':' + x.type.getName();
1.34375 + }
1.34376 + if (x.value !== undefined) {
1.34377 + str += ' = ' + literal(x.value);
1.34378 + }
1.34379 + }
1.34380 + return str;
1.34381 + }).join(', ');
1.34382 + }
1.34383 + function SourceTracer(writer) {
1.34384 + this.writer = writer;
1.34385 + }
1.34386 + SourceTracer.prototype = {
1.34387 + traceTraits: function traceTraits(traits, isStatic, inInterfaceNamespace) {
1.34388 + var writer = this.writer;
1.34389 + var tracer = this;
1.34390 + traits.forEach(function (trait) {
1.34391 + var str;
1.34392 + var accessModifier = Multiname.getAccessModifier(trait.name);
1.34393 + var namespaceName = trait.name.namespaces[0].uri;
1.34394 + if (namespaceName) {
1.34395 + if (namespaceName === 'http://adobe.com/AS3/2006/builtin') {
1.34396 + namespaceName = 'AS3';
1.34397 + }
1.34398 + if (accessModifier === 'public') {
1.34399 + str = inInterfaceNamespace === namespaceName ? '' : namespaceName;
1.34400 + } else {
1.34401 + str = accessModifier;
1.34402 + }
1.34403 + } else {
1.34404 + str = accessModifier;
1.34405 + }
1.34406 + if (isStatic) {
1.34407 + str += ' static';
1.34408 + }
1.34409 + if (trait.isSlot() || trait.isConst()) {
1.34410 + tracer.traceMetadata(trait.metadata);
1.34411 + if (trait.isConst()) {
1.34412 + str += ' const';
1.34413 + } else {
1.34414 + str += ' var';
1.34415 + }
1.34416 + str += ' ' + trait.name.getName();
1.34417 + if (trait.typeName) {
1.34418 + str += ':' + trait.typeName.getName();
1.34419 + }
1.34420 + if (trait.value) {
1.34421 + str += ' = ' + literal(trait.value);
1.34422 + }
1.34423 + writer.writeLn(str + ';');
1.34424 + } else if (trait.isMethod() || trait.isGetter() || trait.isSetter()) {
1.34425 + tracer.traceMetadata(trait.metadata);
1.34426 + var mi = trait.methodInfo;
1.34427 + if (trait.attributes & ATTR_Override) {
1.34428 + str += ' override';
1.34429 + }
1.34430 + if (mi.isNative()) {
1.34431 + str += ' native';
1.34432 + }
1.34433 + str += ' function';
1.34434 + str += trait.isGetter() ? ' get' : trait.isSetter() ? ' set' : '';
1.34435 + str += ' ' + trait.name.getName();
1.34436 + str += '(' + getSignature(mi) + ')';
1.34437 + str += mi.returnType ? ':' + mi.returnType.getName() : '';
1.34438 + if (true) {
1.34439 + var className;
1.34440 + var prefix = '';
1.34441 + if (trait.holder instanceof ClassInfo) {
1.34442 + className = trait.holder.instanceInfo.name;
1.34443 + if (className.namespaces[0].uri) {
1.34444 + prefix += className.namespaces[0].uri + '::';
1.34445 + }
1.34446 + prefix += className.getName();
1.34447 + prefix += '$/';
1.34448 + } else if (trait.holder instanceof InstanceInfo) {
1.34449 + className = trait.holder.name;
1.34450 + if (className.namespaces[0].uri) {
1.34451 + prefix += className.namespaces[0].uri + '::';
1.34452 + }
1.34453 + prefix += className.getName();
1.34454 + prefix += '/';
1.34455 + } else {
1.34456 + prefix = 'global/';
1.34457 + }
1.34458 + var getSet = trait.isGetter() ? 'get ' : trait.isSetter() ? 'set ' : '';
1.34459 + if (!mi.isNative()) {
1.34460 + }
1.34461 + }
1.34462 + if (mi.isNative()) {
1.34463 + writer.writeLn(str + ';');
1.34464 + } else {
1.34465 + if (inInterfaceNamespace) {
1.34466 + writer.writeLn(str + ';');
1.34467 + } else {
1.34468 + writer.writeLn(str + ' { notImplemented("' + trait.name.getName() + '"); }');
1.34469 + }
1.34470 + }
1.34471 + } else if (trait.isClass()) {
1.34472 + var className = trait.classInfo.instanceInfo.name;
1.34473 + writer.enter('package ' + className.namespaces[0].uri + ' {\n');
1.34474 + tracer.traceMetadata(trait.metadata);
1.34475 + tracer.traceClass(trait.classInfo);
1.34476 + writer.leave('\n}');
1.34477 + tracer.traceClassStub(trait);
1.34478 + } else {
1.34479 + notImplemented();
1.34480 + }
1.34481 + });
1.34482 + },
1.34483 + traceClassStub2: function traceClassStub(trait) {
1.34484 + var writer = this.writer;
1.34485 + var ci = trait.classInfo;
1.34486 + var ii = ci.instanceInfo;
1.34487 + var name = ii.name.getName();
1.34488 + var native = trait.metadata ? trait.metadata.native : null;
1.34489 + if (!native) {
1.34490 + return false;
1.34491 + }
1.34492 + writer.writeLn('Cut and paste the following into `native.js\' and edit accordingly');
1.34493 + writer.writeLn('8< --------------------------------------------------------------');
1.34494 + writer.enter('natives.' + native.cls + ' = function ' + native.cls + '(runtime, scope, instanceConstructor, baseClass) {');
1.34495 + writer.writeLn('var c = new Class("' + name + '", instanceConstructor, ApplicationDomain.passthroughCallable(instanceConstructor));');
1.34496 + writer.writeLn('c.extend(baseClass);\n');
1.34497 + function traceTraits(traits, isStatic) {
1.34498 + var nativeMethodTraits = [];
1.34499 + traits.forEach(function (trait, i) {
1.34500 + if (trait.isMethod() || trait.isGetter() || trait.isSetter()) {
1.34501 + if (trait.methodInfo.isNative()) {
1.34502 + nativeMethodTraits.push(trait);
1.34503 + }
1.34504 + }
1.34505 + });
1.34506 + nativeMethodTraits.forEach(function (trait, i) {
1.34507 + var mi = trait.methodInfo;
1.34508 + var traitName = trait.name.getName();
1.34509 + writer.writeLn('// ' + traitName + ' :: ' + (mi.parameters.length ? getSignature(mi) : 'void') + ' -> ' + (mi.returnType ? mi.returnType.getName() : 'any'));
1.34510 + var prop;
1.34511 + if (trait.isGetter()) {
1.34512 + prop = '"get ' + traitName + '"';
1.34513 + } else if (trait.isSetter()) {
1.34514 + prop = '"set ' + traitName + '"';
1.34515 + } else {
1.34516 + prop = traitName;
1.34517 + }
1.34518 + writer.enter(prop + ': function ' + traitName + '(' + getSignature(mi, true) + ') {');
1.34519 + writer.writeLn(' notImplemented("' + name + '.' + traitName + '");');
1.34520 + writer.leave('}' + (i === nativeMethodTraits.length - 1 ? '' : ',\n'));
1.34521 + });
1.34522 + }
1.34523 + writer.enter('c.nativeStatics = {');
1.34524 + traceTraits(ci.traits, true);
1.34525 + writer.leave('};\n');
1.34526 + writer.enter('c.nativeMethods = {');
1.34527 + traceTraits(ii.traits);
1.34528 + writer.leave('};\n');
1.34529 + writer.writeLn('return c;');
1.34530 + writer.leave('};');
1.34531 + writer.writeLn('-------------------------------------------------------------- >8');
1.34532 + return true;
1.34533 + },
1.34534 + traceClassStub: function traceClassStub(trait) {
1.34535 + var writer = this.writer;
1.34536 + var ci = trait.classInfo;
1.34537 + var ii = ci.instanceInfo;
1.34538 + var className = ii.name.getName();
1.34539 + var native = trait.metadata ? trait.metadata.native : null;
1.34540 + writer.writeLn('Cut and paste the following glue and edit accordingly.');
1.34541 + writer.writeLn('Class ' + ii);
1.34542 + writer.writeLn('8< --------------------------------------------------------------');
1.34543 + var uri = ii.name.namespaces[0].uri;
1.34544 + writer.enter('var ' + className + 'Definition = (function () {');
1.34545 + function maxTraitNameLength(traits) {
1.34546 + var length = 0;
1.34547 + traits.forEach(function (t) {
1.34548 + length = Math.max(t.name.name.length, length);
1.34549 + });
1.34550 + return length;
1.34551 + }
1.34552 + function quote(s) {
1.34553 + return '\'' + s + '\'';
1.34554 + }
1.34555 + function filterTraits(traits, isNative) {
1.34556 + function isMethod(x) {
1.34557 + return x.isMethod() || x.isGetter() || x.isSetter();
1.34558 + }
1.34559 + return {
1.34560 + properties: traits.filter(function (trait) {
1.34561 + return !isNative && !isMethod(trait);
1.34562 + }),
1.34563 + methods: traits.filter(function (trait) {
1.34564 + return isMethod(trait) && isNative === trait.methodInfo.isNative();
1.34565 + })
1.34566 + };
1.34567 + }
1.34568 + function writeTraits(traits, isNative, isStatic) {
1.34569 + traits = filterTraits(traits, isNative);
1.34570 + var methods = [];
1.34571 + var gettersAndSetters = createEmptyObject();
1.34572 + traits.methods.forEach(function (trait, i) {
1.34573 + var traitName = trait.name.getName();
1.34574 + if (trait.isGetter() || trait.isSetter()) {
1.34575 + if (!gettersAndSetters[traitName]) {
1.34576 + gettersAndSetters[traitName] = [];
1.34577 + }
1.34578 + gettersAndSetters[traitName].push(trait);
1.34579 + } else {
1.34580 + methods.push(trait);
1.34581 + }
1.34582 + });
1.34583 + function writeTrait(trait, writeComma) {
1.34584 + var mi = trait.methodInfo;
1.34585 + var traitName = trait.name.getName();
1.34586 + var signature = '// (' + (mi.parameters.length ? getSignature(mi) : 'void') + ') -> ' + (mi.returnType ? mi.returnType.getName() : 'any');
1.34587 + var propertyName = traitName;
1.34588 + if (trait.isGetter()) {
1.34589 + propertyName = 'get';
1.34590 + } else if (trait.isSetter()) {
1.34591 + propertyName = 'set';
1.34592 + }
1.34593 + writer.enter(propertyName + ': function ' + traitName + '(' + getSignature(mi, true) + ') { ' + signature);
1.34594 + writer.writeLn('notImplemented("' + className + '.' + traitName + '");');
1.34595 + if (!isStatic) {
1.34596 + if (trait.isGetter()) {
1.34597 + writer.writeLn('return this._' + traitName + ';');
1.34598 + } else if (trait.isSetter()) {
1.34599 + writer.writeLn('this._' + traitName + ' = ' + mi.parameters[0].name + ';');
1.34600 + }
1.34601 + }
1.34602 + writer.leave('}' + (writeComma ? ',' : ''));
1.34603 + }
1.34604 + for (var i = 0; i < methods.length; i++) {
1.34605 + writeTrait(methods[i], i < methods.length - 1);
1.34606 + }
1.34607 + var keyValues = toKeyValueArray(gettersAndSetters);
1.34608 + for (var j = 0; j < keyValues.length; j++) {
1.34609 + writer.enter(keyValues[j][0] + ': {');
1.34610 + var list = keyValues[j][1];
1.34611 + for (var i = 0; i < list.length; i++) {
1.34612 + writeTrait(list[i], i < list.length - 1);
1.34613 + }
1.34614 + writer.leave('}' + (j < keyValues.length - 1 ? ',' : ''));
1.34615 + }
1.34616 + traits.properties.forEach(function (trait, i) {
1.34617 + var traitName = trait.name.getName();
1.34618 + var last = i === traits.properties.length - 1;
1.34619 + if (trait.name.getNamespace().isPublic()) {
1.34620 + writer.writeLn(traitName + ': ' + quote('public ' + trait.name.name) + (last ? '' : ','));
1.34621 + }
1.34622 + });
1.34623 + }
1.34624 + writer.enter('return {');
1.34625 + writer.writeLn('// (' + getSignature(ii.init, false) + ')');
1.34626 + writer.writeLn('__class__: "' + uri + '.' + className + '",');
1.34627 + writer.enter('initialize: function () {');
1.34628 + writer.leave('},');
1.34629 + writer.enter('__glue__: {');
1.34630 + writer.enter('native: {');
1.34631 + writer.enter('static: {');
1.34632 + writeTraits(ci.traits, true, true);
1.34633 + writer.leave('},');
1.34634 + writer.enter('instance: {');
1.34635 + writeTraits(ii.traits, true);
1.34636 + writer.leave('}');
1.34637 + writer.leave('},');
1.34638 + writer.enter('script: {');
1.34639 + writer.writeLn('instance: Glue.ALL');
1.34640 + writer.leave('}');
1.34641 + writer.leave('}');
1.34642 + writer.leave('};');
1.34643 + writer.leave('}).call(this);');
1.34644 + writer.writeLn('-------------------------------------------------------------- >8');
1.34645 + return true;
1.34646 + },
1.34647 + traceClass: function traceClass(ci) {
1.34648 + var writer = this.writer;
1.34649 + var ii = ci.instanceInfo;
1.34650 + var name = ii.name;
1.34651 + var str = Multiname.getAccessModifier(name);
1.34652 + if (ii.isFinal()) {
1.34653 + str += ' final';
1.34654 + }
1.34655 + if (!ii.isSealed()) {
1.34656 + str += ' dynamic';
1.34657 + }
1.34658 + str += ii.isInterface() ? ' interface ' : ' class ';
1.34659 + str += name.getName();
1.34660 + if (ii.superName && ii.superName.getName() !== 'Object') {
1.34661 + str += ' extends ' + ii.superName.getName();
1.34662 + }
1.34663 + if (ii.interfaces.length) {
1.34664 + str += ' implements ' + ii.interfaces.map(function (x) {
1.34665 + return x.getName();
1.34666 + }).join(', ');
1.34667 + }
1.34668 + writer.enter(str + ' {');
1.34669 + if (!ii.isInterface()) {
1.34670 + writer.writeLn('public function ' + name.getName() + '(' + getSignature(ii.init) + ') {}');
1.34671 + }
1.34672 + var interfaceNamespace;
1.34673 + if (ii.isInterface()) {
1.34674 + interfaceNamespace = name.namespaces[0].uri + ':' + name.name;
1.34675 + }
1.34676 + this.traceTraits(ci.traits, true, interfaceNamespace);
1.34677 + this.traceTraits(ii.traits, false, interfaceNamespace);
1.34678 + writer.leave('}');
1.34679 + },
1.34680 + traceMetadata: function traceMetadata(metadata) {
1.34681 + var writer = this.writer;
1.34682 + for (var key in metadata) {
1.34683 + if (metadata.hasOwnProperty(key)) {
1.34684 + if (key.indexOf('__') === 0) {
1.34685 + continue;
1.34686 + }
1.34687 + writer.writeLn('[' + key + '(' + metadata[key].value.map(function (m) {
1.34688 + var str = m.key ? m.key + '=' : '';
1.34689 + return str + '"' + m.value + '"';
1.34690 + }).join(', ') + ')]');
1.34691 + }
1.34692 + }
1.34693 + }
1.34694 + };
1.34695 + return SourceTracer;
1.34696 + }();
1.34697 +function traceSource(writer, abc) {
1.34698 + var tracer = new SourceTracer(writer);
1.34699 + abc.scripts.forEach(function (script) {
1.34700 + tracer.traceTraits(script.traits);
1.34701 + });
1.34702 +}
1.34703 +function traceStatistics(writer, abc) {
1.34704 + var libraryClassCounter = new Shumway.Metrics.Counter(true);
1.34705 + var librarySuperClassCounter = new Shumway.Metrics.Counter(true);
1.34706 + var libraryMethodCounter = new Shumway.Metrics.Counter(true);
1.34707 + var libraryProperties = new Shumway.Metrics.Counter(true);
1.34708 + var definedClasses = {};
1.34709 + var definedMethods = {};
1.34710 + var definedProperties = {};
1.34711 + abc.classes.forEach(function (x) {
1.34712 + var className = x.instanceInfo.name.name;
1.34713 + definedClasses[className] = true;
1.34714 + });
1.34715 + abc.scripts.forEach(function (s) {
1.34716 + s.traits.forEach(function (t) {
1.34717 + if (t.isClass()) {
1.34718 + var superClassName = t.classInfo.instanceInfo.superName ? t.classInfo.instanceInfo.superName.name : '?';
1.34719 + if (!(superClassName in definedClasses)) {
1.34720 + librarySuperClassCounter.count(superClassName);
1.34721 + }
1.34722 + t.classInfo.traits.forEach(function (st) {
1.34723 + if (st.isMethod()) {
1.34724 + definedMethods[st.name.name] = true;
1.34725 + } else {
1.34726 + definedProperties[st.name.name] = true;
1.34727 + }
1.34728 + });
1.34729 + t.classInfo.instanceInfo.traits.forEach(function (it) {
1.34730 + if (it.isMethod() && !(it.attributes & ATTR_Override)) {
1.34731 + definedMethods[it.name.name] = true;
1.34732 + } else {
1.34733 + definedProperties[it.name.name] = true;
1.34734 + }
1.34735 + });
1.34736 + }
1.34737 + });
1.34738 + });
1.34739 + var opCounter = new Shumway.Metrics.Counter(true);
1.34740 + abc.methods.forEach(function (m) {
1.34741 + if (!m.code) {
1.34742 + return;
1.34743 + }
1.34744 + function readOperand(operand) {
1.34745 + var value = 0;
1.34746 + switch (operand.size) {
1.34747 + case 's08':
1.34748 + value = code.readS8();
1.34749 + break;
1.34750 + case 'u08':
1.34751 + value = code.readU8();
1.34752 + break;
1.34753 + case 's16':
1.34754 + value = code.readS16();
1.34755 + break;
1.34756 + case 's24':
1.34757 + value = code.readS24();
1.34758 + break;
1.34759 + case 'u30':
1.34760 + value = code.readU30();
1.34761 + break;
1.34762 + case 'u32':
1.34763 + value = code.readU32();
1.34764 + break;
1.34765 + default:
1.34766 + true;
1.34767 + break;
1.34768 + }
1.34769 + var description = '';
1.34770 + switch (operand.type) {
1.34771 + case '':
1.34772 + break;
1.34773 + case 'I':
1.34774 + description = abc.constantPool.ints[value];
1.34775 + break;
1.34776 + case 'U':
1.34777 + description = abc.constantPool.uints[value];
1.34778 + break;
1.34779 + case 'D':
1.34780 + description = abc.constantPool.doubles[value];
1.34781 + break;
1.34782 + case 'S':
1.34783 + description = abc.constantPool.strings[value];
1.34784 + break;
1.34785 + case 'N':
1.34786 + description = abc.constantPool.namespaces[value];
1.34787 + break;
1.34788 + case 'CI':
1.34789 + description = abc.classes[value];
1.34790 + break;
1.34791 + case 'M':
1.34792 + description = abc.constantPool.multinames[value];
1.34793 + break;
1.34794 + default:
1.34795 + description = '?';
1.34796 + break;
1.34797 + }
1.34798 + return description;
1.34799 + }
1.34800 + var code = new AbcStream(m.code);
1.34801 + while (code.remaining() > 0) {
1.34802 + var bc = code.readU8();
1.34803 + var op = opcodeTable[bc];
1.34804 + var operands = null;
1.34805 + if (op) {
1.34806 + opCounter.count(op.name);
1.34807 + if (op.operands) {
1.34808 + operands = op.operands.map(readOperand);
1.34809 + }
1.34810 + switch (bc) {
1.34811 + case OP_call:
1.34812 + case OP_callmethod:
1.34813 + continue;
1.34814 + case OP_callproperty:
1.34815 + case OP_callproplex:
1.34816 + case OP_callpropvoid:
1.34817 + case OP_callstatic:
1.34818 + case OP_callsuper:
1.34819 + case OP_callsupervoid:
1.34820 + if (operands[0] && !(operands[0].name in definedMethods)) {
1.34821 + libraryMethodCounter.count(operands[0].name);
1.34822 + }
1.34823 + break;
1.34824 + case OP_constructprop:
1.34825 + if (operands[0] && !(operands[0].name in definedClasses)) {
1.34826 + libraryClassCounter.count(operands[0].name);
1.34827 + }
1.34828 + break;
1.34829 + case OP_getproperty:
1.34830 + case OP_setproperty:
1.34831 + if (operands[0] && !(operands[0].name in definedProperties)) {
1.34832 + libraryProperties.count(operands[0].name);
1.34833 + }
1.34834 + break;
1.34835 + }
1.34836 + }
1.34837 + }
1.34838 + });
1.34839 + writer.writeLn(JSON.stringify({
1.34840 + definedClasses: definedClasses,
1.34841 + definedMethods: definedMethods,
1.34842 + definedProperties: definedProperties,
1.34843 + libraryClasses: libraryClassCounter.counts,
1.34844 + librarySuperClasses: librarySuperClassCounter.counts,
1.34845 + libraryMethods: libraryMethodCounter.counts,
1.34846 + libraryProperties: libraryProperties.counts,
1.34847 + operations: opCounter.counts
1.34848 + }, null, 2));
1.34849 +}
1.34850 +var Shumway;
1.34851 +(function (Shumway) {
1.34852 + (function (AVM2) {
1.34853 + var OP = Shumway.AVM2.ABC.OP;
1.34854 + var Scope = Shumway.AVM2.Runtime.Scope;
1.34855 + var asCoerceByMultiname = Shumway.AVM2.Runtime.asCoerceByMultiname;
1.34856 + var asGetSlot = Shumway.AVM2.Runtime.asGetSlot;
1.34857 + var asSetSlot = Shumway.AVM2.Runtime.asSetSlot;
1.34858 + var asHasNext2 = Shumway.AVM2.Runtime.asHasNext2;
1.34859 + var asCoerce = Shumway.AVM2.Runtime.asCoerce;
1.34860 + var asCoerceString = Shumway.AVM2.Runtime.asCoerceString;
1.34861 + var asAsType = Shumway.AVM2.Runtime.asAsType;
1.34862 + var asTypeOf = Shumway.AVM2.Runtime.asTypeOf;
1.34863 + var asIsInstanceOf = Shumway.AVM2.Runtime.asIsInstanceOf;
1.34864 + var asIsType = Shumway.AVM2.Runtime.asIsType;
1.34865 + var applyType = Shumway.AVM2.Runtime.applyType;
1.34866 + var createFunction = Shumway.AVM2.Runtime.createFunction;
1.34867 + var createClass = Shumway.AVM2.Runtime.createClass;
1.34868 + var getDescendants = Shumway.AVM2.Runtime.getDescendants;
1.34869 + var checkFilter = Shumway.AVM2.Runtime.checkFilter;
1.34870 + var asAdd = Shumway.AVM2.Runtime.asAdd;
1.34871 + var translateError = Shumway.AVM2.Runtime.translateError;
1.34872 + var asCreateActivation = Shumway.AVM2.Runtime.asCreateActivation;
1.34873 + var sliceArguments = Shumway.AVM2.Runtime.sliceArguments;
1.34874 + var boxValue = Shumway.ObjectUtilities.boxValue;
1.34875 + var popManyInto = Shumway.ArrayUtilities.popManyInto;
1.34876 + var construct = Shumway.AVM2.Runtime.construct;
1.34877 + var Multiname = Shumway.AVM2.ABC.Multiname;
1.34878 + var ScopeStack = function () {
1.34879 + function ScopeStack(parent) {
1.34880 + this.parent = parent;
1.34881 + this.stack = [];
1.34882 + this.isWith = [];
1.34883 + }
1.34884 + ScopeStack.prototype.push = function (object, isWith) {
1.34885 + this.stack.push(object);
1.34886 + this.isWith.push(!(!isWith));
1.34887 + };
1.34888 + ScopeStack.prototype.get = function (index) {
1.34889 + return this.stack[index];
1.34890 + };
1.34891 + ScopeStack.prototype.clear = function () {
1.34892 + this.stack.length = 0;
1.34893 + this.isWith.length = 0;
1.34894 + };
1.34895 + ScopeStack.prototype.pop = function () {
1.34896 + this.isWith.pop();
1.34897 + this.stack.pop();
1.34898 + };
1.34899 + ScopeStack.prototype.topScope = function () {
1.34900 + if (!this.scopes) {
1.34901 + this.scopes = [];
1.34902 + }
1.34903 + var parent = this.parent;
1.34904 + for (var i = 0; i < this.stack.length; i++) {
1.34905 + var object = this.stack[i], isWith = this.isWith[i], scope = this.scopes[i];
1.34906 + if (!scope || scope.parent !== parent || scope.object !== object || scope.isWith !== isWith) {
1.34907 + scope = this.scopes[i] = new Scope(parent, object, isWith);
1.34908 + }
1.34909 + parent = scope;
1.34910 + }
1.34911 + return parent;
1.34912 + };
1.34913 + return ScopeStack;
1.34914 + }();
1.34915 + function popNameInto(stack, mn, out) {
1.34916 + out.flags = mn.flags;
1.34917 + if (mn.isRuntimeName()) {
1.34918 + out.name = stack.pop();
1.34919 + } else {
1.34920 + out.name = mn.name;
1.34921 + }
1.34922 + if (mn.isRuntimeNamespace()) {
1.34923 + out.namespaces = [
1.34924 + stack.pop()
1.34925 + ];
1.34926 + } else {
1.34927 + out.namespaces = mn.namespaces;
1.34928 + }
1.34929 + }
1.34930 + var Interpreter = function () {
1.34931 + function Interpreter() {
1.34932 + }
1.34933 + Interpreter.interpretMethod = function ($this, method, savedScope, methodArgs) {
1.34934 + true;
1.34935 + Counter.count('Interpret Method');
1.34936 + var abc = method.abc;
1.34937 + var ints = abc.constantPool.ints;
1.34938 + var uints = abc.constantPool.uints;
1.34939 + var doubles = abc.constantPool.doubles;
1.34940 + var strings = abc.constantPool.strings;
1.34941 + var methods = abc.methods;
1.34942 + var multinames = abc.constantPool.multinames;
1.34943 + var domain = abc.applicationDomain;
1.34944 + var exceptions = method.exceptions;
1.34945 + var locals = [
1.34946 + $this
1.34947 + ];
1.34948 + var stack = [], scopeStack = new ScopeStack(savedScope);
1.34949 + var parameterCount = method.parameters.length;
1.34950 + var argCount = methodArgs.length;
1.34951 + var value;
1.34952 + for (var i = 0; i < parameterCount; i++) {
1.34953 + var parameter = method.parameters[i];
1.34954 + if (i < argCount) {
1.34955 + value = methodArgs[i];
1.34956 + } else {
1.34957 + value = parameter.value;
1.34958 + }
1.34959 + if (parameter.type && !parameter.type.isAnyName()) {
1.34960 + value = asCoerceByMultiname(domain, parameter.type, value);
1.34961 + }
1.34962 + locals.push(value);
1.34963 + }
1.34964 + if (method.needsRest()) {
1.34965 + locals.push(sliceArguments(methodArgs, parameterCount));
1.34966 + } else if (method.needsArguments()) {
1.34967 + locals.push(sliceArguments(methodArgs, 0));
1.34968 + }
1.34969 + var bytecodes = method.analysis.bytecodes;
1.34970 + var object, index, multiname, result, a, b, args = [], mn = Multiname.TEMPORARY;
1.34971 + interpretLabel:
1.34972 + for (var pc = 0, end = bytecodes.length; pc < end;) {
1.34973 + try {
1.34974 + var bc = bytecodes[pc];
1.34975 + var op = bc.op;
1.34976 + switch (op | 0) {
1.34977 + case 3:
1.34978 + throw stack.pop();
1.34979 + case 4:
1.34980 + popNameInto(stack, multinames[bc.index], mn);
1.34981 + stack.push(stack.pop().asGetSuper(savedScope, mn.namespaces, mn.name, mn.flags));
1.34982 + break;
1.34983 + case 5:
1.34984 + value = stack.pop();
1.34985 + popNameInto(stack, multinames[bc.index], mn);
1.34986 + stack.pop().asSetSuper(savedScope, mn.namespaces, mn.name, mn.flags, value);
1.34987 + break;
1.34988 + case 8:
1.34989 + locals[bc.index] = undefined;
1.34990 + break;
1.34991 + case 12:
1.34992 + b = stack.pop();
1.34993 + a = stack.pop();
1.34994 + pc = !(a < b) ? bc.offset : pc + 1;
1.34995 + continue;
1.34996 + case 24:
1.34997 + b = stack.pop();
1.34998 + a = stack.pop();
1.34999 + pc = a >= b ? bc.offset : pc + 1;
1.35000 + continue;
1.35001 + case 13:
1.35002 + b = stack.pop();
1.35003 + a = stack.pop();
1.35004 + pc = !(a <= b) ? bc.offset : pc + 1;
1.35005 + continue;
1.35006 + case 23:
1.35007 + b = stack.pop();
1.35008 + a = stack.pop();
1.35009 + pc = a > b ? bc.offset : pc + 1;
1.35010 + continue;
1.35011 + case 14:
1.35012 + b = stack.pop();
1.35013 + a = stack.pop();
1.35014 + pc = !(a > b) ? bc.offset : pc + 1;
1.35015 + continue;
1.35016 + case 22:
1.35017 + b = stack.pop();
1.35018 + a = stack.pop();
1.35019 + pc = a <= b ? bc.offset : pc + 1;
1.35020 + continue;
1.35021 + case 15:
1.35022 + b = stack.pop();
1.35023 + a = stack.pop();
1.35024 + pc = !(a >= b) ? bc.offset : pc + 1;
1.35025 + continue;
1.35026 + case 21:
1.35027 + b = stack.pop();
1.35028 + a = stack.pop();
1.35029 + pc = a < b ? bc.offset : pc + 1;
1.35030 + continue;
1.35031 + case 16:
1.35032 + pc = bc.offset;
1.35033 + continue;
1.35034 + case 17:
1.35035 + pc = !(!stack.pop()) ? bc.offset : pc + 1;
1.35036 + continue;
1.35037 + case 18:
1.35038 + pc = !stack.pop() ? bc.offset : pc + 1;
1.35039 + continue;
1.35040 + case 19:
1.35041 + b = stack.pop();
1.35042 + a = stack.pop();
1.35043 + pc = a == b ? bc.offset : pc + 1;
1.35044 + continue;
1.35045 + case 20:
1.35046 + b = stack.pop();
1.35047 + a = stack.pop();
1.35048 + pc = a != b ? bc.offset : pc + 1;
1.35049 + continue;
1.35050 + case 25:
1.35051 + b = stack.pop();
1.35052 + a = stack.pop();
1.35053 + pc = a === b ? bc.offset : pc + 1;
1.35054 + continue;
1.35055 + case 26:
1.35056 + b = stack.pop();
1.35057 + a = stack.pop();
1.35058 + pc = a !== b ? bc.offset : pc + 1;
1.35059 + continue;
1.35060 + case 27:
1.35061 + index = stack.pop();
1.35062 + if (index < 0 || index >= bc.offsets.length) {
1.35063 + index = bc.offsets.length - 1;
1.35064 + }
1.35065 + pc = bc.offsets[index];
1.35066 + continue;
1.35067 + case 28:
1.35068 + scopeStack.push(boxValue(stack.pop()), true);
1.35069 + break;
1.35070 + case 29:
1.35071 + scopeStack.pop();
1.35072 + break;
1.35073 + case 30:
1.35074 + index = stack.pop();
1.35075 + stack[stack.length - 1] = boxValue(stack[stack.length - 1]).asNextName(index);
1.35076 + break;
1.35077 + case 35:
1.35078 + index = stack.pop();
1.35079 + stack[stack.length - 1] = boxValue(stack[stack.length - 1]).asNextValue(index);
1.35080 + break;
1.35081 + case 50:
1.35082 + result = asHasNext2(locals[bc.object], locals[bc.index]);
1.35083 + locals[bc.object] = result.object;
1.35084 + locals[bc.index] = result.index;
1.35085 + stack.push(!(!result.index));
1.35086 + break;
1.35087 + case 32:
1.35088 + stack.push(null);
1.35089 + break;
1.35090 + case 33:
1.35091 + stack.push(undefined);
1.35092 + break;
1.35093 + case 36:
1.35094 + case 37:
1.35095 + stack.push(bc.value);
1.35096 + break;
1.35097 + case 44:
1.35098 + stack.push(strings[bc.index]);
1.35099 + break;
1.35100 + case 45:
1.35101 + stack.push(ints[bc.index]);
1.35102 + break;
1.35103 + case 46:
1.35104 + stack.push(uints[bc.index]);
1.35105 + break;
1.35106 + case 47:
1.35107 + stack.push(doubles[bc.index]);
1.35108 + break;
1.35109 + case 38:
1.35110 + stack.push(true);
1.35111 + break;
1.35112 + case 39:
1.35113 + stack.push(false);
1.35114 + break;
1.35115 + case 40:
1.35116 + stack.push(NaN);
1.35117 + break;
1.35118 + case 41:
1.35119 + stack.pop();
1.35120 + break;
1.35121 + case 42:
1.35122 + stack.push(stack[stack.length - 1]);
1.35123 + break;
1.35124 + case 43:
1.35125 + object = stack[stack.length - 1];
1.35126 + stack[stack.length - 1] = stack[stack.length - 2];
1.35127 + stack[stack.length - 2] = object;
1.35128 + break;
1.35129 + case 48:
1.35130 + scopeStack.push(boxValue(stack.pop()), false);
1.35131 + break;
1.35132 + case 64:
1.35133 + stack.push(createFunction(methods[bc.index], scopeStack.topScope(), true));
1.35134 + break;
1.35135 + case 65:
1.35136 + popManyInto(stack, bc.argCount, args);
1.35137 + object = stack.pop();
1.35138 + stack[stack.length - 1] = stack[stack.length - 1].apply(object, args);
1.35139 + break;
1.35140 + case 66:
1.35141 + popManyInto(stack, bc.argCount, args);
1.35142 + stack[stack.length - 1] = construct(stack[stack.length - 1], args);
1.35143 + break;
1.35144 + case 71:
1.35145 + return;
1.35146 + case 72:
1.35147 + if (method.returnType) {
1.35148 + return asCoerceByMultiname(domain, method.returnType, stack.pop());
1.35149 + }
1.35150 + return stack.pop();
1.35151 + case 73:
1.35152 + popManyInto(stack, bc.argCount, args);
1.35153 + object = stack.pop();
1.35154 + savedScope.object.baseClass.instanceConstructorNoInitialize.apply(object, args);
1.35155 + break;
1.35156 + case 74:
1.35157 + popManyInto(stack, bc.argCount, args);
1.35158 + popNameInto(stack, multinames[bc.index], mn);
1.35159 + object = boxValue(stack[stack.length - 1]);
1.35160 + object = object.asConstructProperty(mn.namespaces, mn.name, mn.flags, args);
1.35161 + stack[stack.length - 1] = object;
1.35162 + break;
1.35163 + case 75:
1.35164 + Shumway.Debug.notImplemented('OP.callsuperid');
1.35165 + break;
1.35166 + case 76:
1.35167 + case 70:
1.35168 + case 79:
1.35169 + popManyInto(stack, bc.argCount, args);
1.35170 + popNameInto(stack, multinames[bc.index], mn);
1.35171 + result = boxValue(stack.pop()).asCallProperty(mn.namespaces, mn.name, mn.flags, op === 76, args);
1.35172 + if (op !== 79) {
1.35173 + stack.push(result);
1.35174 + }
1.35175 + break;
1.35176 + case 69:
1.35177 + case 78:
1.35178 + popManyInto(stack, bc.argCount, args);
1.35179 + popNameInto(stack, multinames[bc.index], mn);
1.35180 + result = stack.pop().asCallSuper(savedScope, mn.namespaces, mn.name, mn.flags, args);
1.35181 + if (op !== 78) {
1.35182 + stack.push(result);
1.35183 + }
1.35184 + break;
1.35185 + case 83:
1.35186 + popManyInto(stack, bc.argCount, args);
1.35187 + stack[stack.length - 1] = applyType(domain, stack[stack.length - 1], args);
1.35188 + break;
1.35189 + case 85:
1.35190 + object = {};
1.35191 + for (var i = 0; i < bc.argCount; i++) {
1.35192 + value = stack.pop();
1.35193 + object[Multiname.getPublicQualifiedName(stack.pop())] = value;
1.35194 + }
1.35195 + stack.push(object);
1.35196 + break;
1.35197 + case 86:
1.35198 + object = [];
1.35199 + popManyInto(stack, bc.argCount, args);
1.35200 + object.push.apply(object, args);
1.35201 + stack.push(object);
1.35202 + break;
1.35203 + case 87:
1.35204 + true;
1.35205 + stack.push(asCreateActivation(method));
1.35206 + break;
1.35207 + case 88:
1.35208 + stack[stack.length - 1] = createClass(abc.classes[bc.index], stack[stack.length - 1], scopeStack.topScope());
1.35209 + break;
1.35210 + case 89:
1.35211 + popNameInto(stack, multinames[bc.index], mn);
1.35212 + stack.push(getDescendants(stack.pop(), mn));
1.35213 + break;
1.35214 + case 90:
1.35215 + true;
1.35216 + stack.push(exceptions[bc.index].scopeObject);
1.35217 + break;
1.35218 + case 94:
1.35219 + case 93:
1.35220 + popNameInto(stack, multinames[bc.index], mn);
1.35221 + stack.push(scopeStack.topScope().findScopeProperty(mn.namespaces, mn.name, mn.flags, domain, op === 93, false));
1.35222 + break;
1.35223 + case 96:
1.35224 + multiname = multinames[bc.index];
1.35225 + object = scopeStack.topScope().findScopeProperty(multiname.namespaces, multiname.name, multiname.flags, domain, true, false);
1.35226 + stack.push(object.asGetProperty(multiname.namespaces, multiname.name, multiname.flags));
1.35227 + break;
1.35228 + case 104:
1.35229 + case 97:
1.35230 + value = stack.pop();
1.35231 + popNameInto(stack, multinames[bc.index], mn);
1.35232 + boxValue(stack.pop()).asSetProperty(mn.namespaces, mn.name, mn.flags, value);
1.35233 + break;
1.35234 + case 98:
1.35235 + stack.push(locals[bc.index]);
1.35236 + break;
1.35237 + case 99:
1.35238 + locals[bc.index] = stack.pop();
1.35239 + break;
1.35240 + case 100:
1.35241 + stack.push(savedScope.global.object);
1.35242 + break;
1.35243 + case 101:
1.35244 + stack.push(scopeStack.get(bc.index));
1.35245 + break;
1.35246 + case 102:
1.35247 + popNameInto(stack, multinames[bc.index], mn);
1.35248 + stack[stack.length - 1] = boxValue(stack[stack.length - 1]).asGetProperty(mn.namespaces, mn.name, mn.flags);
1.35249 + break;
1.35250 + case 106:
1.35251 + popNameInto(stack, multinames[bc.index], mn);
1.35252 + stack[stack.length - 1] = boxValue(stack[stack.length - 1]).asDeleteProperty(mn.namespaces, mn.name, mn.flags);
1.35253 + break;
1.35254 + case 108:
1.35255 + stack[stack.length - 1] = asGetSlot(stack[stack.length - 1], bc.index);
1.35256 + break;
1.35257 + case 109:
1.35258 + value = stack.pop();
1.35259 + object = stack.pop();
1.35260 + asSetSlot(object, bc.index, value);
1.35261 + break;
1.35262 + case 112:
1.35263 + stack[stack.length - 1] = stack[stack.length - 1] + '';
1.35264 + break;
1.35265 + case 131:
1.35266 + case 115:
1.35267 + stack[stack.length - 1] |= 0;
1.35268 + break;
1.35269 + case 136:
1.35270 + case 116:
1.35271 + stack[stack.length - 1] >>>= 0;
1.35272 + break;
1.35273 + case 132:
1.35274 + case 117:
1.35275 + stack[stack.length - 1] = +stack[stack.length - 1];
1.35276 + break;
1.35277 + case 129:
1.35278 + case 118:
1.35279 + stack[stack.length - 1] = !(!stack[stack.length - 1]);
1.35280 + break;
1.35281 + case 120:
1.35282 + stack[stack.length - 1] = checkFilter(stack[stack.length - 1]);
1.35283 + break;
1.35284 + case 128:
1.35285 + stack[stack.length - 1] = asCoerce(domain.getType(multinames[bc.index]), stack[stack.length - 1]);
1.35286 + break;
1.35287 + case 130:
1.35288 + break;
1.35289 + case 133:
1.35290 + stack[stack.length - 1] = asCoerceString(stack[stack.length - 1]);
1.35291 + break;
1.35292 + case 135:
1.35293 + stack[stack.length - 2] = asAsType(stack.pop(), stack[stack.length - 1]);
1.35294 + break;
1.35295 + case 137:
1.35296 + object = stack[stack.length - 1];
1.35297 + stack[stack.length - 1] = object == undefined ? null : object;
1.35298 + break;
1.35299 + case 144:
1.35300 + stack[stack.length - 1] = -stack[stack.length - 1];
1.35301 + break;
1.35302 + case 145:
1.35303 + ++stack[stack.length - 1];
1.35304 + break;
1.35305 + case 146:
1.35306 + ++locals[bc.index];
1.35307 + break;
1.35308 + case 147:
1.35309 + --stack[stack.length - 1];
1.35310 + break;
1.35311 + case 148:
1.35312 + --locals[bc.index];
1.35313 + break;
1.35314 + case 149:
1.35315 + stack[stack.length - 1] = asTypeOf(stack[stack.length - 1]);
1.35316 + break;
1.35317 + case 150:
1.35318 + stack[stack.length - 1] = !stack[stack.length - 1];
1.35319 + break;
1.35320 + case 151:
1.35321 + stack[stack.length - 1] = ~stack[stack.length - 1];
1.35322 + break;
1.35323 + case 160:
1.35324 + stack[stack.length - 2] = asAdd(stack[stack.length - 2], stack.pop());
1.35325 + break;
1.35326 + case 161:
1.35327 + stack[stack.length - 2] -= stack.pop();
1.35328 + break;
1.35329 + case 162:
1.35330 + stack[stack.length - 2] *= stack.pop();
1.35331 + break;
1.35332 + case 163:
1.35333 + stack[stack.length - 2] /= stack.pop();
1.35334 + break;
1.35335 + case 164:
1.35336 + stack[stack.length - 2] %= stack.pop();
1.35337 + break;
1.35338 + case 165:
1.35339 + stack[stack.length - 2] <<= stack.pop();
1.35340 + break;
1.35341 + case 166:
1.35342 + stack[stack.length - 2] >>= stack.pop();
1.35343 + break;
1.35344 + case 167:
1.35345 + stack[stack.length - 2] >>>= stack.pop();
1.35346 + break;
1.35347 + case 168:
1.35348 + stack[stack.length - 2] &= stack.pop();
1.35349 + break;
1.35350 + case 169:
1.35351 + stack[stack.length - 2] |= stack.pop();
1.35352 + break;
1.35353 + case 170:
1.35354 + stack[stack.length - 2] ^= stack.pop();
1.35355 + break;
1.35356 + case 171:
1.35357 + stack[stack.length - 2] = stack[stack.length - 2] == stack.pop();
1.35358 + break;
1.35359 + case 172:
1.35360 + stack[stack.length - 2] = stack[stack.length - 2] === stack.pop();
1.35361 + break;
1.35362 + case 173:
1.35363 + stack[stack.length - 2] = stack[stack.length - 2] < stack.pop();
1.35364 + break;
1.35365 + case 174:
1.35366 + stack[stack.length - 2] = stack[stack.length - 2] <= stack.pop();
1.35367 + break;
1.35368 + case 175:
1.35369 + stack[stack.length - 2] = stack[stack.length - 2] > stack.pop();
1.35370 + break;
1.35371 + case 176:
1.35372 + stack[stack.length - 2] = stack[stack.length - 2] >= stack.pop();
1.35373 + break;
1.35374 + case 177:
1.35375 + stack[stack.length - 2] = asIsInstanceOf(stack.pop(), stack[stack.length - 1]);
1.35376 + break;
1.35377 + case 178:
1.35378 + stack[stack.length - 1] = asIsType(domain.getType(multinames[bc.index]), stack[stack.length - 1]);
1.35379 + break;
1.35380 + case 179:
1.35381 + stack[stack.length - 2] = asIsType(stack.pop(), stack[stack.length - 1]);
1.35382 + break;
1.35383 + case 180:
1.35384 + stack[stack.length - 2] = boxValue(stack.pop()).asHasProperty(null, stack[stack.length - 1]);
1.35385 + break;
1.35386 + case 192:
1.35387 + stack[stack.length - 1] = (stack[stack.length - 1] | 0) + 1;
1.35388 + break;
1.35389 + case 193:
1.35390 + stack[stack.length - 1] = (stack[stack.length - 1] | 0) - 1;
1.35391 + break;
1.35392 + case 194:
1.35393 + locals[bc.index] = (locals[bc.index] | 0) + 1;
1.35394 + break;
1.35395 + case 195:
1.35396 + locals[bc.index] = (locals[bc.index] | 0) - 1;
1.35397 + break;
1.35398 + case 196:
1.35399 + stack[stack.length - 1] = ~stack[stack.length - 1];
1.35400 + break;
1.35401 + case 197:
1.35402 + stack[stack.length - 2] = stack[stack.length - 2] + stack.pop() | 0;
1.35403 + break;
1.35404 + case 198:
1.35405 + stack[stack.length - 2] = stack[stack.length - 2] - stack.pop() | 0;
1.35406 + break;
1.35407 + case 199:
1.35408 + stack[stack.length - 2] = stack[stack.length - 2] * stack.pop() | 0;
1.35409 + break;
1.35410 + case 208:
1.35411 + case 209:
1.35412 + case 210:
1.35413 + case 211:
1.35414 + stack.push(locals[op - 208]);
1.35415 + break;
1.35416 + case 212:
1.35417 + case 213:
1.35418 + case 214:
1.35419 + case 215:
1.35420 + locals[op - 212] = stack.pop();
1.35421 + break;
1.35422 + case 239:
1.35423 + case 240:
1.35424 + case 241:
1.35425 + break;
1.35426 + default:
1.35427 + Shumway.Debug.notImplemented(Shumway.AVM2.opcodeName(op));
1.35428 + }
1.35429 + pc++;
1.35430 + } catch (e) {
1.35431 + if (exceptions.length < 1) {
1.35432 + throw e;
1.35433 + }
1.35434 + e = translateError(domain, e);
1.35435 + for (var i = 0, j = exceptions.length; i < j; i++) {
1.35436 + var handler = exceptions[i];
1.35437 + if (pc >= handler.start && pc <= handler.end && (!handler.typeName || domain.getType(handler.typeName).isInstance(e))) {
1.35438 + stack.length = 0;
1.35439 + stack.push(e);
1.35440 + scopeStack.clear();
1.35441 + pc = handler.offset;
1.35442 + continue interpretLabel;
1.35443 + }
1.35444 + }
1.35445 + throw e;
1.35446 + }
1.35447 + }
1.35448 + };
1.35449 + return Interpreter;
1.35450 + }();
1.35451 + AVM2.Interpreter = Interpreter;
1.35452 + }(Shumway.AVM2 || (Shumway.AVM2 = {})));
1.35453 + var AVM2 = Shumway.AVM2;
1.35454 +}(Shumway || (Shumway = {})));
1.35455 +Shumway.AVM2.Runtime.enableVerifier.value = true;
1.35456 +release = true;
1.35457 +var avm2Root = SHUMWAY_ROOT + 'avm2/';
1.35458 +var builtinPath = avm2Root + 'generated/builtin/builtin.abc';
1.35459 +var avm1Path = avm2Root + 'generated/avm1lib/avm1lib.abc';
1.35460 +var BinaryFileReader = function binaryFileReader() {
1.35461 + function constructor(url, responseType) {
1.35462 + this.url = url;
1.35463 + this.responseType = responseType || 'arraybuffer';
1.35464 + }
1.35465 + constructor.prototype = {
1.35466 + readAll: function (progress, complete) {
1.35467 + var url = this.url;
1.35468 + var xhr = new XMLHttpRequest();
1.35469 + var async = true;
1.35470 + xhr.open('GET', this.url, async);
1.35471 + xhr.responseType = this.responseType;
1.35472 + if (progress) {
1.35473 + xhr.onprogress = function (event) {
1.35474 + progress(xhr.response, event.loaded, event.total);
1.35475 + };
1.35476 + }
1.35477 + xhr.onreadystatechange = function (event) {
1.35478 + if (xhr.readyState === 4) {
1.35479 + if (xhr.status !== 200 && xhr.status !== 0) {
1.35480 + unexpected('Path: ' + url + ' not found.');
1.35481 + complete(null, xhr.statusText);
1.35482 + return;
1.35483 + }
1.35484 + complete(xhr.response);
1.35485 + }
1.35486 + };
1.35487 + xhr.send(null);
1.35488 + },
1.35489 + readAsync: function (ondata, onerror, onopen, oncomplete, onhttpstatus) {
1.35490 + var xhr = new XMLHttpRequest({
1.35491 + mozSystem: true
1.35492 + });
1.35493 + var url = this.url;
1.35494 + xhr.open(this.method || 'GET', url, true);
1.35495 + var isNotProgressive;
1.35496 + try {
1.35497 + xhr.responseType = 'moz-chunked-arraybuffer';
1.35498 + isNotProgressive = xhr.responseType !== 'moz-chunked-arraybuffer';
1.35499 + } catch (e) {
1.35500 + isNotProgressive = true;
1.35501 + }
1.35502 + if (isNotProgressive) {
1.35503 + xhr.responseType = 'arraybuffer';
1.35504 + }
1.35505 + xhr.onprogress = function (e) {
1.35506 + if (isNotProgressive)
1.35507 + return;
1.35508 + ondata(new Uint8Array(xhr.response), {
1.35509 + loaded: e.loaded,
1.35510 + total: e.total
1.35511 + });
1.35512 + };
1.35513 + xhr.onreadystatechange = function (event) {
1.35514 + if (xhr.readyState === 2 && onhttpstatus) {
1.35515 + onhttpstatus(url, xhr.status, xhr.getAllResponseHeaders());
1.35516 + }
1.35517 + if (xhr.readyState === 4) {
1.35518 + if (xhr.status !== 200 && xhr.status !== 0) {
1.35519 + onerror(xhr.statusText);
1.35520 + }
1.35521 + if (isNotProgressive) {
1.35522 + var buffer = xhr.response;
1.35523 + ondata(new Uint8Array(buffer), {
1.35524 + loaded: buffer.byteLength,
1.35525 + total: buffer.byteLength
1.35526 + });
1.35527 + }
1.35528 + if (oncomplete) {
1.35529 + oncomplete();
1.35530 + }
1.35531 + } else if (xhr.readyState === 2 && onopen) {
1.35532 + onopen();
1.35533 + }
1.35534 + };
1.35535 + xhr.send(null);
1.35536 + }
1.35537 + };
1.35538 + return constructor;
1.35539 + }();
1.35540 +var libraryAbcs;
1.35541 +function grabAbc(abcName) {
1.35542 + var entry = libraryScripts[abcName];
1.35543 + if (entry) {
1.35544 + var offset = entry.offset;
1.35545 + var length = entry.length;
1.35546 + return new AbcFile(new Uint8Array(libraryAbcs, offset, length), abcName);
1.35547 + }
1.35548 + return null;
1.35549 +}
1.35550 +var avm2;
1.35551 +function createAVM2(builtinPath, libraryPath, avm1Path, sysMode, appMode, next) {
1.35552 + avm2 = new AVM2(sysMode, appMode, loadAVM1);
1.35553 + var builtinAbc, avm1Abc;
1.35554 + AVM2.loadPlayerglobal(libraryPath.abcs, libraryPath.catalog).then(function () {
1.35555 + new BinaryFileReader(builtinPath).readAll(null, function (buffer) {
1.35556 + builtinAbc = new AbcFile(new Uint8Array(buffer), 'builtin.abc');
1.35557 + executeAbc();
1.35558 + });
1.35559 + });
1.35560 + function loadAVM1(next) {
1.35561 + new BinaryFileReader(avm1Path).readAll(null, function (buffer) {
1.35562 + avm1Abc = new AbcFile(new Uint8Array(buffer), 'avm1.abc');
1.35563 + ;
1.35564 + avm2.systemDomain.executeAbc(avm1Abc);
1.35565 + next();
1.35566 + });
1.35567 + }
1.35568 + function executeAbc() {
1.35569 + avm2.builtinsLoaded = false;
1.35570 + avm2.systemDomain.onMessage.register('classCreated', Stubs.onClassCreated);
1.35571 + avm2.systemDomain.executeAbc(builtinAbc);
1.35572 + avm2.builtinsLoaded = true;
1.35573 + console.info(JSON.stringify(Counter.toJSON()));
1.35574 + console.timeEnd('Load AVM2');
1.35575 + next(avm2);
1.35576 + }
1.35577 +}
1.35578 +{
1.35579 + var MAX_SNAP_DRAW_SCALE_TO_CACHE = 8;
1.35580 + var CACHE_SNAP_DRAW_AFTER = 3;
1.35581 + var BitmapDefinition = function () {
1.35582 + function setBitmapData(value) {
1.35583 + if (this._bitmapData) {
1.35584 + this._bitmapData._changeNotificationTarget = null;
1.35585 + }
1.35586 + this._bitmapData = value;
1.35587 + if (this._bitmapData) {
1.35588 + this._bitmapData._changeNotificationTarget = this;
1.35589 + }
1.35590 + if (value) {
1.35591 + var canvas = value._drawable;
1.35592 + this._bbox = {
1.35593 + xMin: 0,
1.35594 + yMin: 0,
1.35595 + xMax: canvas.width * 20,
1.35596 + yMax: canvas.height * 20
1.35597 + };
1.35598 + } else {
1.35599 + this._bbox = {
1.35600 + xMin: 0,
1.35601 + yMin: 0,
1.35602 + xMax: 0,
1.35603 + yMax: 0
1.35604 + };
1.35605 + }
1.35606 + this._drawableChanged();
1.35607 + this._invalidateBounds();
1.35608 + this._invalidateTransform();
1.35609 + }
1.35610 + return {
1.35611 + __class__: 'flash.display.Bitmap',
1.35612 + draw: function (ctx, ratio, colorTransform) {
1.35613 + if (!this._bitmapData) {
1.35614 + return;
1.35615 + }
1.35616 + var scaledImage;
1.35617 + ctx.save();
1.35618 + if (this._pixelSnapping === 'auto' || this._pixelSnapping === 'always') {
1.35619 + var transform = this._getConcatenatedTransform(null, true);
1.35620 + var EPSILON = 0.001;
1.35621 + var aInt = Math.abs(Math.round(transform.a));
1.35622 + var dInt = Math.abs(Math.round(transform.d));
1.35623 + var snapPixels;
1.35624 + if (aInt >= 1 && aInt <= MAX_SNAP_DRAW_SCALE_TO_CACHE && dInt >= 1 && dInt <= MAX_SNAP_DRAW_SCALE_TO_CACHE && Math.abs(Math.abs(transform.a) / aInt - 1) <= EPSILON && Math.abs(Math.abs(transform.d) / dInt - 1) <= EPSILON && Math.abs(transform.b) <= EPSILON && Math.abs(transform.c) <= EPSILON) {
1.35625 + if (aInt === 1 && dInt === 1) {
1.35626 + snapPixels = true;
1.35627 + } else {
1.35628 + var sizeKey = aInt + 'x' + dInt;
1.35629 + if (this._snapImageCache.size !== sizeKey) {
1.35630 + this._snapImageCache.size = sizeKey;
1.35631 + this._snapImageCache.hits = 0;
1.35632 + this._snapImageCache.image = null;
1.35633 + }
1.35634 + if (++this._snapImageCache.hits === CACHE_SNAP_DRAW_AFTER) {
1.35635 + this._cacheSnapImage(sizeKey, aInt, dInt);
1.35636 + }
1.35637 + scaledImage = this._snapImageCache.image;
1.35638 + snapPixels = !(!scaledImage);
1.35639 + }
1.35640 + } else {
1.35641 + snapPixels = false;
1.35642 + }
1.35643 + if (snapPixels) {
1.35644 + ctx.setTransform(transform.a < 0 ? -1 : 1, 0, 0, transform.d < 0 ? -1 : 1, transform.tx / 20 | 0, transform.ty / 20 | 0);
1.35645 + }
1.35646 + }
1.35647 + colorTransform.setAlpha(ctx, true);
1.35648 + ctx.imageSmoothingEnabled = ctx.mozImageSmoothingEnabled = this._smoothing;
1.35649 + ctx.drawImage(scaledImage || this._bitmapData._getDrawable(), 0, 0);
1.35650 + ctx.imageSmoothingEnabled = ctx.mozImageSmoothingEnabled = false;
1.35651 + ctx.restore();
1.35652 + traceRenderer.value && frameWriter.writeLn('Bitmap.draw() snapping: ' + this._pixelSnapping + ', dimensions: ' + this._bitmapData._drawable.width + ' x ' + this._bitmapData._drawable.height);
1.35653 + },
1.35654 + _drawableChanged: function () {
1.35655 + this._invalidate();
1.35656 + this._snapImageCache.image = null;
1.35657 + this._snapImageCache.hints = 0;
1.35658 + },
1.35659 + _cacheSnapImage: function (sizeKey, xScale, yScale) {
1.35660 + Counter.count('Cache scaled image');
1.35661 + var original = this._bitmapData._getDrawable();
1.35662 + var canvas = document.createElement('canvas');
1.35663 + canvas.width = xScale * original.width;
1.35664 + canvas.height = yScale * original.height;
1.35665 + var ctx = canvas.getContext('2d');
1.35666 + ctx.imageSmoothingEnabled = ctx.mozImageSmoothingEnabled = this._smoothing;
1.35667 + ctx.drawImage(original, 0, 0, original.width, original.height, 0, 0, canvas.width, canvas.height);
1.35668 + var cache = this._snapImageCache;
1.35669 + var image = document.createElement('img');
1.35670 + cache._tmp = [
1.35671 + canvas,
1.35672 + image
1.35673 + ];
1.35674 + if ('toBlob' in canvas) {
1.35675 + canvas.toBlob(function (blob) {
1.35676 + if (cache.size !== sizeKey) {
1.35677 + return;
1.35678 + }
1.35679 + image.onload = function () {
1.35680 + URL.revokeObjectURL(blob);
1.35681 + if (cache.size === sizeKey) {
1.35682 + cache.image = image;
1.35683 + }
1.35684 + };
1.35685 + image.src = URL.createObjectURL(blob);
1.35686 + });
1.35687 + } else {
1.35688 + image.onload = function () {
1.35689 + if (cache.size === sizeKey) {
1.35690 + cache.image = image;
1.35691 + }
1.35692 + };
1.35693 + image.src = canvas.toDataURL();
1.35694 + }
1.35695 + },
1.35696 + initialize: function () {
1.35697 + },
1.35698 + __glue__: {
1.35699 + native: {
1.35700 + static: {},
1.35701 + instance: {
1.35702 + ctor: function (bitmapData, pixelSnapping, smoothing) {
1.35703 + if (pixelSnapping === 'never' || pixelSnapping === 'always') {
1.35704 + this._pixelSnapping = pixelSnapping;
1.35705 + } else {
1.35706 + this._pixelSnapping = 'auto';
1.35707 + }
1.35708 + this._smoothing = !(!smoothing);
1.35709 + this._snapImageCache = {
1.35710 + hits: 0,
1.35711 + size: '',
1.35712 + image: null
1.35713 + };
1.35714 + if (!bitmapData && this.symbol) {
1.35715 + var symbol = this.symbol;
1.35716 + bitmapData = new flash.display.BitmapData(symbol.width, symbol.height, true, 0);
1.35717 + bitmapData._ctx.imageSmoothingEnabled = this._smoothing;
1.35718 + bitmapData._ctx.mozImageSmoothingEnabled = this._smoothing;
1.35719 + bitmapData._ctx.drawImage(symbol.img, 0, 0);
1.35720 + bitmapData._ctx.imageSmoothingEnabled = false;
1.35721 + bitmapData._ctx.mozImageSmoothingEnabled = false;
1.35722 + }
1.35723 + setBitmapData.call(this, bitmapData || null);
1.35724 + },
1.35725 + pixelSnapping: {
1.35726 + get: function pixelSnapping() {
1.35727 + return this._pixelSnapping;
1.35728 + },
1.35729 + set: function pixelSnapping(value) {
1.35730 + this._pixelSnapping = value;
1.35731 + }
1.35732 + },
1.35733 + smoothing: {
1.35734 + get: function smoothing() {
1.35735 + return this._smoothing;
1.35736 + },
1.35737 + set: function smoothing(value) {
1.35738 + this._smoothing = value;
1.35739 + }
1.35740 + },
1.35741 + bitmapData: {
1.35742 + get: function bitmapData() {
1.35743 + return this._bitmapData;
1.35744 + },
1.35745 + set: setBitmapData
1.35746 + }
1.35747 + }
1.35748 + }
1.35749 + }
1.35750 + };
1.35751 + }.call(this);
1.35752 +}
1.35753 +var CACHE_DRAWABLE_AFTER = 10;
1.35754 +var BitmapDataDefinition = function () {
1.35755 + function replaceRect(ctx, x, y, w, h, alpha) {
1.35756 + if (alpha < 255) {
1.35757 + ctx.clearRect(x, y, w, h);
1.35758 + }
1.35759 + if (alpha > 0) {
1.35760 + ctx.fillRect(x, y, w, h);
1.35761 + }
1.35762 + }
1.35763 + var def = {
1.35764 + __class__: 'flash.display.BitmapData',
1.35765 + initialize: function () {
1.35766 + this._changeNotificationTarget = null;
1.35767 + this._locked = false;
1.35768 + this._requested = 0;
1.35769 + this._cache = null;
1.35770 + if (this.symbol) {
1.35771 + this._img = this.symbol.img;
1.35772 + this._skipCopyToCanvas = this.symbol.skipCopyToCanvas;
1.35773 + }
1.35774 + },
1.35775 + _checkCanvas: function () {
1.35776 + if (this._drawable === null)
1.35777 + throw ArgumentError();
1.35778 + },
1.35779 + ctor: function (width, height, transparent, backgroundColor) {
1.35780 + if (this._img) {
1.35781 + width = this._img.naturalWidth || this._img.width;
1.35782 + height = this._img.naturalHeight || this._img.height;
1.35783 + } else if (isNaN(width + height) || width <= 0 || height <= 0) {
1.35784 + throwError('ArgumentError', Errors.ArgumentError);
1.35785 + }
1.35786 + this._transparent = transparent === undefined ? true : !(!transparent);
1.35787 + this._backgroundColor = backgroundColor === undefined ? 4294967295 : backgroundColor;
1.35788 + if (!this._transparent) {
1.35789 + this._backgroundColor |= 4278190080;
1.35790 + }
1.35791 + if (this._skipCopyToCanvas) {
1.35792 + this._drawable = this._img;
1.35793 + } else {
1.35794 + var canvas = document.createElement('canvas');
1.35795 + this._ctx = canvas.getContext('2d');
1.35796 + canvas.width = width | 0;
1.35797 + canvas.height = height | 0;
1.35798 + this._drawable = canvas;
1.35799 + if (!this._transparent || !this._img && this._backgroundColor) {
1.35800 + this.fillRect(new flash.geom.Rectangle(0, 0, width | 0, height | 0), this._backgroundColor);
1.35801 + }
1.35802 + if (this._img) {
1.35803 + this._ctx.drawImage(this._img, 0, 0);
1.35804 + }
1.35805 + }
1.35806 + },
1.35807 + dispose: function () {
1.35808 + this._ctx = null;
1.35809 + this._drawable.width = 0;
1.35810 + this._drawable.height = 0;
1.35811 + this._drawable = null;
1.35812 + },
1.35813 + draw: function (source, matrix, colorTransform, blendMode, clipRect, smoothing) {
1.35814 + this._checkCanvas();
1.35815 + var ctx = this._ctx;
1.35816 + ctx.save();
1.35817 + ctx.beginPath();
1.35818 + if (clipRect && clipRect.width > 0 && clipRect.height > 0) {
1.35819 + ctx.rect(clipRect.x, clipRect.y, clipRect.width, clipRect.height);
1.35820 + ctx.clip();
1.35821 + }
1.35822 + if (matrix) {
1.35823 + ctx.transform(matrix.a, matrix.b, matrix.c, matrix.d, matrix.tx, matrix.ty);
1.35824 + }
1.35825 + ctx.globalCompositeOperation = getBlendModeName(blendMode);
1.35826 + ctx.imageSmoothingEnabled = ctx.mozImageSmoothingEnabled = !(!smoothing);
1.35827 + if (flash.display.BitmapData.class.isInstanceOf(source)) {
1.35828 + ctx.drawImage(source._drawable, 0, 0);
1.35829 + } else {
1.35830 + new RenderVisitor(source, ctx, null, true).startFragment(matrix);
1.35831 + }
1.35832 + ctx.imageSmoothingEnabled = ctx.mozImageSmoothingEnabled = false;
1.35833 + ctx.restore();
1.35834 + this._invalidate();
1.35835 + },
1.35836 + fillRect: function (rect, color) {
1.35837 + this._checkCanvas();
1.35838 + if (!this._transparent) {
1.35839 + color |= 4278190080;
1.35840 + }
1.35841 + var ctx = this._ctx;
1.35842 + ctx.fillStyle = argbUintToStr(color);
1.35843 + replaceRect(ctx, rect.x, rect.y, rect.width, rect.height, color >>> 24 & 255);
1.35844 + this._invalidate();
1.35845 + },
1.35846 + getPixel: function (x, y) {
1.35847 + this._checkCanvas();
1.35848 + var data = this._ctx.getImageData(x, y, 1, 1).data;
1.35849 + return dataToRGB(data);
1.35850 + },
1.35851 + getPixel32: function (x, y) {
1.35852 + this._checkCanvas();
1.35853 + var data = this._ctx.getImageData(x, y, 1, 1).data;
1.35854 + return dataToARGB(data);
1.35855 + },
1.35856 + _invalidate: function (changeRect) {
1.35857 + if (changeRect) {
1.35858 + somewhatImplemented('BitmapData._invalidate(changeRect)');
1.35859 + }
1.35860 + if (this._locked) {
1.35861 + return;
1.35862 + }
1.35863 + if (this._changeNotificationTarget) {
1.35864 + this._changeNotificationTarget._drawableChanged();
1.35865 + }
1.35866 + this._requested = 0;
1.35867 + this._cache = null;
1.35868 + },
1.35869 + _getDrawable: function () {
1.35870 + if (this._img === this._drawable) {
1.35871 + return this._drawable;
1.35872 + }
1.35873 + this._requested++;
1.35874 + if (this._requested >= CACHE_DRAWABLE_AFTER) {
1.35875 + if (!this._cache) {
1.35876 + Counter.count('Cache drawable');
1.35877 + var img = document.createElement('img');
1.35878 + if ('toBlob' in this._drawable) {
1.35879 + this._drawable.toBlob(function (blob) {
1.35880 + img.src = URL.createObjectURL(blob);
1.35881 + img.onload = function () {
1.35882 + URL.revokeObjectURL(blob);
1.35883 + };
1.35884 + });
1.35885 + } else {
1.35886 + img.src = this._drawable.toDataURL();
1.35887 + }
1.35888 + this._cache = img;
1.35889 + }
1.35890 + if (this._cache.width > 0) {
1.35891 + return this._cache;
1.35892 + }
1.35893 + }
1.35894 + return this._drawable;
1.35895 + },
1.35896 + setPixel: function (x, y, color) {
1.35897 + this.fillRect({
1.35898 + x: x,
1.35899 + y: y,
1.35900 + width: 1,
1.35901 + height: 1
1.35902 + }, color | 4278190080);
1.35903 + this._invalidate();
1.35904 + },
1.35905 + setPixel32: function (x, y, color) {
1.35906 + this.fillRect({
1.35907 + x: x,
1.35908 + y: y,
1.35909 + width: 1,
1.35910 + height: 1
1.35911 + }, color);
1.35912 + this._invalidate();
1.35913 + },
1.35914 + copyPixels: function copyPixels(sourceBitmapData, sourceRect, destPoint, alphaBitmapData, alphaPoint, mergeAlpha) {
1.35915 + if (alphaBitmapData) {
1.35916 + notImplemented('BitmapData.copyPixels w/ alpha');
1.35917 + }
1.35918 + var w = sourceRect.width;
1.35919 + var h = sourceRect.height;
1.35920 + var sx = sourceRect.x;
1.35921 + var sy = sourceRect.y;
1.35922 + var dx = destPoint.x;
1.35923 + var dy = destPoint.y;
1.35924 + var offsetx = -Math.min(0, sx, dx);
1.35925 + var offsety = -Math.min(0, sy, dy);
1.35926 + var correctionw = Math.min(0, this._ctx.canvas.width - dx - w, sourceBitmapData._drawable.width - sx - w) - offsetx;
1.35927 + var correctionh = Math.min(0, this._ctx.canvas.height - dy - h, sourceBitmapData._drawable.height - sy - h) - offsety;
1.35928 + if (!mergeAlpha) {
1.35929 + this._ctx.clearRect(dx, dy, w, h);
1.35930 + }
1.35931 + if (w + correctionw > 0 && h + correctionh > 0) {
1.35932 + this._ctx.drawImage(sourceBitmapData._drawable, sx + offsetx, sy + offsety, w + correctionw, h + correctionh, dx + offsetx, dy + offsety, w + correctionw, h + correctionh);
1.35933 + }
1.35934 + this._invalidate();
1.35935 + },
1.35936 + lock: function lock() {
1.35937 + this._locked = true;
1.35938 + },
1.35939 + unlock: function unlock(changeRect) {
1.35940 + this._locked = false;
1.35941 + this._invalidate(changeRect);
1.35942 + },
1.35943 + clone: function () {
1.35944 + this._checkCanvas();
1.35945 + var bd = new flash.display.BitmapData(this._drawable.width, this._drawable.height, true, 0);
1.35946 + bd._ctx.drawImage(this._drawable, 0, 0);
1.35947 + return bd;
1.35948 + },
1.35949 + scroll: function (x, y) {
1.35950 + this._checkCanvas();
1.35951 + this._ctx.draw(this._drawable, x, y);
1.35952 + this._ctx.save();
1.35953 + var color = this._img ? 0 : this._backgroundColor;
1.35954 + if (!this._transparent) {
1.35955 + color |= 4278190080;
1.35956 + }
1.35957 + var alpha = color >>> 24 & 255;
1.35958 + this._ctx.fillStyle = argbUintToStr(color);
1.35959 + var w = this._drawable.width;
1.35960 + var h = this._drawable.height;
1.35961 + if (x > 0) {
1.35962 + replaceRect(this._ctx, 0, 0, x, h, alpha);
1.35963 + } else if (x < 0) {
1.35964 + replaceRect(this._ctx, w + x, 0, -x, h, alpha);
1.35965 + }
1.35966 + if (y > 0) {
1.35967 + replaceRect(this._ctx, 0, 0, w, y, alpha);
1.35968 + } else if (y < 0) {
1.35969 + replaceRect(this._ctx, h + y, w, -y, alpha);
1.35970 + }
1.35971 + this._ctx.restore();
1.35972 + this._invalidate();
1.35973 + },
1.35974 + get width() {
1.35975 + return this._drawable.width;
1.35976 + },
1.35977 + get height() {
1.35978 + return this._drawable.height;
1.35979 + }
1.35980 + };
1.35981 + var desc = Object.getOwnPropertyDescriptor;
1.35982 + def.__glue__ = {
1.35983 + native: {
1.35984 + instance: {
1.35985 + ctor: def.ctor,
1.35986 + fillRect: def.fillRect,
1.35987 + dispose: def.dispose,
1.35988 + getPixel: def.getPixel,
1.35989 + getPixel32: def.getPixel32,
1.35990 + setPixel: def.setPixel,
1.35991 + setPixel32: def.setPixel32,
1.35992 + copyPixels: def.copyPixels,
1.35993 + lock: def.lock,
1.35994 + unlock: def.unlock,
1.35995 + draw: def.draw,
1.35996 + clone: def.clone,
1.35997 + scroll: def.scroll,
1.35998 + width: desc(def, 'width'),
1.35999 + height: desc(def, 'height')
1.36000 + }
1.36001 + }
1.36002 + };
1.36003 + return def;
1.36004 + }.call(this);
1.36005 +function dataToRGB(data) {
1.36006 + return data[0] << 16 | data[1] << 8 | data[2];
1.36007 +}
1.36008 +function dataToARGB(data) {
1.36009 + return data[3] << 24 | dataToRGB(data);
1.36010 +}
1.36011 +var DisplayObjectDefinition = function () {
1.36012 + var blendModes;
1.36013 + var nextInstanceId = 1;
1.36014 + function generateName() {
1.36015 + return 'instance' + nextInstanceId++;
1.36016 + }
1.36017 + var broadcastedEvents = {
1.36018 + advanceFrame: false,
1.36019 + enterFrame: true,
1.36020 + constructChildren: false,
1.36021 + frameConstructed: true,
1.36022 + executeFrame: false,
1.36023 + exitFrame: true,
1.36024 + render: true
1.36025 + };
1.36026 + var point = {
1.36027 + x: 0,
1.36028 + y: 0
1.36029 + };
1.36030 + var def = {
1.36031 + __class__: 'flash.display.DisplayObject',
1.36032 + initialize: function () {
1.36033 + var blendModeClass = flash.display.BlendMode.class;
1.36034 + this._alpha = 1;
1.36035 + this._animated = false;
1.36036 + this._bbox = null;
1.36037 + this._bitmap = null;
1.36038 + this._blendMode = blendModeClass.NORMAL;
1.36039 + this._bounds = {
1.36040 + xMin: 0,
1.36041 + xMax: 0,
1.36042 + yMin: 0,
1.36043 + yMax: 0,
1.36044 + invalid: true
1.36045 + };
1.36046 + this._cacheAsBitmap = false;
1.36047 + this._children = [];
1.36048 + this._clipDepth = null;
1.36049 + this._currentTransform = {
1.36050 + a: 1,
1.36051 + b: 0,
1.36052 + c: 0,
1.36053 + d: 1,
1.36054 + tx: 0,
1.36055 + ty: 0
1.36056 + };
1.36057 + this._concatenatedTransform = {
1.36058 + a: 1,
1.36059 + b: 0,
1.36060 + c: 0,
1.36061 + d: 1,
1.36062 + tx: 0,
1.36063 + ty: 0,
1.36064 + invalid: true
1.36065 + };
1.36066 + this._current3DTransform = null;
1.36067 + this._cxform = null;
1.36068 + this._graphics = null;
1.36069 + this._filters = [];
1.36070 + this._loader = null;
1.36071 + this._mouseChildren = true;
1.36072 + this._mouseOver = false;
1.36073 + this._mouseX = 0;
1.36074 + this._mouseY = 0;
1.36075 + this._name = null;
1.36076 + this._opaqueBackground = null;
1.36077 + this._owned = false;
1.36078 + this._parent = null;
1.36079 + this._rotation = 0;
1.36080 + this._rotationCos = 1;
1.36081 + this._rotationSin = 0;
1.36082 + this._scale9Grid = null;
1.36083 + this._scaleX = 1;
1.36084 + this._scaleY = 1;
1.36085 + this._stage = null;
1.36086 + this._visible = true;
1.36087 + this._hidden = false;
1.36088 + this._wasCachedAsBitmap = false;
1.36089 + this._destroyed = false;
1.36090 + this._maskedObject = null;
1.36091 + this._scrollRect = null;
1.36092 + this._invalid = false;
1.36093 + this._region = null;
1.36094 + this._level = -1;
1.36095 + this._index = -1;
1.36096 + this._depth = -1;
1.36097 + this._isContainer = false;
1.36098 + this._invisible = false;
1.36099 + this._zindex = 0;
1.36100 + blendModes = [
1.36101 + blendModeClass.NORMAL,
1.36102 + blendModeClass.NORMAL,
1.36103 + blendModeClass.LAYER,
1.36104 + blendModeClass.MULTIPLY,
1.36105 + blendModeClass.SCREEN,
1.36106 + blendModeClass.LIGHTEN,
1.36107 + blendModeClass.DARKEN,
1.36108 + blendModeClass.DIFFERENCE,
1.36109 + blendModeClass.ADD,
1.36110 + blendModeClass.SUBTRACT,
1.36111 + blendModeClass.INVERT,
1.36112 + blendModeClass.ALPHA,
1.36113 + blendModeClass.ERASE,
1.36114 + blendModeClass.OVERLAY,
1.36115 + blendModeClass.HARDLIGHT,
1.36116 + blendModeClass.SHADER
1.36117 + ];
1.36118 + var s = this.symbol;
1.36119 + if (s) {
1.36120 + this._animated = s.animated || false;
1.36121 + this._bbox = s.bbox || null;
1.36122 + this._blendMode = this._resolveBlendMode(s.blendMode);
1.36123 + this._children = s.children || [];
1.36124 + this._clipDepth = s.clipDepth || null;
1.36125 + this._cxform = s.cxform || null;
1.36126 + this._loader = s.loader || null;
1.36127 + this._name = s.name || null;
1.36128 + this._owned = s.owned || false;
1.36129 + this._parent = s.parent || null;
1.36130 + this._level = isNaN(s.level) ? -1 : s.level;
1.36131 + this._index = isNaN(s.index) ? -1 : s.index;
1.36132 + this._depth = isNaN(s.depth) ? -1 : s.depth;
1.36133 + this._root = s.root || null;
1.36134 + this._stage = s.stage || null;
1.36135 + var scale9Grid = s.scale9Grid;
1.36136 + if (scale9Grid) {
1.36137 + this._scale9Grid = new flash.geom.Rectangle(scale9Grid.left, scale9Grid.top, scale9Grid.right - scale9Grid.left, scale9Grid.bottom - scale9Grid.top);
1.36138 + }
1.36139 + var matrix = s.currentTransform;
1.36140 + if (matrix) {
1.36141 + this._setTransformMatrix(matrix, false);
1.36142 + }
1.36143 + }
1.36144 + this._accessibilityProperties = null;
1.36145 + var self = this;
1.36146 + this._onBroadcastMessage = function (type) {
1.36147 + var listeners = self._listeners;
1.36148 + if (listeners[type]) {
1.36149 + self._dispatchEvent(type);
1.36150 + }
1.36151 + };
1.36152 + },
1.36153 + _addEventListener: function addEventListener(type, listener, useCapture, priority) {
1.36154 + if (broadcastedEvents[type] === false) {
1.36155 + avm2.systemDomain.onMessage.register(type, listener);
1.36156 + return;
1.36157 + }
1.36158 + if (type in broadcastedEvents && !this._listeners[type]) {
1.36159 + avm2.systemDomain.onMessage.register(type, this._onBroadcastMessage);
1.36160 + }
1.36161 + this._addEventListenerImpl(type, listener, useCapture, priority);
1.36162 + },
1.36163 + _removeEventListener: function addEventListener(type, listener, useCapture) {
1.36164 + if (broadcastedEvents[type] === false) {
1.36165 + avm2.systemDomain.onMessage.unregister(type, listener);
1.36166 + return;
1.36167 + }
1.36168 + this._removeEventListenerImpl(type, listener, useCapture);
1.36169 + if (type in broadcastedEvents && !this._listeners[type]) {
1.36170 + avm2.systemDomain.onMessage.unregister(type, this._onBroadcastMessage);
1.36171 + }
1.36172 + },
1.36173 + _resolveBlendMode: function (blendModeNumeric) {
1.36174 + return blendModes[blendModeNumeric] || flash.display.BlendMode.class.NORMAL;
1.36175 + },
1.36176 + _getConcatenatedTransform: function (targetCoordSpace, toDeviceSpace) {
1.36177 + var stage = this._stage;
1.36178 + if (this === this._stage) {
1.36179 + return toDeviceSpace ? this._concatenatedTransform : this._currentTransform;
1.36180 + }
1.36181 + if (targetCoordSpace === this._parent) {
1.36182 + return this._currentTransform;
1.36183 + }
1.36184 + var invalidNode = null;
1.36185 + var m, m2, targetCoordMatrix;
1.36186 + var currentNode = this;
1.36187 + while (currentNode !== stage) {
1.36188 + if (currentNode._concatenatedTransform.invalid) {
1.36189 + invalidNode = currentNode;
1.36190 + }
1.36191 + if (currentNode === targetCoordSpace) {
1.36192 + targetCoordMatrix = currentNode._concatenatedTransform;
1.36193 + }
1.36194 + currentNode = currentNode._parent;
1.36195 + }
1.36196 + if (invalidNode) {
1.36197 + if (this._parent === stage) {
1.36198 + m = this._concatenatedTransform;
1.36199 + m2 = this._currentTransform;
1.36200 + m.a = m2.a;
1.36201 + m.b = m2.b;
1.36202 + m.c = m2.c;
1.36203 + m.d = m2.d;
1.36204 + m.tx = m2.tx;
1.36205 + m.ty = m2.ty;
1.36206 + } else {
1.36207 + var stack = [];
1.36208 + var currentNode = this;
1.36209 + while (currentNode !== invalidNode) {
1.36210 + stack.push(currentNode);
1.36211 + currentNode = currentNode._parent;
1.36212 + }
1.36213 + var node = invalidNode;
1.36214 + do {
1.36215 + var parent = node._parent;
1.36216 + m = node._concatenatedTransform;
1.36217 + m2 = node._currentTransform;
1.36218 + if (parent) {
1.36219 + if (parent !== stage) {
1.36220 + var m3 = parent._concatenatedTransform;
1.36221 + m.a = m2.a * m3.a + m2.b * m3.c;
1.36222 + m.b = m2.a * m3.b + m2.b * m3.d;
1.36223 + m.c = m2.c * m3.a + m2.d * m3.c;
1.36224 + m.d = m2.d * m3.d + m2.c * m3.b;
1.36225 + m.tx = m2.tx * m3.a + m3.tx + m2.ty * m3.c;
1.36226 + m.ty = m2.ty * m3.d + m3.ty + m2.tx * m3.b;
1.36227 + }
1.36228 + } else {
1.36229 + m.a = m2.a;
1.36230 + m.b = m2.b;
1.36231 + m.c = m2.c;
1.36232 + m.d = m2.d;
1.36233 + m.tx = m2.tx;
1.36234 + m.ty = m2.ty;
1.36235 + }
1.36236 + m.invalid = false;
1.36237 + var nextNode = stack.pop();
1.36238 + var children = node._children;
1.36239 + for (var i = 0; i < children.length; i++) {
1.36240 + var child = children[i];
1.36241 + if (child !== nextNode) {
1.36242 + child._concatenatedTransform.invalid = true;
1.36243 + }
1.36244 + }
1.36245 + node = nextNode;
1.36246 + } while (node);
1.36247 + }
1.36248 + } else {
1.36249 + m = this._concatenatedTransform;
1.36250 + }
1.36251 + if (targetCoordSpace && targetCoordSpace !== this._stage) {
1.36252 + m2 = targetCoordMatrix || targetCoordSpace._getConcatenatedTransform(null, false);
1.36253 + var a = 1, b = 0, c = 0, d = 1, tx = 0, ty = 0;
1.36254 + if (m2.b || m2.c) {
1.36255 + var det = 1 / (m2.a * m2.d - m2.b * m2.c);
1.36256 + a = m2.d * det;
1.36257 + b = -m2.b * det;
1.36258 + c = -m2.c * det;
1.36259 + d = m2.a * det;
1.36260 + tx = -(a * m2.tx + c * m2.ty);
1.36261 + ty = -(b * m2.tx + d * m2.ty);
1.36262 + } else {
1.36263 + a = 1 / m2.a;
1.36264 + d = 1 / m2.d;
1.36265 + tx = m2.tx * -a;
1.36266 + ty = m2.ty * -d;
1.36267 + }
1.36268 + return {
1.36269 + a: a * m.a + c * m.b,
1.36270 + b: b * m.a + d * m.b,
1.36271 + c: a * m.c + c * m.d,
1.36272 + d: b * m.c + d * m.d,
1.36273 + tx: a * m.tx + c * m.ty + tx,
1.36274 + ty: b * m.tx + d * m.ty + ty
1.36275 + };
1.36276 + }
1.36277 + if (toDeviceSpace && stage) {
1.36278 + m2 = stage._concatenatedTransform;
1.36279 + return {
1.36280 + a: m.a * m2.a,
1.36281 + b: m.b * m2.d,
1.36282 + c: m.c * m2.a,
1.36283 + d: m.d * m2.d,
1.36284 + tx: m.tx * m2.a + m2.tx,
1.36285 + ty: m.ty * m2.d + m2.ty
1.36286 + };
1.36287 + }
1.36288 + return m;
1.36289 + },
1.36290 + _applyCurrentTransform: function (pt) {
1.36291 + var m = this._getConcatenatedTransform(null, false);
1.36292 + var x = pt.x;
1.36293 + var y = pt.y;
1.36294 + pt.x = m.a * x + m.c * y + m.tx | 0;
1.36295 + pt.y = m.d * y + m.b * x + m.ty | 0;
1.36296 + },
1.36297 + _applyConcatenatedInverseTransform: function (pt) {
1.36298 + var m = this._getConcatenatedTransform(null, false);
1.36299 + var det = 1 / (m.a * m.d - m.b * m.c);
1.36300 + var x = pt.x - m.tx;
1.36301 + var y = pt.y - m.ty;
1.36302 + pt.x = (m.d * x - m.c * y) * det | 0;
1.36303 + pt.y = (m.a * y - m.b * x) * det | 0;
1.36304 + },
1.36305 + _hitTest: function (use_xy, x, y, useShape, hitTestObject) {
1.36306 + if (use_xy) {
1.36307 + point.x = x;
1.36308 + point.y = y;
1.36309 + this._applyConcatenatedInverseTransform(point);
1.36310 + var b = this._getContentBounds();
1.36311 + if (!(point.x >= b.xMin && point.x < b.xMax && point.y >= b.yMin && point.y < b.yMax)) {
1.36312 + return false;
1.36313 + }
1.36314 + if (!useShape || !this._graphics) {
1.36315 + return true;
1.36316 + }
1.36317 + if (this._graphics) {
1.36318 + var subpaths = this._graphics._paths;
1.36319 + for (var i = 0, n = subpaths.length; i < n; i++) {
1.36320 + var path = subpaths[i];
1.36321 + if (path.isPointInPath(point.x, point.y)) {
1.36322 + return true;
1.36323 + }
1.36324 + if (path.strokeStyle) {
1.36325 + var strokePath = path._strokePath;
1.36326 + if (!strokePath) {
1.36327 + strokePath = path.strokePath(path.drawingStyles);
1.36328 + path._strokePath = strokePath;
1.36329 + }
1.36330 + if (strokePath.isPointInPath(point.x, point.y)) {
1.36331 + return true;
1.36332 + }
1.36333 + }
1.36334 + }
1.36335 + }
1.36336 + var children = this._children;
1.36337 + for (var i = 0, n = children.length; i < n; i++) {
1.36338 + var child = children[i];
1.36339 + if (child._hitTest && child._hitTest(true, x, y, true, null)) {
1.36340 + return true;
1.36341 + }
1.36342 + }
1.36343 + return false;
1.36344 + }
1.36345 + var b1 = this.getBounds(this._stage);
1.36346 + var b2 = hitTestObject.getBounds(hitTestObject._stage);
1.36347 + x = Math.max(b1.xMin, b2.xMin);
1.36348 + y = Math.max(b1.yMin, b2.yMin);
1.36349 + var width = Math.min(b1.xMax, b2.xMax) - x;
1.36350 + var height = Math.min(b1.yMax, b2.yMax) - y;
1.36351 + return width > 0 && height > 0;
1.36352 + },
1.36353 + _invalidate: function () {
1.36354 + this._invalid = true;
1.36355 + },
1.36356 + _invalidateBounds: function () {
1.36357 + var currentNode = this;
1.36358 + while (currentNode && !currentNode._bounds.invalid) {
1.36359 + currentNode._bounds.invalid = true;
1.36360 + currentNode = currentNode._parent;
1.36361 + }
1.36362 + },
1.36363 + _invalidateTransform: function () {
1.36364 + this._concatenatedTransform.invalid = true;
1.36365 + if (this._parent) {
1.36366 + this._parent._invalidateBounds();
1.36367 + }
1.36368 + },
1.36369 + _setTransformMatrix: function (matrix, convertToTwips) {
1.36370 + var a = matrix.a;
1.36371 + var b = matrix.b;
1.36372 + var c = matrix.c;
1.36373 + var d = matrix.d;
1.36374 + var tx, ty;
1.36375 + if (convertToTwips) {
1.36376 + tx = matrix.tx * 20 | 0;
1.36377 + ty = matrix.ty * 20 | 0;
1.36378 + } else {
1.36379 + tx = matrix.tx;
1.36380 + ty = matrix.ty;
1.36381 + }
1.36382 + var angle = a !== 0 ? Math.atan(b / a) : b > 0 ? Math.PI / 2 : -Math.PI / 2;
1.36383 + this._rotation = angle * 180 / Math.PI;
1.36384 + this._rotationCos = Math.cos(angle);
1.36385 + this._rotationSin = Math.sin(angle);
1.36386 + var sx = Math.sqrt(a * a + b * b);
1.36387 + this._scaleX = a > 0 ? sx : -sx;
1.36388 + var sy = Math.sqrt(d * d + c * c);
1.36389 + this._scaleY = d > 0 ? sy : -sy;
1.36390 + var transform = this._currentTransform;
1.36391 + transform.a = a;
1.36392 + transform.b = b;
1.36393 + transform.c = c;
1.36394 + transform.d = d;
1.36395 + transform.tx = tx;
1.36396 + transform.ty = ty;
1.36397 + this._invalidateTransform();
1.36398 + },
1.36399 + get accessibilityProperties() {
1.36400 + return this._accessibilityProperties;
1.36401 + },
1.36402 + set accessibilityProperties(val) {
1.36403 + this._accessibilityProperties = val;
1.36404 + },
1.36405 + get alpha() {
1.36406 + return this._alpha;
1.36407 + },
1.36408 + set alpha(val) {
1.36409 + if (val === this._alpha) {
1.36410 + return;
1.36411 + }
1.36412 + this._invalidate();
1.36413 + this._alpha = val;
1.36414 + this._animated = false;
1.36415 + },
1.36416 + get blendMode() {
1.36417 + return this._blendMode;
1.36418 + },
1.36419 + set blendMode(val) {
1.36420 + if (blendModes.indexOf(val) >= 0) {
1.36421 + this._blendMode = val;
1.36422 + } else {
1.36423 + throwError('ArgumentError', Errors.InvalidEnumError, 'blendMode');
1.36424 + }
1.36425 + this._animated = false;
1.36426 + },
1.36427 + get cacheAsBitmap() {
1.36428 + return this._cacheAsBitmap;
1.36429 + },
1.36430 + set cacheAsBitmap(val) {
1.36431 + this._cacheAsBitmap = this._filters.length ? true : val;
1.36432 + this._animated = false;
1.36433 + },
1.36434 + get filters() {
1.36435 + return this._filters;
1.36436 + },
1.36437 + set filters(val) {
1.36438 + if (val.length) {
1.36439 + if (!this._filters.length)
1.36440 + this._wasCachedAsBitmap = this._cacheAsBitmap;
1.36441 + this._cacheAsBitmap = true;
1.36442 + } else {
1.36443 + this._cacheAsBitmap = this._wasCachedAsBitmap;
1.36444 + }
1.36445 + this._filters = val;
1.36446 + this._animated = false;
1.36447 + },
1.36448 + get height() {
1.36449 + var bounds = this._getContentBounds();
1.36450 + var t = this._currentTransform;
1.36451 + return Math.abs(t.b) * (bounds.xMax - bounds.xMin) + Math.abs(t.d) * (bounds.yMax - bounds.yMin) | 0;
1.36452 + },
1.36453 + set height(val) {
1.36454 + if (val < 0) {
1.36455 + return;
1.36456 + }
1.36457 + var u = Math.abs(this._rotationCos);
1.36458 + var v = Math.abs(this._rotationSin);
1.36459 + var bounds = this._getContentBounds();
1.36460 + var baseHeight = v * (bounds.xMax - bounds.xMin) + u * (bounds.yMax - bounds.yMin);
1.36461 + if (!baseHeight) {
1.36462 + return;
1.36463 + }
1.36464 + var baseWidth = u * (bounds.xMax - bounds.xMin) + v * (bounds.yMax - bounds.yMin);
1.36465 + this.scaleX = this.width / baseWidth;
1.36466 + this.scaleY = val / baseHeight;
1.36467 + },
1.36468 + get loaderInfo() {
1.36469 + return this._loader && this._loader._contentLoaderInfo || this._parent.loaderInfo;
1.36470 + },
1.36471 + get mask() {
1.36472 + return this._mask;
1.36473 + },
1.36474 + set mask(val) {
1.36475 + if (this._mask === val) {
1.36476 + return;
1.36477 + }
1.36478 + this._invalidate();
1.36479 + if (val && val._maskedObject) {
1.36480 + val._maskedObject.mask = null;
1.36481 + }
1.36482 + this._mask = val;
1.36483 + if (val) {
1.36484 + val._maskedObject = this;
1.36485 + }
1.36486 + this._animated = false;
1.36487 + },
1.36488 + get name() {
1.36489 + return this._name || (this._name = generateName());
1.36490 + },
1.36491 + set name(val) {
1.36492 + this._name = val;
1.36493 + },
1.36494 + get mouseX() {
1.36495 + if (!this._stage) {
1.36496 + return 0;
1.36497 + }
1.36498 + point.x = this._stage._mouseX;
1.36499 + point.y = this._stage._mouseY;
1.36500 + this._applyConcatenatedInverseTransform(point);
1.36501 + return point.x;
1.36502 + },
1.36503 + get mouseY() {
1.36504 + if (!this._stage) {
1.36505 + return 0;
1.36506 + }
1.36507 + point.x = this._stage._mouseX;
1.36508 + point.y = this._stage._mouseY;
1.36509 + this._applyConcatenatedInverseTransform(point);
1.36510 + return point.y;
1.36511 + },
1.36512 + get opaqueBackground() {
1.36513 + return this._opaqueBackground;
1.36514 + },
1.36515 + set opaqueBackground(val) {
1.36516 + this._opaqueBackground = val;
1.36517 + this._animated = false;
1.36518 + },
1.36519 + get parent() {
1.36520 + return this._index > -1 ? this._parent : null;
1.36521 + },
1.36522 + get root() {
1.36523 + return this._stage && this._stage._root;
1.36524 + },
1.36525 + get rotation() {
1.36526 + return this._rotation;
1.36527 + },
1.36528 + set rotation(val) {
1.36529 + val %= 360;
1.36530 + if (val > 180) {
1.36531 + val -= 360;
1.36532 + }
1.36533 + if (val === this._rotation)
1.36534 + return;
1.36535 + this._invalidate();
1.36536 + this._invalidateTransform();
1.36537 + this._rotation = val;
1.36538 + var u, v;
1.36539 + switch (val) {
1.36540 + case 0:
1.36541 + case 360:
1.36542 + u = 1, v = 0;
1.36543 + break;
1.36544 + case 90:
1.36545 + case -270:
1.36546 + u = 0, v = 1;
1.36547 + break;
1.36548 + case 180:
1.36549 + case -180:
1.36550 + u = -1, v = 0;
1.36551 + break;
1.36552 + case 270:
1.36553 + case -90:
1.36554 + u = 0, v = -1;
1.36555 + break;
1.36556 + default:
1.36557 + var angle = this._rotation / 180 * Math.PI;
1.36558 + u = Math.cos(angle);
1.36559 + v = Math.sin(angle);
1.36560 + break;
1.36561 + }
1.36562 + this._rotationCos = u;
1.36563 + this._rotationSin = v;
1.36564 + var m = this._currentTransform;
1.36565 + m.a = u * this._scaleX;
1.36566 + m.b = v * this._scaleX;
1.36567 + m.c = -v * this._scaleY;
1.36568 + m.d = u * this._scaleY;
1.36569 + this._animated = false;
1.36570 + },
1.36571 + get rotationX() {
1.36572 + return 0;
1.36573 + },
1.36574 + set rotationX(val) {
1.36575 + somewhatImplemented('DisplayObject.rotationX');
1.36576 + },
1.36577 + get rotationY() {
1.36578 + return 0;
1.36579 + },
1.36580 + set rotationY(val) {
1.36581 + somewhatImplemented('DisplayObject.rotationY');
1.36582 + },
1.36583 + get rotationZ() {
1.36584 + return this.rotation;
1.36585 + },
1.36586 + set rotationZ(val) {
1.36587 + this.rotation = val;
1.36588 + somewhatImplemented('DisplayObject.rotationZ');
1.36589 + },
1.36590 + get stage() {
1.36591 + return this._stage;
1.36592 + },
1.36593 + get scaleX() {
1.36594 + return this._scaleX;
1.36595 + },
1.36596 + set scaleX(val) {
1.36597 + if (val === this._scaleX)
1.36598 + return;
1.36599 + this._invalidate();
1.36600 + this._invalidateTransform();
1.36601 + this._scaleX = val;
1.36602 + var m = this._currentTransform;
1.36603 + m.a = this._rotationCos * val;
1.36604 + m.b = this._rotationSin * val;
1.36605 + this._animated = false;
1.36606 + },
1.36607 + get scaleY() {
1.36608 + return this._scaleY;
1.36609 + },
1.36610 + set scaleY(val) {
1.36611 + if (val === this._scaleY)
1.36612 + return;
1.36613 + this._invalidate();
1.36614 + this._invalidateTransform();
1.36615 + this._scaleY = val;
1.36616 + var m = this._currentTransform;
1.36617 + m.c = -this._rotationSin * val;
1.36618 + m.d = this._rotationCos * val;
1.36619 + this._animated = false;
1.36620 + },
1.36621 + get scaleZ() {
1.36622 + return 1;
1.36623 + },
1.36624 + set scaleZ(val) {
1.36625 + somewhatImplemented('DisplayObject.scaleZ');
1.36626 + },
1.36627 + get scale9Grid() {
1.36628 + return this._scale9Grid;
1.36629 + },
1.36630 + set scale9Grid(val) {
1.36631 + somewhatImplemented('DisplayObject.scale9Grid');
1.36632 + this._scale9Grid = val;
1.36633 + this._animated = false;
1.36634 + },
1.36635 + get scrollRect() {
1.36636 + return this._scrollRect;
1.36637 + },
1.36638 + set scrollRect(val) {
1.36639 + somewhatImplemented('DisplayObject.scrollRect');
1.36640 + this._scrollRect = val;
1.36641 + },
1.36642 + get transform() {
1.36643 + return new flash.geom.Transform(this);
1.36644 + },
1.36645 + set transform(val) {
1.36646 + var transform = this.transform;
1.36647 + transform.colorTransform = val.colorTransform;
1.36648 + if (val.matrix3D) {
1.36649 + transform.matrix3D = val.matrix3D;
1.36650 + } else {
1.36651 + transform.matrix = val.matrix;
1.36652 + }
1.36653 + },
1.36654 + get visible() {
1.36655 + return this._visible;
1.36656 + },
1.36657 + set visible(val) {
1.36658 + if (val === this._visible)
1.36659 + return;
1.36660 + this._invalidate();
1.36661 + this._visible = val;
1.36662 + this._animated = false;
1.36663 + },
1.36664 + get width() {
1.36665 + var bounds = this._getContentBounds();
1.36666 + var t = this._currentTransform;
1.36667 + return Math.abs(t.a) * (bounds.xMax - bounds.xMin) + Math.abs(t.c) * (bounds.yMax - bounds.yMin) | 0;
1.36668 + },
1.36669 + set width(val) {
1.36670 + if (val < 0) {
1.36671 + return;
1.36672 + }
1.36673 + var u = Math.abs(this._rotationCos);
1.36674 + var v = Math.abs(this._rotationSin);
1.36675 + var bounds = this._getContentBounds();
1.36676 + var baseWidth = u * (bounds.xMax - bounds.xMin) + v * (bounds.yMax - bounds.yMin);
1.36677 + if (!baseWidth) {
1.36678 + return;
1.36679 + }
1.36680 + var baseHeight = v * (bounds.xMax - bounds.xMin) + u * (bounds.yMax - bounds.yMin);
1.36681 + this.scaleY = this.height / baseHeight;
1.36682 + this.scaleX = val / baseWidth;
1.36683 + },
1.36684 + get x() {
1.36685 + return this._currentTransform.tx;
1.36686 + },
1.36687 + set x(val) {
1.36688 + if (val === this._currentTransform.tx) {
1.36689 + return;
1.36690 + }
1.36691 + this._invalidate();
1.36692 + this._invalidateTransform();
1.36693 + this._currentTransform.tx = val;
1.36694 + this._animated = false;
1.36695 + },
1.36696 + get y() {
1.36697 + return this._currentTransform.ty;
1.36698 + },
1.36699 + set y(val) {
1.36700 + if (val === this._currentTransform.ty) {
1.36701 + return;
1.36702 + }
1.36703 + this._invalidate();
1.36704 + this._invalidateTransform();
1.36705 + this._currentTransform.ty = val;
1.36706 + this._animated = false;
1.36707 + },
1.36708 + get z() {
1.36709 + return 0;
1.36710 + },
1.36711 + set z(val) {
1.36712 + somewhatImplemented('DisplayObject.z');
1.36713 + },
1.36714 + _getContentBounds: function () {
1.36715 + var bounds = this._bounds;
1.36716 + if (bounds.invalid) {
1.36717 + var bbox = this._bbox;
1.36718 + var xMin = Number.MAX_VALUE;
1.36719 + var xMax = Number.MIN_VALUE;
1.36720 + var yMin = Number.MAX_VALUE;
1.36721 + var yMax = Number.MIN_VALUE;
1.36722 + if (bbox) {
1.36723 + xMin = bbox.xMin;
1.36724 + xMax = bbox.xMax;
1.36725 + yMin = bbox.yMin;
1.36726 + yMax = bbox.yMax;
1.36727 + } else {
1.36728 + var children = this._children;
1.36729 + var numChildren = children.length;
1.36730 + for (var i = 0; i < numChildren; i++) {
1.36731 + var child = children[i];
1.36732 + if (!flash.display.DisplayObject.class.isInstanceOf(child)) {
1.36733 + continue;
1.36734 + }
1.36735 + var b = child.getBounds(this);
1.36736 + var x1 = b.xMin;
1.36737 + var y1 = b.yMin;
1.36738 + var x2 = b.xMax;
1.36739 + var y2 = b.yMax;
1.36740 + xMin = Math.min(xMin, x1, x2);
1.36741 + xMax = Math.max(xMax, x1, x2);
1.36742 + yMin = Math.min(yMin, y1, y2);
1.36743 + yMax = Math.max(yMax, y1, y2);
1.36744 + }
1.36745 + if (this._graphics) {
1.36746 + var b = this._graphics._getBounds(true);
1.36747 + if (b.xMin !== b.xMax && b.yMin !== b.yMax) {
1.36748 + var x1 = b.xMin;
1.36749 + var y1 = b.yMin;
1.36750 + var x2 = b.xMax;
1.36751 + var y2 = b.yMax;
1.36752 + xMin = Math.min(xMin, x1, x2);
1.36753 + xMax = Math.max(xMax, x1, x2);
1.36754 + yMin = Math.min(yMin, y1, y2);
1.36755 + yMax = Math.max(yMax, y1, y2);
1.36756 + }
1.36757 + }
1.36758 + }
1.36759 + if (xMin === Number.MAX_VALUE) {
1.36760 + xMin = xMax = yMin = yMax = 0;
1.36761 + }
1.36762 + bounds.xMin = xMin;
1.36763 + bounds.xMax = xMax;
1.36764 + bounds.yMin = yMin;
1.36765 + bounds.yMax = yMax;
1.36766 + bounds.invalid = false;
1.36767 + }
1.36768 + return bounds;
1.36769 + },
1.36770 + _getRegion: function getRegion(targetCoordSpace) {
1.36771 + var b;
1.36772 + var filters = this._filters;
1.36773 + if (filters.length) {
1.36774 + var xMin = Number.MAX_VALUE;
1.36775 + var xMax = Number.MIN_VALUE;
1.36776 + var yMin = Number.MAX_VALUE;
1.36777 + var yMax = Number.MIN_VALUE;
1.36778 + if (this._graphics) {
1.36779 + b = this._graphics._getBounds(true);
1.36780 + if (b) {
1.36781 + xMin = b.xMin;
1.36782 + xMax = b.xMax;
1.36783 + yMin = b.yMin;
1.36784 + yMax = b.yMax;
1.36785 + }
1.36786 + }
1.36787 + var children = this._children;
1.36788 + for (var i = 0; i < children.length; i++) {
1.36789 + var child = children[i];
1.36790 + b = children[i]._getRegion(this);
1.36791 + if (b.xMin < xMin) {
1.36792 + xMin = b.xMin;
1.36793 + }
1.36794 + if (b.xMax > xMax) {
1.36795 + xMax = b.xMax;
1.36796 + }
1.36797 + if (b.yMin < yMin) {
1.36798 + yMin = b.yMin;
1.36799 + }
1.36800 + if (b.yMax > yMax) {
1.36801 + yMax = b.yMax;
1.36802 + }
1.36803 + }
1.36804 + if (xMin === Number.MAX_VALUE) {
1.36805 + return {
1.36806 + xMin: 0,
1.36807 + xMax: 0,
1.36808 + yMin: 0,
1.36809 + yMax: 0
1.36810 + };
1.36811 + }
1.36812 + b = {
1.36813 + xMin: xMin,
1.36814 + xMax: xMax,
1.36815 + yMin: yMin,
1.36816 + yMax: yMax
1.36817 + };
1.36818 + for (var i = 0; i < filters.length; i++) {
1.36819 + filters[i]._updateFilterBounds(b);
1.36820 + }
1.36821 + } else {
1.36822 + b = this._graphics ? this._graphics._getBounds(true) : this._getContentBounds();
1.36823 + }
1.36824 + return this._getTransformedRect(b, targetCoordSpace);
1.36825 + },
1.36826 + getBounds: function (targetCoordSpace) {
1.36827 + return this._getTransformedRect(this._getContentBounds(), targetCoordSpace);
1.36828 + },
1.36829 + _getTransformedRect: function (rect, targetCoordSpace) {
1.36830 + if (!targetCoordSpace || targetCoordSpace === this) {
1.36831 + return rect;
1.36832 + }
1.36833 + var xMin = rect.xMin;
1.36834 + var xMax = rect.xMax;
1.36835 + var yMin = rect.yMin;
1.36836 + var yMax = rect.yMax;
1.36837 + if (xMax - xMin === 0 || yMax - yMin === 0) {
1.36838 + return {
1.36839 + xMin: 0,
1.36840 + yMin: 0,
1.36841 + xMax: 0,
1.36842 + yMax: 0
1.36843 + };
1.36844 + }
1.36845 + var m = targetCoordSpace && !flash.display.DisplayObject.class.isInstanceOf(targetCoordSpace) ? targetCoordSpace : this._getConcatenatedTransform(targetCoordSpace, false);
1.36846 + var x0 = m.a * xMin + m.c * yMin + m.tx | 0;
1.36847 + var y0 = m.b * xMin + m.d * yMin + m.ty | 0;
1.36848 + var x1 = m.a * xMax + m.c * yMin + m.tx | 0;
1.36849 + var y1 = m.b * xMax + m.d * yMin + m.ty | 0;
1.36850 + var x2 = m.a * xMax + m.c * yMax + m.tx | 0;
1.36851 + var y2 = m.b * xMax + m.d * yMax + m.ty | 0;
1.36852 + var x3 = m.a * xMin + m.c * yMax + m.tx | 0;
1.36853 + var y3 = m.b * xMin + m.d * yMax + m.ty | 0;
1.36854 + var tmp = 0;
1.36855 + if (x0 > x1) {
1.36856 + tmp = x0;
1.36857 + x0 = x1;
1.36858 + x1 = tmp;
1.36859 + }
1.36860 + if (x2 > x3) {
1.36861 + tmp = x2;
1.36862 + x2 = x3;
1.36863 + x3 = tmp;
1.36864 + }
1.36865 + xMin = x0 < x2 ? x0 : x2;
1.36866 + xMax = x1 > x3 ? x1 : x3;
1.36867 + if (y0 > y1) {
1.36868 + tmp = y0;
1.36869 + y0 = y1;
1.36870 + y1 = tmp;
1.36871 + }
1.36872 + if (y2 > y3) {
1.36873 + tmp = y2;
1.36874 + y2 = y3;
1.36875 + y3 = tmp;
1.36876 + }
1.36877 + yMin = y0 < y2 ? y0 : y2;
1.36878 + yMax = y1 > y3 ? y1 : y3;
1.36879 + return {
1.36880 + xMin: xMin,
1.36881 + yMin: yMin,
1.36882 + xMax: xMax,
1.36883 + yMax: yMax
1.36884 + };
1.36885 + },
1.36886 + hitTestObject: function (obj) {
1.36887 + return this._hitTest(false, 0, 0, false, obj);
1.36888 + },
1.36889 + hitTestPoint: function (x, y, shapeFlag) {
1.36890 + return this._hitTest(true, x, y, shapeFlag, null);
1.36891 + },
1.36892 + destroy: function () {
1.36893 + if (this._destroyed) {
1.36894 + return;
1.36895 + }
1.36896 + this._destroyed = true;
1.36897 + this.cleanupBroadcastListeners();
1.36898 + },
1.36899 + cleanupBroadcastListeners: function () {
1.36900 + var listenerLists = this._listeners;
1.36901 + for (var type in listenerLists) {
1.36902 + avm2.systemDomain.onMessage.unregister(type, this._onBroadcastMessage);
1.36903 + }
1.36904 + }
1.36905 + };
1.36906 + var desc = Object.getOwnPropertyDescriptor;
1.36907 + def.__glue__ = {
1.36908 + native: {
1.36909 + instance: {
1.36910 + root: desc(def, 'root'),
1.36911 + stage: desc(def, 'stage'),
1.36912 + name: desc(def, 'name'),
1.36913 + parent: desc(def, 'parent'),
1.36914 + mask: desc(def, 'mask'),
1.36915 + visible: desc(def, 'visible'),
1.36916 + x: {
1.36917 + get: function x() {
1.36918 + return this.x / 20;
1.36919 + },
1.36920 + set: function x(value) {
1.36921 + this.x = value * 20 | 0;
1.36922 + }
1.36923 + },
1.36924 + y: {
1.36925 + get: function y() {
1.36926 + return this.y / 20;
1.36927 + },
1.36928 + set: function y(value) {
1.36929 + this.y = value * 20 | 0;
1.36930 + }
1.36931 + },
1.36932 + z: {
1.36933 + get: function z() {
1.36934 + return this.z / 20;
1.36935 + },
1.36936 + set: function z(value) {
1.36937 + this.z = value * 20 | 0;
1.36938 + }
1.36939 + },
1.36940 + scaleX: desc(def, 'scaleX'),
1.36941 + scaleY: desc(def, 'scaleY'),
1.36942 + scaleZ: desc(def, 'scaleZ'),
1.36943 + mouseX: {
1.36944 + get: function mouseX() {
1.36945 + return this.mouseX / 20;
1.36946 + },
1.36947 + set: function mouseX(value) {
1.36948 + this.mouseX = value * 20 | 0;
1.36949 + }
1.36950 + },
1.36951 + mouseY: {
1.36952 + get: function mouseY() {
1.36953 + return this.mouseY / 20;
1.36954 + },
1.36955 + set: function mouseY(value) {
1.36956 + this.mouseY = value * 20 | 0;
1.36957 + }
1.36958 + },
1.36959 + rotation: desc(def, 'rotation'),
1.36960 + rotationX: desc(def, 'rotationX'),
1.36961 + rotationY: desc(def, 'rotationY'),
1.36962 + rotationZ: desc(def, 'rotationZ'),
1.36963 + alpha: desc(def, 'alpha'),
1.36964 + width: {
1.36965 + get: function width() {
1.36966 + return this.width / 20;
1.36967 + },
1.36968 + set: function width(value) {
1.36969 + this.width = value * 20 | 0;
1.36970 + }
1.36971 + },
1.36972 + height: {
1.36973 + get: function height() {
1.36974 + return this.height / 20;
1.36975 + },
1.36976 + set: function height(value) {
1.36977 + this.height = value * 20 | 0;
1.36978 + }
1.36979 + },
1.36980 + _hitTest: function (use_xy, x, y, useShape, hitTestObject) {
1.36981 + x = x * 20 | 0;
1.36982 + y = y * 20 | 0;
1.36983 + return this._hitTest(use_xy, x, y, useShape, hitTestObject);
1.36984 + },
1.36985 + cacheAsBitmap: desc(def, 'cacheAsBitmap'),
1.36986 + opaqueBackground: desc(def, 'opaqueBackground'),
1.36987 + scrollRect: desc(def, 'scrollRect'),
1.36988 + filters: desc(def, 'filters'),
1.36989 + blendMode: desc(def, 'blendMode'),
1.36990 + transform: desc(def, 'transform'),
1.36991 + scale9Grid: desc(def, 'scale9Grid'),
1.36992 + loaderInfo: desc(def, 'loaderInfo'),
1.36993 + accessibilityProperties: desc(def, 'accessibilityProperties'),
1.36994 + globalToLocal: function (pt) {
1.36995 + point.x = pt.x * 20 | 0;
1.36996 + point.y = pt.y * 20 | 0;
1.36997 + this._applyConcatenatedInverseTransform(point);
1.36998 + return new flash.geom.Point(point.x / 20, point.y / 20);
1.36999 + },
1.37000 + localToGlobal: function (pt) {
1.37001 + point.x = pt.x * 20 | 0;
1.37002 + point.y = pt.y * 20 | 0;
1.37003 + this._applyCurrentTransform(point);
1.37004 + return new flash.geom.Point(point.x / 20, point.y / 20);
1.37005 + },
1.37006 + getBounds: function (targetCoordSpace) {
1.37007 + var bounds = this.getBounds(targetCoordSpace);
1.37008 + return new flash.geom.Rectangle(bounds.xMin / 20, bounds.yMin / 20, (bounds.xMax - bounds.xMin) / 20, (bounds.yMax - bounds.yMin) / 20);
1.37009 + },
1.37010 + getRect: function (targetCoordSpace) {
1.37011 + somewhatImplemented('DisplayObject.getRect');
1.37012 + var bounds = this.getBounds(targetCoordSpace);
1.37013 + return new flash.geom.Rectangle(bounds.xMin / 20, bounds.yMin / 20, (bounds.xMax - bounds.xMin) / 20, (bounds.yMax - bounds.yMin) / 20);
1.37014 + }
1.37015 + }
1.37016 + }
1.37017 + };
1.37018 + return def;
1.37019 + }.call(this);
1.37020 +var DisplayObjectContainerDefinition = function () {
1.37021 + var def = {
1.37022 + get mouseChildren() {
1.37023 + return this._mouseChildren;
1.37024 + },
1.37025 + set mouseChildren(val) {
1.37026 + this._mouseChildren = val;
1.37027 + },
1.37028 + get numChildren() {
1.37029 + return this._children.length;
1.37030 + },
1.37031 + get tabChildren() {
1.37032 + return this._tabChildren;
1.37033 + },
1.37034 + set tabChildren(val) {
1.37035 + this._tabChildren = val;
1.37036 + },
1.37037 + get textSnapshot() {
1.37038 + notImplemented();
1.37039 + },
1.37040 + addChild: function (child) {
1.37041 + return this.addChildAt(child, this._children.length);
1.37042 + },
1.37043 + addChildAt: function (child, index) {
1.37044 + if (child === this) {
1.37045 + throwError('ArgumentError', Errors.CantAddSelfError);
1.37046 + }
1.37047 + if (child._parent === this) {
1.37048 + return this.setChildIndex(child, index);
1.37049 + }
1.37050 + var children = this._children;
1.37051 + if (index < 0 || index > children.length) {
1.37052 + throwError('RangeError', Errors.ParamRangeError);
1.37053 + }
1.37054 + if (child._index > -1) {
1.37055 + var LoaderClass = avm2.systemDomain.getClass('flash.display.Loader');
1.37056 + if (LoaderClass.isInstanceOf(child._parent)) {
1.37057 + def.removeChild.call(child._parent, child);
1.37058 + } else {
1.37059 + child._parent.removeChild(child);
1.37060 + }
1.37061 + }
1.37062 + if (!this._sparse) {
1.37063 + for (var i = children.length; i && i > index; i--) {
1.37064 + children[i - 1]._index++;
1.37065 + }
1.37066 + }
1.37067 + children.splice(index, 0, child);
1.37068 + child._invalidateTransform();
1.37069 + child._owned = false;
1.37070 + child._parent = this;
1.37071 + child._stage = this._stage;
1.37072 + child._index = index;
1.37073 + child._dispatchEvent('added', undefined, true);
1.37074 + if (this._stage) {
1.37075 + this._stage._addToStage(child);
1.37076 + }
1.37077 + return child;
1.37078 + },
1.37079 + areInaccessibleObjectsUnderPoint: function (pt) {
1.37080 + notImplemented();
1.37081 + },
1.37082 + contains: function (child) {
1.37083 + return child._parent === this;
1.37084 + },
1.37085 + getChildAt: function (index) {
1.37086 + var children = this._children;
1.37087 + if (index < 0 || index > children.length) {
1.37088 + throwError('RangeError', Errors.ParamRangeError);
1.37089 + }
1.37090 + var child = children[index];
1.37091 + if (!flash.display.DisplayObject.class.isInstanceOf(child)) {
1.37092 + return null;
1.37093 + }
1.37094 + return child;
1.37095 + },
1.37096 + getChildByName: function (name) {
1.37097 + var children = this._children;
1.37098 + for (var i = 0, n = children.length; i < n; i++) {
1.37099 + var child = children[i];
1.37100 + if (child.name === name) {
1.37101 + return this.getChildAt(i);
1.37102 + }
1.37103 + }
1.37104 + return null;
1.37105 + },
1.37106 + getChildIndex: function (child) {
1.37107 + if (child._parent !== this) {
1.37108 + throwError('ArgumentError', Errors.NotAChildError);
1.37109 + }
1.37110 + return this._sparse ? this._children.indexOf(child) : child._index;
1.37111 + },
1.37112 + getObjectsUnderPoint: function (pt) {
1.37113 + notImplemented();
1.37114 + },
1.37115 + removeChild: function (child) {
1.37116 + if (child._parent !== this) {
1.37117 + throwError('ArgumentError', Errors.NotAChildError);
1.37118 + }
1.37119 + return this.removeChildAt(this.getChildIndex(child));
1.37120 + },
1.37121 + removeChildAt: function (index) {
1.37122 + var children = this._children;
1.37123 + if (index < 0 || index >= children.length) {
1.37124 + throwError('RangeError', Errors.ParamRangeError);
1.37125 + }
1.37126 + var child = children[index];
1.37127 + child._dispatchEvent('removed', undefined, true);
1.37128 + if (this._stage) {
1.37129 + this._stage._removeFromStage(child);
1.37130 + }
1.37131 + if (!this._sparse) {
1.37132 + for (var i = children.length; i && i > index; i--) {
1.37133 + children[i - 1]._index--;
1.37134 + }
1.37135 + }
1.37136 + children.splice(index, 1);
1.37137 + child._invalidateTransform();
1.37138 + child._owned = false;
1.37139 + child._parent = null;
1.37140 + child._index = -1;
1.37141 + return child;
1.37142 + },
1.37143 + setChildIndex: function (child, index) {
1.37144 + if (child._parent !== this) {
1.37145 + throwError('ArgumentError', Errors.NotAChildError);
1.37146 + }
1.37147 + var currentIndex = this.getChildIndex(child);
1.37148 + if (currentIndex === index) {
1.37149 + return;
1.37150 + }
1.37151 + var children = this._children;
1.37152 + if (index < 0 || index > children.length) {
1.37153 + throwError('RangeError', Errors.ParamRangeError);
1.37154 + }
1.37155 + children.splice(currentIndex, 1);
1.37156 + children.splice(index, 0, child);
1.37157 + if (!this._sparse) {
1.37158 + var i = currentIndex < index ? currentIndex : index;
1.37159 + while (i < children.length) {
1.37160 + children[i]._index = i++;
1.37161 + }
1.37162 + }
1.37163 + child._owned = false;
1.37164 + child._invalidate();
1.37165 + return child;
1.37166 + },
1.37167 + removeChildren: function (beginIndex, endIndex) {
1.37168 + beginIndex = arguments.length < 1 ? 0 : beginIndex | 0;
1.37169 + endIndex = arguments.length < 2 ? 2147483647 : endIndex | 0;
1.37170 + var numChildren = this._children.length;
1.37171 + if (beginIndex < 0 || endIndex < 0 || endIndex < beginIndex) {
1.37172 + throwError('RangeError', Errors.ParamRangeError);
1.37173 + }
1.37174 + if (numChildren === 0) {
1.37175 + return;
1.37176 + }
1.37177 + if (endIndex > numChildren - 1) {
1.37178 + endIndex = numChildren - 1;
1.37179 + }
1.37180 + var count = endIndex - beginIndex + 1;
1.37181 + while (count--) {
1.37182 + this.removeChildAt(beginIndex);
1.37183 + }
1.37184 + },
1.37185 + swapChildren: function (child1, child2) {
1.37186 + if (child1._parent !== this || child2._parent !== this) {
1.37187 + throwError('ArgumentError', Errors.NotAChildError);
1.37188 + }
1.37189 + this.swapChildrenAt(this.getChildIndex(child1), this.getChildIndex(child2));
1.37190 + },
1.37191 + swapChildrenAt: function (index1, index2) {
1.37192 + var children = this._children;
1.37193 + var numChildren = children.length;
1.37194 + if (index1 < 0 || index1 > numChildren || index2 < 0 || index2 > numChildren) {
1.37195 + throwError('RangeError', Errors.ParamRangeError);
1.37196 + }
1.37197 + var child1 = children[index1];
1.37198 + var child2 = children[index2];
1.37199 + children[index1] = child2;
1.37200 + children[index2] = child1;
1.37201 + child1._index = index2;
1.37202 + child2._index = index1;
1.37203 + child1._owned = false;
1.37204 + child2._owned = false;
1.37205 + child1._invalidate();
1.37206 + child2._invalidate();
1.37207 + },
1.37208 + destroy: function () {
1.37209 + if (this._destroyed) {
1.37210 + return;
1.37211 + }
1.37212 + this._destroyed = true;
1.37213 + this._children.forEach(function (child) {
1.37214 + if (child.destroy) {
1.37215 + child.destroy();
1.37216 + }
1.37217 + });
1.37218 + this.cleanupBroadcastListeners();
1.37219 + }
1.37220 + };
1.37221 + var desc = Object.getOwnPropertyDescriptor;
1.37222 + def.initialize = function () {
1.37223 + this._mouseChildren = true;
1.37224 + this._tabChildren = true;
1.37225 + this._sparse = false;
1.37226 + this._isContainer = true;
1.37227 + };
1.37228 + def.__glue__ = {
1.37229 + native: {
1.37230 + instance: {
1.37231 + numChildren: desc(def, 'numChildren'),
1.37232 + tabChildren: desc(def, 'tabChildren'),
1.37233 + mouseChildren: desc(def, 'mouseChildren'),
1.37234 + textSnapshot: desc(def, 'textSnapshot'),
1.37235 + addChild: def.addChild,
1.37236 + addChildAt: def.addChildAt,
1.37237 + removeChild: def.removeChild,
1.37238 + removeChildAt: def.removeChildAt,
1.37239 + getChildIndex: def.getChildIndex,
1.37240 + setChildIndex: def.setChildIndex,
1.37241 + getChildAt: def.getChildAt,
1.37242 + getChildByName: def.getChildByName,
1.37243 + contains: def.contains,
1.37244 + swapChildrenAt: def.swapChildrenAt,
1.37245 + swapChildren: def.swapChildren,
1.37246 + removeChildren: def.removeChildren
1.37247 + }
1.37248 + }
1.37249 + };
1.37250 + return def;
1.37251 + }.call(this);
1.37252 +var FrameLabelDefinition = function () {
1.37253 + return {
1.37254 + __class__: 'flash.display.FrameLabel',
1.37255 + initialize: function () {
1.37256 + },
1.37257 + __glue__: {
1.37258 + native: {
1.37259 + static: {},
1.37260 + instance: {
1.37261 + ctor: function ctor(name, frame) {
1.37262 + this._name = name;
1.37263 + this._frame = frame;
1.37264 + },
1.37265 + name: {
1.37266 + get: function name() {
1.37267 + return this._name;
1.37268 + }
1.37269 + },
1.37270 + frame: {
1.37271 + get: function frame() {
1.37272 + return this._frame;
1.37273 + }
1.37274 + }
1.37275 + }
1.37276 + }
1.37277 + }
1.37278 + };
1.37279 + }.call(this);
1.37280 +var GraphicsDefinition = function () {
1.37281 + var GRAPHICS_PATH_WINDING_EVEN_ODD = 'evenOdd';
1.37282 + var GRAPHICS_PATH_WINDING_NON_ZERO = 'nonZero';
1.37283 + var def = {
1.37284 + __class__: 'flash.display.Graphics',
1.37285 + initialize: function () {
1.37286 + this._paths = [];
1.37287 + this.beginPath();
1.37288 + this._bitmap = null;
1.37289 + this._parent = 0;
1.37290 + this.bbox = null;
1.37291 + this.strokeBbox = null;
1.37292 + },
1.37293 + _invalidate: function () {
1.37294 + this.bbox = null;
1.37295 + this.strokeBbox = null;
1.37296 + this._parent._invalidate();
1.37297 + this._parent._invalidateBounds();
1.37298 + },
1.37299 + beginPath: function () {
1.37300 + var oldPath = this._currentPath;
1.37301 + if (oldPath && (oldPath.commands.length === 0 || oldPath.commands.length === 1 && oldPath.commands[0] === SHAPE_MOVE_TO)) {
1.37302 + return;
1.37303 + }
1.37304 + var path = this._currentPath = new ShapePath(null, null);
1.37305 + this._paths.push(path);
1.37306 + if (oldPath) {
1.37307 + path.fillStyle = oldPath.fillStyle;
1.37308 + path.lineStyle = oldPath.lineStyle;
1.37309 + path.fillRule = oldPath.fillRule;
1.37310 + }
1.37311 + },
1.37312 + _drawPathObject: function (path) {
1.37313 + if (path.__class__ === 'flash.display.GraphicsPath')
1.37314 + this.drawPath(path.commands, path.data, path.winding);
1.37315 + else if (path.__class__ === 'flash.display.GraphicsTrianglePath')
1.37316 + this.drawTriangles(path.vertices, path.indices, path.uvtData, path.culling);
1.37317 + },
1.37318 + draw: function (ctx, clip, ratio, colorTransform) {
1.37319 + var paths = this._paths;
1.37320 + for (var i = 0; i < paths.length; i++) {
1.37321 + paths[i].draw(ctx, clip, ratio, colorTransform);
1.37322 + }
1.37323 + },
1.37324 + beginFill: function (color, alpha) {
1.37325 + if (alpha === undefined)
1.37326 + alpha = 1;
1.37327 + this.beginPath();
1.37328 + this._currentPath.fillStyle = alpha ? {
1.37329 + style: rgbIntAlphaToStr(color, alpha)
1.37330 + } : null;
1.37331 + },
1.37332 + beginGradientFill: function (type, colors, alphas, ratios, matrix, spreadMethod, interpolationMethod, focalPos) {
1.37333 + var style = createGradientStyle(type, colors, alphas, ratios, matrix, spreadMethod, interpolationMethod, focalPos);
1.37334 + this.beginPath();
1.37335 + this._currentPath.fillStyle = style;
1.37336 + },
1.37337 + beginBitmapFill: function (bitmap, matrix, repeat, smooth) {
1.37338 + this.beginPath();
1.37339 + repeat = repeat !== false;
1.37340 + this._currentPath.fillStyle = createPatternStyle(bitmap, matrix, repeat, !(!smooth));
1.37341 + },
1.37342 + clear: function () {
1.37343 + this._invalidate();
1.37344 + this._paths = [];
1.37345 + this._currentPath = null;
1.37346 + this.beginPath();
1.37347 + },
1.37348 + copyFrom: function (sourceGraphics) {
1.37349 + notImplemented('Graphics#copyFrom');
1.37350 + },
1.37351 + cubicCurveTo: function (cp1x, cp1y, cp2x, cp2y, x, y) {
1.37352 + this._invalidate();
1.37353 + this._currentPath.cubicCurveTo(cp1x * 20 | 0, cp1y * 20 | 0, cp2x * 20 | 0, cp2y * 20 | 0, x * 20 | 0, y * 20 | 0);
1.37354 + },
1.37355 + curveTo: function (cpx, cpy, x, y) {
1.37356 + this._invalidate();
1.37357 + this._currentPath.curveTo(cpx * 20 | 0, cpy * 20 | 0, x * 20 | 0, y * 20 | 0);
1.37358 + },
1.37359 + drawCircle: function (x, y, radius) {
1.37360 + var radius2 = radius * 2;
1.37361 + this.drawRoundRect(x - radius, y - radius, radius2, radius2, radius2, radius2);
1.37362 + },
1.37363 + drawEllipse: function (x, y, width, height) {
1.37364 + this.drawRoundRect(x, y, width, height, width, height);
1.37365 + },
1.37366 + drawPath: function (commands, data, winding) {
1.37367 + this._invalidate();
1.37368 + this.beginPath();
1.37369 + this._currentPath.fillRule = winding || GRAPHICS_PATH_WINDING_EVEN_ODD;
1.37370 + this._currentPath.commands = commands;
1.37371 + this._currentPath.data = data;
1.37372 + },
1.37373 + drawRect: function (x, y, w, h) {
1.37374 + if (isNaN(w + h))
1.37375 + throwError('ArgumentError', Errors.InvalidParamError);
1.37376 + this._invalidate();
1.37377 + this._currentPath.rect(x * 20 | 0, y * 20 | 0, w * 20 | 0, h * 20 | 0);
1.37378 + },
1.37379 + drawRoundRect: function (x, y, w, h, ellipseWidth, ellipseHeight) {
1.37380 + if (isNaN(w + h + ellipseWidth) || ellipseHeight !== undefined && isNaN(ellipseHeight)) {
1.37381 + throwError('ArgumentError', Errors.InvalidParamError);
1.37382 + }
1.37383 + this._invalidate();
1.37384 + if (ellipseHeight === undefined) {
1.37385 + ellipseHeight = ellipseWidth;
1.37386 + }
1.37387 + x = x * 20 | 0;
1.37388 + y = y * 20 | 0;
1.37389 + w = w * 20 | 0;
1.37390 + h = h * 20 | 0;
1.37391 + if (!ellipseHeight || !ellipseWidth) {
1.37392 + this._currentPath.rect(x, y, w, h);
1.37393 + return;
1.37394 + }
1.37395 + var radiusX = ellipseWidth / 2 * 20 | 0;
1.37396 + var radiusY = ellipseHeight / 2 * 20 | 0;
1.37397 + var hw = w / 2 | 0;
1.37398 + var hh = h / 2 | 0;
1.37399 + if (radiusX > hw) {
1.37400 + radiusX = hw;
1.37401 + }
1.37402 + if (radiusY > hh) {
1.37403 + radiusY = hh;
1.37404 + }
1.37405 + if (hw === radiusX && hh === radiusY) {
1.37406 + if (radiusX === radiusY)
1.37407 + this._currentPath.circle(x + radiusX, y + radiusY, radiusX);
1.37408 + else
1.37409 + this._currentPath.ellipse(x + radiusX, y + radiusY, radiusX, radiusY);
1.37410 + return;
1.37411 + }
1.37412 + var right = x + w;
1.37413 + var bottom = y + h;
1.37414 + var xlw = x + radiusX;
1.37415 + var xrw = right - radiusX;
1.37416 + var ytw = y + radiusY;
1.37417 + var ybw = bottom - radiusY;
1.37418 + this._currentPath.moveTo(right, ybw);
1.37419 + this._currentPath.curveTo(right, bottom, xrw, bottom);
1.37420 + this._currentPath.lineTo(xlw, bottom);
1.37421 + this._currentPath.curveTo(x, bottom, x, ybw);
1.37422 + this._currentPath.lineTo(x, ytw);
1.37423 + this._currentPath.curveTo(x, y, xlw, y);
1.37424 + this._currentPath.lineTo(xrw, y);
1.37425 + this._currentPath.curveTo(right, y, right, ytw);
1.37426 + this._currentPath.lineTo(right, ybw);
1.37427 + },
1.37428 + drawRoundRectComplex: function (x, y, w, h, topLeftRadius, topRightRadius, bottomLeftRadius, bottomRightRadius) {
1.37429 + if (isNaN(w + h + topLeftRadius + topRightRadius + bottomLeftRadius + bottomRightRadius)) {
1.37430 + throwError('ArgumentError', Errors.InvalidParamError);
1.37431 + }
1.37432 + this._invalidate();
1.37433 + x = x * 20 | 0;
1.37434 + y = y * 20 | 0;
1.37435 + w = w * 20 | 0;
1.37436 + h = h * 20 | 0;
1.37437 + if (!topLeftRadius && !topRightRadius && !bottomLeftRadius && !bottomRightRadius) {
1.37438 + this._currentPath.rect(x, y, w, h);
1.37439 + return;
1.37440 + }
1.37441 + topLeftRadius = topLeftRadius * 20 | 0;
1.37442 + topRightRadius = topRightRadius * 20 | 0;
1.37443 + bottomLeftRadius = bottomLeftRadius * 20 | 0;
1.37444 + bottomRightRadius = bottomRightRadius * 20 | 0;
1.37445 + var right = x + w;
1.37446 + var bottom = y + h;
1.37447 + var xtl = x + topLeftRadius;
1.37448 + this._currentPath.moveTo(right, bottom - bottomRightRadius);
1.37449 + this._currentPath.curveTo(right, bottom, right - bottomRightRadius, bottom);
1.37450 + this._currentPath.lineTo(x + bottomLeftRadius, bottom);
1.37451 + this._currentPath.curveTo(x, bottom, x, bottom - bottomLeftRadius);
1.37452 + this._currentPath.lineTo(x, y + topLeftRadius);
1.37453 + this._currentPath.curveTo(x, y, xtl, y);
1.37454 + this._currentPath.lineTo(right - topRightRadius, y);
1.37455 + this._currentPath.curveTo(right, y, right, y + topRightRadius);
1.37456 + this._currentPath.lineTo(right, bottom - bottomRightRadius);
1.37457 + },
1.37458 + drawTriangles: function (vertices, indices, uvtData, cullingStr) {
1.37459 + if (vertices === null || vertices.length === 0) {
1.37460 + return;
1.37461 + }
1.37462 + var numVertices = vertices.length / 2;
1.37463 + var numTriangles = 0;
1.37464 + if (indices) {
1.37465 + if (indices.length % 3) {
1.37466 + throwError('ArgumentError', Errors.InvalidParamError);
1.37467 + } else {
1.37468 + numTriangles = indices.length / 3;
1.37469 + }
1.37470 + } else {
1.37471 + if (vertices.length % 6) {
1.37472 + throwError('ArgumentError', Errors.InvalidParamError);
1.37473 + } else {
1.37474 + numTriangles = vertices.length / 6;
1.37475 + }
1.37476 + }
1.37477 + var numStrides = 0;
1.37478 + if (uvtData) {
1.37479 + if (uvtData.length == numVertices * 2) {
1.37480 + numStrides = 2;
1.37481 + } else if (uvtData.length == numVertices * 3) {
1.37482 + numStrides = 3;
1.37483 + } else {
1.37484 + throwError('ArgumentError', Errors.InvalidParamError);
1.37485 + }
1.37486 + }
1.37487 + var culling = 0;
1.37488 + if (cullingStr === 'none') {
1.37489 + culling = 0;
1.37490 + } else if (cullingStr === 'negative') {
1.37491 + culling = -1;
1.37492 + } else if (cullingStr === 'positive') {
1.37493 + culling = 1;
1.37494 + } else {
1.37495 + throwError('ArgumentError', Errors.InvalidEnumError, 'culling');
1.37496 + }
1.37497 + notImplemented('Graphics#drawTriangles');
1.37498 + },
1.37499 + endFill: function () {
1.37500 + this.beginPath();
1.37501 + this._currentPath.fillStyle = null;
1.37502 + },
1.37503 + lineBitmapStyle: function (bitmap, matrix, repeat, smooth) {
1.37504 + this.beginPath();
1.37505 + this._currentPath.lineStyle = createPatternStyle(bitmap, matrix, repeat, smooth);
1.37506 + },
1.37507 + lineGradientStyle: function (type, colors, alphas, ratios, matrix, spreadMethod, interpolationMethod, focalPos) {
1.37508 + var style = createGradientStyle(type, colors, alphas, ratios, matrix, spreadMethod, interpolationMethod, focalPos);
1.37509 + this.beginPath();
1.37510 + this._currentPath.lineStyle = style;
1.37511 + },
1.37512 + lineStyle: function (width, color, alpha, pxHinting, scale, cap, joint, mlimit) {
1.37513 + this.beginPath();
1.37514 + if (width) {
1.37515 + if (alpha === undefined)
1.37516 + alpha = 1;
1.37517 + if (mlimit === undefined)
1.37518 + mlimit = 3;
1.37519 + this._currentPath.lineStyle = {
1.37520 + style: rgbIntAlphaToStr(color, alpha),
1.37521 + lineCap: cap || 'round',
1.37522 + lineJoin: cap || 'round',
1.37523 + width: width * 20 | 0,
1.37524 + miterLimit: mlimit * 2
1.37525 + };
1.37526 + } else {
1.37527 + this._currentPath.lineStyle = null;
1.37528 + }
1.37529 + },
1.37530 + lineTo: function (x, y) {
1.37531 + this._invalidate();
1.37532 + this._currentPath.lineTo(x * 20 | 0, y * 20 | 0);
1.37533 + },
1.37534 + moveTo: function (x, y) {
1.37535 + this._currentPath.moveTo(x * 20 | 0, y * 20 | 0);
1.37536 + },
1.37537 + _getBounds: function (includeStroke) {
1.37538 + var bbox = includeStroke ? this.strokeBbox : this.bbox;
1.37539 + if (bbox) {
1.37540 + return bbox;
1.37541 + }
1.37542 + var subpaths = this._paths;
1.37543 + var xMins = [], yMins = [], xMaxs = [], yMaxs = [];
1.37544 + for (var i = 0, n = subpaths.length; i < n; i++) {
1.37545 + var path = subpaths[i];
1.37546 + if (path.commands.length) {
1.37547 + var b = path.getBounds(includeStroke);
1.37548 + if (b) {
1.37549 + xMins.push(b.xMin);
1.37550 + yMins.push(b.yMin);
1.37551 + xMaxs.push(b.xMax);
1.37552 + yMaxs.push(b.yMax);
1.37553 + }
1.37554 + }
1.37555 + }
1.37556 + if (xMins.length === 0) {
1.37557 + bbox = {
1.37558 + xMin: 0,
1.37559 + yMin: 0,
1.37560 + xMax: 0,
1.37561 + yMax: 0
1.37562 + };
1.37563 + } else {
1.37564 + bbox = {
1.37565 + xMin: Math.min.apply(Math, xMins),
1.37566 + yMin: Math.min.apply(Math, yMins),
1.37567 + xMax: Math.max.apply(Math, xMaxs),
1.37568 + yMax: Math.max.apply(Math, yMaxs)
1.37569 + };
1.37570 + }
1.37571 + if (includeStroke) {
1.37572 + this.strokeBbox = bbox;
1.37573 + } else {
1.37574 + this.bbox = bbox;
1.37575 + }
1.37576 + return bbox;
1.37577 + }
1.37578 + };
1.37579 + def.__glue__ = {
1.37580 + native: {
1.37581 + instance: {
1.37582 + beginFill: def.beginFill,
1.37583 + beginGradientFill: def.beginGradientFill,
1.37584 + beginBitmapFill: def.beginBitmapFill,
1.37585 + beginFillObject: def.beginFillObject,
1.37586 + beginStrokeObject: def.beginStrokeObject,
1.37587 + clear: def.clear,
1.37588 + copyFrom: def.copyFrom,
1.37589 + cubicCurveTo: def.cubicCurveTo,
1.37590 + curveTo: def.curveTo,
1.37591 + drawCircle: def.drawCircle,
1.37592 + drawEllipse: def.drawEllipse,
1.37593 + drawPath: def.drawPath,
1.37594 + drawRect: def.drawRect,
1.37595 + drawRoundRect: def.drawRoundRect,
1.37596 + drawRoundRectComplex: def.drawRoundRectComplex,
1.37597 + drawTriangles: def.drawTriangles,
1.37598 + endFill: def.endFill,
1.37599 + lineBitmapStyle: def.lineBitmapStyle,
1.37600 + lineGradientStyle: def.lineGradientStyle,
1.37601 + lineStyle: def.lineStyle,
1.37602 + moveTo: def.moveTo,
1.37603 + lineTo: def.lineTo
1.37604 + }
1.37605 + }
1.37606 + };
1.37607 + return def;
1.37608 + }.call(this);
1.37609 +function createPatternStyle(bitmap, matrix, repeat, smooth) {
1.37610 + var repeatStyle = repeat === false ? 'no-repeat' : 'repeat';
1.37611 + var pattern = factoryCtx.createPattern(bitmap._drawable, repeatStyle);
1.37612 + var transform = matrix ? {
1.37613 + a: matrix.a,
1.37614 + b: matrix.b,
1.37615 + c: matrix.c,
1.37616 + d: matrix.d,
1.37617 + e: matrix.tx,
1.37618 + f: matrix.ty
1.37619 + } : {
1.37620 + a: 1,
1.37621 + b: 0,
1.37622 + c: 0,
1.37623 + d: 1,
1.37624 + e: 0,
1.37625 + f: 0
1.37626 + };
1.37627 + return {
1.37628 + style: pattern,
1.37629 + transform: transform,
1.37630 + smooth: smooth
1.37631 + };
1.37632 +}
1.37633 +function createGradientStyle(type, colors, alphas, ratios, matrix, spreadMethod, interpolationMethod, focalPos) {
1.37634 + type === null || type === undefined && throwError('TypeError', Errors.NullPointerError, 'type');
1.37635 + colors === null || type === undefined && throwError('TypeError', Errors.NullPointerError, 'colors');
1.37636 + if (!(type === 'linear' || type === 'radial')) {
1.37637 + throwError('ArgumentError', Errors.InvalidEnumError, 'type');
1.37638 + }
1.37639 + var colorStops = [];
1.37640 + for (var i = 0, n = colors.length; i < n; i++) {
1.37641 + colorStops.push({
1.37642 + ratio: ratios[i] / 255,
1.37643 + color: rgbIntAlphaToStr(colors[i], alphas[i])
1.37644 + });
1.37645 + }
1.37646 + var gradientConstructor;
1.37647 + if (type === 'linear') {
1.37648 + gradientConstructor = buildLinearGradientFactory(colorStops);
1.37649 + } else {
1.37650 + gradientConstructor = buildRadialGradientFactory(focalPos || 0, colorStops);
1.37651 + }
1.37652 + var scale = 819.2;
1.37653 + var transform = matrix ? {
1.37654 + a: scale * matrix.a,
1.37655 + b: scale * matrix.b,
1.37656 + c: scale * matrix.c,
1.37657 + d: scale * matrix.d,
1.37658 + e: matrix.tx,
1.37659 + f: matrix.ty
1.37660 + } : {
1.37661 + a: scale,
1.37662 + b: 0,
1.37663 + c: 0,
1.37664 + d: scale,
1.37665 + e: 0,
1.37666 + f: 0
1.37667 + };
1.37668 + return {
1.37669 + style: gradientConstructor,
1.37670 + transform: transform
1.37671 + };
1.37672 +}
1.37673 +function drawGraphicsData(data) {
1.37674 + if (data === null) {
1.37675 + return;
1.37676 + }
1.37677 + for (var i = 0; i < data.length; i++) {
1.37678 + var item = data[i];
1.37679 + if (flash.display.IGraphicsPath.class.isInstanceOf(item)) {
1.37680 + this._drawPathObject(item);
1.37681 + } else if (flash.display.IGraphicsStroke.class.isInstanceOf(item)) {
1.37682 + this.beginStrokeObject(item);
1.37683 + } else if (flash.display.IGraphicsFill.class.isInstanceOf(item)) {
1.37684 + this.beginFillObject(item);
1.37685 + }
1.37686 + }
1.37687 +}
1.37688 +var InteractiveObjectDefinition = function () {
1.37689 + var def = {
1.37690 + initialize: function () {
1.37691 + this._contextMenu = null;
1.37692 + this._doubleClickEnabled = false;
1.37693 + this._focusRect = null;
1.37694 + this._mouseEnabled = true;
1.37695 + this._tabEnabled = false;
1.37696 + },
1.37697 + get accessibilityImplementation() {
1.37698 + return null;
1.37699 + },
1.37700 + set accessibilityImplementation(val) {
1.37701 + somewhatImplemented('accessibilityImplementation');
1.37702 + },
1.37703 + get contextMenu() {
1.37704 + somewhatImplemented('contextMenu');
1.37705 + return this._contextMenu;
1.37706 + },
1.37707 + set contextMenu(val) {
1.37708 + somewhatImplemented('contextMenu');
1.37709 + this._contextMenu = val;
1.37710 + },
1.37711 + get doubleClickEnabled() {
1.37712 + return this._doubleClickEnabled;
1.37713 + },
1.37714 + set doubleClickEnabled(val) {
1.37715 + this._doubleClickEnabled = val;
1.37716 + },
1.37717 + get focusRect() {
1.37718 + return this._focusRect;
1.37719 + },
1.37720 + set focusRect(val) {
1.37721 + this._focusRect = val;
1.37722 + },
1.37723 + get mouseEnabled() {
1.37724 + return this._mouseEnabled;
1.37725 + },
1.37726 + set mouseEnabled(val) {
1.37727 + this._mouseEnabled = val;
1.37728 + },
1.37729 + get needsSoftKeyboard() {
1.37730 + return false;
1.37731 + },
1.37732 + set needsSoftKeyboard(val) {
1.37733 + notImplemented();
1.37734 + },
1.37735 + get softKeyboardInputAreaOfInterest() {
1.37736 + return null;
1.37737 + },
1.37738 + set softKeyboardInputAreaOfInterest(val) {
1.37739 + notImplemented();
1.37740 + },
1.37741 + get tabEnabled() {
1.37742 + return this._tabEnabled;
1.37743 + },
1.37744 + set tabEnabled(val) {
1.37745 + var old = this._tabEnabled;
1.37746 + this._tabEnabled = val;
1.37747 + if (old !== val) {
1.37748 + var Event = flash.events.Event;
1.37749 + this._dispatchEvent(new Event('tabEnabledChange', false, false));
1.37750 + }
1.37751 + },
1.37752 + requestSoftKeyboard: function () {
1.37753 + notImplemented();
1.37754 + }
1.37755 + };
1.37756 + var desc = Object.getOwnPropertyDescriptor;
1.37757 + def.__glue__ = {
1.37758 + native: {
1.37759 + instance: {
1.37760 + tabEnabled: desc(def, 'tabEnabled'),
1.37761 + tabIndex: {
1.37762 + get: function tabIndex() {
1.37763 + return this._tabIndex;
1.37764 + },
1.37765 + set: function tabIndex(index) {
1.37766 + this._tabIndex = index;
1.37767 + }
1.37768 + },
1.37769 + focusRect: desc(def, 'focusRect'),
1.37770 + mouseEnabled: desc(def, 'mouseEnabled'),
1.37771 + doubleClickEnabled: desc(def, 'doubleClickEnabled'),
1.37772 + accessibilityImplementation: desc(def, 'accessibilityImplementation'),
1.37773 + softKeyboardInputAreaOfInterest: desc(def, 'softKeyboardInputAreaOfInterest'),
1.37774 + needsSoftKeyboard: desc(def, 'needsSoftKeyboard'),
1.37775 + contextMenu: desc(def, 'contextMenu'),
1.37776 + requestSoftKeyboard: def.requestSoftKeyboard
1.37777 + }
1.37778 + }
1.37779 + };
1.37780 + return def;
1.37781 + }.call(this);
1.37782 +var $RELEASE = false;
1.37783 +var LoaderDefinition = function () {
1.37784 + var WORKERS_ENABLED = true;
1.37785 + var LOADER_PATH = true ? 'shumway-worker.js' : 'swf/resourceloader.js';
1.37786 + var head = document.head;
1.37787 + head.insertBefore(document.createElement('style'), head.firstChild);
1.37788 + var style = document.styleSheets[0];
1.37789 + var def = {
1.37790 + __class__: 'flash.display.Loader',
1.37791 + initialize: function () {
1.37792 + this._contentLoaderInfo = new flash.display.LoaderInfo();
1.37793 + this._contentLoaderInfo._loader = this;
1.37794 + this._dictionary = {};
1.37795 + this._dictionaryResolved = {};
1.37796 + this._displayList = null;
1.37797 + this._timeline = [];
1.37798 + this._lastPromise = null;
1.37799 + this._uncaughtErrorEvents = null;
1.37800 + this._worker = null;
1.37801 + var abc = AVM2.currentAbc();
1.37802 + if (abc && abc.env.loader) {
1.37803 + this._contentLoaderInfo._loaderURL = abc.env.loader._contentLoaderInfo._url;
1.37804 + }
1.37805 + },
1.37806 + _commitData: function (data) {
1.37807 + switch (data.command) {
1.37808 + case 'init':
1.37809 + this._init(data.result);
1.37810 + break;
1.37811 + case 'progress':
1.37812 + this._updateProgress(data.result);
1.37813 + break;
1.37814 + case 'complete':
1.37815 + var frameConstructed = new Promise(function (resolve) {
1.37816 + avm2.systemDomain.onMessage.register('frameConstructed', function waitForFrame(type) {
1.37817 + if (type === 'frameConstructed') {
1.37818 + resolve();
1.37819 + avm2.systemDomain.onMessage.unregister('frameConstructed', waitForFrame);
1.37820 + }
1.37821 + });
1.37822 + });
1.37823 + this._contentLoaderInfo._dispatchEvent('parsed');
1.37824 + Promise.all([
1.37825 + frameConstructed,
1.37826 + this._lastPromise
1.37827 + ]).then(function () {
1.37828 + this._content._complete = true;
1.37829 + this._contentLoaderInfo._dispatchEvent('complete');
1.37830 + }.bind(this));
1.37831 + var stats = data.stats;
1.37832 + if (stats) {
1.37833 + TelemetryService.reportTelemetry(stats);
1.37834 + }
1.37835 + this._worker && this._worker.terminate();
1.37836 + break;
1.37837 + case 'empty':
1.37838 + this._lastPromise = Promise.resolve();
1.37839 + break;
1.37840 + case 'error':
1.37841 + this._contentLoaderInfo._dispatchEvent('ioError', flash.events.IOErrorEvent);
1.37842 + break;
1.37843 + default:
1.37844 + if (data.id === 0)
1.37845 + break;
1.37846 + if (data.isSymbol)
1.37847 + this._commitSymbol(data);
1.37848 + else if (data.type === 'frame')
1.37849 + this._commitFrame(data);
1.37850 + else if (data.type === 'image')
1.37851 + this._commitImage(data);
1.37852 + break;
1.37853 + }
1.37854 + },
1.37855 + _updateProgress: function (state) {
1.37856 + var loaderInfo = this._contentLoaderInfo;
1.37857 + loaderInfo._bytesLoaded = state.bytesLoaded || 0;
1.37858 + loaderInfo._bytesTotal = state.bytesTotal || 0;
1.37859 + var event = new flash.events.ProgressEvent('progress', false, false, loaderInfo._bytesLoaded, loaderInfo._bytesTotal);
1.37860 + loaderInfo._dispatchEvent(event);
1.37861 + },
1.37862 + _buildFrame: function (currentDisplayList, timeline, promiseQueue, frame, frameNum) {
1.37863 + var loader = this;
1.37864 + var dictionary = loader._dictionary;
1.37865 + var dictionaryResolved = loader._dictionaryResolved;
1.37866 + var displayList = {};
1.37867 + var depths = [];
1.37868 + var cmds = frame.depths;
1.37869 + if (currentDisplayList) {
1.37870 + var currentDepths = currentDisplayList.depths;
1.37871 + for (var i = 0; i < currentDepths.length; i++) {
1.37872 + var depth = currentDepths[i];
1.37873 + if (cmds[depth] === null) {
1.37874 + continue;
1.37875 + }
1.37876 + displayList[depth] = currentDisplayList[depth];
1.37877 + depths.push(depth);
1.37878 + }
1.37879 + }
1.37880 + for (var depth in cmds) {
1.37881 + var cmd = cmds[depth];
1.37882 + if (!cmd) {
1.37883 + continue;
1.37884 + }
1.37885 + if (cmd.move) {
1.37886 + var oldCmd = cmd;
1.37887 + cmd = cloneObject(currentDisplayList[depth]);
1.37888 + for (var prop in oldCmd) {
1.37889 + var val = oldCmd[prop];
1.37890 + if (val) {
1.37891 + cmd[prop] = val;
1.37892 + }
1.37893 + }
1.37894 + }
1.37895 + if (cmd.symbolId) {
1.37896 + var itemPromise = dictionary[cmd.symbolId];
1.37897 + if (itemPromise && !dictionaryResolved[cmd.symbolId]) {
1.37898 + promiseQueue.push(itemPromise);
1.37899 + }
1.37900 + cmd = cloneObject(cmd);
1.37901 + Object.defineProperty(cmd, 'symbolInfo', {
1.37902 + get: function (dictionaryResolved, symbolId) {
1.37903 + return function () {
1.37904 + return dictionaryResolved[symbolId];
1.37905 + };
1.37906 + }(dictionaryResolved, cmd.symbolId)
1.37907 + });
1.37908 + }
1.37909 + if (!displayList[depth]) {
1.37910 + depths.push(depth);
1.37911 + }
1.37912 + displayList[depth] = cmd;
1.37913 + }
1.37914 + depths.sort(sortNumeric);
1.37915 + displayList.depths = depths;
1.37916 + var i = frame.repeat;
1.37917 + while (i--) {
1.37918 + timeline.push(displayList);
1.37919 + }
1.37920 + return displayList;
1.37921 + },
1.37922 + _commitFrame: function (frame) {
1.37923 + var abcBlocks = frame.abcBlocks;
1.37924 + var actionBlocks = frame.actionBlocks;
1.37925 + var initActionBlocks = frame.initActionBlocks;
1.37926 + var exports = frame.exports;
1.37927 + var symbolClasses = frame.symbolClasses;
1.37928 + var sceneData = frame.sceneData;
1.37929 + var loader = this;
1.37930 + var dictionary = loader._dictionary;
1.37931 + var loaderInfo = loader._contentLoaderInfo;
1.37932 + var timeline = loader._timeline;
1.37933 + var frameNum = timeline.length + 1;
1.37934 + var framePromiseResolve;
1.37935 + var framePromise = new Promise(function (resolve) {
1.37936 + framePromiseResolve = resolve;
1.37937 + });
1.37938 + var labelName = frame.labelName;
1.37939 + var prevPromise = this._lastPromise;
1.37940 + this._lastPromise = framePromise;
1.37941 + var promiseQueue = [
1.37942 + prevPromise
1.37943 + ];
1.37944 + this._displayList = this._buildFrame(this._displayList, timeline, promiseQueue, frame, frameNum);
1.37945 + var framesLoaded = timeline.length;
1.37946 + if (frame.bgcolor)
1.37947 + loaderInfo._backgroundColor = frame.bgcolor;
1.37948 + else if (isNullOrUndefined(loaderInfo._backgroundColor))
1.37949 + loaderInfo._backgroundColor = {
1.37950 + red: 255,
1.37951 + green: 255,
1.37952 + blue: 255,
1.37953 + alpha: 255
1.37954 + };
1.37955 + Promise.all(promiseQueue).then(function () {
1.37956 + if (abcBlocks && loader._isAvm2Enabled) {
1.37957 + var appDomain = avm2.applicationDomain;
1.37958 + for (var i = 0, n = abcBlocks.length; i < n; i++) {
1.37959 + var abc = new AbcFile(abcBlocks[i].data, 'abc_block_' + i);
1.37960 + abc.env.loader = loader;
1.37961 + if (abcBlocks[i].flags) {
1.37962 + appDomain.loadAbc(abc);
1.37963 + } else {
1.37964 + appDomain.executeAbc(abc);
1.37965 + }
1.37966 + }
1.37967 + }
1.37968 + if (symbolClasses && loader._isAvm2Enabled) {
1.37969 + var symbolClassesPromises = [];
1.37970 + for (var i = 0, n = symbolClasses.length; i < n; i++) {
1.37971 + var asset = symbolClasses[i];
1.37972 + var symbolPromise = dictionary[asset.symbolId];
1.37973 + if (!symbolPromise)
1.37974 + continue;
1.37975 + symbolPromise.then(function (className) {
1.37976 + return function symbolPromiseResolved(symbolInfo) {
1.37977 + symbolInfo.className = className;
1.37978 + avm2.applicationDomain.getClass(className).setSymbol(symbolInfo.props);
1.37979 + };
1.37980 + }(asset.className));
1.37981 + symbolClassesPromises.push(symbolPromise);
1.37982 + }
1.37983 + return Promise.all(symbolClassesPromises);
1.37984 + }
1.37985 + if (exports && !loader._isAvm2Enabled) {
1.37986 + var exportPromises = [];
1.37987 + for (var i = 0, n = exports.length; i < n; i++) {
1.37988 + var asset = exports[i];
1.37989 + var symbolPromise = dictionary[asset.symbolId];
1.37990 + if (!symbolPromise)
1.37991 + continue;
1.37992 + symbolPromise.then(function (className) {
1.37993 + return function symbolPromiseResolved(symbolInfo) {
1.37994 + loader._avm1Context.addAsset(className, symbolInfo.props);
1.37995 + };
1.37996 + }(asset.className));
1.37997 + exportPromises.push(symbolPromise);
1.37998 + }
1.37999 + return Promise.all(exportPromises);
1.38000 + }
1.38001 + }).then(function () {
1.38002 + var root = loader._content;
1.38003 + var labelMap;
1.38004 + if (!root) {
1.38005 + var parent = loader._parent;
1.38006 + true;
1.38007 + var rootInfo = loader._dictionaryResolved[0];
1.38008 + var rootClass = avm2.applicationDomain.getClass(rootInfo.className);
1.38009 + root = rootClass.createAsSymbol({
1.38010 + framesLoaded: framesLoaded,
1.38011 + loader: loader,
1.38012 + parent: parent || loader,
1.38013 + index: parent ? 0 : -1,
1.38014 + level: parent ? 0 : -1,
1.38015 + timeline: timeline,
1.38016 + totalFrames: rootInfo.props.totalFrames,
1.38017 + stage: loader._stage,
1.38018 + complete: frame.complete
1.38019 + });
1.38020 + if (!loader._isAvm2Enabled) {
1.38021 + var avm1Context = loader._avm1Context;
1.38022 + var _root = root;
1.38023 + if (parent && parent !== loader._stage) {
1.38024 + var parentLoader = parent.loaderInfo._loader;
1.38025 + while (parentLoader._parent && parentLoader._parent !== loader._stage) {
1.38026 + parentLoader = parentLoader._parent.loaderInfo._loader;
1.38027 + }
1.38028 + if (parentLoader._isAvm2Enabled) {
1.38029 + somewhatImplemented('AVM1Movie');
1.38030 + this._worker && this._worker.terminate();
1.38031 + return;
1.38032 + }
1.38033 + _root = parentLoader._content;
1.38034 + }
1.38035 + var as2Object = _root._getAS2Object();
1.38036 + avm1Context.globals.asSetPublicProperty('_root', as2Object);
1.38037 + avm1Context.globals.asSetPublicProperty('_level0', as2Object);
1.38038 + avm1Context.globals.asSetPublicProperty('_level1', as2Object);
1.38039 + var parameters = loader.loaderInfo._parameters;
1.38040 + for (var paramName in parameters) {
1.38041 + if (!(paramName in as2Object)) {
1.38042 + as2Object[paramName] = parameters[paramName];
1.38043 + }
1.38044 + }
1.38045 + }
1.38046 + var isRootMovie = parent && parent == loader._stage && loader._stage._children.length === 0;
1.38047 + if (isRootMovie) {
1.38048 + parent._frameRate = loaderInfo._frameRate;
1.38049 + parent._stageHeight = loaderInfo._height;
1.38050 + parent._stageWidth = loaderInfo._width;
1.38051 + parent._root = root;
1.38052 + parent._setup();
1.38053 + } else {
1.38054 + loader._children.push(root);
1.38055 + }
1.38056 + var labels;
1.38057 + labelMap = root.symbol.labelMap = createEmptyObject();
1.38058 + if (sceneData) {
1.38059 + var scenes = [];
1.38060 + var startFrame;
1.38061 + var endFrame = root.symbol.totalFrames - 1;
1.38062 + var sd = sceneData.scenes;
1.38063 + var ld = sceneData.labels;
1.38064 + var i = sd.length;
1.38065 + while (i--) {
1.38066 + var s = sd[i];
1.38067 + startFrame = s.offset;
1.38068 + labels = [];
1.38069 + var j = ld.length;
1.38070 + while (j--) {
1.38071 + var lbl = ld[j];
1.38072 + if (lbl.frame >= startFrame && lbl.frame <= endFrame) {
1.38073 + labelMap[lbl.name] = lbl.frame + 1;
1.38074 + labels.unshift(new flash.display.FrameLabel(lbl.name, lbl.frame - startFrame + 1));
1.38075 + }
1.38076 + }
1.38077 + var scene = new flash.display.Scene(s.name, labels, endFrame - startFrame + 1);
1.38078 + scene._startFrame = startFrame + 1;
1.38079 + scene._endFrame = endFrame + 1;
1.38080 + scenes.unshift(scene);
1.38081 + endFrame = startFrame - 1;
1.38082 + }
1.38083 + root.symbol.scenes = scenes;
1.38084 + } else {
1.38085 + labels = [];
1.38086 + if (labelName) {
1.38087 + labelMap[labelName] = frameNum;
1.38088 + labels.push(new flash.display.FrameLabel(labelName, frameNum));
1.38089 + }
1.38090 + var scene = new flash.display.Scene('Scene 1', labels, root.symbol.totalFrames);
1.38091 + scene._startFrame = 1;
1.38092 + scene._endFrame = root.symbol.totalFrames;
1.38093 + root.symbol.scenes = [
1.38094 + scene
1.38095 + ];
1.38096 + }
1.38097 + if (loader._stage) {
1.38098 + loader._stage._children[0] = root;
1.38099 + }
1.38100 + rootClass.instanceConstructor.call(root);
1.38101 + loader._content = root;
1.38102 + } else {
1.38103 + root._framesLoaded = framesLoaded;
1.38104 + if (labelName && root._labelMap) {
1.38105 + if (root._labelMap[labelName] === undefined) {
1.38106 + root._labelMap[labelName] = frameNum;
1.38107 + for (var i = 0, n = root.symbol.scenes.length; i < n; i++) {
1.38108 + var scene = root.symbol.scenes[i];
1.38109 + if (frameNum >= scene._startFrame && frameNum <= scene._endFrame) {
1.38110 + scene.labels.push(new flash.display.FrameLabel(labelName, frameNum - scene._startFrame));
1.38111 + break;
1.38112 + }
1.38113 + }
1.38114 + }
1.38115 + }
1.38116 + }
1.38117 + if (frame.startSounds) {
1.38118 + root._registerStartSounds(frameNum, frame.startSounds);
1.38119 + }
1.38120 + if (frame.soundStream) {
1.38121 + root._initSoundStream(frame.soundStream);
1.38122 + }
1.38123 + if (frame.soundStreamBlock) {
1.38124 + root._addSoundStreamBlock(frameNum, frame.soundStreamBlock);
1.38125 + }
1.38126 + if (!loader._isAvm2Enabled) {
1.38127 + var avm1Context = loader._avm1Context;
1.38128 + if (initActionBlocks) {
1.38129 + for (var i = 0; i < initActionBlocks.length; i++) {
1.38130 + var spriteId = initActionBlocks[i].spriteId;
1.38131 + var actionsData = initActionBlocks[i].actionsData;
1.38132 + root.addFrameScript(frameNum - 1, function (actionsData, spriteId, state) {
1.38133 + if (state.executed)
1.38134 + return;
1.38135 + state.executed = true;
1.38136 + return executeActions(actionsData, avm1Context, this._getAS2Object());
1.38137 + }.bind(root, actionsData, spriteId, {
1.38138 + executed: false
1.38139 + }));
1.38140 + }
1.38141 + }
1.38142 + if (actionBlocks) {
1.38143 + for (var i = 0; i < actionBlocks.length; i++) {
1.38144 + var block = actionBlocks[i];
1.38145 + root.addFrameScript(frameNum - 1, function (block) {
1.38146 + return function () {
1.38147 + return executeActions(block, avm1Context, this._getAS2Object());
1.38148 + };
1.38149 + }(block));
1.38150 + }
1.38151 + }
1.38152 + }
1.38153 + if (frameNum === 1)
1.38154 + loaderInfo._dispatchEvent(new flash.events.Event('init', false, false));
1.38155 + framePromiseResolve(frame);
1.38156 + });
1.38157 + },
1.38158 + _commitImage: function (imageInfo) {
1.38159 + var loader = this;
1.38160 + var imgPromiseResolve;
1.38161 + var imgPromise = this._lastPromise = new Promise(function (resolve) {
1.38162 + imgPromiseResolve = resolve;
1.38163 + });
1.38164 + var img = new Image();
1.38165 + imageInfo.props.img = img;
1.38166 + img.onload = function () {
1.38167 + var Bitmap = avm2.systemDomain.getClass('flash.display.Bitmap');
1.38168 + var BitmapData = avm2.systemDomain.getClass('flash.display.BitmapData');
1.38169 + var props = imageInfo.props;
1.38170 + props.parent = loader._parent;
1.38171 + props.stage = loader._stage;
1.38172 + props.skipCopyToCanvas = true;
1.38173 + var bitmapData = BitmapData.createAsSymbol(props);
1.38174 + BitmapData.instanceConstructor.call(bitmapData, 0, 0, true, 4294967295);
1.38175 + var image = Bitmap.createAsSymbol(bitmapData);
1.38176 + Bitmap.instanceConstructor.call(image, bitmapData);
1.38177 + image._parent = loader;
1.38178 + loader._children.push(image);
1.38179 + loader._invalidateBounds();
1.38180 + loader._content = image;
1.38181 + imgPromiseResolve(imageInfo);
1.38182 + var loaderInfo = loader._contentLoaderInfo;
1.38183 + loaderInfo._width = image.width;
1.38184 + loaderInfo._height = image.height;
1.38185 + loaderInfo._dispatchEvent('init');
1.38186 + };
1.38187 + img.src = URL.createObjectURL(imageInfo.data);
1.38188 + imageInfo.data = null;
1.38189 + },
1.38190 + _commitSymbol: function (symbol) {
1.38191 + var dictionary = this._dictionary;
1.38192 + var dictionaryResolved = this._dictionaryResolved;
1.38193 + if ('updates' in symbol) {
1.38194 + dictionary[symbol.id].then(function (s) {
1.38195 + for (var i in symbol.updates) {
1.38196 + s.props[i] = symbol.updates[i];
1.38197 + }
1.38198 + });
1.38199 + return;
1.38200 + }
1.38201 + var className = 'flash.display.DisplayObject';
1.38202 + var dependencies = symbol.require;
1.38203 + var promiseQueue = [];
1.38204 + var props = {
1.38205 + symbolId: symbol.id,
1.38206 + loader: this
1.38207 + };
1.38208 + var symbolPromiseResolve;
1.38209 + var symbolPromise = new Promise(function (resolve) {
1.38210 + symbolPromiseResolve = resolve;
1.38211 + });
1.38212 + if (dependencies && dependencies.length) {
1.38213 + for (var i = 0, n = dependencies.length; i < n; i++) {
1.38214 + var dependencyId = dependencies[i];
1.38215 + var dependencyPromise = dictionary[dependencyId];
1.38216 + if (dependencyPromise && !dictionaryResolved[dependencyId])
1.38217 + promiseQueue.push(dependencyPromise);
1.38218 + }
1.38219 + }
1.38220 + switch (symbol.type) {
1.38221 + case 'button':
1.38222 + var states = {};
1.38223 + for (var stateName in symbol.states) {
1.38224 + var characters = [];
1.38225 + var displayList = {};
1.38226 + var state = symbol.states[stateName];
1.38227 + var depths = Object.keys(state);
1.38228 + for (var i = 0; i < depths.length; i++) {
1.38229 + var depth = depths[i];
1.38230 + var cmd = state[depth];
1.38231 + var characterPromise = dictionary[cmd.symbolId];
1.38232 + if (characterPromise && !dictionaryResolved[cmd.symbolId]) {
1.38233 + promiseQueue.push(characterPromise);
1.38234 + }
1.38235 + characters.push(characterPromise);
1.38236 + displayList[depth] = Object.create(cmd, {
1.38237 + symbolInfo: {
1.38238 + get: function (dictionaryResolved, symbolId) {
1.38239 + return function () {
1.38240 + return dictionaryResolved[symbolId];
1.38241 + };
1.38242 + }(dictionaryResolved, cmd.symbolId)
1.38243 + }
1.38244 + });
1.38245 + }
1.38246 + depths.sort(sortNumeric);
1.38247 + displayList.depths = depths;
1.38248 + states[stateName] = {
1.38249 + className: 'flash.display.Sprite',
1.38250 + props: {
1.38251 + loader: this,
1.38252 + timeline: [
1.38253 + displayList
1.38254 + ]
1.38255 + }
1.38256 + };
1.38257 + }
1.38258 + className = 'flash.display.SimpleButton';
1.38259 + props.states = states;
1.38260 + props.buttonActions = symbol.buttonActions;
1.38261 + break;
1.38262 + case 'font':
1.38263 + var charset = fromCharCode.apply(null, symbol.codes);
1.38264 + if (charset) {
1.38265 + style.insertRule('@font-face{font-family:"' + symbol.uniqueName + '";' + 'src:url(data:font/opentype;base64,' + btoa(symbol.data) + ')' + '}', style.cssRules.length);
1.38266 + if (!/Mozilla\/5.0.*?rv:(\d+).*? Gecko/.test(window.navigator.userAgent)) {
1.38267 + var testDiv = document.createElement('div');
1.38268 + testDiv.setAttribute('style', 'position: absolute; top: 0; right: 0;visibility: hidden; z-index: -500;font-family:"' + symbol.uniqueName + '";');
1.38269 + testDiv.textContent = 'font test';
1.38270 + document.body.appendChild(testDiv);
1.38271 + var fontPromise = new Promise(function (resolve) {
1.38272 + setTimeout(function () {
1.38273 + resolve();
1.38274 + document.body.removeChild(testDiv);
1.38275 + }, 200);
1.38276 + });
1.38277 + promiseQueue.push(fontPromise);
1.38278 + }
1.38279 + }
1.38280 + className = 'flash.text.Font';
1.38281 + props.name = symbol.name;
1.38282 + props.uniqueName = symbol.uniqueName;
1.38283 + props.charset = symbol.charset;
1.38284 + props.bold = symbol.bold;
1.38285 + props.italic = symbol.italic;
1.38286 + props.metrics = symbol.metrics;
1.38287 + this._registerFont(className, props);
1.38288 + break;
1.38289 + case 'image':
1.38290 + var img = new Image();
1.38291 + var imgPromiseResolve;
1.38292 + var imgPromise = new Promise(function (resolve) {
1.38293 + imgPromiseResolve = resolve;
1.38294 + });
1.38295 + img.onload = function () {
1.38296 + if (symbol.mask) {
1.38297 + var maskCanvas = document.createElement('canvas');
1.38298 + maskCanvas.width = symbol.width;
1.38299 + maskCanvas.height = symbol.height;
1.38300 + var maskContext = maskCanvas.getContext('2d');
1.38301 + maskContext.drawImage(img, 0, 0);
1.38302 + var maskImageData = maskContext.getImageData(0, 0, symbol.width, symbol.height);
1.38303 + var maskImageDataBytes = maskImageData.data;
1.38304 + var symbolMaskBytes = symbol.mask;
1.38305 + var length = maskImageData.width * maskImageData.height;
1.38306 + for (var i = 0, j = 3; i < length; i++, j += 4) {
1.38307 + maskImageDataBytes[j] = symbolMaskBytes[i];
1.38308 + }
1.38309 + maskContext.putImageData(maskImageData, 0, 0);
1.38310 + props.img = maskCanvas;
1.38311 + }
1.38312 + imgPromiseResolve();
1.38313 + };
1.38314 + img.src = URL.createObjectURL(symbol.data);
1.38315 + promiseQueue.push(imgPromise);
1.38316 + className = 'flash.display.Bitmap';
1.38317 + props.img = img;
1.38318 + props.width = symbol.width;
1.38319 + props.height = symbol.height;
1.38320 + break;
1.38321 + case 'label':
1.38322 + var drawFn = new Function('c,r,ct', symbol.data);
1.38323 + className = 'flash.text.StaticText';
1.38324 + props.bbox = symbol.bbox;
1.38325 + props.draw = drawFn;
1.38326 + break;
1.38327 + case 'text':
1.38328 + props.bbox = symbol.bbox;
1.38329 + props.html = symbol.html;
1.38330 + if (symbol.type === 'label') {
1.38331 + className = 'flash.text.StaticText';
1.38332 + } else {
1.38333 + className = 'flash.text.TextField';
1.38334 + props.tag = symbol.tag;
1.38335 + props.variableName = symbol.variableName;
1.38336 + }
1.38337 + break;
1.38338 + case 'shape':
1.38339 + className = symbol.morph ? 'flash.display.MorphShape' : 'flash.display.Shape';
1.38340 + props.bbox = symbol.bbox;
1.38341 + props.strokeBbox = symbol.strokeBbox;
1.38342 + props.paths = symbol.paths;
1.38343 + props.dictionaryResolved = dictionaryResolved;
1.38344 + break;
1.38345 + case 'sound':
1.38346 + if (!symbol.pcm && !PLAY_USING_AUDIO_TAG) {
1.38347 + var decodePromiseResolve;
1.38348 + var decodePromise = new Promise(function (resolve) {
1.38349 + decodePromiseResolve = resolve;
1.38350 + });
1.38351 + MP3DecoderSession.processAll(symbol.packaged.data, function (props, pcm, id3tags, error) {
1.38352 + props.pcm = pcm || new Uint8Array(0);
1.38353 + decodePromiseResolve();
1.38354 + if (error) {
1.38355 + console.error('ERROR: ' + error);
1.38356 + }
1.38357 + }.bind(null, props));
1.38358 + promiseQueue.push(decodePromise);
1.38359 + }
1.38360 + className = 'flash.media.Sound';
1.38361 + props.sampleRate = symbol.sampleRate;
1.38362 + props.channels = symbol.channels;
1.38363 + props.pcm = symbol.pcm;
1.38364 + props.packaged = symbol.packaged;
1.38365 + break;
1.38366 + case 'binary':
1.38367 + props.data = symbol.data;
1.38368 + break;
1.38369 + case 'sprite':
1.38370 + var displayList = null;
1.38371 + var frameCount = symbol.frameCount;
1.38372 + var labelMap = {};
1.38373 + var frameNum = 1;
1.38374 + var frames = symbol.frames;
1.38375 + var timeline = [];
1.38376 + var startSoundRegistrations = [];
1.38377 + for (var i = 0, n = frames.length; i < n; i++) {
1.38378 + var frame = frames[i];
1.38379 + var frameNum = timeline.length + 1;
1.38380 + if (frame.labelName) {
1.38381 + labelMap[frame.labelName] = frameNum;
1.38382 + }
1.38383 + if (frame.startSounds) {
1.38384 + startSoundRegistrations[frameNum] = frame.startSounds;
1.38385 + for (var j = 0; j < frame.startSounds.length; j++) {
1.38386 + var soundId = frame.startSounds[j].soundId;
1.38387 + var itemPromise = dictionary[soundId];
1.38388 + if (itemPromise && !dictionaryResolved[soundId]) {
1.38389 + promiseQueue.push(itemPromise);
1.38390 + }
1.38391 + }
1.38392 + }
1.38393 + displayList = this._buildFrame(displayList, timeline, promiseQueue, frame, frameNum);
1.38394 + }
1.38395 + var frameScripts = {};
1.38396 + if (!this._isAvm2Enabled) {
1.38397 + if (symbol.frameScripts) {
1.38398 + var data = symbol.frameScripts;
1.38399 + for (var i = 0; i < data.length; i += 2) {
1.38400 + var frameNum = data[i] + 1;
1.38401 + var block = data[i + 1];
1.38402 + var script = function (block, loader) {
1.38403 + return function () {
1.38404 + var avm1Context = loader._avm1Context;
1.38405 + return executeActions(block, avm1Context, this._getAS2Object());
1.38406 + };
1.38407 + }(block, this);
1.38408 + if (!frameScripts[frameNum])
1.38409 + frameScripts[frameNum] = [
1.38410 + script
1.38411 + ];
1.38412 + else
1.38413 + frameScripts[frameNum].push(script);
1.38414 + }
1.38415 + }
1.38416 + }
1.38417 + className = 'flash.display.MovieClip';
1.38418 + props.timeline = timeline;
1.38419 + props.framesLoaded = frameCount;
1.38420 + props.labelMap = labelMap;
1.38421 + props.frameScripts = frameScripts;
1.38422 + props.totalFrames = frameCount;
1.38423 + props.startSoundRegistrations = startSoundRegistrations;
1.38424 + break;
1.38425 + }
1.38426 + dictionary[symbol.id] = symbolPromise;
1.38427 + Promise.all(promiseQueue).then(function () {
1.38428 + var symbolInfo = {
1.38429 + className: className,
1.38430 + props: props
1.38431 + };
1.38432 + dictionaryResolved[symbol.id] = symbolInfo;
1.38433 + symbolPromiseResolve(symbolInfo);
1.38434 + });
1.38435 + },
1.38436 + _registerFont: function (className, props) {
1.38437 + this._vmPromise.then(function () {
1.38438 + var fontClass = avm2.applicationDomain.getClass(className);
1.38439 + var font = fontClass.createAsSymbol(props);
1.38440 + fontClass.instanceConstructor.call(font);
1.38441 + });
1.38442 + },
1.38443 + _init: function (info) {
1.38444 + var loader = this;
1.38445 + var loaderInfo = loader._contentLoaderInfo;
1.38446 + loaderInfo._swfVersion = info.swfVersion;
1.38447 + var bbox = info.bbox;
1.38448 + loaderInfo._width = bbox.xMax - bbox.xMin;
1.38449 + loaderInfo._height = bbox.yMax - bbox.yMin;
1.38450 + loaderInfo._frameRate = info.frameRate;
1.38451 + var vmPromiseResolve, vmPromiseReject;
1.38452 + var vmPromise = new Promise(function (resolve, reject) {
1.38453 + vmPromiseResolve = resolve;
1.38454 + vmPromiseReject = reject;
1.38455 + });
1.38456 + vmPromise.resolve = vmPromiseResolve;
1.38457 + vmPromise.reject = vmPromiseReject;
1.38458 + var documentPromise = new Promise(function (resolve) {
1.38459 + vmPromise.then(function () {
1.38460 + var rootInfo = {
1.38461 + className: 'flash.display.MovieClip',
1.38462 + props: {
1.38463 + totalFrames: info.frameCount
1.38464 + }
1.38465 + };
1.38466 + loader._dictionaryResolved[0] = rootInfo;
1.38467 + resolve(rootInfo);
1.38468 + });
1.38469 + });
1.38470 + loader._dictionary[0] = documentPromise;
1.38471 + loader._lastPromise = documentPromise;
1.38472 + loader._vmPromise = vmPromise;
1.38473 + loader._isAvm2Enabled = info.fileAttributes.doAbc;
1.38474 + this._setup();
1.38475 + },
1.38476 + _load: function (request, checkPolicyFile, applicationDomain, securityDomain, requestedContentParent, parameters, deblockingFilter, allowCodeImport, imageDecodingPolicy) {
1.38477 + if (flash.net.URLRequest.class.isInstanceOf(request)) {
1.38478 + this._contentLoaderInfo._url = request._url;
1.38479 + }
1.38480 + var worker;
1.38481 + if (WORKERS_ENABLED) {
1.38482 + worker = new Worker(SHUMWAY_ROOT + LOADER_PATH);
1.38483 + } else {
1.38484 + worker = new ResourceLoader(window);
1.38485 + }
1.38486 + var loader = this;
1.38487 + loader._worker = worker;
1.38488 + worker.onmessage = function (evt) {
1.38489 + if (evt.data.type === 'exception') {
1.38490 + avm2.exceptions.push({
1.38491 + source: 'parser',
1.38492 + message: evt.data.message,
1.38493 + stack: evt.data.stack
1.38494 + });
1.38495 + } else {
1.38496 + loader._commitData(evt.data);
1.38497 + }
1.38498 + };
1.38499 + if (flash.net.URLRequest.class.isInstanceOf(request)) {
1.38500 + var session = FileLoadingService.createSession();
1.38501 + session.onprogress = function (data, progress) {
1.38502 + worker.postMessage({
1.38503 + data: data,
1.38504 + progress: progress
1.38505 + });
1.38506 + };
1.38507 + session.onerror = function (error) {
1.38508 + loader._commitData({
1.38509 + command: 'error',
1.38510 + error: error
1.38511 + });
1.38512 + };
1.38513 + session.onopen = function () {
1.38514 + worker.postMessage('pipe:');
1.38515 + };
1.38516 + session.onclose = function () {
1.38517 + worker.postMessage({
1.38518 + data: null
1.38519 + });
1.38520 + };
1.38521 + session.open(request._toFileRequest());
1.38522 + } else {
1.38523 + worker.postMessage(request);
1.38524 + }
1.38525 + },
1.38526 + _setup: function () {
1.38527 + var loader = this;
1.38528 + var stage = loader._stage;
1.38529 + if (loader._isAvm2Enabled) {
1.38530 + var mouseClass = avm2.systemDomain.getClass('flash.ui.Mouse');
1.38531 + mouseClass._stage = stage;
1.38532 + loader._vmPromise.resolve();
1.38533 + return;
1.38534 + }
1.38535 + if (!avm2.loadAVM1) {
1.38536 + loader._vmPromise.reject('AVM1 loader is not found');
1.38537 + return;
1.38538 + }
1.38539 + var loaded = function () {
1.38540 + var loaderInfo = loader._contentLoaderInfo;
1.38541 + var avm1Context = new AS2Context(loaderInfo._swfVersion);
1.38542 + avm1Context.stage = stage;
1.38543 + loader._avm1Context = avm1Context;
1.38544 + avm1lib.AS2Key.class.$bind(stage);
1.38545 + avm1lib.AS2Mouse.class.$bind(stage);
1.38546 + stage._addEventListener('frameConstructed', avm1Context.flushPendingScripts.bind(avm1Context), false, Number.MAX_VALUE);
1.38547 + loader._vmPromise.resolve();
1.38548 + };
1.38549 + if (avm2.isAVM1Loaded) {
1.38550 + if (AS2Context.instance) {
1.38551 + loader._avm1Context = AS2Context.instance;
1.38552 + loader._vmPromise.resolve();
1.38553 + } else {
1.38554 + loaded();
1.38555 + }
1.38556 + } else {
1.38557 + avm2.isAVM1Loaded = true;
1.38558 + avm2.loadAVM1(loaded);
1.38559 + }
1.38560 + },
1.38561 + get contentLoaderInfo() {
1.38562 + return this._contentLoaderInfo;
1.38563 + },
1.38564 + get content() {
1.38565 + somewhatImplemented('Loader.content');
1.38566 + return this._content;
1.38567 + }
1.38568 + };
1.38569 + def.__glue__ = {
1.38570 + native: {
1.38571 + instance: {
1.38572 + content: Object.getOwnPropertyDescriptor(def, 'content'),
1.38573 + contentLoaderInfo: Object.getOwnPropertyDescriptor(def, 'contentLoaderInfo'),
1.38574 + _getJPEGLoaderContextdeblockingfilter: function (context) {
1.38575 + return 0;
1.38576 + },
1.38577 + _load: def._load,
1.38578 + _loadBytes: function _loadBytes(bytes, checkPolicyFile, applicationDomain, securityDomain, requestedContentParent, parameters, deblockingFilter, allowLoadBytesCodeExecution, imageDecodingPolicy) {
1.38579 + this._load(bytes.a, checkPolicyFile, applicationDomain, securityDomain, requestedContentParent, parameters, deblockingFilter, allowLoadBytesCodeExecution, imageDecodingPolicy);
1.38580 + },
1.38581 + _unload: function _unload(halt, gc) {
1.38582 + somewhatImplemented('Loader._unload, do we even need to do anything here?');
1.38583 + },
1.38584 + _close: function _close() {
1.38585 + somewhatImplemented('Loader._close');
1.38586 + },
1.38587 + _getUncaughtErrorEvents: function _getUncaughtErrorEvents() {
1.38588 + somewhatImplemented('Loader._getUncaughtErrorEvents');
1.38589 + return this._uncaughtErrorEvents;
1.38590 + },
1.38591 + _setUncaughtErrorEvents: function _setUncaughtErrorEvents(value) {
1.38592 + somewhatImplemented('Loader._setUncaughtErrorEvents');
1.38593 + this._uncaughtErrorEvents = value;
1.38594 + }
1.38595 + }
1.38596 + }
1.38597 + };
1.38598 + return def;
1.38599 + }.call(this);
1.38600 +var LoaderInfoDefinition = function () {
1.38601 + function dispatchEvent(event) {
1.38602 + notImplemented('LoaderInfo.dispatchEvent');
1.38603 + }
1.38604 + return {
1.38605 + __class__: 'flash.display.LoaderInfo',
1.38606 + initialize: function () {
1.38607 + this._actionScriptVersion = null;
1.38608 + this._backgroundColor = null;
1.38609 + this._bytes = null;
1.38610 + this._bytesLoaded = 0;
1.38611 + this._bytesTotal = 0;
1.38612 + this._content = null;
1.38613 + this._contentType = null;
1.38614 + this._frameRate = null;
1.38615 + this._height = null;
1.38616 + this._loader = null;
1.38617 + this._loaderURL = null;
1.38618 + this._swfVersion = null;
1.38619 + this._url = null;
1.38620 + this._width = null;
1.38621 + this._uncaughtErrorEvents = null;
1.38622 + },
1.38623 + __glue__: {
1.38624 + native: {
1.38625 + static: {
1.38626 + getLoaderInfoByDefinition: function getLoaderInfoByDefinition(object) {
1.38627 + notImplemented('LoaderInfo.getLoaderInfoByDefinition');
1.38628 + }
1.38629 + },
1.38630 + instance: {
1.38631 + _getArgs: function _getArgs() {
1.38632 + var params = this._parameters;
1.38633 + var mangled = {};
1.38634 + for (var k in params) {
1.38635 + mangled[Multiname.getPublicQualifiedName(k)] = params[k];
1.38636 + }
1.38637 + return mangled;
1.38638 + },
1.38639 + _getUncaughtErrorEvents: function _getUncaughtErrorEvents() {
1.38640 + somewhatImplemented('Loader._getUncaughtErrorEvents');
1.38641 + return this._uncaughtErrorEvents;
1.38642 + },
1.38643 + _setUncaughtErrorEvents: function _setUncaughtErrorEvents(value) {
1.38644 + somewhatImplemented('Loader._setUncaughtErrorEvents');
1.38645 + this._uncaughtErrorEvents = value;
1.38646 + },
1.38647 + loaderURL: {
1.38648 + get: function loaderURL() {
1.38649 + return this._loaderURL;
1.38650 + }
1.38651 + },
1.38652 + url: {
1.38653 + get: function url() {
1.38654 + return this._url;
1.38655 + }
1.38656 + },
1.38657 + isURLInaccessible: {
1.38658 + get: function isURLInaccessible() {
1.38659 + return this._isURLInaccessible;
1.38660 + }
1.38661 + },
1.38662 + bytesLoaded: {
1.38663 + get: function bytesLoaded() {
1.38664 + return this._bytesLoaded;
1.38665 + }
1.38666 + },
1.38667 + bytesTotal: {
1.38668 + get: function bytesTotal() {
1.38669 + return this._bytesTotal;
1.38670 + }
1.38671 + },
1.38672 + applicationDomain: {
1.38673 + get: function applicationDomain() {
1.38674 + return new flash.system.ApplicationDomain(avm2.applicationDomain);
1.38675 + }
1.38676 + },
1.38677 + swfVersion: {
1.38678 + get: function swfVersion() {
1.38679 + return this._swfVersion;
1.38680 + }
1.38681 + },
1.38682 + actionScriptVersion: {
1.38683 + get: function actionScriptVersion() {
1.38684 + return this._actionScriptVersion;
1.38685 + }
1.38686 + },
1.38687 + frameRate: {
1.38688 + get: function frameRate() {
1.38689 + return this._frameRate;
1.38690 + }
1.38691 + },
1.38692 + width: {
1.38693 + get: function width() {
1.38694 + return this._width;
1.38695 + }
1.38696 + },
1.38697 + height: {
1.38698 + get: function height() {
1.38699 + return this._height;
1.38700 + }
1.38701 + },
1.38702 + contentType: {
1.38703 + get: function contentType() {
1.38704 + return this._contentType;
1.38705 + }
1.38706 + },
1.38707 + sharedEvents: {
1.38708 + get: function sharedEvents() {
1.38709 + return this._sharedEvents;
1.38710 + }
1.38711 + },
1.38712 + parentSandboxBridge: {
1.38713 + get: function parentSandboxBridge() {
1.38714 + return this._parentSandboxBridge;
1.38715 + },
1.38716 + set: function parentSandboxBridge(door) {
1.38717 + this._parentSandboxBridge = door;
1.38718 + }
1.38719 + },
1.38720 + childSandboxBridge: {
1.38721 + get: function childSandboxBridge() {
1.38722 + return this._childSandboxBridge;
1.38723 + },
1.38724 + set: function childSandboxBridge(door) {
1.38725 + this._childSandboxBridge = door;
1.38726 + }
1.38727 + },
1.38728 + sameDomain: {
1.38729 + get: function sameDomain() {
1.38730 + return this._sameDomain;
1.38731 + }
1.38732 + },
1.38733 + childAllowsParent: {
1.38734 + get: function childAllowsParent() {
1.38735 + return this._childAllowsParent;
1.38736 + }
1.38737 + },
1.38738 + parentAllowsChild: {
1.38739 + get: function parentAllowsChild() {
1.38740 + return this._parentAllowsChild;
1.38741 + }
1.38742 + },
1.38743 + loader: {
1.38744 + get: function loader() {
1.38745 + return this._loader;
1.38746 + }
1.38747 + },
1.38748 + content: {
1.38749 + get: function content() {
1.38750 + return this._loader._content;
1.38751 + }
1.38752 + },
1.38753 + bytes: {
1.38754 + get: function bytes() {
1.38755 + return this._bytes;
1.38756 + }
1.38757 + }
1.38758 + }
1.38759 + },
1.38760 + script: {
1.38761 + instance: scriptProperties('public', [
1.38762 + 'swfVersion',
1.38763 + 'bytesTotal',
1.38764 + 'bytesLoaded',
1.38765 + 'parameters',
1.38766 + 'uncaughtErrorEvent'
1.38767 + ])
1.38768 + }
1.38769 + }
1.38770 + };
1.38771 + }.call(this);
1.38772 +var MorphShapeDefinition = function () {
1.38773 + var def = {
1.38774 + __class__: 'flash.display.MorphShape',
1.38775 + initialize: function () {
1.38776 + var graphics = this._graphics = new flash.display.Graphics();
1.38777 + var s = this.symbol;
1.38778 + if (s && s.paths) {
1.38779 + graphics._paths = s.paths;
1.38780 + graphics.bbox = s.bbox;
1.38781 + graphics.strokeBbox = s.strokeBbox;
1.38782 + if (this._stage && this._stage._quality === 'low' && !graphics._bitmap)
1.38783 + graphics._cacheAsBitmap(this._bbox);
1.38784 + }
1.38785 + }
1.38786 + };
1.38787 + def.__glue__ = {
1.38788 + native: {
1.38789 + instance: {
1.38790 + graphics: {
1.38791 + get: function () {
1.38792 + return this._graphics;
1.38793 + }
1.38794 + }
1.38795 + }
1.38796 + }
1.38797 + };
1.38798 + return def;
1.38799 + }.call(this);
1.38800 +var MovieClipDefinition = function () {
1.38801 + var def = {
1.38802 + __class__: 'flash.display.MovieClip',
1.38803 + initialize: function () {
1.38804 + this._playHead = 1;
1.38805 + this._currentFrame = 1;
1.38806 + this._currentFrameLabel = null;
1.38807 + this._currentLabel = null;
1.38808 + this._currentScene = 0;
1.38809 + this._enabled = true;
1.38810 + this._frameScripts = {};
1.38811 + this._framesLoaded = 1;
1.38812 + this._isPlaying = false;
1.38813 + this._labelMap = {};
1.38814 + this._sceneFrameMap = {};
1.38815 + this._sceneMap = {};
1.38816 + this._scenes = null;
1.38817 + this._timeline = null;
1.38818 + this._totalFrames = 1;
1.38819 + this._startSoundRegistrations = [];
1.38820 + this._allowFrameNavigation = true;
1.38821 + this._complete = true;
1.38822 + var s = this.symbol;
1.38823 + if (s) {
1.38824 + this._timeline = s.timeline || null;
1.38825 + this._framesLoaded = s.framesLoaded || 1;
1.38826 + this._labelMap = Object.create(s.labelMap || null);
1.38827 + this._frameScripts = Object.create(s.frameScripts || null);
1.38828 + this._totalFrames = s.totalFrames || 1;
1.38829 + this._startSoundRegistrations = s.startSoundRegistrations || [];
1.38830 + this._scenes = s.scenes || null;
1.38831 + this._complete = s.complete === false ? false : true;
1.38832 + var map = this._labelMap;
1.38833 + for (var name in map) {
1.38834 + var frame = map[name];
1.38835 + if (frame == 1) {
1.38836 + this._currentFrameLabel = this._currentLabel = name;
1.38837 + }
1.38838 + }
1.38839 + }
1.38840 + this._enterFrame(1);
1.38841 + var self = this;
1.38842 + this._onExecuteFrame = function onExecuteFrame() {
1.38843 + self._removeEventListener('executeFrame', onExecuteFrame);
1.38844 + self._allowFrameNavigation = false;
1.38845 + self._callFrame(self._currentFrame);
1.38846 + self._allowFrameNavigation = true;
1.38847 + if (self._playHead !== self._currentFrame) {
1.38848 + self._gotoFrame(self._playHead, true);
1.38849 + }
1.38850 + self._postConstructChildren();
1.38851 + };
1.38852 + this._addEventListener('executeFrame', this._onExecuteFrame);
1.38853 + if (this._complete && this._totalFrames <= 1) {
1.38854 + return this;
1.38855 + }
1.38856 + this._onAdvanceFrame = function onAdvanceFrame() {
1.38857 + var frameNum = self._playHead + 1;
1.38858 + if (self._complete && frameNum > self._totalFrames) {
1.38859 + frameNum = 1;
1.38860 + } else if (frameNum > self._framesLoaded) {
1.38861 + return;
1.38862 + }
1.38863 + self._updateDisplayList(frameNum);
1.38864 + if (self._sparse) {
1.38865 + self._addEventListener('constructChildren', self._onConstructChildren);
1.38866 + }
1.38867 + self._startSounds(frameNum);
1.38868 + self._enterFrame(frameNum);
1.38869 + if (frameNum in self._frameScripts) {
1.38870 + self._addEventListener('executeFrame', self._onExecuteFrame);
1.38871 + }
1.38872 + };
1.38873 + this._onConstructChildren = function onConstructChildren() {
1.38874 + self._removeEventListener('constructChildren', onConstructChildren);
1.38875 + self._constructChildren();
1.38876 + };
1.38877 + this.play();
1.38878 + },
1.38879 + _updateDisplayList: function (nextFrameNum) {
1.38880 + this._destructChildren(nextFrameNum);
1.38881 + this._declareChildren(nextFrameNum);
1.38882 + },
1.38883 + _declareChildren: function declareChildren(nextFrameNum) {
1.38884 + var currentFrame = this._currentFrame;
1.38885 + if (nextFrameNum === currentFrame) {
1.38886 + return;
1.38887 + }
1.38888 + var timeline = this._timeline;
1.38889 + var nextDisplayList = timeline[nextFrameNum - 1];
1.38890 + if (nextDisplayList === timeline[currentFrame - 1]) {
1.38891 + return;
1.38892 + }
1.38893 + var prevDisplayListItem = null;
1.38894 + var currentDisplayListItem = this._currentDisplayList;
1.38895 + var children = this._children;
1.38896 + var depths = nextDisplayList.depths;
1.38897 + var index = children.length;
1.38898 + var i = depths.length;
1.38899 + while (i--) {
1.38900 + var depth = depths[i], depthInt = depth | 0;
1.38901 + while (currentDisplayListItem && currentDisplayListItem.depth > depthInt) {
1.38902 + prevDisplayListItem = currentDisplayListItem;
1.38903 + currentDisplayListItem = currentDisplayListItem.next;
1.38904 + }
1.38905 + var currentChild = null;
1.38906 + if (currentDisplayListItem && currentDisplayListItem.depth === depthInt) {
1.38907 + currentChild = currentDisplayListItem.obj;
1.38908 + if (currentChild && currentChild._owned) {
1.38909 + index = this.getChildIndex(currentChild);
1.38910 + }
1.38911 + }
1.38912 + var currentCmd = currentDisplayListItem && currentDisplayListItem.depth === depthInt ? currentDisplayListItem.cmd : null;
1.38913 + var nextCmd = nextDisplayList[depth];
1.38914 + if (!nextCmd || nextCmd === currentCmd) {
1.38915 + continue;
1.38916 + }
1.38917 + if (currentCmd && currentChild && nextCmd.symbolId === currentCmd.symbolId && nextCmd.ratio === currentCmd.ratio) {
1.38918 + if (currentChild._animated) {
1.38919 + currentChild._invalidate();
1.38920 + if (nextCmd.hasMatrix) {
1.38921 + currentChild._setTransformMatrix(nextCmd.matrix, false);
1.38922 + }
1.38923 + if (nextCmd.hasCxform) {
1.38924 + currentChild._cxform = nextCmd.cxform;
1.38925 + }
1.38926 + if (nextCmd.clip) {
1.38927 + currentChild._clipDepth = nextCmd.clipDepth;
1.38928 + }
1.38929 + if (nextCmd.hasName) {
1.38930 + currentChild.name = nextCmd.name;
1.38931 + }
1.38932 + if (nextCmd.blend) {
1.38933 + currentChild._blendMode = this._resolveBlendMode(nextCmd.blendMode);
1.38934 + }
1.38935 + }
1.38936 + currentDisplayListItem.cmd = nextCmd;
1.38937 + continue;
1.38938 + }
1.38939 + var newDisplayListItem = this._addTimelineChild(nextCmd, index);
1.38940 + newDisplayListItem.next = currentDisplayListItem;
1.38941 + if (prevDisplayListItem) {
1.38942 + prevDisplayListItem.next = newDisplayListItem;
1.38943 + } else {
1.38944 + this._currentDisplayList = newDisplayListItem;
1.38945 + }
1.38946 + prevDisplayListItem = newDisplayListItem;
1.38947 + }
1.38948 + },
1.38949 + _destructChildren: function destructChildren(nextFrameNum) {
1.38950 + var currentFrame = this._currentFrame;
1.38951 + if (nextFrameNum === currentFrame) {
1.38952 + return;
1.38953 + }
1.38954 + var timeline = this._timeline;
1.38955 + var nextDisplayList = timeline[nextFrameNum - 1];
1.38956 + if (nextDisplayList === timeline[currentFrame - 1]) {
1.38957 + return;
1.38958 + }
1.38959 + var prevEntry = null;
1.38960 + var currentEntry = this._currentDisplayList;
1.38961 + var toRemove = null;
1.38962 + while (currentEntry) {
1.38963 + var depth = currentEntry.depth;
1.38964 + var currentCmd = currentEntry.cmd;
1.38965 + var nextCmd = nextDisplayList[depth];
1.38966 + if (!nextCmd || nextCmd.symbolId !== currentCmd.symbolId || nextCmd.ratio !== currentCmd.ratio) {
1.38967 + var nextDisplayListItem = currentEntry.next;
1.38968 + if (prevEntry) {
1.38969 + prevEntry.next = nextDisplayListItem;
1.38970 + } else {
1.38971 + this._currentDisplayList = nextDisplayListItem;
1.38972 + }
1.38973 + currentEntry.next = toRemove;
1.38974 + toRemove = currentEntry;
1.38975 + currentEntry = nextDisplayListItem;
1.38976 + } else {
1.38977 + prevEntry = currentEntry;
1.38978 + currentEntry = currentEntry.next;
1.38979 + }
1.38980 + }
1.38981 + while (toRemove) {
1.38982 + var child = toRemove.obj;
1.38983 + if (child && child._owned) {
1.38984 + this._sparse = true;
1.38985 + this.removeChild(child);
1.38986 + child.destroy();
1.38987 + if (child._isPlaying) {
1.38988 + child.stop();
1.38989 + }
1.38990 + }
1.38991 + toRemove = toRemove.next;
1.38992 + }
1.38993 + },
1.38994 + _gotoFrame: function gotoFrame(frameNum, execute) {
1.38995 + var enterFrame = frameNum !== this._currentFrame;
1.38996 + if (this._allowFrameNavigation || !this._loader._isAvm2Enabled) {
1.38997 + if (enterFrame) {
1.38998 + this._updateDisplayList(frameNum);
1.38999 + this._enterFrame(frameNum);
1.39000 + }
1.39001 + this._constructChildren();
1.39002 + if (this._loader._isAvm2Enabled && this.loaderInfo._swfVersion >= 10) {
1.39003 + if (enterFrame) {
1.39004 + this._addEventListener('executeFrame', this._onExecuteFrame);
1.39005 + }
1.39006 + var domain = avm2.systemDomain;
1.39007 + domain.broadcastMessage('frameConstructed');
1.39008 + domain.broadcastMessage('executeFrame');
1.39009 + domain.broadcastMessage('exitFrame');
1.39010 + return;
1.39011 + }
1.39012 + if (enterFrame && (execute || !this._loader._isAvm2Enabled)) {
1.39013 + this._callFrame(frameNum);
1.39014 + }
1.39015 + this._postConstructChildren();
1.39016 + return;
1.39017 + }
1.39018 + if (enterFrame) {
1.39019 + this._playHead = frameNum;
1.39020 + }
1.39021 + },
1.39022 + _enterFrame: function navigate(frameNum) {
1.39023 + if (frameNum === this._currentFrame) {
1.39024 + return;
1.39025 + }
1.39026 + this._currentFrameLabel = null;
1.39027 + if (frameNum === 1) {
1.39028 + this._currentLabel = null;
1.39029 + }
1.39030 + var map = this._labelMap;
1.39031 + for (var name in map) {
1.39032 + if (map[name] === frameNum) {
1.39033 + this._currentFrameLabel = this._currentLabel = name;
1.39034 + break;
1.39035 + }
1.39036 + }
1.39037 + if (this._scenes) {
1.39038 + var scenes = this._scenes;
1.39039 + for (var j = 0, n = scenes.length; j < n; j++) {
1.39040 + var scene = scenes[j];
1.39041 + if (frameNum >= scene._startFrame && frameNum <= scene._endFrame) {
1.39042 + this._currentScene = j;
1.39043 + break;
1.39044 + }
1.39045 + }
1.39046 + }
1.39047 + this._playHead = this._currentFrame = frameNum;
1.39048 + },
1.39049 + _callFrame: function callFrame(frame) {
1.39050 + if (isNaN(frame)) {
1.39051 + frame = this._labelMap[frame];
1.39052 + if (frame === undefined) {
1.39053 + return;
1.39054 + }
1.39055 + }
1.39056 + if (frame in this._frameScripts) {
1.39057 + var scripts = this._frameScripts[frame];
1.39058 + try {
1.39059 + for (var i = 0, n = scripts.length; i < n; i++) {
1.39060 + scripts[i].call(this);
1.39061 + }
1.39062 + } catch (e) {
1.39063 + var AVM2_ERROR_TYPE = 2;
1.39064 + TelemetryService.reportTelemetry({
1.39065 + topic: 'error',
1.39066 + error: AVM2_ERROR_TYPE
1.39067 + });
1.39068 + if (false) {
1.39069 + console.error('error ' + e + ', stack: \n' + e.stack);
1.39070 + }
1.39071 + this.stop();
1.39072 + throw e;
1.39073 + }
1.39074 + }
1.39075 + },
1.39076 + _gotoButtonState: function gotoButtonState(stateName) {
1.39077 + if (this._enabled) {
1.39078 + this.gotoLabel('_' + stateName);
1.39079 + }
1.39080 + },
1.39081 + _getAbsFrameNum: function (frameNum, sceneName) {
1.39082 + if (frameNum < 1) {
1.39083 + frameNum = 1;
1.39084 + }
1.39085 + if (sceneName && this._scenes && this._scenes.length > 1) {
1.39086 + var scenes = this._scenes;
1.39087 + for (var i = 0; i < scenes.length; i++) {
1.39088 + var scene = scenes[i];
1.39089 + if (scene.name === sceneName) {
1.39090 + frameNum += scene._startFrame - 1;
1.39091 + if (frameNum > scene._endFrame) {
1.39092 + frameNum = scene._endFrame;
1.39093 + }
1.39094 + break;
1.39095 + }
1.39096 + }
1.39097 + }
1.39098 + if (frameNum > this._framesLoaded) {
1.39099 + return this._framesLoaded;
1.39100 + }
1.39101 + return frameNum;
1.39102 + },
1.39103 + _registerStartSounds: function (frameNum, starts) {
1.39104 + this._startSoundRegistrations[frameNum] = starts;
1.39105 + },
1.39106 + _initSoundStream: function (streamInfo) {
1.39107 + this._soundStream = new MovieClipSoundStream(streamInfo, this);
1.39108 + },
1.39109 + _addSoundStreamBlock: function (frameNum, streamBlock) {
1.39110 + this._soundStream.appendBlock(frameNum, streamBlock);
1.39111 + },
1.39112 + _startSounds: function (frameNum) {
1.39113 + var starts = this._startSoundRegistrations[frameNum];
1.39114 + if (starts) {
1.39115 + var sounds = this._sounds || (this._sounds = {});
1.39116 + var loader = this.loaderInfo._loader;
1.39117 + for (var i = 0; i < starts.length; i++) {
1.39118 + var start = starts[i];
1.39119 + var symbolId = start.soundId;
1.39120 + var info = start.soundInfo;
1.39121 + var sound = sounds[symbolId];
1.39122 + if (!sound) {
1.39123 + var symbolInfo = loader._dictionaryResolved[symbolId];
1.39124 + if (!symbolInfo)
1.39125 + continue;
1.39126 + var symbolClass = avm2.systemDomain.findClass(symbolInfo.className) ? avm2.systemDomain.getClass(symbolInfo.className) : avm2.applicationDomain.getClass(symbolInfo.className);
1.39127 + var soundObj = symbolClass.createAsSymbol(symbolInfo.props);
1.39128 + symbolClass.instanceConstructor.call(soundObj);
1.39129 + sounds[symbolId] = sound = {
1.39130 + object: soundObj
1.39131 + };
1.39132 + }
1.39133 + if (sound.channel) {
1.39134 + sound.channel.stop();
1.39135 + sound.channel = null;
1.39136 + }
1.39137 + if (!info.stop) {
1.39138 + var loops = info.hasLoops ? info.loopCount : 0;
1.39139 + sound.channel = sound.object.play(0, loops);
1.39140 + }
1.39141 + }
1.39142 + }
1.39143 + if (this._soundStream) {
1.39144 + this._soundStream.playFrame(frameNum);
1.39145 + }
1.39146 + },
1.39147 + _getAS2Object: function () {
1.39148 + if (!this.$as2Object) {
1.39149 + if (this._avm1SymbolClass) {
1.39150 + var nativeObject = this, nativeObjectClass = this._avm1SymbolClass;
1.39151 + var constructWrapper = function () {
1.39152 + this.init(nativeObject);
1.39153 + nativeObjectClass.call(this);
1.39154 + };
1.39155 + constructWrapper.prototype = Object.create(nativeObjectClass.prototype);
1.39156 + constructWrapper.instanceConstructor = constructWrapper;
1.39157 + constructWrapper.debugName = 'avm1 <symbol constructor wrapper>';
1.39158 + construct(constructWrapper);
1.39159 + } else {
1.39160 + new avm1lib.AS2MovieClip(this);
1.39161 + }
1.39162 + }
1.39163 + return this.$as2Object;
1.39164 + },
1.39165 + get currentFrame() {
1.39166 + var frameNum = this._currentFrame;
1.39167 + return this._scenes ? frameNum - this.currentScene._startFrame + 1 : frameNum;
1.39168 + },
1.39169 + get currentFrameLabel() {
1.39170 + return this._currentFrameLabel;
1.39171 + },
1.39172 + get currentLabel() {
1.39173 + return this._currentLabel;
1.39174 + },
1.39175 + get currentLabels() {
1.39176 + if (this._scenes) {
1.39177 + return this._scenes[this._currentScene].labels;
1.39178 + } else {
1.39179 + var labels = [];
1.39180 + var map = this._labelMap;
1.39181 + for (var name in map) {
1.39182 + labels.push(new flash.display.FrameLabel(name, map[name]));
1.39183 + }
1.39184 + return labels;
1.39185 + }
1.39186 + },
1.39187 + get currentScene() {
1.39188 + return this._scenes ? this._scenes[this._currentScene] : new flash.display.Scene('', this.currentLabels, this._framesLoaded);
1.39189 + },
1.39190 + get enabled() {
1.39191 + return this._enabled;
1.39192 + },
1.39193 + set enabled(val) {
1.39194 + this._enabled = val;
1.39195 + },
1.39196 + get framesLoaded() {
1.39197 + return this._framesLoaded;
1.39198 + },
1.39199 + get totalFrames() {
1.39200 + return this._totalFrames;
1.39201 + },
1.39202 + get scenes() {
1.39203 + return this._scenes || [
1.39204 + new flash.display.Scene('', this.currentLabels, this._framesLoaded)
1.39205 + ];
1.39206 + },
1.39207 + get trackAsMenu() {
1.39208 + return false;
1.39209 + },
1.39210 + set trackAsMenu(val) {
1.39211 + notImplemented();
1.39212 + },
1.39213 + addFrameScript: function () {
1.39214 + var frameScripts = this._frameScripts;
1.39215 + for (var i = 0, n = arguments.length; i < n; i += 2) {
1.39216 + var frameNum = arguments[i] + 1;
1.39217 + var fn = arguments[i + 1];
1.39218 + if (!fn) {
1.39219 + continue;
1.39220 + }
1.39221 + var scripts = frameScripts[frameNum];
1.39222 + if (scripts) {
1.39223 + scripts.push(fn);
1.39224 + } else {
1.39225 + frameScripts[frameNum] = [
1.39226 + fn
1.39227 + ];
1.39228 + }
1.39229 + if (frameNum === this._currentFrame) {
1.39230 + this._addEventListener('executeFrame', this._onExecuteFrame);
1.39231 + }
1.39232 + }
1.39233 + },
1.39234 + gotoAndPlay: function (frame, scene) {
1.39235 + this.play();
1.39236 + if (isNaN(frame)) {
1.39237 + this.gotoLabel(frame);
1.39238 + } else {
1.39239 + this._gotoFrame(this._getAbsFrameNum(frame, scene));
1.39240 + }
1.39241 + },
1.39242 + gotoAndStop: function (frame, scene) {
1.39243 + this.stop();
1.39244 + if (isNaN(frame)) {
1.39245 + this.gotoLabel(frame);
1.39246 + } else {
1.39247 + this._gotoFrame(this._getAbsFrameNum(frame, scene));
1.39248 + }
1.39249 + },
1.39250 + gotoLabel: function (labelName) {
1.39251 + var frameNum = this._labelMap[labelName];
1.39252 + if (frameNum !== undefined) {
1.39253 + this._gotoFrame(frameNum);
1.39254 + }
1.39255 + },
1.39256 + isPlaying: function () {
1.39257 + return this._isPlaying;
1.39258 + },
1.39259 + nextFrame: function () {
1.39260 + this.stop();
1.39261 + if (this._currentFrame < this._framesLoaded) {
1.39262 + this._gotoFrame(this._currentFrame + 1);
1.39263 + }
1.39264 + },
1.39265 + nextScene: function () {
1.39266 + if (this._scenes && this._currentScene < this._scenes.length - 1) {
1.39267 + this._gotoFrame(this._scenes[this._currentScene + 1]._startFrame);
1.39268 + }
1.39269 + },
1.39270 + play: function () {
1.39271 + if (this._isPlaying || this._complete && this._totalFrames <= 1) {
1.39272 + return;
1.39273 + }
1.39274 + this._isPlaying = true;
1.39275 + this._addEventListener('advanceFrame', this._onAdvanceFrame);
1.39276 + },
1.39277 + prevFrame: function () {
1.39278 + this.stop();
1.39279 + if (this._currentFrame > 1) {
1.39280 + this._gotoFrame(this._currentFrame - 1);
1.39281 + }
1.39282 + },
1.39283 + prevScene: function () {
1.39284 + if (this._scenes && this._currentScene > 0) {
1.39285 + this._gotoFrame(this._scenes[this._currentScene - 1]._startFrame);
1.39286 + }
1.39287 + },
1.39288 + stop: function () {
1.39289 + if (!this._isPlaying || this._complete && this._totalFrames <= 1) {
1.39290 + return;
1.39291 + }
1.39292 + this._isPlaying = false;
1.39293 + this._removeEventListener('advanceFrame', this._onAdvanceFrame);
1.39294 + }
1.39295 + };
1.39296 + var desc = Object.getOwnPropertyDescriptor;
1.39297 + def.__glue__ = {
1.39298 + native: {
1.39299 + instance: {
1.39300 + currentFrame: desc(def, 'currentFrame'),
1.39301 + framesLoaded: desc(def, 'framesLoaded'),
1.39302 + totalFrames: desc(def, 'totalFrames'),
1.39303 + trackAsMenu: desc(def, 'trackAsMenu'),
1.39304 + scenes: desc(def, 'scenes'),
1.39305 + currentScene: desc(def, 'currentScene'),
1.39306 + currentLabel: desc(def, 'currentLabel'),
1.39307 + currentFrameLabel: desc(def, 'currentFrameLabel'),
1.39308 + enabled: desc(def, 'enabled'),
1.39309 + isPlaying: desc(def, 'isPlaying'),
1.39310 + play: def.play,
1.39311 + stop: def.stop,
1.39312 + nextFrame: def.nextFrame,
1.39313 + prevFrame: def.prevFrame,
1.39314 + gotoAndPlay: def.gotoAndPlay,
1.39315 + gotoAndStop: def.gotoAndStop,
1.39316 + addFrameScript: def.addFrameScript,
1.39317 + prevScene: def.prevScene,
1.39318 + nextScene: def.nextScene
1.39319 + }
1.39320 + }
1.39321 + };
1.39322 + return def;
1.39323 + }.call(this);
1.39324 +var MovieClipSoundStream = function () {
1.39325 + var MP3_MIME_TYPE = 'audio/mpeg';
1.39326 + function openMediaSource(soundStream, mediaSource) {
1.39327 + var sourceBuffer;
1.39328 + try {
1.39329 + sourceBuffer = mediaSource.addSourceBuffer(MP3_MIME_TYPE);
1.39330 + soundStream.mediaSource = mediaSource;
1.39331 + soundStream.sourceBuffer = sourceBuffer;
1.39332 + soundStream.rawFrames.forEach(function (data) {
1.39333 + sourceBuffer.appendBuffer(data);
1.39334 + });
1.39335 + delete soundStream.rawFrames;
1.39336 + } catch (e) {
1.39337 + console.error('MediaSource mp3 playback is not supported: ' + e);
1.39338 + }
1.39339 + }
1.39340 + function syncTime(element, movieClip) {
1.39341 + var initialized = false;
1.39342 + var startMediaTime, startRealTime;
1.39343 + element.addEventListener('timeupdate', function (e) {
1.39344 + if (!initialized) {
1.39345 + startMediaTime = element.currentTime;
1.39346 + startRealTime = performance.now();
1.39347 + initialized = true;
1.39348 + movieClip._stage._frameScheduler.startTrackDelta();
1.39349 + return;
1.39350 + }
1.39351 + var mediaDelta = element.currentTime - startMediaTime;
1.39352 + var realDelta = performance.now() - startRealTime;
1.39353 + movieClip._stage._frameScheduler.setDelta(realDelta - mediaDelta * 1000);
1.39354 + });
1.39355 + element.addEventListener('pause', function (e) {
1.39356 + movieClip._stage._frameScheduler.endTrackDelta();
1.39357 + initialized = false;
1.39358 + });
1.39359 + element.addEventListener('seeking', function (e) {
1.39360 + movieClip._stage._frameScheduler.endTrackDelta();
1.39361 + initialized = false;
1.39362 + });
1.39363 + }
1.39364 + function MovieClipSoundStream(streamInfo, movieClip) {
1.39365 + this.movieClip = movieClip;
1.39366 + this.data = {
1.39367 + sampleRate: streamInfo.sampleRate,
1.39368 + channels: streamInfo.channels
1.39369 + };
1.39370 + this.seekIndex = [];
1.39371 + this.position = 0;
1.39372 + var isMP3 = streamInfo.format === 'mp3';
1.39373 + if (isMP3 && PLAY_USING_AUDIO_TAG) {
1.39374 + var element = document.createElement('audio');
1.39375 + element.preload = 'metadata';
1.39376 + element.loop = false;
1.39377 + syncTime(element, movieClip);
1.39378 + if (element.canPlayType(MP3_MIME_TYPE)) {
1.39379 + this.element = element;
1.39380 + if (typeof MediaSource !== 'undefined') {
1.39381 + var mediaSource = new MediaSource();
1.39382 + mediaSource.addEventListener('sourceopen', openMediaSource.bind(null, this, mediaSource));
1.39383 + element.src = URL.createObjectURL(mediaSource);
1.39384 + } else {
1.39385 + console.warn('MediaSource is not supported');
1.39386 + }
1.39387 + this.rawFrames = [];
1.39388 + return;
1.39389 + }
1.39390 + }
1.39391 + var totalSamples = streamInfo.samplesCount * streamInfo.channels;
1.39392 + this.data.pcm = new Float32Array(totalSamples);
1.39393 + if (isMP3) {
1.39394 + var soundStream = this;
1.39395 + soundStream.decoderPosition = 0;
1.39396 + soundStream.decoderSession = new MP3DecoderSession();
1.39397 + soundStream.decoderSession.onframedata = function (frameData) {
1.39398 + var position = soundStream.decoderPosition;
1.39399 + soundStream.data.pcm.set(frameData, position);
1.39400 + soundStream.decoderPosition = position + frameData.length;
1.39401 + }.bind(this);
1.39402 + soundStream.decoderSession.onerror = function (error) {
1.39403 + console.error('ERROR: MP3DecoderSession: ' + error);
1.39404 + };
1.39405 + }
1.39406 + }
1.39407 + MovieClipSoundStream.prototype = {
1.39408 + appendBlock: function (frameNum, streamBlock) {
1.39409 + var streamPosition = this.position;
1.39410 + this.seekIndex[frameNum] = streamPosition + streamBlock.seek * this.data.channels;
1.39411 + this.position = streamPosition + streamBlock.samplesCount * this.data.channels;
1.39412 + if (this.sourceBuffer) {
1.39413 + this.sourceBuffer.appendBuffer(streamBlock.data);
1.39414 + return;
1.39415 + }
1.39416 + if (this.rawFrames) {
1.39417 + this.rawFrames.push(streamBlock.data);
1.39418 + return;
1.39419 + }
1.39420 + var decoderSession = this.decoderSession;
1.39421 + if (decoderSession) {
1.39422 + decoderSession.pushAsync(streamBlock.data);
1.39423 + } else {
1.39424 + this.data.pcm.set(streamBlock.pcm, streamPosition);
1.39425 + }
1.39426 + },
1.39427 + playFrame: function (frameNum) {
1.39428 + if (isNaN(this.seekIndex[frameNum])) {
1.39429 + return;
1.39430 + }
1.39431 + var PAUSE_WHEN_OF_SYNC_GREATER = 1;
1.39432 + var PLAYBACK_ADJUSTMENT = 0.25;
1.39433 + var element = this.element;
1.39434 + if (element) {
1.39435 + var soundStreamData = this.data;
1.39436 + var time = this.seekIndex[frameNum] / soundStreamData.sampleRate / soundStreamData.channels;
1.39437 + if (!this.channel && (this.movieClip._complete || this.sourceBuffer)) {
1.39438 + if (!this.sourceBuffer) {
1.39439 + var blob = new Blob(this.rawFrames);
1.39440 + element.src = URL.createObjectURL(blob);
1.39441 + }
1.39442 + var symbolClass = flash.media.SoundChannel.class;
1.39443 + var channel = symbolClass.createAsSymbol({
1.39444 + element: element
1.39445 + });
1.39446 + symbolClass.instanceConstructor.call(channel);
1.39447 + this.channel = channel;
1.39448 + this.expectedFrame = 0;
1.39449 + this.waitFor = 0;
1.39450 + } else if (this.sourceBuffer || !isNaN(element.duration)) {
1.39451 + if (this.mediaSource && this.movieClip._complete) {
1.39452 + this.mediaSource.endOfStream();
1.39453 + this.mediaSource = null;
1.39454 + }
1.39455 + var elementTime = element.currentTime;
1.39456 + if (this.expectedFrame !== frameNum) {
1.39457 + if (element.paused) {
1.39458 + element.play();
1.39459 + element.addEventListener('playing', function setTime(e) {
1.39460 + element.removeEventListener('playing', setTime);
1.39461 + element.currentTime = time;
1.39462 + });
1.39463 + } else {
1.39464 + element.currentTime = time;
1.39465 + }
1.39466 + } else if (this.waitFor > 0) {
1.39467 + if (this.waitFor <= time) {
1.39468 + if (element.paused) {
1.39469 + element.play();
1.39470 + }
1.39471 + this.waitFor = 0;
1.39472 + }
1.39473 + } else if (elementTime - time > PAUSE_WHEN_OF_SYNC_GREATER) {
1.39474 + console.warn('Sound is faster than frames by ' + (elementTime - time));
1.39475 + this.waitFor = elementTime - PLAYBACK_ADJUSTMENT;
1.39476 + element.pause();
1.39477 + } else if (time - elementTime > PAUSE_WHEN_OF_SYNC_GREATER) {
1.39478 + console.warn('Sound is slower than frames by ' + (time - elementTime));
1.39479 + element.currentTime = time + PLAYBACK_ADJUSTMENT;
1.39480 + }
1.39481 + this.expectedFrame = frameNum + 1;
1.39482 + }
1.39483 + } else if (!this.sound) {
1.39484 + var symbolClass = flash.media.Sound.class;
1.39485 + var sound = symbolClass.createAsSymbol(this.data);
1.39486 + symbolClass.instanceConstructor.call(sound);
1.39487 + var channel = sound.play();
1.39488 + this.sound = sound;
1.39489 + this.channel = channel;
1.39490 + }
1.39491 + }
1.39492 + };
1.39493 + return MovieClipSoundStream;
1.39494 + }();
1.39495 +var NativeMenuDefinition = function () {
1.39496 + return {
1.39497 + __class__: 'flash.display.NativeMenu',
1.39498 + initialize: function () {
1.39499 + },
1.39500 + __glue__: {
1.39501 + native: {
1.39502 + static: {},
1.39503 + instance: {}
1.39504 + }
1.39505 + }
1.39506 + };
1.39507 + }.call(this);
1.39508 +var NativeMenuItemDefinition = function () {
1.39509 + return {
1.39510 + __class__: 'flash.display.NativeMenuItem',
1.39511 + initialize: function () {
1.39512 + },
1.39513 + __glue__: {
1.39514 + native: {
1.39515 + static: {},
1.39516 + instance: {
1.39517 + enabled: {
1.39518 + get: function enabled() {
1.39519 + somewhatImplemented('NativeMenuItem.enabled');
1.39520 + return this._enabled;
1.39521 + },
1.39522 + set: function enabled(isSeparator) {
1.39523 + somewhatImplemented('NativeMenuItem.enabled');
1.39524 + this._enabled = isSeparator;
1.39525 + }
1.39526 + }
1.39527 + }
1.39528 + }
1.39529 + }
1.39530 + };
1.39531 + }.call(this);
1.39532 +var SceneDefinition = function () {
1.39533 + return {
1.39534 + __class__: 'flash.display.Scene',
1.39535 + initialize: function () {
1.39536 + this._startFrame = 1;
1.39537 + this._endFrame = 1;
1.39538 + },
1.39539 + __glue__: {
1.39540 + native: {
1.39541 + static: {},
1.39542 + instance: {}
1.39543 + },
1.39544 + script: {
1.39545 + static: {},
1.39546 + instance: {
1.39547 + name: {
1.39548 + get: function name() {
1.39549 + notImplemented('Scene.name');
1.39550 + return this._name;
1.39551 + }
1.39552 + },
1.39553 + labels: {
1.39554 + get: function labels() {
1.39555 + notImplemented('Scene.labels');
1.39556 + return this._labels;
1.39557 + }
1.39558 + },
1.39559 + numFrames: {
1.39560 + get: function numFrames() {
1.39561 + notImplemented('Scene.numFrames');
1.39562 + return this._numFrames;
1.39563 + }
1.39564 + }
1.39565 + }
1.39566 + }
1.39567 + }
1.39568 + };
1.39569 + }.call(this);
1.39570 +var ShaderDefinition = function () {
1.39571 + return {
1.39572 + __class__: 'flash.display.Shader',
1.39573 + initialize: function () {
1.39574 + this._data = null;
1.39575 + },
1.39576 + __glue__: {
1.39577 + native: {
1.39578 + static: {},
1.39579 + instance: {
1.39580 + data: {
1.39581 + get: function data() {
1.39582 + return this._data;
1.39583 + },
1.39584 + set: function data(p) {
1.39585 + this._data = p;
1.39586 + }
1.39587 + },
1.39588 + precisionHint: {
1.39589 + get: function precisionHint() {
1.39590 + return this._precisionHint;
1.39591 + },
1.39592 + set: function precisionHint(p) {
1.39593 + this._precisionHint = p;
1.39594 + }
1.39595 + }
1.39596 + }
1.39597 + },
1.39598 + script: {
1.39599 + instance: Glue.ALL
1.39600 + }
1.39601 + }
1.39602 + };
1.39603 + }.call(this);
1.39604 +var ShaderDataDefinition = function () {
1.39605 + return {
1.39606 + __class__: 'flash.display.ShaderData',
1.39607 + initialize: function () {
1.39608 + this._byteCode = null;
1.39609 + },
1.39610 + __glue__: {
1.39611 + native: {
1.39612 + static: {},
1.39613 + instance: {
1.39614 + _setByteCode: function _setByteCode(code) {
1.39615 + this._byteCode = code;
1.39616 + }
1.39617 + }
1.39618 + },
1.39619 + script: {
1.39620 + instance: Glue.ALL
1.39621 + }
1.39622 + }
1.39623 + };
1.39624 + }.call(this);
1.39625 +var ShapeDefinition = function () {
1.39626 + var def = {
1.39627 + __class__: 'flash.display.Shape',
1.39628 + initialize: function () {
1.39629 + var graphics = this._graphics = new flash.display.Graphics();
1.39630 + graphics._parent = this;
1.39631 + var s = this.symbol;
1.39632 + if (s && s.paths) {
1.39633 + graphics._paths = s.paths;
1.39634 + for (var i = 0; i < s.paths.length; i++) {
1.39635 + s.paths[i] = finishShapePath(s.paths[i], s.dictionaryResolved);
1.39636 + }
1.39637 + graphics.bbox = s.bbox;
1.39638 + graphics.strokeBbox = s.strokeBbox;
1.39639 + if (this._stage && this._stage._quality === 'low' && !graphics._bitmap)
1.39640 + graphics._cacheAsBitmap(this._bbox);
1.39641 + this.ratio = s.ratio || 0;
1.39642 + }
1.39643 + }
1.39644 + };
1.39645 + def.__glue__ = {
1.39646 + native: {
1.39647 + instance: {
1.39648 + graphics: {
1.39649 + get: function () {
1.39650 + return this._graphics;
1.39651 + }
1.39652 + }
1.39653 + }
1.39654 + }
1.39655 + };
1.39656 + return def;
1.39657 + }.call(this);
1.39658 +var SimpleButtonDefinition = function () {
1.39659 + var AVM1KeyCodeMap = [
1.39660 + 0,
1.39661 + 37,
1.39662 + 39,
1.39663 + 36,
1.39664 + 35,
1.39665 + 45,
1.39666 + 46,
1.39667 + 0,
1.39668 + 8,
1.39669 + 0,
1.39670 + 0,
1.39671 + 0,
1.39672 + 0,
1.39673 + 13,
1.39674 + 38,
1.39675 + 40,
1.39676 + 33,
1.39677 + 34,
1.39678 + 9,
1.39679 + 27
1.39680 + ];
1.39681 + var AVM1MouseTransitionEvents = [
1.39682 + 0,
1.39683 + 0,
1.39684 + 1,
1.39685 + 128,
1.39686 + 64,
1.39687 + 0,
1.39688 + 0,
1.39689 + 32,
1.39690 + 2,
1.39691 + 0,
1.39692 + 0,
1.39693 + 4,
1.39694 + 256,
1.39695 + 16,
1.39696 + 8,
1.39697 + 0
1.39698 + ];
1.39699 + return {
1.39700 + __class__: 'flash.display.SimpleButton',
1.39701 + initialize: function () {
1.39702 + this._useHandCursor = true;
1.39703 + this._enabled = true;
1.39704 + this._trackAsMenu = false;
1.39705 + this._upState = null;
1.39706 + this._overState = null;
1.39707 + this._downState = null;
1.39708 + this._hitTestState = null;
1.39709 + this._currentButtonState = 'up';
1.39710 + this._mouseChildren = false;
1.39711 + this._buttonMode = true;
1.39712 + this._prevAvm1StateCode = 0;
1.39713 + this._avm1StateCode = 0;
1.39714 + this._avm1MouseEvents = null;
1.39715 + this._isContainer = true;
1.39716 + var s = this.symbol;
1.39717 + if (s) {
1.39718 + var states = s.states;
1.39719 + if (states.down) {
1.39720 + this._downState = this._constructState(states.down, this);
1.39721 + }
1.39722 + if (states.hitTest) {
1.39723 + this._hitTestState = this._constructState(states.hitTest, this);
1.39724 + }
1.39725 + if (states.over) {
1.39726 + this._overState = this._constructState(states.over, this);
1.39727 + }
1.39728 + if (states.up) {
1.39729 + this._upState = this._constructState(states.up, this);
1.39730 + }
1.39731 + }
1.39732 + if (this._loader && !this._loader._isAvm2Enabled && s && s.buttonActions) {
1.39733 + this._addEventListener('addedToStage', function (e) {
1.39734 + this._initAvm1Events(s.buttonActions);
1.39735 + }.bind(this), false);
1.39736 + }
1.39737 + },
1.39738 + _constructState: function constructState(symbolInfo) {
1.39739 + var symbolClass = avm2.systemDomain.findClass(symbolInfo.className) ? avm2.systemDomain.getClass(symbolInfo.className) : avm2.applicationDomain.getClass(symbolInfo.className);
1.39740 + var instance = symbolClass.createAsSymbol(symbolInfo.props);
1.39741 + symbolClass.instanceConstructor.call(instance);
1.39742 + if (instance._children.length === 1) {
1.39743 + instance = instance._children[0];
1.39744 + instance._parent = null;
1.39745 + instance._index = -1;
1.39746 + }
1.39747 + return instance;
1.39748 + },
1.39749 + _updateButton: function updateButton() {
1.39750 + var state = null;
1.39751 + switch (this._currentButtonState) {
1.39752 + case 'up':
1.39753 + state = this._upState;
1.39754 + break;
1.39755 + case 'over':
1.39756 + state = this._overState;
1.39757 + break;
1.39758 + case 'down':
1.39759 + state = this._downState;
1.39760 + break;
1.39761 + }
1.39762 + if (!state) {
1.39763 + return;
1.39764 + }
1.39765 + var currentChild = this._children[0];
1.39766 + if (currentChild) {
1.39767 + if (currentChild === state) {
1.39768 + return;
1.39769 + }
1.39770 + if (this._stage) {
1.39771 + this._stage._removeFromStage(currentChild);
1.39772 + }
1.39773 + currentChild._invalidateTransform();
1.39774 + }
1.39775 + if (!state) {
1.39776 + this._children.shift();
1.39777 + return;
1.39778 + }
1.39779 + this._children[0] = state;
1.39780 + state._parent = this;
1.39781 + state._invalidateTransform();
1.39782 + if (this._stage) {
1.39783 + this._stage._addToStage(state);
1.39784 + }
1.39785 + },
1.39786 + _gotoButtonState: function gotoButtonState(buttonState) {
1.39787 + this._invalidateBounds();
1.39788 + this._currentButtonState = buttonState;
1.39789 + this._updateButton();
1.39790 + if (this._avm1MouseEvents) {
1.39791 + this._processAvm1MouseEvents(this._avm1MouseEvents);
1.39792 + }
1.39793 + },
1.39794 + _getRegion: function getRegion(targetCoordSpace) {
1.39795 + if (!this._hitTestState) {
1.39796 + return {
1.39797 + xMin: 0,
1.39798 + yMin: 0,
1.39799 + xMax: 0,
1.39800 + yMax: 0
1.39801 + };
1.39802 + }
1.39803 + var b = this._hitTestState.getBounds(null);
1.39804 + return this._getTransformedRect(b, targetCoordSpace);
1.39805 + },
1.39806 + _getAS2Object: function () {
1.39807 + if (!this.$as2Object) {
1.39808 + new avm1lib.AS2Button(this);
1.39809 + }
1.39810 + return this.$as2Object;
1.39811 + },
1.39812 + _initAvm1Events: function (buttonActions) {
1.39813 + var loader = this._loader;
1.39814 + var avm1Context = loader._avm1Context;
1.39815 + var keyEvents = null;
1.39816 + for (var i = 0; i < buttonActions.length; i++) {
1.39817 + var buttonAction = buttonActions[i];
1.39818 + var fn = function (actionBlock) {
1.39819 + return executeActions(actionBlock, avm1Context, this._getAS2Object());
1.39820 + }.bind(this.parent, buttonAction.actionsData);
1.39821 + var mouseEventFlags = buttonAction.mouseEventFlags;
1.39822 + if (mouseEventFlags) {
1.39823 + var mouseEvents = this._avm1MouseEvents || (this._avm1MouseEvents = []);
1.39824 + mouseEvents.push({
1.39825 + flags: mouseEventFlags,
1.39826 + listener: fn
1.39827 + });
1.39828 + }
1.39829 + var keyPress = buttonAction.keyPress;
1.39830 + if (keyPress) {
1.39831 + keyEvents = keyEvents || (keyEvents = []);
1.39832 + keyEvents.push({
1.39833 + keyCode: AVM1KeyCodeMap[keyPress] || 0,
1.39834 + charCode: keyPress,
1.39835 + listener: fn
1.39836 + });
1.39837 + }
1.39838 + }
1.39839 + if (keyEvents) {
1.39840 + var keyListener = function (e) {
1.39841 + for (var i = 0; i < keyEvents.length; i++) {
1.39842 + var keyEvent = keyEvents[i];
1.39843 + if (keyEvent.keyCode ? keyEvent.keyCode === e.keyCode : keyEvent.charCode === e.charCode) {
1.39844 + keyEvent.listener();
1.39845 + }
1.39846 + }
1.39847 + };
1.39848 + var KeyboardEventClass = flash.events.KeyboardEvent;
1.39849 + this.stage._addEventListener(KeyboardEventClass.class.KEY_DOWN, keyListener, false);
1.39850 + this._addEventListener('removedFromStage', function (stage) {
1.39851 + stage._removeEventListener(KeyboardEventClass.class.KEY_DOWN, keyListener, false);
1.39852 + }.bind(this, this.stage), false);
1.39853 + }
1.39854 + },
1.39855 + _processAvm1MouseEvents: function (mouseEvents) {
1.39856 + var prevAvm1StateCode = this._avm1StateCode;
1.39857 + var avm1StateCode = (this._currentButtonState === 'down' ? 1 : 0) | (this._currentButtonState !== 'up' ? 2 : 0);
1.39858 + if (prevAvm1StateCode !== avm1StateCode) {
1.39859 + this._prevAvm1StateCode = prevAvm1StateCode;
1.39860 + this._avm1StateCode = avm1StateCode;
1.39861 + var flag = AVM1MouseTransitionEvents[prevAvm1StateCode << 2 | avm1StateCode];
1.39862 + for (var i = 0; i < mouseEvents.length; i++) {
1.39863 + var mouseEvent = mouseEvents[i];
1.39864 + if ((mouseEvent.flags & flag) !== 0) {
1.39865 + mouseEvent.listener();
1.39866 + }
1.39867 + }
1.39868 + }
1.39869 + },
1.39870 + __glue__: {
1.39871 + native: {
1.39872 + instance: {
1.39873 + _updateButton: function _updateButton() {
1.39874 + this._updateButton();
1.39875 + },
1.39876 + useHandCursor: {
1.39877 + get: function useHandCursor() {
1.39878 + return this._useHandCursor;
1.39879 + },
1.39880 + set: function useHandCursor(value) {
1.39881 + this._useHandCursor = value;
1.39882 + }
1.39883 + },
1.39884 + enabled: {
1.39885 + get: function enabled() {
1.39886 + return this._enabled;
1.39887 + },
1.39888 + set: function enabled(value) {
1.39889 + this._enabled = value;
1.39890 + }
1.39891 + },
1.39892 + trackAsMenu: {
1.39893 + get: function trackAsMenu() {
1.39894 + notImplemented('SimpleButton.trackAsMenu');
1.39895 + return this._trackAsMenu;
1.39896 + },
1.39897 + set: function trackAsMenu(value) {
1.39898 + notImplemented('SimpleButton.trackAsMenu');
1.39899 + this._trackAsMenu = value;
1.39900 + }
1.39901 + },
1.39902 + upState: {
1.39903 + get: function upState() {
1.39904 + return this._upState;
1.39905 + },
1.39906 + set: function upState(value) {
1.39907 + this._upState = value;
1.39908 + this._updateButton();
1.39909 + }
1.39910 + },
1.39911 + overState: {
1.39912 + get: function overState() {
1.39913 + return this._overState;
1.39914 + },
1.39915 + set: function overState(value) {
1.39916 + this._overState = value;
1.39917 + this._updateButton();
1.39918 + }
1.39919 + },
1.39920 + downState: {
1.39921 + get: function downState() {
1.39922 + return this._downState;
1.39923 + },
1.39924 + set: function downState(value) {
1.39925 + this._downState = value;
1.39926 + this._updateButton();
1.39927 + }
1.39928 + },
1.39929 + hitTestState: {
1.39930 + get: function hitTestState() {
1.39931 + return this._hitTestState;
1.39932 + },
1.39933 + set: function hitTestState(value) {
1.39934 + if (value === this._hitTestState) {
1.39935 + return;
1.39936 + }
1.39937 + this._invalidate();
1.39938 + this._hitTestState = value;
1.39939 + }
1.39940 + },
1.39941 + soundTransform: {
1.39942 + get: function soundTransform() {
1.39943 + notImplemented('SimpleButton.soundTransform');
1.39944 + return this._soundTransform;
1.39945 + },
1.39946 + set: function soundTransform(value) {
1.39947 + notImplemented('SimpleButton.soundTransform');
1.39948 + this._soundTransform = value;
1.39949 + }
1.39950 + }
1.39951 + }
1.39952 + }
1.39953 + }
1.39954 + };
1.39955 + }.call(this);
1.39956 +var SpriteDefinition = function () {
1.39957 + var def = {
1.39958 + __class__: 'flash.display.Sprite',
1.39959 + initialize: function () {
1.39960 + this._buttonMode = false;
1.39961 + this._hitArea = null;
1.39962 + this._useHandCursor = true;
1.39963 + this._hitTarget = null;
1.39964 + this._currentDisplayList = null;
1.39965 + var s = this.symbol;
1.39966 + if (s) {
1.39967 + this._graphics = s.graphics || new flash.display.Graphics();
1.39968 + if (s.timeline) {
1.39969 + var displayList = s.timeline[0];
1.39970 + if (displayList) {
1.39971 + var depths = displayList.depths;
1.39972 + for (var i = 0; i < depths.length; i++) {
1.39973 + var cmd = displayList[depths[i]];
1.39974 + if (cmd) {
1.39975 + var displayListItem = this._addTimelineChild(cmd);
1.39976 + displayListItem.next = this._currentDisplayList;
1.39977 + this._currentDisplayList = displayListItem;
1.39978 + }
1.39979 + }
1.39980 + }
1.39981 + }
1.39982 + } else {
1.39983 + this._graphics = new flash.display.Graphics();
1.39984 + }
1.39985 + this._graphics._parent = this;
1.39986 + },
1.39987 + _addTimelineChild: function addTimelineChild(cmd, index) {
1.39988 + var symbolInfo = cmd.symbolInfo;
1.39989 + var props = Object.create(symbolInfo.props);
1.39990 + props.symbolId = cmd.symbolId;
1.39991 + props.depth = cmd.depth;
1.39992 + if (cmd.clip) {
1.39993 + props.clipDepth = cmd.clipDepth;
1.39994 + }
1.39995 + if (cmd.hasCxform) {
1.39996 + props.cxform = cmd.cxform;
1.39997 + }
1.39998 + if (cmd.hasMatrix) {
1.39999 + props.currentTransform = cmd.matrix;
1.40000 + }
1.40001 + if (cmd.hasName) {
1.40002 + props.name = cmd.name;
1.40003 + }
1.40004 + if (cmd.hasRatio) {
1.40005 + props.ratio = cmd.ratio / 65535;
1.40006 + }
1.40007 + if (cmd.blend) {
1.40008 + props.blendMode = cmd.blendMode;
1.40009 + }
1.40010 + var displayListItem = {
1.40011 + cmd: cmd,
1.40012 + depth: cmd.depth,
1.40013 + className: symbolInfo.className,
1.40014 + props: props,
1.40015 + events: cmd.events,
1.40016 + obj: null
1.40017 + };
1.40018 + if (index !== undefined) {
1.40019 + this._children.splice(index, 0, displayListItem);
1.40020 + } else {
1.40021 + this._children.push(displayListItem);
1.40022 + }
1.40023 + this._sparse = true;
1.40024 + return displayListItem;
1.40025 + },
1.40026 + _constructChildren: function () {
1.40027 + if (!this._sparse) {
1.40028 + return;
1.40029 + }
1.40030 + var loader = this._loader;
1.40031 + var children = this._children;
1.40032 + for (var i = 0; i < children.length; i++) {
1.40033 + var displayListItem = children[i];
1.40034 + Counter.count('constructChild');
1.40035 + if (flash.display.DisplayObject.class.isInstanceOf(displayListItem)) {
1.40036 + displayListItem._index = i;
1.40037 + } else {
1.40038 + var symbolClass = avm2.systemDomain.findClass(displayListItem.className) ? avm2.systemDomain.getClass(displayListItem.className) : avm2.applicationDomain.getClass(displayListItem.className);
1.40039 + var props = Object.create(displayListItem.props);
1.40040 + var name = props.name;
1.40041 + props.animated = true;
1.40042 + props.owned = true;
1.40043 + props.parent = this;
1.40044 + props.stage = this._stage;
1.40045 + if (this._level > -1) {
1.40046 + props.level = this._level + 1;
1.40047 + }
1.40048 + props.index = i;
1.40049 + var instance = symbolClass.createAsSymbol(props);
1.40050 + if (name) {
1.40051 + this[Multiname.getPublicQualifiedName(name)] = instance;
1.40052 + }
1.40053 + symbolClass.instanceConstructor.call(instance);
1.40054 + if (flash.display.BitmapData.class.isInstanceOf(instance)) {
1.40055 + var bitmapData = instance;
1.40056 + instance = flash.display.Bitmap.class.createAsSymbol(props);
1.40057 + flash.display.Bitmap.class.instanceConstructor.call(instance, bitmapData);
1.40058 + }
1.40059 + if (!loader._isAvm2Enabled) {
1.40060 + this._initAvm1Bindings(instance, name, displayListItem.events);
1.40061 + instance._dispatchEvent('init');
1.40062 + instance._dispatchEvent('construct');
1.40063 + instance._needLoadEvent = true;
1.40064 + } else {
1.40065 + instance._dispatchEvent('load');
1.40066 + }
1.40067 + instance._dispatchEvent('added', undefined, true);
1.40068 + if (this._stage) {
1.40069 + this._stage._addToStage(instance);
1.40070 + }
1.40071 + children[i] = instance;
1.40072 + displayListItem.obj = instance;
1.40073 + }
1.40074 + }
1.40075 + this._sparse = false;
1.40076 + },
1.40077 + _postConstructChildren: function () {
1.40078 + var loader = this._loader;
1.40079 + if (!loader || loader._isAvm2Enabled) {
1.40080 + return;
1.40081 + }
1.40082 + var children = this._children;
1.40083 + for (var i = 0; i < children.length; i++) {
1.40084 + var instance = children[i];
1.40085 + if (instance._needLoadEvent) {
1.40086 + instance._needLoadEvent = false;
1.40087 + instance._dispatchEvent('load');
1.40088 + }
1.40089 + }
1.40090 + },
1.40091 + _duplicate: function (name, depth, initObject) {
1.40092 + var loader = this._loader;
1.40093 + var parent = this._parent;
1.40094 + var children = parent._children;
1.40095 + var symbolClass = this.class;
1.40096 + var symbolInfo = this.symbol;
1.40097 + var props = Object.create(symbolInfo);
1.40098 + props.name = name;
1.40099 + props.parent = parent;
1.40100 + props.depth = depth;
1.40101 + var instance = symbolClass.createAsSymbol(props);
1.40102 + if (name && loader && !loader._isAvm2Enabled && !parent.asHasProperty(undefined, name, 0, false)) {
1.40103 + parent.asSetPublicProperty(name, instance);
1.40104 + }
1.40105 + symbolClass.instanceConstructor.call(instance);
1.40106 + instance._index = children.length;
1.40107 + children.push(instance);
1.40108 + if (!loader._isAvm2Enabled) {
1.40109 + parent._initAvm1Bindings(instance, name, symbolInfo && symbolInfo.events);
1.40110 + instance._dispatchEvent('init');
1.40111 + instance._dispatchEvent('construct');
1.40112 + }
1.40113 + instance._dispatchEvent('load');
1.40114 + instance._dispatchEvent('added');
1.40115 + if (this._stage) {
1.40116 + instance._invalidate();
1.40117 + }
1.40118 + return instance;
1.40119 + },
1.40120 + _insertChildAtDepth: function (child, depth) {
1.40121 + this.addChild(child);
1.40122 + var name = child._name;
1.40123 + var loader = this._loader;
1.40124 + if (name && loader && !loader._isAvm2Enabled && !this._getAS2Object().asHasProperty(undefined, name, 0, true)) {
1.40125 + this._getAS2Object().asSetPublicProperty(name, child._getAS2Object());
1.40126 + }
1.40127 + },
1.40128 + _initAvm1Bindings: function (instance, name, events) {
1.40129 + var loader = this._loader;
1.40130 + var avm1Context = loader._avm1Context;
1.40131 + var symbolProps = instance.symbol;
1.40132 + if (symbolProps && symbolProps.variableName) {
1.40133 + instance._getAS2Object().asSetPublicProperty('variable', symbolProps.variableName);
1.40134 + }
1.40135 + if (events) {
1.40136 + var eventsBound = [];
1.40137 + for (var i = 0; i < events.length; i++) {
1.40138 + var event = events[i];
1.40139 + if (event.eoe) {
1.40140 + break;
1.40141 + }
1.40142 + var fn = function (actionBlock) {
1.40143 + return executeActions(actionBlock, avm1Context, this._getAS2Object());
1.40144 + }.bind(instance, event.actionsData);
1.40145 + for (var eventName in event) {
1.40146 + if (eventName.indexOf('on') !== 0 || !event[eventName])
1.40147 + continue;
1.40148 + var avm2EventName = eventName[2].toLowerCase() + eventName.substring(3);
1.40149 + if (avm2EventName === 'enterFrame') {
1.40150 + avm2EventName = 'frameConstructed';
1.40151 + }
1.40152 + var avm2EventTarget = instance;
1.40153 + if (avm2EventName === 'mouseDown' || avm2EventName === 'mouseUp' || avm2EventName === 'mouseMove') {
1.40154 + avm2EventTarget = this._stage;
1.40155 + }
1.40156 + avm2EventTarget._addEventListener(avm2EventName, fn, false);
1.40157 + eventsBound.push({
1.40158 + name: avm2EventName,
1.40159 + fn: fn,
1.40160 + target: avm2EventTarget
1.40161 + });
1.40162 + }
1.40163 + }
1.40164 + if (eventsBound.length > 0) {
1.40165 + instance._addEventListener('removed', function (eventsBound) {
1.40166 + for (var i = 0; i < eventsBound.length; i++) {
1.40167 + eventsBound[i].target._removeEventListener(eventsBound[i].name, eventsBound[i].fn, false);
1.40168 + }
1.40169 + }.bind(instance, eventsBound), false);
1.40170 + }
1.40171 + }
1.40172 + if (name && this._getAS2Object && instance._getAS2Object) {
1.40173 + this._getAS2Object().asSetPublicProperty(name, instance._getAS2Object());
1.40174 + }
1.40175 + },
1.40176 + _gotoButtonState: function gotoButtonState(stateName) {
1.40177 + },
1.40178 + get buttonMode() {
1.40179 + return this._buttonMode;
1.40180 + },
1.40181 + set buttonMode(val) {
1.40182 + this._buttonMode = val;
1.40183 + },
1.40184 + get graphics() {
1.40185 + return this._graphics;
1.40186 + },
1.40187 + get hitArea() {
1.40188 + return this._hitArea;
1.40189 + },
1.40190 + set hitArea(val) {
1.40191 + if (this._hitArea === val) {
1.40192 + return;
1.40193 + }
1.40194 + if (val && val._hitTarget) {
1.40195 + val._hitTarget.hitArea = null;
1.40196 + }
1.40197 + this._hitArea = val;
1.40198 + if (val) {
1.40199 + val._hitTarget = this;
1.40200 + }
1.40201 + },
1.40202 + get soundTransform() {
1.40203 + notImplemented();
1.40204 + },
1.40205 + set soundTransform(val) {
1.40206 + notImplemented();
1.40207 + },
1.40208 + get useHandCursor() {
1.40209 + return this._useHandCursor;
1.40210 + },
1.40211 + set useHandCursor(val) {
1.40212 + this._useHandCursor = val;
1.40213 + if (this._stage) {
1.40214 + this._stage._mouseMoved = true;
1.40215 + }
1.40216 + },
1.40217 + startDrag: function (lockCenter, bounds) {
1.40218 + notImplemented();
1.40219 + },
1.40220 + startTouchDrag: function (touchPointID, lockCenter, bounds) {
1.40221 + notImplemented();
1.40222 + },
1.40223 + stopDrag: function () {
1.40224 + notImplemented();
1.40225 + },
1.40226 + stopTouchDrag: function (touchPointID) {
1.40227 + notImplemented();
1.40228 + }
1.40229 + };
1.40230 + var desc = Object.getOwnPropertyDescriptor;
1.40231 + def.__glue__ = {
1.40232 + native: {
1.40233 + instance: {
1.40234 + graphics: desc(def, 'graphics'),
1.40235 + buttonMode: desc(def, 'buttonMode'),
1.40236 + dropTarget: desc(def, 'dropTarget'),
1.40237 + startDrag: def.startDrag,
1.40238 + stopDrag: def.stopDrag,
1.40239 + startTouchDrag: def.startTouchDrag,
1.40240 + stopTouchDrag: def.stopTouchDrag,
1.40241 + constructChildren: def._constructChildren,
1.40242 + hitArea: desc(def, 'hitArea'),
1.40243 + useHandCursor: desc(def, 'useHandCursor'),
1.40244 + soundTransform: desc(def, 'soundTransform')
1.40245 + }
1.40246 + }
1.40247 + };
1.40248 + return def;
1.40249 + }.call(this);
1.40250 +var StageDefinition = function () {
1.40251 + return {
1.40252 + __class__: 'flash.display.Stage',
1.40253 + initialize: function () {
1.40254 + this._frameRate = 24;
1.40255 + this._scaleMode = 'showAll';
1.40256 + this._align = '';
1.40257 + this._stageWidth = 0;
1.40258 + this._stageHeight = 0;
1.40259 + this._quality = 'high';
1.40260 + this._color = 4294967295;
1.40261 + this._stage = this;
1.40262 + this._deferRenderEvent = false;
1.40263 + this._focus = null;
1.40264 + this._showDefaultContextMenu = true;
1.40265 + this._displayState = 'normal';
1.40266 + this._colorCorrection = 'default';
1.40267 + this._stageFocusRect = true;
1.40268 + this._fullScreenSourceRect = null;
1.40269 + this._wmodeGPU = false;
1.40270 + this._root = null;
1.40271 + this._qtree = null;
1.40272 + this._invalidRegions = new RegionCluster();
1.40273 + this._mouseMoved = false;
1.40274 + this._mouseTarget = this;
1.40275 + this._mouseEvents = [];
1.40276 + this._cursor = 'auto';
1.40277 + this._stageVideos = [];
1.40278 + this._concatenatedTransform.invalid = false;
1.40279 + },
1.40280 + _setup: function setup(ctx, options) {
1.40281 + this._qtree = new QuadTree(0, 0, this._stageWidth, this._stageHeight, null);
1.40282 + this._invalid = true;
1.40283 + },
1.40284 + _addToStage: function addToStage(displayObject) {
1.40285 + displayObject._stage = this;
1.40286 + var parent = displayObject._parent;
1.40287 + displayObject._level = parent._level + 1;
1.40288 + displayObject._invalid = true;
1.40289 + var children = displayObject._children;
1.40290 + for (var i = 0; i < children.length; i++) {
1.40291 + var child = children[i];
1.40292 + if (child._stage === null) {
1.40293 + this._addToStage(child);
1.40294 + }
1.40295 + }
1.40296 + displayObject._dispatchEvent('addedToStage');
1.40297 + },
1.40298 + _removeFromStage: function removeFromStage(displayObject) {
1.40299 + var children = displayObject._children;
1.40300 + for (var i = 0; i < children.length; i++) {
1.40301 + var child = children[i];
1.40302 + if (child._stage) {
1.40303 + this._removeFromStage(children[i]);
1.40304 + }
1.40305 + }
1.40306 + displayObject._dispatchEvent('removedFromStage');
1.40307 + displayObject._stage = null;
1.40308 + displayObject._level = -1;
1.40309 + if (displayObject._region) {
1.40310 + this._qtree.remove(displayObject._region);
1.40311 + this._invalidRegions.insert(displayObject._region);
1.40312 + displayObject._region = null;
1.40313 + }
1.40314 + },
1.40315 + _processInvalidations: function processInvalidations(refreshStage) {
1.40316 + var qtree = this._qtree;
1.40317 + var invalidRegions = this._invalidRegions;
1.40318 + var stack = [];
1.40319 + var zindex = 0;
1.40320 + var children = this._children;
1.40321 + var i = children.length;
1.40322 + while (i--) {
1.40323 + var child = children[i];
1.40324 + if (refreshStage) {
1.40325 + child._invalid = true;
1.40326 + }
1.40327 + child._invisible = !child._visible;
1.40328 + stack.push(child);
1.40329 + }
1.40330 + while (stack.length) {
1.40331 + var node = stack.pop();
1.40332 + var m = node._concatenatedTransform;
1.40333 + var children = node._children;
1.40334 + var i = children.length;
1.40335 + while (i--) {
1.40336 + var child = children[i];
1.40337 + if (!flash.display.DisplayObject.class.isInstanceOf(child)) {
1.40338 + continue;
1.40339 + }
1.40340 + if (node._invalid) {
1.40341 + child._invalid = true;
1.40342 + }
1.40343 + if (m.invalid) {
1.40344 + child._concatenatedTransform.invalid = true;
1.40345 + }
1.40346 + child._invisible = node._invisible || !child._visible;
1.40347 + stack.push(child);
1.40348 + }
1.40349 + if (node._level && m.invalid) {
1.40350 + var m2 = node._currentTransform;
1.40351 + var m3 = node._parent._concatenatedTransform;
1.40352 + m.a = m2.a * m3.a + m2.b * m3.c;
1.40353 + m.b = m2.a * m3.b + m2.b * m3.d;
1.40354 + m.c = m2.c * m3.a + m2.d * m3.c;
1.40355 + m.d = m2.d * m3.d + m2.c * m3.b;
1.40356 + m.tx = m2.tx * m3.a + m3.tx + m2.ty * m3.c;
1.40357 + m.ty = m2.ty * m3.d + m3.ty + m2.tx * m3.b;
1.40358 + m.invalid = false;
1.40359 + }
1.40360 + var invalidRegion = node._region;
1.40361 + var currentRegion = node._getRegion(m);
1.40362 + var hidden = node._invisible || !currentRegion || currentRegion.xMax - currentRegion.xMin === 0 || currentRegion.yMax - currentRegion.yMin === 0 || currentRegion.xMax <= 0 || currentRegion.xMin >= this._stageWidth || currentRegion.yMax <= 0 || currentRegion.yMin >= this._stageHeight;
1.40363 + if (node._invalid) {
1.40364 + if (invalidRegion) {
1.40365 + invalidRegions.insert(invalidRegion);
1.40366 + }
1.40367 + if (!hidden && (!invalidRegion || currentRegion.xMin !== invalidRegion.xMin || currentRegion.yMin !== invalidRegion.yMin || currentRegion.xMax !== invalidRegion.xMax || currentRegion.yMax !== invalidRegion.yMax)) {
1.40368 + invalidRegions.insert(currentRegion);
1.40369 + }
1.40370 + }
1.40371 + if (hidden) {
1.40372 + if (invalidRegion) {
1.40373 + qtree.remove(invalidRegion);
1.40374 + node._region = null;
1.40375 + }
1.40376 + } else if (invalidRegion) {
1.40377 + invalidRegion.xMin = currentRegion.xMin;
1.40378 + invalidRegion.xMax = currentRegion.xMax;
1.40379 + invalidRegion.yMin = currentRegion.yMin;
1.40380 + invalidRegion.yMax = currentRegion.yMax;
1.40381 + qtree.update(invalidRegion);
1.40382 + } else {
1.40383 + currentRegion.obj = node;
1.40384 + qtree.insert(currentRegion);
1.40385 + node._region = currentRegion;
1.40386 + }
1.40387 + node._zindex = zindex++;
1.40388 + }
1.40389 + var invalidPath = new ShapePath();
1.40390 + if (refreshStage) {
1.40391 + invalidPath.rect(0, 0, this._stageWidth, this._stageHeight);
1.40392 + invalidRegions.reset();
1.40393 + return invalidPath;
1.40394 + }
1.40395 + var redrawRegions = invalidRegions.retrieve();
1.40396 + for (var i = 0; i < redrawRegions.length; i++) {
1.40397 + var region = redrawRegions[i];
1.40398 + var xMin = region.xMin - region.xMin % 20 - 40;
1.40399 + var yMin = region.yMin - region.yMin % 20 - 40;
1.40400 + var xMax = region.xMax - region.xMax % 20 + 80;
1.40401 + var yMax = region.yMax - region.yMax % 20 + 80;
1.40402 + var intersectees = qtree.retrieve(xMin, xMax, yMin, yMax);
1.40403 + for (var j = 0; j < intersectees.length; j++) {
1.40404 + var item = intersectees[j];
1.40405 + item.obj._invalid = true;
1.40406 + }
1.40407 + invalidPath.rect(xMin, yMin, xMax - xMin, yMax - yMin);
1.40408 + }
1.40409 + invalidRegions.reset();
1.40410 + return invalidPath;
1.40411 + },
1.40412 + _handleMouseButtons: function () {
1.40413 + if (this._mouseEvents.length === 0) {
1.40414 + return;
1.40415 + }
1.40416 + var eventType = this._mouseEvents.shift();
1.40417 + switch (eventType) {
1.40418 + case 'mousedown':
1.40419 + if (this._mouseTarget._buttonMode) {
1.40420 + this._mouseTarget._gotoButtonState('down');
1.40421 + }
1.40422 + this._mouseTarget._dispatchEvent('mouseDown');
1.40423 + break;
1.40424 + case 'mouseup':
1.40425 + if (this._mouseTarget._buttonMode) {
1.40426 + this._mouseTarget._gotoButtonState('over');
1.40427 + }
1.40428 + this._mouseTarget._dispatchEvent('mouseUp');
1.40429 + break;
1.40430 + }
1.40431 + },
1.40432 + _handleMouse: function handleMouse() {
1.40433 + var mouseX = this._mouseX;
1.40434 + var mouseY = this._mouseY;
1.40435 + var candidates = this._qtree.retrieve(mouseX, mouseX, mouseY, mouseY);
1.40436 + var objectsUnderMouse = [];
1.40437 + for (var i = 0; i < candidates.length; i++) {
1.40438 + var item = candidates[i];
1.40439 + var displayObject = item.obj;
1.40440 + var isUnderMouse = false;
1.40441 + if (flash.display.SimpleButton.class.isInstanceOf(displayObject)) {
1.40442 + if (!displayObject._enabled) {
1.40443 + continue;
1.40444 + }
1.40445 + var hitArea = displayObject._hitTestState;
1.40446 + hitArea._parent = displayObject;
1.40447 + isUnderMouse = hitArea._hitTest(true, mouseX, mouseY, true);
1.40448 + hitArea._parent = null;
1.40449 + } else {
1.40450 + isUnderMouse = displayObject._hitTest(true, mouseX, mouseY, true);
1.40451 + }
1.40452 + if (isUnderMouse) {
1.40453 + var currentNode = displayObject;
1.40454 + var lastEnabled = null;
1.40455 + if (!flash.display.InteractiveObject.class.isInstanceOf(currentNode)) {
1.40456 + lastEnabled = currentNode;
1.40457 + currentNode = currentNode._parent;
1.40458 + }
1.40459 + do {
1.40460 + if (!currentNode._mouseEnabled) {
1.40461 + lastEnabled = null;
1.40462 + } else if (lastEnabled === null) {
1.40463 + lastEnabled = currentNode;
1.40464 + }
1.40465 + currentNode = currentNode._parent;
1.40466 + } while (currentNode);
1.40467 + objectsUnderMouse.push(lastEnabled);
1.40468 + }
1.40469 + }
1.40470 + var target;
1.40471 + if (objectsUnderMouse.length) {
1.40472 + objectsUnderMouse.sort(sortByZindex);
1.40473 + var i = objectsUnderMouse.length;
1.40474 + while (i--) {
1.40475 + target = null;
1.40476 + var currentNode = objectsUnderMouse[i];
1.40477 + if (!flash.display.InteractiveObject.class.isInstanceOf(currentNode)) {
1.40478 + var j = i;
1.40479 + while (j--) {
1.40480 + if (objectsUnderMouse[j]._parent === currentNode._parent && flash.display.InteractiveObject.class.isInstanceOf(objectsUnderMouse[j])) {
1.40481 + currentNode = objectsUnderMouse[j];
1.40482 + i = j;
1.40483 + }
1.40484 + }
1.40485 + }
1.40486 + do {
1.40487 + if (flash.display.InteractiveObject.class.isInstanceOf(currentNode)) {
1.40488 + if ((!target || !currentNode._mouseChildren) && !currentNode._hitArea) {
1.40489 + target = currentNode;
1.40490 + }
1.40491 + }
1.40492 + currentNode = currentNode._parent;
1.40493 + } while (currentNode);
1.40494 + if (target !== objectsUnderMouse[i] && flash.display.SimpleButton.class.isInstanceOf(target)) {
1.40495 + continue;
1.40496 + }
1.40497 + break;
1.40498 + }
1.40499 + }
1.40500 + if (!target) {
1.40501 + target = this;
1.40502 + } else if (target._hitTarget) {
1.40503 + target = target._hitTarget;
1.40504 + }
1.40505 + if (target === this._mouseTarget) {
1.40506 + target._dispatchEvent('mouseMove');
1.40507 + } else {
1.40508 + if (this._mouseTarget._buttonMode) {
1.40509 + this._mouseTarget._gotoButtonState('up');
1.40510 + }
1.40511 + this._mouseTarget._dispatchEvent('mouseOut');
1.40512 + var nodeLeft = this._mouseTarget;
1.40513 + var containerLeft = nodeLeft._parent;
1.40514 + var nodeEntered = target;
1.40515 + var containerEntered = nodeEntered._parent;
1.40516 + var cursor = 'auto';
1.40517 + while (nodeLeft._level >= 0 && nodeLeft !== containerEntered) {
1.40518 + if (nodeLeft._hasEventListener('rollOut')) {
1.40519 + nodeLeft._dispatchEvent('rollOut');
1.40520 + }
1.40521 + nodeLeft = nodeLeft._parent;
1.40522 + }
1.40523 + while (nodeEntered._level >= 0 && nodeEntered !== containerLeft) {
1.40524 + if (nodeEntered._hasEventListener('rollOver')) {
1.40525 + nodeEntered._dispatchEvent('rollOver');
1.40526 + }
1.40527 + if (nodeEntered._buttonMode && nodeEntered._useHandCursor) {
1.40528 + cursor = 'pointer';
1.40529 + }
1.40530 + nodeEntered = nodeEntered._parent;
1.40531 + }
1.40532 + if (target._buttonMode) {
1.40533 + target._gotoButtonState('over');
1.40534 + }
1.40535 + target._dispatchEvent('mouseOver');
1.40536 + this._mouseTarget = target;
1.40537 + this._cursor = cursor;
1.40538 + }
1.40539 + },
1.40540 + _as2SetLevel: function (level, loader) {
1.40541 + somewhatImplemented('Stage._as2SetLevel');
1.40542 + this.addChild(loader);
1.40543 + },
1.40544 + __glue__: {
1.40545 + native: {
1.40546 + instance: {
1.40547 + invalidate: function invalidate() {
1.40548 + this._invalid = true;
1.40549 + this._deferRenderEvent = true;
1.40550 + },
1.40551 + isFocusInaccessible: function isFocusInaccessible() {
1.40552 + notImplemented('Stage.isFocusInaccessible');
1.40553 + },
1.40554 + set_displayState: function set_displayState(value) {
1.40555 + somewhatImplemented('Stage.set_displayState');
1.40556 + this._displayState = value;
1.40557 + },
1.40558 + get_simulatedFullScreenWidth: function get_simulatedFullScreenWidth() {
1.40559 + notImplemented('Stage.get_simulatedFullScreenWidth');
1.40560 + },
1.40561 + get_simulatedFullScreenHeight: function get_simulatedFullScreenHeight() {
1.40562 + notImplemented('Stage.get_simulatedFullScreenHeight');
1.40563 + },
1.40564 + removeChildAt: function removeChildAt(index) {
1.40565 + notImplemented('Stage.removeChildAt');
1.40566 + },
1.40567 + swapChildrenAt: function swapChildrenAt(index1, index2) {
1.40568 + notImplemented('Stage.swapChildrenAt');
1.40569 + },
1.40570 + requireOwnerPermissions: function requireOwnerPermissions() {
1.40571 + somewhatImplemented('Stage.requireOwnerPermissions');
1.40572 + },
1.40573 + frameRate: {
1.40574 + get: function frameRate() {
1.40575 + return this._frameRate;
1.40576 + },
1.40577 + set: function frameRate(value) {
1.40578 + this._frameRate = value;
1.40579 + }
1.40580 + },
1.40581 + scaleMode: {
1.40582 + get: function scaleMode() {
1.40583 + return this._scaleMode;
1.40584 + },
1.40585 + set: function scaleMode(value) {
1.40586 + this._scaleMode = value;
1.40587 + this._invalid = true;
1.40588 + }
1.40589 + },
1.40590 + align: {
1.40591 + get: function align() {
1.40592 + return this._align;
1.40593 + },
1.40594 + set: function align(value) {
1.40595 + this._align = value;
1.40596 + this._invalid = true;
1.40597 + }
1.40598 + },
1.40599 + stageWidth: {
1.40600 + get: function stageWidth() {
1.40601 + return this._stageWidth / 20;
1.40602 + },
1.40603 + set: function stageWidth(value) {
1.40604 + notImplemented('Stage.stageWidth');
1.40605 + this._stageWidth = value * 20 | 0;
1.40606 + }
1.40607 + },
1.40608 + stageHeight: {
1.40609 + get: function stageHeight() {
1.40610 + return this._stageHeight / 20;
1.40611 + },
1.40612 + set: function stageHeight(value) {
1.40613 + notImplemented('Stage.stageHeight');
1.40614 + this._stageHeight = value * 20 | 0;
1.40615 + }
1.40616 + },
1.40617 + showDefaultContextMenu: {
1.40618 + get: function showDefaultContextMenu() {
1.40619 + return this._showDefaultContextMenu;
1.40620 + },
1.40621 + set: function showDefaultContextMenu(value) {
1.40622 + somewhatImplemented('Stage.showDefaultContextMenu');
1.40623 + this._showDefaultContextMenu = value;
1.40624 + }
1.40625 + },
1.40626 + focus: {
1.40627 + get: function focus() {
1.40628 + return this._focus;
1.40629 + },
1.40630 + set: function focus(newFocus) {
1.40631 + somewhatImplemented('Stage.focus');
1.40632 + this._focus = newFocus;
1.40633 + }
1.40634 + },
1.40635 + colorCorrection: {
1.40636 + get: function colorCorrection() {
1.40637 + return this._colorCorrection;
1.40638 + },
1.40639 + set: function colorCorrection(value) {
1.40640 + notImplemented('Stage.colorCorrection');
1.40641 + this._colorCorrection = value;
1.40642 + }
1.40643 + },
1.40644 + colorCorrectionSupport: {
1.40645 + get: function colorCorrectionSupport() {
1.40646 + return false;
1.40647 + }
1.40648 + },
1.40649 + stageFocusRect: {
1.40650 + get: function stageFocusRect() {
1.40651 + return this._stageFocusRect;
1.40652 + },
1.40653 + set: function stageFocusRect(on) {
1.40654 + somewhatImplemented('Stage.stageFocusRect');
1.40655 + this._stageFocusRect = on;
1.40656 + }
1.40657 + },
1.40658 + quality: {
1.40659 + get: function quality() {
1.40660 + return this._quality;
1.40661 + },
1.40662 + set: function quality(value) {
1.40663 + somewhatImplemented('Stage.stageFocusRect');
1.40664 + this._quality = value;
1.40665 + }
1.40666 + },
1.40667 + displayState: {
1.40668 + get: function displayState() {
1.40669 + return this._displayState;
1.40670 + },
1.40671 + set: function displayState(value) {
1.40672 + this._displayState = value;
1.40673 + }
1.40674 + },
1.40675 + simulatedDisplayState: {
1.40676 + get: function simulatedDisplayState() {
1.40677 + notImplemented('Stage.simulatedDisplayState');
1.40678 + return this._simulatedDisplayState;
1.40679 + },
1.40680 + set: function simulatedDisplayState(value) {
1.40681 + notImplemented('Stage.simulatedDisplayState');
1.40682 + this._simulatedDisplayState = value;
1.40683 + }
1.40684 + },
1.40685 + fullScreenSourceRect: {
1.40686 + get: function fullScreenSourceRect() {
1.40687 + return this._fullScreenSourceRect;
1.40688 + },
1.40689 + set: function fullScreenSourceRect(value) {
1.40690 + notImplemented('Stage.fullScreenSourceRect');
1.40691 + this._fullScreenSourceRect = value;
1.40692 + }
1.40693 + },
1.40694 + simulatedFullScreenSourceRect: {
1.40695 + get: function simulatedFullScreenSourceRect() {
1.40696 + notImplemented('Stage.simulatedFullScreenSourceRect');
1.40697 + return this._simulatedFullScreenSourceRect;
1.40698 + },
1.40699 + set: function simulatedFullScreenSourceRect(value) {
1.40700 + notImplemented('Stage.simulatedFullScreenSourceRect');
1.40701 + this._simulatedFullScreenSourceRect = value;
1.40702 + }
1.40703 + },
1.40704 + stageVideos: {
1.40705 + get: function stageVideos() {
1.40706 + somewhatImplemented('Stage.stageVideos');
1.40707 + return this._stageVideos;
1.40708 + }
1.40709 + },
1.40710 + stage3Ds: {
1.40711 + get: function stage3Ds() {
1.40712 + notImplemented('Stage.stage3Ds');
1.40713 + return this._stage3Ds;
1.40714 + }
1.40715 + },
1.40716 + color: {
1.40717 + get: function color() {
1.40718 + return this._color;
1.40719 + },
1.40720 + set: function color(color) {
1.40721 + this._color = color;
1.40722 + this._invalid = true;
1.40723 + }
1.40724 + },
1.40725 + fullScreenWidth: {
1.40726 + get: function fullScreenWidth() {
1.40727 + notImplemented('Stage.fullScreenWidth');
1.40728 + return this._fullScreenWidth;
1.40729 + }
1.40730 + },
1.40731 + fullScreenHeight: {
1.40732 + get: function fullScreenHeight() {
1.40733 + notImplemented('Stage.fullScreenHeight');
1.40734 + return this._fullScreenHeight;
1.40735 + }
1.40736 + },
1.40737 + wmodeGPU: {
1.40738 + get: function wmodeGPU() {
1.40739 + somewhatImplemented('Stage.wmodeGPU');
1.40740 + return this._wmodeGPU;
1.40741 + }
1.40742 + },
1.40743 + softKeyboardRect: {
1.40744 + get: function softKeyboardRect() {
1.40745 + notImplemented('Stage.softKeyboardRect');
1.40746 + return this._softKeyboardRect;
1.40747 + }
1.40748 + },
1.40749 + allowsFullScreen: {
1.40750 + get: function allowsFullScreen() {
1.40751 + return false;
1.40752 + }
1.40753 + },
1.40754 + displayContextInfo: {
1.40755 + get: function displayContextInfo() {
1.40756 + notImplemented('Stage.displayContextInfo');
1.40757 + return this._displayContextInfo;
1.40758 + }
1.40759 + }
1.40760 + }
1.40761 + }
1.40762 + }
1.40763 + };
1.40764 + }.call(this);
1.40765 +{
1.40766 + var EventDefinition = function () {
1.40767 + return {
1.40768 + __class__: 'flash.events.Event',
1.40769 + initialize: function () {
1.40770 + this._stopPropagation = false;
1.40771 + this._stopImmediatePropagation = false;
1.40772 + this._isDefaultPrevented = false;
1.40773 + this._target = null;
1.40774 + this._currentTarget = null;
1.40775 + this._eventPhase = 2;
1.40776 + },
1.40777 + __glue__: {
1.40778 + native: {
1.40779 + instance: {
1.40780 + ctor: function ctor(type, bubbles, cancelable) {
1.40781 + Counter.count('Event: ' + type);
1.40782 + this._type = type;
1.40783 + this._bubbles = bubbles;
1.40784 + this._cancelable = cancelable;
1.40785 + },
1.40786 + stopPropagation: function stopPropagation() {
1.40787 + this._stopPropagation = true;
1.40788 + },
1.40789 + stopImmediatePropagation: function stopImmediatePropagation() {
1.40790 + this._stopImmediatePropagation = this._stopPropagation = true;
1.40791 + },
1.40792 + preventDefault: function preventDefault() {
1.40793 + if (this._cancelable)
1.40794 + this._isDefaultPrevented = true;
1.40795 + },
1.40796 + isDefaultPrevented: function isDefaultPrevented() {
1.40797 + return this._isDefaultPrevented;
1.40798 + },
1.40799 + type: {
1.40800 + get: function type() {
1.40801 + return this._type;
1.40802 + }
1.40803 + },
1.40804 + bubbles: {
1.40805 + get: function bubbles() {
1.40806 + return this._bubbles;
1.40807 + }
1.40808 + },
1.40809 + cancelable: {
1.40810 + get: function cancelable() {
1.40811 + return this._cancelable;
1.40812 + }
1.40813 + },
1.40814 + target: {
1.40815 + get: function target() {
1.40816 + return this._target;
1.40817 + }
1.40818 + },
1.40819 + currentTarget: {
1.40820 + get: function currentTarget() {
1.40821 + return this._currentTarget;
1.40822 + }
1.40823 + },
1.40824 + eventPhase: {
1.40825 + get: function eventPhase() {
1.40826 + return this._eventPhase;
1.40827 + }
1.40828 + }
1.40829 + }
1.40830 + },
1.40831 + script: {
1.40832 + static: Glue.ALL,
1.40833 + instance: {
1.40834 + clone: 'open public clone'
1.40835 + }
1.40836 + }
1.40837 + }
1.40838 + };
1.40839 + }.call(this);
1.40840 +}
1.40841 +var EventDispatcherDefinition = function () {
1.40842 + var mouseEvents = {
1.40843 + click: true,
1.40844 + contextMenu: true,
1.40845 + doubleClick: true,
1.40846 + middleClick: true,
1.40847 + middleMouseDown: true,
1.40848 + middleMouseUp: true,
1.40849 + mouseDown: true,
1.40850 + mouseMove: true,
1.40851 + mouseOut: true,
1.40852 + mouseOver: true,
1.40853 + mouseUp: true,
1.40854 + mouseWheel: true,
1.40855 + releaseOutside: true,
1.40856 + rightClick: true,
1.40857 + rightMouseDown: true,
1.40858 + rightMouseUp: true,
1.40859 + rollOut: false,
1.40860 + rollOver: false
1.40861 + };
1.40862 + function doDispatchEvent(dispatcher, event, eventClass, bubbles) {
1.40863 + var target = dispatcher._target;
1.40864 + var type = event._type || event;
1.40865 + var listeners = dispatcher._listeners[type];
1.40866 + if (bubbles || typeof event === 'string' && mouseEvents[event] || event._bubbles) {
1.40867 + var ancestors = [];
1.40868 + var currentNode = target._parent;
1.40869 + while (currentNode) {
1.40870 + if (currentNode._hasEventListener(type)) {
1.40871 + ancestors.push(currentNode);
1.40872 + }
1.40873 + currentNode = currentNode._parent;
1.40874 + }
1.40875 + if (!listeners && !ancestors.length) {
1.40876 + return true;
1.40877 + }
1.40878 + var keepPropagating = true;
1.40879 + var i = ancestors.length;
1.40880 + while (i-- && keepPropagating) {
1.40881 + var currentTarget = ancestors[i];
1.40882 + var queue = currentTarget._captureListeners[type];
1.40883 + keepPropagating = processListeners(queue, event, eventClass, bubbles, target, currentTarget, 1);
1.40884 + }
1.40885 + if (listeners && keepPropagating) {
1.40886 + keepPropagating = processListeners(listeners, event, eventClass, bubbles, target);
1.40887 + }
1.40888 + for (var i = 0; i < ancestors.length && keepPropagating; i++) {
1.40889 + var currentTarget = ancestors[i];
1.40890 + var queue = currentTarget._listeners[type];
1.40891 + keepPropagating = processListeners(queue, event, eventClass, bubbles, target, currentTarget, 3);
1.40892 + }
1.40893 + } else if (listeners) {
1.40894 + processListeners(listeners, event, eventClass, bubbles, target);
1.40895 + }
1.40896 + return !event._isDefaultPrevented;
1.40897 + }
1.40898 + function processListeners(queue, event, eventClass, bubbles, target, currentTarget, eventPhase) {
1.40899 + if (queue) {
1.40900 + queue = queue.slice();
1.40901 + var needsInit = true;
1.40902 + try {
1.40903 + for (var i = 0; i < queue.length; i++) {
1.40904 + var item = queue[i];
1.40905 + var methodInfo = item.handleEvent.methodInfo;
1.40906 + if (methodInfo) {
1.40907 + if (methodInfo.parameters.length) {
1.40908 + if (!methodInfo.parameters[0].isUsed) {
1.40909 + item.handleEvent();
1.40910 + continue;
1.40911 + }
1.40912 + }
1.40913 + }
1.40914 + if (needsInit) {
1.40915 + if (typeof event === 'string') {
1.40916 + if (eventClass) {
1.40917 + event = new eventClass(event);
1.40918 + } else {
1.40919 + if (mouseEvents[event]) {
1.40920 + event = new flash.events.MouseEvent(event, mouseEvents[event]);
1.40921 + if (target._stage) {
1.40922 + event._localX = target.mouseX;
1.40923 + event._localY = target.mouseY;
1.40924 + }
1.40925 + } else {
1.40926 + event = new flash.events.Event(event);
1.40927 + }
1.40928 + }
1.40929 + } else if (event._target) {
1.40930 + event = event.clone();
1.40931 + }
1.40932 + event._target = target;
1.40933 + event._currentTarget = currentTarget || target;
1.40934 + event._eventPhase = eventPhase || 2;
1.40935 + needsInit = false;
1.40936 + }
1.40937 + item.handleEvent(event);
1.40938 + if (event._stopImmediatePropagation) {
1.40939 + break;
1.40940 + }
1.40941 + }
1.40942 + } catch (e) {
1.40943 + avm2.exceptions.push({
1.40944 + source: 'avm2',
1.40945 + message: e.message,
1.40946 + stack: e.stack
1.40947 + });
1.40948 + throw e;
1.40949 + }
1.40950 + }
1.40951 + return !event._stopPropagation;
1.40952 + }
1.40953 + return {
1.40954 + __class__: 'flash.events.EventDispatcher',
1.40955 + initialize: function () {
1.40956 + this._target = this;
1.40957 + this._listeners = {};
1.40958 + this._captureListeners = {};
1.40959 + },
1.40960 + _addEventListenerImpl: function addEventListenerImpl(type, listener, useCapture, priority) {
1.40961 + if (typeof listener !== 'function') {
1.40962 + throwError('TypeError', Errors.CheckTypeFailedError, listener, 'Function');
1.40963 + }
1.40964 + var listeners = useCapture ? this._captureListeners : this._listeners;
1.40965 + var queue = listeners[type];
1.40966 + var listenerObj = {
1.40967 + handleEvent: listener,
1.40968 + priority: priority || 0
1.40969 + };
1.40970 + if (queue) {
1.40971 + var level = queue.length;
1.40972 + var i = level;
1.40973 + while (i--) {
1.40974 + var item = queue[i];
1.40975 + if (item.handleEvent === listener) {
1.40976 + return;
1.40977 + }
1.40978 + if (priority > item.priority) {
1.40979 + level = i;
1.40980 + }
1.40981 + }
1.40982 + queue.splice(level, 0, listenerObj);
1.40983 + } else {
1.40984 + listeners[type] = [
1.40985 + listenerObj
1.40986 + ];
1.40987 + }
1.40988 + },
1.40989 + _addEventListener: function addEventListener(type, listener, useCapture, priority) {
1.40990 + this._addEventListenerImpl(type, listener, useCapture, priority);
1.40991 + },
1.40992 + _removeEventListenerImpl: function removeEventListenerImpl(type, listener, useCapture) {
1.40993 + if (typeof listener !== 'function') {
1.40994 + throwError('TypeError', Errors.CheckTypeFailedError, listener, 'Function');
1.40995 + }
1.40996 + var listeners = useCapture ? this._captureListeners : this._listeners;
1.40997 + var queue = listeners[type];
1.40998 + if (queue) {
1.40999 + for (var i = 0; i < queue.length; i++) {
1.41000 + var item = queue[i];
1.41001 + if (item.handleEvent === listener) {
1.41002 + queue.splice(i, 1);
1.41003 + if (!queue.length) {
1.41004 + listeners[type] = null;
1.41005 + }
1.41006 + return;
1.41007 + }
1.41008 + }
1.41009 + }
1.41010 + },
1.41011 + _removeEventListener: function removeEventListener(type, listener, useCapture) {
1.41012 + this._removeEventListenerImpl(type, listener, useCapture);
1.41013 + },
1.41014 + _hasEventListener: function hasEventListener(type) {
1.41015 + return this._listeners[type] || this._captureListeners[type];
1.41016 + },
1.41017 + _dispatchEvent: function dispatchEvent(event, eventClass, bubbles) {
1.41018 + doDispatchEvent(this, event, eventClass, bubbles);
1.41019 + },
1.41020 + __glue__: {
1.41021 + native: {
1.41022 + instance: {
1.41023 + ctor: function ctor(target) {
1.41024 + this._target = target || this;
1.41025 + },
1.41026 + addEventListener: function addEventListener(type, listener, useCapture, priority, useWeakReference) {
1.41027 + this._addEventListener(type, listener, useCapture, priority);
1.41028 + },
1.41029 + removeEventListener: function removeEventListener(type, listener, useCapture) {
1.41030 + this._removeEventListener(type, listener, useCapture);
1.41031 + },
1.41032 + hasEventListener: function hasEventListener(type) {
1.41033 + return this._hasEventListener(type);
1.41034 + },
1.41035 + willTrigger: function willTrigger(type) {
1.41036 + var currentNode = this._target;
1.41037 + do {
1.41038 + if (currentNode._hasEventListener(type)) {
1.41039 + return true;
1.41040 + }
1.41041 + } while (currentNode = currentNode._parent);
1.41042 + return false;
1.41043 + },
1.41044 + dispatchEventFunction: function dispatchEventFunction(event) {
1.41045 + return doDispatchEvent(this, event);
1.41046 + }
1.41047 + }
1.41048 + }
1.41049 + }
1.41050 + };
1.41051 + }.call(this);
1.41052 +var KeyboardEventDefinition = function () {
1.41053 + return {
1.41054 + __class__: 'flash.events.KeyboardEvent',
1.41055 + __glue__: {
1.41056 + native: {
1.41057 + instance: {
1.41058 + updateAfterEvent: function updateAfterEvent() {
1.41059 + notImplemented('KeyboardEvent.updateAfterEvent');
1.41060 + },
1.41061 + charCode: {
1.41062 + get: function charCode() {
1.41063 + return this._charCode;
1.41064 + },
1.41065 + set: function charCode(value) {
1.41066 + this._charCode = value;
1.41067 + }
1.41068 + },
1.41069 + ctrlKey: {
1.41070 + get: function ctrlKey() {
1.41071 + return this._ctrlKey;
1.41072 + },
1.41073 + set: function ctrlKey(value) {
1.41074 + this._ctrlKey = value;
1.41075 + }
1.41076 + },
1.41077 + altKey: {
1.41078 + get: function altKey() {
1.41079 + return this._altKey;
1.41080 + },
1.41081 + set: function altKey(value) {
1.41082 + this._altKey = value;
1.41083 + }
1.41084 + },
1.41085 + shiftKey: {
1.41086 + get: function shiftKey() {
1.41087 + return this._shiftKey;
1.41088 + },
1.41089 + set: function shiftKey(value) {
1.41090 + this._shiftKey = value;
1.41091 + }
1.41092 + }
1.41093 + }
1.41094 + },
1.41095 + script: {
1.41096 + static: Glue.ALL,
1.41097 + instance: {
1.41098 + keyCode: 'public keyCode'
1.41099 + }
1.41100 + }
1.41101 + }
1.41102 + };
1.41103 + }.call(this);
1.41104 +var MouseEventDefinition = function () {
1.41105 + return {
1.41106 + __class__: 'flash.events.MouseEvent',
1.41107 + initialize: function () {
1.41108 + this._localX = NaN;
1.41109 + this._localY = NaN;
1.41110 + },
1.41111 + __glue__: {
1.41112 + native: {
1.41113 + instance: {
1.41114 + updateAfterEvent: function updateAfterEvent() {
1.41115 + },
1.41116 + getStageX: function getStageX() {
1.41117 + if (this._target) {
1.41118 + var m = this._target._getConcatenatedTransform(null, false);
1.41119 + var x = m.a * this._localX + m.c * this._localY + m.tx;
1.41120 + return x / 20;
1.41121 + }
1.41122 + return this._localX / 20;
1.41123 + },
1.41124 + getStageY: function getStageY() {
1.41125 + if (this._target) {
1.41126 + var m = this._target._getConcatenatedTransform(null, false);
1.41127 + var y = m.d * this._localY + m.b * this._localX + m.ty;
1.41128 + return y / 20;
1.41129 + }
1.41130 + return this._localY / 20;
1.41131 + },
1.41132 + localX: {
1.41133 + get: function localX() {
1.41134 + return this._localX / 20;
1.41135 + },
1.41136 + set: function localX(value) {
1.41137 + this._localX = value * 20 | 0;
1.41138 + }
1.41139 + },
1.41140 + localY: {
1.41141 + get: function localY() {
1.41142 + return this._localY / 20;
1.41143 + },
1.41144 + set: function localY(value) {
1.41145 + this._localY = value * 20 | 0;
1.41146 + }
1.41147 + }
1.41148 + }
1.41149 + },
1.41150 + script: {
1.41151 + static: Glue.ALL
1.41152 + }
1.41153 + }
1.41154 + };
1.41155 + }.call(this);
1.41156 +var TextEventDefinition = function () {
1.41157 + return {
1.41158 + __class__: 'flash.events.TextEvent',
1.41159 + __glue__: {
1.41160 + native: {
1.41161 + instance: {
1.41162 + copyNativeData: function copyNativeData(other) {
1.41163 + notImplemented('TextEvent.copyNativeData');
1.41164 + }
1.41165 + }
1.41166 + }
1.41167 + }
1.41168 + };
1.41169 + }.call(this);
1.41170 +var TimerEventDefinition = function () {
1.41171 + return {
1.41172 + __class__: 'flash.events.TimerEvent',
1.41173 + __glue__: {
1.41174 + native: {
1.41175 + instance: {
1.41176 + updateAfterEvent: function updateAfterEvent() {
1.41177 + notImplemented('TimerEvent.updateAfterEvent');
1.41178 + }
1.41179 + }
1.41180 + }
1.41181 + }
1.41182 + };
1.41183 + }.call(this);
1.41184 +{
1.41185 + var ExternalInterfaceDefinition = function () {
1.41186 + function getAvailable() {
1.41187 + return true;
1.41188 + }
1.41189 + var initialized = false;
1.41190 + var registeredCallbacks = {};
1.41191 + function callIn(functionName, args) {
1.41192 + if (!registeredCallbacks.hasOwnProperty(functionName))
1.41193 + return;
1.41194 + return registeredCallbacks[functionName](functionName, args);
1.41195 + }
1.41196 + return {
1.41197 + __class__: 'flash.external.ExternalInterface',
1.41198 + initialize: function () {
1.41199 + },
1.41200 + __glue__: {
1.41201 + native: {
1.41202 + static: {
1.41203 + _initJS: function _initJS() {
1.41204 + if (initialized)
1.41205 + return;
1.41206 + TelemetryService.reportTelemetry({
1.41207 + topic: 'feature',
1.41208 + feature: EXTERNAL_INTERFACE_FEATURE
1.41209 + });
1.41210 + initialized = true;
1.41211 + FirefoxCom.initJS(callIn);
1.41212 + },
1.41213 + _getPropNames: function _getPropNames(obj) {
1.41214 + var keys = [];
1.41215 + forEachPublicProperty(obj, function (key) {
1.41216 + keys.push(key);
1.41217 + });
1.41218 + return keys;
1.41219 + },
1.41220 + _addCallback: function _addCallback(functionName, closure, hasNullCallback) {
1.41221 + FirefoxCom.request('externalCom', {
1.41222 + action: 'register',
1.41223 + functionName: functionName,
1.41224 + remove: hasNullCallback
1.41225 + });
1.41226 + if (hasNullCallback) {
1.41227 + delete registeredCallbacks[functionName];
1.41228 + } else {
1.41229 + registeredCallbacks[functionName] = closure;
1.41230 + }
1.41231 + },
1.41232 + _evalJS: function _evalJS(expression) {
1.41233 + return FirefoxCom.requestSync('externalCom', {
1.41234 + action: 'eval',
1.41235 + expression: expression
1.41236 + });
1.41237 + },
1.41238 + _callOut: function _callOut(request) {
1.41239 + return FirefoxCom.requestSync('externalCom', {
1.41240 + action: 'call',
1.41241 + request: request
1.41242 + });
1.41243 + },
1.41244 + available: {
1.41245 + get: getAvailable
1.41246 + },
1.41247 + objectID: {
1.41248 + get: function objectID() {
1.41249 + return FirefoxCom.requestSync('externalCom', {
1.41250 + action: 'getId'
1.41251 + });
1.41252 + }
1.41253 + },
1.41254 + activeX: {
1.41255 + get: function activeX() {
1.41256 + return false;
1.41257 + }
1.41258 + }
1.41259 + },
1.41260 + instance: {}
1.41261 + }
1.41262 + }
1.41263 + };
1.41264 + }.call(this);
1.41265 +}
1.41266 +{
1.41267 + var BevelFilterDefinition = function () {
1.41268 + var def = {
1.41269 + __class__: 'flash.filters.BevelFilter',
1.41270 + initialize: function () {
1.41271 + },
1.41272 + _updateFilterBounds: function (bounds) {
1.41273 + }
1.41274 + };
1.41275 + def.__glue__ = {};
1.41276 + return def;
1.41277 + }.call(this);
1.41278 +}
1.41279 +var BitmapFilterDefinition = function () {
1.41280 + var def = {
1.41281 + __class__: 'flash.filters.BitmapFilter',
1.41282 + initialize: function () {
1.41283 + },
1.41284 + _updateFilterBounds: function (bounds) {
1.41285 + }
1.41286 + };
1.41287 + def.__glue__ = {};
1.41288 + return def;
1.41289 + }.call(this);
1.41290 +var BlurFilterDefinition = function () {
1.41291 + return {
1.41292 + __class__: 'flash.filters.BlurFilter',
1.41293 + initialize: function () {
1.41294 + },
1.41295 + _updateFilterBounds: function (bounds) {
1.41296 + var bx = this._blurX * this._quality * 20;
1.41297 + var by = this._blurY * this._quality * 20;
1.41298 + bounds.xMin -= bx;
1.41299 + bounds.xMax += bx;
1.41300 + bounds.yMin -= by;
1.41301 + bounds.yMax += by;
1.41302 + },
1.41303 + __glue__: {
1.41304 + native: {
1.41305 + static: {},
1.41306 + instance: {
1.41307 + blurX: {
1.41308 + get: function blurX() {
1.41309 + return this._blurX;
1.41310 + },
1.41311 + set: function blurX(value) {
1.41312 + this._blurX = value;
1.41313 + }
1.41314 + },
1.41315 + blurY: {
1.41316 + get: function blurY() {
1.41317 + return this._blurY;
1.41318 + },
1.41319 + set: function blurY(value) {
1.41320 + this._blurY = value;
1.41321 + }
1.41322 + },
1.41323 + quality: {
1.41324 + get: function quality() {
1.41325 + return this._quality;
1.41326 + },
1.41327 + set: function quality(value) {
1.41328 + this._quality = value;
1.41329 + }
1.41330 + }
1.41331 + }
1.41332 + }
1.41333 + }
1.41334 + };
1.41335 + }.call(this);
1.41336 +var ColorMatrixFilterDefinition = function () {
1.41337 + return {
1.41338 + __class__: 'flash.filters.ColorMatrixFilter',
1.41339 + initialize: function () {
1.41340 + },
1.41341 + _updateFilterBounds: function (bounds) {
1.41342 + },
1.41343 + __glue__: {
1.41344 + native: {
1.41345 + instance: {
1.41346 + matrix: {
1.41347 + get: function matrix() {
1.41348 + return this._matrix;
1.41349 + },
1.41350 + set: function matrix(value) {
1.41351 + this._matrix = value;
1.41352 + }
1.41353 + }
1.41354 + }
1.41355 + }
1.41356 + }
1.41357 + };
1.41358 + }.call(this);
1.41359 +var ConvolutionFilterDefinition = function () {
1.41360 + var def = {
1.41361 + __class__: 'flash.filters.ConvolutionFilter',
1.41362 + initialize: function () {
1.41363 + },
1.41364 + _updateFilterBounds: function (bounds) {
1.41365 + }
1.41366 + };
1.41367 + def.__glue__ = {};
1.41368 + return def;
1.41369 + }.call(this);
1.41370 +var DisplacementMapFilterDefinition = function () {
1.41371 + var def = {
1.41372 + __class__: 'flash.filters.DisplacementMapFilter',
1.41373 + initialize: function () {
1.41374 + },
1.41375 + _updateFilterBounds: function (bounds) {
1.41376 + }
1.41377 + };
1.41378 + def.__glue__ = {};
1.41379 + return def;
1.41380 + }.call(this);
1.41381 +var DropShadowFilterDefinition = function () {
1.41382 + return {
1.41383 + __class__: 'flash.filters.DropShadowFilter',
1.41384 + initialize: function () {
1.41385 + },
1.41386 + _updateFilterBounds: function (bounds) {
1.41387 + var a = this._angle * Math.PI / 180;
1.41388 + var dy = Math.sin(a) * this._distance;
1.41389 + var dx = Math.cos(a) * this._distance;
1.41390 + var bx = this._blurX * this._quality * 20;
1.41391 + var by = this._blurY * this._quality * 20;
1.41392 + bounds.xMin -= bx - (dx > 0 ? 0 : dx);
1.41393 + bounds.xMax += bx + Math.abs(dx);
1.41394 + bounds.yMin -= by - (dy > 0 ? 0 : dy);
1.41395 + bounds.yMax += by + Math.abs(dy);
1.41396 + },
1.41397 + __glue__: {
1.41398 + native: {
1.41399 + instance: {
1.41400 + distance: {
1.41401 + get: function distance() {
1.41402 + return this._distance;
1.41403 + },
1.41404 + set: function distance(value) {
1.41405 + this._distance = value;
1.41406 + }
1.41407 + },
1.41408 + angle: {
1.41409 + get: function angle() {
1.41410 + return this._angle;
1.41411 + },
1.41412 + set: function angle(value) {
1.41413 + this._angle = value;
1.41414 + }
1.41415 + },
1.41416 + color: {
1.41417 + get: function color() {
1.41418 + return this._color;
1.41419 + },
1.41420 + set: function color(value) {
1.41421 + this._color = value;
1.41422 + }
1.41423 + },
1.41424 + alpha: {
1.41425 + get: function alpha() {
1.41426 + return this._alpha;
1.41427 + },
1.41428 + set: function alpha(value) {
1.41429 + this._alpha = value;
1.41430 + }
1.41431 + },
1.41432 + blurX: {
1.41433 + get: function blurX() {
1.41434 + return this._blurX;
1.41435 + },
1.41436 + set: function blurX(value) {
1.41437 + this._blurX = value;
1.41438 + }
1.41439 + },
1.41440 + blurY: {
1.41441 + get: function blurY() {
1.41442 + return this._blurY;
1.41443 + },
1.41444 + set: function blurY(value) {
1.41445 + this._blurY = value;
1.41446 + }
1.41447 + },
1.41448 + hideObject: {
1.41449 + get: function hideObject() {
1.41450 + return this._hideObject;
1.41451 + },
1.41452 + set: function hideObject(value) {
1.41453 + this._hideObject = value;
1.41454 + }
1.41455 + },
1.41456 + inner: {
1.41457 + get: function inner() {
1.41458 + return this._inner;
1.41459 + },
1.41460 + set: function inner(value) {
1.41461 + this._inner = value;
1.41462 + }
1.41463 + },
1.41464 + knockout: {
1.41465 + get: function knockout() {
1.41466 + return this._knockout;
1.41467 + },
1.41468 + set: function knockout(value) {
1.41469 + this._knockout = value;
1.41470 + }
1.41471 + },
1.41472 + quality: {
1.41473 + get: function quality() {
1.41474 + return this._quality;
1.41475 + },
1.41476 + set: function quality(value) {
1.41477 + this._quality = value;
1.41478 + }
1.41479 + },
1.41480 + strength: {
1.41481 + get: function strength() {
1.41482 + return this._strength;
1.41483 + },
1.41484 + set: function strength(value) {
1.41485 + this._strength = value;
1.41486 + }
1.41487 + }
1.41488 + }
1.41489 + }
1.41490 + }
1.41491 + };
1.41492 + }.call(this);
1.41493 +var GlowFilterDefinition = function () {
1.41494 + return {
1.41495 + __class__: 'flash.filters.GlowFilter',
1.41496 + initialize: function () {
1.41497 + },
1.41498 + _updateFilterBounds: function (bounds) {
1.41499 + var bx = this._blurX * this._quality * 20;
1.41500 + var by = this._blurY * this._quality * 20;
1.41501 + bounds.xMin -= bx;
1.41502 + bounds.xMax += bx;
1.41503 + bounds.yMin -= by;
1.41504 + bounds.yMax += by;
1.41505 + },
1.41506 + __glue__: {
1.41507 + native: {
1.41508 + static: {},
1.41509 + instance: {
1.41510 + color: {
1.41511 + get: function color() {
1.41512 + return this._color;
1.41513 + },
1.41514 + set: function color(value) {
1.41515 + this._color = value;
1.41516 + }
1.41517 + },
1.41518 + alpha: {
1.41519 + get: function alpha() {
1.41520 + return this._alpha;
1.41521 + },
1.41522 + set: function alpha(value) {
1.41523 + this._alpha = value;
1.41524 + }
1.41525 + },
1.41526 + blurX: {
1.41527 + get: function blurX() {
1.41528 + return this._blurX;
1.41529 + },
1.41530 + set: function blurX(value) {
1.41531 + this._blurX = value;
1.41532 + }
1.41533 + },
1.41534 + blurY: {
1.41535 + get: function blurY() {
1.41536 + return this._blurY;
1.41537 + },
1.41538 + set: function blurY(value) {
1.41539 + this._blurY = value;
1.41540 + }
1.41541 + },
1.41542 + inner: {
1.41543 + get: function inner() {
1.41544 + return this._inner;
1.41545 + },
1.41546 + set: function inner(value) {
1.41547 + this._inner = value;
1.41548 + }
1.41549 + },
1.41550 + knockout: {
1.41551 + get: function knockout() {
1.41552 + return this._knockout;
1.41553 + },
1.41554 + set: function knockout(value) {
1.41555 + this._knockout = value;
1.41556 + }
1.41557 + },
1.41558 + quality: {
1.41559 + get: function quality() {
1.41560 + return this._quality;
1.41561 + },
1.41562 + set: function quality(value) {
1.41563 + this._quality = value;
1.41564 + }
1.41565 + },
1.41566 + strength: {
1.41567 + get: function strength() {
1.41568 + return this._strength;
1.41569 + },
1.41570 + set: function strength(value) {
1.41571 + this._strength = value;
1.41572 + }
1.41573 + }
1.41574 + }
1.41575 + }
1.41576 + }
1.41577 + };
1.41578 + }.call(this);
1.41579 +var GradientBevelFilterDefinition = function () {
1.41580 + var def = {
1.41581 + __class__: 'flash.filters.GradientBevelFilter',
1.41582 + initialize: function () {
1.41583 + },
1.41584 + _updateFilterBounds: function (bounds) {
1.41585 + }
1.41586 + };
1.41587 + def.__glue__ = {};
1.41588 + return def;
1.41589 + }.call(this);
1.41590 +var GradientGlowFilterDefinition = function () {
1.41591 + var def = {
1.41592 + __class__: 'flash.filters.GradientGlowFilter',
1.41593 + initialize: function () {
1.41594 + },
1.41595 + _updateFilterBounds: function (bounds) {
1.41596 + }
1.41597 + };
1.41598 + def.__glue__ = {};
1.41599 + return def;
1.41600 + }.call(this);
1.41601 +var ShaderFilterDefinition = function () {
1.41602 + var def = {
1.41603 + __class__: 'flash.filters.ShaderFilter',
1.41604 + initialize: function () {
1.41605 + },
1.41606 + _updateFilterBounds: function (bounds) {
1.41607 + }
1.41608 + };
1.41609 + def.__glue__ = {};
1.41610 + return def;
1.41611 + }.call(this);
1.41612 +{
1.41613 + var ColorTransformDefinition = function () {
1.41614 + return {
1.41615 + __class__: 'flash.geom.ColorTransform',
1.41616 + __glue__: {
1.41617 + script: {
1.41618 + instance: Glue.ALL
1.41619 + }
1.41620 + }
1.41621 + };
1.41622 + }.call(this);
1.41623 +}
1.41624 +var MatrixDefinition = function () {
1.41625 + return {
1.41626 + __class__: 'flash.geom.Matrix',
1.41627 + __glue__: {
1.41628 + script: {
1.41629 + instance: Glue.ALL
1.41630 + }
1.41631 + }
1.41632 + };
1.41633 + }.call(this);
1.41634 +var Matrix3DDefinition = function () {
1.41635 + var precision = 1e-7;
1.41636 + var transposeTransform = new Uint32Array([
1.41637 + 0,
1.41638 + 4,
1.41639 + 8,
1.41640 + 12,
1.41641 + 1,
1.41642 + 5,
1.41643 + 9,
1.41644 + 13,
1.41645 + 2,
1.41646 + 6,
1.41647 + 10,
1.41648 + 14,
1.41649 + 3,
1.41650 + 7,
1.41651 + 11,
1.41652 + 15
1.41653 + ]);
1.41654 + function getRotationMatrix(theta, u, v, w, a, b, c) {
1.41655 + var u2 = u * u, v2 = v * v, w2 = w * w;
1.41656 + var L2 = u2 + v2 + w2, L = Math.sqrt(L2);
1.41657 + u /= L;
1.41658 + v /= L;
1.41659 + w /= L;
1.41660 + u2 /= L2;
1.41661 + v2 /= L2;
1.41662 + w2 /= L2;
1.41663 + var cos = Math.cos(theta), sin = Math.sin(theta);
1.41664 + return new flash.geom.Matrix3D([
1.41665 + u2 + (v2 + w2) * cos,
1.41666 + u * v * (1 - cos) + w * sin,
1.41667 + u * w * (1 - cos) - v * sin,
1.41668 + 0,
1.41669 + u * v * (1 - cos) - w * sin,
1.41670 + v2 + (u2 + w2) * cos,
1.41671 + v * w * (1 - cos) + u * sin,
1.41672 + 0,
1.41673 + u * w * (1 - cos) + v * sin,
1.41674 + v * w * (1 - cos) - u * sin,
1.41675 + w2 + (u2 + v2) * cos,
1.41676 + 0,
1.41677 + (a * (v2 + w2) - u * (b * v + c * w)) * (1 - cos) + (b * w - c * v) * sin,
1.41678 + (b * (u2 + w2) - v * (a * u + c * w)) * (1 - cos) + (c * u - a * w) * sin,
1.41679 + (c * (u2 + v2) - w * (a * u + b * v)) * (1 - cos) + (a * v - b * u) * sin,
1.41680 + 1
1.41681 + ]);
1.41682 + }
1.41683 + return {
1.41684 + __class__: 'flash.geom.Matrix3D',
1.41685 + initialize: function () {
1.41686 + },
1.41687 + __glue__: {
1.41688 + native: {
1.41689 + static: {
1.41690 + interpolate: function interpolate(thisMat, toMat, percent) {
1.41691 + notImplemented('Matrix3D.interpolate');
1.41692 + }
1.41693 + },
1.41694 + instance: {
1.41695 + ctor: function ctor(v) {
1.41696 + this._matrix = new Float32Array(16);
1.41697 + if (v && v.length >= 16) {
1.41698 + this.copyRawDataFrom(v, 0, false);
1.41699 + } else {
1.41700 + this.identity();
1.41701 + }
1.41702 + },
1.41703 + clone: function clone() {
1.41704 + return new flash.geom.Matrix3D(this._matrix);
1.41705 + },
1.41706 + copyToMatrix3D: function copyToMatrix3D(dest) {
1.41707 + dest._matrix.set(this._matrix);
1.41708 + },
1.41709 + append: function append(lhs) {
1.41710 + var ma = lhs._matrix, mb = this._matrix, m = this._matrix;
1.41711 + var ma11 = ma[0], ma12 = ma[4], ma13 = ma[8], ma14 = ma[12], ma21 = ma[1], ma22 = ma[5], ma23 = ma[9], ma24 = ma[13], ma31 = ma[2], ma32 = ma[6], ma33 = ma[10], ma34 = ma[14], ma41 = ma[3], ma42 = ma[7], ma43 = ma[11], ma44 = ma[15];
1.41712 + var mb11 = mb[0], mb12 = mb[4], mb13 = mb[8], mb14 = mb[12], mb21 = mb[1], mb22 = mb[5], mb23 = mb[9], mb24 = mb[13], mb31 = mb[2], mb32 = mb[6], mb33 = mb[10], mb34 = mb[14], mb41 = mb[3], mb42 = mb[7], mb43 = mb[11], mb44 = mb[15];
1.41713 + m[0] = ma11 * mb11 + ma12 * mb21 + ma13 * mb31 + ma14 * mb41;
1.41714 + m[1] = ma21 * mb11 + ma22 * mb21 + ma23 * mb31 + ma24 * mb41;
1.41715 + m[2] = ma31 * mb11 + ma32 * mb21 + ma33 * mb31 + ma34 * mb41;
1.41716 + m[3] = ma41 * mb11 + ma42 * mb21 + ma43 * mb31 + ma44 * mb41;
1.41717 + m[4] = ma11 * mb12 + ma12 * mb22 + ma13 * mb32 + ma14 * mb42;
1.41718 + m[5] = ma21 * mb12 + ma22 * mb22 + ma23 * mb32 + ma24 * mb42;
1.41719 + m[6] = ma31 * mb12 + ma32 * mb22 + ma33 * mb32 + ma34 * mb42;
1.41720 + m[7] = ma41 * mb12 + ma42 * mb22 + ma43 * mb32 + ma44 * mb42;
1.41721 + m[8] = ma11 * mb13 + ma12 * mb23 + ma13 * mb33 + ma14 * mb43;
1.41722 + m[9] = ma21 * mb13 + ma22 * mb23 + ma23 * mb33 + ma24 * mb43;
1.41723 + m[10] = ma31 * mb13 + ma32 * mb23 + ma33 * mb33 + ma34 * mb43;
1.41724 + m[11] = ma41 * mb13 + ma42 * mb23 + ma43 * mb33 + ma44 * mb43;
1.41725 + m[12] = ma11 * mb14 + ma12 * mb24 + ma13 * mb34 + ma14 * mb44;
1.41726 + m[13] = ma21 * mb14 + ma22 * mb24 + ma23 * mb34 + ma24 * mb44;
1.41727 + m[14] = ma31 * mb14 + ma32 * mb24 + ma33 * mb34 + ma34 * mb44;
1.41728 + m[15] = ma41 * mb14 + ma42 * mb24 + ma43 * mb34 + ma44 * mb44;
1.41729 + },
1.41730 + prepend: function prepend(rhs) {
1.41731 + var ma = this._matrix, mb = rhs._matrix, m = this._matrix;
1.41732 + var ma11 = ma[0], ma12 = ma[4], ma13 = ma[8], ma14 = ma[12], ma21 = ma[1], ma22 = ma[5], ma23 = ma[9], ma24 = ma[13], ma31 = ma[2], ma32 = ma[6], ma33 = ma[10], ma34 = ma[14], ma41 = ma[3], ma42 = ma[7], ma43 = ma[11], ma44 = ma[15];
1.41733 + var mb11 = mb[0], mb12 = mb[4], mb13 = mb[8], mb14 = mb[12], mb21 = mb[1], mb22 = mb[5], mb23 = mb[9], mb24 = mb[13], mb31 = mb[2], mb32 = mb[6], mb33 = mb[10], mb34 = mb[14], mb41 = mb[3], mb42 = mb[7], mb43 = mb[11], mb44 = mb[15];
1.41734 + m[0] = ma11 * mb11 + ma12 * mb21 + ma13 * mb31 + ma14 * mb41;
1.41735 + m[1] = ma21 * mb11 + ma22 * mb21 + ma23 * mb31 + ma24 * mb41;
1.41736 + m[2] = ma31 * mb11 + ma32 * mb21 + ma33 * mb31 + ma34 * mb41;
1.41737 + m[3] = ma41 * mb11 + ma42 * mb21 + ma43 * mb31 + ma44 * mb41;
1.41738 + m[4] = ma11 * mb12 + ma12 * mb22 + ma13 * mb32 + ma14 * mb42;
1.41739 + m[5] = ma21 * mb12 + ma22 * mb22 + ma23 * mb32 + ma24 * mb42;
1.41740 + m[6] = ma31 * mb12 + ma32 * mb22 + ma33 * mb32 + ma34 * mb42;
1.41741 + m[7] = ma41 * mb12 + ma42 * mb22 + ma43 * mb32 + ma44 * mb42;
1.41742 + m[8] = ma11 * mb13 + ma12 * mb23 + ma13 * mb33 + ma14 * mb43;
1.41743 + m[9] = ma21 * mb13 + ma22 * mb23 + ma23 * mb33 + ma24 * mb43;
1.41744 + m[10] = ma31 * mb13 + ma32 * mb23 + ma33 * mb33 + ma34 * mb43;
1.41745 + m[11] = ma41 * mb13 + ma42 * mb23 + ma43 * mb33 + ma44 * mb43;
1.41746 + m[12] = ma11 * mb14 + ma12 * mb24 + ma13 * mb34 + ma14 * mb44;
1.41747 + m[13] = ma21 * mb14 + ma22 * mb24 + ma23 * mb34 + ma24 * mb44;
1.41748 + m[14] = ma31 * mb14 + ma32 * mb24 + ma33 * mb34 + ma34 * mb44;
1.41749 + m[15] = ma41 * mb14 + ma42 * mb24 + ma43 * mb34 + ma44 * mb44;
1.41750 + },
1.41751 + invert: function invert() {
1.41752 + var d = this.determinant;
1.41753 + if (Math.abs(d) < precision) {
1.41754 + return false;
1.41755 + }
1.41756 + d = 1 / d;
1.41757 + var m = this._matrix;
1.41758 + var m11 = m[0], m12 = m[1], m13 = m[2], m14 = m[3], m21 = m[4], m22 = m[5], m23 = m[6], m24 = m[7], m31 = m[8], m32 = m[9], m33 = m[10], m34 = m[11], m41 = m[12], m42 = m[13], m43 = m[14], m44 = m[15];
1.41759 + m[0] = d * (m22 * (m33 * m44 - m43 * m34) - m32 * (m23 * m44 - m43 * m24) + m42 * (m23 * m34 - m33 * m24));
1.41760 + m[1] = -d * (m12 * (m33 * m44 - m43 * m34) - m32 * (m13 * m44 - m43 * m14) + m42 * (m13 * m34 - m33 * m14));
1.41761 + m[2] = d * (m12 * (m23 * m44 - m43 * m24) - m22 * (m13 * m44 - m43 * m14) + m42 * (m13 * m24 - m23 * m14));
1.41762 + m[3] = -d * (m12 * (m23 * m34 - m33 * m24) - m22 * (m13 * m34 - m33 * m14) + m32 * (m13 * m24 - m23 * m14));
1.41763 + m[4] = -d * (m21 * (m33 * m44 - m43 * m34) - m31 * (m23 * m44 - m43 * m24) + m41 * (m23 * m34 - m33 * m24));
1.41764 + m[5] = d * (m11 * (m33 * m44 - m43 * m34) - m31 * (m13 * m44 - m43 * m14) + m41 * (m13 * m34 - m33 * m14));
1.41765 + m[6] = -d * (m11 * (m23 * m44 - m43 * m24) - m21 * (m13 * m44 - m43 * m14) + m41 * (m13 * m24 - m23 * m14));
1.41766 + m[7] = d * (m11 * (m23 * m34 - m33 * m24) - m21 * (m13 * m34 - m33 * m14) + m31 * (m13 * m24 - m23 * m14));
1.41767 + m[8] = d * (m21 * (m32 * m44 - m42 * m34) - m31 * (m22 * m44 - m42 * m24) + m41 * (m22 * m34 - m32 * m24));
1.41768 + m[9] = -d * (m11 * (m32 * m44 - m42 * m34) - m31 * (m12 * m44 - m42 * m14) + m41 * (m12 * m34 - m32 * m14));
1.41769 + m[10] = d * (m11 * (m22 * m44 - m42 * m24) - m21 * (m12 * m44 - m42 * m14) + m41 * (m12 * m24 - m22 * m14));
1.41770 + m[11] = -d * (m11 * (m22 * m34 - m32 * m24) - m21 * (m12 * m34 - m32 * m14) + m31 * (m12 * m24 - m22 * m14));
1.41771 + m[12] = -d * (m21 * (m32 * m43 - m42 * m33) - m31 * (m22 * m43 - m42 * m23) + m41 * (m22 * m33 - m32 * m23));
1.41772 + m[13] = d * (m11 * (m32 * m43 - m42 * m33) - m31 * (m12 * m43 - m42 * m13) + m41 * (m12 * m33 - m32 * m13));
1.41773 + m[14] = -d * (m11 * (m22 * m43 - m42 * m23) - m21 * (m12 * m43 - m42 * m13) + m41 * (m12 * m23 - m22 * m13));
1.41774 + m[15] = d * (m11 * (m22 * m33 - m32 * m23) - m21 * (m12 * m33 - m32 * m13) + m31 * (m12 * m23 - m22 * m13));
1.41775 + return true;
1.41776 + },
1.41777 + identity: function identity() {
1.41778 + var m = this._matrix;
1.41779 + m[0] = m[5] = m[10] = m[15] = 1;
1.41780 + m[1] = m[2] = m[3] = m[4] = m[6] = m[7] = m[8] = m[9] = m[11] = m[12] = m[13] = m[14] = 0;
1.41781 + },
1.41782 + decompose: function decompose(orientationStyle) {
1.41783 + notImplemented('Matrix3D.decompose');
1.41784 + },
1.41785 + recompose: function recompose(components, orientationStyle) {
1.41786 + notImplemented('Matrix3D.recompose');
1.41787 + },
1.41788 + appendTranslation: function appendTranslation(x, y, z) {
1.41789 + var m = this._matrix;
1.41790 + var m41 = m[3], m42 = m[7], m43 = m[11], m44 = m[15];
1.41791 + m[0] += x * m41;
1.41792 + m[1] += y * m41;
1.41793 + m[2] += z * m41;
1.41794 + m[4] += x * m42;
1.41795 + m[5] += y * m42;
1.41796 + m[6] += z * m42;
1.41797 + m[8] += x * m43;
1.41798 + m[9] += y * m43;
1.41799 + m[10] += z * m43;
1.41800 + m[12] += x * m44;
1.41801 + m[13] += y * m44;
1.41802 + m[14] += z * m44;
1.41803 + },
1.41804 + appendRotation: function appendRotation(degrees, axis, pivotPoint) {
1.41805 + this.append(getRotationMatrix(degrees / 180 * Math.PI, axis.x, axis.y, axis.z, pivotPoint ? pivotPoint.x : 0, pivotPoint ? pivotPoint.y : 0, pivotPoint ? pivotPoint.z : 0));
1.41806 + },
1.41807 + appendScale: function appendScale(xScale, yScale, zScale) {
1.41808 + var m = this._matrix;
1.41809 + m[0] *= xScale;
1.41810 + m[1] *= yScale;
1.41811 + m[2] *= zScale;
1.41812 + m[4] *= xScale;
1.41813 + m[5] *= yScale;
1.41814 + m[6] *= zScale;
1.41815 + m[8] *= xScale;
1.41816 + m[9] *= yScale;
1.41817 + m[10] *= zScale;
1.41818 + m[12] *= xScale;
1.41819 + m[13] *= yScale;
1.41820 + m[14] *= zScale;
1.41821 + },
1.41822 + prependTranslation: function prependTranslation(x, y, z) {
1.41823 + var m = this._matrix;
1.41824 + var m11 = m[0], m12 = m[4], m13 = m[8], m14 = m[12], m21 = m[1], m22 = m[5], m23 = m[9], m24 = m[13], m31 = m[2], m32 = m[6], m33 = m[10], m34 = m[14], m41 = m[3], m42 = m[7], m43 = m[11], m44 = m[15];
1.41825 + m[12] += m11 * x + m12 * y + m13 * z;
1.41826 + m[13] += m21 * x + m22 * y + m23 * z;
1.41827 + m[14] += m31 * x + m32 * y + m33 * z;
1.41828 + m[15] += m41 * x + m42 * y + m43 * z;
1.41829 + },
1.41830 + prependRotation: function prependRotation(degrees, axis, pivotPoint) {
1.41831 + this.prepend(getRotationMatrix(degrees / 180 * Math.PI, axis.x, axis.y, axis.z, pivotPoint ? pivotPoint.x : 0, pivotPoint ? pivotPoint.y : 0, pivotPoint ? pivotPoint.z : 0));
1.41832 + },
1.41833 + prependScale: function prependScale(xScale, yScale, zScale) {
1.41834 + var m = this._matrix;
1.41835 + m[0] *= xScale;
1.41836 + m[1] *= xScale;
1.41837 + m[2] *= xScale;
1.41838 + m[3] *= xScale;
1.41839 + m[4] *= yScale;
1.41840 + m[5] *= yScale;
1.41841 + m[6] *= yScale;
1.41842 + m[7] *= yScale;
1.41843 + m[8] *= zScale;
1.41844 + m[9] *= zScale;
1.41845 + m[10] *= zScale;
1.41846 + m[11] *= zScale;
1.41847 + },
1.41848 + transformVector: function transformVector(v) {
1.41849 + var m = this._matrix;
1.41850 + var x = v.x, y = v.y, z = v.z;
1.41851 + return new flash.geom.Vector3D(m[0] * x + m[4] * y + m[8] * z + m[12], m[1] * x + m[5] * y + m[9] * z + m[13], m[2] * x + m[6] * y + m[10] * z + m[14]);
1.41852 + },
1.41853 + deltaTransformVector: function deltaTransformVector(v) {
1.41854 + var m = this._matrix;
1.41855 + var x = v.x, y = v.y, z = v.z;
1.41856 + return new flash.geom.Vector3D(m[0] * x + m[4] * y + m[8] * z, m[1] * x + m[5] * y + m[9] * z, m[2] * x + m[6] * y + m[10] * z);
1.41857 + },
1.41858 + transformVectors: function transformVectors(vin, vout) {
1.41859 + var m = this._matrix;
1.41860 + var m11 = m[0], m12 = m[4], m13 = m[8], m14 = m[12], m21 = m[1], m22 = m[5], m23 = m[9], m24 = m[13], m31 = m[2], m32 = m[6], m33 = m[10], m34 = m[14], m41 = m[3], m42 = m[7], m43 = m[11], m44 = m[15];
1.41861 + for (var i = 0; i < vin.length - 2; i += 3) {
1.41862 + var x = vin.asGetNumericProperty(i), y = vin.asGetNumericProperty(i + 1), z = vin.asGetNumericProperty(i + 2);
1.41863 + vout.push(m11 * x + m12 * y + m13 * z + m14);
1.41864 + vout.push(m21 * x + m22 * y + m23 * z + m24);
1.41865 + vout.push(m31 * x + m32 * y + m33 * z + m34);
1.41866 + }
1.41867 + },
1.41868 + transpose: function transpose() {
1.41869 + var m = this._matrix;
1.41870 + var tmp;
1.41871 + tmp = m[1];
1.41872 + m[1] = m[4];
1.41873 + m[4] = tmp;
1.41874 + tmp = m[2];
1.41875 + m[2] = m[8];
1.41876 + m[5] = tmp;
1.41877 + tmp = m[3];
1.41878 + m[3] = m[12];
1.41879 + m[12] = tmp;
1.41880 + tmp = m[6];
1.41881 + m[6] = m[9];
1.41882 + m[9] = tmp;
1.41883 + tmp = m[7];
1.41884 + m[7] = m[13];
1.41885 + m[13] = tmp;
1.41886 + tmp = m[11];
1.41887 + m[11] = m[14];
1.41888 + m[14] = tmp;
1.41889 + },
1.41890 + pointAt: function pointAt(pos, at, up) {
1.41891 + notImplemented('Matrix3D.pointAt');
1.41892 + },
1.41893 + interpolateTo: function interpolateTo(toMat, percent) {
1.41894 + notImplemented('Matrix3D.interpolateTo');
1.41895 + },
1.41896 + copyFrom: function copyFrom(sourceMatrix3D) {
1.41897 + this._matrix.set(sourceMatrix3D._matrix);
1.41898 + },
1.41899 + copyRawDataTo: function copyRawDataTo(vector, index, transpose) {
1.41900 + var m = this._matrix;
1.41901 + if (transpose) {
1.41902 + for (var i = 0, j = index | 0; i < 16; i++, j++) {
1.41903 + vector.asSetNumericProperty(j, m[transposeTransform[i]]);
1.41904 + }
1.41905 + } else {
1.41906 + for (var i = 0, j = index | 0; i < 16; i++, j++) {
1.41907 + vector.asSetNumericProperty(j, m[i]);
1.41908 + }
1.41909 + }
1.41910 + },
1.41911 + copyRawDataFrom: function copyRawDataFrom(vector, index, transpose) {
1.41912 + var m = this._matrix;
1.41913 + if (transpose) {
1.41914 + for (var i = 0, j = index | 0; i < 16; i++, j++) {
1.41915 + m[transposeTransform[i]] = vector.asGetNumericProperty(j) || 0;
1.41916 + }
1.41917 + } else {
1.41918 + for (var i = 0, j = index | 0; i < 16; i++, j++) {
1.41919 + m[i] = vector.asGetNumericProperty(j) || 0;
1.41920 + }
1.41921 + }
1.41922 + },
1.41923 + copyRowTo: function copyRowTo(row, vector3D) {
1.41924 + var offset = row | 0;
1.41925 + var m = this._matrix;
1.41926 + vector3D.x = m[offset];
1.41927 + vector3D.y = m[offset + 4];
1.41928 + vector3D.z = m[offset + 8];
1.41929 + vector3D.w = m[offset + 12];
1.41930 + },
1.41931 + copyColumnTo: function copyColumnTo(column, vector3D) {
1.41932 + var offset = column << 2;
1.41933 + var m = this._matrix;
1.41934 + vector3D.x = m[offset];
1.41935 + vector3D.y = m[offset + 1];
1.41936 + vector3D.z = m[offset + 2];
1.41937 + vector3D.w = m[offset + 3];
1.41938 + },
1.41939 + copyRowFrom: function copyRowFrom(row, vector3D) {
1.41940 + var offset = row | 0;
1.41941 + var m = this._matrix;
1.41942 + m[offset] = vector3D.x;
1.41943 + m[offset + 4] = vector3D.y;
1.41944 + m[offset + 8] = vector3D.z;
1.41945 + m[offset + 12] = vector3D.w;
1.41946 + },
1.41947 + copyColumnFrom: function copyColumnFrom(column, vector3D) {
1.41948 + var offset = column << 2;
1.41949 + var m = this._matrix;
1.41950 + m[offset] = vector3D.x;
1.41951 + m[offset + 1] = vector3D.y;
1.41952 + m[offset + 2] = vector3D.z;
1.41953 + m[offset + 3] = vector3D.w;
1.41954 + },
1.41955 + rawData: {
1.41956 + get: function rawData() {
1.41957 + var result = new Float64Vector();
1.41958 + this.copyRawDataTo(result, 0, false);
1.41959 + return result;
1.41960 + },
1.41961 + set: function rawData(v) {
1.41962 + this.copyRawDataFrom(v, 0, false);
1.41963 + }
1.41964 + },
1.41965 + position: {
1.41966 + get: function position() {
1.41967 + var m = this._matrix;
1.41968 + return new flash.geom.Vector3D(m[12], m[13], m[14]);
1.41969 + },
1.41970 + set: function position(pos) {
1.41971 + var m = this._matrix;
1.41972 + m[12] = pos.x;
1.41973 + m[13] = pos.y;
1.41974 + m[14] = pos.z;
1.41975 + }
1.41976 + },
1.41977 + determinant: {
1.41978 + get: function determinant() {
1.41979 + var m = this._matrix;
1.41980 + var m11 = m[0], m12 = m[4], m13 = m[8], m14 = m[12], m21 = m[1], m22 = m[5], m23 = m[9], m24 = m[13], m31 = m[2], m32 = m[6], m33 = m[10], m34 = m[14], m41 = m[3], m42 = m[7], m43 = m[11], m44 = m[15];
1.41981 + var d;
1.41982 + d = m11 * (m22 * (m33 * m44 - m43 * m34) - m32 * (m23 * m44 - m43 * m24) + m42 * (m23 * m34 - m33 * m24)) - m21 * (m12 * (m33 * m44 - m43 * m34) - m32 * (m13 * m44 - m43 * m14) + m42 * (m13 * m34 - m33 * m14)) + m31 * (m12 * (m23 * m44 - m43 * m24) - m22 * (m13 * m44 - m43 * m14) + m42 * (m13 * m24 - m23 * m14)) - m41 * (m12 * (m23 * m34 - m33 * m24) - m22 * (m13 * m34 - m33 * m14) + m32 * (m13 * m24 - m23 * m14));
1.41983 + return d;
1.41984 + }
1.41985 + }
1.41986 + }
1.41987 + },
1.41988 + script: {
1.41989 + instance: Glue.ALL
1.41990 + }
1.41991 + }
1.41992 + };
1.41993 + }.call(this);
1.41994 +var PointDefinition = function () {
1.41995 + return {
1.41996 + __class__: 'flash.geom.Point',
1.41997 + __glue__: {
1.41998 + script: {
1.41999 + static: Glue.ALL,
1.42000 + instance: Glue.ALL
1.42001 + }
1.42002 + }
1.42003 + };
1.42004 + }.call(this);
1.42005 +var RectangleDefinition = function () {
1.42006 + return {
1.42007 + __class__: 'flash.geom.Rectangle',
1.42008 + __glue__: {
1.42009 + script: {
1.42010 + instance: Glue.ALL
1.42011 + }
1.42012 + }
1.42013 + };
1.42014 + }.call(this);
1.42015 +var TransformDefinition = function () {
1.42016 + var def = {
1.42017 + __class__: 'flash.geom.Transform',
1.42018 + get colorTransform() {
1.42019 + var cxform = this._target._cxform;
1.42020 + if (cxform) {
1.42021 + return new flash.geom.ColorTransform(cxform.redMultiplier / 256, cxform.greenMultiplier / 256, cxform.blueMultiplier / 256, cxform.alphaMultiplier / 256, cxform.redOffset, cxform.greenOffset, cxform.blueOffset, cxform.alphaOffset);
1.42022 + } else {
1.42023 + return new flash.geom.ColorTransform();
1.42024 + }
1.42025 + },
1.42026 + set colorTransform(val) {
1.42027 + var CTClass = avm2.systemDomain.getClass('flash.geom.ColorTransform');
1.42028 + if (!CTClass.isInstanceOf(val)) {
1.42029 + throwError('TypeError', Errors.CheckTypeFailedError, val, 'flash.geom.ColorTransform');
1.42030 + }
1.42031 + this._target._cxform = {
1.42032 + redMultiplier: val.redMultiplier * 256,
1.42033 + greenMultiplier: val.greenMultiplier * 256,
1.42034 + blueMultiplier: val.blueMultiplier * 256,
1.42035 + alphaMultiplier: val.alphaMultiplier * 256,
1.42036 + redOffset: val.redOffset,
1.42037 + greenOffset: val.greenOffset,
1.42038 + blueOffset: val.blueOffset,
1.42039 + alphaOffset: val.alphaOffset
1.42040 + };
1.42041 + this._target._invalidate();
1.42042 + },
1.42043 + get concatenatedColorTransform() {
1.42044 + var cxform = this.colorTransform;
1.42045 + cxform.concat(this._target.parent.transform.concatenatedColorTransform);
1.42046 + return cxform;
1.42047 + },
1.42048 + get concatenatedMatrix() {
1.42049 + if (this._target._current3DTransform) {
1.42050 + return null;
1.42051 + }
1.42052 + var m = this._target._getConcatenatedTransform(null, false);
1.42053 + return new flash.geom.Matrix(m.a, m.b, m.c, m.d, m.tx / 20, m.ty / 20);
1.42054 + },
1.42055 + get matrix() {
1.42056 + if (this._target._current3DTransform) {
1.42057 + return null;
1.42058 + }
1.42059 + var m = this._target._currentTransform;
1.42060 + return new flash.geom.Matrix(m.a, m.b, m.c, m.d, m.tx / 20, m.ty / 20);
1.42061 + },
1.42062 + set matrix(val) {
1.42063 + if (!flash.geom.Matrix.class.isInstanceOf(val)) {
1.42064 + throwError('TypeError', Errors.CheckTypeFailedError, val, 'flash.geom.Matrix');
1.42065 + }
1.42066 + var target = this._target;
1.42067 + target._invalidate();
1.42068 + target._setTransformMatrix(val, true);
1.42069 + target._current3DTransform = null;
1.42070 + target._animated = false;
1.42071 + },
1.42072 + get matrix3D() {
1.42073 + var m = this._target._current3DTransform;
1.42074 + return m && m.clone();
1.42075 + },
1.42076 + set matrix3D(val) {
1.42077 + var Matrix3DClass = avm2.systemDomain.getClass('flash.geom.Matrix3D');
1.42078 + if (!Matrix3DClass.isInstanceOf(val)) {
1.42079 + throwError('TypeError', Errors.CheckTypeFailedError, val, 'flash.geom.Matrix3D');
1.42080 + }
1.42081 + var raw = val.rawData;
1.42082 + this.matrix = new flash.geom.Matrix(raw.asGetPublicProperty(0), raw.asGetPublicProperty(1), raw.asGetPublicProperty(4), raw.asGetPublicProperty(5), raw.asGetPublicProperty(12), raw.asGetPublicProperty(13));
1.42083 + this._target._current3DTransform = val;
1.42084 + },
1.42085 + ctor: function (target) {
1.42086 + this._target = target;
1.42087 + }
1.42088 + };
1.42089 + var desc = Object.getOwnPropertyDescriptor;
1.42090 + def.__glue__ = {
1.42091 + native: {
1.42092 + instance: {
1.42093 + colorTransform: desc(def, 'colorTransform'),
1.42094 + concatenatedColorTransform: desc(def, 'concatenatedColorTransform'),
1.42095 + concatenatedMatrix: desc(def, 'concatenatedMatrix'),
1.42096 + matrix: desc(def, 'matrix'),
1.42097 + matrix3D: desc(def, 'matrix3D'),
1.42098 + ctor: def.ctor
1.42099 + }
1.42100 + }
1.42101 + };
1.42102 + return def;
1.42103 + }.call(this);
1.42104 +var Vector3DDefinition = function () {
1.42105 + return {
1.42106 + __class__: 'flash.geom.Vector3D',
1.42107 + initialize: function () {
1.42108 + },
1.42109 + __glue__: {
1.42110 + script: {
1.42111 + instance: Glue.ALL
1.42112 + }
1.42113 + }
1.42114 + };
1.42115 + }.call(this);
1.42116 +{
1.42117 + var ID3InfoDefinition = function () {
1.42118 + return {
1.42119 + __glue__: {
1.42120 + script: {
1.42121 + instance: {
1.42122 + songName: 'public songName',
1.42123 + genre: 'public genre',
1.42124 + artist: 'public artist',
1.42125 + track: 'public track',
1.42126 + album: 'public album',
1.42127 + year: 'public year',
1.42128 + comment: 'public comment'
1.42129 + }
1.42130 + }
1.42131 + }
1.42132 + };
1.42133 + }.call(this);
1.42134 +}
1.42135 +var MicrophoneDefinition = function () {
1.42136 + return {
1.42137 + __class__: 'flash.media.Microphone',
1.42138 + initialize: function () {
1.42139 + },
1.42140 + __glue__: {
1.42141 + native: {
1.42142 + static: {
1.42143 + getMicrophone: function getMicrophone(index) {
1.42144 + notImplemented('Microphone.getMicrophone');
1.42145 + },
1.42146 + getEnhancedMicrophone: function getEnhancedMicrophone(index) {
1.42147 + notImplemented('Microphone.getEnhancedMicrophone');
1.42148 + },
1.42149 + names: {
1.42150 + get: function names() {
1.42151 + notImplemented('Microphone.names');
1.42152 + }
1.42153 + },
1.42154 + isSupported: {
1.42155 + get: function isSupported() {
1.42156 + notImplemented('Microphone.isSupported');
1.42157 + }
1.42158 + }
1.42159 + },
1.42160 + instance: {
1.42161 + setSilenceLevel: function setSilenceLevel(silenceLevel, timeout) {
1.42162 + notImplemented('Microphone.setSilenceLevel');
1.42163 + },
1.42164 + setUseEchoSuppression: function setUseEchoSuppression(useEchoSuppression) {
1.42165 + notImplemented('Microphone.setUseEchoSuppression');
1.42166 + },
1.42167 + setLoopBack: function setLoopBack(state) {
1.42168 + notImplemented('Microphone.setLoopBack');
1.42169 + },
1.42170 + gain: {
1.42171 + set: function gain(gain) {
1.42172 + notImplemented('Microphone.gain');
1.42173 + this._gain = gain;
1.42174 + },
1.42175 + get: function gain() {
1.42176 + notImplemented('Microphone.gain');
1.42177 + return this._gain;
1.42178 + }
1.42179 + },
1.42180 + rate: {
1.42181 + set: function rate(rate) {
1.42182 + notImplemented('Microphone.rate');
1.42183 + this._rate = rate;
1.42184 + },
1.42185 + get: function rate() {
1.42186 + notImplemented('Microphone.rate');
1.42187 + return this._rate;
1.42188 + }
1.42189 + },
1.42190 + codec: {
1.42191 + set: function codec(codec) {
1.42192 + notImplemented('Microphone.codec');
1.42193 + this._codec = codec;
1.42194 + },
1.42195 + get: function codec() {
1.42196 + notImplemented('Microphone.codec');
1.42197 + return this._codec;
1.42198 + }
1.42199 + },
1.42200 + framesPerPacket: {
1.42201 + get: function framesPerPacket() {
1.42202 + notImplemented('Microphone.framesPerPacket');
1.42203 + return this._framesPerPacket;
1.42204 + },
1.42205 + set: function framesPerPacket(frames) {
1.42206 + notImplemented('Microphone.framesPerPacket');
1.42207 + this._framesPerPacket = frames;
1.42208 + }
1.42209 + },
1.42210 + encodeQuality: {
1.42211 + get: function encodeQuality() {
1.42212 + notImplemented('Microphone.encodeQuality');
1.42213 + return this._encodeQuality;
1.42214 + },
1.42215 + set: function encodeQuality(quality) {
1.42216 + notImplemented('Microphone.encodeQuality');
1.42217 + this._encodeQuality = quality;
1.42218 + }
1.42219 + },
1.42220 + noiseSuppressionLevel: {
1.42221 + get: function noiseSuppressionLevel() {
1.42222 + notImplemented('Microphone.noiseSuppressionLevel');
1.42223 + return this._noiseSuppressionLevel;
1.42224 + },
1.42225 + set: function noiseSuppressionLevel(level) {
1.42226 + notImplemented('Microphone.noiseSuppressionLevel');
1.42227 + this._noiseSuppressionLevel = level;
1.42228 + }
1.42229 + },
1.42230 + enableVAD: {
1.42231 + get: function enableVAD() {
1.42232 + notImplemented('Microphone.enableVAD');
1.42233 + return this._enableVAD;
1.42234 + },
1.42235 + set: function enableVAD(enable) {
1.42236 + notImplemented('Microphone.enableVAD');
1.42237 + this._enableVAD = enable;
1.42238 + }
1.42239 + },
1.42240 + activityLevel: {
1.42241 + get: function activityLevel() {
1.42242 + notImplemented('Microphone.activityLevel');
1.42243 + return this._activityLevel;
1.42244 + }
1.42245 + },
1.42246 + index: {
1.42247 + get: function index() {
1.42248 + notImplemented('Microphone.index');
1.42249 + return this._index;
1.42250 + }
1.42251 + },
1.42252 + muted: {
1.42253 + get: function muted() {
1.42254 + notImplemented('Microphone.muted');
1.42255 + return this._muted;
1.42256 + }
1.42257 + },
1.42258 + name: {
1.42259 + get: function name() {
1.42260 + notImplemented('Microphone.name');
1.42261 + return this._name;
1.42262 + }
1.42263 + },
1.42264 + silenceLevel: {
1.42265 + get: function silenceLevel() {
1.42266 + notImplemented('Microphone.silenceLevel');
1.42267 + return this._silenceLevel;
1.42268 + }
1.42269 + },
1.42270 + silenceTimeout: {
1.42271 + get: function silenceTimeout() {
1.42272 + notImplemented('Microphone.silenceTimeout');
1.42273 + return this._silenceTimeout;
1.42274 + }
1.42275 + },
1.42276 + useEchoSuppression: {
1.42277 + get: function useEchoSuppression() {
1.42278 + notImplemented('Microphone.useEchoSuppression');
1.42279 + return this._useEchoSuppression;
1.42280 + }
1.42281 + },
1.42282 + soundTransform: {
1.42283 + get: function soundTransform() {
1.42284 + notImplemented('Microphone.soundTransform');
1.42285 + return this._soundTransform;
1.42286 + },
1.42287 + set: function soundTransform(sndTransform) {
1.42288 + notImplemented('Microphone.soundTransform');
1.42289 + this._soundTransform = sndTransform;
1.42290 + }
1.42291 + },
1.42292 + enhancedOptions: {
1.42293 + get: function enhancedOptions() {
1.42294 + notImplemented('Microphone.enhancedOptions');
1.42295 + return this._enhancedOptions;
1.42296 + },
1.42297 + set: function enhancedOptions(options) {
1.42298 + notImplemented('Microphone.enhancedOptions');
1.42299 + this._enhancedOptions = options;
1.42300 + }
1.42301 + }
1.42302 + }
1.42303 + },
1.42304 + script: {
1.42305 + instance: Glue.ALL
1.42306 + }
1.42307 + }
1.42308 + };
1.42309 + }.call(this);
1.42310 +var PLAY_USING_AUDIO_TAG = true;
1.42311 +var SoundDefinition = function () {
1.42312 + function getAudioDescription(soundData, onComplete) {
1.42313 + var audioElement = document.createElement('audio');
1.42314 + if (!audioElement.canPlayType(soundData.mimeType)) {
1.42315 + onComplete({
1.42316 + duration: 0
1.42317 + });
1.42318 + return;
1.42319 + }
1.42320 + audioElement.preload = 'metadata';
1.42321 + var blob = new Blob([
1.42322 + soundData.data
1.42323 + ], {
1.42324 + type: soundData.mimeType
1.42325 + });
1.42326 + audioElement.src = URL.createObjectURL(blob);
1.42327 + audioElement.load();
1.42328 + audioElement.addEventListener('loadedmetadata', function () {
1.42329 + onComplete({
1.42330 + duration: this.duration * 1000
1.42331 + });
1.42332 + });
1.42333 + }
1.42334 + var def = {
1.42335 + initialize: function initialize() {
1.42336 + this._playQueue = [];
1.42337 + this._url = null;
1.42338 + this._length = 0;
1.42339 + this._bytesTotal = 0;
1.42340 + this._bytesLoaded = 0;
1.42341 + this._id3 = new flash.media.ID3Info();
1.42342 + var s = this.symbol;
1.42343 + if (s) {
1.42344 + var soundData = {};
1.42345 + if (s.pcm) {
1.42346 + soundData.sampleRate = s.sampleRate;
1.42347 + soundData.channels = s.channels;
1.42348 + soundData.pcm = s.pcm;
1.42349 + soundData.end = s.pcm.length;
1.42350 + }
1.42351 + soundData.completed = true;
1.42352 + if (s.packaged) {
1.42353 + soundData.data = s.packaged.data.buffer;
1.42354 + soundData.mimeType = s.packaged.mimeType;
1.42355 + }
1.42356 + var _this = this;
1.42357 + getAudioDescription(soundData, function (description) {
1.42358 + _this._length = description.duration;
1.42359 + });
1.42360 + this._soundData = soundData;
1.42361 + }
1.42362 + TelemetryService.reportTelemetry({
1.42363 + topic: 'feature',
1.42364 + feature: SOUND_FEATURE
1.42365 + });
1.42366 + },
1.42367 + close: function close() {
1.42368 + somewhatImplemented('Sound.close');
1.42369 + },
1.42370 + extract: function extract(target, length, startPosition) {
1.42371 + notImplemented('Sound.extract');
1.42372 + },
1.42373 + _load: function _load(request, checkPolicyFile, bufferTime) {
1.42374 + if (!request) {
1.42375 + return;
1.42376 + }
1.42377 + var _this = this;
1.42378 + var stream = this._stream = new flash.net.URLStream();
1.42379 + var ByteArrayClass = avm2.systemDomain.getClass('flash.utils.ByteArray');
1.42380 + var data = ByteArrayClass.createInstance();
1.42381 + var dataPosition = 0;
1.42382 + var mp3DecodingSession = null;
1.42383 + var soundData = {
1.42384 + completed: false
1.42385 + };
1.42386 + stream._addEventListener('progress', function (event) {
1.42387 + _this._bytesLoaded = event[Multiname.getPublicQualifiedName('bytesLoaded')];
1.42388 + _this._bytesTotal = event[Multiname.getPublicQualifiedName('bytesTotal')];
1.42389 + if (!PLAY_USING_AUDIO_TAG && !mp3DecodingSession) {
1.42390 + mp3DecodingSession = decodeMP3(soundData, function (duration, final) {
1.42391 + if (_this._length === 0) {
1.42392 + _this._soundData = soundData;
1.42393 + _this._playQueue.forEach(function (item) {
1.42394 + item.channel._playSoundDataViaChannel(soundData, item.startTime);
1.42395 + });
1.42396 + }
1.42397 + _this._length = final ? duration * 1000 : Math.max(duration, mp3DecodingSession.estimateDuration(_this._bytesTotal)) * 1000;
1.42398 + });
1.42399 + }
1.42400 + var bytesAvailable = stream.bytesAvailable;
1.42401 + stream.readBytes(data, dataPosition, bytesAvailable);
1.42402 + if (mp3DecodingSession) {
1.42403 + mp3DecodingSession.pushData(new Uint8Array(data.a, dataPosition, bytesAvailable));
1.42404 + }
1.42405 + dataPosition += bytesAvailable;
1.42406 + _this._dispatchEvent(event);
1.42407 + });
1.42408 + stream._addEventListener('complete', function (event) {
1.42409 + _this._dispatchEvent(event);
1.42410 + soundData.data = data.a;
1.42411 + soundData.mimeType = 'audio/mpeg';
1.42412 + soundData.completed = true;
1.42413 + if (PLAY_USING_AUDIO_TAG) {
1.42414 + _this._soundData = soundData;
1.42415 + getAudioDescription(soundData, function (description) {
1.42416 + _this._length = description.duration;
1.42417 + });
1.42418 + _this._playQueue.forEach(function (item) {
1.42419 + item.channel._playSoundDataViaAudio(soundData, item.startTime);
1.42420 + });
1.42421 + }
1.42422 + if (mp3DecodingSession) {
1.42423 + mp3DecodingSession.close();
1.42424 + }
1.42425 + });
1.42426 + stream.load(request);
1.42427 + },
1.42428 + loadCompressedDataFromByteArray: function loadCompressedDataFromByteArray(bytes, bytesLength) {
1.42429 + notImplemented('Sound#loadCompressedDataFromByteArray');
1.42430 + },
1.42431 + loadPCMFromByteArray: function loadPCMFromByteArray(bytes, samples, format, stereo, sampleRate) {
1.42432 + notImplemented('Sound#loadPCMFromByteArray');
1.42433 + },
1.42434 + play: function play(startTime, loops, soundTransform) {
1.42435 + startTime = startTime || 0;
1.42436 + loops = loops || 0;
1.42437 + var channel = new flash.media.SoundChannel();
1.42438 + channel._sound = this;
1.42439 + channel._soundTransform = isNullOrUndefined(soundTransform) ? new flash.media.SoundTransform() : soundTransform;
1.42440 + this._playQueue.push({
1.42441 + channel: channel,
1.42442 + startTime: startTime
1.42443 + });
1.42444 + if (this._soundData) {
1.42445 + if (PLAY_USING_AUDIO_TAG)
1.42446 + channel._playSoundDataViaAudio(this._soundData, startTime, loops);
1.42447 + else
1.42448 + channel._playSoundDataViaChannel(this._soundData, startTime, loops);
1.42449 + }
1.42450 + return channel;
1.42451 + },
1.42452 + get bytesLoaded() {
1.42453 + return this._bytesLoaded;
1.42454 + },
1.42455 + get bytesTotal() {
1.42456 + return this._bytesTotal;
1.42457 + },
1.42458 + get id3() {
1.42459 + return this._id3;
1.42460 + },
1.42461 + get isBuffering() {
1.42462 + notImplemented('Sound#isBuffering');
1.42463 + },
1.42464 + get isURLInaccessible() {
1.42465 + notImplemented('Sound#isURLInaccessible');
1.42466 + },
1.42467 + get length() {
1.42468 + return this._length;
1.42469 + },
1.42470 + get url() {
1.42471 + return this._url;
1.42472 + }
1.42473 + };
1.42474 + function decodeMP3(soundData, ondurationchanged) {
1.42475 + var currentSize = 8000;
1.42476 + var pcm = new Float32Array(currentSize);
1.42477 + var position = 0;
1.42478 + var lastTimeRatio = 0;
1.42479 + var durationEstimationData = {
1.42480 + estimateBitRate: true,
1.42481 + bitRateSum: 0,
1.42482 + bitRateCount: 0,
1.42483 + metadataSize: 0,
1.42484 + averageBitRate: 0
1.42485 + };
1.42486 + var mp3DecoderSession = new MP3DecoderSession();
1.42487 + mp3DecoderSession.onframedata = function (frame, channels, sampleRate, bitRate) {
1.42488 + if (durationEstimationData.estimateBitRate) {
1.42489 + var FramesToEstimate = 200;
1.42490 + if (durationEstimationData.bitRateCount < FramesToEstimate) {
1.42491 + durationEstimationData.bitRateSum += bitRate;
1.42492 + durationEstimationData.bitRateCount++;
1.42493 + } else {
1.42494 + durationEstimationData.estimateBitRate = false;
1.42495 + }
1.42496 + this.averageBitRate = durationEstimationData.bitRateSum / durationEstimationData.bitRateCount;
1.42497 + }
1.42498 + if (frame.length === 0)
1.42499 + return;
1.42500 + if (!position) {
1.42501 + soundData.sampleRate = sampleRate, soundData.channels = channels;
1.42502 + soundData.pcm = pcm;
1.42503 + }
1.42504 + if (position + frame.length >= currentSize) {
1.42505 + do {
1.42506 + currentSize *= 2;
1.42507 + } while (position + frame.length >= currentSize);
1.42508 + var newPcm = new Float32Array(currentSize);
1.42509 + newPcm.set(pcm);
1.42510 + pcm = soundData.pcm = newPcm;
1.42511 + }
1.42512 + pcm.set(frame, position);
1.42513 + soundData.end = position += frame.length;
1.42514 + lastTimeRatio = 1 / soundData.sampleRate / soundData.channels;
1.42515 + ondurationchanged(position * lastTimeRatio, false);
1.42516 + };
1.42517 + mp3DecoderSession.onid3tag = function (data) {
1.42518 + durationEstimationData.metadataSize += data.length;
1.42519 + }, mp3DecoderSession.onclosed = function () {
1.42520 + ondurationchanged(position * lastTimeRatio, true);
1.42521 + };
1.42522 + var completed = false;
1.42523 + return {
1.42524 + pushData: function (data) {
1.42525 + mp3DecoderSession.pushAsync(data);
1.42526 + },
1.42527 + estimateDuration: function (fileSize) {
1.42528 + return Math.max(0, (fileSize - durationEstimationData.metadataSize) * 8 / durationEstimationData.averageBitRate);
1.42529 + },
1.42530 + close: function () {
1.42531 + mp3DecoderSession.close();
1.42532 + }
1.42533 + };
1.42534 + }
1.42535 + var desc = Object.getOwnPropertyDescriptor;
1.42536 + def.__glue__ = {
1.42537 + native: {
1.42538 + instance: {
1.42539 + close: def.close,
1.42540 + extract: def.extract,
1.42541 + _load: def._load,
1.42542 + loadCompressedDataFromByteArray: def.loadCompressedDataFromByteArray,
1.42543 + loadPCMFromByteArray: def.loadPCMFromByteArray,
1.42544 + play: def.play,
1.42545 + bytesLoaded: desc(def, 'bytesLoaded'),
1.42546 + bytesTotal: desc(def, 'bytesTotal'),
1.42547 + id3: desc(def, 'id3'),
1.42548 + isBuffering: desc(def, 'isBuffering'),
1.42549 + isURLInaccessible: desc(def, 'isURLInaccessible'),
1.42550 + length: desc(def, 'length'),
1.42551 + url: desc(def, 'url')
1.42552 + }
1.42553 + }
1.42554 + };
1.42555 + return def;
1.42556 + }.call(this);
1.42557 +var SoundChannelDefinition = function () {
1.42558 + return {
1.42559 + initialize: function () {
1.42560 + this._element = null;
1.42561 + this._position = 0;
1.42562 + this._leftPeak = 0;
1.42563 + this._rightPeak = 0;
1.42564 + this._pcmData = null;
1.42565 + this._soundTransform = new flash.media.SoundTransform();
1.42566 + this._soundMixerClass = avm2.systemDomain.getClass('flash.media.SoundMixer');
1.42567 + var s = this.symbol;
1.42568 + if (s) {
1.42569 + this._element = s.element || null;
1.42570 + }
1.42571 + if (this._element) {
1.42572 + this._registerWithSoundMixer();
1.42573 + }
1.42574 + },
1.42575 + _registerWithSoundMixer: function () {
1.42576 + this._soundMixerClass.native.static._registerChannel(this);
1.42577 + },
1.42578 + _unregisterWithSoundMixer: function () {
1.42579 + this._soundMixerClass.native.static._unregisterChannel(this);
1.42580 + },
1.42581 + _applySoundTransform: function () {
1.42582 + var volume = this._soundTransform._volume;
1.42583 + if (this._soundMixerClass._soundTransform) {
1.42584 + volume *= this._soundMixerClass._soundTransform._volume;
1.42585 + }
1.42586 + volume *= this._soundMixerClass.native.static._getMasterVolume();
1.42587 + if (this._element) {
1.42588 + this._element.volume = clamp(volume, 0, 1);
1.42589 + }
1.42590 + if (this._audioChannel) {
1.42591 + }
1.42592 + },
1.42593 + _playSoundDataViaChannel: function (soundData, startTime, loops) {
1.42594 + this._registerWithSoundMixer();
1.42595 + var self = this;
1.42596 + var startPosition = Math.round(startTime / 1000 * soundData.sampleRate) * soundData.channels;
1.42597 + var position = startPosition;
1.42598 + this._position = startTime;
1.42599 + this._audioChannel = createAudioChannel(soundData.sampleRate, soundData.channels);
1.42600 + this._audioChannel.ondatarequested = function (e) {
1.42601 + var end = soundData.end;
1.42602 + if (position >= end && soundData.completed) {
1.42603 + self._unregisterWithSoundMixer();
1.42604 + self._audioChannel.stop();
1.42605 + self._dispatchEvent(new flash.events.Event('soundComplete', false, false));
1.42606 + return;
1.42607 + }
1.42608 + var left = e.count;
1.42609 + var data = e.data;
1.42610 + var source = soundData.pcm;
1.42611 + do {
1.42612 + var count = Math.min(end - position, left);
1.42613 + for (var j = 0; j < count; j++) {
1.42614 + data[j] = source[position++];
1.42615 + }
1.42616 + left -= count;
1.42617 + if (position >= end) {
1.42618 + if (!loops)
1.42619 + break;
1.42620 + loops--;
1.42621 + position = startPosition;
1.42622 + }
1.42623 + } while (left > 0);
1.42624 + self._position = position / soundData.sampleRate / soundData.channels * 1000;
1.42625 + };
1.42626 + this._audioChannel.start();
1.42627 + this._applySoundTransform();
1.42628 + },
1.42629 + _playSoundDataViaAudio: function (soundData, startTime, loops) {
1.42630 + if (!soundData.mimeType)
1.42631 + return;
1.42632 + this._registerWithSoundMixer();
1.42633 + this._position = startTime;
1.42634 + var self = this;
1.42635 + var lastCurrentTime = 0;
1.42636 + var element = document.createElement('audio');
1.42637 + if (!element.canPlayType(soundData.mimeType)) {
1.42638 + console.error('ERROR: "' + soundData.mimeType + '" ' + 'type playback is not supported by the browser');
1.42639 + return;
1.42640 + }
1.42641 + element.preload = 'metadata';
1.42642 + element.loop = loops > 0;
1.42643 + var blob = new Blob([
1.42644 + soundData.data
1.42645 + ], {
1.42646 + type: soundData.mimeType
1.42647 + });
1.42648 + element.src = URL.createObjectURL(blob);
1.42649 + element.addEventListener('loadeddata', function loaded() {
1.42650 + element.currentTime = startTime / 1000;
1.42651 + element.play();
1.42652 + });
1.42653 + element.addEventListener('timeupdate', function timeupdate() {
1.42654 + var currentTime = element.currentTime;
1.42655 + if (loops && lastCurrentTime > currentTime) {
1.42656 + --loops;
1.42657 + if (!loops)
1.42658 + element.loop = false;
1.42659 + if (currentTime < startTime / 1000)
1.42660 + element.currentTime = startTime / 1000;
1.42661 + }
1.42662 + self._position = (lastCurrentTime = currentTime) * 1000;
1.42663 + });
1.42664 + element.addEventListener('ended', function ended() {
1.42665 + self._unregisterWithSoundMixer();
1.42666 + self._dispatchEvent(new flash.events.Event('soundComplete', false, false));
1.42667 + self._element = null;
1.42668 + });
1.42669 + this._element = element;
1.42670 + this._applySoundTransform();
1.42671 + },
1.42672 + __glue__: {
1.42673 + native: {
1.42674 + static: {},
1.42675 + instance: {
1.42676 + stop: function stop() {
1.42677 + if (this._element) {
1.42678 + this._unregisterWithSoundMixer();
1.42679 + this._element.pause();
1.42680 + }
1.42681 + if (this._audioChannel) {
1.42682 + this._unregisterWithSoundMixer();
1.42683 + this._audioChannel.stop();
1.42684 + }
1.42685 + },
1.42686 + 'position': {
1.42687 + get: function position() {
1.42688 + return this._position;
1.42689 + }
1.42690 + },
1.42691 + 'leftPeak': {
1.42692 + get: function leftPeak() {
1.42693 + return this._leftPeak;
1.42694 + }
1.42695 + },
1.42696 + 'rightPeak': {
1.42697 + get: function rightPeak() {
1.42698 + return this.rightPeak;
1.42699 + }
1.42700 + },
1.42701 + 'soundTransform': {
1.42702 + get: function soundTransform() {
1.42703 + somewhatImplemented('SoundChannel.soundTransform');
1.42704 + return new flash.media.SoundTransform(this._soundTransform._volume, this._soundTransform.pan);
1.42705 + },
1.42706 + set: function soundTransform(soundTransform) {
1.42707 + somewhatImplemented('SoundChannel.soundTransform');
1.42708 + this._soundTransform = isNullOrUndefined(soundTransform) ? new flash.media.SoundTransform() : soundTransform;
1.42709 + this._applySoundTransform();
1.42710 + }
1.42711 + }
1.42712 + }
1.42713 + },
1.42714 + script: {
1.42715 + instance: scriptProperties('public', [
1.42716 + 'stop'
1.42717 + ])
1.42718 + }
1.42719 + }
1.42720 + };
1.42721 + }.call(this);
1.42722 +function createAudioChannel(sampleRate, channels) {
1.42723 + if (WebAudioChannel.isSupported)
1.42724 + return new WebAudioChannel(sampleRate, channels);
1.42725 + else
1.42726 + error('PCM data playback is not supported by the browser');
1.42727 +}
1.42728 +function AudioResampler(sourceRate, targetRate) {
1.42729 + this.sourceRate = sourceRate;
1.42730 + this.targetRate = targetRate;
1.42731 + this.tail = [];
1.42732 + this.sourceOffset = 0;
1.42733 +}
1.42734 +AudioResampler.prototype = {
1.42735 + ondatarequested: function (e) {
1.42736 + },
1.42737 + getData: function (channelsData, count) {
1.42738 + var k = this.sourceRate / this.targetRate;
1.42739 + var offset = this.sourceOffset;
1.42740 + var needed = Math.ceil((count - 1) * k + offset) + 1;
1.42741 + var sourceData = [];
1.42742 + for (var channel = 0; channel < channelsData.length; channel++)
1.42743 + sourceData.push(new Float32Array(needed));
1.42744 + var e = {
1.42745 + data: sourceData,
1.42746 + count: needed
1.42747 + };
1.42748 + this.ondatarequested(e);
1.42749 + for (var channel = 0; channel < channelsData.length; channel++) {
1.42750 + var data = channelsData[channel];
1.42751 + var source = sourceData[channel];
1.42752 + for (var j = 0; j < count; j++) {
1.42753 + var i = j * k + offset;
1.42754 + var i1 = i | 0, i2 = Math.ceil(i) | 0;
1.42755 + var source_i1 = i1 < 0 ? this.tail[channel] : source[i1];
1.42756 + if (i1 === i2) {
1.42757 + data[j] = source_i1;
1.42758 + } else {
1.42759 + var alpha = i - i1;
1.42760 + data[j] = source_i1 * (1 - alpha) + source[i2] * alpha;
1.42761 + }
1.42762 + }
1.42763 + this.tail[channel] = source[needed - 1];
1.42764 + }
1.42765 + this.sourceOffset = (count - 1) * k + offset - (needed - 1);
1.42766 + }
1.42767 +};
1.42768 +function WebAudioChannel(sampleRate, channels) {
1.42769 + var context = WebAudioChannel.context;
1.42770 + if (!context) {
1.42771 + if (typeof AudioContext !== 'undefined')
1.42772 + context = new AudioContext();
1.42773 + else
1.42774 + context = new webkitAudioContext();
1.42775 + WebAudioChannel.context = context;
1.42776 + }
1.42777 + this.context = context;
1.42778 + this.contextSampleRate = context.sampleRate || 44100;
1.42779 + this.channels = channels;
1.42780 + this.sampleRate = sampleRate;
1.42781 + if (this.contextSampleRate != sampleRate) {
1.42782 + this.resampler = new AudioResampler(sampleRate, this.contextSampleRate);
1.42783 + this.resampler.ondatarequested = function (e) {
1.42784 + this.requestData(e.data, e.count);
1.42785 + }.bind(this);
1.42786 + }
1.42787 +}
1.42788 +WebAudioChannel.prototype = {
1.42789 + start: function () {
1.42790 + var source = this.context.createScriptProcessor ? this.context.createScriptProcessor(2048, 0, this.channels) : this.context.createJavaScriptNode(2048, 0, this.channels);
1.42791 + var self = this;
1.42792 + source.onaudioprocess = function (e) {
1.42793 + var channelsData = [];
1.42794 + for (var i = 0; i < self.channels; i++)
1.42795 + channelsData.push(e.outputBuffer.getChannelData(i));
1.42796 + var count = channelsData[0].length;
1.42797 + if (self.resampler) {
1.42798 + self.resampler.getData(channelsData, count);
1.42799 + } else {
1.42800 + var e = {
1.42801 + data: channelsData,
1.42802 + count: count
1.42803 + };
1.42804 + self.requestData(channelsData, count);
1.42805 + }
1.42806 + };
1.42807 + source.connect(this.context.destination);
1.42808 + this.source = source;
1.42809 + },
1.42810 + stop: function () {
1.42811 + this.source.disconnect(this.context.destination);
1.42812 + },
1.42813 + requestData: function (channelsData, count) {
1.42814 + var channels = this.channels;
1.42815 + var buffer = new Float32Array(count * channels);
1.42816 + var e = {
1.42817 + data: buffer,
1.42818 + count: buffer.length
1.42819 + };
1.42820 + this.ondatarequested(e);
1.42821 + for (var j = 0, p = 0; j < count; j++) {
1.42822 + for (var i = 0; i < channels; i++)
1.42823 + channelsData[i][j] = buffer[p++];
1.42824 + }
1.42825 + }
1.42826 +};
1.42827 +WebAudioChannel.isSupported = function () {
1.42828 + return typeof AudioContext !== 'undefined' || typeof webkitAudioContext != 'undefined';
1.42829 +}();
1.42830 +var SoundMixerDefinition = function () {
1.42831 + var masterVolume = 1;
1.42832 + var registeredChannels = [];
1.42833 + return {
1.42834 + __class__: 'flash.media.SoundMixer',
1.42835 + initialize: function () {
1.42836 + },
1.42837 + __glue__: {
1.42838 + native: {
1.42839 + static: {
1.42840 + _registerChannel: function _registerChannel(channel) {
1.42841 + registeredChannels.push(channel);
1.42842 + },
1.42843 + _unregisterChannel: function _unregisterChannel(channel) {
1.42844 + var index = registeredChannels.indexOf(channel);
1.42845 + if (index >= 0)
1.42846 + registeredChannels.splice(index, 1);
1.42847 + },
1.42848 + _getMasterVolume: function _getMasterVolume() {
1.42849 + return masterVolume;
1.42850 + },
1.42851 + _setMasterVolume: function _setMasterVolume(volume) {
1.42852 + masterVolume = volume;
1.42853 + registeredChannels.forEach(function (channel) {
1.42854 + channel._applySoundTransform();
1.42855 + });
1.42856 + },
1.42857 + stopAll: function stopAll() {
1.42858 + registeredChannels.forEach(function (channel) {
1.42859 + channel.stop();
1.42860 + });
1.42861 + registeredChannels = [];
1.42862 + },
1.42863 + computeSpectrum: function computeSpectrum(outputArray, FFTMode, stretchFactor) {
1.42864 + somewhatImplemented('SoundMixer.computeSpectrum');
1.42865 + var data = new Float32Array(1024);
1.42866 + for (var i = 0; i < 1024; i++) {
1.42867 + data[i] = Math.random();
1.42868 + }
1.42869 + outputArray.writeRawBytes(data);
1.42870 + outputArray.position = 0;
1.42871 + },
1.42872 + areSoundsInaccessible: function areSoundsInaccessible() {
1.42873 + notImplemented('SoundMixer.areSoundsInaccessible');
1.42874 + },
1.42875 + bufferTime: {
1.42876 + get: function bufferTime() {
1.42877 + notImplemented('SoundMixer.bufferTime');
1.42878 + },
1.42879 + set: function bufferTime(pA) {
1.42880 + notImplemented('SoundMixer.bufferTime');
1.42881 + }
1.42882 + },
1.42883 + soundTransform: {
1.42884 + get: function soundTransform() {
1.42885 + somewhatImplemented('SoundMixer.soundTransform');
1.42886 + return isNullOrUndefined(this._soundTransform) ? new flash.media.SoundTransform() : new flash.media.SoundTransform(this._soundTransform._volume, this._soundTransform.pan);
1.42887 + },
1.42888 + set: function soundTransform(soundTransform) {
1.42889 + somewhatImplemented('SoundMixer.soundTransform');
1.42890 + this._soundTransform = isNullOrUndefined(soundTransform) ? new flash.media.SoundTransform() : soundTransform;
1.42891 + registeredChannels.forEach(function (channel) {
1.42892 + channel._applySoundTransform();
1.42893 + });
1.42894 + }
1.42895 + },
1.42896 + audioPlaybackMode: {
1.42897 + get: function audioPlaybackMode() {
1.42898 + notImplemented('SoundMixer.audioPlaybackMode');
1.42899 + },
1.42900 + set: function audioPlaybackMode(pA) {
1.42901 + notImplemented('SoundMixer.audioPlaybackMode');
1.42902 + }
1.42903 + },
1.42904 + useSpeakerphoneForVoice: {
1.42905 + get: function useSpeakerphoneForVoice() {
1.42906 + notImplemented('SoundMixer.useSpeakerphoneForVoice');
1.42907 + },
1.42908 + set: function useSpeakerphoneForVoice(pA) {
1.42909 + notImplemented('SoundMixer.useSpeakerphoneForVoice');
1.42910 + }
1.42911 + }
1.42912 + },
1.42913 + instance: {}
1.42914 + }
1.42915 + }
1.42916 + };
1.42917 + }.call(this);
1.42918 +var SoundTransformDefinition = function () {
1.42919 + return {
1.42920 + __class__: 'flash.media.SoundTransform',
1.42921 + initialize: function () {
1.42922 + },
1.42923 + _updateTransform: function () {
1.42924 + somewhatImplemented('SoundTransform._updateTransform');
1.42925 + },
1.42926 + __glue__: {
1.42927 + native: {
1.42928 + static: {},
1.42929 + instance: {
1.42930 + volume: {
1.42931 + get: function volume() {
1.42932 + return this._volume;
1.42933 + },
1.42934 + set: function volume(volume) {
1.42935 + this._volume = volume;
1.42936 + this._updateTransform();
1.42937 + }
1.42938 + },
1.42939 + leftToLeft: {
1.42940 + get: function leftToLeft() {
1.42941 + return this._leftToLeft;
1.42942 + },
1.42943 + set: function leftToLeft(leftToLeft) {
1.42944 + this._leftToLeft = leftToLeft;
1.42945 + this._updateTransform();
1.42946 + }
1.42947 + },
1.42948 + leftToRight: {
1.42949 + get: function leftToRight() {
1.42950 + return this._leftToRight;
1.42951 + },
1.42952 + set: function leftToRight(leftToRight) {
1.42953 + this._leftToRight = leftToRight;
1.42954 + this._updateTransform();
1.42955 + }
1.42956 + },
1.42957 + rightToRight: {
1.42958 + get: function rightToRight() {
1.42959 + return this._rightToRight;
1.42960 + },
1.42961 + set: function rightToRight(rightToRight) {
1.42962 + this._rightToRight = rightToRight;
1.42963 + this._updateTransform();
1.42964 + }
1.42965 + },
1.42966 + rightToLeft: {
1.42967 + get: function rightToLeft() {
1.42968 + return this._rightToLeft;
1.42969 + },
1.42970 + set: function rightToLeft(rightToLeft) {
1.42971 + this._rightToLeft = rightToLeft;
1.42972 + this._updateTransform();
1.42973 + }
1.42974 + }
1.42975 + }
1.42976 + },
1.42977 + script: {
1.42978 + instance: {
1.42979 + pan: 'public pan'
1.42980 + }
1.42981 + }
1.42982 + }
1.42983 + };
1.42984 + }.call(this);
1.42985 +var StageVideoDefinition = function () {
1.42986 + return {
1.42987 + __class__: 'flash.media.StageVideo',
1.42988 + initialize: function () {
1.42989 + },
1.42990 + __glue__: {
1.42991 + native: {
1.42992 + static: {},
1.42993 + instance: {
1.42994 + attachNetStream: function attachNetStream(netStream) {
1.42995 + notImplemented('StageVideo.attachNetStream');
1.42996 + },
1.42997 + attachCamera: function attachCamera(theCamera) {
1.42998 + notImplemented('StageVideo.attachCamera');
1.42999 + },
1.43000 + viewPort: {
1.43001 + get: function viewPort() {
1.43002 + notImplemented('StageVideo.viewPort');
1.43003 + return this._viewPort;
1.43004 + },
1.43005 + set: function viewPort(rect) {
1.43006 + notImplemented('StageVideo.viewPort');
1.43007 + this._viewPort = rect;
1.43008 + }
1.43009 + },
1.43010 + pan: {
1.43011 + set: function pan(point) {
1.43012 + notImplemented('StageVideo.pan');
1.43013 + this._pan = point;
1.43014 + },
1.43015 + get: function pan() {
1.43016 + notImplemented('StageVideo.pan');
1.43017 + return this._pan;
1.43018 + }
1.43019 + },
1.43020 + zoom: {
1.43021 + set: function zoom(point) {
1.43022 + notImplemented('StageVideo.zoom');
1.43023 + this._zoom = point;
1.43024 + },
1.43025 + get: function zoom() {
1.43026 + notImplemented('StageVideo.zoom');
1.43027 + return this._zoom;
1.43028 + }
1.43029 + },
1.43030 + depth: {
1.43031 + set: function depth(depth) {
1.43032 + notImplemented('StageVideo.depth');
1.43033 + this._depth = depth;
1.43034 + },
1.43035 + get: function depth() {
1.43036 + notImplemented('StageVideo.depth');
1.43037 + return this._depth;
1.43038 + }
1.43039 + },
1.43040 + videoWidth: {
1.43041 + get: function videoWidth() {
1.43042 + notImplemented('StageVideo.videoWidth');
1.43043 + return this._videoWidth;
1.43044 + }
1.43045 + },
1.43046 + videoHeight: {
1.43047 + get: function videoHeight() {
1.43048 + notImplemented('StageVideo.videoHeight');
1.43049 + return this._videoHeight;
1.43050 + }
1.43051 + },
1.43052 + colorSpaces: {
1.43053 + get: function colorSpaces() {
1.43054 + notImplemented('StageVideo.colorSpaces');
1.43055 + return this._colorSpaces;
1.43056 + }
1.43057 + }
1.43058 + }
1.43059 + }
1.43060 + }
1.43061 + };
1.43062 + }.call(this);
1.43063 +var VideoDefinition = function () {
1.43064 + function burnHole(ctx, x, y, width, height) {
1.43065 + ctx.save();
1.43066 + ctx.beginPath();
1.43067 + ctx.rect(0, 0, width, height);
1.43068 + ctx.clip();
1.43069 + ctx.clearRect(0, 0, width, height);
1.43070 + ctx.restore();
1.43071 + }
1.43072 + var def = {
1.43073 + initialize: function initialize() {
1.43074 + TelemetryService.reportTelemetry({
1.43075 + topic: 'feature',
1.43076 + feature: VIDEO_FEATURE
1.43077 + });
1.43078 + },
1.43079 + attachNetStream: function (netStream) {
1.43080 + if (this._netStream === netStream) {
1.43081 + return;
1.43082 + }
1.43083 + if (this._netStream) {
1.43084 + this._netStream._videoReady.then(function (element) {
1.43085 + this._element = null;
1.43086 + if (this._added) {
1.43087 + element.remove();
1.43088 + this._added = false;
1.43089 + }
1.43090 + }.bind(this));
1.43091 + }
1.43092 + this._netStream = netStream;
1.43093 + if (!netStream) {
1.43094 + return;
1.43095 + }
1.43096 + netStream._videoReady.then(function (element) {
1.43097 + this._element = element;
1.43098 + netStream._videoMetadataReady.then(function (url) {
1.43099 + this._element.width = this._videoWidth = this._element.videoWidth;
1.43100 + this._element.height = this._videoHeight = this._element.videoHeight;
1.43101 + if (this.stage) {
1.43102 + this.stage._invalid = true;
1.43103 + }
1.43104 + }.bind(this));
1.43105 + }.bind(this));
1.43106 + },
1.43107 + ctor: function (width, height) {
1.43108 + if (!width || width < 0)
1.43109 + width = 320;
1.43110 + if (!height || height < 0)
1.43111 + height = 240;
1.43112 + this._bbox = {
1.43113 + xMin: 0,
1.43114 + yMin: 0,
1.43115 + xMax: width * 20,
1.43116 + yMax: height * 20
1.43117 + };
1.43118 + this._initialWidth = this._videoWidth = width;
1.43119 + this._initialHeight = this._videoHeight = height;
1.43120 + this._netStream = null;
1.43121 + this._element = null;
1.43122 + this._added = false;
1.43123 + },
1.43124 + draw: function (ctx, ratio, ct, parentCtxs) {
1.43125 + if (!this._element) {
1.43126 + return;
1.43127 + }
1.43128 + if (!this._added && this._stage) {
1.43129 + this._stage._domContainer.appendChild(this._element);
1.43130 + this._added = true;
1.43131 + }
1.43132 + var width = this._initialWidth;
1.43133 + var height = this._initialHeight;
1.43134 + var matrix = this._getConcatenatedTransform(null, true);
1.43135 + var scaleFactor = this.stage && this.stage._contentsScaleFactor || 1;
1.43136 + var a = matrix.a / scaleFactor;
1.43137 + var b = matrix.b / scaleFactor;
1.43138 + var c = matrix.c / scaleFactor;
1.43139 + var d = matrix.d / scaleFactor;
1.43140 + var e = matrix.tx / 20 / scaleFactor;
1.43141 + var f = matrix.ty / 20 / scaleFactor;
1.43142 + if (width > 0 && height > 0) {
1.43143 + burnHole(ctx, 0, 0, width, height);
1.43144 + parentCtxs.forEach(function (ctx) {
1.43145 + ctx.save();
1.43146 + ctx.setTransform(a, b, c, d, e, f);
1.43147 + burnHole(ctx, 0, 0, width, height);
1.43148 + ctx.restore();
1.43149 + });
1.43150 + }
1.43151 + var sx = width / this._videoWidth;
1.43152 + var sy = height / this._videoHeight;
1.43153 + var cssTransform = 'transform: matrix(' + sx * a + ',' + sx * b + ',' + sy * c + ',' + sy * d + ',' + e + ',' + f + ');';
1.43154 + if (this._currentCssTransform !== cssTransform) {
1.43155 + this._currentCssTransform = cssTransform;
1.43156 + this._element.setAttribute('style', 'position: absolute; top:0; left:0; z-index: -100;transform-origin: 0px 0px 0;' + cssTransform + '-webkit-transform-origin: 0px 0px 0; -webkit-' + cssTransform);
1.43157 + }
1.43158 + }
1.43159 + };
1.43160 + def.__glue__ = {
1.43161 + native: {
1.43162 + instance: {
1.43163 + attachNetStream: def.attachNetStream,
1.43164 + ctor: def.ctor,
1.43165 + smoothing: {
1.43166 + get: function smoothing() {
1.43167 + return this._smoothing;
1.43168 + },
1.43169 + set: function smoothing(value) {
1.43170 + somewhatImplemented('Video.smoothing');
1.43171 + this._smoothing = value;
1.43172 + }
1.43173 + },
1.43174 + videoHeight: {
1.43175 + get: function videoHeight() {
1.43176 + return this._videoHeight;
1.43177 + }
1.43178 + },
1.43179 + videoWidth: {
1.43180 + get: function videoWidth() {
1.43181 + return this._videoWidth;
1.43182 + }
1.43183 + }
1.43184 + }
1.43185 + }
1.43186 + };
1.43187 + return def;
1.43188 + }.call(this);
1.43189 +{
1.43190 + var FileFilterDefinition = function () {
1.43191 + return {
1.43192 + __class__: 'flash.net.FileFilter',
1.43193 + initialize: function () {
1.43194 + this._description = null;
1.43195 + this._extension = null;
1.43196 + this._macType = null;
1.43197 + },
1.43198 + __glue__: {
1.43199 + native: {
1.43200 + static: {},
1.43201 + instance: {
1.43202 + description: {
1.43203 + get: function description() {
1.43204 + return this._description;
1.43205 + },
1.43206 + set: function description(value) {
1.43207 + this._description = value;
1.43208 + }
1.43209 + },
1.43210 + extension: {
1.43211 + get: function extension() {
1.43212 + return this._extension;
1.43213 + },
1.43214 + set: function extension(value) {
1.43215 + this._extension = value;
1.43216 + }
1.43217 + },
1.43218 + macType: {
1.43219 + get: function macType() {
1.43220 + return this._macType;
1.43221 + },
1.43222 + set: function macType(value) {
1.43223 + this._macType = value;
1.43224 + }
1.43225 + }
1.43226 + }
1.43227 + }
1.43228 + }
1.43229 + };
1.43230 + }.call(this);
1.43231 +}
1.43232 +var LocalConnectionDefinition = function () {
1.43233 + return {
1.43234 + __class__: 'flash.net.LocalConnection',
1.43235 + initialize: function () {
1.43236 + },
1.43237 + __glue__: {
1.43238 + native: {
1.43239 + static: {},
1.43240 + instance: {
1.43241 + close: function close() {
1.43242 + notImplemented('LocalConnection.close');
1.43243 + },
1.43244 + connect: function connect(connectionName) {
1.43245 + notImplemented('LocalConnection.connect');
1.43246 + },
1.43247 + send: function send(connectionName, methodName) {
1.43248 + notImplemented('LocalConnection.send');
1.43249 + },
1.43250 + allowDomain: function allowDomain() {
1.43251 + notImplemented('LocalConnection.allowDomain');
1.43252 + },
1.43253 + allowInsecureDomain: function allowInsecureDomain() {
1.43254 + notImplemented('LocalConnection.allowInsecureDomain');
1.43255 + },
1.43256 + domain: {
1.43257 + get: function domain() {
1.43258 + somewhatImplemented('LocalConnection.domain');
1.43259 + var url = FileLoadingService.resolveUrl('/');
1.43260 + var m = /:\/\/(.+?)[:?#\/]/.exec(url);
1.43261 + return m && m[1];
1.43262 + }
1.43263 + },
1.43264 + client: {
1.43265 + get: function client() {
1.43266 + notImplemented('LocalConnection.client');
1.43267 + return this._client;
1.43268 + },
1.43269 + set: function client(client) {
1.43270 + notImplemented('LocalConnection.client');
1.43271 + this._client = client;
1.43272 + }
1.43273 + },
1.43274 + isPerUser: {
1.43275 + get: function isPerUser() {
1.43276 + notImplemented('LocalConnection.isPerUser');
1.43277 + return this._isPerUser;
1.43278 + },
1.43279 + set: function isPerUser(newValue) {
1.43280 + notImplemented('LocalConnection.isPerUser');
1.43281 + this._isPerUser = newValue;
1.43282 + }
1.43283 + }
1.43284 + }
1.43285 + }
1.43286 + }
1.43287 + };
1.43288 + }.call(this);
1.43289 +var NetConnectionDefinition = function () {
1.43290 + var defaultObjectEncoding = 3;
1.43291 + return {
1.43292 + __class__: 'flash.net.NetConnection',
1.43293 + initialize: function () {
1.43294 + TelemetryService.reportTelemetry({
1.43295 + topic: 'feature',
1.43296 + feature: NETCONNECTION_FEATURE
1.43297 + });
1.43298 + },
1.43299 + _invoke: function (index, args) {
1.43300 + var simulated = false, result;
1.43301 + switch (index) {
1.43302 + case 2:
1.43303 + simulated = true;
1.43304 + break;
1.43305 + }
1.43306 + (simulated ? somewhatImplemented : notImplemented)('NetConnection._invoke (' + index + ')');
1.43307 + return result;
1.43308 + },
1.43309 + __glue__: {
1.43310 + native: {
1.43311 + static: {
1.43312 + defaultObjectEncoding: {
1.43313 + get: function defaultObjectEncoding() {
1.43314 + return defaultObjectEncoding;
1.43315 + },
1.43316 + set: function defaultObjectEncoding(version) {
1.43317 + somewhatImplemented('NetConnection.defaultObjectEncoding');
1.43318 + return defaultObjectEncoding;
1.43319 + }
1.43320 + }
1.43321 + },
1.43322 + instance: {
1.43323 + ctor: function ctor() {
1.43324 + this._uri = null;
1.43325 + this._connected = false;
1.43326 + this._client = null;
1.43327 + this._proxyType = 'none';
1.43328 + this._objectEncoding = defaultObjectEncoding;
1.43329 + },
1.43330 + connect: function connect(command) {
1.43331 + var NetStatusEvent = flash.events.NetStatusEvent;
1.43332 + somewhatImplemented('NetConnection.connect');
1.43333 + this._uri = command;
1.43334 + if (!command) {
1.43335 + this._connected = true;
1.43336 + this._dispatchEvent(new NetStatusEvent(NetStatusEvent.class.NET_STATUS, false, false, wrapJSObject({
1.43337 + level: 'status',
1.43338 + code: 'NetConnection.Connect.Success'
1.43339 + })));
1.43340 + } else {
1.43341 + this._dispatchEvent(new NetStatusEvent(NetStatusEvent.class.NET_STATUS, false, false, wrapJSObject({
1.43342 + level: 'status',
1.43343 + code: 'NetConnection.Connect.Failed'
1.43344 + })));
1.43345 + }
1.43346 + },
1.43347 + call: function call(command, responder) {
1.43348 + notImplemented('NetConnection.call');
1.43349 + },
1.43350 + connected: {
1.43351 + get: function connected() {
1.43352 + return this._connected;
1.43353 + }
1.43354 + },
1.43355 + uri: {
1.43356 + get: function uri() {
1.43357 + return this._uri;
1.43358 + }
1.43359 + },
1.43360 + client: {
1.43361 + get: function client() {
1.43362 + return this._client;
1.43363 + },
1.43364 + set: function client(object) {
1.43365 + this._client = object;
1.43366 + }
1.43367 + },
1.43368 + objectEncoding: {
1.43369 + get: function objectEncoding() {
1.43370 + return this._objectEncoding;
1.43371 + },
1.43372 + set: function objectEncoding(version) {
1.43373 + somewhatImplemented('NetConnection.objectEncoding');
1.43374 + this._objectEncoding = version;
1.43375 + }
1.43376 + },
1.43377 + proxyType: {
1.43378 + get: function proxyType() {
1.43379 + return this._proxyType;
1.43380 + },
1.43381 + set: function proxyType(ptype) {
1.43382 + notImplemented('NetConnection.proxyType');
1.43383 + this._proxyType = ptype;
1.43384 + }
1.43385 + },
1.43386 + connectedProxyType: {
1.43387 + get: function connectedProxyType() {
1.43388 + notImplemented('NetConnection.connectedProxyType');
1.43389 + return this._connectedProxyType;
1.43390 + }
1.43391 + },
1.43392 + usingTLS: {
1.43393 + get: function usingTLS() {
1.43394 + somewhatImplemented('NetConnection.usingTLS');
1.43395 + return false;
1.43396 + }
1.43397 + },
1.43398 + protocol: {
1.43399 + get: function protocol() {
1.43400 + notImplemented('NetConnection.protocol');
1.43401 + return this._protocol;
1.43402 + }
1.43403 + },
1.43404 + maxPeerConnections: {
1.43405 + get: function maxPeerConnections() {
1.43406 + notImplemented('NetConnection.maxPeerConnections');
1.43407 + return this._maxPeerConnections;
1.43408 + },
1.43409 + set: function maxPeerConnections(maxPeers) {
1.43410 + notImplemented('NetConnection.maxPeerConnections');
1.43411 + this._maxPeerConnections = maxPeers;
1.43412 + }
1.43413 + },
1.43414 + nearID: {
1.43415 + get: function nearID() {
1.43416 + notImplemented('NetConnection.nearID');
1.43417 + return this._nearID;
1.43418 + }
1.43419 + },
1.43420 + farID: {
1.43421 + get: function farID() {
1.43422 + notImplemented('NetConnection.farID');
1.43423 + return this._farID;
1.43424 + }
1.43425 + },
1.43426 + nearNonce: {
1.43427 + get: function nearNonce() {
1.43428 + notImplemented('NetConnection.nearNonce');
1.43429 + return this._nearNonce;
1.43430 + }
1.43431 + },
1.43432 + farNonce: {
1.43433 + get: function farNonce() {
1.43434 + notImplemented('NetConnection.farNonce');
1.43435 + return this._farNonce;
1.43436 + }
1.43437 + },
1.43438 + unconnectedPeerStreams: {
1.43439 + get: function unconnectedPeerStreams() {
1.43440 + notImplemented('NetConnection.unconnectedPeerStreams');
1.43441 + return this._unconnectedPeerStreams;
1.43442 + }
1.43443 + },
1.43444 + invoke: function invokeWithArgsArray(index) {
1.43445 + return this._invoke(index, Array.prototype.slice.call(arguments, 1));
1.43446 + },
1.43447 + invokeWithArgsArray: function invokeWithArgsArray(index, p_arguments) {
1.43448 + return this._invoke.call(this, index, p_arguments);
1.43449 + }
1.43450 + }
1.43451 + }
1.43452 + }
1.43453 + };
1.43454 + }.call(this);
1.43455 +var USE_MEDIASOURCE_API = false;
1.43456 +var NetStreamDefinition = function () {
1.43457 + return {
1.43458 + __class__: 'flash.net.NetStream',
1.43459 + initialize: function () {
1.43460 + },
1.43461 + _invoke: function (index, args) {
1.43462 + var simulated = false, result;
1.43463 + var videoElement = this._videoElement;
1.43464 + switch (index) {
1.43465 + case 4:
1.43466 + this._videoState.bufferTime = args[0];
1.43467 + simulated = true;
1.43468 + break;
1.43469 + case 202:
1.43470 + switch (args[1]) {
1.43471 + case 'pause':
1.43472 + simulated = true;
1.43473 + if (videoElement) {
1.43474 + if (args[3] !== false && !videoElement.paused) {
1.43475 + videoElement.pause();
1.43476 + } else if (args[3] !== true && videoElement.paused) {
1.43477 + videoElement.play();
1.43478 + }
1.43479 + videoElement.currentTime = args[4] / 1000;
1.43480 + }
1.43481 + break;
1.43482 + case 'seek':
1.43483 + simulated = true;
1.43484 + if (videoElement && !videoElement.paused) {
1.43485 + videoElement.currentTime = args[3] / 1000;
1.43486 + }
1.43487 + break;
1.43488 + }
1.43489 + break;
1.43490 + case 300:
1.43491 + result = videoElement ? videoElement.currentTime : 0;
1.43492 + simulated = true;
1.43493 + break;
1.43494 + case 302:
1.43495 + result = this._videoState.bufferTime;
1.43496 + simulated = true;
1.43497 + break;
1.43498 + case 303:
1.43499 + result = videoElement ? videoElement.duration : 0;
1.43500 + simulated = true;
1.43501 + break;
1.43502 + case 305:
1.43503 + result = this._videoState.buffer === 'full' ? 100 : this._videoState.buffer === 'progress' ? 50 : 0;
1.43504 + simulated = true;
1.43505 + break;
1.43506 + case 306:
1.43507 + result = 100;
1.43508 + simulated = true;
1.43509 + break;
1.43510 + }
1.43511 + (simulated ? somewhatImplemented : notImplemented)('NetStream._invoke (' + index + ')');
1.43512 + return result;
1.43513 + },
1.43514 + _createVideoElement: function (url) {
1.43515 + function notifyPlayStart(e) {
1.43516 + if (netStream._videoState.started) {
1.43517 + return;
1.43518 + }
1.43519 + netStream._videoState.started = true;
1.43520 + netStream._dispatchEvent(new NetStatusEvent(NetStatusEvent.class.NET_STATUS, false, false, wrapJSObject({
1.43521 + code: 'NetStream.Play.Start',
1.43522 + level: 'status'
1.43523 + })));
1.43524 + }
1.43525 + function notifyPlayStop(e) {
1.43526 + netStream._videoState.started = false;
1.43527 + netStream._dispatchEvent(new NetStatusEvent(NetStatusEvent.class.NET_STATUS, false, false, wrapJSObject({
1.43528 + code: 'NetStream.Play.Stop',
1.43529 + level: 'status'
1.43530 + })));
1.43531 + }
1.43532 + function notifyBufferFull(e) {
1.43533 + netStream._videoState.buffer = 'full';
1.43534 + netStream._dispatchEvent(new NetStatusEvent(NetStatusEvent.class.NET_STATUS, false, false, wrapJSObject({
1.43535 + code: 'NetStream.Buffer.Full',
1.43536 + level: 'status'
1.43537 + })));
1.43538 + }
1.43539 + function notifyProgress(e) {
1.43540 + netStream._videoState.buffer = 'progress';
1.43541 + }
1.43542 + function notifyBufferEmpty(e) {
1.43543 + netStream._videoState.buffer = 'empty';
1.43544 + netStream._dispatchEvent(new NetStatusEvent(NetStatusEvent.class.NET_STATUS, false, false, wrapJSObject({
1.43545 + code: 'NetStream.Buffer.Empty',
1.43546 + level: 'status'
1.43547 + })));
1.43548 + }
1.43549 + function notifyError(e) {
1.43550 + var code = e.target.error.code === 4 ? 'NetStream.Play.NoSupportedTrackFound' : e.target.error.code === 3 ? 'NetStream.Play.FileStructureInvalid' : 'NetStream.Play.StreamNotFound';
1.43551 + netStream._dispatchEvent(new NetStatusEvent(NetStatusEvent.class.NET_STATUS, false, false, wrapJSObject({
1.43552 + code: code,
1.43553 + level: 'error'
1.43554 + })));
1.43555 + }
1.43556 + function notifyMetadata(e) {
1.43557 + netStream._videoMetadataReady.resolve({
1.43558 + videoWidth: element.videoWidth,
1.43559 + videoHeight: element.videoHeight
1.43560 + });
1.43561 + if (netStream._client) {
1.43562 + var data = {};
1.43563 + data.asSetPublicProperty('width', element.videoWidth);
1.43564 + data.asSetPublicProperty('height', element.videoHeight);
1.43565 + data.asSetPublicProperty('duration', element.duration);
1.43566 + netStream._client.asCallPublicProperty('onMetaData', [
1.43567 + data
1.43568 + ]);
1.43569 + }
1.43570 + }
1.43571 + var NetStatusEvent = flash.events.NetStatusEvent;
1.43572 + var netStream = this;
1.43573 + if (/\.mp4$/i.test(url) && /Intel Mac OS X.*?Firefox\/\d+/.test(window.navigator.userAgent)) {
1.43574 + url = 'http://videos-cdn.mozilla.net/brand/Mozilla_2011_Story.webm';
1.43575 + }
1.43576 + var element = document.createElement('video');
1.43577 + element.preload = 'metadata';
1.43578 + element.src = url;
1.43579 + element.addEventListener('play', notifyPlayStart);
1.43580 + element.addEventListener('ended', notifyPlayStop);
1.43581 + element.addEventListener('loadeddata', notifyBufferFull);
1.43582 + element.addEventListener('progress', notifyProgress);
1.43583 + element.addEventListener('waiting', notifyBufferEmpty);
1.43584 + element.addEventListener('loadedmetadata', notifyMetadata);
1.43585 + element.addEventListener('error', notifyError);
1.43586 + element.play();
1.43587 + this._videoElement = element;
1.43588 + this._videoReady.resolve(element);
1.43589 + },
1.43590 + __glue__: {
1.43591 + script: {
1.43592 + instance: scriptProperties('public', [
1.43593 + 'appendBytes',
1.43594 + 'appendBytesAction'
1.43595 + ])
1.43596 + },
1.43597 + native: {
1.43598 + static: {},
1.43599 + instance: {
1.43600 + ctor: function ctor(connection, peerID) {
1.43601 + somewhatImplemented('NetStream.ctor');
1.43602 + this._contentTypeHint = null;
1.43603 + this._mediaSource = null;
1.43604 + this._checkPolicyFile = true;
1.43605 + this._videoElement = null;
1.43606 + var videoReadyResolve, videoReadyReject;
1.43607 + this._videoReady = new Promise(function (resolve, reject) {
1.43608 + videoReadyResolve = resolve;
1.43609 + videoReadyReject = reject;
1.43610 + });
1.43611 + this._videoReady.resolve = videoReadyResolve;
1.43612 + this._videoReady.reject = videoReadyReject;
1.43613 + var videoMetadataReadyResolve, videoMetadataReadyReject;
1.43614 + this._videoMetadataReady = new Promise(function (resolve, reject) {
1.43615 + videoMetadataReadyResolve = resolve;
1.43616 + videoMetadataReadyReject = reject;
1.43617 + });
1.43618 + this._videoMetadataReady.resolve = videoMetadataReadyResolve;
1.43619 + this._videoMetadataReady.reject = videoMetadataReadyReject;
1.43620 + this._videoState = {
1.43621 + started: false,
1.43622 + buffer: 'empty',
1.43623 + bufferTime: 0.1
1.43624 + };
1.43625 + },
1.43626 + onResult: function onResult(streamId) {
1.43627 + notImplemented('NetStream.onResult');
1.43628 + },
1.43629 + dispose: function dispose() {
1.43630 + notImplemented('NetStream.dispose');
1.43631 + },
1.43632 + play: function play(url) {
1.43633 + var isMediaSourceEnabled = USE_MEDIASOURCE_API;
1.43634 + if (isMediaSourceEnabled && typeof MediaSource === 'undefined') {
1.43635 + console.warn('MediaSource API is not enabled, falling back to regular playback');
1.43636 + isMediaSourceEnabled = false;
1.43637 + }
1.43638 + if (!isMediaSourceEnabled) {
1.43639 + somewhatImplemented('NetStream.play');
1.43640 + this._createVideoElement(FileLoadingService.resolveUrl(url));
1.43641 + return;
1.43642 + }
1.43643 + var mediaSource = new MediaSource();
1.43644 + mediaSource.addEventListener('sourceopen', function (e) {
1.43645 + this._mediaSource = mediaSource;
1.43646 + }.bind(this));
1.43647 + mediaSource.addEventListener('sourceend', function (e) {
1.43648 + this._mediaSource = null;
1.43649 + }.bind(this));
1.43650 + this._createVideoElement(window.URL.createObjectURL(mediaSource));
1.43651 + if (!url) {
1.43652 + return;
1.43653 + }
1.43654 + var request = new flash.net.URLRequest(url);
1.43655 + request._checkPolicyFile = this._checkPolicyFile;
1.43656 + var stream = new flash.net.URLStream();
1.43657 + stream._addEventListener('httpStatus', function (e) {
1.43658 + var responseHeaders = e.asGetPublicProperty('responseHeaders');
1.43659 + var contentTypeHeader = responseHeaders.filter(function (h) {
1.43660 + return h.asGetPublicProperty('name') === 'Content-Type';
1.43661 + })[0];
1.43662 + if (contentTypeHeader && contentTypeHeader.asGetPublicProperty('value') !== 'application/octet-stream') {
1.43663 + this._contentTypeHint = contentTypeHeader.asGetPublicProperty('value');
1.43664 + }
1.43665 + }.bind(this));
1.43666 + stream._addEventListener('progress', function (e) {
1.43667 + var available = stream.bytesAvailable;
1.43668 + var ByteArrayClass = avm2.systemDomain.getClass('flash.utils.ByteArray');
1.43669 + var data = ByteArrayClass.createInstance();
1.43670 + stream.readBytes(data, 0, available);
1.43671 + this.appendBytes(data);
1.43672 + }.bind(this));
1.43673 + stream._addEventListener('complete', function (e) {
1.43674 + this.appendBytesAction('endSequence');
1.43675 + }.bind(this));
1.43676 + stream.load(request);
1.43677 + },
1.43678 + play2: function play2(param) {
1.43679 + notImplemented('NetStream.play2');
1.43680 + },
1.43681 + invoke: function invoke(index) {
1.43682 + return this._invoke(index, Array.prototype.slice.call(arguments, 1));
1.43683 + },
1.43684 + invokeWithArgsArray: function invokeWithArgsArray(index, p_arguments) {
1.43685 + return this._invoke.call(this, index, p_arguments);
1.43686 + },
1.43687 + appendBytes: function appendBytes(bytes) {
1.43688 + if (this._mediaSource) {
1.43689 + if (!this._mediaSourceBuffer) {
1.43690 + this._mediaSourceBuffer = this._mediaSource.addSourceBuffer(this._contentTypeHint);
1.43691 + }
1.43692 + this._mediaSourceBuffer.appendBuffer(new Uint8Array(bytes.a, 0, bytes.length));
1.43693 + }
1.43694 + somewhatImplemented('NetStream.appendBytes');
1.43695 + },
1.43696 + appendBytesAction: function appendBytesAction(netStreamAppendBytesAction) {
1.43697 + if (netStreamAppendBytesAction === 'endSequence' && this._mediaSource) {
1.43698 + this._mediaSource.endOfStream();
1.43699 + }
1.43700 + somewhatImplemented('NetStream.appendBytesAction');
1.43701 + },
1.43702 + info: {
1.43703 + get: function info() {
1.43704 + notImplemented('NetStream.info');
1.43705 + return this._info;
1.43706 + }
1.43707 + },
1.43708 + multicastInfo: {
1.43709 + get: function multicastInfo() {
1.43710 + notImplemented('NetStream.multicastInfo');
1.43711 + return this._multicastInfo;
1.43712 + }
1.43713 + },
1.43714 + soundTransform: {
1.43715 + get: function soundTransform() {
1.43716 + return this._soundTransform;
1.43717 + },
1.43718 + set: function soundTransform(sndTransform) {
1.43719 + somewhatImplemented('NetStream.soundTransform');
1.43720 + this._soundTransform = sndTransform;
1.43721 + }
1.43722 + },
1.43723 + checkPolicyFile: {
1.43724 + get: function checkPolicyFile() {
1.43725 + return this._checkPolicyFile;
1.43726 + },
1.43727 + set: function checkPolicyFile(state) {
1.43728 + this._checkPolicyFile = state;
1.43729 + }
1.43730 + },
1.43731 + client: {
1.43732 + get: function client() {
1.43733 + somewhatImplemented('NetStream.client');
1.43734 + return this._client;
1.43735 + },
1.43736 + set: function client(object) {
1.43737 + somewhatImplemented('NetStream.client');
1.43738 + this._client = object;
1.43739 + }
1.43740 + },
1.43741 + objectEncoding: {
1.43742 + get: function objectEncoding() {
1.43743 + notImplemented('NetStream.objectEncoding');
1.43744 + return this._objectEncoding;
1.43745 + }
1.43746 + },
1.43747 + multicastPushNeighborLimit: {
1.43748 + get: function multicastPushNeighborLimit() {
1.43749 + notImplemented('NetStream.multicastPushNeighborLimit');
1.43750 + return this._multicastPushNeighborLimit;
1.43751 + },
1.43752 + set: function multicastPushNeighborLimit(neighbors) {
1.43753 + notImplemented('NetStream.multicastPushNeighborLimit');
1.43754 + this._multicastPushNeighborLimit = neighbors;
1.43755 + }
1.43756 + },
1.43757 + multicastWindowDuration: {
1.43758 + get: function multicastWindowDuration() {
1.43759 + notImplemented('NetStream.multicastWindowDuration');
1.43760 + return this._multicastWindowDuration;
1.43761 + },
1.43762 + set: function multicastWindowDuration(seconds) {
1.43763 + notImplemented('NetStream.multicastWindowDuration');
1.43764 + this._multicastWindowDuration = seconds;
1.43765 + }
1.43766 + },
1.43767 + multicastRelayMarginDuration: {
1.43768 + get: function multicastRelayMarginDuration() {
1.43769 + notImplemented('NetStream.multicastRelayMarginDuration');
1.43770 + return this._multicastRelayMarginDuration;
1.43771 + },
1.43772 + set: function multicastRelayMarginDuration(seconds) {
1.43773 + notImplemented('NetStream.multicastRelayMarginDuration');
1.43774 + this._multicastRelayMarginDuration = seconds;
1.43775 + }
1.43776 + },
1.43777 + multicastAvailabilityUpdatePeriod: {
1.43778 + get: function multicastAvailabilityUpdatePeriod() {
1.43779 + notImplemented('NetStream.multicastAvailabilityUpdatePeriod');
1.43780 + return this._multicastAvailabilityUpdatePeriod;
1.43781 + },
1.43782 + set: function multicastAvailabilityUpdatePeriod(seconds) {
1.43783 + notImplemented('NetStream.multicastAvailabilityUpdatePeriod');
1.43784 + this._multicastAvailabilityUpdatePeriod = seconds;
1.43785 + }
1.43786 + },
1.43787 + multicastFetchPeriod: {
1.43788 + get: function multicastFetchPeriod() {
1.43789 + notImplemented('NetStream.multicastFetchPeriod');
1.43790 + return this._multicastFetchPeriod;
1.43791 + },
1.43792 + set: function multicastFetchPeriod(seconds) {
1.43793 + notImplemented('NetStream.multicastFetchPeriod');
1.43794 + this._multicastFetchPeriod = seconds;
1.43795 + }
1.43796 + },
1.43797 + multicastAvailabilitySendToAll: {
1.43798 + get: function multicastAvailabilitySendToAll() {
1.43799 + notImplemented('NetStream.multicastAvailabilitySendToAll');
1.43800 + return this._multicastAvailabilitySendToAll;
1.43801 + },
1.43802 + set: function multicastAvailabilitySendToAll(value) {
1.43803 + notImplemented('NetStream.multicastAvailabilitySendToAll');
1.43804 + this._multicastAvailabilitySendToAll = value;
1.43805 + }
1.43806 + },
1.43807 + farID: {
1.43808 + get: function farID() {
1.43809 + notImplemented('NetStream.farID');
1.43810 + return this._farID;
1.43811 + }
1.43812 + },
1.43813 + nearNonce: {
1.43814 + get: function nearNonce() {
1.43815 + notImplemented('NetStream.nearNonce');
1.43816 + return this._nearNonce;
1.43817 + }
1.43818 + },
1.43819 + farNonce: {
1.43820 + get: function farNonce() {
1.43821 + notImplemented('NetStream.farNonce');
1.43822 + return this._farNonce;
1.43823 + }
1.43824 + },
1.43825 + peerStreams: {
1.43826 + get: function peerStreams() {
1.43827 + notImplemented('NetStream.peerStreams');
1.43828 + return this._peerStreams;
1.43829 + }
1.43830 + },
1.43831 + audioReliable: {
1.43832 + get: function audioReliable() {
1.43833 + notImplemented('NetStream.audioReliable');
1.43834 + return this._audioReliable;
1.43835 + },
1.43836 + set: function audioReliable(reliable) {
1.43837 + notImplemented('NetStream.audioReliable');
1.43838 + this._audioReliable = reliable;
1.43839 + }
1.43840 + },
1.43841 + videoReliable: {
1.43842 + get: function videoReliable() {
1.43843 + notImplemented('NetStream.videoReliable');
1.43844 + return this._videoReliable;
1.43845 + },
1.43846 + set: function videoReliable(reliable) {
1.43847 + notImplemented('NetStream.videoReliable');
1.43848 + this._videoReliable = reliable;
1.43849 + }
1.43850 + },
1.43851 + dataReliable: {
1.43852 + get: function dataReliable() {
1.43853 + notImplemented('NetStream.dataReliable');
1.43854 + return this._dataReliable;
1.43855 + },
1.43856 + set: function dataReliable(reliable) {
1.43857 + notImplemented('NetStream.dataReliable');
1.43858 + this._dataReliable = reliable;
1.43859 + }
1.43860 + },
1.43861 + audioSampleAccess: {
1.43862 + get: function audioSampleAccess() {
1.43863 + notImplemented('NetStream.audioSampleAccess');
1.43864 + return this._audioSampleAccess;
1.43865 + },
1.43866 + set: function audioSampleAccess(reliable) {
1.43867 + notImplemented('NetStream.audioSampleAccess');
1.43868 + this._audioSampleAccess = reliable;
1.43869 + }
1.43870 + },
1.43871 + videoSampleAccess: {
1.43872 + get: function videoSampleAccess() {
1.43873 + notImplemented('NetStream.videoSampleAccess');
1.43874 + return this._videoSampleAccess;
1.43875 + },
1.43876 + set: function videoSampleAccess(reliable) {
1.43877 + notImplemented('NetStream.videoSampleAccess');
1.43878 + this._videoSampleAccess = reliable;
1.43879 + }
1.43880 + },
1.43881 + useHardwareDecoder: {
1.43882 + get: function useHardwareDecoder() {
1.43883 + notImplemented('NetStream.useHardwareDecoder');
1.43884 + return this._useHardwareDecoder;
1.43885 + },
1.43886 + set: function useHardwareDecoder(v) {
1.43887 + notImplemented('NetStream.useHardwareDecoder');
1.43888 + this._useHardwareDecoder = v;
1.43889 + }
1.43890 + },
1.43891 + useJitterBuffer: {
1.43892 + get: function useJitterBuffer() {
1.43893 + notImplemented('NetStream.useJitterBuffer');
1.43894 + return this._useJitterBuffer;
1.43895 + },
1.43896 + set: function useJitterBuffer(value) {
1.43897 + notImplemented('NetStream.useJitterBuffer');
1.43898 + this._useJitterBuffer = value;
1.43899 + }
1.43900 + },
1.43901 + videoStreamSettings: {
1.43902 + get: function videoStreamSettings() {
1.43903 + notImplemented('NetStream.videoStreamSettings');
1.43904 + return this._videoStreamSettings;
1.43905 + },
1.43906 + set: function videoStreamSettings(settings) {
1.43907 + notImplemented('NetStream.videoStreamSettings');
1.43908 + this._videoStreamSettings = settings;
1.43909 + }
1.43910 + }
1.43911 + }
1.43912 + }
1.43913 + }
1.43914 + };
1.43915 + }.call(this);
1.43916 +var ObjectEncodingDefinition = function () {
1.43917 + return {
1.43918 + __class__: 'flash.net.ObjectEncoding',
1.43919 + initialize: function () {
1.43920 + },
1.43921 + __glue__: {
1.43922 + native: {
1.43923 + static: {
1.43924 + dynamicPropertyWriter: {
1.43925 + get: function dynamicPropertyWriter() {
1.43926 + notImplemented('ObjectEncoding.dynamicPropertyWriter');
1.43927 + },
1.43928 + set: function dynamicPropertyWriter(object) {
1.43929 + notImplemented('ObjectEncoding.dynamicPropertyWriter');
1.43930 + }
1.43931 + }
1.43932 + },
1.43933 + instance: {}
1.43934 + }
1.43935 + }
1.43936 + };
1.43937 + }.call(this);
1.43938 +var ResponderDefinition = function () {
1.43939 + var def = {
1.43940 + ctor: function (result, status) {
1.43941 + }
1.43942 + };
1.43943 + def.__glue__ = {
1.43944 + native: {
1.43945 + instance: {
1.43946 + ctor: def.ctor
1.43947 + }
1.43948 + }
1.43949 + };
1.43950 + return def;
1.43951 + }.call(this);
1.43952 +var SharedObjectDefinition = function () {
1.43953 + var _defaultObjectEncoding = 3;
1.43954 + var sharedObjects = createEmptyObject();
1.43955 + function invokeWithArgsArray(index, args) {
1.43956 + var simulated = false, result;
1.43957 + switch (index) {
1.43958 + case 4:
1.43959 + result = JSON.stringify(this._data).length - 2;
1.43960 + simulated = true;
1.43961 + break;
1.43962 + case 6:
1.43963 + this._data = {};
1.43964 + sessionStorage.removeItem(this._path);
1.43965 + simulated = true;
1.43966 + break;
1.43967 + case 2:
1.43968 + sessionStorage.setItem(this._path, JSON.stringify(this._data));
1.43969 + simulated = true;
1.43970 + result = true;
1.43971 + break;
1.43972 + case 3:
1.43973 + simulated = true;
1.43974 + break;
1.43975 + }
1.43976 + (simulated ? somewhatImplemented : notImplemented)('SharedObject.invoke (' + index + ')');
1.43977 + return result;
1.43978 + }
1.43979 + return {
1.43980 + __class__: 'flash.net.SharedObject',
1.43981 + initialize: function () {
1.43982 + this._path = null;
1.43983 + this._data = null;
1.43984 + this._objectEncoding = _defaultObjectEncoding;
1.43985 + TelemetryService.reportTelemetry({
1.43986 + topic: 'feature',
1.43987 + feature: SHAREDOBJECT_FEATURE
1.43988 + });
1.43989 + },
1.43990 + __glue__: {
1.43991 + native: {
1.43992 + static: {
1.43993 + deleteAll: function deleteAll(url) {
1.43994 + notImplemented('SharedObject.deleteAll');
1.43995 + },
1.43996 + getDiskUsage: function getDiskUsage(url) {
1.43997 + notImplemented('SharedObject.getDiskUsage');
1.43998 + },
1.43999 + getLocal: function getLocal(name, localPath, secure) {
1.44000 + var path = (localPath || '') + '/' + name;
1.44001 + if (sharedObjects[path]) {
1.44002 + return sharedObjects[path];
1.44003 + }
1.44004 + var so = new flash.net.SharedObject();
1.44005 + so._path = path;
1.44006 + var data = sessionStorage.getItem(path);
1.44007 + so._data = data ? JSON.parse(data) : {};
1.44008 + return so;
1.44009 + },
1.44010 + getRemote: function getRemote(name, remotePath, persistence, secure) {
1.44011 + notImplemented('SharedObject.getRemote');
1.44012 + },
1.44013 + defaultObjectEncoding: {
1.44014 + get: function defaultObjectEncoding() {
1.44015 + return _defaultObjectEncoding;
1.44016 + },
1.44017 + set: function defaultObjectEncoding(version) {
1.44018 + _defaultObjectEncoding = version;
1.44019 + }
1.44020 + }
1.44021 + },
1.44022 + instance: {
1.44023 + setDirty: function setDirty(propertyName) {
1.44024 + somewhatImplemented('SharedObject.setDirty');
1.44025 + },
1.44026 + invoke: function invoke(index) {
1.44027 + return invokeWithArgsArray.call(this, index, Array.prototype.slice.call(arguments, 1));
1.44028 + },
1.44029 + invokeWithArgsArray: function invokeWithArgsArray(index, args) {
1.44030 + return invokeWithArgsArray.call(this, index, args);
1.44031 + },
1.44032 + data: {
1.44033 + get: function data() {
1.44034 + return this._data;
1.44035 + }
1.44036 + },
1.44037 + objectEncoding: {
1.44038 + get: function objectEncoding() {
1.44039 + return this._objectEncoding;
1.44040 + },
1.44041 + set: function objectEncoding(version) {
1.44042 + this._objectEncoding = version;
1.44043 + }
1.44044 + },
1.44045 + client: {
1.44046 + get: function client() {
1.44047 + notImplemented('SharedObject.client');
1.44048 + return this._client;
1.44049 + },
1.44050 + set: function client(object) {
1.44051 + notImplemented('SharedObject.client');
1.44052 + this._client = object;
1.44053 + }
1.44054 + }
1.44055 + }
1.44056 + }
1.44057 + }
1.44058 + };
1.44059 + }.call(this);
1.44060 +var SocketDefinition = function () {
1.44061 + return {
1.44062 + __class__: 'flash.net.Socket',
1.44063 + initialize: function () {
1.44064 + this._connected = false;
1.44065 + },
1.44066 + __glue__: {
1.44067 + native: {
1.44068 + static: {},
1.44069 + instance: {
1.44070 + internalGetSecurityErrorMessage: function internalGetSecurityErrorMessage(host, port) {
1.44071 + somewhatImplemented('Socket.internalGetSecurityErrorMessage');
1.44072 + return 'SecurityErrorEvent';
1.44073 + },
1.44074 + internalConnect: function internalConnect(host, port) {
1.44075 + somewhatImplemented('Socket.internalConnect');
1.44076 + throwError('SecurityError', Errors.SocketConnectError, host, port);
1.44077 + },
1.44078 + didFailureOccur: function didFailureOccur() {
1.44079 + somewhatImplemented('Socket.didFailureOccur');
1.44080 + return true;
1.44081 + },
1.44082 + readBytes: function readBytes(bytes, offset, length) {
1.44083 + notImplemented('Socket.readBytes');
1.44084 + },
1.44085 + writeBytes: function writeBytes(bytes, offset, length) {
1.44086 + notImplemented('Socket.writeBytes');
1.44087 + },
1.44088 + writeBoolean: function writeBoolean(value) {
1.44089 + notImplemented('Socket.writeBoolean');
1.44090 + },
1.44091 + writeByte: function writeByte(value) {
1.44092 + notImplemented('Socket.writeByte');
1.44093 + },
1.44094 + writeShort: function writeShort(value) {
1.44095 + notImplemented('Socket.writeShort');
1.44096 + },
1.44097 + writeInt: function writeInt(value) {
1.44098 + notImplemented('Socket.writeInt');
1.44099 + },
1.44100 + writeUnsignedInt: function writeUnsignedInt(value) {
1.44101 + notImplemented('Socket.writeUnsignedInt');
1.44102 + },
1.44103 + writeFloat: function writeFloat(value) {
1.44104 + notImplemented('Socket.writeFloat');
1.44105 + },
1.44106 + writeDouble: function writeDouble(value) {
1.44107 + notImplemented('Socket.writeDouble');
1.44108 + },
1.44109 + writeMultiByte: function writeMultiByte(value, charSet) {
1.44110 + notImplemented('Socket.writeMultiByte');
1.44111 + },
1.44112 + writeUTF: function writeUTF(value) {
1.44113 + notImplemented('Socket.writeUTF');
1.44114 + },
1.44115 + writeUTFBytes: function writeUTFBytes(value) {
1.44116 + notImplemented('Socket.writeUTFBytes');
1.44117 + },
1.44118 + readBoolean: function readBoolean() {
1.44119 + notImplemented('Socket.readBoolean');
1.44120 + },
1.44121 + readByte: function readByte() {
1.44122 + notImplemented('Socket.readByte');
1.44123 + },
1.44124 + readUnsignedByte: function readUnsignedByte() {
1.44125 + notImplemented('Socket.readUnsignedByte');
1.44126 + },
1.44127 + readShort: function readShort() {
1.44128 + notImplemented('Socket.readShort');
1.44129 + },
1.44130 + readUnsignedShort: function readUnsignedShort() {
1.44131 + notImplemented('Socket.readUnsignedShort');
1.44132 + },
1.44133 + readInt: function readInt() {
1.44134 + notImplemented('Socket.readInt');
1.44135 + },
1.44136 + readUnsignedInt: function readUnsignedInt() {
1.44137 + notImplemented('Socket.readUnsignedInt');
1.44138 + },
1.44139 + readFloat: function readFloat() {
1.44140 + notImplemented('Socket.readFloat');
1.44141 + },
1.44142 + readDouble: function readDouble() {
1.44143 + notImplemented('Socket.readDouble');
1.44144 + },
1.44145 + readMultiByte: function readMultiByte(length, charSet) {
1.44146 + notImplemented('Socket.readMultiByte');
1.44147 + },
1.44148 + readUTF: function readUTF() {
1.44149 + notImplemented('Socket.readUTF');
1.44150 + },
1.44151 + readUTFBytes: function readUTFBytes(length) {
1.44152 + notImplemented('Socket.readUTFBytes');
1.44153 + },
1.44154 + internalClose: function internalClose() {
1.44155 + notImplemented('Socket.internalClose');
1.44156 + },
1.44157 + flush: function flush() {
1.44158 + notImplemented('Socket.flush');
1.44159 + },
1.44160 + writeObject: function writeObject(object) {
1.44161 + notImplemented('Socket.writeObject');
1.44162 + },
1.44163 + readObject: function readObject() {
1.44164 + notImplemented('Socket.readObject');
1.44165 + },
1.44166 + bytesAvailable: {
1.44167 + get: function bytesAvailable() {
1.44168 + notImplemented('Socket.bytesAvailable');
1.44169 + return this._bytesAvailable;
1.44170 + }
1.44171 + },
1.44172 + connected: {
1.44173 + get: function connected() {
1.44174 + somewhatImplemented('Socket.connected');
1.44175 + return this._connected;
1.44176 + }
1.44177 + },
1.44178 + objectEncoding: {
1.44179 + get: function objectEncoding() {
1.44180 + notImplemented('Socket.objectEncoding');
1.44181 + return this._objectEncoding;
1.44182 + },
1.44183 + set: function objectEncoding(version) {
1.44184 + notImplemented('Socket.objectEncoding');
1.44185 + this._objectEncoding = version;
1.44186 + }
1.44187 + },
1.44188 + endian: {
1.44189 + get: function endian() {
1.44190 + notImplemented('Socket.endian');
1.44191 + return this._endian;
1.44192 + },
1.44193 + set: function endian(type) {
1.44194 + notImplemented('Socket.endian');
1.44195 + this._endian = type;
1.44196 + }
1.44197 + },
1.44198 + bytesPending: {
1.44199 + get: function bytesPending() {
1.44200 + notImplemented('Socket.bytesPending');
1.44201 + return this._bytesPending;
1.44202 + }
1.44203 + }
1.44204 + }
1.44205 + },
1.44206 + script: {
1.44207 + instance: Glue.ALL
1.44208 + }
1.44209 + }
1.44210 + };
1.44211 + }.call(this);
1.44212 +var URLLoaderDefinition = function () {
1.44213 + return {
1.44214 + initialize: function () {
1.44215 + },
1.44216 + __glue__: {
1.44217 + native: {
1.44218 + static: {},
1.44219 + instance: {}
1.44220 + },
1.44221 + script: {
1.44222 + static: {},
1.44223 + instance: {
1.44224 + data: 'public data',
1.44225 + dataFormat: 'public dataFormat',
1.44226 + bytesTotal: 'public bytesTotal',
1.44227 + bytesLoaded: 'public bytesLoaded',
1.44228 + load: 'public load'
1.44229 + }
1.44230 + }
1.44231 + }
1.44232 + };
1.44233 + }.call(this);
1.44234 +var URLRequestDefinition = function () {
1.44235 + function toFileLoadingServiceRequest() {
1.44236 + var obj = {};
1.44237 + obj.url = this._url;
1.44238 + obj.method = this._method;
1.44239 + obj.checkPolicyFile = this._checkPolicyFile;
1.44240 + if (this._data) {
1.44241 + obj.mimeType = this._contentType;
1.44242 + var ByteArrayClass = avm2.systemDomain.getClass('flash.utils.ByteArray');
1.44243 + if (ByteArrayClass.isInstanceOf(this._data)) {
1.44244 + obj.data = new Uint8Array(this._data.a, 0, this._data.length);
1.44245 + } else {
1.44246 + var data = this._data.asGetPublicProperty('toString').call(this._data);
1.44247 + if (this._method === 'GET') {
1.44248 + var i = obj.url.lastIndexOf('?');
1.44249 + obj.url = (i < 0 ? obj.url : obj.url.substring(0, i)) + '?' + data;
1.44250 + } else {
1.44251 + obj.data = data;
1.44252 + }
1.44253 + }
1.44254 + }
1.44255 + return obj;
1.44256 + }
1.44257 + var def = {
1.44258 + initialize: function () {
1.44259 + this._url = null;
1.44260 + this._method = 'GET';
1.44261 + this._data = null;
1.44262 + this._digest = null;
1.44263 + this._contentType = 'application/x-www-form-urlencoded';
1.44264 + this._requestHeaders = null;
1.44265 + this._checkPolicyFile = true;
1.44266 + this._toFileRequest = toFileLoadingServiceRequest;
1.44267 + },
1.44268 + setMethod: function (val) {
1.44269 + this._method = val;
1.44270 + },
1.44271 + setRequestHeaders: function (val) {
1.44272 + this._requestHeaders = val;
1.44273 + },
1.44274 + get contentType() {
1.44275 + return this._contentType;
1.44276 + },
1.44277 + set contentType(val) {
1.44278 + this._contentType = val;
1.44279 + },
1.44280 + get data() {
1.44281 + return this._data;
1.44282 + },
1.44283 + set data(val) {
1.44284 + this._data = val;
1.44285 + },
1.44286 + get digest() {
1.44287 + return this._digest;
1.44288 + },
1.44289 + set digest(val) {
1.44290 + this._digest = val;
1.44291 + },
1.44292 + get method() {
1.44293 + return this._method;
1.44294 + },
1.44295 + set method(method) {
1.44296 + this._method = method;
1.44297 + },
1.44298 + get requestHeaders() {
1.44299 + return this._requestHeaders;
1.44300 + },
1.44301 + set requestHeaders(requestHeaders) {
1.44302 + this._requestHeaders = requestHeaders;
1.44303 + },
1.44304 + get url() {
1.44305 + return this._url;
1.44306 + },
1.44307 + set url(val) {
1.44308 + this._url = val;
1.44309 + }
1.44310 + };
1.44311 + var desc = Object.getOwnPropertyDescriptor;
1.44312 + def.__glue__ = {
1.44313 + native: {
1.44314 + instance: {
1.44315 + setMethod: def.setMethod,
1.44316 + setRequestHeaders: def.setRequestHeaders,
1.44317 + contentType: desc(def, 'contentType'),
1.44318 + data: desc(def, 'data'),
1.44319 + digest: desc(def, 'digest'),
1.44320 + method: desc(def, 'method'),
1.44321 + requestHeaders: desc(def, 'requestHeaders'),
1.44322 + url: desc(def, 'url')
1.44323 + }
1.44324 + }
1.44325 + };
1.44326 + return def;
1.44327 + }.call(this);
1.44328 +var URLStreamDefinition = function () {
1.44329 + var def = {
1.44330 + initialize: function () {
1.44331 + this._stream = null;
1.44332 + this._connected = false;
1.44333 + this._littleEndian = false;
1.44334 + },
1.44335 + close: function close() {
1.44336 + this._session.close();
1.44337 + },
1.44338 + load: function load(request) {
1.44339 + var session = FileLoadingService.createSession();
1.44340 + var self = this;
1.44341 + var initStream = true;
1.44342 + session.onprogress = function (data, progressState) {
1.44343 + if (initStream) {
1.44344 + initStream = false;
1.44345 + var length = Math.max(progressState.bytesTotal, data.length);
1.44346 + var buffer = new ArrayBuffer(length);
1.44347 + self._stream = new Stream(buffer, 0, 0, length);
1.44348 + } else if (self._stream.end + data.length > self._stream.bytes.length) {
1.44349 + var length = self._stream.end + data.length;
1.44350 + var buffer = new ArrayBuffer(length);
1.44351 + var newStream = new Stream(buffer, 0, 0, length);
1.44352 + newStream.push(self._stream.bytes.subarray(0, self._stream.end));
1.44353 + self._stream = newStream;
1.44354 + }
1.44355 + self._stream.push(data);
1.44356 + var ProgressEventClass = avm2.systemDomain.getClass('flash.events.ProgressEvent');
1.44357 + self._dispatchEvent(ProgressEventClass.createInstance([
1.44358 + 'progress',
1.44359 + false,
1.44360 + false,
1.44361 + progressState.bytesLoaded,
1.44362 + progressState.bytesTotal
1.44363 + ]));
1.44364 + };
1.44365 + session.onerror = function (error) {
1.44366 + self._connected = false;
1.44367 + if (!self._stream) {
1.44368 + self._stream = new Stream(new ArrayBuffer(0), 0, 0, 0);
1.44369 + }
1.44370 + self._dispatchEvent(new flash.events.IOErrorEvent(flash.events.IOErrorEvent.class.IO_ERROR, false, false, error));
1.44371 + };
1.44372 + session.onopen = function () {
1.44373 + self._connected = true;
1.44374 + self._dispatchEvent(new flash.events.Event('open', false, false));
1.44375 + };
1.44376 + session.onhttpstatus = function (location, httpStatus, httpHeaders) {
1.44377 + var HTTPStatusEventClass = avm2.systemDomain.getClass('flash.events.HTTPStatusEvent');
1.44378 + var URLRequestHeaderClass = avm2.systemDomain.getClass('flash.net.URLRequestHeader');
1.44379 + var httpStatusEvent = HTTPStatusEventClass.createInstance([
1.44380 + 'httpStatus',
1.44381 + false,
1.44382 + false,
1.44383 + httpStatus
1.44384 + ]);
1.44385 + var headers = [];
1.44386 + httpHeaders.split(/(?:\n|\r?\n)/g).forEach(function (h) {
1.44387 + var m = /^([^:]+): (.*)$/.exec(h);
1.44388 + if (m) {
1.44389 + headers.push(URLRequestHeaderClass.createInstance([
1.44390 + m[1],
1.44391 + m[2]
1.44392 + ]));
1.44393 + if (m[1] === 'Location') {
1.44394 + location = m[2];
1.44395 + }
1.44396 + }
1.44397 + });
1.44398 + httpStatusEvent.asSetPublicProperty('responseHeaders', headers);
1.44399 + httpStatusEvent.asSetPublicProperty('responseURL', location);
1.44400 + self._dispatchEvent(httpStatusEvent);
1.44401 + };
1.44402 + session.onclose = function () {
1.44403 + self._connected = false;
1.44404 + if (!self._stream) {
1.44405 + self._stream = new Stream(new ArrayBuffer(0), 0, 0, 0);
1.44406 + }
1.44407 + self._dispatchEvent(new flash.events.Event('complete', false, false));
1.44408 + };
1.44409 + session.open(request._toFileRequest());
1.44410 + this._session = session;
1.44411 + },
1.44412 + readBoolean: function readBoolean() {
1.44413 + notImplemented('URLStream.readBoolean');
1.44414 + },
1.44415 + readByte: function readByte() {
1.44416 + var stream = this._stream;
1.44417 + stream.ensure(1);
1.44418 + return stream.bytes[stream.pos++];
1.44419 + },
1.44420 + readBytes: function readBytes(bytes, offset, length) {
1.44421 + if (length < 0)
1.44422 + throw 'Invalid length argument';
1.44423 + var stream = this._stream;
1.44424 + if (!length)
1.44425 + length = stream.remaining();
1.44426 + else
1.44427 + stream.ensure(length);
1.44428 + bytes.writeRawBytes(stream.bytes.subarray(stream.pos, stream.pos + length), offset, length);
1.44429 + stream.pos += length;
1.44430 + },
1.44431 + readDouble: function readDouble() {
1.44432 + notImplemented('URLStream.readDouble');
1.44433 + },
1.44434 + readFloat: function readFloat() {
1.44435 + notImplemented('URLStream.readFloat');
1.44436 + },
1.44437 + readInt: function readInt() {
1.44438 + notImplemented('URLStream.readInt');
1.44439 + },
1.44440 + readMultiByte: function readMultiByte(length, charSet) {
1.44441 + notImplemented('URLStream.readMultiByte');
1.44442 + },
1.44443 + readObject: function readObject() {
1.44444 + notImplemented('URLStream.readObject');
1.44445 + },
1.44446 + readShort: function readShort() {
1.44447 + notImplemented('URLStream.readShort');
1.44448 + },
1.44449 + readUTF: function readUTF() {
1.44450 + return this.readUTFBytes(this.readUnsignedShort());
1.44451 + },
1.44452 + readUTFBytes: function readUTFBytes(length) {
1.44453 + if (length < 0)
1.44454 + throw 'Invalid length argument';
1.44455 + var stream = this._stream;
1.44456 + stream.ensure(length);
1.44457 + var str = utf8encode(stream.bytes.subarray(stream.pos, stream.pos + length));
1.44458 + stream.pos += length;
1.44459 + return str;
1.44460 + },
1.44461 + readUnsignedByte: function readUnsignedByte() {
1.44462 + notImplemented('URLStream.readUnsignedByte');
1.44463 + },
1.44464 + readUnsignedInt: function readUnsignedInt() {
1.44465 + notImplemented('URLStream.readUnsignedInt');
1.44466 + },
1.44467 + readUnsignedShort: function readUnsignedShort() {
1.44468 + var stream = this._stream;
1.44469 + stream.ensure(2);
1.44470 + var result = stream.getUint16(stream.pos, this._littleEndian);
1.44471 + stream.pos += 2;
1.44472 + return result;
1.44473 + },
1.44474 + get bytesAvailable() {
1.44475 + return this._stream.remaining();
1.44476 + },
1.44477 + get connected() {
1.44478 + return this._connected;
1.44479 + },
1.44480 + get endian() {
1.44481 + return this._littleEndian ? 'littleEndian' : 'bigEndian';
1.44482 + },
1.44483 + set endian(val) {
1.44484 + this._littleEndian = val == 'littleEndian';
1.44485 + },
1.44486 + get objectEncoding() {
1.44487 + notImplemented('URLStream.objectEncoding');
1.44488 + },
1.44489 + set objectEncoding(val) {
1.44490 + notImplemented('URLStream.objectEncoding');
1.44491 + }
1.44492 + };
1.44493 + var desc = Object.getOwnPropertyDescriptor;
1.44494 + def.__glue__ = {
1.44495 + native: {
1.44496 + instance: {
1.44497 + close: def.close,
1.44498 + load: def.load,
1.44499 + readBoolean: def.readBoolean,
1.44500 + readByte: def.readByte,
1.44501 + readBytes: def.readBytes,
1.44502 + readDouble: def.readDouble,
1.44503 + readFloat: def.readFloat,
1.44504 + readInt: def.readInt,
1.44505 + readMultiByte: def.readMultiByte,
1.44506 + readObject: def.readObject,
1.44507 + readShort: def.readShort,
1.44508 + readUTF: def.readUTF,
1.44509 + readUTFBytes: def.readUTFBytes,
1.44510 + readUnsignedByte: def.readUnsignedByte,
1.44511 + readUnsignedInt: def.readUnsignedInt,
1.44512 + readUnsignedShort: def.readUnsignedShort,
1.44513 + bytesAvailable: desc(def, 'bytesAvailable'),
1.44514 + connected: desc(def, 'connected'),
1.44515 + endian: desc(def, 'endian'),
1.44516 + objectEncoding: desc(def, 'objectEncoding')
1.44517 + }
1.44518 + }
1.44519 + };
1.44520 + return def;
1.44521 + }.call(this);
1.44522 +{
1.44523 + var ApplicationDomainDefinition = function () {
1.44524 + return {
1.44525 + __class__: 'flash.system.ApplicationDomain',
1.44526 + initialize: function () {
1.44527 + },
1.44528 + __glue__: {
1.44529 + native: {
1.44530 + static: {
1.44531 + currentDomain: {
1.44532 + get: function currentDomain() {
1.44533 + return new flash.system.ApplicationDomain(AVM2.currentDomain());
1.44534 + }
1.44535 + },
1.44536 + MIN_DOMAIN_MEMORY_LENGTH: {
1.44537 + get: function MIN_DOMAIN_MEMORY_LENGTH() {
1.44538 + notImplemented('ApplicationDomain.MIN_DOMAIN_MEMORY_LENGTH');
1.44539 + }
1.44540 + }
1.44541 + },
1.44542 + instance: {
1.44543 + ctor: function ctor(parentDomainOrNativeObject) {
1.44544 + if (parentDomainOrNativeObject instanceof ApplicationDomain) {
1.44545 + this.nativeObject = parentDomainOrNativeObject;
1.44546 + return;
1.44547 + }
1.44548 + var parentNativeObject = parentDomainOrNativeObject ? parentDomainOrNativeObject.nativeObject : AVM2.currentDomain().system;
1.44549 + this.nativeObject = new ApplicationDomain(parentNativeObject.vm, parentNativeObject);
1.44550 + },
1.44551 + getDefinition: function getDefinition(name) {
1.44552 + var simpleName = name.replace('::', '.');
1.44553 + return this.nativeObject.getProperty(Multiname.fromSimpleName(simpleName), true, true);
1.44554 + },
1.44555 + hasDefinition: function hasDefinition(name) {
1.44556 + if (name === undefined) {
1.44557 + return false;
1.44558 + }
1.44559 + var simpleName = name.replace('::', '.');
1.44560 + return !(!this.nativeObject.findDomainProperty(Multiname.fromSimpleName(simpleName), false, false));
1.44561 + },
1.44562 + getQualifiedDefinitionNames: function getQualifiedDefinitionNames() {
1.44563 + notImplemented('ApplicationDomain.getQualifiedDefinitionNames');
1.44564 + },
1.44565 + parentDomain: {
1.44566 + get: function parentDomain() {
1.44567 + var base = this.nativeObject.base;
1.44568 + if (!base) {
1.44569 + return undefined;
1.44570 + }
1.44571 + return new flash.system.ApplicationDomain(base);
1.44572 + }
1.44573 + },
1.44574 + domainMemory: {
1.44575 + get: function domainMemory() {
1.44576 + notImplemented('ApplicationDomain.domainMemory');
1.44577 + return this._domainMemory;
1.44578 + },
1.44579 + set: function domainMemory(mem) {
1.44580 + notImplemented('ApplicationDomain.domainMemory');
1.44581 + this._domainMemory = mem;
1.44582 + }
1.44583 + }
1.44584 + }
1.44585 + },
1.44586 + script: {
1.44587 + static: Glue.ALL,
1.44588 + instance: Glue.ALL
1.44589 + }
1.44590 + }
1.44591 + };
1.44592 + }.call(this);
1.44593 +}
1.44594 +var CapabilitiesDefinition = function () {
1.44595 + var def = {};
1.44596 + var os;
1.44597 + var userAgent = window.navigator.userAgent;
1.44598 + if (userAgent.indexOf('Macintosh') > 0) {
1.44599 + os = 'Mac OS 10.5.2';
1.44600 + } else if (userAgent.indexOf('Windows') > 0) {
1.44601 + os = 'Windows XP';
1.44602 + } else if (userAgent.indexOf('Linux') > 0) {
1.44603 + os = 'Linux';
1.44604 + } else if (/(iPad|iPhone|iPod|Android)/.test(userAgent)) {
1.44605 + os = 'iPhone3,1';
1.44606 + } else {
1.44607 + notImplemented();
1.44608 + }
1.44609 + def.__glue__ = {
1.44610 + native: {
1.44611 + static: {
1.44612 + version: {
1.44613 + get: function version() {
1.44614 + return 'SHUMWAY 10,0,0,0';
1.44615 + },
1.44616 + enumerable: true
1.44617 + },
1.44618 + os: {
1.44619 + get: function () {
1.44620 + return os;
1.44621 + },
1.44622 + enumerable: true
1.44623 + },
1.44624 + serverString: {
1.44625 + get: function () {
1.44626 + var str = toKeyValueArray({
1.44627 + OS: os
1.44628 + }).map(function (pair) {
1.44629 + return pair[0] + '=' + encodeURIComponent(pair[1]);
1.44630 + }).join('&');
1.44631 + somewhatImplemented('Capabilities.serverString: ' + str);
1.44632 + return str;
1.44633 + }
1.44634 + },
1.44635 + hasAccessibility: {
1.44636 + get: function hasAccessibility() {
1.44637 + somewhatImplemented('Capabilities.hasAccessibility');
1.44638 + return false;
1.44639 + }
1.44640 + },
1.44641 + isDebugger: {
1.44642 + get: function isDebugger() {
1.44643 + return false;
1.44644 + }
1.44645 + },
1.44646 + screenResolutionX: {
1.44647 + get: function screenResolutionX() {
1.44648 + return window.screen.width;
1.44649 + }
1.44650 + },
1.44651 + screenResolutionY: {
1.44652 + get: function screenResolutionY() {
1.44653 + return window.screen.height;
1.44654 + }
1.44655 + },
1.44656 + manufacturer: {
1.44657 + get: function manufacturer() {
1.44658 + somewhatImplemented('Capabilities.manufacturer');
1.44659 + return 'Mozilla Research';
1.44660 + }
1.44661 + },
1.44662 + language: {
1.44663 + get: function language() {
1.44664 + somewhatImplemented('Capabilities.language');
1.44665 + return 'en';
1.44666 + }
1.44667 + },
1.44668 + playerType: {
1.44669 + get: function playerType() {
1.44670 + somewhatImplemented('Capabilities.playerType');
1.44671 + return 'PlugIn';
1.44672 + }
1.44673 + }
1.44674 + }
1.44675 + },
1.44676 + script: {
1.44677 + static: scriptProperties('public', [
1.44678 + 'version',
1.44679 + 'os'
1.44680 + ])
1.44681 + }
1.44682 + };
1.44683 + return def;
1.44684 + }.call(this);
1.44685 +var FSCommandDefinition = function () {
1.44686 + var def = {};
1.44687 + function fscommand(command, parameters) {
1.44688 + console.log('FSCommand: ' + command + '; ' + parameters);
1.44689 + switch (command.toLowerCase()) {
1.44690 + case 'quit':
1.44691 + renderingTerminated = true;
1.44692 + return;
1.44693 + case 'debugger':
1.44694 + debugger;
1.44695 + return;
1.44696 + default:
1.44697 + break;
1.44698 + }
1.44699 + }
1.44700 + def.__glue__ = {
1.44701 + native: {
1.44702 + static: {
1.44703 + _fscommand: fscommand
1.44704 + }
1.44705 + }
1.44706 + };
1.44707 + return def;
1.44708 + }.call(this);
1.44709 +var SecurityDefinition = function () {
1.44710 + var _exactSettings;
1.44711 + return {
1.44712 + __class__: 'flash.system.Security',
1.44713 + initialize: function () {
1.44714 + },
1.44715 + __glue__: {
1.44716 + native: {
1.44717 + static: {
1.44718 + allowDomain: function allowDomain() {
1.44719 + somewhatImplemented('Security.allowDomain ["' + Array.prototype.join.call(arguments, '", "') + '"]');
1.44720 + },
1.44721 + allowInsecureDomain: function allowInsecureDomain() {
1.44722 + somewhatImplemented('Security.allowInsecureDomain');
1.44723 + },
1.44724 + loadPolicyFile: function loadPolicyFile(url) {
1.44725 + somewhatImplemented('Security.loadPolicyFile');
1.44726 + },
1.44727 + duplicateSandboxBridgeInputArguments: function duplicateSandboxBridgeInputArguments(toplevel, args) {
1.44728 + notImplemented('Security.duplicateSandboxBridgeInputArguments');
1.44729 + },
1.44730 + duplicateSandboxBridgeOutputArgument: function duplicateSandboxBridgeOutputArgument(toplevel, arg) {
1.44731 + notImplemented('Security.duplicateSandboxBridgeOutputArgument');
1.44732 + },
1.44733 + showSettings: function showSettings(panel) {
1.44734 + notImplemented('Security.showSettings');
1.44735 + },
1.44736 + exactSettings: {
1.44737 + get: function () {
1.44738 + return _exactSettings;
1.44739 + },
1.44740 + set: function (value) {
1.44741 + _exactSettings = value;
1.44742 + }
1.44743 + },
1.44744 + disableAVM1Loading: {
1.44745 + get: function disableAVM1Loading() {
1.44746 + notImplemented('Security.disableAVM1Loading');
1.44747 + },
1.44748 + set: function disableAVM1Loading(value) {
1.44749 + notImplemented('Security.disableAVM1Loading');
1.44750 + }
1.44751 + },
1.44752 + sandboxType: {
1.44753 + get: function () {
1.44754 + somewhatImplemented('Security.sandboxType');
1.44755 + return 'remote';
1.44756 + }
1.44757 + },
1.44758 + pageDomain: {
1.44759 + get: function pageDomain() {
1.44760 + somewhatImplemented('Security.pageDomain');
1.44761 + var pageHost = FileLoadingService.resolveUrl('/');
1.44762 + var parts = pageHost.split('/');
1.44763 + parts.pop();
1.44764 + return parts.pop();
1.44765 + }
1.44766 + }
1.44767 + }
1.44768 + }
1.44769 + }
1.44770 + };
1.44771 + }.call(this);
1.44772 +var SecurityDomainDefinition = function () {
1.44773 + return {
1.44774 + __class__: 'flash.system.SecurityDomain',
1.44775 + initialize: function () {
1.44776 + },
1.44777 + _currentDomain: null,
1.44778 + __glue__: {
1.44779 + native: {
1.44780 + static: {
1.44781 + currentDomain: {
1.44782 + get: function () {
1.44783 + return this._currentDomain;
1.44784 + }
1.44785 + }
1.44786 + },
1.44787 + instance: {
1.44788 + ctor_impl: function ctor_impl() {
1.44789 + notImplemented('SecurityDomain.ctor_impl');
1.44790 + },
1.44791 + domainID: {
1.44792 + get: function domainID() {
1.44793 + notImplemented('SecurityDomain.domainID');
1.44794 + return this._domainID;
1.44795 + }
1.44796 + }
1.44797 + }
1.44798 + }
1.44799 + }
1.44800 + };
1.44801 + }.call(this);
1.44802 +var SystemDefinition = function () {
1.44803 + return {
1.44804 + __class__: 'flash.system.System',
1.44805 + initialize: function () {
1.44806 + },
1.44807 + __glue__: {
1.44808 + native: {
1.44809 + static: {
1.44810 + setClipboard: function setClipboard(string) {
1.44811 + FirefoxCom.request('setClipboard', string);
1.44812 + TelemetryService.reportTelemetry({
1.44813 + topic: 'feature',
1.44814 + feature: CLIPBOARD_FEATURE
1.44815 + });
1.44816 + },
1.44817 + pause: function pause() {
1.44818 + somewhatImplemented('System.pause');
1.44819 + },
1.44820 + resume: function resume() {
1.44821 + somewhatImplemented('System.resume');
1.44822 + },
1.44823 + exit: function exit(code) {
1.44824 + somewhatImplemented('System.exit');
1.44825 + renderingTerminated = true;
1.44826 + },
1.44827 + gc: function gc() {
1.44828 + somewhatImplemented('System.gc');
1.44829 + },
1.44830 + pauseForGCIfCollectionImminent: function pauseForGCIfCollectionImminent(imminence) {
1.44831 + notImplemented('System.pauseForGCIfCollectionImminent');
1.44832 + },
1.44833 + disposeXML: function disposeXML(node) {
1.44834 + notImplemented('System.disposeXML');
1.44835 + },
1.44836 + ime: {
1.44837 + get: function ime() {
1.44838 + notImplemented('System.ime');
1.44839 + }
1.44840 + },
1.44841 + totalMemoryNumber: {
1.44842 + get: function totalMemoryNumber() {
1.44843 + if (performance.memory) {
1.44844 + return performance.memory.usedJSHeapSize;
1.44845 + }
1.44846 + return 0;
1.44847 + }
1.44848 + },
1.44849 + freeMemory: {
1.44850 + get: function freeMemory() {
1.44851 + notImplemented('System.freeMemory');
1.44852 + }
1.44853 + },
1.44854 + privateMemory: {
1.44855 + get: function privateMemory() {
1.44856 + return 0;
1.44857 + }
1.44858 + },
1.44859 + processCPUUsage: {
1.44860 + get: function processCPUUsage() {
1.44861 + notImplemented('System.processCPUUsage');
1.44862 + }
1.44863 + },
1.44864 + useCodePage: {
1.44865 + get: function useCodePage() {
1.44866 + somewhatImplemented('System.useCodePage');
1.44867 + return false;
1.44868 + },
1.44869 + set: function useCodePage(value) {
1.44870 + notImplemented('System.useCodePage');
1.44871 + }
1.44872 + },
1.44873 + vmVersion: {
1.44874 + get: function vmVersion() {
1.44875 + somewhatImplemented('System.vmVersion');
1.44876 + return '1.0 shumway';
1.44877 + }
1.44878 + },
1.44879 + swfVersion: {
1.44880 + get: function () {
1.44881 + return 19;
1.44882 + }
1.44883 + },
1.44884 + apiVersion: {
1.44885 + get: function () {
1.44886 + return 26;
1.44887 + }
1.44888 + },
1.44889 + getArgv: function () {
1.44890 + return [];
1.44891 + },
1.44892 + getRunmode: function () {
1.44893 + return 'mixed';
1.44894 + }
1.44895 + },
1.44896 + instance: {}
1.44897 + }
1.44898 + }
1.44899 + };
1.44900 + }.call(this);
1.44901 +{
1.44902 + var FontDefinition = function () {
1.44903 + var fonts = [];
1.44904 + var fontsByUniqueName = Object.create(null);
1.44905 + var fontsByNameStyleType = Object.create(null);
1.44906 + var _deviceFontMetrics;
1.44907 + var def = {
1.44908 + __class__: 'flash.text.Font',
1.44909 + initialize: function () {
1.44910 + var s = this.symbol;
1.44911 + if (s) {
1.44912 + this._fontName = s.name || null;
1.44913 + this._uniqueName = s.uniqueName;
1.44914 + if (s.bold) {
1.44915 + if (s.italic) {
1.44916 + this._fontStyle = 'boldItalic';
1.44917 + } else {
1.44918 + this._fontStyle = 'bold';
1.44919 + }
1.44920 + } else if (s.italic) {
1.44921 + this._fontStyle = 'italic';
1.44922 + } else {
1.44923 + this._fontStyle = 'regular';
1.44924 + }
1.44925 + var metrics = s.metrics;
1.44926 + metrics.height = metrics.ascent + metrics.descent + metrics.leading;
1.44927 + this._metrics = metrics;
1.44928 + this._fontType = 'embedded';
1.44929 + fonts.push(this);
1.44930 + fontsByUniqueName[this._uniqueName] = this;
1.44931 + var ident = this._fontName.toLowerCase() + '_' + this._fontStyle + '_embedded';
1.44932 + fontsByNameStyleType[ident] = this;
1.44933 + }
1.44934 + },
1.44935 + get fontName() {
1.44936 + return this._fontName;
1.44937 + },
1.44938 + get fontStyle() {
1.44939 + return this._fontStyle;
1.44940 + },
1.44941 + get fontType() {
1.44942 + return this._fontType;
1.44943 + },
1.44944 + hasGlyphs: function hasGlyphs(str) {
1.44945 + return true;
1.44946 + },
1.44947 + getFont: function (name, style, embedded) {
1.44948 + var ident = name.toLowerCase() + '_' + style + (embedded ? '_embedded' : '_device');
1.44949 + var font = fontsByNameStyleType[ident];
1.44950 + if (font) {
1.44951 + return font;
1.44952 + }
1.44953 + font = new flash.text.Font();
1.44954 + font._fontName = font._uniqueName = name;
1.44955 + font._fontStyle = style;
1.44956 + font._fontType = 'device';
1.44957 + var metrics = deviceFontMetrics()[name];
1.44958 + if (!metrics) {
1.44959 + metrics = deviceFontMetrics().serif;
1.44960 + font._fontName = font._uniqueName = 'serif';
1.44961 + }
1.44962 + font._metrics = {
1.44963 + ascent: metrics[0],
1.44964 + descent: metrics[1],
1.44965 + leading: metrics[2]
1.44966 + };
1.44967 + font._metrics.height = metrics[0] + metrics[1] + metrics[2];
1.44968 + fontsByNameStyleType[ident] = font;
1.44969 + return font;
1.44970 + },
1.44971 + getFontByUniqueName: function (name) {
1.44972 + return fontsByUniqueName[name];
1.44973 + }
1.44974 + };
1.44975 + function enumerateFonts(device) {
1.44976 + return fonts.slice();
1.44977 + }
1.44978 + function registerFont(font) {
1.44979 + somewhatImplemented('Font.registerFont');
1.44980 + }
1.44981 + function deviceFontMetrics() {
1.44982 + if (_deviceFontMetrics) {
1.44983 + return _deviceFontMetrics;
1.44984 + }
1.44985 + var userAgent = window.navigator.userAgent;
1.44986 + if (userAgent.indexOf('Windows') > -1) {
1.44987 + _deviceFontMetrics = DEVICE_FONT_METRICS_WIN;
1.44988 + } else if (/(Macintosh|iPad|iPhone|iPod|Android)/.test(userAgent)) {
1.44989 + _deviceFontMetrics = DEVICE_FONT_METRICS_MAC;
1.44990 + } else {
1.44991 + _deviceFontMetrics = DEVICE_FONT_METRICS_LINUX;
1.44992 + }
1.44993 + return _deviceFontMetrics;
1.44994 + }
1.44995 + var desc = Object.getOwnPropertyDescriptor;
1.44996 + def.__glue__ = {
1.44997 + native: {
1.44998 + instance: {
1.44999 + fontName: desc(def, 'fontName'),
1.45000 + fontStyle: desc(def, 'fontStyle'),
1.45001 + fontType: desc(def, 'fontType'),
1.45002 + hasGlyphs: def.hasGlyphs
1.45003 + },
1.45004 + static: {
1.45005 + enumerateFonts: enumerateFonts,
1.45006 + registerFont: registerFont
1.45007 + }
1.45008 + }
1.45009 + };
1.45010 + return def;
1.45011 + }.call(this);
1.45012 + var DEVICE_FONT_METRICS_WIN = {
1.45013 + 'serif': [
1.45014 + 1,
1.45015 + 0.25,
1.45016 + 0
1.45017 + ],
1.45018 + 'sans-serif': [
1.45019 + 1,
1.45020 + 0.25,
1.45021 + 0
1.45022 + ],
1.45023 + 'monospace': [
1.45024 + 1,
1.45025 + 0.25,
1.45026 + 0
1.45027 + ],
1.45028 + 'birch std': [
1.45029 + 0.9167,
1.45030 + 0.25,
1.45031 + 0
1.45032 + ],
1.45033 + 'blackoak std': [
1.45034 + 1,
1.45035 + 0.3333,
1.45036 + 0
1.45037 + ],
1.45038 + 'chaparral pro': [
1.45039 + 0.8333,
1.45040 + 0.3333,
1.45041 + 0
1.45042 + ],
1.45043 + 'chaparral pro light': [
1.45044 + 0.8333,
1.45045 + 0.3333,
1.45046 + 0
1.45047 + ],
1.45048 + 'charlemagne std': [
1.45049 + 0.9167,
1.45050 + 0.25,
1.45051 + 0
1.45052 + ],
1.45053 + 'cooper std black': [
1.45054 + 0.9167,
1.45055 + 0.25,
1.45056 + 0
1.45057 + ],
1.45058 + 'giddyup std': [
1.45059 + 0.8333,
1.45060 + 0.3333,
1.45061 + 0
1.45062 + ],
1.45063 + 'hobo std': [
1.45064 + 1.0833,
1.45065 + 0.3333,
1.45066 + 0
1.45067 + ],
1.45068 + 'kozuka gothic pro b': [
1.45069 + 1,
1.45070 + 0.4167,
1.45071 + 0
1.45072 + ],
1.45073 + 'kozuka gothic pro el': [
1.45074 + 1.0833,
1.45075 + 0.25,
1.45076 + 0
1.45077 + ],
1.45078 + 'kozuka gothic pro h': [
1.45079 + 1,
1.45080 + 0.4167,
1.45081 + 0
1.45082 + ],
1.45083 + 'kozuka gothic pro l': [
1.45084 + 1,
1.45085 + 0.3333,
1.45086 + 0
1.45087 + ],
1.45088 + 'kozuka gothic pro m': [
1.45089 + 1.0833,
1.45090 + 0.3333,
1.45091 + 0
1.45092 + ],
1.45093 + 'kozuka gothic pro r': [
1.45094 + 1,
1.45095 + 0.3333,
1.45096 + 0
1.45097 + ],
1.45098 + 'kozuka mincho pro b': [
1.45099 + 1.0833,
1.45100 + 0.25,
1.45101 + 0
1.45102 + ],
1.45103 + 'kozuka mincho pro el': [
1.45104 + 1.0833,
1.45105 + 0.25,
1.45106 + 0
1.45107 + ],
1.45108 + 'kozuka mincho pro h': [
1.45109 + 1.1667,
1.45110 + 0.25,
1.45111 + 0
1.45112 + ],
1.45113 + 'kozuka mincho pro l': [
1.45114 + 1.0833,
1.45115 + 0.25,
1.45116 + 0
1.45117 + ],
1.45118 + 'kozuka mincho pro m': [
1.45119 + 1.0833,
1.45120 + 0.25,
1.45121 + 0
1.45122 + ],
1.45123 + 'kozuka mincho pro r': [
1.45124 + 1.0833,
1.45125 + 0.25,
1.45126 + 0
1.45127 + ],
1.45128 + 'mesquite std': [
1.45129 + 0.9167,
1.45130 + 0.25,
1.45131 + 0
1.45132 + ],
1.45133 + 'minion pro cond': [
1.45134 + 1,
1.45135 + 0.3333,
1.45136 + 0
1.45137 + ],
1.45138 + 'minion pro med': [
1.45139 + 1,
1.45140 + 0.3333,
1.45141 + 0
1.45142 + ],
1.45143 + 'minion pro smbd': [
1.45144 + 1,
1.45145 + 0.3333,
1.45146 + 0
1.45147 + ],
1.45148 + 'myriad arabic': [
1.45149 + 1,
1.45150 + 0.4167,
1.45151 + 0
1.45152 + ],
1.45153 + 'nueva std': [
1.45154 + 0.75,
1.45155 + 0.25,
1.45156 + 0
1.45157 + ],
1.45158 + 'nueva std cond': [
1.45159 + 0.75,
1.45160 + 0.25,
1.45161 + 0
1.45162 + ],
1.45163 + 'ocr a std': [
1.45164 + 0.8333,
1.45165 + 0.25,
1.45166 + 0
1.45167 + ],
1.45168 + 'orator std': [
1.45169 + 1.0833,
1.45170 + 0.25,
1.45171 + 0
1.45172 + ],
1.45173 + 'poplar std': [
1.45174 + 0.9167,
1.45175 + 0.25,
1.45176 + 0
1.45177 + ],
1.45178 + 'prestige elite std': [
1.45179 + 0.9167,
1.45180 + 0.25,
1.45181 + 0
1.45182 + ],
1.45183 + 'rosewood std regular': [
1.45184 + 0.8333,
1.45185 + 0.3333,
1.45186 + 0
1.45187 + ],
1.45188 + 'stencil std': [
1.45189 + 1,
1.45190 + 0.3333,
1.45191 + 0
1.45192 + ],
1.45193 + 'trajan pro': [
1.45194 + 1,
1.45195 + 0.25,
1.45196 + 0
1.45197 + ],
1.45198 + 'kozuka gothic pr6n b': [
1.45199 + 1.4167,
1.45200 + 0.4167,
1.45201 + 0
1.45202 + ],
1.45203 + 'kozuka gothic pr6n el': [
1.45204 + 1.4167,
1.45205 + 0.3333,
1.45206 + 0
1.45207 + ],
1.45208 + 'kozuka gothic pr6n h': [
1.45209 + 1.4167,
1.45210 + 0.4167,
1.45211 + 0
1.45212 + ],
1.45213 + 'kozuka gothic pr6n l': [
1.45214 + 1.4167,
1.45215 + 0.3333,
1.45216 + 0
1.45217 + ],
1.45218 + 'kozuka gothic pr6n m': [
1.45219 + 1.5,
1.45220 + 0.3333,
1.45221 + 0
1.45222 + ],
1.45223 + 'kozuka gothic pr6n r': [
1.45224 + 1.4167,
1.45225 + 0.3333,
1.45226 + 0
1.45227 + ],
1.45228 + 'kozuka mincho pr6n b': [
1.45229 + 1.3333,
1.45230 + 0.3333,
1.45231 + 0
1.45232 + ],
1.45233 + 'kozuka mincho pr6n el': [
1.45234 + 1.3333,
1.45235 + 0.3333,
1.45236 + 0
1.45237 + ],
1.45238 + 'kozuka mincho pr6n h': [
1.45239 + 1.4167,
1.45240 + 0.3333,
1.45241 + 0
1.45242 + ],
1.45243 + 'kozuka mincho pr6n l': [
1.45244 + 1.3333,
1.45245 + 0.3333,
1.45246 + 0
1.45247 + ],
1.45248 + 'kozuka mincho pr6n m': [
1.45249 + 1.3333,
1.45250 + 0.3333,
1.45251 + 0
1.45252 + ],
1.45253 + 'kozuka mincho pr6n r': [
1.45254 + 1.3333,
1.45255 + 0.3333,
1.45256 + 0
1.45257 + ],
1.45258 + 'letter gothic std': [
1.45259 + 1,
1.45260 + 0.25,
1.45261 + 0
1.45262 + ],
1.45263 + 'minion pro': [
1.45264 + 1,
1.45265 + 0.3333,
1.45266 + 0
1.45267 + ],
1.45268 + 'myriad hebrew': [
1.45269 + 0.8333,
1.45270 + 0.3333,
1.45271 + 0
1.45272 + ],
1.45273 + 'myriad pro': [
1.45274 + 0.9167,
1.45275 + 0.25,
1.45276 + 0
1.45277 + ],
1.45278 + 'myriad pro cond': [
1.45279 + 0.9167,
1.45280 + 0.25,
1.45281 + 0
1.45282 + ],
1.45283 + 'myriad pro light': [
1.45284 + 1,
1.45285 + 0.25,
1.45286 + 0
1.45287 + ],
1.45288 + 'marlett': [
1.45289 + 1,
1.45290 + 0,
1.45291 + 0
1.45292 + ],
1.45293 + 'arial': [
1.45294 + 1,
1.45295 + 0.25,
1.45296 + 0
1.45297 + ],
1.45298 + 'arabic transparent': [
1.45299 + 1,
1.45300 + 0.25,
1.45301 + 0
1.45302 + ],
1.45303 + 'arial baltic': [
1.45304 + 1,
1.45305 + 0.25,
1.45306 + 0
1.45307 + ],
1.45308 + 'arial ce': [
1.45309 + 1,
1.45310 + 0.25,
1.45311 + 0
1.45312 + ],
1.45313 + 'arial cyr': [
1.45314 + 1,
1.45315 + 0.25,
1.45316 + 0
1.45317 + ],
1.45318 + 'arial greek': [
1.45319 + 1,
1.45320 + 0.25,
1.45321 + 0
1.45322 + ],
1.45323 + 'arial tur': [
1.45324 + 1,
1.45325 + 0.25,
1.45326 + 0
1.45327 + ],
1.45328 + 'batang': [
1.45329 + 0.8333,
1.45330 + 0.1667,
1.45331 + 0
1.45332 + ],
1.45333 + 'batangche': [
1.45334 + 0.8333,
1.45335 + 0.1667,
1.45336 + 0
1.45337 + ],
1.45338 + 'gungsuh': [
1.45339 + 0.8333,
1.45340 + 0.1667,
1.45341 + 0
1.45342 + ],
1.45343 + 'gungsuhche': [
1.45344 + 0.8333,
1.45345 + 0.1667,
1.45346 + 0
1.45347 + ],
1.45348 + 'courier new': [
1.45349 + 1,
1.45350 + 0.25,
1.45351 + 0
1.45352 + ],
1.45353 + 'courier new baltic': [
1.45354 + 1,
1.45355 + 0.25,
1.45356 + 0
1.45357 + ],
1.45358 + 'courier new ce': [
1.45359 + 1,
1.45360 + 0.25,
1.45361 + 0
1.45362 + ],
1.45363 + 'courier new cyr': [
1.45364 + 1,
1.45365 + 0.25,
1.45366 + 0
1.45367 + ],
1.45368 + 'courier new greek': [
1.45369 + 1,
1.45370 + 0.25,
1.45371 + 0
1.45372 + ],
1.45373 + 'courier new tur': [
1.45374 + 1,
1.45375 + 0.25,
1.45376 + 0
1.45377 + ],
1.45378 + 'daunpenh': [
1.45379 + 0.6667,
1.45380 + 0.6667,
1.45381 + 0
1.45382 + ],
1.45383 + 'dokchampa': [
1.45384 + 1.4167,
1.45385 + 0.5833,
1.45386 + 0
1.45387 + ],
1.45388 + 'estrangelo edessa': [
1.45389 + 0.75,
1.45390 + 0.3333,
1.45391 + 0
1.45392 + ],
1.45393 + 'euphemia': [
1.45394 + 1.0833,
1.45395 + 0.3333,
1.45396 + 0
1.45397 + ],
1.45398 + 'gautami': [
1.45399 + 1.1667,
1.45400 + 0.8333,
1.45401 + 0
1.45402 + ],
1.45403 + 'vani': [
1.45404 + 1.0833,
1.45405 + 0.75,
1.45406 + 0
1.45407 + ],
1.45408 + 'gulim': [
1.45409 + 0.8333,
1.45410 + 0.1667,
1.45411 + 0
1.45412 + ],
1.45413 + 'gulimche': [
1.45414 + 0.8333,
1.45415 + 0.1667,
1.45416 + 0
1.45417 + ],
1.45418 + 'dotum': [
1.45419 + 0.8333,
1.45420 + 0.1667,
1.45421 + 0
1.45422 + ],
1.45423 + 'dotumche': [
1.45424 + 0.8333,
1.45425 + 0.1667,
1.45426 + 0
1.45427 + ],
1.45428 + 'impact': [
1.45429 + 1.0833,
1.45430 + 0.25,
1.45431 + 0
1.45432 + ],
1.45433 + 'iskoola pota': [
1.45434 + 1,
1.45435 + 0.3333,
1.45436 + 0
1.45437 + ],
1.45438 + 'kalinga': [
1.45439 + 1.0833,
1.45440 + 0.5,
1.45441 + 0
1.45442 + ],
1.45443 + 'kartika': [
1.45444 + 1,
1.45445 + 0.4167,
1.45446 + 0
1.45447 + ],
1.45448 + 'khmer ui': [
1.45449 + 1.0833,
1.45450 + 0.3333,
1.45451 + 0
1.45452 + ],
1.45453 + 'lao ui': [
1.45454 + 1,
1.45455 + 0.25,
1.45456 + 0
1.45457 + ],
1.45458 + 'latha': [
1.45459 + 1.0833,
1.45460 + 0.4167,
1.45461 + 0
1.45462 + ],
1.45463 + 'lucida console': [
1.45464 + 0.75,
1.45465 + 0.25,
1.45466 + 0
1.45467 + ],
1.45468 + 'malgun gothic': [
1.45469 + 1,
1.45470 + 0.25,
1.45471 + 0
1.45472 + ],
1.45473 + 'mangal': [
1.45474 + 1.0833,
1.45475 + 0.3333,
1.45476 + 0
1.45477 + ],
1.45478 + 'meiryo': [
1.45479 + 1.0833,
1.45480 + 0.4167,
1.45481 + 0
1.45482 + ],
1.45483 + 'meiryo ui': [
1.45484 + 1,
1.45485 + 0.25,
1.45486 + 0
1.45487 + ],
1.45488 + 'microsoft himalaya': [
1.45489 + 0.5833,
1.45490 + 0.4167,
1.45491 + 0
1.45492 + ],
1.45493 + 'microsoft jhenghei': [
1.45494 + 1,
1.45495 + 0.3333,
1.45496 + 0
1.45497 + ],
1.45498 + 'microsoft yahei': [
1.45499 + 1.0833,
1.45500 + 0.3333,
1.45501 + 0
1.45502 + ],
1.45503 + 'mingliu': [
1.45504 + 0.8333,
1.45505 + 0.1667,
1.45506 + 0
1.45507 + ],
1.45508 + 'pmingliu': [
1.45509 + 0.8333,
1.45510 + 0.1667,
1.45511 + 0
1.45512 + ],
1.45513 + 'mingliu_hkscs': [
1.45514 + 0.8333,
1.45515 + 0.1667,
1.45516 + 0
1.45517 + ],
1.45518 + 'mingliu-extb': [
1.45519 + 0.8333,
1.45520 + 0.1667,
1.45521 + 0
1.45522 + ],
1.45523 + 'pmingliu-extb': [
1.45524 + 0.8333,
1.45525 + 0.1667,
1.45526 + 0
1.45527 + ],
1.45528 + 'mingliu_hkscs-extb': [
1.45529 + 0.8333,
1.45530 + 0.1667,
1.45531 + 0
1.45532 + ],
1.45533 + 'mongolian baiti': [
1.45534 + 0.8333,
1.45535 + 0.25,
1.45536 + 0
1.45537 + ],
1.45538 + 'ms gothic': [
1.45539 + 0.8333,
1.45540 + 0.1667,
1.45541 + 0
1.45542 + ],
1.45543 + 'ms pgothic': [
1.45544 + 0.8333,
1.45545 + 0.1667,
1.45546 + 0
1.45547 + ],
1.45548 + 'ms ui gothic': [
1.45549 + 0.8333,
1.45550 + 0.1667,
1.45551 + 0
1.45552 + ],
1.45553 + 'ms mincho': [
1.45554 + 0.8333,
1.45555 + 0.1667,
1.45556 + 0
1.45557 + ],
1.45558 + 'ms pmincho': [
1.45559 + 0.8333,
1.45560 + 0.1667,
1.45561 + 0
1.45562 + ],
1.45563 + 'mv boli': [
1.45564 + 1.1667,
1.45565 + 0.25,
1.45566 + 0
1.45567 + ],
1.45568 + 'microsoft new tai lue': [
1.45569 + 1,
1.45570 + 0.4167,
1.45571 + 0
1.45572 + ],
1.45573 + 'nyala': [
1.45574 + 0.9167,
1.45575 + 0.3333,
1.45576 + 0
1.45577 + ],
1.45578 + 'microsoft phagspa': [
1.45579 + 1.0833,
1.45580 + 0.25,
1.45581 + 0
1.45582 + ],
1.45583 + 'plantagenet cherokee': [
1.45584 + 1,
1.45585 + 0.4167,
1.45586 + 0
1.45587 + ],
1.45588 + 'raavi': [
1.45589 + 1.0833,
1.45590 + 0.6667,
1.45591 + 0
1.45592 + ],
1.45593 + 'segoe script': [
1.45594 + 1.0833,
1.45595 + 0.5,
1.45596 + 0
1.45597 + ],
1.45598 + 'segoe ui': [
1.45599 + 1,
1.45600 + 0.25,
1.45601 + 0
1.45602 + ],
1.45603 + 'segoe ui semibold': [
1.45604 + 1,
1.45605 + 0.25,
1.45606 + 0
1.45607 + ],
1.45608 + 'segoe ui light': [
1.45609 + 1,
1.45610 + 0.25,
1.45611 + 0
1.45612 + ],
1.45613 + 'segoe ui symbol': [
1.45614 + 1,
1.45615 + 0.25,
1.45616 + 0
1.45617 + ],
1.45618 + 'shruti': [
1.45619 + 1.0833,
1.45620 + 0.5,
1.45621 + 0
1.45622 + ],
1.45623 + 'simsun': [
1.45624 + 0.8333,
1.45625 + 0.1667,
1.45626 + 0
1.45627 + ],
1.45628 + 'nsimsun': [
1.45629 + 0.8333,
1.45630 + 0.1667,
1.45631 + 0
1.45632 + ],
1.45633 + 'simsun-extb': [
1.45634 + 0.8333,
1.45635 + 0.1667,
1.45636 + 0
1.45637 + ],
1.45638 + 'sylfaen': [
1.45639 + 1,
1.45640 + 0.3333,
1.45641 + 0
1.45642 + ],
1.45643 + 'microsoft tai le': [
1.45644 + 1,
1.45645 + 0.3333,
1.45646 + 0
1.45647 + ],
1.45648 + 'times new roman': [
1.45649 + 1,
1.45650 + 0.25,
1.45651 + 0
1.45652 + ],
1.45653 + 'times new roman baltic': [
1.45654 + 1,
1.45655 + 0.25,
1.45656 + 0
1.45657 + ],
1.45658 + 'times new roman ce': [
1.45659 + 1,
1.45660 + 0.25,
1.45661 + 0
1.45662 + ],
1.45663 + 'times new roman cyr': [
1.45664 + 1,
1.45665 + 0.25,
1.45666 + 0
1.45667 + ],
1.45668 + 'times new roman greek': [
1.45669 + 1,
1.45670 + 0.25,
1.45671 + 0
1.45672 + ],
1.45673 + 'times new roman tur': [
1.45674 + 1,
1.45675 + 0.25,
1.45676 + 0
1.45677 + ],
1.45678 + 'tunga': [
1.45679 + 1.0833,
1.45680 + 0.75,
1.45681 + 0
1.45682 + ],
1.45683 + 'vrinda': [
1.45684 + 1,
1.45685 + 0.4167,
1.45686 + 0
1.45687 + ],
1.45688 + 'shonar bangla': [
1.45689 + 0.8333,
1.45690 + 0.5,
1.45691 + 0
1.45692 + ],
1.45693 + 'microsoft yi baiti': [
1.45694 + 0.8333,
1.45695 + 0.1667,
1.45696 + 0
1.45697 + ],
1.45698 + 'tahoma': [
1.45699 + 1,
1.45700 + 0.1667,
1.45701 + 0
1.45702 + ],
1.45703 + 'microsoft sans serif': [
1.45704 + 1.0833,
1.45705 + 0.1667,
1.45706 + 0
1.45707 + ],
1.45708 + 'angsana new': [
1.45709 + 0.9167,
1.45710 + 0.4167,
1.45711 + 0
1.45712 + ],
1.45713 + 'aparajita': [
1.45714 + 0.75,
1.45715 + 0.4167,
1.45716 + 0
1.45717 + ],
1.45718 + 'cordia new': [
1.45719 + 0.9167,
1.45720 + 0.5,
1.45721 + 0
1.45722 + ],
1.45723 + 'ebrima': [
1.45724 + 1.0833,
1.45725 + 0.5,
1.45726 + 0
1.45727 + ],
1.45728 + 'gisha': [
1.45729 + 0.9167,
1.45730 + 0.25,
1.45731 + 0
1.45732 + ],
1.45733 + 'kokila': [
1.45734 + 0.8333,
1.45735 + 0.3333,
1.45736 + 0
1.45737 + ],
1.45738 + 'leelawadee': [
1.45739 + 0.9167,
1.45740 + 0.25,
1.45741 + 0
1.45742 + ],
1.45743 + 'microsoft uighur': [
1.45744 + 1.0833,
1.45745 + 0.5,
1.45746 + 0
1.45747 + ],
1.45748 + 'moolboran': [
1.45749 + 0.6667,
1.45750 + 0.6667,
1.45751 + 0
1.45752 + ],
1.45753 + 'symbol': [
1.45754 + 1,
1.45755 + 0.25,
1.45756 + 0
1.45757 + ],
1.45758 + 'utsaah': [
1.45759 + 0.8333,
1.45760 + 0.4167,
1.45761 + 0
1.45762 + ],
1.45763 + 'vijaya': [
1.45764 + 1.0833,
1.45765 + 0.25,
1.45766 + 0
1.45767 + ],
1.45768 + 'wingdings': [
1.45769 + 0.9167,
1.45770 + 0.25,
1.45771 + 0
1.45772 + ],
1.45773 + 'andalus': [
1.45774 + 1.3333,
1.45775 + 0.4167,
1.45776 + 0
1.45777 + ],
1.45778 + 'arabic typesetting': [
1.45779 + 0.8333,
1.45780 + 0.5,
1.45781 + 0
1.45782 + ],
1.45783 + 'simplified arabic': [
1.45784 + 1.3333,
1.45785 + 0.5,
1.45786 + 0
1.45787 + ],
1.45788 + 'simplified arabic fixed': [
1.45789 + 1,
1.45790 + 0.4167,
1.45791 + 0
1.45792 + ],
1.45793 + 'sakkal majalla': [
1.45794 + 0.9167,
1.45795 + 0.5,
1.45796 + 0
1.45797 + ],
1.45798 + 'traditional arabic': [
1.45799 + 1.3333,
1.45800 + 0.5,
1.45801 + 0
1.45802 + ],
1.45803 + 'aharoni': [
1.45804 + 0.75,
1.45805 + 0.25,
1.45806 + 0
1.45807 + ],
1.45808 + 'david': [
1.45809 + 0.75,
1.45810 + 0.25,
1.45811 + 0
1.45812 + ],
1.45813 + 'frankruehl': [
1.45814 + 0.75,
1.45815 + 0.25,
1.45816 + 0
1.45817 + ],
1.45818 + 'fangsong': [
1.45819 + 0.8333,
1.45820 + 0.1667,
1.45821 + 0
1.45822 + ],
1.45823 + 'simhei': [
1.45824 + 0.8333,
1.45825 + 0.1667,
1.45826 + 0
1.45827 + ],
1.45828 + 'kaiti': [
1.45829 + 0.8333,
1.45830 + 0.1667,
1.45831 + 0
1.45832 + ],
1.45833 + 'browallia new': [
1.45834 + 0.8333,
1.45835 + 0.4167,
1.45836 + 0
1.45837 + ],
1.45838 + 'lucida sans unicode': [
1.45839 + 1.0833,
1.45840 + 0.25,
1.45841 + 0
1.45842 + ],
1.45843 + 'arial black': [
1.45844 + 1.0833,
1.45845 + 0.3333,
1.45846 + 0
1.45847 + ],
1.45848 + 'calibri': [
1.45849 + 0.9167,
1.45850 + 0.25,
1.45851 + 0
1.45852 + ],
1.45853 + 'cambria': [
1.45854 + 0.9167,
1.45855 + 0.25,
1.45856 + 0
1.45857 + ],
1.45858 + 'cambria math': [
1.45859 + 3.0833,
1.45860 + 2.5,
1.45861 + 0
1.45862 + ],
1.45863 + 'candara': [
1.45864 + 0.9167,
1.45865 + 0.25,
1.45866 + 0
1.45867 + ],
1.45868 + 'comic sans ms': [
1.45869 + 1.0833,
1.45870 + 0.3333,
1.45871 + 0
1.45872 + ],
1.45873 + 'consolas': [
1.45874 + 0.9167,
1.45875 + 0.25,
1.45876 + 0
1.45877 + ],
1.45878 + 'constantia': [
1.45879 + 0.9167,
1.45880 + 0.25,
1.45881 + 0
1.45882 + ],
1.45883 + 'corbel': [
1.45884 + 0.9167,
1.45885 + 0.25,
1.45886 + 0
1.45887 + ],
1.45888 + 'franklin gothic medium': [
1.45889 + 1,
1.45890 + 0.3333,
1.45891 + 0
1.45892 + ],
1.45893 + 'gabriola': [
1.45894 + 1.1667,
1.45895 + 0.6667,
1.45896 + 0
1.45897 + ],
1.45898 + 'georgia': [
1.45899 + 1,
1.45900 + 0.25,
1.45901 + 0
1.45902 + ],
1.45903 + 'palatino linotype': [
1.45904 + 1.0833,
1.45905 + 0.3333,
1.45906 + 0
1.45907 + ],
1.45908 + 'segoe print': [
1.45909 + 1.25,
1.45910 + 0.5,
1.45911 + 0
1.45912 + ],
1.45913 + 'trebuchet ms': [
1.45914 + 1.0833,
1.45915 + 0.4167,
1.45916 + 0
1.45917 + ],
1.45918 + 'verdana': [
1.45919 + 1,
1.45920 + 0.1667,
1.45921 + 0
1.45922 + ],
1.45923 + 'webdings': [
1.45924 + 1.0833,
1.45925 + 0.5,
1.45926 + 0
1.45927 + ],
1.45928 + 'lucida bright': [
1.45929 + 0.9167,
1.45930 + 0.25,
1.45931 + 0
1.45932 + ],
1.45933 + 'lucida sans': [
1.45934 + 0.9167,
1.45935 + 0.25,
1.45936 + 0
1.45937 + ],
1.45938 + 'lucida sans typewriter': [
1.45939 + 0.9167,
1.45940 + 0.25,
1.45941 + 0
1.45942 + ],
1.45943 + 'gentium basic': [
1.45944 + 0.8333,
1.45945 + 0.25,
1.45946 + 0
1.45947 + ],
1.45948 + 'dejavu serif condensed': [
1.45949 + 0.9167,
1.45950 + 0.25,
1.45951 + 0
1.45952 + ],
1.45953 + 'arimo': [
1.45954 + 1,
1.45955 + 0.25,
1.45956 + 0
1.45957 + ],
1.45958 + 'dejavu sans condensed': [
1.45959 + 0.9167,
1.45960 + 0.25,
1.45961 + 0
1.45962 + ],
1.45963 + 'dejavu sans': [
1.45964 + 0.9167,
1.45965 + 0.25,
1.45966 + 0
1.45967 + ],
1.45968 + 'dejavu sans light': [
1.45969 + 0.9167,
1.45970 + 0.25,
1.45971 + 0
1.45972 + ],
1.45973 + 'opensymbol': [
1.45974 + 0.8333,
1.45975 + 0.1667,
1.45976 + 0
1.45977 + ],
1.45978 + 'gentium book basic': [
1.45979 + 0.8333,
1.45980 + 0.25,
1.45981 + 0
1.45982 + ],
1.45983 + 'dejavu sans mono': [
1.45984 + 0.9167,
1.45985 + 0.25,
1.45986 + 0
1.45987 + ],
1.45988 + 'dejavu serif': [
1.45989 + 0.9167,
1.45990 + 0.25,
1.45991 + 0
1.45992 + ],
1.45993 + 'calibri light': [
1.45994 + 0.9167,
1.45995 + 0.25,
1.45996 + 0
1.45997 + ]
1.45998 + };
1.45999 + var DEVICE_FONT_METRICS_MAC = {
1.46000 + 'al bayan plain': [
1.46001 + 1,
1.46002 + 0.5,
1.46003 + 0
1.46004 + ],
1.46005 + 'al bayan bold': [
1.46006 + 1,
1.46007 + 0.5833,
1.46008 + 0
1.46009 + ],
1.46010 + 'american typewriter': [
1.46011 + 0.9167,
1.46012 + 0.25,
1.46013 + 0
1.46014 + ],
1.46015 + 'american typewriter bold': [
1.46016 + 0.9167,
1.46017 + 0.25,
1.46018 + 0
1.46019 + ],
1.46020 + 'american typewriter condensed': [
1.46021 + 0.9167,
1.46022 + 0.25,
1.46023 + 0
1.46024 + ],
1.46025 + 'american typewriter condensed bold': [
1.46026 + 0.9167,
1.46027 + 0.25,
1.46028 + 0
1.46029 + ],
1.46030 + 'american typewriter condensed light': [
1.46031 + 0.8333,
1.46032 + 0.25,
1.46033 + 0
1.46034 + ],
1.46035 + 'american typewriter light': [
1.46036 + 0.9167,
1.46037 + 0.25,
1.46038 + 0
1.46039 + ],
1.46040 + 'andale mono': [
1.46041 + 0.9167,
1.46042 + 0.25,
1.46043 + 0
1.46044 + ],
1.46045 + 'apple symbols': [
1.46046 + 0.6667,
1.46047 + 0.25,
1.46048 + 0
1.46049 + ],
1.46050 + 'arial bold italic': [
1.46051 + 0.9167,
1.46052 + 0.25,
1.46053 + 0
1.46054 + ],
1.46055 + 'arial bold': [
1.46056 + 0.9167,
1.46057 + 0.25,
1.46058 + 0
1.46059 + ],
1.46060 + 'arial italic': [
1.46061 + 0.9167,
1.46062 + 0.25,
1.46063 + 0
1.46064 + ],
1.46065 + 'arial hebrew': [
1.46066 + 0.75,
1.46067 + 0.3333,
1.46068 + 0
1.46069 + ],
1.46070 + 'arial hebrew bold': [
1.46071 + 0.75,
1.46072 + 0.3333,
1.46073 + 0
1.46074 + ],
1.46075 + 'arial': [
1.46076 + 0.9167,
1.46077 + 0.25,
1.46078 + 0
1.46079 + ],
1.46080 + 'arial narrow': [
1.46081 + 0.9167,
1.46082 + 0.25,
1.46083 + 0
1.46084 + ],
1.46085 + 'arial narrow bold': [
1.46086 + 0.9167,
1.46087 + 0.25,
1.46088 + 0
1.46089 + ],
1.46090 + 'arial narrow bold italic': [
1.46091 + 0.9167,
1.46092 + 0.25,
1.46093 + 0
1.46094 + ],
1.46095 + 'arial narrow italic': [
1.46096 + 0.9167,
1.46097 + 0.25,
1.46098 + 0
1.46099 + ],
1.46100 + 'arial rounded mt bold': [
1.46101 + 0.9167,
1.46102 + 0.25,
1.46103 + 0
1.46104 + ],
1.46105 + 'arial unicode ms': [
1.46106 + 1.0833,
1.46107 + 0.25,
1.46108 + 0
1.46109 + ],
1.46110 + 'avenir black': [
1.46111 + 1,
1.46112 + 0.3333,
1.46113 + 0
1.46114 + ],
1.46115 + 'avenir black oblique': [
1.46116 + 1,
1.46117 + 0.3333,
1.46118 + 0
1.46119 + ],
1.46120 + 'avenir book': [
1.46121 + 1,
1.46122 + 0.3333,
1.46123 + 0
1.46124 + ],
1.46125 + 'avenir book oblique': [
1.46126 + 1,
1.46127 + 0.3333,
1.46128 + 0
1.46129 + ],
1.46130 + 'avenir heavy': [
1.46131 + 1,
1.46132 + 0.3333,
1.46133 + 0
1.46134 + ],
1.46135 + 'avenir heavy oblique': [
1.46136 + 1,
1.46137 + 0.3333,
1.46138 + 0
1.46139 + ],
1.46140 + 'avenir light': [
1.46141 + 1,
1.46142 + 0.3333,
1.46143 + 0
1.46144 + ],
1.46145 + 'avenir light oblique': [
1.46146 + 1,
1.46147 + 0.3333,
1.46148 + 0
1.46149 + ],
1.46150 + 'avenir medium': [
1.46151 + 1,
1.46152 + 0.3333,
1.46153 + 0
1.46154 + ],
1.46155 + 'avenir medium oblique': [
1.46156 + 1,
1.46157 + 0.3333,
1.46158 + 0
1.46159 + ],
1.46160 + 'avenir oblique': [
1.46161 + 1,
1.46162 + 0.3333,
1.46163 + 0
1.46164 + ],
1.46165 + 'avenir roman': [
1.46166 + 1,
1.46167 + 0.3333,
1.46168 + 0
1.46169 + ],
1.46170 + 'avenir next bold': [
1.46171 + 1,
1.46172 + 0.3333,
1.46173 + 0
1.46174 + ],
1.46175 + 'avenir next bold italic': [
1.46176 + 1,
1.46177 + 0.3333,
1.46178 + 0
1.46179 + ],
1.46180 + 'avenir next demi bold': [
1.46181 + 1,
1.46182 + 0.3333,
1.46183 + 0
1.46184 + ],
1.46185 + 'avenir next demi bold italic': [
1.46186 + 1,
1.46187 + 0.3333,
1.46188 + 0
1.46189 + ],
1.46190 + 'avenir next heavy': [
1.46191 + 1,
1.46192 + 0.3333,
1.46193 + 0
1.46194 + ],
1.46195 + 'avenir next heavy italic': [
1.46196 + 1,
1.46197 + 0.3333,
1.46198 + 0
1.46199 + ],
1.46200 + 'avenir next italic': [
1.46201 + 1,
1.46202 + 0.3333,
1.46203 + 0
1.46204 + ],
1.46205 + 'avenir next medium': [
1.46206 + 1,
1.46207 + 0.3333,
1.46208 + 0
1.46209 + ],
1.46210 + 'avenir next medium italic': [
1.46211 + 1,
1.46212 + 0.3333,
1.46213 + 0
1.46214 + ],
1.46215 + 'avenir next regular': [
1.46216 + 1,
1.46217 + 0.3333,
1.46218 + 0
1.46219 + ],
1.46220 + 'avenir next ultra light': [
1.46221 + 1,
1.46222 + 0.3333,
1.46223 + 0
1.46224 + ],
1.46225 + 'avenir next ultra light italic': [
1.46226 + 1,
1.46227 + 0.3333,
1.46228 + 0
1.46229 + ],
1.46230 + 'avenir next condensed bold': [
1.46231 + 1,
1.46232 + 0.3333,
1.46233 + 0
1.46234 + ],
1.46235 + 'avenir next condensed bold italic': [
1.46236 + 1,
1.46237 + 0.3333,
1.46238 + 0
1.46239 + ],
1.46240 + 'avenir next condensed demi bold': [
1.46241 + 1,
1.46242 + 0.3333,
1.46243 + 0
1.46244 + ],
1.46245 + 'avenir next condensed demi bold italic': [
1.46246 + 1,
1.46247 + 0.3333,
1.46248 + 0
1.46249 + ],
1.46250 + 'avenir next condensed heavy': [
1.46251 + 1,
1.46252 + 0.3333,
1.46253 + 0
1.46254 + ],
1.46255 + 'avenir next condensed heavy italic': [
1.46256 + 1,
1.46257 + 0.3333,
1.46258 + 0
1.46259 + ],
1.46260 + 'avenir next condensed italic': [
1.46261 + 1,
1.46262 + 0.3333,
1.46263 + 0
1.46264 + ],
1.46265 + 'avenir next condensed medium': [
1.46266 + 1,
1.46267 + 0.3333,
1.46268 + 0
1.46269 + ],
1.46270 + 'avenir next condensed medium italic': [
1.46271 + 1,
1.46272 + 0.3333,
1.46273 + 0
1.46274 + ],
1.46275 + 'avenir next condensed regular': [
1.46276 + 1,
1.46277 + 0.3333,
1.46278 + 0
1.46279 + ],
1.46280 + 'avenir next condensed ultra light': [
1.46281 + 1,
1.46282 + 0.3333,
1.46283 + 0
1.46284 + ],
1.46285 + 'avenir next condensed ultra light italic': [
1.46286 + 1,
1.46287 + 0.3333,
1.46288 + 0
1.46289 + ],
1.46290 + 'ayuthaya': [
1.46291 + 1.0833,
1.46292 + 0.3333,
1.46293 + 0
1.46294 + ],
1.46295 + 'baghdad': [
1.46296 + 0.9167,
1.46297 + 0.4167,
1.46298 + 0
1.46299 + ],
1.46300 + 'bangla mn': [
1.46301 + 0.9167,
1.46302 + 0.6667,
1.46303 + 0
1.46304 + ],
1.46305 + 'bangla mn bold': [
1.46306 + 0.9167,
1.46307 + 0.6667,
1.46308 + 0
1.46309 + ],
1.46310 + 'bangla sangam mn': [
1.46311 + 0.9167,
1.46312 + 0.4167,
1.46313 + 0
1.46314 + ],
1.46315 + 'bangla sangam mn bold': [
1.46316 + 0.9167,
1.46317 + 0.4167,
1.46318 + 0
1.46319 + ],
1.46320 + 'baskerville': [
1.46321 + 0.9167,
1.46322 + 0.25,
1.46323 + 0
1.46324 + ],
1.46325 + 'baskerville bold': [
1.46326 + 0.9167,
1.46327 + 0.25,
1.46328 + 0
1.46329 + ],
1.46330 + 'baskerville bold italic': [
1.46331 + 0.9167,
1.46332 + 0.25,
1.46333 + 0
1.46334 + ],
1.46335 + 'baskerville italic': [
1.46336 + 0.9167,
1.46337 + 0.25,
1.46338 + 0
1.46339 + ],
1.46340 + 'baskerville semibold': [
1.46341 + 0.9167,
1.46342 + 0.25,
1.46343 + 0
1.46344 + ],
1.46345 + 'baskerville semibold italic': [
1.46346 + 0.9167,
1.46347 + 0.25,
1.46348 + 0
1.46349 + ],
1.46350 + 'big caslon medium': [
1.46351 + 0.9167,
1.46352 + 0.25,
1.46353 + 0
1.46354 + ],
1.46355 + 'brush script mt italic': [
1.46356 + 0.9167,
1.46357 + 0.3333,
1.46358 + 0
1.46359 + ],
1.46360 + 'chalkboard': [
1.46361 + 1,
1.46362 + 0.25,
1.46363 + 0
1.46364 + ],
1.46365 + 'chalkboard bold': [
1.46366 + 1,
1.46367 + 0.25,
1.46368 + 0
1.46369 + ],
1.46370 + 'chalkboard se bold': [
1.46371 + 1.1667,
1.46372 + 0.25,
1.46373 + 0
1.46374 + ],
1.46375 + 'chalkboard se light': [
1.46376 + 1.1667,
1.46377 + 0.25,
1.46378 + 0
1.46379 + ],
1.46380 + 'chalkboard se regular': [
1.46381 + 1.1667,
1.46382 + 0.25,
1.46383 + 0
1.46384 + ],
1.46385 + 'chalkduster': [
1.46386 + 1,
1.46387 + 0.25,
1.46388 + 0
1.46389 + ],
1.46390 + 'charcoal cy': [
1.46391 + 1,
1.46392 + 0.25,
1.46393 + 0
1.46394 + ],
1.46395 + 'cochin': [
1.46396 + 0.9167,
1.46397 + 0.25,
1.46398 + 0
1.46399 + ],
1.46400 + 'cochin bold': [
1.46401 + 0.9167,
1.46402 + 0.25,
1.46403 + 0
1.46404 + ],
1.46405 + 'cochin bold italic': [
1.46406 + 0.9167,
1.46407 + 0.25,
1.46408 + 0
1.46409 + ],
1.46410 + 'cochin italic': [
1.46411 + 0.9167,
1.46412 + 0.25,
1.46413 + 0
1.46414 + ],
1.46415 + 'comic sans ms': [
1.46416 + 1.0833,
1.46417 + 0.25,
1.46418 + 0
1.46419 + ],
1.46420 + 'comic sans ms bold': [
1.46421 + 1.0833,
1.46422 + 0.25,
1.46423 + 0
1.46424 + ],
1.46425 + 'copperplate': [
1.46426 + 0.75,
1.46427 + 0.25,
1.46428 + 0
1.46429 + ],
1.46430 + 'copperplate bold': [
1.46431 + 0.75,
1.46432 + 0.25,
1.46433 + 0
1.46434 + ],
1.46435 + 'copperplate light': [
1.46436 + 0.75,
1.46437 + 0.25,
1.46438 + 0
1.46439 + ],
1.46440 + 'corsiva hebrew': [
1.46441 + 0.6667,
1.46442 + 0.3333,
1.46443 + 0
1.46444 + ],
1.46445 + 'corsiva hebrew bold': [
1.46446 + 0.6667,
1.46447 + 0.3333,
1.46448 + 0
1.46449 + ],
1.46450 + 'courier': [
1.46451 + 0.75,
1.46452 + 0.25,
1.46453 + 0
1.46454 + ],
1.46455 + 'courier bold': [
1.46456 + 0.75,
1.46457 + 0.25,
1.46458 + 0
1.46459 + ],
1.46460 + 'courier bold oblique': [
1.46461 + 0.75,
1.46462 + 0.25,
1.46463 + 0
1.46464 + ],
1.46465 + 'courier oblique': [
1.46466 + 0.75,
1.46467 + 0.25,
1.46468 + 0
1.46469 + ],
1.46470 + 'courier new bold italic': [
1.46471 + 0.8333,
1.46472 + 0.3333,
1.46473 + 0
1.46474 + ],
1.46475 + 'courier new bold': [
1.46476 + 0.8333,
1.46477 + 0.3333,
1.46478 + 0
1.46479 + ],
1.46480 + 'courier new italic': [
1.46481 + 0.8333,
1.46482 + 0.3333,
1.46483 + 0
1.46484 + ],
1.46485 + 'courier new': [
1.46486 + 0.8333,
1.46487 + 0.3333,
1.46488 + 0
1.46489 + ],
1.46490 + 'biaukai': [
1.46491 + 0.8333,
1.46492 + 0.1667,
1.46493 + 0
1.46494 + ],
1.46495 + 'damascus': [
1.46496 + 0.5833,
1.46497 + 0.4167,
1.46498 + 0
1.46499 + ],
1.46500 + 'damascus bold': [
1.46501 + 0.5833,
1.46502 + 0.4167,
1.46503 + 0
1.46504 + ],
1.46505 + 'decotype naskh': [
1.46506 + 1.1667,
1.46507 + 0.6667,
1.46508 + 0
1.46509 + ],
1.46510 + 'devanagari mt': [
1.46511 + 0.9167,
1.46512 + 0.6667,
1.46513 + 0
1.46514 + ],
1.46515 + 'devanagari mt bold': [
1.46516 + 0.9167,
1.46517 + 0.6667,
1.46518 + 0
1.46519 + ],
1.46520 + 'devanagari sangam mn': [
1.46521 + 0.9167,
1.46522 + 0.4167,
1.46523 + 0
1.46524 + ],
1.46525 + 'devanagari sangam mn bold': [
1.46526 + 0.9167,
1.46527 + 0.4167,
1.46528 + 0
1.46529 + ],
1.46530 + 'didot': [
1.46531 + 0.9167,
1.46532 + 0.3333,
1.46533 + 0
1.46534 + ],
1.46535 + 'didot bold': [
1.46536 + 1,
1.46537 + 0.3333,
1.46538 + 0
1.46539 + ],
1.46540 + 'didot italic': [
1.46541 + 0.9167,
1.46542 + 0.25,
1.46543 + 0
1.46544 + ],
1.46545 + 'euphemia ucas': [
1.46546 + 1.0833,
1.46547 + 0.25,
1.46548 + 0
1.46549 + ],
1.46550 + 'euphemia ucas bold': [
1.46551 + 1.0833,
1.46552 + 0.25,
1.46553 + 0
1.46554 + ],
1.46555 + 'euphemia ucas italic': [
1.46556 + 1.0833,
1.46557 + 0.25,
1.46558 + 0
1.46559 + ],
1.46560 + 'futura condensed extrabold': [
1.46561 + 1,
1.46562 + 0.25,
1.46563 + 0
1.46564 + ],
1.46565 + 'futura condensed medium': [
1.46566 + 1,
1.46567 + 0.25,
1.46568 + 0
1.46569 + ],
1.46570 + 'futura medium': [
1.46571 + 1,
1.46572 + 0.25,
1.46573 + 0
1.46574 + ],
1.46575 + 'futura medium italic': [
1.46576 + 1,
1.46577 + 0.25,
1.46578 + 0
1.46579 + ],
1.46580 + 'gb18030 bitmap': [
1.46581 + 1,
1.46582 + 0.6667,
1.46583 + 0
1.46584 + ],
1.46585 + 'geeza pro': [
1.46586 + 0.9167,
1.46587 + 0.3333,
1.46588 + 0
1.46589 + ],
1.46590 + 'geeza pro bold': [
1.46591 + 0.9167,
1.46592 + 0.3333,
1.46593 + 0
1.46594 + ],
1.46595 + 'geneva': [
1.46596 + 1,
1.46597 + 0.25,
1.46598 + 0
1.46599 + ],
1.46600 + 'geneva cy': [
1.46601 + 1,
1.46602 + 0.25,
1.46603 + 0
1.46604 + ],
1.46605 + 'georgia': [
1.46606 + 0.9167,
1.46607 + 0.25,
1.46608 + 0
1.46609 + ],
1.46610 + 'georgia bold': [
1.46611 + 0.9167,
1.46612 + 0.25,
1.46613 + 0
1.46614 + ],
1.46615 + 'georgia bold italic': [
1.46616 + 0.9167,
1.46617 + 0.25,
1.46618 + 0
1.46619 + ],
1.46620 + 'georgia italic': [
1.46621 + 0.9167,
1.46622 + 0.25,
1.46623 + 0
1.46624 + ],
1.46625 + 'gill sans': [
1.46626 + 0.9167,
1.46627 + 0.25,
1.46628 + 0
1.46629 + ],
1.46630 + 'gill sans bold': [
1.46631 + 0.9167,
1.46632 + 0.25,
1.46633 + 0
1.46634 + ],
1.46635 + 'gill sans bold italic': [
1.46636 + 0.9167,
1.46637 + 0.25,
1.46638 + 0
1.46639 + ],
1.46640 + 'gill sans italic': [
1.46641 + 0.9167,
1.46642 + 0.25,
1.46643 + 0
1.46644 + ],
1.46645 + 'gill sans light': [
1.46646 + 0.9167,
1.46647 + 0.25,
1.46648 + 0
1.46649 + ],
1.46650 + 'gill sans light italic': [
1.46651 + 0.9167,
1.46652 + 0.25,
1.46653 + 0
1.46654 + ],
1.46655 + 'gujarati mt': [
1.46656 + 0.9167,
1.46657 + 0.6667,
1.46658 + 0
1.46659 + ],
1.46660 + 'gujarati mt bold': [
1.46661 + 0.9167,
1.46662 + 0.6667,
1.46663 + 0
1.46664 + ],
1.46665 + 'gujarati sangam mn': [
1.46666 + 0.8333,
1.46667 + 0.4167,
1.46668 + 0
1.46669 + ],
1.46670 + 'gujarati sangam mn bold': [
1.46671 + 0.8333,
1.46672 + 0.4167,
1.46673 + 0
1.46674 + ],
1.46675 + 'gurmukhi mn': [
1.46676 + 0.9167,
1.46677 + 0.25,
1.46678 + 0
1.46679 + ],
1.46680 + 'gurmukhi mn bold': [
1.46681 + 0.9167,
1.46682 + 0.25,
1.46683 + 0
1.46684 + ],
1.46685 + 'gurmukhi sangam mn': [
1.46686 + 0.9167,
1.46687 + 0.3333,
1.46688 + 0
1.46689 + ],
1.46690 + 'gurmukhi sangam mn bold': [
1.46691 + 0.9167,
1.46692 + 0.3333,
1.46693 + 0
1.46694 + ],
1.46695 + 'helvetica': [
1.46696 + 0.75,
1.46697 + 0.25,
1.46698 + 0
1.46699 + ],
1.46700 + 'helvetica bold': [
1.46701 + 0.75,
1.46702 + 0.25,
1.46703 + 0
1.46704 + ],
1.46705 + 'helvetica bold oblique': [
1.46706 + 0.75,
1.46707 + 0.25,
1.46708 + 0
1.46709 + ],
1.46710 + 'helvetica light': [
1.46711 + 0.75,
1.46712 + 0.25,
1.46713 + 0
1.46714 + ],
1.46715 + 'helvetica light oblique': [
1.46716 + 0.75,
1.46717 + 0.25,
1.46718 + 0
1.46719 + ],
1.46720 + 'helvetica oblique': [
1.46721 + 0.75,
1.46722 + 0.25,
1.46723 + 0
1.46724 + ],
1.46725 + 'helvetica neue': [
1.46726 + 0.9167,
1.46727 + 0.25,
1.46728 + 0
1.46729 + ],
1.46730 + 'helvetica neue bold': [
1.46731 + 1,
1.46732 + 0.25,
1.46733 + 0
1.46734 + ],
1.46735 + 'helvetica neue bold italic': [
1.46736 + 1,
1.46737 + 0.25,
1.46738 + 0
1.46739 + ],
1.46740 + 'helvetica neue condensed black': [
1.46741 + 1,
1.46742 + 0.25,
1.46743 + 0
1.46744 + ],
1.46745 + 'helvetica neue condensed bold': [
1.46746 + 1,
1.46747 + 0.25,
1.46748 + 0
1.46749 + ],
1.46750 + 'helvetica neue italic': [
1.46751 + 0.9167,
1.46752 + 0.25,
1.46753 + 0
1.46754 + ],
1.46755 + 'helvetica neue light': [
1.46756 + 1,
1.46757 + 0.25,
1.46758 + 0
1.46759 + ],
1.46760 + 'helvetica neue light italic': [
1.46761 + 0.9167,
1.46762 + 0.25,
1.46763 + 0
1.46764 + ],
1.46765 + 'helvetica neue medium': [
1.46766 + 1,
1.46767 + 0.25,
1.46768 + 0
1.46769 + ],
1.46770 + 'helvetica neue ultralight': [
1.46771 + 0.9167,
1.46772 + 0.25,
1.46773 + 0
1.46774 + ],
1.46775 + 'helvetica neue ultralight italic': [
1.46776 + 0.9167,
1.46777 + 0.25,
1.46778 + 0
1.46779 + ],
1.46780 + 'herculanum': [
1.46781 + 0.8333,
1.46782 + 0.1667,
1.46783 + 0
1.46784 + ],
1.46785 + 'hiragino kaku gothic pro w3': [
1.46786 + 0.9167,
1.46787 + 0.0833,
1.46788 + 0
1.46789 + ],
1.46790 + 'hiragino kaku gothic pro w6': [
1.46791 + 0.9167,
1.46792 + 0.0833,
1.46793 + 0
1.46794 + ],
1.46795 + 'hiragino kaku gothic pron w3': [
1.46796 + 0.9167,
1.46797 + 0.0833,
1.46798 + 0
1.46799 + ],
1.46800 + 'hiragino kaku gothic pron w6': [
1.46801 + 0.9167,
1.46802 + 0.0833,
1.46803 + 0
1.46804 + ],
1.46805 + 'hiragino kaku gothic std w8': [
1.46806 + 0.9167,
1.46807 + 0.0833,
1.46808 + 0
1.46809 + ],
1.46810 + 'hiragino kaku gothic stdn w8': [
1.46811 + 0.9167,
1.46812 + 0.0833,
1.46813 + 0
1.46814 + ],
1.46815 + 'hiragino maru gothic pro w4': [
1.46816 + 0.9167,
1.46817 + 0.0833,
1.46818 + 0
1.46819 + ],
1.46820 + 'hiragino maru gothic pron w4': [
1.46821 + 0.9167,
1.46822 + 0.0833,
1.46823 + 0
1.46824 + ],
1.46825 + 'hiragino mincho pro w3': [
1.46826 + 0.9167,
1.46827 + 0.0833,
1.46828 + 0
1.46829 + ],
1.46830 + 'hiragino mincho pro w6': [
1.46831 + 0.9167,
1.46832 + 0.0833,
1.46833 + 0
1.46834 + ],
1.46835 + 'hiragino mincho pron w3': [
1.46836 + 0.9167,
1.46837 + 0.0833,
1.46838 + 0
1.46839 + ],
1.46840 + 'hiragino mincho pron w6': [
1.46841 + 0.9167,
1.46842 + 0.0833,
1.46843 + 0
1.46844 + ],
1.46845 + 'hiragino sans gb w3': [
1.46846 + 0.9167,
1.46847 + 0.0833,
1.46848 + 0
1.46849 + ],
1.46850 + 'hiragino sans gb w6': [
1.46851 + 0.9167,
1.46852 + 0.0833,
1.46853 + 0
1.46854 + ],
1.46855 + 'hoefler text black': [
1.46856 + 0.75,
1.46857 + 0.25,
1.46858 + 0
1.46859 + ],
1.46860 + 'hoefler text black italic': [
1.46861 + 0.75,
1.46862 + 0.25,
1.46863 + 0
1.46864 + ],
1.46865 + 'hoefler text italic': [
1.46866 + 0.75,
1.46867 + 0.25,
1.46868 + 0
1.46869 + ],
1.46870 + 'hoefler text ornaments': [
1.46871 + 0.8333,
1.46872 + 0.1667,
1.46873 + 0
1.46874 + ],
1.46875 + 'hoefler text': [
1.46876 + 0.75,
1.46877 + 0.25,
1.46878 + 0
1.46879 + ],
1.46880 + 'impact': [
1.46881 + 1,
1.46882 + 0.25,
1.46883 + 0
1.46884 + ],
1.46885 + 'inaimathi': [
1.46886 + 0.8333,
1.46887 + 0.4167,
1.46888 + 0
1.46889 + ],
1.46890 + 'headlinea regular': [
1.46891 + 0.8333,
1.46892 + 0.1667,
1.46893 + 0
1.46894 + ],
1.46895 + 'pilgi regular': [
1.46896 + 0.8333,
1.46897 + 0.25,
1.46898 + 0
1.46899 + ],
1.46900 + 'gungseo regular': [
1.46901 + 0.8333,
1.46902 + 0.25,
1.46903 + 0
1.46904 + ],
1.46905 + 'pcmyungjo regular': [
1.46906 + 0.8333,
1.46907 + 0.25,
1.46908 + 0
1.46909 + ],
1.46910 + 'kailasa regular': [
1.46911 + 1.0833,
1.46912 + 0.5833,
1.46913 + 0
1.46914 + ],
1.46915 + 'kannada mn': [
1.46916 + 0.9167,
1.46917 + 0.25,
1.46918 + 0
1.46919 + ],
1.46920 + 'kannada mn bold': [
1.46921 + 0.9167,
1.46922 + 0.25,
1.46923 + 0
1.46924 + ],
1.46925 + 'kannada sangam mn': [
1.46926 + 1,
1.46927 + 0.5833,
1.46928 + 0
1.46929 + ],
1.46930 + 'kannada sangam mn bold': [
1.46931 + 1,
1.46932 + 0.5833,
1.46933 + 0
1.46934 + ],
1.46935 + 'kefa bold': [
1.46936 + 0.9167,
1.46937 + 0.25,
1.46938 + 0
1.46939 + ],
1.46940 + 'kefa regular': [
1.46941 + 0.9167,
1.46942 + 0.25,
1.46943 + 0
1.46944 + ],
1.46945 + 'khmer mn': [
1.46946 + 1,
1.46947 + 0.6667,
1.46948 + 0
1.46949 + ],
1.46950 + 'khmer mn bold': [
1.46951 + 1,
1.46952 + 0.6667,
1.46953 + 0
1.46954 + ],
1.46955 + 'khmer sangam mn': [
1.46956 + 1.0833,
1.46957 + 0.6667,
1.46958 + 0
1.46959 + ],
1.46960 + 'kokonor regular': [
1.46961 + 1.0833,
1.46962 + 0.5833,
1.46963 + 0
1.46964 + ],
1.46965 + 'krungthep': [
1.46966 + 1,
1.46967 + 0.25,
1.46968 + 0
1.46969 + ],
1.46970 + 'kufistandardgk': [
1.46971 + 0.9167,
1.46972 + 0.5,
1.46973 + 0
1.46974 + ],
1.46975 + 'lao mn': [
1.46976 + 0.9167,
1.46977 + 0.4167,
1.46978 + 0
1.46979 + ],
1.46980 + 'lao mn bold': [
1.46981 + 0.9167,
1.46982 + 0.4167,
1.46983 + 0
1.46984 + ],
1.46985 + 'lao sangam mn': [
1.46986 + 1,
1.46987 + 0.3333,
1.46988 + 0
1.46989 + ],
1.46990 + 'apple ligothic medium': [
1.46991 + 0.8333,
1.46992 + 0.1667,
1.46993 + 0
1.46994 + ],
1.46995 + 'lihei pro': [
1.46996 + 0.8333,
1.46997 + 0.1667,
1.46998 + 0
1.46999 + ],
1.47000 + 'lisong pro': [
1.47001 + 0.8333,
1.47002 + 0.1667,
1.47003 + 0
1.47004 + ],
1.47005 + 'lucida grande': [
1.47006 + 1,
1.47007 + 0.25,
1.47008 + 0
1.47009 + ],
1.47010 + 'lucida grande bold': [
1.47011 + 1,
1.47012 + 0.25,
1.47013 + 0
1.47014 + ],
1.47015 + 'malayalam mn': [
1.47016 + 1,
1.47017 + 0.4167,
1.47018 + 0
1.47019 + ],
1.47020 + 'malayalam mn bold': [
1.47021 + 1,
1.47022 + 0.4167,
1.47023 + 0
1.47024 + ],
1.47025 + 'malayalam sangam mn': [
1.47026 + 0.8333,
1.47027 + 0.4167,
1.47028 + 0
1.47029 + ],
1.47030 + 'malayalam sangam mn bold': [
1.47031 + 0.8333,
1.47032 + 0.4167,
1.47033 + 0
1.47034 + ],
1.47035 + 'marion bold': [
1.47036 + 0.6667,
1.47037 + 0.3333,
1.47038 + 0
1.47039 + ],
1.47040 + 'marion italic': [
1.47041 + 0.6667,
1.47042 + 0.3333,
1.47043 + 0
1.47044 + ],
1.47045 + 'marion regular': [
1.47046 + 0.6667,
1.47047 + 0.3333,
1.47048 + 0
1.47049 + ],
1.47050 + 'marker felt thin': [
1.47051 + 0.8333,
1.47052 + 0.25,
1.47053 + 0
1.47054 + ],
1.47055 + 'marker felt wide': [
1.47056 + 0.9167,
1.47057 + 0.25,
1.47058 + 0
1.47059 + ],
1.47060 + 'menlo bold': [
1.47061 + 0.9167,
1.47062 + 0.25,
1.47063 + 0
1.47064 + ],
1.47065 + 'menlo bold italic': [
1.47066 + 0.9167,
1.47067 + 0.25,
1.47068 + 0
1.47069 + ],
1.47070 + 'menlo italic': [
1.47071 + 0.9167,
1.47072 + 0.25,
1.47073 + 0
1.47074 + ],
1.47075 + 'menlo regular': [
1.47076 + 0.9167,
1.47077 + 0.25,
1.47078 + 0
1.47079 + ],
1.47080 + 'microsoft sans serif': [
1.47081 + 0.9167,
1.47082 + 0.25,
1.47083 + 0
1.47084 + ],
1.47085 + 'monaco': [
1.47086 + 1,
1.47087 + 0.25,
1.47088 + 0
1.47089 + ],
1.47090 + 'gurmukhi mt': [
1.47091 + 0.8333,
1.47092 + 0.4167,
1.47093 + 0
1.47094 + ],
1.47095 + 'mshtakan': [
1.47096 + 0.9167,
1.47097 + 0.25,
1.47098 + 0
1.47099 + ],
1.47100 + 'mshtakan bold': [
1.47101 + 0.9167,
1.47102 + 0.25,
1.47103 + 0
1.47104 + ],
1.47105 + 'mshtakan boldoblique': [
1.47106 + 0.9167,
1.47107 + 0.25,
1.47108 + 0
1.47109 + ],
1.47110 + 'mshtakan oblique': [
1.47111 + 0.9167,
1.47112 + 0.25,
1.47113 + 0
1.47114 + ],
1.47115 + 'myanmar mn': [
1.47116 + 1,
1.47117 + 0.4167,
1.47118 + 0
1.47119 + ],
1.47120 + 'myanmar mn bold': [
1.47121 + 1,
1.47122 + 0.4167,
1.47123 + 0
1.47124 + ],
1.47125 + 'myanmar sangam mn': [
1.47126 + 0.9167,
1.47127 + 0.4167,
1.47128 + 0
1.47129 + ],
1.47130 + 'nadeem': [
1.47131 + 0.9167,
1.47132 + 0.4167,
1.47133 + 0
1.47134 + ],
1.47135 + 'nanum brush script': [
1.47136 + 0.9167,
1.47137 + 0.25,
1.47138 + 0
1.47139 + ],
1.47140 + 'nanumgothic': [
1.47141 + 0.9167,
1.47142 + 0.25,
1.47143 + 0
1.47144 + ],
1.47145 + 'nanumgothic bold': [
1.47146 + 0.9167,
1.47147 + 0.25,
1.47148 + 0
1.47149 + ],
1.47150 + 'nanumgothic extrabold': [
1.47151 + 0.9167,
1.47152 + 0.25,
1.47153 + 0
1.47154 + ],
1.47155 + 'nanummyeongjo': [
1.47156 + 0.9167,
1.47157 + 0.25,
1.47158 + 0
1.47159 + ],
1.47160 + 'nanummyeongjo bold': [
1.47161 + 0.9167,
1.47162 + 0.25,
1.47163 + 0
1.47164 + ],
1.47165 + 'nanummyeongjo extrabold': [
1.47166 + 0.9167,
1.47167 + 0.25,
1.47168 + 0
1.47169 + ],
1.47170 + 'nanum pen script': [
1.47171 + 0.9167,
1.47172 + 0.25,
1.47173 + 0
1.47174 + ],
1.47175 + 'optima bold': [
1.47176 + 0.9167,
1.47177 + 0.25,
1.47178 + 0
1.47179 + ],
1.47180 + 'optima bold italic': [
1.47181 + 0.9167,
1.47182 + 0.25,
1.47183 + 0
1.47184 + ],
1.47185 + 'optima extrablack': [
1.47186 + 1,
1.47187 + 0.25,
1.47188 + 0
1.47189 + ],
1.47190 + 'optima italic': [
1.47191 + 0.9167,
1.47192 + 0.25,
1.47193 + 0
1.47194 + ],
1.47195 + 'optima regular': [
1.47196 + 0.9167,
1.47197 + 0.25,
1.47198 + 0
1.47199 + ],
1.47200 + 'oriya mn': [
1.47201 + 0.9167,
1.47202 + 0.25,
1.47203 + 0
1.47204 + ],
1.47205 + 'oriya mn bold': [
1.47206 + 0.9167,
1.47207 + 0.25,
1.47208 + 0
1.47209 + ],
1.47210 + 'oriya sangam mn': [
1.47211 + 0.8333,
1.47212 + 0.4167,
1.47213 + 0
1.47214 + ],
1.47215 + 'oriya sangam mn bold': [
1.47216 + 0.8333,
1.47217 + 0.4167,
1.47218 + 0
1.47219 + ],
1.47220 + 'osaka': [
1.47221 + 1,
1.47222 + 0.25,
1.47223 + 0
1.47224 + ],
1.47225 + 'osaka-mono': [
1.47226 + 0.8333,
1.47227 + 0.1667,
1.47228 + 0
1.47229 + ],
1.47230 + 'palatino bold': [
1.47231 + 0.8333,
1.47232 + 0.25,
1.47233 + 0
1.47234 + ],
1.47235 + 'palatino bold italic': [
1.47236 + 0.8333,
1.47237 + 0.25,
1.47238 + 0
1.47239 + ],
1.47240 + 'palatino italic': [
1.47241 + 0.8333,
1.47242 + 0.25,
1.47243 + 0
1.47244 + ],
1.47245 + 'palatino': [
1.47246 + 0.8333,
1.47247 + 0.25,
1.47248 + 0
1.47249 + ],
1.47250 + 'papyrus': [
1.47251 + 0.9167,
1.47252 + 0.5833,
1.47253 + 0
1.47254 + ],
1.47255 + 'papyrus condensed': [
1.47256 + 0.9167,
1.47257 + 0.5833,
1.47258 + 0
1.47259 + ],
1.47260 + 'plantagenet cherokee': [
1.47261 + 0.6667,
1.47262 + 0.25,
1.47263 + 0
1.47264 + ],
1.47265 + 'raanana': [
1.47266 + 0.75,
1.47267 + 0.25,
1.47268 + 0
1.47269 + ],
1.47270 + 'raanana bold': [
1.47271 + 0.75,
1.47272 + 0.25,
1.47273 + 0
1.47274 + ],
1.47275 + 'hei regular': [
1.47276 + 0.8333,
1.47277 + 0.1667,
1.47278 + 0
1.47279 + ],
1.47280 + 'kai regular': [
1.47281 + 0.8333,
1.47282 + 0.1667,
1.47283 + 0
1.47284 + ],
1.47285 + 'stfangsong': [
1.47286 + 0.8333,
1.47287 + 0.1667,
1.47288 + 0
1.47289 + ],
1.47290 + 'stheiti': [
1.47291 + 0.8333,
1.47292 + 0.1667,
1.47293 + 0
1.47294 + ],
1.47295 + 'heiti sc light': [
1.47296 + 0.8333,
1.47297 + 0.1667,
1.47298 + 0
1.47299 + ],
1.47300 + 'heiti sc medium': [
1.47301 + 0.8333,
1.47302 + 0.1667,
1.47303 + 0
1.47304 + ],
1.47305 + 'heiti tc light': [
1.47306 + 0.8333,
1.47307 + 0.1667,
1.47308 + 0
1.47309 + ],
1.47310 + 'heiti tc medium': [
1.47311 + 0.8333,
1.47312 + 0.1667,
1.47313 + 0
1.47314 + ],
1.47315 + 'stkaiti': [
1.47316 + 0.8333,
1.47317 + 0.1667,
1.47318 + 0
1.47319 + ],
1.47320 + 'kaiti sc black': [
1.47321 + 1.0833,
1.47322 + 0.3333,
1.47323 + 0
1.47324 + ],
1.47325 + 'kaiti sc bold': [
1.47326 + 1.0833,
1.47327 + 0.3333,
1.47328 + 0
1.47329 + ],
1.47330 + 'kaiti sc regular': [
1.47331 + 1.0833,
1.47332 + 0.3333,
1.47333 + 0
1.47334 + ],
1.47335 + 'stsong': [
1.47336 + 0.8333,
1.47337 + 0.1667,
1.47338 + 0
1.47339 + ],
1.47340 + 'songti sc black': [
1.47341 + 1.0833,
1.47342 + 0.3333,
1.47343 + 0
1.47344 + ],
1.47345 + 'songti sc bold': [
1.47346 + 1.0833,
1.47347 + 0.3333,
1.47348 + 0
1.47349 + ],
1.47350 + 'songti sc light': [
1.47351 + 1.0833,
1.47352 + 0.3333,
1.47353 + 0
1.47354 + ],
1.47355 + 'songti sc regular': [
1.47356 + 1.0833,
1.47357 + 0.3333,
1.47358 + 0
1.47359 + ],
1.47360 + 'stxihei': [
1.47361 + 0.8333,
1.47362 + 0.1667,
1.47363 + 0
1.47364 + ],
1.47365 + 'sathu': [
1.47366 + 0.9167,
1.47367 + 0.3333,
1.47368 + 0
1.47369 + ],
1.47370 + 'silom': [
1.47371 + 1,
1.47372 + 0.3333,
1.47373 + 0
1.47374 + ],
1.47375 + 'sinhala mn': [
1.47376 + 0.9167,
1.47377 + 0.25,
1.47378 + 0
1.47379 + ],
1.47380 + 'sinhala mn bold': [
1.47381 + 0.9167,
1.47382 + 0.25,
1.47383 + 0
1.47384 + ],
1.47385 + 'sinhala sangam mn': [
1.47386 + 1.1667,
1.47387 + 0.3333,
1.47388 + 0
1.47389 + ],
1.47390 + 'sinhala sangam mn bold': [
1.47391 + 1.1667,
1.47392 + 0.3333,
1.47393 + 0
1.47394 + ],
1.47395 + 'skia regular': [
1.47396 + 0.75,
1.47397 + 0.25,
1.47398 + 0
1.47399 + ],
1.47400 + 'symbol': [
1.47401 + 0.6667,
1.47402 + 0.3333,
1.47403 + 0
1.47404 + ],
1.47405 + 'tahoma negreta': [
1.47406 + 1,
1.47407 + 0.1667,
1.47408 + 0
1.47409 + ],
1.47410 + 'tamil mn': [
1.47411 + 0.9167,
1.47412 + 0.25,
1.47413 + 0
1.47414 + ],
1.47415 + 'tamil mn bold': [
1.47416 + 0.9167,
1.47417 + 0.25,
1.47418 + 0
1.47419 + ],
1.47420 + 'tamil sangam mn': [
1.47421 + 0.75,
1.47422 + 0.25,
1.47423 + 0
1.47424 + ],
1.47425 + 'tamil sangam mn bold': [
1.47426 + 0.75,
1.47427 + 0.25,
1.47428 + 0
1.47429 + ],
1.47430 + 'telugu mn': [
1.47431 + 0.9167,
1.47432 + 0.25,
1.47433 + 0
1.47434 + ],
1.47435 + 'telugu mn bold': [
1.47436 + 0.9167,
1.47437 + 0.25,
1.47438 + 0
1.47439 + ],
1.47440 + 'telugu sangam mn': [
1.47441 + 1,
1.47442 + 0.5833,
1.47443 + 0
1.47444 + ],
1.47445 + 'telugu sangam mn bold': [
1.47446 + 1,
1.47447 + 0.5833,
1.47448 + 0
1.47449 + ],
1.47450 + 'thonburi': [
1.47451 + 1.0833,
1.47452 + 0.25,
1.47453 + 0
1.47454 + ],
1.47455 + 'thonburi bold': [
1.47456 + 1.0833,
1.47457 + 0.25,
1.47458 + 0
1.47459 + ],
1.47460 + 'times bold': [
1.47461 + 0.75,
1.47462 + 0.25,
1.47463 + 0
1.47464 + ],
1.47465 + 'times bold italic': [
1.47466 + 0.75,
1.47467 + 0.25,
1.47468 + 0
1.47469 + ],
1.47470 + 'times italic': [
1.47471 + 0.75,
1.47472 + 0.25,
1.47473 + 0
1.47474 + ],
1.47475 + 'times roman': [
1.47476 + 0.75,
1.47477 + 0.25,
1.47478 + 0
1.47479 + ],
1.47480 + 'times new roman bold italic': [
1.47481 + 0.9167,
1.47482 + 0.25,
1.47483 + 0
1.47484 + ],
1.47485 + 'times new roman bold': [
1.47486 + 0.9167,
1.47487 + 0.25,
1.47488 + 0
1.47489 + ],
1.47490 + 'times new roman italic': [
1.47491 + 0.9167,
1.47492 + 0.25,
1.47493 + 0
1.47494 + ],
1.47495 + 'times new roman': [
1.47496 + 0.9167,
1.47497 + 0.25,
1.47498 + 0
1.47499 + ],
1.47500 + 'trebuchet ms bold italic': [
1.47501 + 0.9167,
1.47502 + 0.25,
1.47503 + 0
1.47504 + ],
1.47505 + 'trebuchet ms': [
1.47506 + 0.9167,
1.47507 + 0.25,
1.47508 + 0
1.47509 + ],
1.47510 + 'trebuchet ms bold': [
1.47511 + 0.9167,
1.47512 + 0.25,
1.47513 + 0
1.47514 + ],
1.47515 + 'trebuchet ms italic': [
1.47516 + 0.9167,
1.47517 + 0.25,
1.47518 + 0
1.47519 + ],
1.47520 + 'verdana': [
1.47521 + 1,
1.47522 + 0.25,
1.47523 + 0
1.47524 + ],
1.47525 + 'verdana bold': [
1.47526 + 1,
1.47527 + 0.25,
1.47528 + 0
1.47529 + ],
1.47530 + 'verdana bold italic': [
1.47531 + 1,
1.47532 + 0.25,
1.47533 + 0
1.47534 + ],
1.47535 + 'verdana italic': [
1.47536 + 1,
1.47537 + 0.25,
1.47538 + 0
1.47539 + ],
1.47540 + 'webdings': [
1.47541 + 0.8333,
1.47542 + 0.1667,
1.47543 + 0
1.47544 + ],
1.47545 + 'wingdings 2': [
1.47546 + 0.8333,
1.47547 + 0.25,
1.47548 + 0
1.47549 + ],
1.47550 + 'wingdings 3': [
1.47551 + 0.9167,
1.47552 + 0.25,
1.47553 + 0
1.47554 + ],
1.47555 + 'yuppy sc regular': [
1.47556 + 1.0833,
1.47557 + 0.3333,
1.47558 + 0
1.47559 + ],
1.47560 + 'yuppy tc regular': [
1.47561 + 1.0833,
1.47562 + 0.3333,
1.47563 + 0
1.47564 + ],
1.47565 + 'zapf dingbats': [
1.47566 + 0.8333,
1.47567 + 0.1667,
1.47568 + 0
1.47569 + ],
1.47570 + 'zapfino': [
1.47571 + 1.9167,
1.47572 + 1.5,
1.47573 + 0
1.47574 + ]
1.47575 + };
1.47576 + var DEVICE_FONT_METRICS_LINUX = {
1.47577 + 'kacstfarsi': [
1.47578 + 1.0831,
1.47579 + 0.5215,
1.47580 + 0
1.47581 + ],
1.47582 + 'meera': [
1.47583 + 0.682,
1.47584 + 0.4413,
1.47585 + 0
1.47586 + ],
1.47587 + 'freemono': [
1.47588 + 0.8023,
1.47589 + 0.2006,
1.47590 + 0
1.47591 + ],
1.47592 + 'undotum': [
1.47593 + 1.0029,
1.47594 + 0.2808,
1.47595 + 0
1.47596 + ],
1.47597 + 'loma': [
1.47598 + 1.1634,
1.47599 + 0.4814,
1.47600 + 0
1.47601 + ],
1.47602 + 'century schoolbook l': [
1.47603 + 1.0029,
1.47604 + 0.3209,
1.47605 + 0
1.47606 + ],
1.47607 + 'kacsttitlel': [
1.47608 + 1.0831,
1.47609 + 0.5215,
1.47610 + 0
1.47611 + ],
1.47612 + 'undinaru': [
1.47613 + 1.0029,
1.47614 + 0.2407,
1.47615 + 0
1.47616 + ],
1.47617 + 'ungungseo': [
1.47618 + 1.0029,
1.47619 + 0.2808,
1.47620 + 0
1.47621 + ],
1.47622 + 'garuda': [
1.47623 + 1.3238,
1.47624 + 0.6017,
1.47625 + 0
1.47626 + ],
1.47627 + 'rekha': [
1.47628 + 1.1232,
1.47629 + 0.2808,
1.47630 + 0
1.47631 + ],
1.47632 + 'purisa': [
1.47633 + 1.1232,
1.47634 + 0.5215,
1.47635 + 0
1.47636 + ],
1.47637 + 'dejavu sans mono': [
1.47638 + 0.9628,
1.47639 + 0.2407,
1.47640 + 0
1.47641 + ],
1.47642 + 'vemana2000': [
1.47643 + 0.8825,
1.47644 + 0.8424,
1.47645 + 0
1.47646 + ],
1.47647 + 'kacstoffice': [
1.47648 + 1.0831,
1.47649 + 0.5215,
1.47650 + 0
1.47651 + ],
1.47652 + 'umpush': [
1.47653 + 1.2837,
1.47654 + 0.682,
1.47655 + 0
1.47656 + ],
1.47657 + 'opensymbol': [
1.47658 + 0.8023,
1.47659 + 0.2006,
1.47660 + 0
1.47661 + ],
1.47662 + 'sawasdee': [
1.47663 + 1.1232,
1.47664 + 0.4413,
1.47665 + 0
1.47666 + ],
1.47667 + 'urw palladio l': [
1.47668 + 1.0029,
1.47669 + 0.3209,
1.47670 + 0
1.47671 + ],
1.47672 + 'freeserif': [
1.47673 + 0.9227,
1.47674 + 0.3209,
1.47675 + 0
1.47676 + ],
1.47677 + 'kacstdigital': [
1.47678 + 1.0831,
1.47679 + 0.5215,
1.47680 + 0
1.47681 + ],
1.47682 + 'ubuntu condensed': [
1.47683 + 0.9628,
1.47684 + 0.2006,
1.47685 + 0
1.47686 + ],
1.47687 + 'unpilgi': [
1.47688 + 1.0029,
1.47689 + 0.4413,
1.47690 + 0
1.47691 + ],
1.47692 + 'mry_kacstqurn': [
1.47693 + 1.4442,
1.47694 + 0.7221,
1.47695 + 0
1.47696 + ],
1.47697 + 'urw gothic l': [
1.47698 + 1.0029,
1.47699 + 0.2407,
1.47700 + 0
1.47701 + ],
1.47702 + 'dingbats': [
1.47703 + 0.8424,
1.47704 + 0.1605,
1.47705 + 0
1.47706 + ],
1.47707 + 'urw chancery l': [
1.47708 + 1.0029,
1.47709 + 0.3209,
1.47710 + 0
1.47711 + ],
1.47712 + 'phetsarath ot': [
1.47713 + 1.0831,
1.47714 + 0.5215,
1.47715 + 0
1.47716 + ],
1.47717 + 'tlwg typist': [
1.47718 + 0.8825,
1.47719 + 0.4012,
1.47720 + 0
1.47721 + ],
1.47722 + 'kacstletter': [
1.47723 + 1.0831,
1.47724 + 0.5215,
1.47725 + 0
1.47726 + ],
1.47727 + 'utkal': [
1.47728 + 1.2035,
1.47729 + 0.6418,
1.47730 + 0
1.47731 + ],
1.47732 + 'dejavu sans light': [
1.47733 + 0.9628,
1.47734 + 0.2407,
1.47735 + 0
1.47736 + ],
1.47737 + 'norasi': [
1.47738 + 1.2436,
1.47739 + 0.5215,
1.47740 + 0
1.47741 + ],
1.47742 + 'dejavu serif condensed': [
1.47743 + 0.9628,
1.47744 + 0.2407,
1.47745 + 0
1.47746 + ],
1.47747 + 'kacstone': [
1.47748 + 1.2436,
1.47749 + 0.6418,
1.47750 + 0
1.47751 + ],
1.47752 + 'liberation sans narrow': [
1.47753 + 0.9628,
1.47754 + 0.2407,
1.47755 + 0
1.47756 + ],
1.47757 + 'symbol': [
1.47758 + 1.043,
1.47759 + 0.3209,
1.47760 + 0
1.47761 + ],
1.47762 + 'nanummyeongjo': [
1.47763 + 0.9227,
1.47764 + 0.2407,
1.47765 + 0
1.47766 + ],
1.47767 + 'untitled1': [
1.47768 + 0.682,
1.47769 + 0.5616,
1.47770 + 0
1.47771 + ],
1.47772 + 'lohit gujarati': [
1.47773 + 0.9628,
1.47774 + 0.4012,
1.47775 + 0
1.47776 + ],
1.47777 + 'liberation mono': [
1.47778 + 0.8424,
1.47779 + 0.3209,
1.47780 + 0
1.47781 + ],
1.47782 + 'kacstart': [
1.47783 + 1.0831,
1.47784 + 0.5215,
1.47785 + 0
1.47786 + ],
1.47787 + 'mallige': [
1.47788 + 1.0029,
1.47789 + 0.682,
1.47790 + 0
1.47791 + ],
1.47792 + 'bitstream charter': [
1.47793 + 1.0029,
1.47794 + 0.2407,
1.47795 + 0
1.47796 + ],
1.47797 + 'nanumgothic': [
1.47798 + 0.9227,
1.47799 + 0.2407,
1.47800 + 0
1.47801 + ],
1.47802 + 'liberation serif': [
1.47803 + 0.9227,
1.47804 + 0.2407,
1.47805 + 0
1.47806 + ],
1.47807 + 'dejavu sans condensed': [
1.47808 + 0.9628,
1.47809 + 0.2407,
1.47810 + 0
1.47811 + ],
1.47812 + 'ubuntu': [
1.47813 + 0.9628,
1.47814 + 0.2006,
1.47815 + 0
1.47816 + ],
1.47817 + 'courier 10 pitch': [
1.47818 + 0.8825,
1.47819 + 0.3209,
1.47820 + 0
1.47821 + ],
1.47822 + 'nimbus sans l': [
1.47823 + 0.9628,
1.47824 + 0.3209,
1.47825 + 0
1.47826 + ],
1.47827 + 'takaopgothic': [
1.47828 + 0.8825,
1.47829 + 0.2006,
1.47830 + 0
1.47831 + ],
1.47832 + 'wenquanyi micro hei mono': [
1.47833 + 0.9628,
1.47834 + 0.2407,
1.47835 + 0
1.47836 + ],
1.47837 + 'dejavu sans': [
1.47838 + 0.9628,
1.47839 + 0.2407,
1.47840 + 0
1.47841 + ],
1.47842 + 'kedage': [
1.47843 + 1.0029,
1.47844 + 0.682,
1.47845 + 0
1.47846 + ],
1.47847 + 'kinnari': [
1.47848 + 1.3238,
1.47849 + 0.5215,
1.47850 + 0
1.47851 + ],
1.47852 + 'tlwgmono': [
1.47853 + 0.8825,
1.47854 + 0.4012,
1.47855 + 0
1.47856 + ],
1.47857 + 'standard symbols l': [
1.47858 + 1.043,
1.47859 + 0.3209,
1.47860 + 0
1.47861 + ],
1.47862 + 'lohit punjabi': [
1.47863 + 1.2035,
1.47864 + 0.682,
1.47865 + 0
1.47866 + ],
1.47867 + 'nimbus mono l': [
1.47868 + 0.8424,
1.47869 + 0.2808,
1.47870 + 0
1.47871 + ],
1.47872 + 'rachana': [
1.47873 + 0.682,
1.47874 + 0.5616,
1.47875 + 0
1.47876 + ],
1.47877 + 'waree': [
1.47878 + 1.2436,
1.47879 + 0.4413,
1.47880 + 0
1.47881 + ],
1.47882 + 'kacstposter': [
1.47883 + 1.0831,
1.47884 + 0.5215,
1.47885 + 0
1.47886 + ],
1.47887 + 'khmer os': [
1.47888 + 1.2837,
1.47889 + 0.7622,
1.47890 + 0
1.47891 + ],
1.47892 + 'freesans': [
1.47893 + 1.0029,
1.47894 + 0.3209,
1.47895 + 0
1.47896 + ],
1.47897 + 'gargi': [
1.47898 + 0.9628,
1.47899 + 0.2808,
1.47900 + 0
1.47901 + ],
1.47902 + 'nimbus roman no9 l': [
1.47903 + 0.9628,
1.47904 + 0.3209,
1.47905 + 0
1.47906 + ],
1.47907 + 'dejavu serif': [
1.47908 + 0.9628,
1.47909 + 0.2407,
1.47910 + 0
1.47911 + ],
1.47912 + 'wenquanyi micro hei': [
1.47913 + 0.9628,
1.47914 + 0.2407,
1.47915 + 0
1.47916 + ],
1.47917 + 'ubuntu light': [
1.47918 + 0.9628,
1.47919 + 0.2006,
1.47920 + 0
1.47921 + ],
1.47922 + 'tlwgtypewriter': [
1.47923 + 0.9227,
1.47924 + 0.4012,
1.47925 + 0
1.47926 + ],
1.47927 + 'kacstpen': [
1.47928 + 1.0831,
1.47929 + 0.5215,
1.47930 + 0
1.47931 + ],
1.47932 + 'tlwg typo': [
1.47933 + 0.8825,
1.47934 + 0.4012,
1.47935 + 0
1.47936 + ],
1.47937 + 'mukti narrow': [
1.47938 + 1.2837,
1.47939 + 0.4413,
1.47940 + 0
1.47941 + ],
1.47942 + 'ubuntu mono': [
1.47943 + 0.8424,
1.47944 + 0.2006,
1.47945 + 0
1.47946 + ],
1.47947 + 'lohit bengali': [
1.47948 + 1.0029,
1.47949 + 0.4413,
1.47950 + 0
1.47951 + ],
1.47952 + 'liberation sans': [
1.47953 + 0.9227,
1.47954 + 0.2407,
1.47955 + 0
1.47956 + ],
1.47957 + 'unbatang': [
1.47958 + 1.0029,
1.47959 + 0.2808,
1.47960 + 0
1.47961 + ],
1.47962 + 'kacstdecorative': [
1.47963 + 1.1232,
1.47964 + 0.5215,
1.47965 + 0
1.47966 + ],
1.47967 + 'khmer os system': [
1.47968 + 1.2436,
1.47969 + 0.6017,
1.47970 + 0
1.47971 + ],
1.47972 + 'saab': [
1.47973 + 1.0029,
1.47974 + 0.682,
1.47975 + 0
1.47976 + ],
1.47977 + 'kacsttitle': [
1.47978 + 1.0831,
1.47979 + 0.5215,
1.47980 + 0
1.47981 + ],
1.47982 + 'mukti narrow bold': [
1.47983 + 1.2837,
1.47984 + 0.4413,
1.47985 + 0
1.47986 + ],
1.47987 + 'lohit hindi': [
1.47988 + 1.0029,
1.47989 + 0.5215,
1.47990 + 0
1.47991 + ],
1.47992 + 'kacstqurn': [
1.47993 + 1.0831,
1.47994 + 0.5215,
1.47995 + 0
1.47996 + ],
1.47997 + 'urw bookman l': [
1.47998 + 0.9628,
1.47999 + 0.2808,
1.48000 + 0
1.48001 + ],
1.48002 + 'kacstnaskh': [
1.48003 + 1.0831,
1.48004 + 0.5215,
1.48005 + 0
1.48006 + ],
1.48007 + 'kacstscreen': [
1.48008 + 1.0831,
1.48009 + 0.5215,
1.48010 + 0
1.48011 + ],
1.48012 + 'pothana2000': [
1.48013 + 0.8825,
1.48014 + 0.8424,
1.48015 + 0
1.48016 + ],
1.48017 + 'ungraphic': [
1.48018 + 1.0029,
1.48019 + 0.2808,
1.48020 + 0
1.48021 + ],
1.48022 + 'lohit tamil': [
1.48023 + 0.8825,
1.48024 + 0.361,
1.48025 + 0
1.48026 + ],
1.48027 + 'kacstbook': [
1.48028 + 1.0831,
1.48029 + 0.5215,
1.48030 + 0
1.48031 + ]
1.48032 + };
1.48033 + DEVICE_FONT_METRICS_MAC.__proto__ = DEVICE_FONT_METRICS_WIN;
1.48034 + DEVICE_FONT_METRICS_LINUX.__proto__ = DEVICE_FONT_METRICS_MAC;
1.48035 +}
1.48036 +var StaticTextDefinition = function () {
1.48037 + var def = {
1.48038 + __class__: 'flash.text.StaticText',
1.48039 + initialize: function () {
1.48040 + var s = this.symbol;
1.48041 + if (s) {
1.48042 + this.draw = s.draw;
1.48043 + }
1.48044 + },
1.48045 + get text() {
1.48046 + return this._text;
1.48047 + },
1.48048 + set text(val) {
1.48049 + this._text = val;
1.48050 + }
1.48051 + };
1.48052 + var desc = Object.getOwnPropertyDescriptor;
1.48053 + def.__glue__ = {
1.48054 + native: {
1.48055 + instance: {
1.48056 + text: desc(def, 'text')
1.48057 + }
1.48058 + }
1.48059 + };
1.48060 + return def;
1.48061 + }.call(this);
1.48062 +var StyleSheetDefinition = function () {
1.48063 + return {
1.48064 + __class__: 'flash.text.StyleSheet',
1.48065 + initialize: function () {
1.48066 + },
1.48067 + __glue__: {
1.48068 + native: {
1.48069 + static: {},
1.48070 + instance: {
1.48071 + _update: function _update() {
1.48072 + somewhatImplemented('StyleSheet._update');
1.48073 + },
1.48074 + _parseCSSInternal: function _parseCSSInternal(cssText) {
1.48075 + somewhatImplemented('StyleSheet._parseCSSInternal');
1.48076 + return null;
1.48077 + },
1.48078 + _parseCSSFontFamily: function _parseCSSFontFamily(fontFamily) {
1.48079 + notImplemented('StyleSheet._parseCSSFontFamily');
1.48080 + },
1.48081 + _parseColor: function _parseColor(color) {
1.48082 + notImplemented('StyleSheet._parseColor');
1.48083 + },
1.48084 + _styles: {
1.48085 + get: function _styles() {
1.48086 + return this.__styles;
1.48087 + },
1.48088 + set: function _styles(styles) {
1.48089 + somewhatImplemented('StyleSheet._styles');
1.48090 + this.__styles = styles;
1.48091 + }
1.48092 + }
1.48093 + }
1.48094 + }
1.48095 + }
1.48096 + };
1.48097 + }.call(this);
1.48098 +var TextFieldDefinition = function () {
1.48099 + var def = {
1.48100 + __class__: 'flash.text.TextField',
1.48101 + initialize: function () {
1.48102 + this._bbox = {
1.48103 + xMin: 0,
1.48104 + yMin: 0,
1.48105 + xMax: 2000,
1.48106 + yMax: 2000
1.48107 + };
1.48108 + var initialFormat = {
1.48109 + align: 'LEFT',
1.48110 + face: 'serif',
1.48111 + size: 12,
1.48112 + letterspacing: 0,
1.48113 + kerning: 0,
1.48114 + color: 0,
1.48115 + leading: 0
1.48116 + };
1.48117 + this._content = new TextFieldContent(initialFormat);
1.48118 + this._type = 'dynamic';
1.48119 + this._embedFonts = false;
1.48120 + this._selectable = true;
1.48121 + this._autoSize = 'none';
1.48122 + this._scrollV = 1;
1.48123 + this._maxScrollV = 1;
1.48124 + this._bottomScrollV = 1;
1.48125 + this._drawingOffsetH = 0;
1.48126 + this._background = false;
1.48127 + this._border = false;
1.48128 + this._backgroundColor = 16777215;
1.48129 + this._backgroundColorStr = '#ffffff';
1.48130 + this._borderColor = 0;
1.48131 + this._borderColorStr = '#000000';
1.48132 + var s = this.symbol;
1.48133 + if (!s) {
1.48134 + this._currentTransform.tx -= 40;
1.48135 + this._currentTransform.ty -= 40;
1.48136 + this._content.resolveFont(initialFormat, false);
1.48137 + this.text = '';
1.48138 + return;
1.48139 + }
1.48140 + var tag = s.tag;
1.48141 + var bbox = tag.bbox;
1.48142 + this._currentTransform.tx += bbox.xMin;
1.48143 + this._currentTransform.ty += bbox.yMin;
1.48144 + this._bbox.xMax = bbox.xMax - bbox.xMin;
1.48145 + this._bbox.yMax = bbox.yMax - bbox.yMin;
1.48146 + if (tag.hasLayout) {
1.48147 + initialFormat.size = tag.fontHeight / 20;
1.48148 + initialFormat.leading = (tag.leading | 0) / 20;
1.48149 + }
1.48150 + if (tag.hasColor) {
1.48151 + initialFormat.color = rgbaObjToStr(tag.color);
1.48152 + }
1.48153 + if (tag.hasFont) {
1.48154 + var font = FontDefinition.getFontByUniqueName(tag.font);
1.48155 + initialFormat.font = font;
1.48156 + initialFormat.face = font._fontName;
1.48157 + initialFormat.bold = font.symbol.bold;
1.48158 + initialFormat.italic = font.symbol.italic;
1.48159 + initialFormat.str = this._content.makeFormatString(initialFormat);
1.48160 + }
1.48161 + this._content.multiline = !(!tag.multiline);
1.48162 + this._content.wordWrap = !(!tag.wordWrap);
1.48163 + this._embedFonts = !(!tag.useOutlines);
1.48164 + this._selectable = !tag.noSelect;
1.48165 + this._border = !(!tag.border);
1.48166 + switch (tag.align) {
1.48167 + case 1:
1.48168 + initialFormat.align = 'right';
1.48169 + break;
1.48170 + case 2:
1.48171 + initialFormat.align = 'center';
1.48172 + break;
1.48173 + case 3:
1.48174 + initialFormat.align = 'justified';
1.48175 + break;
1.48176 + default:
1.48177 + }
1.48178 + if (tag.initialText) {
1.48179 + if (tag.html) {
1.48180 + this.htmlText = tag.initialText;
1.48181 + } else {
1.48182 + this.text = tag.initialText;
1.48183 + }
1.48184 + } else {
1.48185 + this.text = '';
1.48186 + }
1.48187 + },
1.48188 + _getAS2Object: function () {
1.48189 + if (!this.$as2Object) {
1.48190 + new avm1lib.AS2TextField(this);
1.48191 + }
1.48192 + return this.$as2Object;
1.48193 + },
1.48194 + replaceText: function (begin, end, str) {
1.48195 + var text = this._content.text;
1.48196 + this.text = text.substring(0, begin) + str + text.substring(end);
1.48197 + },
1.48198 + draw: function (ctx, ratio, colorTransform) {
1.48199 + this.ensureDimensions();
1.48200 + var bounds = this._bbox;
1.48201 + var width = bounds.xMax / 20;
1.48202 + var height = bounds.yMax / 20;
1.48203 + if (width <= 0 || height <= 0) {
1.48204 + return;
1.48205 + }
1.48206 + ctx.save();
1.48207 + ctx.beginPath();
1.48208 + ctx.rect(0, 0, width + 1, height + 1);
1.48209 + ctx.clip();
1.48210 + if (this._background) {
1.48211 + colorTransform.setFillStyle(ctx, this._backgroundColorStr);
1.48212 + ctx.fill();
1.48213 + }
1.48214 + if (this._border) {
1.48215 + colorTransform.setStrokeStyle(ctx, this._borderColorStr);
1.48216 + ctx.lineCap = 'square';
1.48217 + ctx.lineWidth = 1;
1.48218 + ctx.strokeRect(0.5, 0.5, width | 0, height | 0);
1.48219 + }
1.48220 + ctx.closePath();
1.48221 + if (this._content.lines.length === 0) {
1.48222 + ctx.restore();
1.48223 + return;
1.48224 + }
1.48225 + ctx.translate(2, 2);
1.48226 + ctx.save();
1.48227 + colorTransform.setAlpha(ctx);
1.48228 + var runs = this._content._textRuns;
1.48229 + var offsetY = this._content.lines[this._scrollV - 1].y;
1.48230 + for (var i = 0; i < runs.length; i++) {
1.48231 + var run = runs[i];
1.48232 + if (run.type === 'f') {
1.48233 + ctx.restore();
1.48234 + ctx.font = run.format.str;
1.48235 + colorTransform.setFillStyle(ctx, run.format.color);
1.48236 + ctx.save();
1.48237 + colorTransform.setAlpha(ctx);
1.48238 + } else {
1.48239 + if (run.y < offsetY) {
1.48240 + continue;
1.48241 + }
1.48242 + ctx.fillText(run.text, run.x - this._drawingOffsetH, run.y - offsetY);
1.48243 + }
1.48244 + }
1.48245 + ctx.restore();
1.48246 + ctx.restore();
1.48247 + },
1.48248 + invalidateDimensions: function () {
1.48249 + this._invalidate();
1.48250 + this._invalidateBounds();
1.48251 + this._dimensionsValid = false;
1.48252 + },
1.48253 + ensureDimensions: function () {
1.48254 + if (this._dimensionsValid) {
1.48255 + return;
1.48256 + }
1.48257 + var bounds = this._bbox;
1.48258 + var combinedAlign = this._content.calculateMetrics(bounds, this._embedFonts);
1.48259 + this._scrollV = 1;
1.48260 + this._maxScrollV = 1;
1.48261 + this._bottomScrollV = 1;
1.48262 + var autoSize = this._autoSize;
1.48263 + if (autoSize === 'none') {
1.48264 + var maxVisibleY = (bounds.yMax - 80) / 20;
1.48265 + if (this._content.textHeight > maxVisibleY) {
1.48266 + var lines = this._content.lines;
1.48267 + for (var i = 0; i < lines.length; i++) {
1.48268 + var line = lines[i];
1.48269 + if (line.y + line.height > maxVisibleY) {
1.48270 + this._maxScrollV = i + 1;
1.48271 + this._bottomScrollV = i === 0 ? 1 : i;
1.48272 + break;
1.48273 + }
1.48274 + }
1.48275 + }
1.48276 + } else {
1.48277 + var width = Math.max(bounds.xMax / 20 - 4, 1);
1.48278 + var targetWidth = this._content.textWidth;
1.48279 + var align = combinedAlign;
1.48280 + var diffX = 0;
1.48281 + if (align !== 'mixed') {
1.48282 + switch (autoSize) {
1.48283 + case 'left':
1.48284 + break;
1.48285 + case 'center':
1.48286 + diffX = width - targetWidth >> 1;
1.48287 + break;
1.48288 + case 'right':
1.48289 + diffX = width - targetWidth;
1.48290 + }
1.48291 + if (align === 'left') {
1.48292 + this._drawingOffsetH = 0;
1.48293 + } else {
1.48294 + var offset;
1.48295 + switch (autoSize) {
1.48296 + case 'left':
1.48297 + offset = width - targetWidth;
1.48298 + break;
1.48299 + case 'center':
1.48300 + offset = diffX << 1;
1.48301 + break;
1.48302 + case 'right':
1.48303 + offset = diffX;
1.48304 + break;
1.48305 + }
1.48306 + if (align === 'center') {
1.48307 + offset >>= 1;
1.48308 + }
1.48309 + this._drawingOffsetH = offset;
1.48310 + }
1.48311 + this._invalidateTransform();
1.48312 + this._currentTransform.tx += diffX * 20 | 0;
1.48313 + bounds.xMax = (targetWidth * 20 | 0) + 80;
1.48314 + }
1.48315 + bounds.yMax = (this._content.textHeight * 20 | 0) + 80;
1.48316 + console.log(bounds.yMax);
1.48317 + this._invalidateBounds();
1.48318 + }
1.48319 + this._dimensionsValid = true;
1.48320 + },
1.48321 + get text() {
1.48322 + return this._content.text;
1.48323 + },
1.48324 + set text(val) {
1.48325 + this._content.text = val;
1.48326 + this.invalidateDimensions();
1.48327 + },
1.48328 + get htmlText() {
1.48329 + return this._content.htmlText;
1.48330 + },
1.48331 + set htmlText(val) {
1.48332 + this._content.htmlText = val;
1.48333 + this.invalidateDimensions();
1.48334 + },
1.48335 + get defaultTextFormat() {
1.48336 + var format = this._content.defaultTextFormat;
1.48337 + return new flash.text.TextFormat().fromObject(format);
1.48338 + },
1.48339 + set defaultTextFormat(val) {
1.48340 + this._content.defaultTextFormat = val.toObject();
1.48341 + this.invalidateDimensions();
1.48342 + },
1.48343 + getTextFormat: function (beginIndex, endIndex) {
1.48344 + return this.defaultTextFormat;
1.48345 + },
1.48346 + setTextFormat: function (format, beginIndex, endIndex) {
1.48347 + this.defaultTextFormat = format;
1.48348 + if (this.text === this.htmlText) {
1.48349 + this.text = this.text;
1.48350 + }
1.48351 + this.invalidateDimensions();
1.48352 + },
1.48353 + get x() {
1.48354 + this.ensureDimensions();
1.48355 + return this._currentTransform.tx;
1.48356 + },
1.48357 + set x(val) {
1.48358 + if (val === this._currentTransform.tx) {
1.48359 + return;
1.48360 + }
1.48361 + this._invalidate();
1.48362 + this._invalidateBounds();
1.48363 + this._invalidateTransform();
1.48364 + this._currentTransform.tx = val;
1.48365 + },
1.48366 + get width() {
1.48367 + this.ensureDimensions();
1.48368 + return this._bbox.xMax;
1.48369 + },
1.48370 + set width(value) {
1.48371 + if (value < 0) {
1.48372 + return;
1.48373 + }
1.48374 + this._bbox.xMax = value;
1.48375 + this.invalidateDimensions();
1.48376 + },
1.48377 + get height() {
1.48378 + this.ensureDimensions();
1.48379 + return this._bbox.yMax;
1.48380 + },
1.48381 + set height(value) {
1.48382 + if (value < 0) {
1.48383 + return;
1.48384 + }
1.48385 + this._bbox.yMax = value;
1.48386 + this._invalidate();
1.48387 + },
1.48388 + _getContentBounds: function () {
1.48389 + this.ensureDimensions();
1.48390 + return this._bbox;
1.48391 + },
1.48392 + _getRegion: function getRegion(targetCoordSpace) {
1.48393 + return this._getTransformedRect(this._getContentBounds(), targetCoordSpace);
1.48394 + },
1.48395 + getLineMetrics: function (lineIndex) {
1.48396 + this.ensureDimensions();
1.48397 + if (lineIndex < 0 || lineIndex >= this._content.lines.length) {
1.48398 + throwError('RangeError', Errors.ParamRangeError);
1.48399 + }
1.48400 + var line = this._content.lines[lineIndex];
1.48401 + var format = line.largestFormat;
1.48402 + var metrics = format.font._metrics;
1.48403 + var size = format.size;
1.48404 + var ascent = metrics.ascent * size + 0.49999 | 0;
1.48405 + var descent = metrics.descent * size + 0.49999 | 0;
1.48406 + var leading = metrics.leading * size + 0.49999 + line.leading | 0;
1.48407 + return new flash.text.TextLineMetrics(line.x + 2, line.width, line.height, ascent, descent, leading);
1.48408 + },
1.48409 + getCharBoundaries: function getCharBoundaries(index) {
1.48410 + somewhatImplemented('TextField.getCharBoundaries');
1.48411 + return new flash.geom.Rectangle(0, 0, 0, 0);
1.48412 + }
1.48413 + };
1.48414 + var desc = Object.getOwnPropertyDescriptor;
1.48415 + def.__glue__ = {
1.48416 + native: {
1.48417 + instance: {
1.48418 + text: desc(def, 'text'),
1.48419 + defaultTextFormat: desc(def, 'defaultTextFormat'),
1.48420 + draw: def.draw,
1.48421 + htmlText: desc(def, 'htmlText'),
1.48422 + replaceText: def.replaceText,
1.48423 + getTextFormat: def.getTextFormat,
1.48424 + setTextFormat: def.setTextFormat,
1.48425 + getCharBoundaries: def.getCharBoundaries,
1.48426 + autoSize: {
1.48427 + get: function autoSize() {
1.48428 + return this._autoSize;
1.48429 + },
1.48430 + set: function autoSize(value) {
1.48431 + if (this._autoSize === value) {
1.48432 + return;
1.48433 + }
1.48434 + this._autoSize = value;
1.48435 + this.invalidateDimensions();
1.48436 + }
1.48437 + },
1.48438 + multiline: {
1.48439 + get: function multiline() {
1.48440 + return this._content.multiline;
1.48441 + },
1.48442 + set: function multiline(value) {
1.48443 + if (this._content.multiline === value) {
1.48444 + return;
1.48445 + }
1.48446 + this._content.multiline = value;
1.48447 + this.invalidateDimensions();
1.48448 + }
1.48449 + },
1.48450 + textColor: {
1.48451 + get: function textColor() {
1.48452 + return this._content.textColor;
1.48453 + },
1.48454 + set: function textColor(value) {
1.48455 + if (this._content.textColor === value) {
1.48456 + return;
1.48457 + }
1.48458 + this._content.textColor = value;
1.48459 + this._invalidate();
1.48460 + }
1.48461 + },
1.48462 + selectable: {
1.48463 + get: function selectable() {
1.48464 + return this._selectable;
1.48465 + },
1.48466 + set: function selectable(value) {
1.48467 + somewhatImplemented('TextField.selectable');
1.48468 + this._selectable = value;
1.48469 + }
1.48470 + },
1.48471 + wordWrap: {
1.48472 + get: function wordWrap() {
1.48473 + return this._content.wordWrap;
1.48474 + },
1.48475 + set: function wordWrap(value) {
1.48476 + if (this._content.wordWrap === value) {
1.48477 + return;
1.48478 + }
1.48479 + this._content.wordWrap = value;
1.48480 + this.invalidateDimensions();
1.48481 + }
1.48482 + },
1.48483 + textHeight: {
1.48484 + get: function textHeight() {
1.48485 + this.ensureDimensions();
1.48486 + return this._content.textHeight;
1.48487 + }
1.48488 + },
1.48489 + textWidth: {
1.48490 + get: function textWidth() {
1.48491 + this.ensureDimensions();
1.48492 + return this._content.textWidth;
1.48493 + }
1.48494 + },
1.48495 + length: {
1.48496 + get: function length() {
1.48497 + return this.text.length;
1.48498 + }
1.48499 + },
1.48500 + numLines: {
1.48501 + get: function numLines() {
1.48502 + this.ensureDimensions();
1.48503 + return this._content.lines.length;
1.48504 + }
1.48505 + },
1.48506 + getLineMetrics: function (lineIndex) {
1.48507 + return this.getLineMetrics(lineIndex);
1.48508 + },
1.48509 + setSelection: function (beginIndex, endIndex) {
1.48510 + somewhatImplemented('TextField.setSelection');
1.48511 + },
1.48512 + scrollV: {
1.48513 + get: function scrollV() {
1.48514 + return this._scrollV;
1.48515 + },
1.48516 + set: function scrollV(value) {
1.48517 + this.ensureDimensions();
1.48518 + value = Math.max(1, Math.min(this._maxScrollV, value));
1.48519 + this._scrollV = value;
1.48520 + }
1.48521 + },
1.48522 + bottomScrollV: {
1.48523 + get: function bottomScrollV() {
1.48524 + this.ensureDimensions();
1.48525 + if (this._scrollV === 1) {
1.48526 + return this._bottomScrollV;
1.48527 + }
1.48528 + var maxVisibleY = (this._bbox.yMax - 80) / 20;
1.48529 + var lines = this._content.lines;
1.48530 + var offsetY = lines[this._scrollV - 1].y;
1.48531 + for (var i = this._bottomScrollV; i < lines.length; i++) {
1.48532 + var line = lines[i];
1.48533 + if (line.y + line.height + offsetY > maxVisibleY) {
1.48534 + return i + 1;
1.48535 + }
1.48536 + }
1.48537 + }
1.48538 + },
1.48539 + maxScrollV: {
1.48540 + get: function maxScrollV() {
1.48541 + this.ensureDimensions();
1.48542 + return this._maxScrollV;
1.48543 + }
1.48544 + },
1.48545 + maxScrollH: {
1.48546 + get: function maxScrollH() {
1.48547 + this.ensureDimensions();
1.48548 + return Math.max(this._content.textWidth - this._bbox.xMax / 20 + 4, 0);
1.48549 + }
1.48550 + },
1.48551 + background: {
1.48552 + get: function background() {
1.48553 + return this._background;
1.48554 + },
1.48555 + set: function background(value) {
1.48556 + if (this._background === value) {
1.48557 + return;
1.48558 + }
1.48559 + this._background = value;
1.48560 + this._invalidate();
1.48561 + }
1.48562 + },
1.48563 + backgroundColor: {
1.48564 + get: function backgroundColor() {
1.48565 + return this._backgroundColor;
1.48566 + },
1.48567 + set: function backgroundColor(value) {
1.48568 + if (this._backgroundColor === value) {
1.48569 + return;
1.48570 + }
1.48571 + this._backgroundColor = value;
1.48572 + this._backgroundColorStr = rgbIntAlphaToStr(value, 1);
1.48573 + if (this._background) {
1.48574 + this._invalidate();
1.48575 + }
1.48576 + }
1.48577 + },
1.48578 + border: {
1.48579 + get: function border() {
1.48580 + return this._border;
1.48581 + },
1.48582 + set: function border(value) {
1.48583 + if (this._border === value) {
1.48584 + return;
1.48585 + }
1.48586 + this._border = value;
1.48587 + this._invalidate();
1.48588 + }
1.48589 + },
1.48590 + borderColor: {
1.48591 + get: function borderColor() {
1.48592 + return this._borderColor;
1.48593 + },
1.48594 + set: function borderColor(value) {
1.48595 + if (this._borderColor === value) {
1.48596 + return;
1.48597 + }
1.48598 + this._borderColor = value;
1.48599 + this._borderColorStr = rgbIntAlphaToStr(value, 1);
1.48600 + if (this._border) {
1.48601 + this._invalidate();
1.48602 + }
1.48603 + }
1.48604 + },
1.48605 + type: {
1.48606 + get: function borderColor() {
1.48607 + return this._type;
1.48608 + },
1.48609 + set: function borderColor(value) {
1.48610 + somewhatImplemented('TextField.type');
1.48611 + this._type = value;
1.48612 + }
1.48613 + },
1.48614 + embedFonts: {
1.48615 + get: function embedFonts() {
1.48616 + return this._embedFonts;
1.48617 + },
1.48618 + set: function embedFonts(value) {
1.48619 + this.invalidateDimensions();
1.48620 + this._embedFonts = value;
1.48621 + }
1.48622 + },
1.48623 + condenseWhite: {
1.48624 + get: function condenseWhite() {
1.48625 + return this._content.condenseWhite;
1.48626 + },
1.48627 + set: function condenseWhite(value) {
1.48628 + somewhatImplemented('TextField.condenseWhite');
1.48629 + this._content.condenseWhite = value;
1.48630 + }
1.48631 + },
1.48632 + sharpness: {
1.48633 + get: function sharpness() {
1.48634 + return this._sharpness;
1.48635 + },
1.48636 + set: function sharpness(value) {
1.48637 + somewhatImplemented('TextField.sharpness');
1.48638 + this._sharpness = value;
1.48639 + }
1.48640 + }
1.48641 + }
1.48642 + }
1.48643 + };
1.48644 + return def;
1.48645 + }.call(this);
1.48646 +function TextFieldContent(initialFormat) {
1.48647 + this.defaultTextFormat = initialFormat;
1.48648 + this.textWidth = 0;
1.48649 + this.textHeight = 0;
1.48650 + this.condenseWhite = false;
1.48651 + this.wordWrap = false;
1.48652 + this.multiline = false;
1.48653 + this.textColor = null;
1.48654 + this._text = '';
1.48655 + this._htmlText = '';
1.48656 + this._createTrunk();
1.48657 + this._textRuns = null;
1.48658 + this._htmlParser = document.createElement('p');
1.48659 + this._measureCtx = document.createElement('canvas').getContext('2d');
1.48660 +}
1.48661 +TextFieldContent.knownNodeTypes = {
1.48662 + 'BR': true,
1.48663 + 'LI': true,
1.48664 + 'P': true,
1.48665 + 'B': true,
1.48666 + 'I': true,
1.48667 + 'FONT': true,
1.48668 + 'TEXTFORMAT': true,
1.48669 + 'U': true,
1.48670 + 'A': true,
1.48671 + 'IMG': true,
1.48672 + 'SPAN': true
1.48673 +};
1.48674 +TextFieldContent.WRAP_OPPORTUNITIES = {
1.48675 + ' ': true,
1.48676 + '.': true,
1.48677 + '-': true,
1.48678 + '\t': true
1.48679 +};
1.48680 +TextFieldContent.TextLine = function (y) {
1.48681 + this.x = 0;
1.48682 + this.width = 0;
1.48683 + this.y = y;
1.48684 + this.height = 0;
1.48685 + this.leading = 0;
1.48686 + this.runs = [];
1.48687 + this.largestFormat = null;
1.48688 +};
1.48689 +TextFieldContent.prototype = {
1.48690 + get text() {
1.48691 + return this._text;
1.48692 + },
1.48693 + set text(val) {
1.48694 + val = val + '';
1.48695 + if (this._text === val) {
1.48696 + return;
1.48697 + }
1.48698 + var lines = [];
1.48699 + var lineOffset = 0;
1.48700 + for (var index = 0; index < val.length;) {
1.48701 + var char = val[index];
1.48702 + if (char === '\r' || char === '\n') {
1.48703 + lines.push(val.substring(lineOffset, index));
1.48704 + lineOffset = index;
1.48705 + if (char === '\r' && val[index + 1] === '\n') {
1.48706 + index++;
1.48707 + }
1.48708 + }
1.48709 + index++;
1.48710 + }
1.48711 + lines.push(val.substring(lineOffset, index));
1.48712 + this._createTrunk();
1.48713 + this._text = val;
1.48714 + this._htmlText = val;
1.48715 + this._tree.children[0].children[0] = {
1.48716 + type: 'plain-text',
1.48717 + lines: lines
1.48718 + };
1.48719 + },
1.48720 + get htmlText() {
1.48721 + return this._htmlText;
1.48722 + },
1.48723 + set htmlText(val) {
1.48724 + if (this._htmlText === val) {
1.48725 + return;
1.48726 + }
1.48727 + this.defaultTextFormat.bold = false;
1.48728 + this.defaultTextFormat.italic = false;
1.48729 + this._parseHtml(val);
1.48730 + },
1.48731 + calculateMetrics: function (bounds, embedFonts) {
1.48732 + var initialFormat = this.defaultTextFormat;
1.48733 + this.resolveFont(initialFormat, embedFonts);
1.48734 + this.lines = [];
1.48735 + this._textRuns = [
1.48736 + {
1.48737 + type: 'f',
1.48738 + format: initialFormat
1.48739 + }
1.48740 + ];
1.48741 + var width = Math.max(bounds.xMax / 20 - 4, 1);
1.48742 + var height = Math.max(bounds.yMax / 20 - 4, 1);
1.48743 + var state = {
1.48744 + ctx: this._measureCtx,
1.48745 + w: width,
1.48746 + h: height,
1.48747 + maxLineWidth: 0,
1.48748 + formats: [
1.48749 + initialFormat
1.48750 + ],
1.48751 + currentFormat: initialFormat,
1.48752 + line: new TextFieldContent.TextLine(0),
1.48753 + wordWrap: this.wordWrap,
1.48754 + combinedAlign: null,
1.48755 + textColor: this.textColor,
1.48756 + embedFonts: embedFonts
1.48757 + };
1.48758 + this._collectRuns(state, this._tree);
1.48759 + this._finishLine(state, false);
1.48760 + this.textWidth = state.maxLineWidth | 0;
1.48761 + this.textHeight = state.line.y | 0;
1.48762 + return state.combinedAlign;
1.48763 + },
1.48764 + makeFormatString: function (format) {
1.48765 + var boldItalic = '';
1.48766 + if (format.italic) {
1.48767 + boldItalic += 'italic';
1.48768 + }
1.48769 + if (format.bold) {
1.48770 + boldItalic += ' bold';
1.48771 + }
1.48772 + return boldItalic + ' ' + format.size + 'px ' + (format.font._uniqueName || format.font._fontName);
1.48773 + },
1.48774 + resolveFont: function (format, embedded) {
1.48775 + var face = format.face.toLowerCase();
1.48776 + if (face === '_sans') {
1.48777 + face = 'sans-serif';
1.48778 + } else if (face === '_serif') {
1.48779 + face = 'serif';
1.48780 + } else if (face === '_typewriter') {
1.48781 + face = 'monospace';
1.48782 + }
1.48783 + var style;
1.48784 + if (format.bold) {
1.48785 + if (format.italic) {
1.48786 + style = 'boldItalic';
1.48787 + } else {
1.48788 + style = 'bold';
1.48789 + }
1.48790 + } else if (format.italic) {
1.48791 + style = 'italic';
1.48792 + } else {
1.48793 + style = 'regular';
1.48794 + }
1.48795 + var font = FontDefinition.getFont(face, style, embedded);
1.48796 + format.font = font;
1.48797 + },
1.48798 + _parseHtml: function (val) {
1.48799 + this._htmlParser.innerHTML = val;
1.48800 + var rootElement = this._htmlParser.childNodes.length !== 1 ? this._htmlParser : this._htmlParser.childNodes[0];
1.48801 + this._text = '';
1.48802 + this._htmlText = val;
1.48803 + this._createTrunk();
1.48804 + if (rootElement.nodeType === 3) {
1.48805 + this._convertNode(rootElement, this._tree.children[0].children);
1.48806 + }
1.48807 + var initialNodeList = [
1.48808 + rootElement
1.48809 + ];
1.48810 + var attributes;
1.48811 + var format;
1.48812 + var key;
1.48813 + if (initialNodeList.length == 1 && rootElement.localName.toUpperCase() == 'P') {
1.48814 + attributes = this._extractAttributes(rootElement);
1.48815 + format = this._tree.format;
1.48816 + for (key in attributes) {
1.48817 + format[key] = attributes[key];
1.48818 + }
1.48819 + initialNodeList = rootElement.childNodes;
1.48820 + rootElement = rootElement.childNodes[0];
1.48821 + }
1.48822 + if (initialNodeList.length == 1 && rootElement.localName.toUpperCase() == 'FONT') {
1.48823 + attributes = this._extractAttributes(rootElement);
1.48824 + format = this._tree.children[0].format;
1.48825 + for (key in attributes) {
1.48826 + format[key] = attributes[key];
1.48827 + }
1.48828 + initialNodeList = rootElement.childNodes;
1.48829 + }
1.48830 + this._convertNodeList(initialNodeList, this._tree.children[0].children);
1.48831 + },
1.48832 + _createTrunk: function () {
1.48833 + var initialFormat = this.defaultTextFormat;
1.48834 + this._tree = {
1.48835 + type: 'SPAN',
1.48836 + format: {
1.48837 + ALIGN: initialFormat.align
1.48838 + },
1.48839 + children: []
1.48840 + };
1.48841 + var fontAttributes = {
1.48842 + FACE: initialFormat.face,
1.48843 + LETTERSPACING: initialFormat.letterSpacing,
1.48844 + KERNING: initialFormat.kerning,
1.48845 + LEADING: initialFormat.leading,
1.48846 + COLOR: initialFormat.color
1.48847 + };
1.48848 + this._tree.children[0] = {
1.48849 + type: 'FONT',
1.48850 + format: fontAttributes,
1.48851 + children: []
1.48852 + };
1.48853 + },
1.48854 + _convertNode: function (input, destinationList) {
1.48855 + if (!(input.nodeType === 1 || input.nodeType === 3) || input.prefix) {
1.48856 + return;
1.48857 + }
1.48858 + var node;
1.48859 + if (input.nodeType === 3) {
1.48860 + var text = input.textContent;
1.48861 + node = {
1.48862 + type: 'text',
1.48863 + text: text,
1.48864 + format: null,
1.48865 + children: null
1.48866 + };
1.48867 + this._text += text;
1.48868 + destinationList.push(node);
1.48869 + return;
1.48870 + }
1.48871 + var nodeType = input.localName.toUpperCase();
1.48872 + if (!TextFieldContent.knownNodeTypes[nodeType] || this.multiline === false && (nodeType === 'P' || nodeType === 'BR')) {
1.48873 + if (nodeType === 'SBR') {
1.48874 + destinationList.push({
1.48875 + type: 'BR',
1.48876 + text: null,
1.48877 + format: null,
1.48878 + children: null
1.48879 + });
1.48880 + }
1.48881 + this._convertNodeList(input.childNodes, destinationList);
1.48882 + return;
1.48883 + }
1.48884 + node = {
1.48885 + type: nodeType,
1.48886 + text: null,
1.48887 + format: this._extractAttributes(input),
1.48888 + children: []
1.48889 + };
1.48890 + this._convertNodeList(input.childNodes, node.children);
1.48891 + destinationList.push(node);
1.48892 + },
1.48893 + _convertNodeList: function (from, to) {
1.48894 + var childCount = from.length;
1.48895 + for (var i = 0; i < childCount; i++) {
1.48896 + this._convertNode(from[i], to);
1.48897 + }
1.48898 + },
1.48899 + _extractAttributes: function (node) {
1.48900 + var attributesList = node.attributes;
1.48901 + var attributesMap = {};
1.48902 + for (var i = 0; i < attributesList.length; i++) {
1.48903 + var attr = attributesList[i];
1.48904 + if (attr.prefix) {
1.48905 + continue;
1.48906 + }
1.48907 + attributesMap[attr.localName.toUpperCase()] = attr.value;
1.48908 + }
1.48909 + return attributesMap;
1.48910 + },
1.48911 + _collectRuns: function (state, node) {
1.48912 + var formatNode = false;
1.48913 + var blockNode = false;
1.48914 + switch (node.type) {
1.48915 + case 'plain-text':
1.48916 + var lines = node.lines;
1.48917 + for (var i = 0; i < lines.length; i++) {
1.48918 + this._addRunsForText(state, lines[i]);
1.48919 + if (i < lines.length - 1) {
1.48920 + this._finishLine(state, true);
1.48921 + }
1.48922 + }
1.48923 + return;
1.48924 + case 'text':
1.48925 + this._addRunsForText(state, node.text);
1.48926 + return;
1.48927 + case 'BR':
1.48928 + this._finishLine(state, true);
1.48929 + return;
1.48930 + case 'LI':
1.48931 + case 'P':
1.48932 + this._finishLine(state, false);
1.48933 + this._pushFormat(state, node);
1.48934 + blockNode = true;
1.48935 + break;
1.48936 + case 'B':
1.48937 + case 'I':
1.48938 + case 'FONT':
1.48939 + case 'TEXTFORMAT':
1.48940 + this._pushFormat(state, node);
1.48941 + formatNode = true;
1.48942 + break;
1.48943 + case 'U':
1.48944 + case 'A':
1.48945 + case 'IMG':
1.48946 + case 'SPAN':
1.48947 + default:
1.48948 + }
1.48949 + for (var i = 0; i < node.children.length; i++) {
1.48950 + var child = node.children[i];
1.48951 + this._collectRuns(state, child);
1.48952 + }
1.48953 + if (formatNode) {
1.48954 + this._popFormat(state);
1.48955 + }
1.48956 + if (blockNode) {
1.48957 + this._finishLine(state, true);
1.48958 + }
1.48959 + },
1.48960 + _addRunsForText: function (state, text) {
1.48961 + if (!text) {
1.48962 + return;
1.48963 + }
1.48964 + if (!state.wordWrap) {
1.48965 + this._addTextRun(state, text, state.ctx.measureText(text).width);
1.48966 + return;
1.48967 + }
1.48968 + while (text.length) {
1.48969 + var width = state.ctx.measureText(text).width;
1.48970 + var availableWidth = state.w - state.line.width;
1.48971 + if (availableWidth <= 0) {
1.48972 + this._finishLine(state, false);
1.48973 + availableWidth = state.w - state.line.width;
1.48974 + }
1.48975 + if (width <= availableWidth) {
1.48976 + this._addTextRun(state, text, width);
1.48977 + break;
1.48978 + } else {
1.48979 + var offset = text.length / width * availableWidth | 0;
1.48980 + while (state.ctx.measureText(text.substr(0, offset)).width < availableWidth && offset < text.length) {
1.48981 + offset++;
1.48982 + }
1.48983 + var wrapOffset = offset;
1.48984 + while (wrapOffset > -1) {
1.48985 + if (TextFieldContent.WRAP_OPPORTUNITIES[text[wrapOffset]]) {
1.48986 + wrapOffset++;
1.48987 + break;
1.48988 + }
1.48989 + wrapOffset--;
1.48990 + }
1.48991 + if (wrapOffset === -1) {
1.48992 + if (state.line.width > 0) {
1.48993 + this._finishLine(state, false);
1.48994 + continue;
1.48995 + }
1.48996 + while (state.ctx.measureText(text.substr(0, offset)).width > availableWidth) {
1.48997 + offset--;
1.48998 + }
1.48999 + if (offset === 0) {
1.49000 + offset = 1;
1.49001 + }
1.49002 + wrapOffset = offset;
1.49003 + }
1.49004 + var runText = text.substr(0, wrapOffset);
1.49005 + width = state.ctx.measureText(runText).width;
1.49006 + this._addTextRun(state, runText, width);
1.49007 + if (state.wordWrap) {
1.49008 + this._finishLine(state, false);
1.49009 + }
1.49010 + text = text.substr(wrapOffset);
1.49011 + }
1.49012 + }
1.49013 + },
1.49014 + _addTextRun: function (state, text, width) {
1.49015 + if (text.length === 0) {
1.49016 + return;
1.49017 + }
1.49018 + var line = state.line;
1.49019 + var format = state.currentFormat;
1.49020 + var size = format.size;
1.49021 + var run = {
1.49022 + type: 't',
1.49023 + text: text,
1.49024 + x: line.width
1.49025 + };
1.49026 + this._textRuns.push(run);
1.49027 + state.line.runs.push(run);
1.49028 + line.width += width | 0;
1.49029 + if (line.leading === 0 && format.leading > line.leading) {
1.49030 + line.leading = format.leading;
1.49031 + }
1.49032 + if (!line.largestFormat || size > line.largestFormat.size) {
1.49033 + line.largestFormat = format;
1.49034 + }
1.49035 + },
1.49036 + _finishLine: function (state, forceNewline) {
1.49037 + var line = state.line;
1.49038 + if (line.runs.length === 0) {
1.49039 + if (forceNewline) {
1.49040 + var format = state.currentFormat;
1.49041 + state.line.y += format.font._metrics.height * format.size + format.leading | 0;
1.49042 + }
1.49043 + return;
1.49044 + }
1.49045 + var runs = line.runs;
1.49046 + var format = line.largestFormat;
1.49047 + var baselinePos = line.y + format.font._metrics.ascent * format.size;
1.49048 + for (var i = runs.length; i--;) {
1.49049 + runs[i].y = baselinePos;
1.49050 + }
1.49051 + var align = (state.currentFormat.align || '').toLowerCase();
1.49052 + if (state.combinedAlign === null) {
1.49053 + state.combinedAlign = align;
1.49054 + } else if (state.combinedAlign !== align) {
1.49055 + state.combinedAlign = 'mixed';
1.49056 + }
1.49057 + if (align === 'center' || align === 'right') {
1.49058 + var offset = Math.max(state.w - line.width, 0);
1.49059 + if (align === 'center') {
1.49060 + offset >>= 1;
1.49061 + }
1.49062 + for (i = runs.length; i--;) {
1.49063 + runs[i].x += offset;
1.49064 + }
1.49065 + }
1.49066 + line.height = format.font._metrics.height * format.size + line.leading | 0;
1.49067 + state.maxLineWidth = Math.max(state.maxLineWidth, line.width);
1.49068 + this.lines.push(line);
1.49069 + state.line = new TextFieldContent.TextLine(line.y + line.height);
1.49070 + },
1.49071 + _pushFormat: function (state, node) {
1.49072 + var attributes = node.format;
1.49073 + var format = Object.create(state.formats[state.formats.length - 1]);
1.49074 + var fontChanged = false;
1.49075 + switch (node.type) {
1.49076 + case 'P':
1.49077 + if (attributes.ALIGN === format.align) {
1.49078 + return;
1.49079 + }
1.49080 + format.align = attributes.ALIGN;
1.49081 + break;
1.49082 + case 'B':
1.49083 + format.bold = true;
1.49084 + fontChanged = true;
1.49085 + break;
1.49086 + case 'I':
1.49087 + format.italic = true;
1.49088 + fontChanged = true;
1.49089 + break;
1.49090 + case 'FONT':
1.49091 + if (attributes.COLOR !== undefined) {
1.49092 + format.color = attributes.COLOR;
1.49093 + }
1.49094 + if (attributes.FACE !== undefined) {
1.49095 + format.face = attributes.FACE;
1.49096 + fontChanged = true;
1.49097 + }
1.49098 + if (attributes.SIZE !== undefined) {
1.49099 + format.size = parseFloat(attributes.SIZE);
1.49100 + }
1.49101 + if (attributes.LETTERSPACING !== undefined) {
1.49102 + format.letterspacing = parseFloat(attributes.LETTERSPACING);
1.49103 + }
1.49104 + if (attributes.KERNING !== undefined) {
1.49105 + format.kerning = attributes.KERNING && true;
1.49106 + }
1.49107 + case 'TEXTFORMAT':
1.49108 + if (attributes.LEADING !== undefined) {
1.49109 + format.leading = parseFloat(attributes.LEADING);
1.49110 + }
1.49111 + if (attributes.INDENT !== undefined) {
1.49112 + state.line.x = attributes.INDENT;
1.49113 + state.line.width += attributes.INDENT | 0;
1.49114 + }
1.49115 + break;
1.49116 + default:
1.49117 + warning('Unknown format node encountered: ' + node.type);
1.49118 + return;
1.49119 + }
1.49120 + if (state.textColor !== null) {
1.49121 + format.color = rgbIntAlphaToStr(state.textColor, 1);
1.49122 + }
1.49123 + if (fontChanged) {
1.49124 + this.resolveFont(format, state.embedFonts);
1.49125 + }
1.49126 + format.str = this.makeFormatString(format);
1.49127 + state.formats.push(format);
1.49128 + this._textRuns.push({
1.49129 + type: 'f',
1.49130 + format: format
1.49131 + });
1.49132 + state.currentFormat = format;
1.49133 + state.ctx.font = format.str;
1.49134 + },
1.49135 + _popFormat: function (state) {
1.49136 + state.formats.pop();
1.49137 + var format = state.currentFormat = state.formats[state.formats.length - 1];
1.49138 + this._textRuns.push({
1.49139 + type: 'f',
1.49140 + format: format
1.49141 + });
1.49142 + state.ctx.font = state.str;
1.49143 + }
1.49144 +};
1.49145 +var TextFormatDefinition = function () {
1.49146 + var measureTextField;
1.49147 + return {
1.49148 + __class__: 'flash.text.TextFormat',
1.49149 + initialize: function () {
1.49150 + },
1.49151 + fromObject: function (obj) {
1.49152 + this._font = obj.face || null;
1.49153 + this._size = typeof obj.size === 'number' ? obj.size : null;
1.49154 + this._color = typeof obj.color === 'number' ? obj.color : null;
1.49155 + this._bold = typeof obj.bold === 'boolean' ? obj.bold : null;
1.49156 + this._italic = typeof obj.italic === 'boolean' ? obj.italic : null;
1.49157 + this._underline = typeof obj.underline === 'boolean' ? obj.underline : null;
1.49158 + this._url = obj.url || null;
1.49159 + this._target = obj.target || null;
1.49160 + this._align = obj.align || null;
1.49161 + this._leftMargin = typeof obj.leftMargin === 'number' ? obj.leftMargin : null;
1.49162 + this._rightMargin = typeof obj.rightMargin === 'number' ? obj.rightMargin : null;
1.49163 + this._indent = typeof obj.indent === 'number' ? obj.indent : null;
1.49164 + this._leading = typeof obj.leading === 'number' ? obj.leading : null;
1.49165 + return this;
1.49166 + },
1.49167 + toObject: function () {
1.49168 + return {
1.49169 + face: this._font || 'serif',
1.49170 + size: this._size || 12,
1.49171 + color: this._color || 0,
1.49172 + bold: this._bold || false,
1.49173 + italic: this._italic || false,
1.49174 + underline: this._underline || false,
1.49175 + url: this._url,
1.49176 + target: this._target,
1.49177 + align: this._align || 'left',
1.49178 + leftMargin: this._leftMargin || 0,
1.49179 + rightMargin: this._rightMargin || 0,
1.49180 + indent: this._indent || 0,
1.49181 + leading: this._leading || 0
1.49182 + };
1.49183 + },
1.49184 + as2GetTextExtent: function (text, width) {
1.49185 + if (!measureTextField) {
1.49186 + measureTextField = new flash.text.TextField();
1.49187 + measureTextField._multiline = true;
1.49188 + }
1.49189 + if (!isNaN(width) && width > 0) {
1.49190 + measureTextField.width = width + 4;
1.49191 + measureTextField._wordWrap = true;
1.49192 + } else {
1.49193 + measureTextField._wordWrap = false;
1.49194 + }
1.49195 + measureTextField.defaultTextFormat = this;
1.49196 + measureTextField.text = text;
1.49197 + measureTextField.ensureDimensions();
1.49198 + var result = {};
1.49199 + var textWidth = measureTextField._textWidth;
1.49200 + var textHeight = measureTextField._textHeight;
1.49201 + result.asSetPublicProperty('width', textWidth);
1.49202 + result.asSetPublicProperty('height', textHeight);
1.49203 + result.asSetPublicProperty('textFieldWidth', textWidth + 4);
1.49204 + result.asSetPublicProperty('textFieldHeight', textHeight + 4);
1.49205 + var metrics = measureTextField.getLineMetrics(0);
1.49206 + result.asSetPublicProperty('ascent', metrics.asGetPublicProperty('ascent'));
1.49207 + result.asSetPublicProperty('descent', metrics.asGetPublicProperty('descent'));
1.49208 + return result;
1.49209 + },
1.49210 + __glue__: {
1.49211 + native: {
1.49212 + static: {},
1.49213 + instance: {
1.49214 + align: {
1.49215 + get: function align() {
1.49216 + return this._align;
1.49217 + },
1.49218 + set: function align(value) {
1.49219 + this._align = value;
1.49220 + }
1.49221 + },
1.49222 + blockIndent: {
1.49223 + get: function blockIndent() {
1.49224 + return this._blockIndent;
1.49225 + },
1.49226 + set: function blockIndent(value) {
1.49227 + this._blockIndent = value;
1.49228 + }
1.49229 + },
1.49230 + bold: {
1.49231 + get: function bold() {
1.49232 + return this._bold;
1.49233 + },
1.49234 + set: function bold(value) {
1.49235 + this._bold = value;
1.49236 + }
1.49237 + },
1.49238 + bullet: {
1.49239 + get: function bullet() {
1.49240 + return this._bullet;
1.49241 + },
1.49242 + set: function bullet(value) {
1.49243 + this._bullet = value;
1.49244 + }
1.49245 + },
1.49246 + color: {
1.49247 + get: function color() {
1.49248 + return this._color;
1.49249 + },
1.49250 + set: function color(value) {
1.49251 + this._color = value;
1.49252 + }
1.49253 + },
1.49254 + display: {
1.49255 + get: function display() {
1.49256 + return this._display;
1.49257 + },
1.49258 + set: function display(value) {
1.49259 + this._display = value;
1.49260 + }
1.49261 + },
1.49262 + font: {
1.49263 + get: function font() {
1.49264 + return this._font;
1.49265 + },
1.49266 + set: function font(value) {
1.49267 + this._font = value;
1.49268 + }
1.49269 + },
1.49270 + indent: {
1.49271 + get: function indent() {
1.49272 + return this._indent;
1.49273 + },
1.49274 + set: function indent(value) {
1.49275 + this._indent = value;
1.49276 + }
1.49277 + },
1.49278 + italic: {
1.49279 + get: function italic() {
1.49280 + return this._italic;
1.49281 + },
1.49282 + set: function italic(value) {
1.49283 + this._italic = value;
1.49284 + }
1.49285 + },
1.49286 + kerning: {
1.49287 + get: function kerning() {
1.49288 + return this._kerning;
1.49289 + },
1.49290 + set: function kerning(value) {
1.49291 + this._kerning = value;
1.49292 + }
1.49293 + },
1.49294 + leading: {
1.49295 + get: function leading() {
1.49296 + return this._leading;
1.49297 + },
1.49298 + set: function leading(value) {
1.49299 + this._leading = value;
1.49300 + }
1.49301 + },
1.49302 + leftMargin: {
1.49303 + get: function leftMargin() {
1.49304 + return this._leftMargin;
1.49305 + },
1.49306 + set: function leftMargin(value) {
1.49307 + this._leftMargin = value;
1.49308 + }
1.49309 + },
1.49310 + letterSpacing: {
1.49311 + get: function letterSpacing() {
1.49312 + return this._letterSpacing;
1.49313 + },
1.49314 + set: function letterSpacing(value) {
1.49315 + this._letterSpacing = value;
1.49316 + }
1.49317 + },
1.49318 + rightMargin: {
1.49319 + get: function rightMargin() {
1.49320 + return this._rightMargin;
1.49321 + },
1.49322 + set: function rightMargin(value) {
1.49323 + this._rightMargin = value;
1.49324 + }
1.49325 + },
1.49326 + size: {
1.49327 + get: function size() {
1.49328 + return this._size;
1.49329 + },
1.49330 + set: function size(value) {
1.49331 + this._size = value;
1.49332 + }
1.49333 + },
1.49334 + tabStops: {
1.49335 + get: function tabStops() {
1.49336 + return this._tabStops;
1.49337 + },
1.49338 + set: function tabStops(value) {
1.49339 + this._tabStops = value;
1.49340 + }
1.49341 + },
1.49342 + target: {
1.49343 + get: function target() {
1.49344 + return this._target;
1.49345 + },
1.49346 + set: function target(value) {
1.49347 + this._target = value;
1.49348 + }
1.49349 + },
1.49350 + underline: {
1.49351 + get: function underline() {
1.49352 + return this._underline;
1.49353 + },
1.49354 + set: function underline(value) {
1.49355 + this._underline = value;
1.49356 + }
1.49357 + },
1.49358 + url: {
1.49359 + get: function url() {
1.49360 + return this._url;
1.49361 + },
1.49362 + set: function url(value) {
1.49363 + this._url = value;
1.49364 + }
1.49365 + }
1.49366 + }
1.49367 + }
1.49368 + }
1.49369 + };
1.49370 + }.call(this);
1.49371 +var ContentElementDefinition = function () {
1.49372 + return {
1.49373 + __class__: 'flash.text.engine.ContentElement',
1.49374 + initialize: function () {
1.49375 + },
1.49376 + __glue__: {
1.49377 + native: {
1.49378 + static: {},
1.49379 + instance: {
1.49380 + textBlock: {
1.49381 + get: function textBlock() {
1.49382 + notImplemented('ContentElement.textBlock');
1.49383 + return this._textBlock;
1.49384 + }
1.49385 + },
1.49386 + textBlockBeginIndex: {
1.49387 + get: function textBlockBeginIndex() {
1.49388 + notImplemented('ContentElement.textBlockBeginIndex');
1.49389 + return this._textBlockBeginIndex;
1.49390 + }
1.49391 + },
1.49392 + elementFormat: {
1.49393 + get: function elementFormat() {
1.49394 + return this._elementFormat;
1.49395 + },
1.49396 + set: function elementFormat(value) {
1.49397 + somewhatImplemented('ContentElement.elementFormat');
1.49398 + this._elementFormat = value;
1.49399 + }
1.49400 + },
1.49401 + eventMirror: {
1.49402 + get: function eventMirror() {
1.49403 + return this._eventMirror;
1.49404 + },
1.49405 + set: function eventMirror(value) {
1.49406 + somewhatImplemented('ContentElement.eventMirror');
1.49407 + this._eventMirror = value;
1.49408 + }
1.49409 + },
1.49410 + groupElement: {
1.49411 + get: function groupElement() {
1.49412 + notImplemented('ContentElement.groupElement');
1.49413 + return this._groupElement;
1.49414 + }
1.49415 + },
1.49416 + rawText: {
1.49417 + get: function rawText() {
1.49418 + notImplemented('ContentElement.rawText');
1.49419 + return this._rawText;
1.49420 + }
1.49421 + },
1.49422 + text: {
1.49423 + get: function text() {
1.49424 + notImplemented('ContentElement.text');
1.49425 + return this._text;
1.49426 + }
1.49427 + },
1.49428 + textRotation: {
1.49429 + get: function textRotation() {
1.49430 + return this._textRotation;
1.49431 + },
1.49432 + set: function textRotation(value) {
1.49433 + somewhatImplemented('ContentElement.textRotation');
1.49434 + this._textRotation = value;
1.49435 + }
1.49436 + }
1.49437 + }
1.49438 + }
1.49439 + }
1.49440 + };
1.49441 + }.call(this);
1.49442 +var ElementFormatDefinition = function () {
1.49443 + return {
1.49444 + __class__: 'flash.text.engine.ElementFormat',
1.49445 + initialize: function () {
1.49446 + },
1.49447 + __glue__: {
1.49448 + native: {
1.49449 + static: {},
1.49450 + instance: {
1.49451 + getFontMetrics: function getFontMetrics() {
1.49452 + notImplemented('ElementFormat.getFontMetrics');
1.49453 + },
1.49454 + alignmentBaseline: {
1.49455 + get: function alignmentBaseline() {
1.49456 + return this._alignmentBaseline;
1.49457 + },
1.49458 + set: function alignmentBaseline(alignmentBaseline) {
1.49459 + somewhatImplemented('ElementFormat.alignmentBaseline');
1.49460 + this._alignmentBaseline = alignmentBaseline;
1.49461 + }
1.49462 + },
1.49463 + alpha: {
1.49464 + get: function alpha() {
1.49465 + return this._alpha;
1.49466 + },
1.49467 + set: function alpha(value) {
1.49468 + somewhatImplemented('ElementFormat.alpha');
1.49469 + this._alpha = value;
1.49470 + }
1.49471 + },
1.49472 + baselineShift: {
1.49473 + get: function baselineShift() {
1.49474 + return this._baselineShift;
1.49475 + },
1.49476 + set: function baselineShift(value) {
1.49477 + somewhatImplemented('ElementFormat.baselineShift');
1.49478 + this._baselineShift = value;
1.49479 + }
1.49480 + },
1.49481 + breakOpportunity: {
1.49482 + get: function breakOpportunity() {
1.49483 + return this._breakOpportunity;
1.49484 + },
1.49485 + set: function breakOpportunity(opportunityType) {
1.49486 + somewhatImplemented('ElementFormat.breakOpportunity');
1.49487 + this._breakOpportunity = opportunityType;
1.49488 + }
1.49489 + },
1.49490 + color: {
1.49491 + get: function color() {
1.49492 + return this._color;
1.49493 + },
1.49494 + set: function color(value) {
1.49495 + somewhatImplemented('ElementFormat.color');
1.49496 + this._color = value;
1.49497 + }
1.49498 + },
1.49499 + dominantBaseline: {
1.49500 + get: function dominantBaseline() {
1.49501 + return this._dominantBaseline;
1.49502 + },
1.49503 + set: function dominantBaseline(dominantBaseline) {
1.49504 + somewhatImplemented('ElementFormat.dominantBaseline');
1.49505 + this._dominantBaseline = dominantBaseline;
1.49506 + }
1.49507 + },
1.49508 + fontDescription: {
1.49509 + get: function fontDescription() {
1.49510 + return this._fontDescription;
1.49511 + },
1.49512 + set: function fontDescription(value) {
1.49513 + somewhatImplemented('ElementFormat.fontDescription');
1.49514 + this._fontDescription = value;
1.49515 + }
1.49516 + },
1.49517 + digitCase: {
1.49518 + get: function digitCase() {
1.49519 + return this._digitCase;
1.49520 + },
1.49521 + set: function digitCase(digitCaseType) {
1.49522 + somewhatImplemented('ElementFormat.digitCase');
1.49523 + this._digitCase = digitCaseType;
1.49524 + }
1.49525 + },
1.49526 + digitWidth: {
1.49527 + get: function digitWidth() {
1.49528 + return this._digitWidth;
1.49529 + },
1.49530 + set: function digitWidth(digitWidthType) {
1.49531 + somewhatImplemented('ElementFormat.digitWidth');
1.49532 + this._digitWidth = digitWidthType;
1.49533 + }
1.49534 + },
1.49535 + ligatureLevel: {
1.49536 + get: function ligatureLevel() {
1.49537 + return this._ligatureLevel;
1.49538 + },
1.49539 + set: function ligatureLevel(ligatureLevelType) {
1.49540 + somewhatImplemented('ElementFormat.ligatureLevel');
1.49541 + this._ligatureLevel = ligatureLevelType;
1.49542 + }
1.49543 + },
1.49544 + fontSize: {
1.49545 + get: function fontSize() {
1.49546 + return this._fontSize;
1.49547 + },
1.49548 + set: function fontSize(value) {
1.49549 + somewhatImplemented('ElementFormat.fontSize');
1.49550 + this._fontSize = value;
1.49551 + }
1.49552 + },
1.49553 + kerning: {
1.49554 + get: function kerning() {
1.49555 + return this._kerning;
1.49556 + },
1.49557 + set: function kerning(value) {
1.49558 + somewhatImplemented('ElementFormat.kerning');
1.49559 + this._kerning = value;
1.49560 + }
1.49561 + },
1.49562 + locale: {
1.49563 + get: function locale() {
1.49564 + return this._locale;
1.49565 + },
1.49566 + set: function locale(value) {
1.49567 + somewhatImplemented('ElementFormat.locale');
1.49568 + this._locale = value;
1.49569 + }
1.49570 + },
1.49571 + textRotation: {
1.49572 + get: function textRotation() {
1.49573 + return this._textRotation;
1.49574 + },
1.49575 + set: function textRotation(value) {
1.49576 + somewhatImplemented('ElementFormat.textRotation');
1.49577 + this._textRotation = value;
1.49578 + }
1.49579 + },
1.49580 + trackingRight: {
1.49581 + get: function trackingRight() {
1.49582 + return this._trackingRight;
1.49583 + },
1.49584 + set: function trackingRight(value) {
1.49585 + somewhatImplemented('ElementFormat.trackingRight');
1.49586 + this._trackingRight = value;
1.49587 + }
1.49588 + },
1.49589 + trackingLeft: {
1.49590 + get: function trackingLeft() {
1.49591 + return this._trackingLeft;
1.49592 + },
1.49593 + set: function trackingLeft(value) {
1.49594 + somewhatImplemented('ElementFormat.trackingLeft');
1.49595 + this._trackingLeft = value;
1.49596 + }
1.49597 + },
1.49598 + typographicCase: {
1.49599 + get: function typographicCase() {
1.49600 + return this._typographicCase;
1.49601 + },
1.49602 + set: function typographicCase(typographicCaseType) {
1.49603 + somewhatImplemented('ElementFormat.typographicCase');
1.49604 + this._typographicCase = typographicCaseType;
1.49605 + }
1.49606 + },
1.49607 + locked: {
1.49608 + get: function locked() {
1.49609 + notImplemented('ElementFormat.locked');
1.49610 + return this._locked;
1.49611 + },
1.49612 + set: function locked(value) {
1.49613 + notImplemented('ElementFormat.locked');
1.49614 + this._locked = value;
1.49615 + }
1.49616 + }
1.49617 + }
1.49618 + }
1.49619 + }
1.49620 + };
1.49621 + }.call(this);
1.49622 +var FontDescriptionDefinition = function () {
1.49623 + return {
1.49624 + __class__: 'flash.text.engine.FontDescription',
1.49625 + initialize: function () {
1.49626 + },
1.49627 + __glue__: {
1.49628 + native: {
1.49629 + static: {
1.49630 + isFontCompatible: function isFontCompatible(fontName, fontWeight, fontPosture) {
1.49631 + notImplemented('FontDescription.isFontCompatible');
1.49632 + },
1.49633 + isDeviceFontCompatible: function isDeviceFontCompatible(fontName, fontWeight, fontPosture) {
1.49634 + notImplemented('FontDescription.isDeviceFontCompatible');
1.49635 + }
1.49636 + },
1.49637 + instance: {
1.49638 + renderingMode: {
1.49639 + get: function renderingMode() {
1.49640 + return this._renderingMode;
1.49641 + },
1.49642 + set: function renderingMode(value) {
1.49643 + somewhatImplemented('FontDescription.renderingMode');
1.49644 + this._renderingMode = value;
1.49645 + }
1.49646 + },
1.49647 + fontLookup: {
1.49648 + get: function fontLookup() {
1.49649 + return this._fontLookup;
1.49650 + },
1.49651 + set: function fontLookup(value) {
1.49652 + somewhatImplemented('FontDescription.fontLookup');
1.49653 + this._fontLookup = value;
1.49654 + }
1.49655 + },
1.49656 + fontName: {
1.49657 + get: function fontName() {
1.49658 + return this._fontName;
1.49659 + },
1.49660 + set: function fontName(value) {
1.49661 + somewhatImplemented('FontDescription.fontName');
1.49662 + this._fontName = value;
1.49663 + }
1.49664 + },
1.49665 + fontPosture: {
1.49666 + get: function fontPosture() {
1.49667 + return this._fontPosture;
1.49668 + },
1.49669 + set: function fontPosture(value) {
1.49670 + somewhatImplemented('FontDescription.fontPosture');
1.49671 + this._fontPosture = value;
1.49672 + }
1.49673 + },
1.49674 + fontWeight: {
1.49675 + get: function fontWeight() {
1.49676 + return this._fontWeight;
1.49677 + },
1.49678 + set: function fontWeight(value) {
1.49679 + somewhatImplemented('FontDescription.fontWeight');
1.49680 + this._fontWeight = value;
1.49681 + }
1.49682 + },
1.49683 + cffHinting: {
1.49684 + get: function cffHinting() {
1.49685 + return this._cffHinting;
1.49686 + },
1.49687 + set: function cffHinting(value) {
1.49688 + somewhatImplemented('FontDescription.cffHinting');
1.49689 + this._cffHinting = value;
1.49690 + }
1.49691 + },
1.49692 + locked: {
1.49693 + get: function locked() {
1.49694 + notImplemented('FontDescription.locked');
1.49695 + return this._locked;
1.49696 + },
1.49697 + set: function locked(value) {
1.49698 + notImplemented('FontDescription.locked');
1.49699 + this._locked = value;
1.49700 + }
1.49701 + }
1.49702 + }
1.49703 + },
1.49704 + script: {
1.49705 + static: {},
1.49706 + instance: {}
1.49707 + }
1.49708 + }
1.49709 + };
1.49710 + }.call(this);
1.49711 +var GroupElementDefinition = function () {
1.49712 + return {
1.49713 + __class__: 'flash.text.engine.GroupElement',
1.49714 + initialize: function () {
1.49715 + },
1.49716 + __glue__: {
1.49717 + native: {
1.49718 + static: {},
1.49719 + instance: {
1.49720 + getElementAt: function getElementAt(index) {
1.49721 + notImplemented('GroupElement.getElementAt');
1.49722 + },
1.49723 + setElements: function setElements(value) {
1.49724 + somewhatImplemented('GroupElement.setElements');
1.49725 + this._elements = value;
1.49726 + },
1.49727 + groupElements: function groupElements(beginIndex, endIndex) {
1.49728 + notImplemented('GroupElement.groupElements');
1.49729 + },
1.49730 + ungroupElements: function ungroupElements(groupIndex) {
1.49731 + notImplemented('GroupElement.ungroupElements');
1.49732 + },
1.49733 + mergeTextElements: function mergeTextElements(beginIndex, endIndex) {
1.49734 + notImplemented('GroupElement.mergeTextElements');
1.49735 + },
1.49736 + splitTextElement: function splitTextElement(elementIndex, splitIndex) {
1.49737 + notImplemented('GroupElement.splitTextElement');
1.49738 + },
1.49739 + replaceElements: function replaceElements(beginIndex, endIndex, newElements) {
1.49740 + notImplemented('GroupElement.replaceElements');
1.49741 + },
1.49742 + getElementAtCharIndex: function getElementAtCharIndex(charIndex) {
1.49743 + notImplemented('GroupElement.getElementAtCharIndex');
1.49744 + },
1.49745 + elementCount: {
1.49746 + get: function elementCount() {
1.49747 + notImplemented('GroupElement.elementCount');
1.49748 + return this._elementCount;
1.49749 + }
1.49750 + }
1.49751 + }
1.49752 + }
1.49753 + }
1.49754 + };
1.49755 + }.call(this);
1.49756 +var SpaceJustifierDefinition = function () {
1.49757 + return {
1.49758 + __class__: 'flash.text.engine.SpaceJustifier',
1.49759 + initialize: function () {
1.49760 + this._letterSpacing = false;
1.49761 + this._optimumSpacing = 1;
1.49762 + this._minimumSpacing = 0.5;
1.49763 + this._maximumSpacing = 1.5;
1.49764 + },
1.49765 + __glue__: {
1.49766 + native: {
1.49767 + static: {},
1.49768 + instance: {
1.49769 + cloneSpacing: function cloneSpacing(justifier) {
1.49770 + somewhatImplemented('SpaceJustifier.cloneSpacing');
1.49771 + justifier._optimumSpacing = this._optimumSpacing;
1.49772 + justifier._minimumSpacing = this._minimumSpacing;
1.49773 + justifier._maximumSpacing = this._maximumSpacing;
1.49774 + },
1.49775 + letterSpacing: {
1.49776 + get: function letterSpacing() {
1.49777 + return this._letterSpacing;
1.49778 + },
1.49779 + set: function letterSpacing(value) {
1.49780 + somewhatImplemented('SpaceJustifier.letterSpacing');
1.49781 + this._letterSpacing = value;
1.49782 + }
1.49783 + },
1.49784 + minimumSpacing: {
1.49785 + get: function minimumSpacing() {
1.49786 + return this._minimumSpacing;
1.49787 + },
1.49788 + set: function minimumSpacing(value) {
1.49789 + somewhatImplemented('SpaceJustifier.minimumSpacing');
1.49790 + this._minimumSpacing = value;
1.49791 + }
1.49792 + },
1.49793 + optimumSpacing: {
1.49794 + get: function optimumSpacing() {
1.49795 + return this._optimumSpacing;
1.49796 + },
1.49797 + set: function optimumSpacing(value) {
1.49798 + somewhatImplemented('SpaceJustifier.optimumSpacing');
1.49799 + this._optimumSpacing = value;
1.49800 + }
1.49801 + },
1.49802 + maximumSpacing: {
1.49803 + get: function maximumSpacing() {
1.49804 + return this._maximumSpacing;
1.49805 + },
1.49806 + set: function maximumSpacing(value) {
1.49807 + somewhatImplemented('SpaceJustifier.maximumSpacing');
1.49808 + this._maximumSpacing = value;
1.49809 + }
1.49810 + }
1.49811 + }
1.49812 + }
1.49813 + }
1.49814 + };
1.49815 + }.call(this);
1.49816 +var TextBlockDefinition = function () {
1.49817 + return {
1.49818 + __class__: 'flash.text.engine.TextBlock',
1.49819 + initialize: function () {
1.49820 + this._firstLine = null;
1.49821 + this._lastLine = null;
1.49822 + },
1.49823 + __glue__: {
1.49824 + native: {
1.49825 + static: {},
1.49826 + instance: {
1.49827 + getTextJustifier: function getTextJustifier() {
1.49828 + return this._textJustifier;
1.49829 + },
1.49830 + setTextJustifier: function setTextJustifier(value) {
1.49831 + somewhatImplemented('TextBlock.setTextJustifier');
1.49832 + this._textJustifier = value;
1.49833 + },
1.49834 + getTabStops: function getTabStops() {
1.49835 + return this._tabStops;
1.49836 + },
1.49837 + setTabStops: function setTabStops(value) {
1.49838 + somewhatImplemented('TextBlock.setTabStops');
1.49839 + this._tabStops = value;
1.49840 + },
1.49841 + findNextAtomBoundary: function findNextAtomBoundary(afterCharIndex) {
1.49842 + notImplemented('TextBlock.findNextAtomBoundary');
1.49843 + },
1.49844 + findPreviousAtomBoundary: function findPreviousAtomBoundary(beforeCharIndex) {
1.49845 + notImplemented('TextBlock.findPreviousAtomBoundary');
1.49846 + },
1.49847 + findNextWordBoundary: function findNextWordBoundary(afterCharIndex) {
1.49848 + notImplemented('TextBlock.findNextWordBoundary');
1.49849 + },
1.49850 + findPreviousWordBoundary: function findPreviousWordBoundary(beforeCharIndex) {
1.49851 + notImplemented('TextBlock.findPreviousWordBoundary');
1.49852 + },
1.49853 + getTextLineAtCharIndex: function getTextLineAtCharIndex(charIndex) {
1.49854 + notImplemented('TextBlock.getTextLineAtCharIndex');
1.49855 + },
1.49856 + DoCreateTextLine: function DoCreateTextLine(previousLine, width, lineOffset, fitSomething, reuseLine) {
1.49857 + somewhatImplemented('TextBlock.DoCreateTextLine');
1.49858 + if (previousLine) {
1.49859 + return null;
1.49860 + }
1.49861 + var textLine = new flash.text.engine.TextLine();
1.49862 + textLine._textBlock = this;
1.49863 + textLine._specifiedWidth = width;
1.49864 + textLine._rawTextLength = 0;
1.49865 + textLine._textWidth = 0;
1.49866 + textLine._textHeight = 0;
1.49867 + textLine._ascent = 0;
1.49868 + textLine._descent = 0;
1.49869 + textLine._unjustifiedTextWidth = 0;
1.49870 + textLine._validity = 'valid';
1.49871 + textLine._previousLine = null;
1.49872 + textLine._nextLine = null;
1.49873 + this._firstLine = textLine;
1.49874 + this._lastLine = textLine;
1.49875 + return textLine;
1.49876 + },
1.49877 + releaseLineCreationData: function releaseLineCreationData() {
1.49878 + notImplemented('TextBlock.releaseLineCreationData');
1.49879 + },
1.49880 + releaseLines: function releaseLines(firstLine, lastLine) {
1.49881 + notImplemented('TextBlock.releaseLines');
1.49882 + },
1.49883 + dump: function dump() {
1.49884 + notImplemented('TextBlock.dump');
1.49885 + },
1.49886 + applyNonLinearFontScaling: {
1.49887 + get: function applyNonLinearFontScaling() {
1.49888 + return this._applyNonLinearFontScaling;
1.49889 + },
1.49890 + set: function applyNonLinearFontScaling(value) {
1.49891 + somewhatImplemented('TextBlock.applyNonLinearFontScaling');
1.49892 + this._applyNonLinearFontScaling = value;
1.49893 + }
1.49894 + },
1.49895 + baselineFontDescription: {
1.49896 + get: function baselineFontDescription() {
1.49897 + return this._baselineFontDescription;
1.49898 + },
1.49899 + set: function baselineFontDescription(value) {
1.49900 + somewhatImplemented('TextBlock.baselineFontDescription');
1.49901 + this._baselineFontDescription = value;
1.49902 + }
1.49903 + },
1.49904 + baselineFontSize: {
1.49905 + get: function baselineFontSize() {
1.49906 + return this._baselineFontSize;
1.49907 + },
1.49908 + set: function baselineFontSize(value) {
1.49909 + somewhatImplemented('TextBlock.baselineFontSize');
1.49910 + this._baselineFontSize = value;
1.49911 + }
1.49912 + },
1.49913 + baselineZero: {
1.49914 + get: function baselineZero() {
1.49915 + return this._baselineZero;
1.49916 + },
1.49917 + set: function baselineZero(value) {
1.49918 + somewhatImplemented('TextBlock.baselineZero');
1.49919 + this._baselineZero = value;
1.49920 + }
1.49921 + },
1.49922 + content: {
1.49923 + get: function content() {
1.49924 + return this._content;
1.49925 + },
1.49926 + set: function content(value) {
1.49927 + somewhatImplemented('TextBlock.content');
1.49928 + this._content = value;
1.49929 + }
1.49930 + },
1.49931 + bidiLevel: {
1.49932 + get: function bidiLevel() {
1.49933 + return this._bidiLevel;
1.49934 + },
1.49935 + set: function bidiLevel(value) {
1.49936 + somewhatImplemented('TextBlock.bidiLevel');
1.49937 + this._bidiLevel = value;
1.49938 + }
1.49939 + },
1.49940 + firstInvalidLine: {
1.49941 + get: function firstInvalidLine() {
1.49942 + notImplemented('TextBlock.firstInvalidLine');
1.49943 + return this._firstInvalidLine;
1.49944 + }
1.49945 + },
1.49946 + firstLine: {
1.49947 + get: function firstLine() {
1.49948 + somewhatImplemented('TextBlock.firstLine');
1.49949 + return this._firstLine;
1.49950 + }
1.49951 + },
1.49952 + lastLine: {
1.49953 + get: function lastLine() {
1.49954 + somewhatImplemented('TextBlock.lastLine');
1.49955 + return this._lastLine;
1.49956 + }
1.49957 + },
1.49958 + textLineCreationResult: {
1.49959 + get: function textLineCreationResult() {
1.49960 + notImplemented('TextBlock.textLineCreationResult');
1.49961 + return this._textLineCreationResult;
1.49962 + }
1.49963 + },
1.49964 + lineRotation: {
1.49965 + get: function lineRotation() {
1.49966 + return this._lineRotation;
1.49967 + },
1.49968 + set: function lineRotation(value) {
1.49969 + somewhatImplemented('TextBlock.lineRotation');
1.49970 + this._lineRotation = value;
1.49971 + }
1.49972 + }
1.49973 + }
1.49974 + }
1.49975 + }
1.49976 + };
1.49977 + }.call(this);
1.49978 +var TextElementDefinition = function () {
1.49979 + return {
1.49980 + __class__: 'flash.text.engine.TextElement',
1.49981 + initialize: function () {
1.49982 + },
1.49983 + __glue__: {
1.49984 + native: {
1.49985 + static: {},
1.49986 + instance: {
1.49987 + replaceText: function replaceText(beginIndex, endIndex, newText) {
1.49988 + somewhatImplemented('TextElement.replaceText');
1.49989 + var text = this._text || '';
1.49990 + this._text = text.slice(0, beginIndex) + newText + text.slice(endIndex);
1.49991 + },
1.49992 + text: {
1.49993 + set: function text(value) {
1.49994 + somewhatImplemented('TextElement.text');
1.49995 + this._text = value;
1.49996 + }
1.49997 + }
1.49998 + }
1.49999 + }
1.50000 + }
1.50001 + };
1.50002 + }.call(this);
1.50003 +var TextJustifierDefinition = function () {
1.50004 + return {
1.50005 + __class__: 'flash.text.engine.TextJustifier',
1.50006 + initialize: function () {
1.50007 + this._locale = null;
1.50008 + this._lineJustification = null;
1.50009 + },
1.50010 + __glue__: {
1.50011 + native: {
1.50012 + static: {},
1.50013 + instance: {
1.50014 + setLocale: function setLocale(value) {
1.50015 + somewhatImplemented('TextJustifier.setLocale');
1.50016 + this._locale = value;
1.50017 + },
1.50018 + locale: {
1.50019 + get: function locale() {
1.50020 + return this._locale;
1.50021 + }
1.50022 + },
1.50023 + lineJustification: {
1.50024 + get: function lineJustification() {
1.50025 + return this._lineJustification;
1.50026 + },
1.50027 + set: function lineJustification(value) {
1.50028 + somewhatImplemented('TextJustifier.lineJustification');
1.50029 + this._lineJustification = value;
1.50030 + }
1.50031 + }
1.50032 + }
1.50033 + }
1.50034 + }
1.50035 + };
1.50036 + }.call(this);
1.50037 +var TextLineDefinition = function () {
1.50038 + return {
1.50039 + __class__: 'flash.text.engine.TextLine',
1.50040 + initialize: function () {
1.50041 + },
1.50042 + __glue__: {
1.50043 + native: {
1.50044 + static: {},
1.50045 + instance: {
1.50046 + getAtomIndexAtPoint: function getAtomIndexAtPoint(stageX, stageY) {
1.50047 + notImplemented('TextLine.getAtomIndexAtPoint');
1.50048 + },
1.50049 + getAtomIndexAtCharIndex: function getAtomIndexAtCharIndex(charIndex) {
1.50050 + notImplemented('TextLine.getAtomIndexAtCharIndex');
1.50051 + },
1.50052 + getAtomBounds: function getAtomBounds(atomIndex) {
1.50053 + notImplemented('TextLine.getAtomBounds');
1.50054 + },
1.50055 + getAtomBidiLevel: function getAtomBidiLevel(atomIndex) {
1.50056 + notImplemented('TextLine.getAtomBidiLevel');
1.50057 + },
1.50058 + getAtomTextRotation: function getAtomTextRotation(atomIndex) {
1.50059 + notImplemented('TextLine.getAtomTextRotation');
1.50060 + },
1.50061 + getAtomTextBlockBeginIndex: function getAtomTextBlockBeginIndex(atomIndex) {
1.50062 + notImplemented('TextLine.getAtomTextBlockBeginIndex');
1.50063 + },
1.50064 + getAtomTextBlockEndIndex: function getAtomTextBlockEndIndex(atomIndex) {
1.50065 + notImplemented('TextLine.getAtomTextBlockEndIndex');
1.50066 + },
1.50067 + getAtomCenter: function getAtomCenter(atomIndex) {
1.50068 + notImplemented('TextLine.getAtomCenter');
1.50069 + },
1.50070 + getAtomWordBoundaryOnLeft: function getAtomWordBoundaryOnLeft(atomIndex) {
1.50071 + notImplemented('TextLine.getAtomWordBoundaryOnLeft');
1.50072 + },
1.50073 + getAtomGraphic: function getAtomGraphic(atomIndex) {
1.50074 + notImplemented('TextLine.getAtomGraphic');
1.50075 + },
1.50076 + getBaselinePosition: function getBaselinePosition(baseline) {
1.50077 + notImplemented('TextLine.getBaselinePosition');
1.50078 + },
1.50079 + dump: function dump() {
1.50080 + notImplemented('TextLine.dump');
1.50081 + },
1.50082 + textBlock: {
1.50083 + get: function textBlock() {
1.50084 + notImplemented('TextLine.textBlock');
1.50085 + return this._textBlock;
1.50086 + }
1.50087 + },
1.50088 + hasGraphicElement: {
1.50089 + get: function hasGraphicElement() {
1.50090 + notImplemented('TextLine.hasGraphicElement');
1.50091 + return this._hasGraphicElement;
1.50092 + }
1.50093 + },
1.50094 + hasTabs: {
1.50095 + get: function hasTabs() {
1.50096 + notImplemented('TextLine.hasTabs');
1.50097 + return this._hasTabs;
1.50098 + }
1.50099 + },
1.50100 + nextLine: {
1.50101 + get: function nextLine() {
1.50102 + somewhatImplemented('TextLine.nextLine');
1.50103 + return this._nextLine;
1.50104 + }
1.50105 + },
1.50106 + previousLine: {
1.50107 + get: function previousLine() {
1.50108 + somewhatImplemented('TextLine.previousLine');
1.50109 + return this._previousLine;
1.50110 + }
1.50111 + },
1.50112 + ascent: {
1.50113 + get: function ascent() {
1.50114 + somewhatImplemented('TextLine.ascent');
1.50115 + return this._ascent;
1.50116 + }
1.50117 + },
1.50118 + descent: {
1.50119 + get: function descent() {
1.50120 + somewhatImplemented('TextLine.descent');
1.50121 + return this._descent;
1.50122 + }
1.50123 + },
1.50124 + textHeight: {
1.50125 + get: function textHeight() {
1.50126 + somewhatImplemented('TextLine.textHeight');
1.50127 + return this._textHeight;
1.50128 + }
1.50129 + },
1.50130 + textWidth: {
1.50131 + get: function textWidth() {
1.50132 + somewhatImplemented('TextLine.textWidth');
1.50133 + return this._textWidth;
1.50134 + }
1.50135 + },
1.50136 + totalAscent: {
1.50137 + get: function totalAscent() {
1.50138 + notImplemented('TextLine.totalAscent');
1.50139 + return this._totalAscent;
1.50140 + }
1.50141 + },
1.50142 + totalDescent: {
1.50143 + get: function totalDescent() {
1.50144 + notImplemented('TextLine.totalDescent');
1.50145 + return this._totalDescent;
1.50146 + }
1.50147 + },
1.50148 + totalHeight: {
1.50149 + get: function totalHeight() {
1.50150 + notImplemented('TextLine.totalHeight');
1.50151 + return this._totalHeight;
1.50152 + }
1.50153 + },
1.50154 + textBlockBeginIndex: {
1.50155 + get: function textBlockBeginIndex() {
1.50156 + notImplemented('TextLine.textBlockBeginIndex');
1.50157 + return this._textBlockBeginIndex;
1.50158 + }
1.50159 + },
1.50160 + rawTextLength: {
1.50161 + get: function rawTextLength() {
1.50162 + somewhatImplemented('TextLine.rawTextLength');
1.50163 + return this._rawTextLength;
1.50164 + }
1.50165 + },
1.50166 + specifiedWidth: {
1.50167 + get: function specifiedWidth() {
1.50168 + somewhatImplemented('TextLine.specifiedWidth');
1.50169 + return this._specifiedWidth;
1.50170 + }
1.50171 + },
1.50172 + unjustifiedTextWidth: {
1.50173 + get: function unjustifiedTextWidth() {
1.50174 + somewhatImplemented('TextLine.unjustifiedTextWidth');
1.50175 + return this._unjustifiedTextWidth;
1.50176 + }
1.50177 + },
1.50178 + validity: {
1.50179 + get: function validity() {
1.50180 + return this._validity;
1.50181 + },
1.50182 + set: function validity(value) {
1.50183 + somewhatImplemented('TextLine.validity');
1.50184 + this._validity = value;
1.50185 + }
1.50186 + },
1.50187 + atomCount: {
1.50188 + get: function atomCount() {
1.50189 + notImplemented('TextLine.atomCount');
1.50190 + return this._atomCount;
1.50191 + }
1.50192 + },
1.50193 + mirrorRegions: {
1.50194 + get: function mirrorRegions() {
1.50195 + notImplemented('TextLine.mirrorRegions');
1.50196 + return this._mirrorRegions;
1.50197 + }
1.50198 + }
1.50199 + }
1.50200 + }
1.50201 + }
1.50202 + };
1.50203 + }.call(this);
1.50204 +{
1.50205 + var ContextMenuDefinition = function () {
1.50206 + return {
1.50207 + __class__: 'flash.ui.ContextMenu',
1.50208 + initialize: function () {
1.50209 + },
1.50210 + __glue__: {
1.50211 + native: {
1.50212 + static: {
1.50213 + _checkSupported: function _checkSupported() {
1.50214 + notImplemented('ContextMenu._checkSupported');
1.50215 + }
1.50216 + },
1.50217 + instance: {
1.50218 + cloneLinkAndClipboardProperties: function cloneLinkAndClipboardProperties(c) {
1.50219 + notImplemented('ContextMenu.cloneLinkAndClipboardProperties');
1.50220 + },
1.50221 + builtInItems: {
1.50222 + get: function builtInItems() {
1.50223 + somewhatImplemented('ContextMenu.builtInItems');
1.50224 + return this._builtInItems;
1.50225 + },
1.50226 + set: function builtInItems(value) {
1.50227 + somewhatImplemented('ContextMenu.builtInItems');
1.50228 + this._builtInItems = value;
1.50229 + }
1.50230 + },
1.50231 + customItems: {
1.50232 + get: function customItems() {
1.50233 + somewhatImplemented('ContextMenu.customItems');
1.50234 + return this._customItems;
1.50235 + },
1.50236 + set: function customItems(value) {
1.50237 + somewhatImplemented('ContextMenu.customItems');
1.50238 + this._customItems = value;
1.50239 + }
1.50240 + },
1.50241 + link: {
1.50242 + get: function link() {
1.50243 + notImplemented('ContextMenu.link');
1.50244 + return this._link;
1.50245 + },
1.50246 + set: function link(value) {
1.50247 + notImplemented('ContextMenu.link');
1.50248 + this._link = value;
1.50249 + }
1.50250 + },
1.50251 + clipboardMenu: {
1.50252 + get: function clipboardMenu() {
1.50253 + notImplemented('ContextMenu.clipboardMenu');
1.50254 + return this._clipboardMenu;
1.50255 + },
1.50256 + set: function clipboardMenu(value) {
1.50257 + notImplemented('ContextMenu.clipboardMenu');
1.50258 + this._clipboardMenu = value;
1.50259 + }
1.50260 + },
1.50261 + clipboardItems: {
1.50262 + get: function clipboardItems() {
1.50263 + notImplemented('ContextMenu.clipboardItems');
1.50264 + return this._clipboardItems;
1.50265 + },
1.50266 + set: function clipboardItems(value) {
1.50267 + notImplemented('ContextMenu.clipboardItems');
1.50268 + this._clipboardItems = value;
1.50269 + }
1.50270 + }
1.50271 + }
1.50272 + }
1.50273 + }
1.50274 + };
1.50275 + }.call(this);
1.50276 +}
1.50277 +var ContextMenuItemDefinition = function () {
1.50278 + return {
1.50279 + __class__: 'flash.ui.ContextMenuItem',
1.50280 + initialize: function () {
1.50281 + },
1.50282 + __glue__: {
1.50283 + native: {
1.50284 + static: {},
1.50285 + instance: {
1.50286 + caption: {
1.50287 + get: function caption() {
1.50288 + somewhatImplemented('ContextMenuItem.caption');
1.50289 + return this._caption;
1.50290 + },
1.50291 + set: function caption(value) {
1.50292 + somewhatImplemented('ContextMenuItem.caption');
1.50293 + this._caption = value;
1.50294 + }
1.50295 + },
1.50296 + separatorBefore: {
1.50297 + get: function separatorBefore() {
1.50298 + somewhatImplemented('ContextMenuItem.separatorBefore');
1.50299 + return this._separatorBefore;
1.50300 + },
1.50301 + set: function separatorBefore(value) {
1.50302 + somewhatImplemented('ContextMenuItem.separatorBefore');
1.50303 + this._separatorBefore = value;
1.50304 + }
1.50305 + },
1.50306 + visible: {
1.50307 + get: function visible() {
1.50308 + somewhatImplemented('ContextMenuItem.visible');
1.50309 + return this._visible;
1.50310 + },
1.50311 + set: function visible(value) {
1.50312 + somewhatImplemented('ContextMenuItem.visible');
1.50313 + this._visible = value;
1.50314 + }
1.50315 + }
1.50316 + }
1.50317 + }
1.50318 + }
1.50319 + };
1.50320 + }.call(this);
1.50321 +var ShumwayKeyboardListener = {
1.50322 + _lastKeyCode: 0,
1.50323 + _captureKeyPress: false,
1.50324 + _charCodeMap: [],
1.50325 + focus: null,
1.50326 + handleEvent: function (domEvt) {
1.50327 + var keyCode = domEvt.keyCode;
1.50328 + if (domEvt.type === 'keydown') {
1.50329 + this._lastKeyCode = keyCode;
1.50330 + this._captureKeyPress = keyCode === 8 || keyCode === 9 || keyCode === 13 || keyCode === 32 || keyCode >= 48 && keyCode <= 90 || keyCode > 145;
1.50331 + if (this._captureKeyPress) {
1.50332 + return;
1.50333 + }
1.50334 + this._charCodeMap[keyCode] = 0;
1.50335 + } else if (domEvt.type === 'keypress') {
1.50336 + if (this._captureKeyPress) {
1.50337 + keyCode = this._lastKeyCode;
1.50338 + this._charCodeMap[keyCode] = domEvt.charCode;
1.50339 + } else {
1.50340 + return;
1.50341 + }
1.50342 + }
1.50343 + if (this.focus) {
1.50344 + this.focus._dispatchEvent(new flash.events.KeyboardEvent(domEvt.type === 'keyup' ? 'keyUp' : 'keyDown', true, false, domEvt.type === 'keyup' ? this._charCodeMap[keyCode] : domEvt.charCode, domEvt.type === 'keyup' ? domEvt.keyCode : this._lastKeyCode, domEvt.keyLocation, domEvt.ctrlKey, domEvt.altKey, domEvt.shiftKey));
1.50345 + }
1.50346 + }
1.50347 + };
1.50348 +window.addEventListener('keydown', ShumwayKeyboardListener);
1.50349 +window.addEventListener('keypress', ShumwayKeyboardListener);
1.50350 +window.addEventListener('keyup', ShumwayKeyboardListener);
1.50351 +var KeyboardDefinition = function () {
1.50352 + var def = {
1.50353 + get capsLock() {
1.50354 + return false;
1.50355 + },
1.50356 + get hasVirtualKeyboard() {
1.50357 + return false;
1.50358 + },
1.50359 + get numLock() {
1.50360 + return false;
1.50361 + },
1.50362 + get physicalKeyboardType() {
1.50363 + return 'alphanumeric';
1.50364 + },
1.50365 + get isAccessible() {
1.50366 + return true;
1.50367 + }
1.50368 + };
1.50369 + var desc = Object.getOwnPropertyDescriptor;
1.50370 + def.__glue__ = {
1.50371 + script: {
1.50372 + static: scriptProperties('public', [
1.50373 + 'A',
1.50374 + 'ALTERNATE',
1.50375 + 'AUDIO',
1.50376 + 'B',
1.50377 + 'BACK',
1.50378 + 'BACKQUOTE',
1.50379 + 'BACKSLASH',
1.50380 + 'BACKSPACE',
1.50381 + 'BLUE',
1.50382 + 'C',
1.50383 + 'CAPS_LOCK',
1.50384 + 'CHANNEL_DOWN',
1.50385 + 'CHANNEL_UP',
1.50386 + 'COMMA',
1.50387 + 'COMMAND',
1.50388 + 'CONTROL',
1.50389 + 'D',
1.50390 + 'DELETE',
1.50391 + 'DOWN',
1.50392 + 'DVR',
1.50393 + 'E',
1.50394 + 'END',
1.50395 + 'ENTER',
1.50396 + 'EQUAL',
1.50397 + 'ESCAPE',
1.50398 + 'EXIT',
1.50399 + 'F',
1.50400 + 'F1',
1.50401 + 'F10',
1.50402 + 'F11',
1.50403 + 'F12',
1.50404 + 'F13',
1.50405 + 'F14',
1.50406 + 'F15',
1.50407 + 'F2',
1.50408 + 'F3',
1.50409 + 'F4',
1.50410 + 'F5',
1.50411 + 'F6',
1.50412 + 'F7',
1.50413 + 'F8',
1.50414 + 'F9',
1.50415 + 'FAST_FORWARD',
1.50416 + 'G',
1.50417 + 'GREEN',
1.50418 + 'GUIDE',
1.50419 + 'H',
1.50420 + 'HELP',
1.50421 + 'HOME',
1.50422 + 'I',
1.50423 + 'INFO',
1.50424 + 'INPUT',
1.50425 + 'INSERT',
1.50426 + 'J',
1.50427 + 'K',
1.50428 + 'KEYNAME_BEGIN',
1.50429 + 'KEYNAME_BREAK',
1.50430 + 'KEYNAME_CLEARDISPLAY',
1.50431 + 'KEYNAME_CLEARLINE',
1.50432 + 'KEYNAME_DELETE',
1.50433 + 'KEYNAME_DELETECHAR',
1.50434 + 'KEYNAME_DELETELINE',
1.50435 + 'KEYNAME_DOWNARROW',
1.50436 + 'KEYNAME_END',
1.50437 + 'KEYNAME_EXECUTE',
1.50438 + 'KEYNAME_F1',
1.50439 + 'KEYNAME_F10',
1.50440 + 'KEYNAME_F11',
1.50441 + 'KEYNAME_F12',
1.50442 + 'KEYNAME_F13',
1.50443 + 'KEYNAME_F14',
1.50444 + 'KEYNAME_F15',
1.50445 + 'KEYNAME_F16',
1.50446 + 'KEYNAME_F17',
1.50447 + 'KEYNAME_F18',
1.50448 + 'KEYNAME_F19',
1.50449 + 'KEYNAME_F2',
1.50450 + 'KEYNAME_F20',
1.50451 + 'KEYNAME_F21',
1.50452 + 'KEYNAME_F22',
1.50453 + 'KEYNAME_F23',
1.50454 + 'KEYNAME_F24',
1.50455 + 'KEYNAME_F25',
1.50456 + 'KEYNAME_F26',
1.50457 + 'KEYNAME_F27',
1.50458 + 'KEYNAME_F28',
1.50459 + 'KEYNAME_F29',
1.50460 + 'KEYNAME_F3',
1.50461 + 'KEYNAME_F30',
1.50462 + 'KEYNAME_F31',
1.50463 + 'KEYNAME_F32',
1.50464 + 'KEYNAME_F33',
1.50465 + 'KEYNAME_F34',
1.50466 + 'KEYNAME_F35',
1.50467 + 'KEYNAME_F4',
1.50468 + 'KEYNAME_F5',
1.50469 + 'KEYNAME_F6',
1.50470 + 'KEYNAME_F7',
1.50471 + 'KEYNAME_F8',
1.50472 + 'KEYNAME_F9',
1.50473 + 'KEYNAME_FIND',
1.50474 + 'KEYNAME_HELP',
1.50475 + 'KEYNAME_HOME',
1.50476 + 'KEYNAME_INSERT',
1.50477 + 'KEYNAME_INSERTCHAR',
1.50478 + 'KEYNAME_INSERTLINE',
1.50479 + 'KEYNAME_LEFTARROW',
1.50480 + 'KEYNAME_MENU',
1.50481 + 'KEYNAME_MODESWITCH',
1.50482 + 'KEYNAME_NEXT',
1.50483 + 'KEYNAME_PAGEDOWN',
1.50484 + 'KEYNAME_PAGEUP',
1.50485 + 'KEYNAME_PAUSE',
1.50486 + 'KEYNAME_PREV',
1.50487 + 'KEYNAME_PRINT',
1.50488 + 'KEYNAME_PRINTSCREEN',
1.50489 + 'KEYNAME_REDO',
1.50490 + 'KEYNAME_RESET',
1.50491 + 'KEYNAME_RIGHTARROW',
1.50492 + 'KEYNAME_SCROLLLOCK',
1.50493 + 'KEYNAME_SELECT',
1.50494 + 'KEYNAME_STOP',
1.50495 + 'KEYNAME_SYSREQ',
1.50496 + 'KEYNAME_SYSTEM',
1.50497 + 'KEYNAME_UNDO',
1.50498 + 'KEYNAME_UPARROW',
1.50499 + 'KEYNAME_USER',
1.50500 + 'L',
1.50501 + 'LAST',
1.50502 + 'LEFT',
1.50503 + 'LEFTBRACKET',
1.50504 + 'LIVE',
1.50505 + 'M',
1.50506 + 'MASTER_SHELL',
1.50507 + 'MENU',
1.50508 + 'MINUS',
1.50509 + 'N',
1.50510 + 'NEXT',
1.50511 + 'NUMBER_0',
1.50512 + 'NUMBER_1',
1.50513 + 'NUMBER_2',
1.50514 + 'NUMBER_3',
1.50515 + 'NUMBER_4',
1.50516 + 'NUMBER_5',
1.50517 + 'NUMBER_6',
1.50518 + 'NUMBER_7',
1.50519 + 'NUMBER_8',
1.50520 + 'NUMBER_9',
1.50521 + 'NUMPAD',
1.50522 + 'NUMPAD_0',
1.50523 + 'NUMPAD_1',
1.50524 + 'NUMPAD_2',
1.50525 + 'NUMPAD_3',
1.50526 + 'NUMPAD_4',
1.50527 + 'NUMPAD_5',
1.50528 + 'NUMPAD_6',
1.50529 + 'NUMPAD_7',
1.50530 + 'NUMPAD_8',
1.50531 + 'NUMPAD_9',
1.50532 + 'NUMPAD_ADD',
1.50533 + 'NUMPAD_DECIMAL',
1.50534 + 'NUMPAD_DIVIDE',
1.50535 + 'NUMPAD_ENTER',
1.50536 + 'NUMPAD_MULTIPLY',
1.50537 + 'NUMPAD_SUBTRACT',
1.50538 + 'O',
1.50539 + 'P',
1.50540 + 'PAGE_DOWN',
1.50541 + 'PAGE_UP',
1.50542 + 'PAUSE',
1.50543 + 'PERIOD',
1.50544 + 'PLAY',
1.50545 + 'PREVIOUS',
1.50546 + 'Q',
1.50547 + 'QUOTE',
1.50548 + 'R',
1.50549 + 'RECORD',
1.50550 + 'RED',
1.50551 + 'REWIND',
1.50552 + 'RIGHT',
1.50553 + 'RIGHTBRACKET',
1.50554 + 'S',
1.50555 + 'SEARCH',
1.50556 + 'SEMICOLON',
1.50557 + 'SETUP',
1.50558 + 'SHIFT',
1.50559 + 'SKIP_BACKWARD',
1.50560 + 'SKIP_FORWARD',
1.50561 + 'SLASH',
1.50562 + 'SPACE',
1.50563 + 'STOP',
1.50564 + 'STRING_BEGIN',
1.50565 + 'STRING_BREAK',
1.50566 + 'STRING_CLEARDISPLAY',
1.50567 + 'STRING_CLEARLINE',
1.50568 + 'STRING_DELETE',
1.50569 + 'STRING_DELETECHAR',
1.50570 + 'STRING_DELETELINE',
1.50571 + 'STRING_DOWNARROW',
1.50572 + 'STRING_END',
1.50573 + 'STRING_EXECUTE',
1.50574 + 'STRING_F1',
1.50575 + 'STRING_F10',
1.50576 + 'STRING_F11',
1.50577 + 'STRING_F12',
1.50578 + 'STRING_F13',
1.50579 + 'STRING_F14',
1.50580 + 'STRING_F15',
1.50581 + 'STRING_F16',
1.50582 + 'STRING_F17',
1.50583 + 'STRING_F18',
1.50584 + 'STRING_F19',
1.50585 + 'STRING_F2',
1.50586 + 'STRING_F20',
1.50587 + 'STRING_F21',
1.50588 + 'STRING_F22',
1.50589 + 'STRING_F23',
1.50590 + 'STRING_F24',
1.50591 + 'STRING_F25',
1.50592 + 'STRING_F26',
1.50593 + 'STRING_F27',
1.50594 + 'STRING_F28',
1.50595 + 'STRING_F29',
1.50596 + 'STRING_F3',
1.50597 + 'STRING_F30',
1.50598 + 'STRING_F31',
1.50599 + 'STRING_F32',
1.50600 + 'STRING_F33',
1.50601 + 'STRING_F34',
1.50602 + 'STRING_F35',
1.50603 + 'STRING_F4',
1.50604 + 'STRING_F5',
1.50605 + 'STRING_F6',
1.50606 + 'STRING_F7',
1.50607 + 'STRING_F8',
1.50608 + 'STRING_F9',
1.50609 + 'STRING_FIND',
1.50610 + 'STRING_HELP',
1.50611 + 'STRING_HOME',
1.50612 + 'STRING_INSERT',
1.50613 + 'STRING_INSERTCHAR',
1.50614 + 'STRING_INSERTLINE',
1.50615 + 'STRING_LEFTARROW',
1.50616 + 'STRING_MENU',
1.50617 + 'STRING_MODESWITCH',
1.50618 + 'STRING_NEXT',
1.50619 + 'STRING_PAGEDOWN',
1.50620 + 'STRING_PAGEUP',
1.50621 + 'STRING_PAUSE',
1.50622 + 'STRING_PREV',
1.50623 + 'STRING_PRINT',
1.50624 + 'STRING_PRINTSCREEN',
1.50625 + 'STRING_REDO',
1.50626 + 'STRING_RESET',
1.50627 + 'STRING_RIGHTARROW',
1.50628 + 'STRING_SCROLLLOCK',
1.50629 + 'STRING_SELECT',
1.50630 + 'STRING_STOP',
1.50631 + 'STRING_SYSREQ',
1.50632 + 'STRING_SYSTEM',
1.50633 + 'STRING_UNDO',
1.50634 + 'STRING_UPARROW',
1.50635 + 'STRING_USER',
1.50636 + 'SUBTITLE',
1.50637 + 'T',
1.50638 + 'TAB',
1.50639 + 'U',
1.50640 + 'UP',
1.50641 + 'V',
1.50642 + 'VOD',
1.50643 + 'W',
1.50644 + 'X',
1.50645 + 'Y',
1.50646 + 'YELLOW',
1.50647 + 'Z',
1.50648 + 'CharCodeStrings'
1.50649 + ])
1.50650 + },
1.50651 + native: {
1.50652 + instance: {
1.50653 + capsLock: desc(def, 'capsLock'),
1.50654 + hasVirtualKeyboard: desc(def, 'hasVirtualKeyboard'),
1.50655 + numLock: desc(def, 'numLock'),
1.50656 + physicalKeyboardType: desc(def, 'physicalKeyboardType'),
1.50657 + isAccessible: desc(def, 'isAccessible')
1.50658 + }
1.50659 + }
1.50660 + };
1.50661 + return def;
1.50662 + }.call(this);
1.50663 +var MouseDefinition = function () {
1.50664 + var def = {
1.50665 + __class__: 'flash.ui.Mouse'
1.50666 + };
1.50667 + function hide() {
1.50668 + }
1.50669 + function show() {
1.50670 + }
1.50671 + function registerCursor() {
1.50672 + notImplemented();
1.50673 + }
1.50674 + function unregisterCursor() {
1.50675 + notImplemented();
1.50676 + }
1.50677 + def.__glue__ = {
1.50678 + native: {
1.50679 + static: {
1.50680 + cursor: {
1.50681 + get: function () {
1.50682 + return 'auto';
1.50683 + },
1.50684 + set: function () {
1.50685 + notImplemented();
1.50686 + }
1.50687 + },
1.50688 + supportsCursor: {
1.50689 + get: function () {
1.50690 + return true;
1.50691 + }
1.50692 + },
1.50693 + supportsNativeCursor: {
1.50694 + get: function () {
1.50695 + return true;
1.50696 + }
1.50697 + },
1.50698 + hide: hide,
1.50699 + show: show,
1.50700 + registerCursor: registerCursor,
1.50701 + unregisterCursor: unregisterCursor
1.50702 + }
1.50703 + }
1.50704 + };
1.50705 + return def;
1.50706 + }.call(this);
1.50707 +var MouseCursorDataDefinition = function () {
1.50708 + return {
1.50709 + __class__: 'flash.ui.MouseCursorData',
1.50710 + initialize: function () {
1.50711 + },
1.50712 + __glue__: {
1.50713 + native: {
1.50714 + static: {},
1.50715 + instance: {
1.50716 + data: {
1.50717 + get: function data() {
1.50718 + notImplemented('MouseCursorData.data');
1.50719 + return this._data;
1.50720 + },
1.50721 + set: function data(data) {
1.50722 + notImplemented('MouseCursorData.data');
1.50723 + this._data = data;
1.50724 + }
1.50725 + },
1.50726 + hotSpot: {
1.50727 + get: function hotSpot() {
1.50728 + notImplemented('MouseCursorData.hotSpot');
1.50729 + return this._hotSpot;
1.50730 + },
1.50731 + set: function hotSpot(data) {
1.50732 + notImplemented('MouseCursorData.hotSpot');
1.50733 + this._hotSpot = data;
1.50734 + }
1.50735 + },
1.50736 + frameRate: {
1.50737 + get: function frameRate() {
1.50738 + notImplemented('MouseCursorData.frameRate');
1.50739 + return this._frameRate;
1.50740 + },
1.50741 + set: function frameRate(data) {
1.50742 + notImplemented('MouseCursorData.frameRate');
1.50743 + this._frameRate = data;
1.50744 + }
1.50745 + }
1.50746 + }
1.50747 + }
1.50748 + }
1.50749 + };
1.50750 + }.call(this);
1.50751 +{
1.50752 + var DictionaryDefinition = function () {
1.50753 + return {
1.50754 + __class__: 'flash.utils.Dictionary',
1.50755 + initialize: function () {
1.50756 + },
1.50757 + __glue__: {
1.50758 + native: {
1.50759 + static: {},
1.50760 + instance: {
1.50761 + init: function init(weakKeys) {
1.50762 + notImplemented('Dictionary.init');
1.50763 + }
1.50764 + }
1.50765 + }
1.50766 + }
1.50767 + };
1.50768 + }.call(this);
1.50769 +}
1.50770 +var TimerDefinition = function () {
1.50771 + var def = {
1.50772 + __class__: 'flash.utils.Timer',
1.50773 + initialize: function () {
1.50774 + this._running = false;
1.50775 + }
1.50776 + };
1.50777 + def.__glue__ = {
1.50778 + native: {
1.50779 + instance: {
1.50780 + running: {
1.50781 + get: function () {
1.50782 + return this._running;
1.50783 + }
1.50784 + },
1.50785 + _start: function (delay, closure) {
1.50786 + this._running = true;
1.50787 + this.interval = setInterval(closure, delay);
1.50788 + },
1.50789 + stop: function () {
1.50790 + this._running = false;
1.50791 + clearInterval(this.interval);
1.50792 + },
1.50793 + _tick: function () {
1.50794 + if (!this._running) {
1.50795 + return;
1.50796 + }
1.50797 + this._dispatchEvent(new flash.events.TimerEvent('timer', true, false));
1.50798 + }
1.50799 + }
1.50800 + }
1.50801 + };
1.50802 + return def;
1.50803 + }.call(this);
1.50804 +{
1.50805 + var AccessibilityDefinition = function () {
1.50806 + return {
1.50807 + __class__: 'flash.accessibility.Accessibility',
1.50808 + initialize: function () {
1.50809 + },
1.50810 + __glue__: {
1.50811 + native: {
1.50812 + static: {
1.50813 + sendEvent: function sendEvent(source, childID, eventType, nonHTML) {
1.50814 + notImplemented('Accessibility.sendEvent');
1.50815 + },
1.50816 + updateProperties: function updateProperties() {
1.50817 + notImplemented('Accessibility.updateProperties');
1.50818 + },
1.50819 + active: {
1.50820 + get: function active() {
1.50821 + somewhatImplemented('Accessibility.active');
1.50822 + return false;
1.50823 + }
1.50824 + }
1.50825 + },
1.50826 + instance: {}
1.50827 + }
1.50828 + }
1.50829 + };
1.50830 + }.call(this);
1.50831 +}
1.50832 +{
1.50833 + var AS2ButtonDefinition = function () {
1.50834 + var def = {
1.50835 + __class__: 'avm1lib.AS2Button',
1.50836 + initialize: function () {
1.50837 + }
1.50838 + };
1.50839 + var desc = Object.getOwnPropertyDescriptor;
1.50840 + def.__glue__ = {
1.50841 + native: {
1.50842 + instance: {
1.50843 + _as3Object: {
1.50844 + get: function () {
1.50845 + return this.$nativeObject;
1.50846 + }
1.50847 + },
1.50848 + _init: function init(nativeButton) {
1.50849 + Object.defineProperty(this, '$nativeObject', {
1.50850 + value: nativeButton
1.50851 + });
1.50852 + nativeButton.$as2Object = this;
1.50853 + initDefaultListeners(this);
1.50854 + }
1.50855 + }
1.50856 + },
1.50857 + script: {
1.50858 + instance: Glue.ALL
1.50859 + }
1.50860 + };
1.50861 + return def;
1.50862 + }.call(this);
1.50863 +}
1.50864 +var AS2GlobalsDefinition = function () {
1.50865 + var def = {
1.50866 + __class__: 'avm1lib.AS2Globals',
1.50867 + initialize: function () {
1.50868 + flash.text.TextFormat.prototype.asDefinePublicProperty('getTextExtent', {
1.50869 + value: TextFormatDefinition.as2GetTextExtent,
1.50870 + writable: false,
1.50871 + enumerable: false,
1.50872 + configurable: false
1.50873 + });
1.50874 + }
1.50875 + };
1.50876 + def.__glue__ = {
1.50877 + native: {
1.50878 + instance: {
1.50879 + ASSetPropFlags: function ASSetPropFlags(obj, children, flags, allowFalse) {
1.50880 + },
1.50881 + _addToPendingScripts: function _addToPendingScripts(subject, fn, args) {
1.50882 + AS2Context.instance.addToPendingScripts(function () {
1.50883 + fn.apply(subject, args);
1.50884 + });
1.50885 + },
1.50886 + _setLevel: function _setLevel(level, loader) {
1.50887 + AS2Context.instance.stage._as2SetLevel(level, loader);
1.50888 + },
1.50889 + trace: function (expression) {
1.50890 + var trace = avm2.applicationDomain.getProperty(Multiname.fromSimpleName('trace'), true, true);
1.50891 + trace(expression);
1.50892 + }
1.50893 + },
1.50894 + static: {
1.50895 + _addInternalClasses: function _addInternalClasses(proto) {
1.50896 + proto.asSetPublicProperty('Object', Stubs.Object);
1.50897 + proto.asSetPublicProperty('Function', Stubs.Function);
1.50898 + proto.asSetPublicProperty('Array', Stubs.Array);
1.50899 + proto.asSetPublicProperty('Number', Stubs.Number);
1.50900 + proto.asSetPublicProperty('Math', avm2.systemDomain.getClass('Math'));
1.50901 + proto.asSetPublicProperty('Boolean', Stubs.Boolean);
1.50902 + proto.asSetPublicProperty('Date', Stubs.Date);
1.50903 + proto.asSetPublicProperty('RegExp', Stubs.RegExp);
1.50904 + proto.asSetPublicProperty('String', Stubs.String);
1.50905 + }
1.50906 + }
1.50907 + },
1.50908 + script: {
1.50909 + instance: Glue.ALL
1.50910 + }
1.50911 + };
1.50912 + return def;
1.50913 + }.call(this);
1.50914 +var AS2MovieClipDefinition = function () {
1.50915 + var def = {
1.50916 + __class__: 'avm1lib.AS2MovieClip',
1.50917 + initialize: function () {
1.50918 + },
1.50919 + _insertChildAtDepth: function _insertChildAtDepth(mc, depth) {
1.50920 + return this.$nativeObject._insertChildAtDepth(mc, depth);
1.50921 + },
1.50922 + _duplicate: function _duplicate(name, depth, initObject) {
1.50923 + return this.$nativeObject._duplicate(name, depth, initObject);
1.50924 + },
1.50925 + _constructSymbol: function constructSymbol(symbolId, name) {
1.50926 + var theClass = AS2Context.instance.classes && AS2Context.instance.classes[symbolId];
1.50927 + var symbolProps = AS2Context.instance.assets[symbolId];
1.50928 + var symbolClass = flash.display.MovieClip.class;
1.50929 + var mc = symbolClass.createAsSymbol(symbolProps);
1.50930 + mc._avm1SymbolClass = theClass;
1.50931 + symbolClass.instanceConstructor.call(mc);
1.50932 + this.$nativeObject.addChild(mc);
1.50933 + return mc;
1.50934 + },
1.50935 + _gotoLabel: function (label) {
1.50936 + this.$nativeObject.gotoLabel(label);
1.50937 + },
1.50938 + _callFrame: function callFrame(frame) {
1.50939 + this.$nativeObject._callFrame(frame);
1.50940 + },
1.50941 + init: function init(nativeMovieClip) {
1.50942 + if (!nativeMovieClip) {
1.50943 + return;
1.50944 + }
1.50945 + Object.defineProperty(this, '$nativeObject', {
1.50946 + value: nativeMovieClip
1.50947 + });
1.50948 + nativeMovieClip.$as2Object = this;
1.50949 + initDefaultListeners(this);
1.50950 + }
1.50951 + };
1.50952 + var desc = Object.getOwnPropertyDescriptor;
1.50953 + def.__glue__ = {
1.50954 + native: {
1.50955 + instance: {
1.50956 + _as3Object: {
1.50957 + get: function () {
1.50958 + return this.$nativeObject;
1.50959 + }
1.50960 + },
1.50961 + _init: def.init,
1.50962 + _insertChildAtDepth: def._insertChildAtDepth,
1.50963 + _duplicate: def._duplicate,
1.50964 + _constructSymbol: def._constructSymbol,
1.50965 + _callFrame: def._callFrame,
1.50966 + _gotoLabel: def._gotoLabel
1.50967 + }
1.50968 + },
1.50969 + script: {
1.50970 + instance: Glue.ALL
1.50971 + }
1.50972 + };
1.50973 + return def;
1.50974 + }.call(this);
1.50975 +var AS2MovieClipLoaderDefinition = function () {
1.50976 + var def = {
1.50977 + __class__: 'avm1lib.AS2MovieClipLoader',
1.50978 + initialize: function () {
1.50979 + },
1.50980 + get _bytesLoaded() {
1.50981 + return this.$nativeObject._contentLoaderInfo._bytesLoaded;
1.50982 + }
1.50983 + };
1.50984 + var desc = Object.getOwnPropertyDescriptor;
1.50985 + def.__glue__ = {
1.50986 + native: {
1.50987 + instance: {
1.50988 + $nativeObject: {
1.50989 + get: function () {
1.50990 + return this.$nativeObject;
1.50991 + }
1.50992 + },
1.50993 + _bytesLoaded: desc(def, '_bytesLoaded')
1.50994 + }
1.50995 + },
1.50996 + script: {
1.50997 + instance: Glue.ALL
1.50998 + }
1.50999 + };
1.51000 + return def;
1.51001 + }.call(this);
1.51002 +var AS2TextFieldDefinition = function () {
1.51003 + var def = {
1.51004 + __class__: 'avm1lib.AS2TextField',
1.51005 + initialize: function () {
1.51006 + this._variable = '';
1.51007 + }
1.51008 + };
1.51009 + def.__glue__ = {
1.51010 + native: {
1.51011 + instance: {
1.51012 + variable: {
1.51013 + get: function () {
1.51014 + return this._variable;
1.51015 + },
1.51016 + set: function (name) {
1.51017 + if (name === this._variable) {
1.51018 + return;
1.51019 + }
1.51020 + this._variable = name;
1.51021 + var instance = this.$nativeObject;
1.51022 + var hasPath = name.indexOf('.') >= 0 || name.indexOf(':') >= 0;
1.51023 + var clip;
1.51024 + if (hasPath) {
1.51025 + var targetPath = name.split(/[.:\/]/g);
1.51026 + name = targetPath.pop();
1.51027 + if (targetPath[0] == '_root' || targetPath[0] === '') {
1.51028 + clip = instance.root._getAS2Object();
1.51029 + targetPath.shift();
1.51030 + if (targetPath[0] === '') {
1.51031 + targetPath.shift();
1.51032 + }
1.51033 + } else {
1.51034 + clip = instance._parent._getAS2Object();
1.51035 + }
1.51036 + while (targetPath.length > 0) {
1.51037 + var childName = targetPath.shift();
1.51038 + clip = clip.asGetPublicProperty(childName) || clip[childName];
1.51039 + if (!clip) {
1.51040 + throw new Error('Cannot find ' + childName + ' variable');
1.51041 + }
1.51042 + }
1.51043 + } else {
1.51044 + clip = instance._parent._getAS2Object();
1.51045 + }
1.51046 + if (!clip.asHasProperty(undefined, name, 0)) {
1.51047 + clip.asSetPublicProperty(name, instance.text);
1.51048 + }
1.51049 + instance._addEventListener('advanceFrame', function () {
1.51050 + instance.text = '' + clip.asGetPublicProperty(name);
1.51051 + });
1.51052 + }
1.51053 + },
1.51054 + _as3Object: {
1.51055 + get: function () {
1.51056 + return this.$nativeObject;
1.51057 + }
1.51058 + },
1.51059 + _init: function init(nativeTextField) {
1.51060 + Object.defineProperty(this, '$nativeObject', {
1.51061 + value: nativeTextField
1.51062 + });
1.51063 + nativeTextField.$as2Object = this;
1.51064 + initDefaultListeners(this);
1.51065 + }
1.51066 + }
1.51067 + },
1.51068 + script: {
1.51069 + instance: Glue.ALL
1.51070 + }
1.51071 + };
1.51072 + return def;
1.51073 + }.call(this);
1.51074 +var AS2UtilsDefinition = function () {
1.51075 + var def = {
1.51076 + __class__: 'avm1lib.AS2Utils',
1.51077 + initialize: function () {
1.51078 + }
1.51079 + };
1.51080 + function installObjectMethods() {
1.51081 + var c = Stubs.Object, p = c.asGetPublicProperty('prototype');
1.51082 + c.asSetPublicProperty('registerClass', function registerClass(name, theClass) {
1.51083 + var classes = AS2Context.instance.classes || (AS2Context.instance.classes = {});
1.51084 + classes[name] = theClass;
1.51085 + });
1.51086 + p.asDefinePublicProperty('addProperty', {
1.51087 + value: function addProperty(name, getter, setter) {
1.51088 + if (typeof name !== 'string' || name === '') {
1.51089 + return false;
1.51090 + }
1.51091 + if (typeof getter !== 'function') {
1.51092 + return false;
1.51093 + }
1.51094 + if (typeof setter !== 'function' && setter !== null) {
1.51095 + return false;
1.51096 + }
1.51097 + this.asDefinePublicProperty(name, {
1.51098 + get: getter,
1.51099 + set: setter || undefined,
1.51100 + configurable: true,
1.51101 + enumerable: true
1.51102 + });
1.51103 + return true;
1.51104 + },
1.51105 + writable: false,
1.51106 + enumerable: false,
1.51107 + configurable: false
1.51108 + });
1.51109 + }
1.51110 + def.__glue__ = {
1.51111 + native: {
1.51112 + static: {
1.51113 + getAS2Object: function (nativeObject) {
1.51114 + return nativeObject && nativeObject._getAS2Object ? nativeObject._getAS2Object() : null;
1.51115 + },
1.51116 + addProperty: function (obj, propertyName, getter, setter, enumerable) {
1.51117 + obj.asDefinePublicProperty(propertyName, {
1.51118 + get: getter,
1.51119 + set: setter || undefined,
1.51120 + enumerable: enumerable,
1.51121 + configurable: true
1.51122 + });
1.51123 + },
1.51124 + resolveTarget: function (target_mc) {
1.51125 + return AS2Context.instance.resolveTarget(target_mc);
1.51126 + },
1.51127 + resolveLevel: function (level) {
1.51128 + return AS2Context.instance.resolveLevel(level);
1.51129 + },
1.51130 + currentStage: {
1.51131 + get: function () {
1.51132 + return AS2Context.instance.stage;
1.51133 + }
1.51134 + },
1.51135 + _installObjectMethods: installObjectMethods
1.51136 + }
1.51137 + }
1.51138 + };
1.51139 + return def;
1.51140 + }.call(this);
1.51141 +function initDefaultListeners(thisArg) {
1.51142 + var defaultListeners = thisArg.asGetPublicProperty('$defaultListeners');
1.51143 + if (!defaultListeners) {
1.51144 + return;
1.51145 + }
1.51146 + for (var i = 0; i < defaultListeners.length; i++) {
1.51147 + var p = defaultListeners[i];
1.51148 + p.asGetPublicProperty('setter').call(thisArg, p.value);
1.51149 + }
1.51150 +}
1.51151 +function bindNativeClassDefinition(nativeName, definition) {
1.51152 + natives[nativeName] = function (domain, scope, instanceConstructor, baseClass) {
1.51153 + var c = new Class(undefined, instanceConstructor, ApplicationDomain.coerceCallable);
1.51154 + c.extend(baseClass);
1.51155 + c.linkNatives(definition);
1.51156 + return c;
1.51157 + };
1.51158 +}
1.51159 +var Stubs = new function () {
1.51160 + var that = this;
1.51161 + var definitions = createEmptyObject();
1.51162 + var DEFAULT_DEFINITION = {
1.51163 + __glue__: {
1.51164 + script: {
1.51165 + instance: Glue.ALL,
1.51166 + static: Glue.ALL
1.51167 + }
1.51168 + }
1.51169 + };
1.51170 + this.getClassNames = function () {
1.51171 + return Object.keys(definitions);
1.51172 + };
1.51173 + this.onClassCreated = function (eventType, cls) {
1.51174 + var classOriginalName = cls.classInfo.instanceInfo.name.getOriginalName();
1.51175 + if (classOriginalName in definitions) {
1.51176 + cls.link(definitions[classOriginalName] || DEFAULT_DEFINITION);
1.51177 + }
1.51178 + };
1.51179 + function makeStub(container, classSimpleName, shortName) {
1.51180 + Object.defineProperty(container, shortName, {
1.51181 + get: function () {
1.51182 + var cls = avm2.systemDomain.getClass(classSimpleName);
1.51183 + true;
1.51184 + Object.defineProperty(container, shortName, {
1.51185 + value: cls.instanceConstructor,
1.51186 + writable: false
1.51187 + });
1.51188 + return container[shortName];
1.51189 + },
1.51190 + configurable: true
1.51191 + });
1.51192 + }
1.51193 + [
1.51194 + 'Boolean',
1.51195 + 'Date',
1.51196 + 'String',
1.51197 + 'Function',
1.51198 + 'Object',
1.51199 + 'Number',
1.51200 + 'Math',
1.51201 + 'Array',
1.51202 + 'RegExp'
1.51203 + ].forEach(function (classSimpleName) {
1.51204 + makeStub(that, classSimpleName, classSimpleName);
1.51205 + });
1.51206 + [
1.51207 + 'Error',
1.51208 + 'DefinitionError',
1.51209 + 'EvalError',
1.51210 + 'RangeError',
1.51211 + 'ReferenceError',
1.51212 + 'SecurityError',
1.51213 + 'SyntaxError',
1.51214 + 'TypeError',
1.51215 + 'URIError',
1.51216 + 'VerifyError',
1.51217 + 'UninitializedError',
1.51218 + 'ArgumentError'
1.51219 + ].forEach(function (classSimpleName) {
1.51220 + makeStub(that, classSimpleName, classSimpleName);
1.51221 + });
1.51222 + function M(classSimpleName, nativeName, definition) {
1.51223 + return {
1.51224 + classSimpleName: classSimpleName,
1.51225 + nativeName: nativeName,
1.51226 + definition: definition
1.51227 + };
1.51228 + }
1.51229 + [
1.51230 + M('flash.display.DisplayObject', 'DisplayObjectClass', DisplayObjectDefinition),
1.51231 + M('flash.display.InteractiveObject', 'InteractiveObjectClass', InteractiveObjectDefinition),
1.51232 + M('flash.display.DisplayObjectContainer', 'ContainerClass', DisplayObjectContainerDefinition),
1.51233 + M('flash.display.Sprite', 'SpriteClass', SpriteDefinition),
1.51234 + M('flash.display.MovieClip', 'MovieClipClass', MovieClipDefinition),
1.51235 + M('flash.display.Shape', 'ShapeClass', ShapeDefinition),
1.51236 + M('flash.display.Bitmap', 'BitmapClass', BitmapDefinition),
1.51237 + M('flash.display.BitmapData', 'BitmapDataClass', BitmapDataDefinition),
1.51238 + M('flash.display.Stage', 'StageClass', StageDefinition),
1.51239 + M('flash.display.Loader', 'LoaderClass', LoaderDefinition),
1.51240 + M('flash.display.LoaderInfo', 'LoaderInfoClass', LoaderInfoDefinition),
1.51241 + M('flash.display.Graphics', 'GraphicsClass', GraphicsDefinition),
1.51242 + M('flash.display.SimpleButton', 'SimpleButtonClass', SimpleButtonDefinition),
1.51243 + M('flash.display.MorphShape', 'MorphShapeClass', MorphShapeDefinition),
1.51244 + M('flash.display.NativeMenu', 'MenuClass', NativeMenuDefinition),
1.51245 + M('flash.display.NativeMenuItem', 'MenuItemClass', NativeMenuItemDefinition),
1.51246 + M('flash.display.FrameLabel', 'FrameLabelClass', FrameLabelDefinition),
1.51247 + M('flash.display.Scene'),
1.51248 + M('flash.display.BlendMode'),
1.51249 + M('flash.display.Shader', 'ShaderClass', ShaderDefinition),
1.51250 + M('flash.display.ShaderData', 'ShaderDataClass', ShaderDataDefinition),
1.51251 + M('flash.filters.BevelFilter', 'BevelFilterClass', BevelFilterDefinition),
1.51252 + M('flash.filters.BitmapFilter', 'BitmapFilterClass', BitmapFilterDefinition),
1.51253 + M('flash.filters.BlurFilter', 'BlurFilterClass', BlurFilterDefinition),
1.51254 + M('flash.filters.ColorMatrixFilter', 'ColorMatrixFilterClass', ColorMatrixFilterDefinition),
1.51255 + M('flash.filters.ConvolutionFilter', 'ConvolutionFilterClass', ConvolutionFilterDefinition),
1.51256 + M('flash.filters.DisplacementMapFilter', 'DisplacementMapFilterClass', DisplacementMapFilterDefinition),
1.51257 + M('flash.filters.DropShadowFilter', 'DropShadowFilterClass', DropShadowFilterDefinition),
1.51258 + M('flash.filters.GlowFilter', 'GlowFilterClass', GlowFilterDefinition),
1.51259 + M('flash.filters.GradientBevelFilter', 'GradientBevelFilterClass', GradientBevelFilterDefinition),
1.51260 + M('flash.filters.GradientGlowFilter', 'GradientGlowFilterClass', GradientGlowFilterDefinition),
1.51261 + M('flash.filters.ShaderFilter', 'ShaderFilterClass', ShaderFilterDefinition),
1.51262 + M('flash.geom.Point', 'PointClass', PointDefinition),
1.51263 + M('flash.geom.Rectangle', 'RectangleClass', RectangleDefinition),
1.51264 + M('flash.geom.Matrix', 'MatrixClass', MatrixDefinition),
1.51265 + M('flash.geom.Matrix3D', 'Matrix3DClass', Matrix3DDefinition),
1.51266 + M('flash.geom.Vector3D', 'Vector3DClass', Vector3DDefinition),
1.51267 + M('flash.geom.Transform', 'TransformClass', TransformDefinition),
1.51268 + M('flash.geom.ColorTransform', 'ColorTransformClass', ColorTransformDefinition),
1.51269 + M('flash.events.EventDispatcher', 'EventDispatcherClass', EventDispatcherDefinition),
1.51270 + M('flash.events.Event', 'EventClass', EventDefinition),
1.51271 + M('flash.events.IOErrorEvent'),
1.51272 + M('flash.events.NetStatusEvent'),
1.51273 + M('flash.events.KeyboardEvent', 'KeyboardEventClass', KeyboardEventDefinition),
1.51274 + M('flash.events.MouseEvent', 'MouseEventClass', MouseEventDefinition),
1.51275 + M('flash.events.TextEvent', 'TextEventClass', TextEventDefinition),
1.51276 + M('flash.events.TimerEvent', 'TimerEventClass', TimerEventDefinition),
1.51277 + M('flash.events.ProgressEvent'),
1.51278 + M('flash.events.NetStatusEvent'),
1.51279 + M('flash.external.ExternalInterface', 'ExternalInterfaceClass', ExternalInterfaceDefinition),
1.51280 + M('flash.ui.ContextMenu', 'ContextMenuClass', ContextMenuDefinition),
1.51281 + M('flash.ui.ContextMenuItem', 'ContextMenuItemClass', ContextMenuItemDefinition),
1.51282 + M('flash.ui.Keyboard', 'KeyboardClass', KeyboardDefinition),
1.51283 + M('flash.ui.Mouse', 'MouseClass', MouseDefinition),
1.51284 + M('flash.ui.MouseCursorData', 'MouseCursorDataClass', MouseCursorDataDefinition),
1.51285 + M('flash.text.Font', 'FontClass', FontDefinition),
1.51286 + M('flash.text.TextField', 'TextFieldClass', TextFieldDefinition),
1.51287 + M('flash.text.StaticText', 'StaticTextClass', StaticTextDefinition),
1.51288 + M('flash.text.StyleSheet', 'StyleSheetClass', StyleSheetDefinition),
1.51289 + M('flash.text.TextFormat', 'TextFormatClass', TextFormatDefinition),
1.51290 + M('flash.text.TextLineMetrics'),
1.51291 + M('flash.text.engine.ContentElement', 'ContentElementClass', ContentElementDefinition),
1.51292 + M('flash.text.engine.ElementFormat', 'ElementFormatClass', ElementFormatDefinition),
1.51293 + M('flash.text.engine.FontDescription', 'FontDescriptionClass', FontDescriptionDefinition),
1.51294 + M('flash.text.engine.GroupElement', 'GroupElementClass', GroupElementDefinition),
1.51295 + M('flash.text.engine.SpaceJustifier', 'SpaceJustifierClass', SpaceJustifierDefinition),
1.51296 + M('flash.text.engine.TextBlock', 'TextBlockClass', TextBlockDefinition),
1.51297 + M('flash.text.engine.TextElement', 'TextElementClass', TextElementDefinition),
1.51298 + M('flash.text.engine.TextJustifier', 'TextJustifierClass', TextJustifierDefinition),
1.51299 + M('flash.text.engine.TextLine', 'TextLineClass', TextLineDefinition),
1.51300 + M('flash.media.Sound', 'SoundClass', SoundDefinition),
1.51301 + M('flash.media.SoundChannel', 'SoundChannelClass', SoundChannelDefinition),
1.51302 + M('flash.media.SoundMixer', 'SoundMixerClass', SoundMixerDefinition),
1.51303 + M('flash.media.SoundTransform', 'SoundTransformClass', SoundTransformDefinition),
1.51304 + M('flash.media.Video', 'VideoClass', VideoDefinition),
1.51305 + M('flash.media.ID3Info', 'ID3InfoClass', ID3InfoDefinition),
1.51306 + M('flash.media.Microphone', 'MicrophoneClass', MicrophoneDefinition),
1.51307 + M('flash.net.FileFilter', 'FileFilterClass', FileFilterDefinition),
1.51308 + M('flash.net.NetConnection', 'NetConnectionClass', NetConnectionDefinition),
1.51309 + M('flash.net.NetStream', 'NetStreamClass', NetStreamDefinition),
1.51310 + M('flash.net.Responder', 'ResponderClass', ResponderDefinition),
1.51311 + M('flash.net.URLRequest', 'URLRequestClass', URLRequestDefinition),
1.51312 + M('flash.net.URLStream', 'URLStreamClass', URLStreamDefinition),
1.51313 + M('flash.net.URLLoader', 'URLLoaderClass', URLLoaderDefinition),
1.51314 + M('flash.net.SharedObject', 'SharedObjectClass', SharedObjectDefinition),
1.51315 + M('flash.net.ObjectEncoding', 'ObjectEncodingClass', ObjectEncodingDefinition),
1.51316 + M('flash.net.LocalConnection', 'LocalConnectionClass', LocalConnectionDefinition),
1.51317 + M('flash.net.Socket', 'SocketClass', SocketDefinition),
1.51318 + M('flash.net.URLVariables'),
1.51319 + M('packageInternal flash.system.FSCommand', 'FSCommandClass', FSCommandDefinition),
1.51320 + M('flash.system.Capabilities', 'CapabilitiesClass', CapabilitiesDefinition),
1.51321 + M('flash.system.System', 'SystemClass', SystemDefinition),
1.51322 + M('flash.system.Security', 'SecurityClass', SecurityDefinition),
1.51323 + M('flash.system.SecurityDomain', 'SecurityDomainClass', SecurityDomainDefinition),
1.51324 + M('flash.system.ApplicationDomain', 'ApplicationDomainClass', ApplicationDomainDefinition),
1.51325 + M('flash.accessibility.Accessibility', 'AccessibilityClass', AccessibilityDefinition),
1.51326 + M('flash.utils.Timer', 'TimerClass', TimerDefinition),
1.51327 + M('avm1lib.AS2Utils', 'AS2Utils', AS2UtilsDefinition),
1.51328 + M('avm1lib.AS2Broadcaster'),
1.51329 + M('avm1lib.AS2Key'),
1.51330 + M('avm1lib.AS2Mouse'),
1.51331 + M('avm1lib.AS2MovieClip', 'AS2MovieClip', AS2MovieClipDefinition),
1.51332 + M('avm1lib.AS2Button', 'AS2Button', AS2ButtonDefinition),
1.51333 + M('avm1lib.AS2TextField', 'AS2TextField', AS2TextFieldDefinition),
1.51334 + M('avm1lib.AS2Stage'),
1.51335 + M('avm1lib.AS2System'),
1.51336 + M('avm1lib.AS2Color'),
1.51337 + M('avm1lib.AS2Globals', 'AS2Globals', AS2GlobalsDefinition),
1.51338 + M('avm1lib.AS2MovieClipLoader', 'AS2MovieClipLoader', AS2MovieClipLoaderDefinition)
1.51339 + ].forEach(function (m) {
1.51340 + var className = Multiname.fromSimpleName(m.classSimpleName);
1.51341 + var path = className.getOriginalName().split('.');
1.51342 + var container = this;
1.51343 + for (var i = 0, j = path.length - 1; i < j; i++) {
1.51344 + if (!container[path[i]]) {
1.51345 + container[path[i]] = {};
1.51346 + }
1.51347 + container = container[path[i]];
1.51348 + }
1.51349 + makeStub(container, m.classSimpleName, path[path.length - 1]);
1.51350 + if (m.nativeName) {
1.51351 + bindNativeClassDefinition(m.nativeName, m.definition);
1.51352 + }
1.51353 + definitions[className.getOriginalName()] = m.definition;
1.51354 + });
1.51355 + }();
1.51356 +natives['FlashUtilScript::getAliasName'] = function (domain, scope, instanceConstructor, baseClass) {
1.51357 + return function getAliasName(value) {
1.51358 + return value.debugName;
1.51359 + };
1.51360 +};
1.51361 +natives['FlashUtilScript::getDefinitionByName'] = natives.getDefinitionByName;
1.51362 +natives['FlashUtilScript::getTimer'] = function GetTimerMethod(domain, scope, instanceConstructor, baseClass) {
1.51363 + var start = Date.now();
1.51364 + return function getTimer() {
1.51365 + return Date.now() - start;
1.51366 + };
1.51367 +};
1.51368 +natives['FlashUtilScript::escapeMultiByte'] = function EscapeMultiByteMethod(domain, scope, instanceConstructor, baseClass) {
1.51369 + return escape;
1.51370 +};
1.51371 +natives['FlashUtilScript::unescapeMultiByte'] = function UnescapeMultiByteMethod(domain, scope, instanceConstructor, baseClass) {
1.51372 + return unescape;
1.51373 +};
1.51374 +natives['FlashNetScript::navigateToURL'] = function GetNavigateToURLMethod(domain, scope, instanceConstructor, baseClass) {
1.51375 + return function navigateToURL(request, window_) {
1.51376 + if (request === null || request === undefined) {
1.51377 + throwError('TypeError', Errors.NullPointerError, 'request');
1.51378 + }
1.51379 + var RequestClass = avm2.systemDomain.getClass('flash.net.URLRequest');
1.51380 + if (!RequestClass.isInstanceOf(request)) {
1.51381 + throwError('TypeError', Errors.CheckTypeFailedError, request, 'flash.net.URLRequest');
1.51382 + }
1.51383 + var url = request.url;
1.51384 + if (/^fscommand:/i.test(url)) {
1.51385 + var fscommand = avm2.applicationDomain.getProperty(Multiname.fromSimpleName('flash.system.fscommand'), true, true);
1.51386 + fscommand.call(null, url.substring('fscommand:'.length), window_);
1.51387 + return;
1.51388 + }
1.51389 + var targetWindow = window_ || '_parent';
1.51390 + window.open(FileLoadingService.resolveUrl(url), targetWindow);
1.51391 + };
1.51392 +};
1.51393 +natives['FlashNetScript::sendToURL'] = function GetSendToURLMethod(domain, scope, instanceConstructor, baseClass) {
1.51394 + return function sendToURL(request) {
1.51395 + if (request === null || request === undefined) {
1.51396 + throwError('TypeError', Errors.NullPointerError, 'request');
1.51397 + }
1.51398 + var RequestClass = avm2.systemDomain.getClass('flash.net.URLRequest');
1.51399 + if (!RequestClass.isInstanceOf(request)) {
1.51400 + throwError('TypeError', Errors.CheckTypeFailedError, request, 'flash.net.URLRequest');
1.51401 + }
1.51402 + var session = FileLoadingService.createSession();
1.51403 + session.onprogress = function () {
1.51404 + };
1.51405 + session.open(request);
1.51406 + };
1.51407 +};
1.51408 +natives['Toplevel::registerClassAlias'] = function GetRegisterClassAliasMethod(domain, scope, instance, baseClass) {
1.51409 + return function registerClassAlias(aliasName, classObject) {
1.51410 + if (!aliasName) {
1.51411 + throwError('TypeError', Errors.NullPointerError, 'aliasName');
1.51412 + }
1.51413 + if (!classObject) {
1.51414 + throwError('TypeError', Errors.NullPointerError, 'classObject');
1.51415 + }
1.51416 + AMFUtils.aliasesCache.classes.set(classObject, aliasName);
1.51417 + AMFUtils.aliasesCache.names[aliasName] = classObject;
1.51418 + };
1.51419 +};
1.51420 +natives['Toplevel::getClassByAlias'] = function GetGetClassByAliasMethod(domain, scope, instance, baseClass) {
1.51421 + return function getClassByAlias(aliasName) {
1.51422 + if (!aliasName) {
1.51423 + throwError('TypeError', Errors.NullPointerError, 'aliasName');
1.51424 + }
1.51425 + var classObject = AMFUtils.aliasesCache.names[aliasName];
1.51426 + if (!classObject) {
1.51427 + throwError('ReferenceError', Errors.ClassNotFoundError, aliasName);
1.51428 + }
1.51429 + return classObject;
1.51430 + };
1.51431 +};
